diff --git a/tests/testthat/chemical-batch/chemical/detail/search/by-dtxcid/DTXCID30182-9e51f1.json b/tests/testthat/chemical-batch/chemical/detail/search/by-dtxcid/DTXCID30182-9e51f1.json index 8fc1dd7..a218349 100644 --- a/tests/testthat/chemical-batch/chemical/detail/search/by-dtxcid/DTXCID30182-9e51f1.json +++ b/tests/testthat/chemical-batch/chemical/detail/search/by-dtxcid/DTXCID30182-9e51f1.json @@ -1,22 +1,11 @@ { "id": "337693", - "dtxsid": "DTXSID7020182", - "dtxcid": "DTXCID30182", - "casrn": "80-05-7", - "compoundId": 182, - "genericSubstanceId": 20182, - "preferredName": "Bisphenol A", - "activeAssays": 221, - "molFormula": "C15H16O2", - "monoisotopicMass": 228.115029755, - "percentAssays": 23.0, + "inchikey": "IISBACLAFKSPIT-UHFFFAOYSA-N", + "wikipediaArticle": "Bisphenol A", "pubchemCount": 212, "pubmedCount": 3850.0, "sourcesCount": 146, "qcLevel": 1, - "cpdataCount": 292, - "inchikey": "IISBACLAFKSPIT-UHFFFAOYSA-N", - "wikipediaArticle": "Bisphenol A", "qcLevelDesc": "Level 1: Expert curated, highest confidence in accuracy and consistency of unique chemical identifiers", "isotope": 0, "multicomponent": 0, @@ -35,5 +24,16 @@ "irisLink": "356", "pprtvLink": null, "descriptorStringTsv": "0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t1\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t1\t1\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t1\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0\t0", - "isMarkush": false + "isMarkush": false, + "dtxsid": "DTXSID7020182", + "dtxcid": "DTXCID30182", + "casrn": "80-05-7", + "compoundId": 182, + "genericSubstanceId": 20182, + "preferredName": "Bisphenol A", + "activeAssays": 221, + "molFormula": "C15H16O2", + "monoisotopicMass": 228.115029755, + "percentAssays": 23.0, + "cpdataCount": 292 } diff --git a/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.R b/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.R index a0cba00..4a0ed8a 100644 --- a/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.R +++ b/tests/testthat/chemical-batch/chemical/detail/search/by-dtxsid-9e51f1-cd40e5-POST.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/detail/search/by-dtxsid/?projection=chemicaldetailstandard", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:06 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d91890cc-b92e-450b-41b9-714d9fa08f19", + date = "Mon, 16 Sep 2024 19:14:20 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "9468487a-0d49-4dc8-4291-4305bbd95790", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "JwXXH2mGA_xWTQXOSY2d4xeNQbzg6IwM4RsDF-V5kVdZlaL90rLtRw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "jmd34w49GjsLP6YBdgfMEoXDyTz0p3zzn3Dqp2ZifTRYrgFfWAVhcQ=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:06 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d91890cc-b92e-450b-41b9-714d9fa08f19", + date = "Mon, 16 Sep 2024 19:14:20 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "9468487a-0d49-4dc8-4291-4305bbd95790", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "JwXXH2mGA_xWTQXOSY2d4xeNQbzg6IwM4RsDF-V5kVdZlaL90rLtRw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "jmd34w49GjsLP6YBdgfMEoXDyTz0p3zzn3Dqp2ZifTRYrgFfWAVhcQ=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506666, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.5e-05, - connect = 0, pretransfer = 0.000146, starttransfer = 0.286009, - total = 0.286078)), class = "response") + date = structure(1726514060, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.4e-05, + connect = 0, pretransfer = 0.000139, starttransfer = 0.278543, + total = 0.278575)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/fate/search/by-dtxsid-cd40e5-POST.R b/tests/testthat/chemical-batch/chemical/fate/search/by-dtxsid-cd40e5-POST.R index ec6bcdf..ab25ea0 100644 --- a/tests/testthat/chemical-batch/chemical/fate/search/by-dtxsid-cd40e5-POST.R +++ b/tests/testthat/chemical-batch/chemical/fate/search/by-dtxsid-cd40e5-POST.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/fate/search/by-dtxsid/", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:08 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "5002b458-24ae-4c70-6cdd-b70e0d7a2d78", + date = "Mon, 16 Sep 2024 19:14:22 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "bf4f474f-6285-4b70-479f-4a30740b2fd6", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "m94OEuIJ0u2htf5TJp0jbGCRS92H6AVp_yTNypkB-ByZE5oBTaI-Yw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "dfZjApDdYNF5OFXJs9lGVFgEJYmb_p9_yL4LqyBw-NOc0zB06J7VdA=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:08 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "5002b458-24ae-4c70-6cdd-b70e0d7a2d78", + date = "Mon, 16 Sep 2024 19:14:22 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "bf4f474f-6285-4b70-479f-4a30740b2fd6", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "m94OEuIJ0u2htf5TJp0jbGCRS92H6AVp_yTNypkB-ByZE5oBTaI-Yw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "dfZjApDdYNF5OFXJs9lGVFgEJYmb_p9_yL4LqyBw-NOc0zB06J7VdA=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506668, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.2e-05, - connect = 0, pretransfer = 0.000142, starttransfer = 0.10186, - total = 0.101894)), class = "response") + date = structure(1726514062, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.5e-05, + connect = 0, pretransfer = 0.000141, starttransfer = 0.113118, + total = 0.113157)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R index e276212..19bf26a 100644 --- a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R +++ b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxcid/DTXCID30182-ac797a.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtxcid/DTXCID30182?Image+Format=png", status_code = 200L, headers = structure(list(`content-type` = "image/png", `content-length` = "22764", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "7c2c5d28-a6f6-4245-50c0-9de2281c902a", + `x-vcap-request-id` = "da3c4665-235d-4518-76e1-5608f714765f", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Miss from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "jOtvzzgBL4aQmPPDCNYHIHaV1i1zL_xWqlr7A4HeoFZ4WRporCKKOA=="), class = c("insensitive", + `x-cache` = "Miss from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "aMQwbV8RJA7lF9Wqftxxh2lWWI1ul0BCmX6QwVAbHQbAZSEozQAR9g=="), class = c("insensitive", "list")), all_headers = list(list(status = 200L, version = "HTTP/1.1", headers = structure(list(`content-type` = "image/png", `content-length` = "22764", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "7c2c5d28-a6f6-4245-50c0-9de2281c902a", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "da3c4665-235d-4518-76e1-5608f714765f", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Miss from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "jOtvzzgBL4aQmPPDCNYHIHaV1i1zL_xWqlr7A4HeoFZ4WRporCKKOA=="), class = c("insensitive", + `x-cache` = "Miss from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "aMQwbV8RJA7lF9Wqftxxh2lWWI1ul0BCmX6QwVAbHQbAZSEozQAR9g=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -2296,7 +2296,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtx 0x00, 0x08, 0x19, 0x01, 0x0b, 0x00, 0x00, 0x20, 0x64, 0x04, 0x2c, 0x00, 0x00, 0x80, 0x90, 0xfd, 0x3f, 0xca, 0x71, 0x75, 0x8f, 0x81, 0x96, 0xf0, 0x66, 0x00, 0x00, 0x00, 0x00, 0x49, - 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1726506691, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.4e-05, - connect = 0, pretransfer = 0.000216, starttransfer = 0.123415, - total = 0.123591)), class = "response") + 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1726514091, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.2e-05, + connect = 0, pretransfer = 0.000156, starttransfer = 0.116778, + total = 0.119209)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R index 8b79dab..bff92c8 100644 --- a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R +++ b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid-85b7e8.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtxsid/?Image+Format=svg", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "b0a5c9a7-185c-45e8-7fa8-98f0a12b141e", + `x-vcap-request-id` = "e0b0d246-3d63-49d8-73a2-06e7af78bbeb", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "wF9gc6OG63x1_9x2jfr_M2eeUXE1CPkaY_E-_UAN3GELyb4kHRpgMw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "1u1dW3O8q-vEfm5W9rKR74aBB80q64wqXqwvEdpAMj8K-Fg53sEAVw=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "b0a5c9a7-185c-45e8-7fa8-98f0a12b141e", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e0b0d246-3d63-49d8-73a2-06e7af78bbeb", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "wF9gc6OG63x1_9x2jfr_M2eeUXE1CPkaY_E-_UAN3GELyb4kHRpgMw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "1u1dW3O8q-vEfm5W9rKR74aBB80q64wqXqwvEdpAMj8K-Fg53sEAVw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtx 0x61, 0x6c, 0x2f, 0x66, 0x69, 0x6c, 0x65, 0x2f, 0x69, 0x6d, 0x61, 0x67, 0x65, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64, - 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506691, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 0.000104, - connect = 0, pretransfer = 0.000206, starttransfer = 0.292254, - total = 0.292312)), class = "response") + 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514091, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.4e-05, + connect = 0, pretransfer = 0.00015, starttransfer = 0.117413, + total = 0.117491)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R index 169ec83..ed8bf35 100644 --- a/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/file/image/search/by-dtxsid/DTXSID7020182.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtxsid/DTXSID7020182", status_code = 200L, headers = structure(list(`content-type` = "image/png", `content-length` = "22764", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "b003d64c-cb9e-4151-44a7-61667e9c9be6", + `x-vcap-request-id` = "467e23e7-7cda-4f21-4908-66c44a6c8285", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Miss from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "bk-9alaWIbBuTT7XPrreL7jDvjY48SBjj05G2jaU5hiMLnVSIzkzhA=="), class = c("insensitive", + `x-cache` = "Miss from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "c_MnrWzkHLFY7wbV-ODOlpLYdVYK1l2YRzyyRoSgX4rvIxWXAchSlw=="), class = c("insensitive", "list")), all_headers = list(list(status = 200L, version = "HTTP/1.1", headers = structure(list(`content-type` = "image/png", `content-length` = "22764", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:51 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "b003d64c-cb9e-4151-44a7-61667e9c9be6", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "467e23e7-7cda-4f21-4908-66c44a6c8285", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Miss from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "bk-9alaWIbBuTT7XPrreL7jDvjY48SBjj05G2jaU5hiMLnVSIzkzhA=="), class = c("insensitive", + `x-cache` = "Miss from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "c_MnrWzkHLFY7wbV-ODOlpLYdVYK1l2YRzyyRoSgX4rvIxWXAchSlw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -2296,7 +2296,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/image/search/by-dtx 0x00, 0x08, 0x19, 0x01, 0x0b, 0x00, 0x00, 0x20, 0x64, 0x04, 0x2c, 0x00, 0x00, 0x80, 0x90, 0xfd, 0x3f, 0xca, 0x71, 0x75, 0x8f, 0x81, 0x96, 0xf0, 0x66, 0x00, 0x00, 0x00, 0x00, 0x49, - 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1726506691, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.9e-05, - connect = 0, pretransfer = 0.000141, starttransfer = 0.135598, - total = 0.136553)), class = "response") + 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82)), date = structure(1726514091, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.1e-05, + connect = 0, pretransfer = 0.00014, starttransfer = 0.12403, + total = 0.124683)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R index 65edaac..8663489 100644 --- a/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R +++ b/tests/testthat/chemical-batch/chemical/file/mol/search/by-dtxsid.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/mol/search/by-dtxsid/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:30 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:49 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "86c79d82-8d95-4eac-5095-5fa4e2885ca6", + `x-vcap-request-id` = "6b55ef06-0365-4db2-6d73-9bd7c79f8f15", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "muZp2csLl6lx-ut2nd_9odD55FaSkOq_uV1_QFgZiY-SBaB2SCUGAQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "eqt3528_Nc1Af532FqYJJtt5aGyI4pMTDSGnEJcXL2bOG5kRPjfgRA=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:30 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:49 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "86c79d82-8d95-4eac-5095-5fa4e2885ca6", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6b55ef06-0365-4db2-6d73-9bd7c79f8f15", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "muZp2csLl6lx-ut2nd_9odD55FaSkOq_uV1_QFgZiY-SBaB2SCUGAQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "eqt3528_Nc1Af532FqYJJtt5aGyI4pMTDSGnEJcXL2bOG5kRPjfgRA=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/mol/search/by-dtxsi 0x2f, 0x66, 0x69, 0x6c, 0x65, 0x2f, 0x6d, 0x6f, 0x6c, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d - )), date = structure(1726506690, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.2e-05, - connect = 0, pretransfer = 0.000144, starttransfer = 0.297507, - total = 0.29755)), class = "response") + )), date = structure(1726514089, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 3.6e-05, + connect = 0, pretransfer = 9.4e-05, starttransfer = 0.385702, + total = 0.385915)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R index 93d8bb7..e3426d4 100644 --- a/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R +++ b/tests/testthat/chemical-batch/chemical/file/mrv/search/by-dtxsid.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/mrv/search/by-dtxsid/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:29 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:48 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "c285e75f-3f75-46eb-4656-b0064b5f394e", + `x-vcap-request-id` = "46fbed7c-5ccd-4da8-65bf-a753ece6e4af", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "yocFlHtO5YRcZFR9j5K3ANjZs__DmfU_DPXU9THn9xmWI3mPg2hKfQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BCIBuMv0tOrZKERRoYc7mpuyjbdUDOFaqPssYDioyiER7uOBOh74Rw=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:29 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:48 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "c285e75f-3f75-46eb-4656-b0064b5f394e", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "46fbed7c-5ccd-4da8-65bf-a753ece6e4af", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "yocFlHtO5YRcZFR9j5K3ANjZs__DmfU_DPXU9THn9xmWI3mPg2hKfQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BCIBuMv0tOrZKERRoYc7mpuyjbdUDOFaqPssYDioyiER7uOBOh74Rw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/file/mrv/search/by-dtxsi 0x2f, 0x66, 0x69, 0x6c, 0x65, 0x2f, 0x6d, 0x72, 0x76, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d - )), date = structure(1726506689, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.4e-05, - connect = 0, pretransfer = 0.000183, starttransfer = 0.397684, - total = 0.397717)), class = "response") + )), date = structure(1726514088, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4e-05, + connect = 0, pretransfer = 0.000111, starttransfer = 0.124468, + total = 0.124501)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/ghslink/to-dtxsid.R b/tests/testthat/chemical-batch/chemical/ghslink/to-dtxsid.R index 378a913..da58b58 100644 --- a/tests/testthat/chemical-batch/chemical/ghslink/to-dtxsid.R +++ b/tests/testthat/chemical-batch/chemical/ghslink/to-dtxsid.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/ghslink/to-dtxsid/", status_code = 405L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:07 GMT", allow = "POST", + date = "Mon, 16 Sep 2024 19:14:21 GMT", allow = "POST", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "8bd4c884-2244-4567-4c97-ca8b0b2c75b2", + `x-vcap-request-id` = "9d2c184d-4315-4939-5c8c-4e8fbf6852af", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "baI3dZOU1Z9MEw9hAXcmkaj5-k2El6AGtiJLPVw6BheOUkztQm24kw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "gYstBXWzDPIIA9a9NkxhGIz9shGIQx0Oc_J0yJuxibaAWvaWTRrC2Q=="), class = c("insensitive", "list")), all_headers = list(list(status = 405L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:07 GMT", allow = "POST", + date = "Mon, 16 Sep 2024 19:14:21 GMT", allow = "POST", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "8bd4c884-2244-4567-4c97-ca8b0b2c75b2", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "9d2c184d-4315-4939-5c8c-4e8fbf6852af", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "baI3dZOU1Z9MEw9hAXcmkaj5-k2El6AGtiJLPVw6BheOUkztQm24kw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "gYstBXWzDPIIA9a9NkxhGIz9shGIQx0Oc_J0yJuxibaAWvaWTRrC2Q=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -37,7 +37,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/ghslink/to-dtxsid/", 0x65, 0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x67, 0x68, 0x73, 0x6c, 0x69, 0x6e, 0x6b, 0x2f, 0x74, 0x6f, 0x2d, 0x64, 0x74, 0x78, - 0x73, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506667, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.3e-05, - connect = 0, pretransfer = 0.000116, starttransfer = 0.104331, - total = 0.104419)), class = "response") + 0x73, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514061, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 2.9e-05, + connect = 0, pretransfer = 0.000115, starttransfer = 0.318013, + total = 0.318086)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R index dfc493f..2857488 100644 --- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R +++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/contain//", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:41 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "17a84ab2-5043-4ecf-7f88-87d46367b9f6", + `x-vcap-request-id` = "15dd042d-525f-4ec7-4e50-1b6aaa6d0f0a", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "P1s8DAlVHmQleRzuRSTNmL2i8kg_3AaMNN9CnWSFk0l-xdg85IkfbA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "fDexY6N7_cf1rz87okjoJi26Wr2zBZK-EoKEe1qTPfIsJxr2keqEDw=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:41 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "17a84ab2-5043-4ecf-7f88-87d46367b9f6", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "15dd042d-525f-4ec7-4e50-1b6aaa6d0f0a", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "P1s8DAlVHmQleRzuRSTNmL2i8kg_3AaMNN9CnWSFk0l-xdg85IkfbA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "fDexY6N7_cf1rz87okjoJi26Wr2zBZK-EoKEe1qTPfIsJxr2keqEDw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/co 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x63, 0x6f, 0x6e, - 0x74, 0x61, 0x69, 0x6e, 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506687, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.3e-05, - connect = 0, pretransfer = 0.000179, starttransfer = 0.063499, - total = 0.063552)), class = "response") + 0x74, 0x61, 0x69, 0x6e, 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514081, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.7e-05, + connect = 0, pretransfer = 0.00016, starttransfer = 0.055339, + total = 0.05539)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R index 57d2d58..de4ef68 100644 --- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/contain/DTXSID7020182.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/contain/DTXSID7020182/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:02 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:14 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "6c5209e6-f5e3-4b3b-532c-efc621d9fd78", + `x-vcap-request-id` = "cf0e5458-0daa-4bc7-4ca1-58824b1c8c35", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Xg2ebmtl2vBv0r1D1SY4BXBup1oaXDOC2dydqQFL6ctQ8eUxVkRBog=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "nj4mU5i1mpgHrMfQNtWPBMsRhMskK8NY5x6UKV_RwZPCCcI3VATV0w=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:02 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:14 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6c5209e6-f5e3-4b3b-532c-efc621d9fd78", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "cf0e5458-0daa-4bc7-4ca1-58824b1c8c35", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Xg2ebmtl2vBv0r1D1SY4BXBup1oaXDOC2dydqQFL6ctQ8eUxVkRBog=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "nj4mU5i1mpgHrMfQNtWPBMsRhMskK8NY5x6UKV_RwZPCCcI3VATV0w=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -43,7 +43,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/co 0x61, 0x6c, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x63, 0x6f, 0x6e, 0x74, 0x61, 0x69, 0x6e, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49, 0x44, 0x37, 0x30, 0x32, 0x30, 0x31, - 0x38, 0x32, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506662, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.7e-05, - connect = 0, pretransfer = 0.000165, starttransfer = 0.033899, - total = 0.033933)), class = "response") + 0x38, 0x32, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514054, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.3e-05, + connect = 0, pretransfer = 0.000134, starttransfer = 0.046535, + total = 0.046575)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R index f339585..07a3d8a 100644 --- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R +++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/equal//", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:41 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "3f24602d-4a09-4bc6-4bff-0e9ccb2f297b", + `x-vcap-request-id` = "e89d775d-1519-4615-79ea-6cd7270569cb", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "sz4GzvF4JcSgKqsQgvVtgR5CV0FUefAcVNxlBi3Q6NGQr9_arDWkhw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "FkhPk-PnNLWX1JVgJkN3cKMqtIeObkPzncYSOPOPQmUZRBPkQHB75Q=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:27 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:41 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "3f24602d-4a09-4bc6-4bff-0e9ccb2f297b", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e89d775d-1519-4615-79ea-6cd7270569cb", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "sz4GzvF4JcSgKqsQgvVtgR5CV0FUefAcVNxlBi3Q6NGQr9_arDWkhw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "FkhPk-PnNLWX1JVgJkN3cKMqtIeObkPzncYSOPOPQmUZRBPkQHB75Q=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/eq 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x65, 0x71, 0x75, 0x61, 0x6c, - 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506687, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.7e-05, - connect = 0, pretransfer = 0.000167, starttransfer = 0.052645, - total = 0.052683)), class = "response") + 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514081, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.6e-05, + connect = 0, pretransfer = 0.000191, starttransfer = 0.052074, + total = 0.052108)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R index c5feac5..08c479d 100644 --- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/equal/DTXSID7020182.R @@ -1,25 +1,24 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/equal/DTXSID7020182/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:01 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:14 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "ce426a14-ba69-47b5-78c0-1a55083acad9", + `x-vcap-request-id` = "4a0d3e30-5717-45d7-5bd1-595b115eb4b0", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "TJW_z7gxseEmFneuaQs8WjwK8Bpd4k_3htgIX707krZkd7aMWZNH5g==", - age = "1"), class = c("insensitive", "list")), all_headers = list( - list(status = 404L, version = "HTTP/1.1", headers = structure(list( - `content-type` = "application/problem+json", `transfer-encoding` = "chunked", - connection = "keep-alive", date = "Mon, 16 Sep 2024 17:11:01 GMT", - `cache-control` = "max-age=0, must-revalidate, no-transform", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "l8ClFGoRVIDBvXFl7Ua5tMaXX5y1zNrfwCHjjlefbQIDzxxnRV3ELw=="), class = c("insensitive", + "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", + headers = structure(list(`content-type` = "application/problem+json", + `transfer-encoding` = "chunked", connection = "keep-alive", + date = "Mon, 16 Sep 2024 19:14:14 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ce426a14-ba69-47b5-78c0-1a55083acad9", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "4a0d3e30-5717-45d7-5bd1-595b115eb4b0", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "TJW_z7gxseEmFneuaQs8WjwK8Bpd4k_3htgIX707krZkd7aMWZNH5g==", - age = "1"), class = c("insensitive", "list")))), - cookies = structure(list(domain = logical(0), flag = logical(0), - path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "l8ClFGoRVIDBvXFl7Ua5tMaXX5y1zNrfwCHjjlefbQIDzxxnRV3ELw=="), class = c("insensitive", + "list")))), cookies = structure(list(domain = logical(0), + flag = logical(0), path = logical(0), secure = logical(0), + expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = as.raw(c(0x7b, 0x0a, 0x20, 0x20, 0x22, 0x74, 0x79, 0x70, 0x65, 0x22, 0x20, 0x3a, 0x20, 0x22, 0x61, 0x62, 0x6f, @@ -44,7 +43,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/eq 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x65, 0x71, 0x75, 0x61, 0x6c, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49, 0x44, 0x37, 0x30, 0x32, 0x30, 0x31, 0x38, 0x32, 0x2f, 0x22, - 0x0a, 0x7d)), date = structure(1726506661, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.5e-05, - connect = 0, pretransfer = 0.000132, starttransfer = 0.033992, - total = 0.034023)), class = "response") + 0x0a, 0x7d)), date = structure(1726514054, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.7e-05, + connect = 0, pretransfer = 0.000153, starttransfer = 0.041388, + total = 0.041448)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R index 83d7847..f952d37 100644 --- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R +++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/start-with//", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:25 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "89475da6-cab6-42af-73d9-513c397e2ab5", + `x-vcap-request-id` = "6c644901-adc5-4162-5a98-4fd695265962", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "E43XS-NJVjMI5scHKJqJSEqt4DwMCHmZR6X5c2S14VigSaXoHo49lA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "i6Cml61bwiINcJYQ9YtK7CENxGYx-TU_gexqPkUXts9_E4oStGbZ7Q=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:25 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "89475da6-cab6-42af-73d9-513c397e2ab5", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6c644901-adc5-4162-5a98-4fd695265962", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "E43XS-NJVjMI5scHKJqJSEqt4DwMCHmZR6X5c2S14VigSaXoHo49lA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "i6Cml61bwiINcJYQ9YtK7CENxGYx-TU_gexqPkUXts9_E4oStGbZ7Q=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -41,7 +41,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/st 0x73, 0x74, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x73, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x73, 0x74, 0x61, 0x72, 0x74, 0x2d, 0x77, 0x69, 0x74, 0x68, - 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506685, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 8.3e-05, - connect = 0, pretransfer = 0.000216, starttransfer = 0.056655, - total = 0.056709)), class = "response") + 0x2f, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514077, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 3.9e-05, + connect = 0, pretransfer = 0.000104, starttransfer = 0.053207, + total = 0.053249)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R index d78238e..885799d 100644 --- a/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/list/chemicals/search/start-with/DTXSID7020182.R @@ -1,24 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/start-with/DTXSID7020182/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:01 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:13 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "ffb5f266-502e-459b-6679-9b1d788d6ef8", + `x-vcap-request-id` = "fe6c4685-947e-4e57-4343-8e07422fa4c0", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "DQmWvFbM0h12n8ATF68coZm3mBTTwuPUXNL7mUnA_uaX1SkDD7AS5A=="), class = c("insensitive", - "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", - headers = structure(list(`content-type` = "application/problem+json", - `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:01 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "HvCe8dwTBKiQNRK1j8DIOsJJvY3seNO8fzBSrwyiLcwmzIiXU3fNsA==", + age = "1"), class = c("insensitive", "list")), all_headers = list( + list(status = 404L, version = "HTTP/1.1", headers = structure(list( + `content-type` = "application/problem+json", `transfer-encoding` = "chunked", + connection = "keep-alive", date = "Mon, 16 Sep 2024 19:14:13 GMT", + `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ffb5f266-502e-459b-6679-9b1d788d6ef8", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "fe6c4685-947e-4e57-4343-8e07422fa4c0", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "DQmWvFbM0h12n8ATF68coZm3mBTTwuPUXNL7mUnA_uaX1SkDD7AS5A=="), class = c("insensitive", - "list")))), cookies = structure(list(domain = logical(0), - flag = logical(0), path = logical(0), secure = logical(0), - expiration = structure(numeric(0), class = c("POSIXct", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "HvCe8dwTBKiQNRK1j8DIOsJJvY3seNO8fzBSrwyiLcwmzIiXU3fNsA==", + age = "1"), class = c("insensitive", "list")))), + cookies = structure(list(domain = logical(0), flag = logical(0), + path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = as.raw(c(0x7b, 0x0a, 0x20, 0x20, 0x22, 0x74, 0x79, 0x70, 0x65, 0x22, 0x20, 0x3a, 0x20, 0x22, 0x61, 0x62, 0x6f, @@ -44,7 +45,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/chemicals/search/st 0x72, 0x63, 0x68, 0x2f, 0x73, 0x74, 0x61, 0x72, 0x74, 0x2d, 0x77, 0x69, 0x74, 0x68, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49, 0x44, 0x37, 0x30, 0x32, 0x30, 0x31, 0x38, 0x32, 0x2f, 0x22, - 0x0a, 0x7d)), date = structure(1726506661, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.7e-05, - connect = 0, pretransfer = 0.000358, starttransfer = 0.033036, - total = 0.033082)), class = "response") + 0x0a, 0x7d)), date = structure(1726514053, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.3e-05, + connect = 0, pretransfer = 0.000143, starttransfer = 0.036148, + total = 0.036182)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R index 184c7b7..fe0e3ed 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-dtxsid/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:25 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "e4f2f999-f048-4f99-41ca-a55820c80fc5", + `x-vcap-request-id` = "2695f2b5-f7ec-4324-6374-a9474619a236", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "VUfKJJnxEhcFa2wdpk0mb9rc62MFIpjns5huwlNt2JWbze8M1U1Cbw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "jqZ25zLAJK2KeJ3wfbrRhvfICIbk6gq37TMvqnF7CHs5ZkViRTbV4A=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:25 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e4f2f999-f048-4f99-41ca-a55820c80fc5", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "2695f2b5-f7ec-4324-6374-a9474619a236", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "VUfKJJnxEhcFa2wdpk0mb9rc62MFIpjns5huwlNt2JWbze8M1U1Cbw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "jqZ25zLAJK2KeJ3wfbrRhvfICIbk6gq37TMvqnF7CHs5ZkViRTbV4A=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-dtxsid/", 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64, 0x2f, 0x22, - 0x0a, 0x7d)), date = structure(1726506685, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.5e-05, - connect = 0, pretransfer = 0.000147, starttransfer = 0.334501, - total = 0.334569)), class = "response") + 0x0a, 0x7d)), date = structure(1726514077, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.2e-05, + connect = 0, pretransfer = 0.000219, starttransfer = 0.351102, + total = 0.351154)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid/DTXSID7020182.R index 4f17b91..f4347a8 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-dtxsid/DTXSID7020182.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-dtxsid/DTXSID7020182", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:25 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "75fb00e9-e4be-4239-5a11-60ad98de22ad", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6a23a558-cb6f-411f-65fa-d53e3a80ef32", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BfBSZizAw-tD6O_ZgjdsuO4stby90Kqw9TOcmEYkKaJpkMGUN7gsyw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "0lGJxTnpl_6zdfa6AXbg7jk01oFlb3juVns4HY-rVUNZm4qUiyag3Q=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:25 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "75fb00e9-e4be-4239-5a11-60ad98de22ad", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6a23a558-cb6f-411f-65fa-d53e3a80ef32", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "BfBSZizAw-tD6O_ZgjdsuO4stby90Kqw9TOcmEYkKaJpkMGUN7gsyw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "0lGJxTnpl_6zdfa6AXbg7jk01oFlb3juVns4HY-rVUNZm4qUiyag3Q=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506685, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.1e-05, - connect = 0, pretransfer = 0.000151, starttransfer = 0.115124, - total = 0.115154)), class = "response") + date = structure(1726514077, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.4e-05, + connect = 0, pretransfer = 0.000116, starttransfer = 0.1238, + total = 0.123853)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R b/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R index aa3e11e..886fa06 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-name-8b6df7.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/?projection=chemicallistwithdtxsids", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:28 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:47 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "ba26ce33-8eb2-4792-7465-4788633d304d", + `x-vcap-request-id` = "c7ac6bd3-418e-42e2-7328-9648d1dc5776", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "OV-nnHuuvsbdtFyWrUA98aq5qUwG_d0mzT7Bj-zV1WTOxdIt8ZpVSg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "SUUnWwcG2ES8ocryHHvVKt5fEygWJmA3mj2WXncaeqgHf0IzCBaaiw=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:28 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:47 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ba26ce33-8eb2-4792-7465-4788633d304d", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "c7ac6bd3-418e-42e2-7328-9648d1dc5776", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "OV-nnHuuvsbdtFyWrUA98aq5qUwG_d0mzT7Bj-zV1WTOxdIt8ZpVSg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "SUUnWwcG2ES8ocryHHvVKt5fEygWJmA3mj2WXncaeqgHf0IzCBaaiw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -38,7 +38,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/?pro 0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, - 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506688, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 6e-05, - connect = 0, pretransfer = 0.000179, starttransfer = 0.133238, - total = 0.133317)), class = "response") + 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514087, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.1e-05, + connect = 0, pretransfer = 0.000164, starttransfer = 0.289329, + total = 0.289432)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name.R b/tests/testthat/chemical-batch/chemical/list/search/by-name.R index 8351c09..5b08daa 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-name.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-name.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:24 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "2ad4e972-273c-42bf-6daa-dec013bb2216", + `x-vcap-request-id` = "89c426b1-71c3-4a09-76ff-29fda664d13d", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "062cF3OmRTqZ6tlY1OOhfbZegVzt-okEj9k8B_WlSPiDGkQlEu-4nA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Apd_vQsqdv2KCrZ-OYJcwUxlA5kPWdgEw-1QrpOUM9UiTB9XFAgUhw=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:24 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "2ad4e972-273c-42bf-6daa-dec013bb2216", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "89c426b1-71c3-4a09-76ff-29fda664d13d", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "062cF3OmRTqZ6tlY1OOhfbZegVzt-okEj9k8B_WlSPiDGkQlEu-4nA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Apd_vQsqdv2KCrZ-OYJcwUxlA5kPWdgEw-1QrpOUM9UiTB9XFAgUhw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -38,7 +38,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/", 0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, - 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506684, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.6e-05, - connect = 0, pretransfer = 0.000106, starttransfer = 0.379852, - total = 0.379914)), class = "response") + 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514076, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.9e-05, + connect = 0, pretransfer = 0.000146, starttransfer = 0.12809, + total = 0.128129)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R b/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R index 462170f..5489d8a 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLDIS2021-8b6df7.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/BIOSOLDIS2021?projection=chemicallistwithdtxsids", status_code = 400L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:28 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:47 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "41336434-cd8c-4d93-57f6-d5edcf385480", + `x-vcap-request-id` = "73c229ee-6ed2-47a9-7b4a-a84aff2b4e8d", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "3alo_T7nsIPuANJtW0-gXgrWVN7kYedKVUSZp3q8maSOPuLzwo51QQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "COsS2H_1y79jnIVwVjj404TRMFf5vELpEKEqUB4CBbmGRe55vmcf-A=="), class = c("insensitive", "list")), all_headers = list(list(status = 400L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:28 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:47 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "41336434-cd8c-4d93-57f6-d5edcf385480", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "73c229ee-6ed2-47a9-7b4a-a84aff2b4e8d", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "3alo_T7nsIPuANJtW0-gXgrWVN7kYedKVUSZp3q8maSOPuLzwo51QQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "COsS2H_1y79jnIVwVjj404TRMFf5vELpEKEqUB4CBbmGRe55vmcf-A=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/BIOS 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x42, 0x49, 0x4f, 0x53, 0x4f, 0x4c, 0x44, 0x49, 0x53, 0x32, 0x30, 0x32, 0x31, 0x22, 0x0a, 0x7d - )), date = structure(1726506688, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.9e-05, - connect = 0, pretransfer = 0.000163, starttransfer = 0.071202, - total = 0.071246)), class = "response") + )), date = structure(1726514087, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.8e-05, + connect = 0, pretransfer = 0.000151, starttransfer = 0.043447, + total = 0.043494)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLIDS2021.R b/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLIDS2021.R index a4739fe..800c264 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLIDS2021.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-name/BIOSOLIDS2021.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/BIOSOLIDS2021", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:24 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "472e528a-1efd-4d7b-636f-34f4ad63562d", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "59b3d1ba-3a7f-43de-5d57-b8b341329932", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "ynqZ90Geng767QfDhKYwvebYKzcmqyBOVBWSaSD51DANTTpllTSJvw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "pi791qcxP6QWGBZRXZmnvg5on9g8I6z5Wmi73BTac55S2F4IGU11_w=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:24 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "472e528a-1efd-4d7b-636f-34f4ad63562d", + date = "Mon, 16 Sep 2024 19:14:37 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "59b3d1ba-3a7f-43de-5d57-b8b341329932", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "ynqZ90Geng767QfDhKYwvebYKzcmqyBOVBWSaSD51DANTTpllTSJvw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "pi791qcxP6QWGBZRXZmnvg5on9g8I6z5Wmi73BTac55S2F4IGU11_w=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506684, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.9e-05, - connect = 0, pretransfer = 0.000125, starttransfer = 0.139428, - total = 0.139464)), class = "response") + date = structure(1726514077, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4e-05, + connect = 0, pretransfer = 0.000115, starttransfer = 0.111379, + total = 0.111411)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R b/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R index 2b1db57..9ee961e 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-name/DTXSID7020182-8b6df7.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/DTXSID7020182?projection=chemicallistwithdtxsids", status_code = 400L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:02 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:15 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "aa0c4d56-8dc4-432a-414d-e54e9bbe1adc", + `x-vcap-request-id` = "d376b1c3-3f50-4a96-4626-4489303f6625", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "emgxM2IE4l-veP3cAFXvuremiS9pGUotQ3jhTviHI14kSqKjobsxAQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Vb4-ST0SEaWTW0vB8G2sfNDWgnpAvu881u4yF2GrE_dF926Wf_qpMg=="), class = c("insensitive", "list")), all_headers = list(list(status = 400L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:02 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:15 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "aa0c4d56-8dc4-432a-414d-e54e9bbe1adc", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d376b1c3-3f50-4a96-4626-4489303f6625", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "emgxM2IE4l-veP3cAFXvuremiS9pGUotQ3jhTviHI14kSqKjobsxAQ=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Vb4-ST0SEaWTW0vB8G2sfNDWgnpAvu881u4yF2GrE_dF926Wf_qpMg=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-name/DTXS 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6e, 0x61, 0x6d, 0x65, 0x2f, 0x44, 0x54, 0x58, 0x53, 0x49, 0x44, 0x37, 0x30, 0x32, 0x30, 0x31, 0x38, 0x32, 0x22, 0x0a, 0x7d - )), date = structure(1726506662, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5e-05, - connect = 0, pretransfer = 0.000145, starttransfer = 0.034938, - total = 0.034969)), class = "response") + )), date = structure(1726514055, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.9e-05, + connect = 0, pretransfer = 0.000147, starttransfer = 0.049409, + total = 0.051042)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-type.R b/tests/testthat/chemical-batch/chemical/list/search/by-type.R index 012784a..3a613f2 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-type.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-type.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-type/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:23 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "2bff8569-cdc5-4106-4f0f-ad9661560a9b", + `x-vcap-request-id` = "a00076ad-e1b3-4179-7f82-6c0b1014097b", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Dn3T71imWODVjafvqGMlGm1RvD1q36UZT9hJSqTYEUsDbqWtskUDWA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "0IZePKTQsXckNskZs8uDIG32EkAD_2EiCCYTEh3LoDlKQGycQqV7gw=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:23 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "2bff8569-cdc5-4106-4f0f-ad9661560a9b", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "a00076ad-e1b3-4179-7f82-6c0b1014097b", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Dn3T71imWODVjafvqGMlGm1RvD1q36UZT9hJSqTYEUsDbqWtskUDWA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "0IZePKTQsXckNskZs8uDIG32EkAD_2EiCCYTEh3LoDlKQGycQqV7gw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -38,7 +38,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-type/", 0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6c, 0x69, 0x73, 0x74, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, - 0x74, 0x79, 0x70, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506683, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.6e-05, - connect = 0, pretransfer = 0.000121, starttransfer = 0.361751, - total = 0.3618)), class = "response") + 0x74, 0x79, 0x70, 0x65, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514076, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.4e-05, + connect = 0, pretransfer = 0.000131, starttransfer = 0.109444, + total = 0.109486)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/list/search/by-type/federal.R b/tests/testthat/chemical-batch/chemical/list/search/by-type/federal.R index 02326d3..65836ea 100644 --- a/tests/testthat/chemical-batch/chemical/list/search/by-type/federal.R +++ b/tests/testthat/chemical-batch/chemical/list/search/by-type/federal.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/list/search/by-type/federal", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:24 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d3aafa31-f442-4763-6f6e-067ea22bd2f4", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "246d0bcf-fee4-44aa-745a-2749e297ab4b", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "muQOH37PLhqU_nQb6wwHr9Q5TZAKDXbqwcYOLARReUpy75wYipLyiw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Pf6_d9ZFyzRkIUOlLiX1_ZI3noHZ_xlmbBE1PUijNB3LwKDckDlNng=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:24 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d3aafa31-f442-4763-6f6e-067ea22bd2f4", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "246d0bcf-fee4-44aa-745a-2749e297ab4b", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "muQOH37PLhqU_nQb6wwHr9Q5TZAKDXbqwcYOLARReUpy75wYipLyiw=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Pf6_d9ZFyzRkIUOlLiX1_ZI3noHZ_xlmbBE1PUijNB3LwKDckDlNng=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506684, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.1e-05, - connect = 0, pretransfer = 0.000111, starttransfer = 0.128435, - total = 0.128464)), class = "response") + date = structure(1726514076, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.9e-05, + connect = 0, pretransfer = 0.000185, starttransfer = 0.107719, + total = 0.107766)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R b/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R index 60cd339..f8f184f 100644 --- a/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R +++ b/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-dtxcid/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:22 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:35 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "3b8cba6f-7f13-4723-7dc7-f45860e43b7d", + `x-vcap-request-id` = "05265e2b-a4de-45a2-4c3c-975af4d3f5f5", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "PnkyDEewHs4lmtUmr8kLvok7i2IAeZ-uAg420S316zuGXj5YVwM3VA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "l-6sgFQ34-Q1rPDAts79GE_4kwGTDeVAzcz3I9j4iS9iEih_DyYXwg=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:22 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:35 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "3b8cba6f-7f13-4723-7dc7-f45860e43b7d", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "05265e2b-a4de-45a2-4c3c-975af4d3f5f5", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "PnkyDEewHs4lmtUmr8kLvok7i2IAeZ-uAg420S316zuGXj5YVwM3VA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "l-6sgFQ34-Q1rPDAts79GE_4kwGTDeVAzcz3I9j4iS9iEih_DyYXwg=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-dtxcid 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, - 0x78, 0x63, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506682, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.8e-05, - connect = 0, pretransfer = 0.000156, starttransfer = 0.300575, - total = 0.300642)), class = "response") + 0x78, 0x63, 0x69, 0x64, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514075, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.1e-05, + connect = 0, pretransfer = 0.000146, starttransfer = 0.109394, + total = 0.109445)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid/DTXCID30182.R b/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid/DTXCID30182.R index f7f8e29..7edb1fa 100644 --- a/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid/DTXCID30182.R +++ b/tests/testthat/chemical-batch/chemical/msready/search/by-dtxcid/DTXCID30182.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-dtxcid/DTXCID30182", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:23 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "eebc34fd-dc7e-48d8-682f-c74f58b19e59", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "1f288974-02eb-45a7-6382-797e699b320f", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "8yK9KibiFKz7L-f7X3JJ1dvkmauorEfbJ9VlYm2lOkzmGzWR02VOYg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "bfHLTNMR3Vftwa9pB8ADjobMUe7k_tnsopGHVgZsyo3go_JNVvhcqg=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:23 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "eebc34fd-dc7e-48d8-682f-c74f58b19e59", + date = "Mon, 16 Sep 2024 19:14:36 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "1f288974-02eb-45a7-6382-797e699b320f", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "8yK9KibiFKz7L-f7X3JJ1dvkmauorEfbJ9VlYm2lOkzmGzWR02VOYg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "bfHLTNMR3Vftwa9pB8ADjobMUe7k_tnsopGHVgZsyo3go_JNVvhcqg=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506683, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.2e-05, - connect = 0, pretransfer = 0.000125, starttransfer = 0.133303, - total = 0.133367)), class = "response") + date = structure(1726514076, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.3e-05, + connect = 0, pretransfer = 0.00012, starttransfer = 0.116622, + total = 0.116653)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R b/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R index ce68732..41dfff9 100644 --- a/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R +++ b/tests/testthat/chemical-batch/chemical/msready/search/by-formula.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-formula/", status_code = 404L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:21 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:34 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "6589f983-16f3-43ab-6a1e-33608c47abc5", + `x-vcap-request-id` = "d6f7b39f-12a8-45d9-60cf-111fbbd3a57e", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "aS5PN3yZGJLoIl56E4nSdZRR6CZoND4G0zbZ9l1aB7JtsQvYSdX0Kg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "uhUcnW9PSG77-K2o38HfgSaR4N46ul1weF7SqjLocsvB0TYvcEmAvA=="), class = c("insensitive", "list")), all_headers = list(list(status = 404L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:21 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:34 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "6589f983-16f3-43ab-6a1e-33608c47abc5", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "d6f7b39f-12a8-45d9-60cf-111fbbd3a57e", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "aS5PN3yZGJLoIl56E4nSdZRR6CZoND4G0zbZ9l1aB7JtsQvYSdX0Kg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "uhUcnW9PSG77-K2o38HfgSaR4N46ul1weF7SqjLocsvB0TYvcEmAvA=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -40,7 +40,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-formul 0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x66, 0x6f, 0x72, 0x6d, 0x75, 0x6c, 0x61, 0x2f, 0x22, 0x0a, 0x7d - )), date = structure(1726506681, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.2e-05, - connect = 0, pretransfer = 0.000155, starttransfer = 0.378808, - total = 0.378873)), class = "response") + )), date = structure(1726514074, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.2e-05, + connect = 0, pretransfer = 0.000132, starttransfer = 0.290198, + total = 0.290228)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-formula/CH4.R b/tests/testthat/chemical-batch/chemical/msready/search/by-formula/CH4.R index b2a984e..c1356e8 100644 --- a/tests/testthat/chemical-batch/chemical/msready/search/by-formula/CH4.R +++ b/tests/testthat/chemical-batch/chemical/msready/search/by-formula/CH4.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-formula/CH4", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:22 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "1f800da2-98cb-48b9-40c2-8f7ce52dfd8e", + date = "Mon, 16 Sep 2024 19:14:35 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "aef56d9a-c688-4cc2-7856-ce3923a04056", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "OysTISobrF34YAqMZq_jflaCsVB5bKeranATIZxuK2jLq3VXDyBM8A=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "y4T46hkehbZ8UMWLQlf0ZL9dPlCgMglOZAYbn-vQPoUJ799B3HaFvA=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:22 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "1f800da2-98cb-48b9-40c2-8f7ce52dfd8e", + date = "Mon, 16 Sep 2024 19:14:35 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "aef56d9a-c688-4cc2-7856-ce3923a04056", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "OysTISobrF34YAqMZq_jflaCsVB5bKeranATIZxuK2jLq3VXDyBM8A=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "y4T46hkehbZ8UMWLQlf0ZL9dPlCgMglOZAYbn-vQPoUJ799B3HaFvA=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506682, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.5e-05, - connect = 0, pretransfer = 0.000115, starttransfer = 0.126698, - total = 0.126747)), class = "response") + date = structure(1726514075, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 6.9e-05, + connect = 0, pretransfer = 0.000165, starttransfer = 0.294837, + total = 0.294877)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R index fef23fb..3d60381 100644 --- a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R +++ b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-3083de-POST.R @@ -1,24 +1,24 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/", status_code = 400L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:04 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", vary = "Origin", vary = "Access-Control-Request-Method", vary = "Access-Control-Request-Headers", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "e184e906-da1b-4d1e-58e5-b14673198214", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "8d469667-d4de-4bf2-62e5-e0e870575d26", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "vVqBmfJyuHx-sLRRXMVG2Rk3GNhOIjskIRy3nvTkFcfwgwM5mqIXhA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "23BX42Zil0NGOFDkVcCtBprhb0LhFD0zBLdr4SEsj2L_r5hTZkXxYw=="), class = c("insensitive", "list")), all_headers = list(list(status = 400L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:04 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", vary = "Origin", vary = "Access-Control-Request-Method", vary = "Access-Control-Request-Headers", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "e184e906-da1b-4d1e-58e5-b14673198214", + `x-vcap-request-id` = "8d469667-d4de-4bf2-62e5-e0e870575d26", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "vVqBmfJyuHx-sLRRXMVG2Rk3GNhOIjskIRy3nvTkFcfwgwM5mqIXhA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "23BX42Zil0NGOFDkVcCtBprhb0LhFD0zBLdr4SEsj2L_r5hTZkXxYw=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/" 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6d, - 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506664, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.6e-05, - connect = 0, pretransfer = 0.000141, starttransfer = 0.324103, - total = 0.324208)), class = "response") + 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514057, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.6e-05, + connect = 0, pretransfer = 0.00016, starttransfer = 0.405217, + total = 0.405522)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R index 4c35fd4..a6dfe1f 100644 --- a/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R +++ b/tests/testthat/chemical-batch/chemical/msready/search/by-mass-d40255-POST.R @@ -1,24 +1,24 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/", status_code = 400L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:18 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", vary = "Origin", vary = "Access-Control-Request-Method", vary = "Access-Control-Request-Headers", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "317a64fe-5532-40bc-6685-3fbb5255c468", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "81fa47e0-c04e-4c41-5571-e2ae3b6d3446", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Ljrp7Ik1YordsSyWmjXj0uslvV5EhVj7aMisTpuxZo81hIUY2CJpXA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "U8mVxyGoeV4HTovdhBoE0P2hA3x10NY0rQCgf-s7uprcVP83RIsKdA=="), class = c("insensitive", "list")), all_headers = list(list(status = 400L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:18 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", vary = "Origin", vary = "Access-Control-Request-Method", vary = "Access-Control-Request-Headers", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "317a64fe-5532-40bc-6685-3fbb5255c468", + `x-vcap-request-id` = "81fa47e0-c04e-4c41-5571-e2ae3b6d3446", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Ljrp7Ik1YordsSyWmjXj0uslvV5EhVj7aMisTpuxZo81hIUY2CJpXA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "U8mVxyGoeV4HTovdhBoE0P2hA3x10NY0rQCgf-s7uprcVP83RIsKdA=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -39,7 +39,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/msready/search/by-mass/" 0x22, 0x2f, 0x63, 0x68, 0x65, 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x6d, 0x73, 0x72, 0x65, 0x61, 0x64, 0x79, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, 0x2f, 0x62, 0x79, 0x2d, 0x6d, - 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506678, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.6e-05, - connect = 0, pretransfer = 0.000166, starttransfer = 0.342507, - total = 0.342565)), class = "response") + 0x61, 0x73, 0x73, 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726514071, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.9e-05, + connect = 0, pretransfer = 0.000203, starttransfer = 0.257579, + total = 0.257614)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-cd40e5-POST.R b/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-cd40e5-POST.R index ef09cdd..6109d7f 100644 --- a/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-cd40e5-POST.R +++ b/tests/testthat/chemical-batch/chemical/property/search/by-dtxsid-cd40e5-POST.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/property/search/by-dtxsid/", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:08 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "7dab097c-8491-492c-697b-b3967198f9c4", + date = "Mon, 16 Sep 2024 19:14:21 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "2cdc3e3e-7c9d-4de3-69be-d9e57754c899", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "x92-5TdAVA7Gja_vVEiFCqYBhiOBUwNqV8kNvDXAMhDMACV5kVKEzA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "QrastKU20WObQL6Al49K04_f6n0_KrDmPLRXOgyriq5X7mH7J5eH2g=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:08 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "7dab097c-8491-492c-697b-b3967198f9c4", + date = "Mon, 16 Sep 2024 19:14:21 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "2cdc3e3e-7c9d-4de3-69be-d9e57754c899", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "x92-5TdAVA7Gja_vVEiFCqYBhiOBUwNqV8kNvDXAMhDMACV5kVKEzA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "QrastKU20WObQL6Al49K04_f6n0_KrDmPLRXOgyriq5X7mH7J5eH2g=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506668, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.1e-05, - connect = 0, pretransfer = 0.000117, starttransfer = 0.102969, - total = 0.103012)), class = "response") + date = structure(1726514061, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.3e-05, + connect = 0, pretransfer = 0.000147, starttransfer = 0.109084, + total = 0.109131)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.R index 482330f..2d80e16 100644 --- a/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/contain/DTXSID7020182", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:18 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f52584be-5f2b-4572-5414-c8f8c53df241", + date = "Mon, 16 Sep 2024 19:14:31 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "bd0f6669-1992-446f-6858-ad8c9ab5df16", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "UjQrNESYKFrP6xNnwe3B9PK3A1P1Jy71Tgi5v6p_MPxElpnsdRqj9A=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "4AGH8UfO82bhWuq-e5t24hGe10ZN1gqogf3LowIHitMPGi6XmF-yXg=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:18 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "f52584be-5f2b-4572-5414-c8f8c53df241", + date = "Mon, 16 Sep 2024 19:14:31 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "bd0f6669-1992-446f-6858-ad8c9ab5df16", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "UjQrNESYKFrP6xNnwe3B9PK3A1P1Jy71Tgi5v6p_MPxElpnsdRqj9A=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "4AGH8UfO82bhWuq-e5t24hGe10ZN1gqogf3LowIHitMPGi6XmF-yXg=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506678, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.6e-05, - connect = 0, pretransfer = 0.000152, starttransfer = 0.123175, - total = 0.123229)), class = "response") + date = structure(1726514071, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.9e-05, + connect = 0, pretransfer = 0.000197, starttransfer = 0.106026, + total = 0.106063)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json b/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json index 34ef919..00e0426 100644 --- a/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json +++ b/tests/testthat/chemical-batch/chemical/search/contain/DTXSID7020182.json @@ -1,38 +1,38 @@ [ { - "hasStructureImage": 1, - "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1", - "isMarkush": false, + "searchName": "DSSTox_Substance_Id", + "searchValue": "DTXSID7020182", + "rank": 1, "dtxsid": "DTXSID7020182", "dtxcid": "DTXCID30182", "casrn": "80-05-7", "preferredName": "Bisphenol A", - "searchName": "DSSTox_Substance_Id", - "searchValue": "DTXSID7020182", - "rank": 1 + "hasStructureImage": 1, + "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1", + "isMarkush": false }, { - "hasStructureImage": 1, - "smiles": "OC(=O)C1=CC=C(NS(=O)(=O)CC2=CC=CC=C2)C=C1", - "isMarkush": false, + "searchName": "DSSTox_Substance_Id", + "searchValue": "DTXSID70201820", + "rank": 1, "dtxsid": "DTXSID70201820", "dtxcid": "DTXCID00124311", "casrn": "536-95-8", "preferredName": "Carinamide", - "searchName": "DSSTox_Substance_Id", - "searchValue": "DTXSID70201820", - "rank": 1 + "hasStructureImage": 1, + "smiles": "OC(=O)C1=CC=C(NS(=O)(=O)CC2=CC=CC=C2)C=C1", + "isMarkush": false }, { - "hasStructureImage": 1, - "smiles": "CCOP(=S)(OCC)OC1=NN=CC=C1", - "isMarkush": false, + "searchName": "DSSTox_Substance_Id", + "searchValue": "DTXSID70201825", + "rank": 1, "dtxsid": "DTXSID70201825", "dtxcid": "DTXCID00124316", "casrn": "53605-00-8", "preferredName": "Phosphorothioic acid, O,O-diethyl O-3-pyridazinyl ester", - "searchName": "DSSTox_Substance_Id", - "searchValue": "DTXSID70201825", - "rank": 1 + "hasStructureImage": 1, + "smiles": "CCOP(=S)(OCC)OC1=NN=CC=C1", + "isMarkush": false } ] diff --git a/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R b/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R index 43ff65e..e3218da 100644 --- a/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R +++ b/tests/testthat/chemical-batch/chemical/search/contain/gvfdsr7.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/contain/gvfdsr7", status_code = 400L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "ab7a1020-94f7-4e4a-5798-1fc2480097b3", + `x-vcap-request-id` = "b5a2eaa8-a9ec-4e4a-7259-29de2bff16ce", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "2fvTk2LfqSoNiSvc8VdpYtAYmQ_VMbMoJzVebZsWTk-0mbGfFv4shg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "XJAcvVWaWu-WGID4lIfmPO5dTx8zF7mzN3FnTmP4QX_zVWtgASvIvg=="), class = c("insensitive", "list")), all_headers = list(list(status = 400L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:17 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:31 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "ab7a1020-94f7-4e4a-5798-1fc2480097b3", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "b5a2eaa8-a9ec-4e4a-7259-29de2bff16ce", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "2fvTk2LfqSoNiSvc8VdpYtAYmQ_VMbMoJzVebZsWTk-0mbGfFv4shg=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "XJAcvVWaWu-WGID4lIfmPO5dTx8zF7mzN3FnTmP4QX_zVWtgASvIvg=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -42,7 +42,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/contain/gvfdsr7", 0x72, 0x37, 0x22, 0x2c, 0x0a, 0x20, 0x20, 0x22, 0x73, 0x75, 0x67, 0x67, 0x65, 0x73, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x22, 0x20, 0x3a, 0x20, 0x5b, 0x20, 0x6e, 0x75, 0x6c, 0x6c, 0x20, - 0x5d, 0x0a, 0x7d)), date = structure(1726506677, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.2e-05, - connect = 0, pretransfer = 0.000154, starttransfer = 3.967357, - total = 3.967413)), class = "response") + 0x5d, 0x0a, 0x7d)), date = structure(1726514071, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5e-05, + connect = 0, pretransfer = 0.000126, starttransfer = 3.898013, + total = 3.898108)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.R index 7095ea7..74f7bcf 100644 --- a/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.R @@ -1,25 +1,25 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/start-with/DTXSID7020182", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:09 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "dd1a27d6-6ed3-41eb-6e75-98bfd8e0450e", + date = "Mon, 16 Sep 2024 19:14:22 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "830584da-ece9-4e41-6e3c-ca68e0bde648", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "pmNqzVtAhSAPOnVU76Jr72DkydCeGfwfZzqwZpb9tZkkd-O01pTp9A=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "YV2RTeQ4dBf5larbDvfiVK--05cWlYM90by2Hk-g4p6AO6PCVfnrlg=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:09 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "dd1a27d6-6ed3-41eb-6e75-98bfd8e0450e", + date = "Mon, 16 Sep 2024 19:14:22 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "830584da-ece9-4e41-6e3c-ca68e0bde648", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "pmNqzVtAhSAPOnVU76Jr72DkydCeGfwfZzqwZpb9tZkkd-O01pTp9A=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "YV2RTeQ4dBf5larbDvfiVK--05cWlYM90by2Hk-g4p6AO6PCVfnrlg=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506669, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.4e-05, - connect = 0, pretransfer = 0.000138, starttransfer = 0.102414, - total = 0.102472)), class = "response") + date = structure(1726514062, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.2e-05, + connect = 0, pretransfer = 0.000157, starttransfer = 0.332792, + total = 0.332823)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json b/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json index 9db85b3..6fd8ac5 100644 --- a/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json +++ b/tests/testthat/chemical-batch/chemical/search/start-with/DTXSID7020182.json @@ -1,14 +1,14 @@ [ { - "hasStructureImage": 1, - "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1", - "isMarkush": false, + "searchName": "DSSTox_Substance_Id", + "searchValue": "DTXSID7020182", + "rank": 1, "dtxsid": "DTXSID7020182", "dtxcid": "DTXCID30182", "casrn": "80-05-7", "preferredName": "Bisphenol A", - "searchName": "DSSTox_Substance_Id", - "searchValue": "DTXSID7020182", - "rank": 1 + "hasStructureImage": 1, + "smiles": "CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1", + "isMarkush": false } ] diff --git a/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R b/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R index fcd5782..78f63ff 100644 --- a/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R +++ b/tests/testthat/chemical-batch/chemical/search/start-with/gvfdsr7.R @@ -1,21 +1,21 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/start-with/gvfdsr7", status_code = 400L, headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:09 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:22 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "20560608-92e8-4505-6dd6-c45d60c4aa0e", + `x-vcap-request-id` = "33d0e2fc-904b-4405-4c6c-c5f00e84ffdf", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Z50ex303WKz83KB_2Jxh-bpiJCSmf2GcmtexP02Gizz-zeR2B7pNLA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "5dI0BvKqNP8d9XmUQRCBAHcaelWcBJPVJOj2_1nFPHM37NVT9j_TgQ=="), class = c("insensitive", "list")), all_headers = list(list(status = 400L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/problem+json", `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:09 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", + date = "Mon, 16 Sep 2024 19:14:22 GMT", `cache-control` = "max-age=0, must-revalidate, no-transform", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "20560608-92e8-4505-6dd6-c45d60c4aa0e", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "33d0e2fc-904b-4405-4c6c-c5f00e84ffdf", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "Z50ex303WKz83KB_2Jxh-bpiJCSmf2GcmtexP02Gizz-zeR2B7pNLA=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "5dI0BvKqNP8d9XmUQRCBAHcaelWcBJPVJOj2_1nFPHM37NVT9j_TgQ=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", @@ -42,7 +42,7 @@ structure(list(url = "https://api-ccte.epa.gov/chemical/search/start-with/gvfdsr 0x66, 0x64, 0x73, 0x72, 0x37, 0x22, 0x2c, 0x0a, 0x20, 0x20, 0x22, 0x73, 0x75, 0x67, 0x67, 0x65, 0x73, 0x74, 0x69, 0x6f, 0x6e, 0x73, 0x22, 0x20, 0x3a, 0x20, 0x5b, 0x20, 0x6e, 0x75, - 0x6c, 0x6c, 0x20, 0x5d, 0x0a, 0x7d)), date = structure(1726506669, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 5.3e-05, - connect = 0, pretransfer = 0.000151, starttransfer = 0.390288, - total = 0.390368)), class = "response") + 0x6c, 0x6c, 0x20, 0x5d, 0x0a, 0x7d)), date = structure(1726514062, class = c("POSIXct", + "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 9.2e-05, + connect = 0, pretransfer = 0.000242, starttransfer = 0.152872, + total = 0.152936)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid/DTXSID7020182.R b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.R similarity index 57% rename from tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid/DTXSID7020182.R rename to tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.R index 5183dd7..a107f48 100644 --- a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid/DTXSID7020182.R +++ b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.R @@ -1,25 +1,25 @@ -structure(list(url = "https://api-ccte.epa.gov/chemical/synonym/search/by-dtxsid/DTXSID7020182", +structure(list(url = "https://api-ccte.epa.gov/chemical/synonym/search/by-dtxsid/", status_code = 401L, headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:32 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "4ea3b427-40a8-431a-6254-a15011dad773", + date = "Mon, 16 Sep 2024 19:14:52 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "5d04155e-695d-49eb-5bc3-520ab35657a5", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "2QcLlXl3-eRm4ZiLRjw-vf_zDdbvuXIoDu7Fu3_Lfx21LWwO2HQy-g=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "FhPFp5VA5k0xcuUWSc1lvcamkbOlzol1s3VLdROKaRAUtxgH13ww_Q=="), class = c("insensitive", "list")), all_headers = list(list(status = 401L, version = "HTTP/1.1", headers = structure(list(`content-type` = "application/json;charset=ISO-8859-1", `content-length` = "164", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:32 GMT", `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "4ea3b427-40a8-431a-6254-a15011dad773", + date = "Mon, 16 Sep 2024 19:14:52 GMT", `strict-transport-security` = "max-age=31536000", + `x-content-type-options` = "nosniff", `x-vcap-request-id` = "5d04155e-695d-49eb-5bc3-520ab35657a5", `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "2QcLlXl3-eRm4ZiLRjw-vf_zDdbvuXIoDu7Fu3_Lfx21LWwO2HQy-g=="), class = c("insensitive", + `x-cache` = "Error from cloudfront", via = "1.1 263d97c176fc51d1d08116820c013de4.cloudfront.net (CloudFront)", + `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "FhPFp5VA5k0xcuUWSc1lvcamkbOlzol1s3VLdROKaRAUtxgH13ww_Q=="), class = c("insensitive", "list")))), cookies = structure(list(domain = logical(0), flag = logical(0), path = logical(0), secure = logical(0), expiration = structure(numeric(0), class = c("POSIXct", "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), content = charToRaw("{\"title\":\"API Header Not Found\",\"detail\":\"Every API call should pass assigned API key through custom http header or query parameter. Request is missing x-api-key.\"}"), - date = structure(1726506692, class = c("POSIXct", "POSIXt" - ), tzone = "GMT"), times = c(redirect = 0, namelookup = 5e-05, - connect = 0, pretransfer = 0.000146, starttransfer = 0.112982, - total = 0.113023)), class = "response") + date = structure(1726514092, class = c("POSIXct", "POSIXt" + ), tzone = "GMT"), times = c(redirect = 0, namelookup = 3.9e-05, + connect = 0, pretransfer = 0.00011, starttransfer = 0.286577, + total = 0.286626)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json new file mode 100644 index 0000000..ac1df7a --- /dev/null +++ b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-cd40e5-POST.json @@ -0,0 +1,271 @@ +[ + { + "beilstein": null, + "alternateCasrn": null, + "deletedCasrn": [ + "137885-53-1", + "1429425-26-2", + "146479-75-6", + "27360-89-0", + "28106-82-3", + "37808-08-5" + ], + "other": [ + "1,1'-(1-Methylethylidene)bisphenylol, 9CI", + "(1-methylethylidene)bis-Phenol", + "201-245-8", + "201-245-8", + "2,2-(4,4-Dihydroxydiphenyl)propane", + "2,2-(4,4'-Dihydroxydiphenyl)propane", + "2,2-Bis(4,4'-hydroxyphenyl)propane", + "2,2-Bis-4'-hydroxyfenylpropan", + "2,2-Bis (4-hydroxyphenol) propane", + "2,2-bis(4-hydroxyphenyl)propane", + "2, 2-Bis(4-hydroxyphenyl)propane", + "2,2-Bis(4'-hydroxyphenyl)propane", + "2,2-Bis(4'-hydroxyphenyl) propane", + "2,2'-Bis(4-hydroxyphenyl)propane", + "2,2-Bis[4-Hydroxyphenyl]propane", + "2, 2-Bis(hydroxyphenyl)propane", + "2,2-Bis(hydroxyphenyl)propane", + "2,2-Bis(hydroxyphenyl)propane", + "2,2-Bis(hydroxyphenyl)propane", + "2,2-Bis(p-hydroxyphenyl)propane", + "2,2-Bis(p-hydroxyphenyl)-Propane", + "2,2-Di-(4'-Hydroxyphenyl)-propane", + "2, 2-Di(4-phenylol)propane", + "4-06-00-06717", + "4-[1-(4-Hydroxyphenyl)-1-methylethyl]phenol", + "4-[2-(4-hydroxyphenyl)propan-2-yl]phenol", + "4-[2-(4-hydroxyphenyl)propan-2-yl]phenol", + "4,4'-(1-Methylethane-1,1-diyl)diphenol", + "4,4'-(1-Methylethylidene)bisphenol", + "4,4'-(1-Methylethylidene)bis-Phenol", + "4,4'-(1-Methylethylidene)bisphenol, 9CI", + "4, 4'-Bisphenol A", + "4,4'-Dihydroxdiphenylpropane", + "4,4'-dihydroxy-2,2-diphenylpropane", + "4,4'-Dihydroxy-2,2-diphenylpropane", + "4, 4'-Dihydroxydiphenyl-2,2-propane", + "4,4'-Dihydroxydiphenyl-2,2-propane", + "4, 4'-Dihydroxydiphenyldimethylmethane", + "4,4'-Dihydroxydiphenyldimethylmethane", + "4, 4'-Dihydroxydiphenylpropane", + "4,4'-Dihydroxydiphenylpropane", + "4,4'-Dimethylmethylenediphenol", + "4,4'-Dimethylmethylenedi-Phenol", + "4,4'-Isopropylidenebisphenol", + "4,4'-Isopropylidenebis[phenol]", + "4,4-Isopropylidenediphenol", + "4,4-Isopropylidenediphenol", + "4,4'-Isopropylidenediphenol", + "4,4'-Isopropylidenediphenol", + "4,4'-Isopropylidene diphenol", + "4,4[-Isopropylidenediphenol", + "4,4'-Isopropylidenedi-Phenol", + "4,4'-ISOPROPYLIDENE-DIPHENOL", + "4,4'-Isopropylidenediphenol B", + "4_4'-isopropylidenedi-phenol (bisphenol a)", + "4,4'-ISOPROPYLIDENEDIPHENOL (BISPHENOL A)", + "4_4'-isopropylidenediphenol_ (bisphenol a) (sara 313)", + "4_4'-isopropylidenediphenol_ (bisphenol a) (sara iii)", + "4_4'-isopropylidenediphenol (sara 313)", + "4_4'-isopropylidenediphenol (sara iii)", + "4_4'-isopropylidenediphenol (sara iii)", + "4_4'-isopropylidenediphenol (sara iii)", + "4_4'-isopropylidenediphenol (sara iii)/bisphenol a", + "4_4'-isopropylidenediphenol (sara iii)/bisphenol-a", + "4,4' Isopropylidinediphenol", + "4,4'-(Propane-2,2-diyl)diphenol", + "4,4'-Propane-2,2-diyldiphenol", + "4,4'-PROPANE-2,2-DIYLDIPHENOL", + "4,4’-Propane-2,2-diyldiphenol (bisphenol A)", + "beta, beta'-Bis(p-hydroxyphenyl)propane", + "beta,beta'-Bis(p-hydroxyphenyl)propane", + "beta,beta-Di-(p-hydroxyphenyl)propane", + "beta-Di-(p-hydroxyphenyl)propane", + "beta-Di-p-hydroxyphenylpropane", + "beta-Di-p-hydroxyphenylpropane", + "Biphenol a", + "Biphenol A", + "Bis(4-hyd roxyphenyl) dimethylmethane", + "Bis(4-hydroxyphenyl) dimethylmethane", + "Bis(4-hydroxyphenyl)propane", + "Bis(4-hydroxyphenyl) propane", + "Bisfenol A", + "Bisferol a", + "Bisphenol", + "bisphenol-A", + "Bis-phenol A", + "Bisphenol A", + "Bisphenol A.", + "Bisphenol-A (.alpha.)", + "bisphenol a_ bisphenol", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-1*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-2*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-3*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-4*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-4*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-4*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *97-1*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *97-2*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *97-3*", + "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *98-1*", + "Bisphenol A (BPA)", + "Bisphenol A (BPA) (creatinine adjusted)", + "bisphenol a resin", + "bisphenol a (sara 313)", + "bisphenol a (sara iii)", + "bisphenol-a (sara iii)", + "Bisphenol A, water, dissolved (ug/l)", + "BPA", + "BPA", + "BRN 1107700", + "Di-2,2-(4-Hydroxyphenyl)propane", + "Dian", + "Dian", + "Diano", + "Diano", + "Dimethyl bis(p-hydroxyphenyl)methane", + "Dimethylbis(p-hydroxyphenyl)methane", + "Dimethylmethylene-p,p'-diphenol", + "DIPHENYLOLPROPANE", + "EC No.: 201-245-8", + "EINECS 201-245-8", + "Hydrogenated bisphenol a", + "IISBACLAFKSPIT-UHFFFAOYSA-N", + "Ipognox 88", + "Isopropylidenediphenol", + "Millad hbpa", + "mixture of triisobutylene, diisobutylene (2,4,4-trimethylpentene) and 4,4'-(methylethylidene) bisphenol (bisphenol a)", + "NCGC00090952-07", + "NCGC00260537-01", + "NCI-C50635", + "Parabis A", + "Phenol, (1-methylethylidene)bis-", + "Phenol, (1-methylethylidene)bis-", + "phenol_ 4_4'-(1-methylethylidene) bis-", + "Phenol, 4,4'-(1-methylethylidene)bis-", + "Phenol, 4,4'-dimethylmethylenedi-", + "phenol_ 4_4'-isopropylenedi-_ (4_4'-isopropylidenediphenol) (bisphenol a) (sara iii)", + "phenol_ 4_4'-isopropylenedi-_ (bisphenol a resin) (sara 313)", + "phenol_ 4_4'-isopropylenedi-_ (bisphenol a) (sara 313)", + "Phenol, 4,4'-isopropylidenedi-", + "phenol_4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol)", + "phenol_ 4_4'-isopropylidenedi-_4_4'-isopropylidenediphenol_ (bisphenol a) (sara iii)", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'- isopropylidenediphenol (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'- isopropylidenediphenol) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidene diphenol) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara 313)", + "phenol_ 4_4'-isopropylidenedi)_ (4_4'-isopropylidenediphenol) (sara 313)", + "phenol_ 4_4'-isopropyl idenedi-_ (4_4'-isopropylidenediphenol) (sara 313). ld50 (oral_ rat): 3000 mg/kg.", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara 313). vp:0.", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara 313) vp: 0.00", + "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara iii)", + "phenol_4_4'-isopropylidenedi-_(4_4'-isopropylidenediphenol) (sara iii)", + "phenol_ 4_4'-isopropylidene di-_ (bisphenol a)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a)", + "phenol_4_4'-isopropylidenedi-_ (bisphenol a)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a (bpa)) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a). ld50 (oral):2000 mg/kg.", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a).ld50:(oral_rat) 2000 mg/kg", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a).ld50:(oral_rat) 2000 mg/kg.", + "phenol_4_4'-isopropylidenedi-_ (bisphenol a)_(mfr's invalid cas#: 80-5-7).", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a polycarbonate)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin (bpa))", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin (bpa) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin (bpa)) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin) (bpa) (sara 313). ld50:(oral_rat) >5 g/kg.", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin) (saraiii)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin) (saraiii)", + "phenol_ 4_4'-isopropylidenedi-_ ( bisphenol a) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol-a) (sara 313)", + "phenol_4_4'-isopropylidenedi-_ (bisphenol a) (sara 313)", + "phenol_4_4'-isopropylidenedi-_ (bisphenol a) (sara 313))", + "phenol_4.4'-isopropylidenedi-_ (bisphenol a) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313) ld50: (oral) 3250 mg/kg", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313) ld50 (oral_ rat):4.2 g/kg", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313) % wt: <100 ppm", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara iii)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara iii)", + "phenol_4_4'-isopropylidenedi_(bisphenol-a) (sara iii)", + "phenol_4_4'-isopropylidenedi-_(bisphenol-a) (sara iii)", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara iii).ld50:(oral) 3250 mg/kg.", + "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a). vp: 0.01 @ 20c. ld50 (oral_rat): 1999.9 mg/kg.", + "phenol_4_4'-isopropylidenedi-_ (bisphenol a). vp: 0.01 @20c. ld50: oral(rat)2000 mg/kg.", + "phenol_ 4_4'-isopropylidenedi-_(p_p'-isopropylidenediphenol) (sara 313)", + "phenol_ 4_4'-isopropylidenedi-_ (sara iii)(4_4'-isopropylidenediphenol) (bisphenol-a)", + "phenol_ 4_4'-isopropylideneol-_ (bisphenol a) (sara 313)", + "phenol_ 4_4_-isopropylidenidi-_ (4_4'-isopropylidenediphenol) (bisphenol a) (sara iii)", + "phenol_ 4_4'-isopropylidinedi-_ (bisphenol a resin) (sara iii)", + "Pluracol 245", + "P, p'-Dihydroxydiphenyldimethylmethane", + "P,p'-Dihydroxydiphenyldimethylmethane", + "P, p'-Dihydroxydiphenylpropane", + "p,p'-Isopropylidenebisphenol", + "p,p'-Isopropylidenediphenol", + "P, p'-Isopropylidenediphenol", + "Propane, 2,2-bis(p-hydroxyphenyl)-", + "Rikabanol", + "total bisphenol a", + "Tox21_202992", + "Tox21_400088", + "Ucar bisphenol a", + "Ucar bisphenol HP", + "UNII-MLT3645I99" + ], + "valid": [ + "4,4’-Propane-2,2-diyldiphenol", + "80-05-7", + "Bisphenol A", + "Phenol, 4,4'-(1-methylethylidene)bis-" + ], + "good": [ + "2,2-Bis(4-hydroxyphenyl)propane", + "2,2-Bis(4'-hydroxyphenyl) propane", + "2,2'-Bis(4-hydroxyphenyl)propane", + "2,2-BIS-(4-HYDROXY-PHENYL)-PROPANE", + "2,2-Bis(p-hydroxyphenyl)propane", + "2,2-Di(4-Hydroxyphenyl) Propane", + "2,2-DI(4-HYDROXYPHENYL)PROPANE", + "2,2-Di(4-phenylol)propane", + "4,4'-(1-Methylethylidene)bisphenol", + "4,4'-Bisphenol A", + "(4,4'-Dihydroxydiphenyl)dimethylmethane", + "4,4'-DIHYDROXYPHENYL-2,2-PROPANE", + "4,4'-isopropilidendifenol", + "4,4'-Isopropylidendiphenol", + "4,4'-Isopropylidene bisphenol", + "4,4'-Isopropylidenebis[phenol]", + "4,4'-isopropylidenediphenol", + "4,4-ISOPROPYLIDENE DIPHENYL", + "4,4'-Methylethylidenebisphenol", + "Bis(4-hydroxyphenyl)dimethylmethane", + "BIS[PHENOL], 4,4'-(1-METHYLETHYLIDENE)-", + "BISPHENOL, 4,4'-(1-METHYLETHYLIDENE)-", + "Bisphenol-A", + "Bis(p-hydroxyphenyl)propane", + "Diphenol methylethylidene", + "Diphenylolpropane", + "Hidorin F 285", + "Isopropylidenebis(4-hydroxybenzene)", + "NSC 1767", + "NSC 17959", + "Parabis", + "Parabis A", + "Phenol, 4,4'-isopropylidenedi-", + "Pluracol 245", + "p,p'-Bisphenol A", + "p,p'-Dihydroxydiphenylpropane", + "p,p'-Isopropylidenebisphenol", + "p,p'-Isopropylidenediphenol", + "P,P'-ISOPROPYLIDENE DIPHENOL", + "Rikabanol", + "β,β'-Bis(p-hydroxyphenyl)propane" + ], + "pcCode": null, + "dtxsid": "DTXSID7020182" + } +] diff --git a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-ddb193-POST.json b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-ddb193-POST.json new file mode 100644 index 0000000..41b42e6 --- /dev/null +++ b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid-ddb193-POST.json @@ -0,0 +1,3 @@ +[ + +] diff --git a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid.R b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid.R deleted file mode 100644 index 95b7e36..0000000 --- a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid.R +++ /dev/null @@ -1,44 +0,0 @@ -structure(list(url = "https://api-ccte.epa.gov/chemical/synonym/search/by-dtxsid/", - status_code = 405L, headers = structure(list(`content-type` = "application/problem+json", - `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:32 GMT", allow = "POST", - `strict-transport-security` = "max-age=31536000", `x-content-type-options` = "nosniff", - `x-vcap-request-id` = "2eca991b-6eb6-4e96-5c90-b6faeee7d82e", - `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "KvM_xaqJj85fMZ54820mbVUg15oJSmnLDDnMPlY4eXtbWjdNR8vqSg=="), class = c("insensitive", - "list")), all_headers = list(list(status = 405L, version = "HTTP/1.1", - headers = structure(list(`content-type` = "application/problem+json", - `transfer-encoding` = "chunked", connection = "keep-alive", - date = "Mon, 16 Sep 2024 17:11:32 GMT", allow = "POST", - `strict-transport-security` = "max-age=31536000", - `x-content-type-options` = "nosniff", `x-vcap-request-id` = "2eca991b-6eb6-4e96-5c90-b6faeee7d82e", - `x-xss-protection` = "1; mode=block", `x-frame-options` = "DENY", - `x-cache` = "Error from cloudfront", via = "1.1 8fc9659fc06389e49927f68638e9bc94.cloudfront.net (CloudFront)", - `x-amz-cf-pop` = "IAD89-C1", `x-amz-cf-id` = "KvM_xaqJj85fMZ54820mbVUg15oJSmnLDDnMPlY4eXtbWjdNR8vqSg=="), class = c("insensitive", - "list")))), cookies = structure(list(domain = logical(0), - flag = logical(0), path = logical(0), secure = logical(0), - expiration = structure(numeric(0), class = c("POSIXct", - "POSIXt")), name = logical(0), value = logical(0)), row.names = integer(0), class = "data.frame"), - content = as.raw(c(0x7b, 0x0a, 0x20, 0x20, 0x22, 0x74, 0x79, - 0x70, 0x65, 0x22, 0x20, 0x3a, 0x20, 0x22, 0x61, 0x62, 0x6f, - 0x75, 0x74, 0x3a, 0x62, 0x6c, 0x61, 0x6e, 0x6b, 0x22, 0x2c, - 0x0a, 0x20, 0x20, 0x22, 0x74, 0x69, 0x74, 0x6c, 0x65, 0x22, - 0x20, 0x3a, 0x20, 0x22, 0x4d, 0x65, 0x74, 0x68, 0x6f, 0x64, - 0x20, 0x4e, 0x6f, 0x74, 0x20, 0x41, 0x6c, 0x6c, 0x6f, 0x77, - 0x65, 0x64, 0x22, 0x2c, 0x0a, 0x20, 0x20, 0x22, 0x73, 0x74, - 0x61, 0x74, 0x75, 0x73, 0x22, 0x20, 0x3a, 0x20, 0x34, 0x30, - 0x35, 0x2c, 0x0a, 0x20, 0x20, 0x22, 0x64, 0x65, 0x74, 0x61, - 0x69, 0x6c, 0x22, 0x20, 0x3a, 0x20, 0x22, 0x4d, 0x65, 0x74, - 0x68, 0x6f, 0x64, 0x20, 0x27, 0x47, 0x45, 0x54, 0x27, 0x20, - 0x69, 0x73, 0x20, 0x6e, 0x6f, 0x74, 0x20, 0x73, 0x75, 0x70, - 0x70, 0x6f, 0x72, 0x74, 0x65, 0x64, 0x2e, 0x22, 0x2c, 0x0a, - 0x20, 0x20, 0x22, 0x69, 0x6e, 0x73, 0x74, 0x61, 0x6e, 0x63, - 0x65, 0x22, 0x20, 0x3a, 0x20, 0x22, 0x2f, 0x63, 0x68, 0x65, - 0x6d, 0x69, 0x63, 0x61, 0x6c, 0x2f, 0x73, 0x79, 0x6e, 0x6f, - 0x6e, 0x79, 0x6d, 0x2f, 0x73, 0x65, 0x61, 0x72, 0x63, 0x68, - 0x2f, 0x62, 0x79, 0x2d, 0x64, 0x74, 0x78, 0x73, 0x69, 0x64, - 0x2f, 0x22, 0x0a, 0x7d)), date = structure(1726506692, class = c("POSIXct", - "POSIXt"), tzone = "GMT"), times = c(redirect = 0, namelookup = 4.6e-05, - connect = 0, pretransfer = 0.000139, starttransfer = 0.316072, - total = 0.316106)), class = "response") diff --git a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid/DTXSID7020182.json b/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid/DTXSID7020182.json deleted file mode 100644 index 36d58ae..0000000 --- a/tests/testthat/chemical-batch/chemical/synonym/search/by-dtxsid/DTXSID7020182.json +++ /dev/null @@ -1,269 +0,0 @@ -{ - "dtxsid": "DTXSID7020182", - "pcCode": null, - "other": [ - "1,1'-(1-Methylethylidene)bisphenylol, 9CI", - "(1-methylethylidene)bis-Phenol", - "201-245-8", - "201-245-8", - "2,2-(4,4-Dihydroxydiphenyl)propane", - "2,2-(4,4'-Dihydroxydiphenyl)propane", - "2,2-Bis(4,4'-hydroxyphenyl)propane", - "2,2-Bis-4'-hydroxyfenylpropan", - "2,2-Bis (4-hydroxyphenol) propane", - "2,2-bis(4-hydroxyphenyl)propane", - "2, 2-Bis(4-hydroxyphenyl)propane", - "2,2-Bis(4'-hydroxyphenyl)propane", - "2,2-Bis(4'-hydroxyphenyl) propane", - "2,2'-Bis(4-hydroxyphenyl)propane", - "2,2-Bis[4-Hydroxyphenyl]propane", - "2, 2-Bis(hydroxyphenyl)propane", - "2,2-Bis(hydroxyphenyl)propane", - "2,2-Bis(hydroxyphenyl)propane", - "2,2-Bis(hydroxyphenyl)propane", - "2,2-Bis(p-hydroxyphenyl)propane", - "2,2-Bis(p-hydroxyphenyl)-Propane", - "2,2-Di-(4'-Hydroxyphenyl)-propane", - "2, 2-Di(4-phenylol)propane", - "4-06-00-06717", - "4-[1-(4-Hydroxyphenyl)-1-methylethyl]phenol", - "4-[2-(4-hydroxyphenyl)propan-2-yl]phenol", - "4-[2-(4-hydroxyphenyl)propan-2-yl]phenol", - "4,4'-(1-Methylethane-1,1-diyl)diphenol", - "4,4'-(1-Methylethylidene)bisphenol", - "4,4'-(1-Methylethylidene)bis-Phenol", - "4,4'-(1-Methylethylidene)bisphenol, 9CI", - "4, 4'-Bisphenol A", - "4,4'-Dihydroxdiphenylpropane", - "4,4'-dihydroxy-2,2-diphenylpropane", - "4,4'-Dihydroxy-2,2-diphenylpropane", - "4, 4'-Dihydroxydiphenyl-2,2-propane", - "4,4'-Dihydroxydiphenyl-2,2-propane", - "4, 4'-Dihydroxydiphenyldimethylmethane", - "4,4'-Dihydroxydiphenyldimethylmethane", - "4, 4'-Dihydroxydiphenylpropane", - "4,4'-Dihydroxydiphenylpropane", - "4,4'-Dimethylmethylenediphenol", - "4,4'-Dimethylmethylenedi-Phenol", - "4,4'-Isopropylidenebisphenol", - "4,4'-Isopropylidenebis[phenol]", - "4,4-Isopropylidenediphenol", - "4,4-Isopropylidenediphenol", - "4,4'-Isopropylidenediphenol", - "4,4'-Isopropylidenediphenol", - "4,4'-Isopropylidene diphenol", - "4,4[-Isopropylidenediphenol", - "4,4'-Isopropylidenedi-Phenol", - "4,4'-ISOPROPYLIDENE-DIPHENOL", - "4,4'-Isopropylidenediphenol B", - "4_4'-isopropylidenedi-phenol (bisphenol a)", - "4,4'-ISOPROPYLIDENEDIPHENOL (BISPHENOL A)", - "4_4'-isopropylidenediphenol_ (bisphenol a) (sara 313)", - "4_4'-isopropylidenediphenol_ (bisphenol a) (sara iii)", - "4_4'-isopropylidenediphenol (sara 313)", - "4_4'-isopropylidenediphenol (sara iii)", - "4_4'-isopropylidenediphenol (sara iii)", - "4_4'-isopropylidenediphenol (sara iii)", - "4_4'-isopropylidenediphenol (sara iii)/bisphenol a", - "4_4'-isopropylidenediphenol (sara iii)/bisphenol-a", - "4,4' Isopropylidinediphenol", - "4,4'-(Propane-2,2-diyl)diphenol", - "4,4'-Propane-2,2-diyldiphenol", - "4,4'-PROPANE-2,2-DIYLDIPHENOL", - "4,4’-Propane-2,2-diyldiphenol (bisphenol A)", - "beta, beta'-Bis(p-hydroxyphenyl)propane", - "beta,beta'-Bis(p-hydroxyphenyl)propane", - "beta,beta-Di-(p-hydroxyphenyl)propane", - "beta-Di-(p-hydroxyphenyl)propane", - "beta-Di-p-hydroxyphenylpropane", - "beta-Di-p-hydroxyphenylpropane", - "Biphenol a", - "Biphenol A", - "Bis(4-hyd roxyphenyl) dimethylmethane", - "Bis(4-hydroxyphenyl) dimethylmethane", - "Bis(4-hydroxyphenyl)propane", - "Bis(4-hydroxyphenyl) propane", - "Bisfenol A", - "Bisferol a", - "Bisphenol", - "bisphenol-A", - "Bis-phenol A", - "Bisphenol A", - "Bisphenol A.", - "Bisphenol-A (.alpha.)", - "bisphenol a_ bisphenol", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-1*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-2*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-3*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-4*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-4*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *96-4*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *97-1*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *97-2*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *97-3*", - "bisphenol a_ bisphenol_ 2_2-bis-4'-hydroxylpropan *98-1*", - "Bisphenol A (BPA)", - "Bisphenol A (BPA) (creatinine adjusted)", - "bisphenol a resin", - "bisphenol a (sara 313)", - "bisphenol a (sara iii)", - "bisphenol-a (sara iii)", - "Bisphenol A, water, dissolved (ug/l)", - "BPA", - "BPA", - "BRN 1107700", - "Di-2,2-(4-Hydroxyphenyl)propane", - "Dian", - "Dian", - "Diano", - "Diano", - "Dimethyl bis(p-hydroxyphenyl)methane", - "Dimethylbis(p-hydroxyphenyl)methane", - "Dimethylmethylene-p,p'-diphenol", - "DIPHENYLOLPROPANE", - "EC No.: 201-245-8", - "EINECS 201-245-8", - "Hydrogenated bisphenol a", - "IISBACLAFKSPIT-UHFFFAOYSA-N", - "Ipognox 88", - "Isopropylidenediphenol", - "Millad hbpa", - "mixture of triisobutylene, diisobutylene (2,4,4-trimethylpentene) and 4,4'-(methylethylidene) bisphenol (bisphenol a)", - "NCGC00090952-07", - "NCGC00260537-01", - "NCI-C50635", - "Parabis A", - "Phenol, (1-methylethylidene)bis-", - "Phenol, (1-methylethylidene)bis-", - "phenol_ 4_4'-(1-methylethylidene) bis-", - "Phenol, 4,4'-(1-methylethylidene)bis-", - "Phenol, 4,4'-dimethylmethylenedi-", - "phenol_ 4_4'-isopropylenedi-_ (4_4'-isopropylidenediphenol) (bisphenol a) (sara iii)", - "phenol_ 4_4'-isopropylenedi-_ (bisphenol a resin) (sara 313)", - "phenol_ 4_4'-isopropylenedi-_ (bisphenol a) (sara 313)", - "Phenol, 4,4'-isopropylidenedi-", - "phenol_4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol)", - "phenol_ 4_4'-isopropylidenedi-_4_4'-isopropylidenediphenol_ (bisphenol a) (sara iii)", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'- isopropylidenediphenol (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'- isopropylidenediphenol) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidene diphenol) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara 313)", - "phenol_ 4_4'-isopropylidenedi)_ (4_4'-isopropylidenediphenol) (sara 313)", - "phenol_ 4_4'-isopropyl idenedi-_ (4_4'-isopropylidenediphenol) (sara 313). ld50 (oral_ rat): 3000 mg/kg.", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara 313). vp:0.", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara 313) vp: 0.00", - "phenol_ 4_4'-isopropylidenedi-_ (4_4'-isopropylidenediphenol) (sara iii)", - "phenol_4_4'-isopropylidenedi-_(4_4'-isopropylidenediphenol) (sara iii)", - "phenol_ 4_4'-isopropylidene di-_ (bisphenol a)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a)", - "phenol_4_4'-isopropylidenedi-_ (bisphenol a)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a (bpa)) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a). ld50 (oral):2000 mg/kg.", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a).ld50:(oral_rat) 2000 mg/kg", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a).ld50:(oral_rat) 2000 mg/kg.", - "phenol_4_4'-isopropylidenedi-_ (bisphenol a)_(mfr's invalid cas#: 80-5-7).", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a polycarbonate)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin (bpa))", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin (bpa) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin (bpa)) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin) (bpa) (sara 313). ld50:(oral_rat) >5 g/kg.", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin) (saraiii)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a resin) (saraiii)", - "phenol_ 4_4'-isopropylidenedi-_ ( bisphenol a) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol-a) (sara 313)", - "phenol_4_4'-isopropylidenedi-_ (bisphenol a) (sara 313)", - "phenol_4_4'-isopropylidenedi-_ (bisphenol a) (sara 313))", - "phenol_4.4'-isopropylidenedi-_ (bisphenol a) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313) ld50: (oral) 3250 mg/kg", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313) ld50 (oral_ rat):4.2 g/kg", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara 313) % wt: <100 ppm", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara iii)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara iii)", - "phenol_4_4'-isopropylidenedi_(bisphenol-a) (sara iii)", - "phenol_4_4'-isopropylidenedi-_(bisphenol-a) (sara iii)", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a) (sara iii).ld50:(oral) 3250 mg/kg.", - "phenol_ 4_4'-isopropylidenedi-_ (bisphenol a). vp: 0.01 @ 20c. ld50 (oral_rat): 1999.9 mg/kg.", - "phenol_4_4'-isopropylidenedi-_ (bisphenol a). vp: 0.01 @20c. ld50: oral(rat)2000 mg/kg.", - "phenol_ 4_4'-isopropylidenedi-_(p_p'-isopropylidenediphenol) (sara 313)", - "phenol_ 4_4'-isopropylidenedi-_ (sara iii)(4_4'-isopropylidenediphenol) (bisphenol-a)", - "phenol_ 4_4'-isopropylideneol-_ (bisphenol a) (sara 313)", - "phenol_ 4_4_-isopropylidenidi-_ (4_4'-isopropylidenediphenol) (bisphenol a) (sara iii)", - "phenol_ 4_4'-isopropylidinedi-_ (bisphenol a resin) (sara iii)", - "Pluracol 245", - "P, p'-Dihydroxydiphenyldimethylmethane", - "P,p'-Dihydroxydiphenyldimethylmethane", - "P, p'-Dihydroxydiphenylpropane", - "p,p'-Isopropylidenebisphenol", - "p,p'-Isopropylidenediphenol", - "P, p'-Isopropylidenediphenol", - "Propane, 2,2-bis(p-hydroxyphenyl)-", - "Rikabanol", - "total bisphenol a", - "Tox21_202992", - "Tox21_400088", - "Ucar bisphenol a", - "Ucar bisphenol HP", - "UNII-MLT3645I99" - ], - "beilstein": null, - "alternateCasrn": null, - "valid": [ - "4,4’-Propane-2,2-diyldiphenol", - "80-05-7", - "Bisphenol A", - "Phenol, 4,4'-(1-methylethylidene)bis-" - ], - "good": [ - "2,2-Bis(4-hydroxyphenyl)propane", - "2,2-Bis(4'-hydroxyphenyl) propane", - "2,2'-Bis(4-hydroxyphenyl)propane", - "2,2-BIS-(4-HYDROXY-PHENYL)-PROPANE", - "2,2-Bis(p-hydroxyphenyl)propane", - "2,2-Di(4-Hydroxyphenyl) Propane", - "2,2-DI(4-HYDROXYPHENYL)PROPANE", - "2,2-Di(4-phenylol)propane", - "4,4'-(1-Methylethylidene)bisphenol", - "4,4'-Bisphenol A", - "(4,4'-Dihydroxydiphenyl)dimethylmethane", - "4,4'-DIHYDROXYPHENYL-2,2-PROPANE", - "4,4'-isopropilidendifenol", - "4,4'-Isopropylidendiphenol", - "4,4'-Isopropylidene bisphenol", - "4,4'-Isopropylidenebis[phenol]", - "4,4'-isopropylidenediphenol", - "4,4-ISOPROPYLIDENE DIPHENYL", - "4,4'-Methylethylidenebisphenol", - "Bis(4-hydroxyphenyl)dimethylmethane", - "BIS[PHENOL], 4,4'-(1-METHYLETHYLIDENE)-", - "BISPHENOL, 4,4'-(1-METHYLETHYLIDENE)-", - "Bisphenol-A", - "Bis(p-hydroxyphenyl)propane", - "Diphenol methylethylidene", - "Diphenylolpropane", - "Hidorin F 285", - "Isopropylidenebis(4-hydroxybenzene)", - "NSC 1767", - "NSC 17959", - "Parabis", - "Parabis A", - "Phenol, 4,4'-isopropylidenedi-", - "Pluracol 245", - "p,p'-Bisphenol A", - "p,p'-Dihydroxydiphenylpropane", - "p,p'-Isopropylidenebisphenol", - "p,p'-Isopropylidenediphenol", - "P,P'-ISOPROPYLIDENE DIPHENOL", - "Rikabanol", - "β,β'-Bis(p-hydroxyphenyl)propane" - ], - "deletedCasrn": [ - "137885-53-1", - "1429425-26-2", - "146479-75-6", - "27360-89-0", - "28106-82-3", - "37808-08-5" - ] -}