diff --git a/.github/actions/spelling/excludes.txt b/.github/actions/spelling/excludes.txt
index 5da4245ffb8..337ce983103 100644
--- a/.github/actions/spelling/excludes.txt
+++ b/.github/actions/spelling/excludes.txt
@@ -105,6 +105,7 @@
 ^doc/reference/windows-terminal-logo\.ans$
 ^oss/
 ^samples/PixelShaders/Screenshots/
+^src/cascadia/TerminalSettingsEditor/SegoeFluentIconList.h$
 ^src/interactivity/onecore/BgfxEngine\.
 ^src/renderer/atlas/
 ^src/renderer/wddmcon/WddmConRenderer\.
diff --git a/src/cascadia/TerminalSettingsEditor/Appearances.cpp b/src/cascadia/TerminalSettingsEditor/Appearances.cpp
index 4e6bc3b74fc..bf85a5db29d 100644
--- a/src/cascadia/TerminalSettingsEditor/Appearances.cpp
+++ b/src/cascadia/TerminalSettingsEditor/Appearances.cpp
@@ -221,6 +221,30 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
                 // box, prevent it from ever being changed again.
                 _NotifyChanges(L"UseDesktopBGImage", L"BackgroundImageSettingsVisible");
             }
+            else if (viewModelProperty == L"Foreground")
+            {
+                _NotifyChanges(L"ForegroundPreview");
+            }
+            else if (viewModelProperty == L"Background")
+            {
+                _NotifyChanges(L"BackgroundPreview");
+            }
+            else if (viewModelProperty == L"SelectionBackground")
+            {
+                _NotifyChanges(L"SelectionBackgroundPreview");
+            }
+            else if (viewModelProperty == L"CursorColor")
+            {
+                _NotifyChanges(L"CursorColorPreview");
+            }
+            else if (viewModelProperty == L"DarkColorSchemeName" || viewModelProperty == L"LightColorSchemeName")
+            {
+                _NotifyChanges(L"CurrentColorScheme");
+            }
+            else if (viewModelProperty == L"CurrentColorScheme")
+            {
+                _NotifyChanges(L"ForegroundPreview", L"BackgroundPreview", L"SelectionBackgroundPreview", L"CursorColorPreview");
+            }
         });
 
         // Cache the original BG image path. If the user clicks "Use desktop
@@ -928,7 +952,7 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         _NotifyChanges(L"CurrentColorScheme");
     }
 
-    Editor::ColorSchemeViewModel AppearanceViewModel::CurrentColorScheme()
+    Editor::ColorSchemeViewModel AppearanceViewModel::CurrentColorScheme() const
     {
         const auto schemeName{ DarkColorSchemeName() };
         const auto allSchemes{ SchemesList() };
@@ -950,6 +974,42 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         LightColorSchemeName(val.Name());
     }
 
+    static inline Windows::UI::Color _getColorPreview(const IReference<Microsoft::Terminal::Core::Color>& modelVal, Windows::UI::Color deducedVal)
+    {
+        if (modelVal)
+        {
+            // user defined an override value
+            return Windows::UI::Color{
+                .A = 255,
+                .R = modelVal.Value().R,
+                .G = modelVal.Value().G,
+                .B = modelVal.Value().B
+            };
+        }
+        // set to null --> deduce value from color scheme
+        return deducedVal;
+    }
+
+    Windows::UI::Color AppearanceViewModel::ForegroundPreview() const
+    {
+        return _getColorPreview(_appearance.Foreground(), CurrentColorScheme().ForegroundColor().Color());
+    }
+
+    Windows::UI::Color AppearanceViewModel::BackgroundPreview() const
+    {
+        return _getColorPreview(_appearance.Background(), CurrentColorScheme().BackgroundColor().Color());
+    }
+
+    Windows::UI::Color AppearanceViewModel::SelectionBackgroundPreview() const
+    {
+        return _getColorPreview(_appearance.SelectionBackground(), CurrentColorScheme().SelectionBackgroundColor().Color());
+    }
+
+    Windows::UI::Color AppearanceViewModel::CursorColorPreview() const
+    {
+        return _getColorPreview(_appearance.CursorColor(), CurrentColorScheme().CursorColor().Color());
+    }
+
     DependencyProperty Appearances::_AppearanceProperty{ nullptr };
 
     Appearances::Appearances()
diff --git a/src/cascadia/TerminalSettingsEditor/Appearances.h b/src/cascadia/TerminalSettingsEditor/Appearances.h
index aba3abd45ff..c31c1269cf1 100644
--- a/src/cascadia/TerminalSettingsEditor/Appearances.h
+++ b/src/cascadia/TerminalSettingsEditor/Appearances.h
@@ -127,9 +127,14 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         void SetBackgroundImagePath(winrt::hstring path);
 
         void ClearColorScheme();
-        Editor::ColorSchemeViewModel CurrentColorScheme();
+        Editor::ColorSchemeViewModel CurrentColorScheme() const;
         void CurrentColorScheme(const Editor::ColorSchemeViewModel& val);
 
+        Windows::UI::Color ForegroundPreview() const;
+        Windows::UI::Color BackgroundPreview() const;
+        Windows::UI::Color SelectionBackgroundPreview() const;
+        Windows::UI::Color CursorColorPreview() const;
+
         WINRT_PROPERTY(bool, IsDefault, false);
 
         // These settings are not defined in AppearanceConfig, so we grab them
@@ -153,6 +158,10 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         OBSERVABLE_PROJECTED_SETTING(_appearance, BackgroundImageAlignment);
         OBSERVABLE_PROJECTED_SETTING(_appearance, IntenseTextStyle);
         OBSERVABLE_PROJECTED_SETTING(_appearance, AdjustIndistinguishableColors);
+        OBSERVABLE_PROJECTED_SETTING(_appearance, Foreground);
+        OBSERVABLE_PROJECTED_SETTING(_appearance, Background);
+        OBSERVABLE_PROJECTED_SETTING(_appearance, SelectionBackground);
+        OBSERVABLE_PROJECTED_SETTING(_appearance, CursorColor);
         WINRT_OBSERVABLE_PROPERTY(Windows::Foundation::Collections::IObservableVector<Editor::ColorSchemeViewModel>, SchemesList, _propertyChangedHandlers, nullptr);
 
     private:
diff --git a/src/cascadia/TerminalSettingsEditor/Appearances.idl b/src/cascadia/TerminalSettingsEditor/Appearances.idl
index 5a22a190d2d..68cbd4ee76b 100644
--- a/src/cascadia/TerminalSettingsEditor/Appearances.idl
+++ b/src/cascadia/TerminalSettingsEditor/Appearances.idl
@@ -45,6 +45,11 @@ namespace Microsoft.Terminal.Settings.Editor
         ColorSchemeViewModel CurrentColorScheme;
         IObservableVector<ColorSchemeViewModel> SchemesList;
 
+        Windows.UI.Color ForegroundPreview { get; };
+        Windows.UI.Color BackgroundPreview { get; };
+        Windows.UI.Color SelectionBackgroundPreview { get; };
+        Windows.UI.Color CursorColorPreview { get; };
+
         String MissingFontFaces { get; };
         String ProportionalFontFaces { get; };
         Boolean HasPowerlineCharacters { get; };
@@ -78,6 +83,11 @@ namespace Microsoft.Terminal.Settings.Editor
         OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Microsoft.Terminal.Settings.Model.ConvergedAlignment, BackgroundImageAlignment);
         OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Microsoft.Terminal.Settings.Model.IntenseStyle, IntenseTextStyle);
         OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Microsoft.Terminal.Core.AdjustTextMode, AdjustIndistinguishableColors);
+
+        OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, Foreground);
+        OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, Background);
+        OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, SelectionBackground);
+        OBSERVABLE_PROJECTED_APPEARANCE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, CursorColor);
     }
 
     [default_interface] runtimeclass Appearances : Windows.UI.Xaml.Controls.UserControl, Windows.UI.Xaml.Data.INotifyPropertyChanged
diff --git a/src/cascadia/TerminalSettingsEditor/Appearances.xaml b/src/cascadia/TerminalSettingsEditor/Appearances.xaml
index 0ed87caa624..9789ac91450 100644
--- a/src/cascadia/TerminalSettingsEditor/Appearances.xaml
+++ b/src/cascadia/TerminalSettingsEditor/Appearances.xaml
@@ -69,138 +69,188 @@
             <!--  Grouping: Text  -->
             <TextBlock x:Uid="Profile_TextHeader"
                        Style="{StaticResource TextBlockSubHeaderStyle}" />
-
             <!--  Color Scheme  -->
             <!--  This currently only display the Dark color scheme, even if the user has a pair of schemes set.  -->
             <local:SettingContainer x:Uid="Profile_ColorScheme"
                                     ClearSettingValue="{x:Bind Appearance.ClearColorScheme}"
                                     HasSettingValue="{x:Bind Appearance.HasDarkColorSchemeName, Mode=OneWay}"
-                                    SettingOverrideSource="{x:Bind Appearance.DarkColorSchemeNameOverrideSource, Mode=OneWay}">
-                <ComboBox Padding="4"
-                          ItemsSource="{x:Bind Appearance.SchemesList, Mode=OneWay}"
-                          SelectedItem="{x:Bind Appearance.CurrentColorScheme, Mode=TwoWay}"
-                          Style="{StaticResource ComboBoxSettingStyle}">
-                    <ComboBox.ItemTemplate>
-                        <DataTemplate x:DataType="local:ColorSchemeViewModel">
-                            <Grid Grid.Column="0"
-                                  Padding="8"
-                                  VerticalAlignment="Center"
-                                  Background="{x:Bind mtu:Converters.ColorToBrush(BackgroundColor.Color), Mode=OneWay}"
-                                  ColumnSpacing="1"
-                                  CornerRadius="2"
-                                  RowSpacing="1">
-                                <Grid.ColumnDefinitions>
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                    <ColumnDefinition Width="Auto" />
-                                </Grid.ColumnDefinitions>
-                                <Grid.RowDefinitions>
-                                    <RowDefinition Height="Auto" />
-                                    <RowDefinition Height="Auto" />
-                                </Grid.RowDefinitions>
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="0"
-                                                Content="{x:Bind ColorEntryAt(0), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="1"
-                                                Content="{x:Bind ColorEntryAt(1), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="2"
-                                                Content="{x:Bind ColorEntryAt(2), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="3"
-                                                Content="{x:Bind ColorEntryAt(3), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="4"
-                                                Content="{x:Bind ColorEntryAt(4), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="5"
-                                                Content="{x:Bind ColorEntryAt(5), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="6"
-                                                Content="{x:Bind ColorEntryAt(6), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="0"
-                                                Grid.Column="7"
-                                                Content="{x:Bind ColorEntryAt(7), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="0"
-                                                Content="{x:Bind ColorEntryAt(8), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="1"
-                                                Content="{x:Bind ColorEntryAt(9), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="2"
-                                                Content="{x:Bind ColorEntryAt(10), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="3"
-                                                Content="{x:Bind ColorEntryAt(11), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="4"
-                                                Content="{x:Bind ColorEntryAt(12), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="5"
-                                                Content="{x:Bind ColorEntryAt(13), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="6"
-                                                Content="{x:Bind ColorEntryAt(14), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <ContentControl Grid.Row="1"
-                                                Grid.Column="7"
-                                                Content="{x:Bind ColorEntryAt(15), Mode=OneWay}"
-                                                ContentTemplate="{StaticResource ColorChipTemplate}"
-                                                IsTabStop="False" />
-                                <TextBlock Grid.RowSpan="2"
-                                           Grid.Column="8"
-                                           MaxWidth="192"
-                                           Margin="4,0,4,0"
-                                           HorizontalAlignment="Center"
-                                           VerticalAlignment="Center"
-                                           AutomationProperties.AccessibilityView="Raw"
-                                           FontFamily="Cascadia Code"
-                                           Foreground="{x:Bind mtu:Converters.ColorToBrush(ForegroundColor.Color), Mode=OneWay}"
-                                           Text="{x:Bind Name, Mode=OneWay}"
-                                           TextTrimming="WordEllipsis" />
-                            </Grid>
-                        </DataTemplate>
-                    </ComboBox.ItemTemplate>
-                </ComboBox>
+                                    SettingOverrideSource="{x:Bind Appearance.DarkColorSchemeNameOverrideSource, Mode=OneWay}"
+                                    Style="{StaticResource ExpanderSettingContainerStyleWithComplexPreview}">
+                <local:SettingContainer.CurrentValue>
+                    <ComboBox Padding="4"
+                              ItemsSource="{x:Bind Appearance.SchemesList, Mode=OneWay}"
+                              SelectedItem="{x:Bind Appearance.CurrentColorScheme, Mode=TwoWay}"
+                              Style="{StaticResource ComboBoxSettingStyle}">
+                        <ComboBox.ItemTemplate>
+                            <DataTemplate x:DataType="local:ColorSchemeViewModel">
+                                <Grid Grid.Column="0"
+                                      Padding="8"
+                                      VerticalAlignment="Center"
+                                      Background="{x:Bind mtu:Converters.ColorToBrush(BackgroundColor.Color), Mode=OneWay}"
+                                      ColumnSpacing="1"
+                                      CornerRadius="2"
+                                      RowSpacing="1">
+                                    <Grid.ColumnDefinitions>
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                        <ColumnDefinition Width="Auto" />
+                                    </Grid.ColumnDefinitions>
+                                    <Grid.RowDefinitions>
+                                        <RowDefinition Height="Auto" />
+                                        <RowDefinition Height="Auto" />
+                                    </Grid.RowDefinitions>
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="0"
+                                                    Content="{x:Bind ColorEntryAt(0), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="1"
+                                                    Content="{x:Bind ColorEntryAt(1), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="2"
+                                                    Content="{x:Bind ColorEntryAt(2), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="3"
+                                                    Content="{x:Bind ColorEntryAt(3), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="4"
+                                                    Content="{x:Bind ColorEntryAt(4), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="5"
+                                                    Content="{x:Bind ColorEntryAt(5), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="6"
+                                                    Content="{x:Bind ColorEntryAt(6), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="0"
+                                                    Grid.Column="7"
+                                                    Content="{x:Bind ColorEntryAt(7), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="0"
+                                                    Content="{x:Bind ColorEntryAt(8), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="1"
+                                                    Content="{x:Bind ColorEntryAt(9), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="2"
+                                                    Content="{x:Bind ColorEntryAt(10), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="3"
+                                                    Content="{x:Bind ColorEntryAt(11), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="4"
+                                                    Content="{x:Bind ColorEntryAt(12), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="5"
+                                                    Content="{x:Bind ColorEntryAt(13), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="6"
+                                                    Content="{x:Bind ColorEntryAt(14), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <ContentControl Grid.Row="1"
+                                                    Grid.Column="7"
+                                                    Content="{x:Bind ColorEntryAt(15), Mode=OneWay}"
+                                                    ContentTemplate="{StaticResource ColorChipTemplate}"
+                                                    IsTabStop="False" />
+                                    <TextBlock Grid.RowSpan="2"
+                                               Grid.Column="8"
+                                               MaxWidth="192"
+                                               Margin="4,0,4,0"
+                                               HorizontalAlignment="Center"
+                                               VerticalAlignment="Center"
+                                               AutomationProperties.AccessibilityView="Raw"
+                                               FontFamily="Cascadia Code"
+                                               Foreground="{x:Bind mtu:Converters.ColorToBrush(ForegroundColor.Color), Mode=OneWay}"
+                                               Text="{x:Bind Name, Mode=OneWay}"
+                                               TextTrimming="WordEllipsis" />
+                                </Grid>
+                            </DataTemplate>
+                        </ComboBox.ItemTemplate>
+                    </ComboBox>
+                </local:SettingContainer.CurrentValue>
+                <local:SettingContainer.Content>
+                    <StackPanel>
+
+                        <!--  Foreground Color  -->
+                        <local:SettingContainer x:Name="Foreground"
+                                                x:Uid="Profile_Foreground"
+                                                ClearSettingValue="{x:Bind Appearance.ClearForeground}"
+                                                CurrentValue="{x:Bind Appearance.ForegroundPreview, Mode=OneWay}"
+                                                CurrentValueTemplate="{StaticResource ColorPreviewTemplate}"
+                                                HasSettingValue="{x:Bind Appearance.HasForeground, Mode=OneWay}"
+                                                SettingOverrideSource="{x:Bind Appearance.ForegroundOverrideSource, Mode=OneWay}"
+                                                Style="{StaticResource ExpanderSettingContainerStyleWithComplexPreview}">
+                            <local:NullableColorPicker x:Uid="Profile_Foreground_NullableColorPicker"
+                                                       ColorSchemeVM="{x:Bind Appearance.CurrentColorScheme, Mode=OneWay}"
+                                                       CurrentColor="{x:Bind Appearance.Foreground, Mode=TwoWay}"
+                                                       NullColorPreview="{x:Bind Appearance.CurrentColorScheme.ForegroundColor.Color, Mode=OneWay}" />
+                        </local:SettingContainer>
+
+                        <!--  Background Color  -->
+                        <local:SettingContainer x:Name="Background"
+                                                x:Uid="Profile_Background"
+                                                ClearSettingValue="{x:Bind Appearance.ClearBackground}"
+                                                CurrentValue="{x:Bind Appearance.BackgroundPreview, Mode=OneWay}"
+                                                CurrentValueTemplate="{StaticResource ColorPreviewTemplate}"
+                                                HasSettingValue="{x:Bind Appearance.HasBackground, Mode=OneWay}"
+                                                SettingOverrideSource="{x:Bind Appearance.BackgroundOverrideSource, Mode=OneWay}"
+                                                Style="{StaticResource ExpanderSettingContainerStyleWithComplexPreview}">
+                            <local:NullableColorPicker x:Uid="Profile_Background_NullableColorPicker"
+                                                       ColorSchemeVM="{x:Bind Appearance.CurrentColorScheme, Mode=OneWay}"
+                                                       CurrentColor="{x:Bind Appearance.Background, Mode=TwoWay}"
+                                                       NullColorPreview="{x:Bind Appearance.CurrentColorScheme.BackgroundColor.Color, Mode=OneWay}" />
+                        </local:SettingContainer>
+
+                        <!--  Selection Background Color  -->
+                        <local:SettingContainer x:Name="SelectionBackground"
+                                                x:Uid="Profile_SelectionBackground"
+                                                ClearSettingValue="{x:Bind Appearance.ClearSelectionBackground}"
+                                                CurrentValue="{x:Bind Appearance.SelectionBackgroundPreview, Mode=OneWay}"
+                                                CurrentValueTemplate="{StaticResource ColorPreviewTemplate}"
+                                                HasSettingValue="{x:Bind Appearance.HasSelectionBackground, Mode=OneWay}"
+                                                SettingOverrideSource="{x:Bind Appearance.SelectionBackgroundOverrideSource, Mode=OneWay}"
+                                                Style="{StaticResource ExpanderSettingContainerStyleWithComplexPreview}">
+                            <local:NullableColorPicker x:Uid="Profile_SelectionBackground_NullableColorPicker"
+                                                       ColorSchemeVM="{x:Bind Appearance.CurrentColorScheme, Mode=OneWay}"
+                                                       CurrentColor="{x:Bind Appearance.SelectionBackground, Mode=TwoWay}"
+                                                       NullColorPreview="{x:Bind Appearance.CurrentColorScheme.SelectionBackgroundColor.Color, Mode=OneWay}" />
+                        </local:SettingContainer>
+                    </StackPanel>
+                </local:SettingContainer.Content>
             </local:SettingContainer>
-
             <!--  Font Face  -->
             <local:SettingContainer x:Name="FontFaceContainer"
                                     x:Uid="Profile_FontFace"
@@ -452,6 +502,21 @@
                                Text="{Binding ElementName=CursorHeightSlider, Path=Value, Mode=OneWay}" />
                 </Grid>
             </local:SettingContainer>
+
+            <!--  Cursor Color  -->
+            <local:SettingContainer x:Name="CursorColor"
+                                    x:Uid="Profile_CursorColor"
+                                    ClearSettingValue="{x:Bind Appearance.ClearCursorColor}"
+                                    CurrentValue="{x:Bind Appearance.CursorColorPreview, Mode=OneWay}"
+                                    CurrentValueTemplate="{StaticResource ColorPreviewTemplate}"
+                                    HasSettingValue="{x:Bind Appearance.HasCursorColor, Mode=OneWay}"
+                                    SettingOverrideSource="{x:Bind Appearance.CursorColorOverrideSource, Mode=OneWay}"
+                                    Style="{StaticResource ExpanderSettingContainerStyleWithComplexPreview}">
+                <local:NullableColorPicker x:Uid="Profile_CursorColor_NullableColorPicker"
+                                           ColorSchemeVM="{x:Bind Appearance.CurrentColorScheme, Mode=OneWay}"
+                                           CurrentColor="{x:Bind Appearance.CursorColor, Mode=TwoWay}"
+                                           NullColorPreview="{x:Bind Appearance.CurrentColorScheme.CursorColor.Color, Mode=OneWay}" />
+            </local:SettingContainer>
         </StackPanel>
 
         <!--  Grouping: Background  -->
diff --git a/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.h b/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.h
index 12b26c160bf..45d3983f9ab 100644
--- a/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.h
+++ b/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.h
@@ -69,6 +69,11 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
             return hstring{ fmt::format(FMT_COMPILE(L"{} RGB({}, {}, {})"), _Name, _Color.R, _Color.G, _Color.B) };
         }
 
+        hstring NameWithHexCode() const
+        {
+            return hstring{ fmt::format(FMT_COMPILE(L"{} #{:02X}{:02X}{:02X}"), _Name, _Color.R, _Color.G, _Color.B) };
+        }
+
         til::property_changed_event PropertyChanged;
         WINRT_OBSERVABLE_PROPERTY(Windows::UI::Color, Color, PropertyChanged.raise);
         WINRT_OBSERVABLE_PROPERTY(winrt::hstring, Name, PropertyChanged.raise);
diff --git a/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.idl b/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.idl
index bf36ef4146b..9ad129b2285 100644
--- a/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.idl
+++ b/src/cascadia/TerminalSettingsEditor/ColorSchemeViewModel.idl
@@ -36,5 +36,6 @@ namespace Microsoft.Terminal.Settings.Editor
         IInspectable Tag;
         Windows.UI.Color Color;
         String AccessibleName { get; };
+        String NameWithHexCode { get; };
     }
 }
diff --git a/src/cascadia/TerminalSettingsEditor/CommonResources.xaml b/src/cascadia/TerminalSettingsEditor/CommonResources.xaml
index 7f2f3446bf2..8bff86deec1 100644
--- a/src/cascadia/TerminalSettingsEditor/CommonResources.xaml
+++ b/src/cascadia/TerminalSettingsEditor/CommonResources.xaml
@@ -4,6 +4,8 @@
 -->
 <ResourceDictionary xmlns="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
                     xmlns:x="http://schemas.microsoft.com/winfx/2006/xaml"
+                    xmlns:local="using:Microsoft.Terminal.Settings.Editor"
+                    xmlns:mtu="using:Microsoft.Terminal.UI"
                     xmlns:muxc="using:Microsoft.UI.Xaml.Controls">
 
     <!--  Merge SettingContainerStyle here to give every page access to the SettingContainer  -->
@@ -60,6 +62,9 @@
         </ResourceDictionary>
     </ResourceDictionary.ThemeDictionaries>
 
+    <local:ColorToBrushConverter x:Key="ColorToBrushConverter" />
+    <local:ColorToStringConverter x:Key="ColorToStringConverter" />
+
     <Color x:Key="DeleteButtonColor">Firebrick</Color>
 
     <x:Double x:Key="StandardIconSize">14.0</x:Double>
@@ -68,6 +73,32 @@
     <x:Double x:Key="StandardBoxMinWidth">250</x:Double>
     <x:Double x:Key="StandardControlMaxWidth">1000</x:Double>
 
+    <!-- We're purposefully not providing a DataType here.
+     This is expected to be used with an IReference<Microsoft::Terminal::Core::Color>.
+     We're doing all the data type handling in the used converters.-->
+    <DataTemplate x:Key="ColorPreviewTemplate">
+        <Grid ColumnSpacing="5">
+            <Grid.ColumnDefinitions>
+                <ColumnDefinition Width="auto" />
+                <ColumnDefinition Width="*" />
+            </Grid.ColumnDefinitions>
+            <Rectangle Grid.Column="0"
+                       Width="13"
+                       Height="13"
+                       VerticalAlignment="Center"
+                       Fill="{Binding Converter={StaticResource ColorToBrushConverter}}"
+                       RadiusX="2"
+                       RadiusY="2" />
+            <TextBlock Grid.Column="1"
+                       Margin="0,0,0,0"
+                       HorizontalAlignment="Right"
+                       VerticalAlignment="Center"
+                       FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
+                       Style="{StaticResource SettingsPageItemDescriptionStyle}"
+                       Text="{Binding Converter={StaticResource ColorToStringConverter}}" />
+        </Grid>
+    </DataTemplate>
+
     <!--
         This is for styling the entire items control used on the
         color schemes page
@@ -376,6 +407,91 @@
         </Setter>
     </Style>
 
+    <Style x:Key="ColorToggleButtonStyle"
+           TargetType="ToggleButton">
+        <Setter Property="BackgroundSizing" Value="OuterBorderEdge" />
+        <Setter Property="BorderBrush" Value="{ThemeResource ToggleButtonBorderThemeBrush}" />
+        <Setter Property="BorderThickness" Value="{ThemeResource ToggleButtonBorderThemeThickness}" />
+        <Setter Property="CornerRadius" Value="{ThemeResource ControlCornerRadius}" />
+        <Setter Property="UseSystemFocusVisuals" Value="{StaticResource UseSystemFocusVisuals}" />
+        <Setter Property="FocusVisualMargin" Value="-3" />
+        <Setter Property="Width" Value="32" />
+        <Setter Property="Height" Value="32" />
+        <Setter Property="Template">
+            <Setter.Value>
+                <ControlTemplate TargetType="ToggleButton">
+                    <Grid>
+                        <Border x:Name="ColorButtonBorder"
+                                BorderBrush="{TemplateBinding Background}"
+                                BorderThickness="{TemplateBinding BorderThickness}"
+                                CornerRadius="{TemplateBinding CornerRadius}">
+                            <Grid>
+                                <Border x:Name="ColorButtonBackground"
+                                        Background="{TemplateBinding Background}"
+                                        BorderThickness="0" />
+                                <!--  We have to use Binding here! We're trying to do a template binding with a converter, so we have to use the verbose syntax.  -->
+                                <FontIcon Margin="0,0,-1,-1"
+                                          HorizontalAlignment="Right"
+                                          VerticalAlignment="Bottom"
+                                          FontFamily="Segoe Fluent Icons"
+                                          FontSize="12"
+                                          Foreground="{TemplateBinding BorderBrush}"
+                                          Glyph="&#xE73D;"
+                                          Visibility="{Binding RelativeSource={RelativeSource TemplatedParent}, Path=IsChecked, Mode=OneWay}" />
+                            </Grid>
+                        </Border>
+                        <VisualStateManager.VisualStateGroups>
+                            <VisualStateGroup x:Name="CommonStates">
+                                <VisualState x:Name="Normal" />
+                                <VisualState x:Name="Disabled" />
+
+                                <VisualState x:Name="PointerOver">
+                                    <Storyboard>
+                                        <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ColorButtonBackground"
+                                                                       Storyboard.TargetProperty="Opacity">
+                                            <DiscreteObjectKeyFrame KeyTime="0"
+                                                                    Value="0.7" />
+                                        </ObjectAnimationUsingKeyFrames>
+                                        <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ColorButtonBorder"
+                                                                       Storyboard.TargetProperty="BorderBrush">
+                                            <DiscreteObjectKeyFrame KeyTime="0"
+                                                                    Value="{Binding Path=BorderBrush, RelativeSource={RelativeSource TemplatedParent}}" />
+                                        </ObjectAnimationUsingKeyFrames>
+                                    </Storyboard>
+                                </VisualState>
+
+                                <VisualState x:Name="Pressed">
+                                    <Storyboard>
+                                        <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ColorButtonBackground"
+                                                                       Storyboard.TargetProperty="Opacity">
+                                            <DiscreteObjectKeyFrame KeyTime="0"
+                                                                    Value="0.5" />
+                                        </ObjectAnimationUsingKeyFrames>
+                                        <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ColorButtonBorder"
+                                                                       Storyboard.TargetProperty="BorderBrush">
+                                            <DiscreteObjectKeyFrame KeyTime="0"
+                                                                    Value="{Binding Path=BorderBrush, RelativeSource={RelativeSource TemplatedParent}}" />
+                                        </ObjectAnimationUsingKeyFrames>
+                                    </Storyboard>
+                                </VisualState>
+
+                                <VisualState x:Name="Checked">
+                                    <Storyboard>
+                                        <ObjectAnimationUsingKeyFrames Storyboard.TargetName="ColorButtonBorder"
+                                                                       Storyboard.TargetProperty="BorderBrush">
+                                            <DiscreteObjectKeyFrame KeyTime="0"
+                                                                    Value="{Binding Path=BorderBrush, RelativeSource={RelativeSource TemplatedParent}}" />
+                                        </ObjectAnimationUsingKeyFrames>
+                                    </Storyboard>
+                                </VisualState>
+                            </VisualStateGroup>
+                        </VisualStateManager.VisualStateGroups>
+                    </Grid>
+                </ControlTemplate>
+            </Setter.Value>
+        </Setter>
+    </Style>
+
     <!--  Slider-Related Styling  -->
     <Style x:Key="SliderValueLabelStyle"
            TargetType="TextBlock">
diff --git a/src/cascadia/TerminalSettingsEditor/MainPage.cpp b/src/cascadia/TerminalSettingsEditor/MainPage.cpp
index 696579ae950..62d7614cd62 100644
--- a/src/cascadia/TerminalSettingsEditor/MainPage.cpp
+++ b/src/cascadia/TerminalSettingsEditor/MainPage.cpp
@@ -634,9 +634,9 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
             if (auto menuItem{ weakMenuItem.get() })
             {
                 const auto& tag{ menuItem.Tag().as<Editor::ProfileViewModel>() };
-                if (args.PropertyName() == L"Icon")
+                if (args.PropertyName() == L"Icon" || args.PropertyName() == L"EvaluatedIcon")
                 {
-                    menuItem.Icon(UI::IconPathConverter::IconWUX(tag.Icon()));
+                    menuItem.Icon(UI::IconPathConverter::IconWUX(tag.EvaluatedIcon()));
                 }
                 else if (args.PropertyName() == L"Name")
                 {
diff --git a/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj b/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj
index 7d2aed1b744..e02809041b9 100644
--- a/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj
+++ b/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj
@@ -57,6 +57,10 @@
       <DependentUpon>ColorSchemes.xaml</DependentUpon>
       <SubType>Code</SubType>
     </ClInclude>
+    <ClInclude Include="NullableColorPicker.h">
+      <DependentUpon>NullableColorPicker.xaml</DependentUpon>
+      <SubType>Code</SubType>
+    </ClInclude>
     <ClInclude Include="EditColorScheme.h">
       <DependentUpon>EditColorScheme.xaml</DependentUpon>
       <SubType>Code</SubType>
@@ -85,6 +89,11 @@
       <DependentUpon>ActionsViewModel.idl</DependentUpon>
       <SubType>Code</SubType>
     </ClInclude>
+    <ClInclude Include="SegoeFluentIconList.h" />
+    <ClInclude Include="TerminalColorConverters.h">
+      <DependentUpon>TerminalColorConverters.idl</DependentUpon>
+      <SubType>Code</SubType>
+    </ClInclude>
     <ClInclude Include="ColorSchemeViewModel.h">
       <DependentUpon>ColorSchemeViewModel.idl</DependentUpon>
       <SubType>Code</SubType>
@@ -155,6 +164,9 @@
     <Page Include="ColorSchemes.xaml">
       <SubType>Designer</SubType>
     </Page>
+    <Page Include="NullableColorPicker.xaml">
+      <SubType>Designer</SubType>
+    </Page>
     <Page Include="EditColorScheme.xaml">
       <SubType>Designer</SubType>
     </Page>
@@ -210,6 +222,10 @@
       <DependentUpon>ColorSchemes.xaml</DependentUpon>
       <SubType>Code</SubType>
     </ClCompile>
+    <ClCompile Include="NullableColorPicker.cpp">
+      <DependentUpon>NullableColorPicker.xaml</DependentUpon>
+      <SubType>Code</SubType>
+    </ClCompile>
     <ClCompile Include="EditColorScheme.cpp">
       <DependentUpon>EditColorScheme.xaml</DependentUpon>
       <SubType>Code</SubType>
@@ -241,6 +257,10 @@
       <DependentUpon>ActionsViewModel.idl</DependentUpon>
       <SubType>Code</SubType>
     </ClCompile>
+    <ClCompile Include="TerminalColorConverters.cpp">
+      <DependentUpon>TerminalColorConverters.idl</DependentUpon>
+      <SubType>Code</SubType>
+    </ClCompile>
     <ClCompile Include="ColorSchemeViewModel.cpp">
       <DependentUpon>ColorSchemeViewModel.idl</DependentUpon>
       <SubType>Code</SubType>
@@ -315,6 +335,10 @@
       <DependentUpon>ColorSchemes.xaml</DependentUpon>
       <SubType>Code</SubType>
     </Midl>
+    <Midl Include="NullableColorPicker.idl">
+      <DependentUpon>NullableColorPicker.xaml</DependentUpon>
+      <SubType>Code</SubType>
+    </Midl>
     <Midl Include="EditColorScheme.idl">
       <DependentUpon>EditColorScheme.xaml</DependentUpon>
       <SubType>Code</SubType>
@@ -344,6 +368,7 @@
     </Midl>
     <Midl Include="ProfileViewModel.idl" />
     <Midl Include="ActionsViewModel.idl" />
+    <Midl Include="TerminalColorConverters.idl" />
     <Midl Include="ColorSchemeViewModel.idl" />
     <Midl Include="ColorSchemesPageViewModel.idl" />
     <Midl Include="RenderingViewModel.idl" />
@@ -402,7 +427,6 @@
     <ProjectReference Include="$(OpenConsoleDir)src\cascadia\TerminalConnection\TerminalConnection.vcxproj">
       <Private>false</Private>
     </ProjectReference>
-
     <ProjectReference Include="$(OpenConsoleDir)src\cascadia\TerminalControl\dll\TerminalControl.vcxproj">
       <!-- Private:false and ReferenceOutputAssembly:false, in combination with
       the manual reference to TerminalControl.winmd below make sure that this
@@ -415,7 +439,6 @@
       <Private>false</Private>
     </ProjectReference>
   </ItemGroup>
-
   <ItemGroup>
     <!-- Manually add a reference to TerminalControl here. We need this so
     MDMERGE will know where the TermControl types are defined. However, we need
@@ -434,17 +457,13 @@
       <CopyLocalSatelliteAssemblies>false</CopyLocalSatelliteAssemblies>
     </Reference>
   </ItemGroup>
-
   <ItemDefinitionGroup>
     <Link>
       <AdditionalDependencies>shell32.lib;%(AdditionalDependencies)</AdditionalDependencies>
     </Link>
   </ItemDefinitionGroup>
-
   <Import Project="$(OpenConsoleDir)src\cppwinrt.build.post.props" />
-
   <!-- This -must- go after cppwinrt.build.post.props because that includes many VS-provided props including appcontainer.common.props, which stomps on what cppwinrt.targets did. -->
   <Import Project="$(OpenConsoleDir)src\common.nugetversions.targets" />
-
   <Import Project="$(SolutionDir)build\rules\CollectWildcardResources.targets" />
-</Project>
+</Project>
\ No newline at end of file
diff --git a/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj.filters b/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj.filters
index 6e8ad60b9e8..a4675332178 100644
--- a/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj.filters
+++ b/src/cascadia/TerminalSettingsEditor/Microsoft.Terminal.Settings.Editor.vcxproj.filters
@@ -2,6 +2,7 @@
 <Project ToolsVersion="4.0" xmlns="http://schemas.microsoft.com/developer/msbuild/2003">
   <ItemGroup>
     <Natvis Include="$(SolutionDir)tools\ConsoleTypes.natvis" />
+    <Natvis Include="$(MSBuildThisFileDirectory)..\..\natvis\wil.natvis" />
   </ItemGroup>
   <ItemGroup>
     <PRIResource Include="Resources\en-US\Resources.resw" />
@@ -15,6 +16,7 @@
     <ClInclude Include="pch.h" />
     <ClInclude Include="Utils.h" />
     <ClInclude Include="PreviewConnection.h" />
+    <ClInclude Include="SegoeFluentIconList.h" />
   </ItemGroup>
   <ItemGroup>
     <Midl Include="ProfileViewModel.idl" />
@@ -27,9 +29,9 @@
     <Midl Include="LaunchViewModel.idl" />
     <Midl Include="EnumEntry.idl" />
     <Midl Include="SettingContainer.idl" />
+    <Midl Include="TerminalColorConverters.idl" />
   </ItemGroup>
   <ItemGroup>
-    <None Include="packages.config" />
     <None Include="$(ProjectName).def" />
   </ItemGroup>
   <ItemGroup>
@@ -49,5 +51,6 @@
     <Page Include="SettingContainerStyle.xaml" />
     <Page Include="AddProfile.xaml" />
     <Page Include="KeyChordListener.xaml" />
+    <Page Include="NullableColorPicker.xaml" />
   </ItemGroup>
-</Project>
+</Project>
\ No newline at end of file
diff --git a/src/cascadia/TerminalSettingsEditor/NullableColorPicker.cpp b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.cpp
new file mode 100644
index 00000000000..4cb9f655b72
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.cpp
@@ -0,0 +1,226 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+#include "pch.h"
+#include "NullableColorPicker.h"
+#include "NullableColorPicker.g.cpp"
+
+#include <LibraryResources.h>
+
+using namespace winrt;
+using namespace winrt::Windows::UI;
+using namespace winrt::Windows::UI::Xaml;
+using namespace winrt::Windows::UI::Xaml::Navigation;
+using namespace winrt::Windows::UI::Xaml::Controls;
+using namespace winrt::Windows::UI::Xaml::Media;
+using namespace winrt::Windows::Foundation;
+using namespace winrt::Windows::Foundation::Collections;
+using namespace winrt::Microsoft::UI::Xaml::Controls;
+
+namespace winrt
+{
+    namespace MUX = Microsoft::UI::Xaml;
+    namespace WUX = Windows::UI::Xaml;
+}
+
+namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
+{
+    static constexpr bool equalsColor(Windows::UI::Color a, Microsoft::Terminal::Core::Color b)
+    {
+        return a.R == b.R && a.G == b.G && a.B == b.B;
+    }
+
+    DependencyProperty NullableColorPicker::_ColorSchemeVMProperty{ nullptr };
+    DependencyProperty NullableColorPicker::_CurrentColorProperty{ nullptr };
+    DependencyProperty NullableColorPicker::_ShowNullColorButtonProperty{ nullptr };
+    DependencyProperty NullableColorPicker::_NullColorButtonLabelProperty{ nullptr };
+    DependencyProperty NullableColorPicker::_NullColorPreviewProperty{ nullptr };
+
+    NullableColorPicker::NullableColorPicker()
+    {
+        _InitializeProperties();
+        InitializeComponent();
+    }
+
+    void NullableColorPicker::_InitializeProperties()
+    {
+        // Initialize any dependency properties here.
+        // This performs a lazy load on these properties, instead of
+        // initializing them when the DLL loads.
+        if (!_ColorSchemeVMProperty)
+        {
+            _ColorSchemeVMProperty =
+                DependencyProperty::Register(
+                    L"ColorSchemeVM",
+                    xaml_typename<Editor::ColorSchemeViewModel>(),
+                    xaml_typename<Editor::NullableColorPicker>(),
+                    PropertyMetadata{ nullptr });
+        }
+        if (!_CurrentColorProperty)
+        {
+            _CurrentColorProperty =
+                DependencyProperty::Register(
+                    L"CurrentColor",
+                    xaml_typename<Windows::Foundation::IReference<Microsoft::Terminal::Core::Color>>(),
+                    xaml_typename<Editor::NullableColorPicker>(),
+                    PropertyMetadata{ nullptr, PropertyChangedCallback{ &NullableColorPicker::_OnCurrentColorValueChanged } });
+        }
+        if (!_ShowNullColorButtonProperty)
+        {
+            _ShowNullColorButtonProperty =
+                DependencyProperty::Register(
+                    L"ShowNullColorButton",
+                    xaml_typename<bool>(),
+                    xaml_typename<Editor::NullableColorPicker>(),
+                    PropertyMetadata{ box_value(true) });
+        }
+        if (!_NullColorButtonLabelProperty)
+        {
+            _NullColorButtonLabelProperty =
+                DependencyProperty::Register(
+                    L"NullColorButtonLabel",
+                    xaml_typename<hstring>(),
+                    xaml_typename<Editor::NullableColorPicker>(),
+                    PropertyMetadata{ nullptr });
+        }
+        if (!_NullColorPreviewProperty)
+        {
+            _NullColorPreviewProperty =
+                DependencyProperty::Register(
+                    L"NullColorPreview",
+                    xaml_typename<Windows::UI::Color>(),
+                    xaml_typename<Editor::NullableColorPicker>(),
+                    PropertyMetadata{ box_value(Windows::UI::Colors::Transparent()) });
+        }
+    }
+
+    void NullableColorPicker::_OnCurrentColorValueChanged(const DependencyObject& d, const DependencyPropertyChangedEventArgs& /*e*/)
+    {
+        const auto& obj{ d.try_as<Editor::NullableColorPicker>() };
+        get_self<NullableColorPicker>(obj)->_UpdateColorChips();
+    }
+
+    void NullableColorPicker::_UpdateColorChips()
+    {
+        const auto& currentColor = CurrentColor();
+        for (const auto& colorChip : _colorChips)
+        {
+            const auto& chipColor = colorChip.DataContext().as<Editor::ColorTableEntry>().Color();
+            colorChip.IsChecked(currentColor ?
+                                    equalsColor(chipColor, currentColor.Value()) :
+                                    false);
+        }
+    }
+
+    SolidColorBrush NullableColorPicker::CalculateBorderBrush(const Windows::UI::Color& color)
+    {
+        static constexpr auto isColorLight = [](const winrt::Windows::UI::Color& clr) -> bool {
+            return (((5 * clr.G) + (2 * clr.R) + clr.B) > (8 * 128));
+        };
+        if (isColorLight(color))
+        {
+            return SolidColorBrush(Colors::Black());
+        }
+        else
+        {
+            return SolidColorBrush(Colors::White());
+        }
+    }
+
+    void NullableColorPicker::ColorChip_Clicked(const IInspectable& sender, const RoutedEventArgs& /*args*/)
+    {
+        const auto& btn = sender.as<Windows::UI::Xaml::Controls::Primitives::ToggleButton>();
+        const auto& colorEntryColor = btn.DataContext().as<Editor::ColorTableEntry>().Color();
+        const Microsoft::Terminal::Core::Color terminalColor{ colorEntryColor.R, colorEntryColor.G, colorEntryColor.B, colorEntryColor.A };
+        CurrentColor(terminalColor);
+        btn.IsChecked(true);
+    }
+
+    void NullableColorPicker::ColorChip_DataContextChanged(const IInspectable& sender, const DataContextChangedEventArgs& args)
+    {
+        if (const auto& toggleBtn = sender.try_as<Controls::Primitives::ToggleButton>())
+        {
+            if (const auto& currentColor = CurrentColor())
+            {
+                const auto& currentColorVal = currentColor.Value();
+                const auto& newChipColor = args.NewValue().as<Editor::ColorTableEntry>().Color();
+                toggleBtn.IsChecked(equalsColor(newChipColor, currentColorVal));
+            }
+        }
+    }
+
+    bool NullableColorPicker::IsNull(IReference<Microsoft::Terminal::Core::Color> color)
+    {
+        return color == nullptr;
+    }
+
+    void NullableColorPicker::NullColorButton_Clicked(const IInspectable& /*sender*/, const RoutedEventArgs& /*args*/)
+    {
+        CurrentColor(nullptr);
+    }
+
+    safe_void_coroutine NullableColorPicker::MoreColors_Clicked(const IInspectable& /*sender*/, const RoutedEventArgs& /*args*/)
+    {
+        co_await ColorPickerDialog().ShowAsync();
+    }
+
+    void NullableColorPicker::ColorPickerDialog_Opened(const IInspectable& /*sender*/, const ContentDialogOpenedEventArgs& /*args*/)
+    {
+        // Initialize color picker with current color
+        if (CurrentColor())
+        {
+            const auto& terminalColor = CurrentColor().Value();
+            const Windows::UI::Color winuiColor{
+                .A = terminalColor.A,
+                .R = terminalColor.R,
+                .G = terminalColor.G,
+                .B = terminalColor.B
+            };
+            ColorPickerControl().Color(winuiColor);
+        }
+        else
+        {
+            // No current color (null), use the deduced value for null
+            ColorPickerControl().Color(NullColorPreview());
+        }
+    }
+
+    void NullableColorPicker::ColorPickerDialog_PrimaryButtonClick(const IInspectable& /*sender*/, const ContentDialogButtonClickEventArgs& /*args*/)
+    {
+        const auto& selectedColor = ColorPickerControl().Color();
+        const Microsoft::Terminal::Core::Color terminalColor{ selectedColor.R, selectedColor.G, selectedColor.B, selectedColor.A };
+        CurrentColor(terminalColor);
+    }
+
+    void NullableColorPicker::ColorChip_Loaded(const IInspectable& sender, const RoutedEventArgs& /*args*/)
+    {
+        if (const auto& toggleBtn = sender.try_as<Controls::Primitives::ToggleButton>())
+        {
+            if (const auto& currentColor = CurrentColor())
+            {
+                const auto& currentColorVal = currentColor.Value();
+                const auto& chipColor = toggleBtn.DataContext().as<Editor::ColorTableEntry>().Color();
+                if (equalsColor(chipColor, currentColorVal))
+                {
+                    toggleBtn.IsChecked(true);
+                }
+            }
+            _colorChips.push_back(toggleBtn);
+        }
+    }
+
+    void NullableColorPicker::ColorChip_Unloaded(const IInspectable& sender, const RoutedEventArgs& /*args*/)
+    {
+        if (const auto& toggleBtn = sender.try_as<Controls::Primitives::ToggleButton>())
+        {
+            for (auto it = _colorChips.begin(); it != _colorChips.end(); ++it)
+            {
+                if (*it == toggleBtn)
+                {
+                    _colorChips.erase(it);
+                    break;
+                }
+            }
+        }
+    }
+}
diff --git a/src/cascadia/TerminalSettingsEditor/NullableColorPicker.h b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.h
new file mode 100644
index 00000000000..876ce23d7f9
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.h
@@ -0,0 +1,49 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+#pragma once
+
+#include "NullableColorPicker.g.h"
+#include "Utils.h"
+
+namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
+{
+    struct NullableColorPicker : public HasScrollViewer<NullableColorPicker>, NullableColorPickerT<NullableColorPicker>
+    {
+    public:
+        NullableColorPicker();
+
+        static winrt::Windows::UI::Xaml::Media::SolidColorBrush CalculateBorderBrush(const Windows::UI::Color& color);
+        static bool IsNull(Windows::Foundation::IReference<Microsoft::Terminal::Core::Color> color);
+
+        void ColorChip_Loaded(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::RoutedEventArgs& args);
+        void ColorChip_Unloaded(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::RoutedEventArgs& args);
+        void ColorChip_Clicked(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::RoutedEventArgs& args);
+        void ColorChip_DataContextChanged(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::DataContextChangedEventArgs& args);
+
+        void NullColorButton_Clicked(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::RoutedEventArgs& args);
+        safe_void_coroutine MoreColors_Clicked(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::RoutedEventArgs& args);
+
+        void ColorPickerDialog_Opened(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::Controls::ContentDialogOpenedEventArgs& args);
+        void ColorPickerDialog_PrimaryButtonClick(const winrt::Windows::Foundation::IInspectable& sender, const winrt::Windows::UI::Xaml::Controls::ContentDialogButtonClickEventArgs& args);
+
+        DEPENDENCY_PROPERTY(Editor::ColorSchemeViewModel, ColorSchemeVM);
+        DEPENDENCY_PROPERTY(Windows::Foundation::IReference<Microsoft::Terminal::Core::Color>, CurrentColor);
+        DEPENDENCY_PROPERTY(bool, ShowNullColorButton);
+        DEPENDENCY_PROPERTY(hstring, NullColorButtonLabel);
+        DEPENDENCY_PROPERTY(Windows::UI::Color, NullColorPreview);
+
+    private:
+        static void _InitializeProperties();
+        static void _OnCurrentColorValueChanged(const Windows::UI::Xaml::DependencyObject& d, const Windows::UI::Xaml::DependencyPropertyChangedEventArgs& e);
+
+        void _UpdateColorChips();
+
+        std::vector<Windows::UI::Xaml::Controls::Primitives::ToggleButton> _colorChips;
+    };
+}
+
+namespace winrt::Microsoft::Terminal::Settings::Editor::factory_implementation
+{
+    BASIC_FACTORY(NullableColorPicker);
+}
diff --git a/src/cascadia/TerminalSettingsEditor/NullableColorPicker.idl b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.idl
new file mode 100644
index 00000000000..47229065433
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.idl
@@ -0,0 +1,30 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+import "ColorSchemeViewModel.idl";
+
+namespace Microsoft.Terminal.Settings.Editor
+{
+    [default_interface] runtimeclass NullableColorPicker : Windows.UI.Xaml.Controls.UserControl
+    {
+        NullableColorPicker();
+
+        ColorSchemeViewModel ColorSchemeVM;
+        static Windows.UI.Xaml.DependencyProperty ColorSchemeVMProperty { get; };
+
+        Windows.Foundation.IReference<Microsoft.Terminal.Core.Color> CurrentColor;
+        static Windows.UI.Xaml.DependencyProperty CurrentColorProperty { get; };
+
+        Boolean ShowNullColorButton;
+        static Windows.UI.Xaml.DependencyProperty ShowNullColorButtonProperty { get; };
+
+        String NullColorButtonLabel;
+        static Windows.UI.Xaml.DependencyProperty NullColorButtonLabelProperty { get; };
+
+        Windows.UI.Color NullColorPreview;
+        static Windows.UI.Xaml.DependencyProperty NullColorPreviewProperty { get; };
+
+        static Windows.UI.Xaml.Media.SolidColorBrush CalculateBorderBrush(Windows.UI.Color color);
+        static Boolean IsNull(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color> color);
+    }
+}
diff --git a/src/cascadia/TerminalSettingsEditor/NullableColorPicker.xaml b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.xaml
new file mode 100644
index 00000000000..c54a2fd72a7
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/NullableColorPicker.xaml
@@ -0,0 +1,155 @@
+<!--
+    Copyright (c) Microsoft Corporation. All rights reserved. Licensed under
+    the MIT License. See LICENSE in the project root for license information.
+-->
+<UserControl x:Class="Microsoft.Terminal.Settings.Editor.NullableColorPicker"
+             xmlns="http://schemas.microsoft.com/winfx/2006/xaml/presentation"
+             xmlns:x="http://schemas.microsoft.com/winfx/2006/xaml"
+             xmlns:d="http://schemas.microsoft.com/expression/blend/2008"
+             xmlns:local="using:Microsoft.Terminal.Settings.Editor"
+             xmlns:mc="http://schemas.openxmlformats.org/markup-compatibility/2006"
+             xmlns:model="using:Microsoft.Terminal.Settings.Model"
+             xmlns:mtu="using:Microsoft.Terminal.UI"
+             xmlns:muxc="using:Microsoft.UI.Xaml.Controls"
+             mc:Ignorable="d">
+
+    <UserControl.Resources>
+        <ResourceDictionary>
+            <ResourceDictionary.MergedDictionaries>
+                <ResourceDictionary Source="CommonResources.xaml" />
+            </ResourceDictionary.MergedDictionaries>
+
+            <DataTemplate x:Key="ColorPreviewChipTemplate"
+                          x:DataType="local:ColorTableEntry">
+                <ToggleButton Margin="0,0,4,4"
+                              AutomationProperties.Name="{x:Bind NameWithHexCode}"
+                              Background="{x:Bind mtu:Converters.ColorToBrush(Color)}"
+                              BorderBrush="{x:Bind local:NullableColorPicker.CalculateBorderBrush(Color), Mode=OneWay}"
+                              BorderThickness="2"
+                              Click="ColorChip_Clicked"
+                              DataContextChanged="ColorChip_DataContextChanged"
+                              Loaded="ColorChip_Loaded"
+                              Style="{StaticResource ColorToggleButtonStyle}"
+                              ToolTipService.ToolTip="{x:Bind NameWithHexCode}"
+                              Unloaded="ColorChip_Unloaded" />
+            </DataTemplate>
+
+            <DataTemplate x:Key="ColorSchemeTemplate"
+                          x:DataType="local:ColorSchemeViewModel">
+                <VariableSizedWrapGrid Name="ColorSchemeGrid"
+                                       HorizontalAlignment="Left"
+                                       MaximumRowsOrColumns="4"
+                                       Orientation="Horizontal"
+                                       XYFocusKeyboardNavigation="Enabled">
+                    <ContentControl Content="{x:Bind ColorEntryAt(0), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(1), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(2), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(3), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(4), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(5), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(6), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(7), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(8), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(9), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(10), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(11), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(12), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(13), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(14), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                    <ContentControl Content="{x:Bind ColorEntryAt(15), Mode=OneWay}"
+                                    ContentTemplate="{StaticResource ColorPreviewChipTemplate}"
+                                    IsTabStop="False" />
+                </VariableSizedWrapGrid>
+            </DataTemplate>
+        </ResourceDictionary>
+    </UserControl.Resources>
+
+    <Grid ColumnSpacing="5">
+        <Grid.ColumnDefinitions>
+            <ColumnDefinition Width="Auto" />
+            <ColumnDefinition Width="Auto" />
+        </Grid.ColumnDefinitions>
+
+        <ContentDialog x:Name="ColorPickerDialog"
+                       x:Uid="NullableColorPicker_ColorPickerContentDialog"
+                       DefaultButton="Primary"
+                       Opened="ColorPickerDialog_Opened"
+                       PrimaryButtonClick="ColorPickerDialog_PrimaryButtonClick"
+                       TabFocusNavigation="Cycle">
+            <muxc:ColorPicker x:Name="ColorPickerControl"
+                              Margin="0,0,0,-40"
+                              ColorSpectrumShape="Box"
+                              IsAlphaEnabled="False"
+                              IsAlphaSliderVisible="True"
+                              IsAlphaTextInputVisible="True"
+                              IsColorChannelTextInputVisible="False"
+                              IsColorSliderVisible="False"
+                              IsHexInputVisible="False"
+                              IsMoreButtonVisible="False"
+                              Orientation="Horizontal" />
+        </ContentDialog>
+
+        <ContentPresenter Grid.Column="0"
+                          Content="{x:Bind ColorSchemeVM, Mode=OneWay}"
+                          ContentTemplate="{StaticResource ColorSchemeTemplate}" />
+
+        <StackPanel Grid.Column="1"
+                    Spacing="5">
+            <ToggleButton AutomationProperties.Name="{x:Bind NullColorButtonLabel}"
+                          Click="NullColorButton_Clicked"
+                          IsChecked="{x:Bind IsNull(CurrentColor), Mode=OneWay}">
+                <Grid ColumnSpacing="5">
+                    <Grid.ColumnDefinitions>
+                        <ColumnDefinition Width="Auto" />
+                        <ColumnDefinition Width="*" />
+                    </Grid.ColumnDefinitions>
+
+                    <Border Grid.Column="0"
+                            Width="20"
+                            Height="20"
+                            Background="{x:Bind mtu:Converters.ColorToBrush(NullColorPreview), Mode=OneWay}"
+                            BorderThickness="1"
+                            CornerRadius="{ThemeResource ControlCornerRadius}" />
+
+                    <TextBlock Grid.Column="1"
+                               Text="{x:Bind NullColorButtonLabel}" />
+                </Grid>
+            </ToggleButton>
+
+            <Button x:Uid="NullableColorPicker_MoreColorsButton"
+                    HorizontalAlignment="Stretch"
+                    Click="MoreColors_Clicked" />
+        </StackPanel>
+    </Grid>
+
+</UserControl>
diff --git a/src/cascadia/TerminalSettingsEditor/ProfileViewModel.cpp b/src/cascadia/TerminalSettingsEditor/ProfileViewModel.cpp
index 66d8371c3ea..44d1431baaa 100644
--- a/src/cascadia/TerminalSettingsEditor/ProfileViewModel.cpp
+++ b/src/cascadia/TerminalSettingsEditor/ProfileViewModel.cpp
@@ -10,6 +10,7 @@
 #include <LibraryResources.h>
 #include "../WinRTUtils/inc/Utils.h"
 #include "../../renderer/base/FontCache.h"
+#include "SegoeFluentIconList.h"
 
 using namespace winrt::Windows::UI::Text;
 using namespace winrt::Windows::UI::Xaml;
@@ -26,6 +27,7 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
 
     Windows::Foundation::Collections::IObservableVector<Editor::Font> ProfileViewModel::_MonospaceFontList{ nullptr };
     Windows::Foundation::Collections::IObservableVector<Editor::Font> ProfileViewModel::_FontList{ nullptr };
+    Windows::Foundation::Collections::IVector<IInspectable> ProfileViewModel::_BuiltInIcons{ nullptr };
 
     static constexpr std::wstring_view HideIconValue{ L"none" };
 
@@ -40,6 +42,17 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         INITIALIZE_BINDABLE_ENUM_SETTING_REVERSE_ORDER(CloseOnExitMode, CloseOnExitMode, winrt::Microsoft::Terminal::Settings::Model::CloseOnExitMode, L"Profile_CloseOnExit", L"Content");
         INITIALIZE_BINDABLE_ENUM_SETTING(ScrollState, ScrollbarState, winrt::Microsoft::Terminal::Control::ScrollbarState, L"Profile_ScrollbarVisibility", L"Content");
 
+        // set up IconTypes
+        std::vector<IInspectable> iconTypes;
+        iconTypes.reserve(4);
+        iconTypes.emplace_back(make<EnumEntry>(RS_(L"Profile_IconTypeNone"), box_value(IconType::None)));
+        iconTypes.emplace_back(make<EnumEntry>(RS_(L"Profile_IconTypeFontIcon"), box_value(IconType::FontIcon)));
+        iconTypes.emplace_back(make<EnumEntry>(RS_(L"Profile_IconTypeEmoji"), box_value(IconType::Emoji)));
+        iconTypes.emplace_back(make<EnumEntry>(RS_(L"Profile_IconTypeImage"), box_value(IconType::Image)));
+        _IconTypes = winrt::single_threaded_vector<IInspectable>(std::move(iconTypes));
+        _DeduceCurrentIconType();
+        _DeduceCurrentBuiltInIcon();
+
         // Add a property changed handler to our own property changed event.
         // This propagates changes from the settings model to anybody listening to our
         //  unique view model members.
@@ -74,7 +87,29 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
             }
             else if (viewModelProperty == L"Icon")
             {
-                _NotifyChanges(L"HideIcon");
+                // _DeduceCurrentIconType() ends with a "CurrentIconType" notification
+                //  so we don't need to call _UpdateIconPreview() here
+                _DeduceCurrentIconType();
+            }
+            else if (viewModelProperty == L"CurrentIconType")
+            {
+                // "Using*" handles the visibility of the IconType-related UI.
+                // The others propagate the rendered icon into a preview (i.e. nav view, container item)
+                _NotifyChanges(L"UsingNoIcon",
+                               L"UsingBuiltInIcon",
+                               L"UsingEmojiIcon",
+                               L"UsingImageIcon",
+                               L"LocalizedIcon",
+                               L"IconPreview",
+                               L"EvaluatedIcon");
+            }
+            else if (viewModelProperty == L"CurrentBuiltInIcon")
+            {
+                Icon(unbox_value<hstring>(_CurrentBuiltInIcon.as<Editor::EnumEntry>().EnumValue()));
+            }
+            else if (viewModelProperty == L"CurrentEmojiIcon")
+            {
+                Icon(CurrentEmojiIcon());
             }
         });
 
@@ -98,6 +133,61 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         _defaultAppearanceViewModel.IsDefault(true);
     }
 
+    void ProfileViewModel::_UpdateBuiltInIcons()
+    {
+        std::vector<IInspectable> builtInIcons;
+        for (auto& [val, name] : s_SegoeFluentIcons)
+        {
+            builtInIcons.emplace_back(make<EnumEntry>(hstring{ name }, box_value(val)));
+        }
+        _BuiltInIcons = single_threaded_vector<IInspectable>(std::move(builtInIcons));
+    }
+
+    void ProfileViewModel::_DeduceCurrentIconType()
+    {
+        const auto& profileIcon = _profile.Icon();
+        if (profileIcon == HideIconValue)
+        {
+            _currentIconType = _IconTypes.GetAt(0);
+        }
+        else if (L"\uE700" <= profileIcon && profileIcon <= L"\uF8B3")
+        {
+            _currentIconType = _IconTypes.GetAt(1);
+            _DeduceCurrentBuiltInIcon();
+        }
+        else if (profileIcon.size() <= 2)
+        {
+            // We already did a range check for MDL2 Assets in the previous one,
+            // so if we're out of that range but still short, assume we're an emoji
+            _currentIconType = _IconTypes.GetAt(2);
+        }
+        else
+        {
+            _currentIconType = _IconTypes.GetAt(3);
+        }
+        _NotifyChanges(L"CurrentIconType");
+    }
+
+    void ProfileViewModel::_DeduceCurrentBuiltInIcon()
+    {
+        if (!_BuiltInIcons)
+        {
+            _UpdateBuiltInIcons();
+        }
+        const auto& profileIcon = Icon();
+        for (uint32_t i = 0; i < _BuiltInIcons.Size(); i++)
+        {
+            const auto& builtIn = _BuiltInIcons.GetAt(i);
+            if (profileIcon == unbox_value<hstring>(builtIn.as<Editor::EnumEntry>().EnumValue()))
+            {
+                _CurrentBuiltInIcon = builtIn;
+                return;
+            }
+        }
+        _CurrentBuiltInIcon = _BuiltInIcons.GetAt(0);
+        _NotifyChanges(L"CurrentBuiltInIcon");
+    }
+
     Model::TerminalSettings ProfileViewModel::TermSettings() const
     {
         return Model::TerminalSettings::CreateForPreview(_appSettings, _profile);
@@ -328,26 +418,103 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         }
     }
 
-    bool ProfileViewModel::HideIcon()
+    winrt::hstring ProfileViewModel::LocalizedIcon() const
     {
-        return Icon() == HideIconValue;
-    }
-    void ProfileViewModel::HideIcon(const bool hide)
-    {
-        if (hide)
+        if (_currentIconType && unbox_value<IconType>(_currentIconType.as<Editor::EnumEntry>().EnumValue()) == IconType::None)
         {
-            // Stash the current value of Icon. If the user
-            // checks and un-checks the "Hide Icon" checkbox, we want
-            // the path that we display in the text box to remain unchanged.
-            _lastIcon = Icon();
-            Icon(HideIconValue);
+            return RS_(L"Profile_IconTypeNone");
         }
-        else
+        return Icon();
+    }
+
+    Windows::UI::Xaml::Controls::IconElement ProfileViewModel::IconPreview() const
+    {
+        // IconWUX sets the icon width/height to 32 by default
+        auto icon = Microsoft::Terminal::UI::IconPathConverter::IconWUX(EvaluatedIcon());
+        icon.Width(16);
+        icon.Height(16);
+        return icon;
+    }
+
+    void ProfileViewModel::CurrentIconType(const Windows::Foundation::IInspectable& value)
+    {
+        if (_currentIconType != value)
         {
-            Icon(_lastIcon);
+            // Switching from...
+            if (_currentIconType && unbox_value<IconType>(_currentIconType.as<Editor::EnumEntry>().EnumValue()) == IconType::Image)
+            {
+                // Stash the current value of Icon. If the user
+                // switches out of then back to IconType::Image, we want
+                // the path that we display in the text box to remain unchanged.
+                _lastIconPath = Icon();
+            }
+
+            // Set the member here instead of after setting Icon() below!
+            // We have an Icon property changed handler defined for when we discard changes.
+            // Inadvertently, that means that we call this setter again.
+            // Setting the member here means that we early exit at the beginning of the function
+            //  because _currentIconType == value.
+            _currentIconType = value;
+
+            // Switched to...
+            switch (unbox_value<IconType>(value.as<Editor::EnumEntry>().EnumValue()))
+            {
+            case IconType::None:
+            {
+                _profile.Icon(HideIconValue);
+                break;
+            }
+            case IconType::Image:
+            {
+                if (!_lastIconPath.empty())
+                {
+                    // Conversely, if we switch to Image,
+                    // retrieve that saved value and apply it
+                    _profile.Icon(_lastIconPath);
+                }
+                break;
+            }
+            case IconType::FontIcon:
+            {
+                if (_CurrentBuiltInIcon)
+                {
+                    _profile.Icon(unbox_value<hstring>(_CurrentBuiltInIcon.as<Editor::EnumEntry>().EnumValue()));
+                }
+                break;
+            }
+            case IconType::Emoji:
+            {
+                // Don't set Icon here!
+                // Clear out the text box so we direct the user to use the emoji picker.
+                CurrentEmojiIcon({});
+            }
+            }
+            // We're not using the VM's Icon() setter above,
+            // so notify HasIcon changed manually
+            _NotifyChanges(L"CurrentIconType", L"HasIcon");
         }
     }
 
+    bool ProfileViewModel::UsingNoIcon() const
+    {
+        return _currentIconType == _IconTypes.GetAt(0);
+    }
+
+    bool ProfileViewModel::UsingBuiltInIcon() const
+    {
+        return _currentIconType == _IconTypes.GetAt(1);
+    }
+
+    bool ProfileViewModel::UsingEmojiIcon() const
+    {
+        return _currentIconType == _IconTypes.GetAt(2);
+    }
+
+    bool ProfileViewModel::UsingImageIcon() const
+    {
+        return _currentIconType == _IconTypes.GetAt(3);
+    }
+
     bool ProfileViewModel::IsBellStyleFlagSet(const uint32_t flag)
     {
         return (WI_EnumValue(BellStyle()) & flag) == flag;
diff --git a/src/cascadia/TerminalSettingsEditor/ProfileViewModel.h b/src/cascadia/TerminalSettingsEditor/ProfileViewModel.h
index c396fe38ec8..decfe9fe50c 100644
--- a/src/cascadia/TerminalSettingsEditor/ProfileViewModel.h
+++ b/src/cascadia/TerminalSettingsEditor/ProfileViewModel.h
@@ -33,6 +33,7 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         static void UpdateFontList() noexcept;
         static Windows::Foundation::Collections::IObservableVector<Editor::Font> CompleteFontList() noexcept { return _FontList; };
         static Windows::Foundation::Collections::IObservableVector<Editor::Font> MonospaceFontList() noexcept { return _MonospaceFontList; };
+        static Windows::Foundation::Collections::IVector<IInspectable> BuiltInIcons() noexcept { return _BuiltInIcons; };
 
         ProfileViewModel(const Model::Profile& profile, const Model::CascadiaSettings& settings);
         Model::TerminalSettings TermSettings() const;
@@ -60,16 +61,23 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         {
             return _profile.EvaluatedIcon();
         }
+        Windows::Foundation::IInspectable CurrentIconType() const noexcept
+        {
+            return _currentIconType;
+        }
+        Windows::UI::Xaml::Controls::IconElement IconPreview() const;
+        winrt::hstring LocalizedIcon() const;
+        void CurrentIconType(const Windows::Foundation::IInspectable& value);
+        bool UsingNoIcon() const;
+        bool UsingBuiltInIcon() const;
+        bool UsingEmojiIcon() const;
+        bool UsingImageIcon() const;
 
         // starting directory
         bool UseParentProcessDirectory();
         void UseParentProcessDirectory(const bool useParent);
         bool UseCustomStartingDirectory();
 
-        // icon
-        bool HideIcon();
-        void HideIcon(const bool hide);
-
         // general profile knowledge
         winrt::guid OriginalProfileGuid() const noexcept;
         bool CanDeleteProfile() const;
@@ -88,6 +96,8 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         til::typed_event<Editor::ProfileViewModel, Editor::DeleteProfileEventArgs> DeleteProfileRequested;
 
         VIEW_MODEL_OBSERVABLE_PROPERTY(ProfileSubPage, CurrentPage);
+        VIEW_MODEL_OBSERVABLE_PROPERTY(Windows::Foundation::IInspectable, CurrentBuiltInIcon);
+        VIEW_MODEL_OBSERVABLE_PROPERTY(hstring, CurrentEmojiIcon);
 
         PERMANENT_OBSERVABLE_PROJECTED_SETTING(_profile, Guid);
         PERMANENT_OBSERVABLE_PROJECTED_SETTING(_profile, ConnectionType);
@@ -104,10 +114,6 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         OBSERVABLE_PROJECTED_SETTING(_profile, Commandline);
         OBSERVABLE_PROJECTED_SETTING(_profile, StartingDirectory);
         OBSERVABLE_PROJECTED_SETTING(_profile, AntialiasingMode);
-        OBSERVABLE_PROJECTED_SETTING(_profile.DefaultAppearance(), Foreground);
-        OBSERVABLE_PROJECTED_SETTING(_profile.DefaultAppearance(), Background);
-        OBSERVABLE_PROJECTED_SETTING(_profile.DefaultAppearance(), SelectionBackground);
-        OBSERVABLE_PROJECTED_SETTING(_profile.DefaultAppearance(), CursorColor);
         OBSERVABLE_PROJECTED_SETTING(_profile.DefaultAppearance(), Opacity);
         OBSERVABLE_PROJECTED_SETTING(_profile.DefaultAppearance(), UseAcrylic);
         OBSERVABLE_PROJECTED_SETTING(_profile, HistorySize);
@@ -127,6 +133,7 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
 
         WINRT_PROPERTY(bool, IsBaseLayer, false);
         WINRT_PROPERTY(bool, FocusDeleteButton, false);
+        WINRT_PROPERTY(Windows::Foundation::Collections::IVector<Windows::Foundation::IInspectable>, IconTypes);
         GETSET_BINDABLE_ENUM_SETTING(AntiAliasingMode, Microsoft::Terminal::Control::TextAntialiasingMode, AntialiasingMode);
         GETSET_BINDABLE_ENUM_SETTING(CloseOnExitMode, Microsoft::Terminal::Settings::Model::CloseOnExitMode, CloseOnExit);
         GETSET_BINDABLE_ENUM_SETTING(ScrollState, Microsoft::Terminal::Control::ScrollbarState, ScrollState);
@@ -136,14 +143,20 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         winrt::guid _originalProfileGuid{};
         winrt::hstring _lastBgImagePath;
         winrt::hstring _lastStartingDirectoryPath;
-        winrt::hstring _lastIcon;
+        winrt::hstring _lastIconPath;
+        Windows::Foundation::IInspectable _currentIconType{};
         Editor::AppearanceViewModel _defaultAppearanceViewModel;
 
         static Windows::Foundation::Collections::IObservableVector<Editor::Font> _MonospaceFontList;
         static Windows::Foundation::Collections::IObservableVector<Editor::Font> _FontList;
+        static Windows::Foundation::Collections::IVector<Windows::Foundation::IInspectable> _BuiltInIcons;
 
         Model::CascadiaSettings _appSettings;
         Editor::AppearanceViewModel _unfocusedAppearanceViewModel;
+
+        void _UpdateBuiltInIcons();
+        void _DeduceCurrentIconType();
+        void _DeduceCurrentBuiltInIcon();
     };
 
     struct DeleteProfileEventArgs :
diff --git a/src/cascadia/TerminalSettingsEditor/ProfileViewModel.idl b/src/cascadia/TerminalSettingsEditor/ProfileViewModel.idl
index 9bf20079cba..07f6574bad3 100644
--- a/src/cascadia/TerminalSettingsEditor/ProfileViewModel.idl
+++ b/src/cascadia/TerminalSettingsEditor/ProfileViewModel.idl
@@ -33,6 +33,14 @@ namespace Microsoft.Terminal.Settings.Editor
         Advanced = 3
     };
 
+    enum IconType
+    {
+        None = 0,
+        FontIcon,
+        Image,
+        Emoji
+    };
+
     runtimeclass ProfileViewModel : Windows.UI.Xaml.Data.INotifyPropertyChanged
     {
         Microsoft.Terminal.Settings.Model.TerminalSettings TermSettings { get; };
@@ -64,7 +72,6 @@ namespace Microsoft.Terminal.Settings.Editor
         ProfileSubPage CurrentPage;
         Boolean UseParentProcessDirectory;
         Boolean UseCustomStartingDirectory { get; };
-        Boolean HideIcon;
         AppearanceViewModel DefaultAppearance { get; };
         Guid OriginalProfileGuid { get; };
         Boolean HasUnfocusedAppearance { get; };
@@ -76,7 +83,19 @@ namespace Microsoft.Terminal.Settings.Editor
         Boolean AutoMarkPromptsAvailable { get; };
         Boolean RepositionCursorWithMouseAvailable { get; };
 
+        Windows.UI.Xaml.Controls.IconElement IconPreview { get; };
         String EvaluatedIcon { get; };
+        String LocalizedIcon { get; };
+        String CurrentEmojiIcon;
+        IInspectable CurrentIconType;
+        Windows.Foundation.Collections.IVector<IInspectable> IconTypes { get; };
+        Boolean UsingNoIcon { get; };
+        Boolean UsingBuiltInIcon { get; };
+        Boolean UsingEmojiIcon { get; };
+        Boolean UsingImageIcon { get; };
+
+        IInspectable CurrentBuiltInIcon;
+        Windows.Foundation.Collections.IVector<IInspectable> BuiltInIcons { get; };
 
         void CreateUnfocusedAppearance();
         void DeleteUnfocusedAppearance();
@@ -98,10 +117,6 @@ namespace Microsoft.Terminal.Settings.Editor
         OBSERVABLE_PROJECTED_PROFILE_SETTING(String, Commandline);
         OBSERVABLE_PROJECTED_PROFILE_SETTING(String, StartingDirectory);
         OBSERVABLE_PROJECTED_PROFILE_SETTING(Microsoft.Terminal.Control.TextAntialiasingMode, AntialiasingMode);
-        OBSERVABLE_PROJECTED_PROFILE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, Foreground);
-        OBSERVABLE_PROJECTED_PROFILE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, Background);
-        OBSERVABLE_PROJECTED_PROFILE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, SelectionBackground);
-        OBSERVABLE_PROJECTED_PROFILE_SETTING(Windows.Foundation.IReference<Microsoft.Terminal.Core.Color>, CursorColor);
         OBSERVABLE_PROJECTED_PROFILE_SETTING(Int32, HistorySize);
         OBSERVABLE_PROJECTED_PROFILE_SETTING(Boolean, SnapOnInput);
         OBSERVABLE_PROJECTED_PROFILE_SETTING(Boolean, AltGrAliasing);
diff --git a/src/cascadia/TerminalSettingsEditor/Profiles_Base.cpp b/src/cascadia/TerminalSettingsEditor/Profiles_Base.cpp
index e685bdc64a4..476c81e3118 100644
--- a/src/cascadia/TerminalSettingsEditor/Profiles_Base.cpp
+++ b/src/cascadia/TerminalSettingsEditor/Profiles_Base.cpp
@@ -148,4 +148,9 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
             _Profile.StartingDirectory(folder);
         }
     }
+
+    Windows::UI::Xaml::Controls::IconSource Profiles_Base::BuiltInIconConverter(const IInspectable& iconVal)
+    {
+        return Microsoft::Terminal::UI::IconPathConverter::IconSourceWUX(unbox_value<hstring>(iconVal));
+    }
 }
diff --git a/src/cascadia/TerminalSettingsEditor/Profiles_Base.h b/src/cascadia/TerminalSettingsEditor/Profiles_Base.h
index 77b4f5f4938..29ca4a0f692 100644
--- a/src/cascadia/TerminalSettingsEditor/Profiles_Base.h
+++ b/src/cascadia/TerminalSettingsEditor/Profiles_Base.h
@@ -25,6 +25,8 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
         void Advanced_Click(const Windows::Foundation::IInspectable& sender, const Windows::UI::Xaml::RoutedEventArgs& e);
         void DeleteConfirmation_Click(const Windows::Foundation::IInspectable& sender, const Windows::UI::Xaml::RoutedEventArgs& e);
 
+        static Windows::UI::Xaml::Controls::IconSource BuiltInIconConverter(const Windows::Foundation::IInspectable& iconVal);
+
         til::property_changed_event PropertyChanged;
         WINRT_PROPERTY(Editor::ProfileViewModel, Profile, nullptr);
 
diff --git a/src/cascadia/TerminalSettingsEditor/Profiles_Base.idl b/src/cascadia/TerminalSettingsEditor/Profiles_Base.idl
index b076fe75a3c..0e85e049216 100644
--- a/src/cascadia/TerminalSettingsEditor/Profiles_Base.idl
+++ b/src/cascadia/TerminalSettingsEditor/Profiles_Base.idl
@@ -9,5 +9,7 @@ namespace Microsoft.Terminal.Settings.Editor
     {
         Profiles_Base();
         ProfileViewModel Profile { get; };
+
+        static Windows.UI.Xaml.Controls.IconSource BuiltInIconConverter(IInspectable iconVal);
     }
 }
diff --git a/src/cascadia/TerminalSettingsEditor/Profiles_Base.xaml b/src/cascadia/TerminalSettingsEditor/Profiles_Base.xaml
index 4a92c480318..75c4f31420f 100644
--- a/src/cascadia/TerminalSettingsEditor/Profiles_Base.xaml
+++ b/src/cascadia/TerminalSettingsEditor/Profiles_Base.xaml
@@ -102,28 +102,98 @@
             <!--  Icon  -->
             <local:SettingContainer x:Uid="Profile_Icon"
                                     ClearSettingValue="{x:Bind Profile.ClearIcon}"
-                                    CurrentValue="{x:Bind Profile.Icon, Mode=OneWay}"
                                     HasSettingValue="{x:Bind Profile.HasIcon, Mode=OneWay}"
                                     SettingOverrideSource="{x:Bind Profile.IconOverrideSource, Mode=OneWay}"
-                                    Style="{StaticResource ExpanderSettingContainerStyle}">
-                <StackPanel>
-                    <TextBox x:Uid="Profile_IconBox"
-                             FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
-                             IsEnabled="{x:Bind mtu:Converters.InvertBoolean(Profile.HideIcon), Mode=OneWay}"
-                             IsSpellCheckEnabled="False"
-                             Style="{StaticResource TextBoxSettingStyle}"
-                             Text="{x:Bind Profile.Icon, Mode=TwoWay}"
-                             Visibility="{x:Bind mtu:Converters.InvertedBooleanToVisibility(Profile.HideIcon), Mode=OneWay}" />
-                    <Button x:Uid="Profile_IconBrowse"
-                            Margin="0,10,0,0"
-                            Click="Icon_Click"
-                            Style="{StaticResource BrowseButtonStyle}"
-                            Visibility="{x:Bind mtu:Converters.InvertedBooleanToVisibility(Profile.HideIcon), Mode=OneWay}" />
-                    <CheckBox x:Name="HideIconCheckbox"
-                              x:Uid="Profile_HideIconCheckbox"
-                              Margin="0,5,0,0"
-                              IsChecked="{x:Bind Profile.HideIcon, Mode=TwoWay}" />
-                </StackPanel>
+                                    Style="{StaticResource ExpanderSettingContainerStyleWithComplexPreview}">
+                <local:SettingContainer.CurrentValue>
+                    <Grid>
+                        <ContentControl Width="16"
+                                        Height="16"
+                                        Content="{x:Bind Profile.IconPreview, Mode=OneWay}"
+                                        Visibility="{x:Bind mtu:Converters.InvertedBooleanToVisibility(Profile.UsingNoIcon), Mode=OneWay}" />
+                        <TextBlock Margin="0,0,0,0"
+                                   HorizontalAlignment="Right"
+                                   VerticalAlignment="Center"
+                                   FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
+                                   Style="{StaticResource SettingsPageItemDescriptionStyle}"
+                                   Text="{x:Bind Profile.LocalizedIcon, Mode=OneWay}"
+                                   Visibility="{x:Bind Profile.UsingNoIcon, Mode=OneWay}" />
+                    </Grid>
+                </local:SettingContainer.CurrentValue>
+                <local:SettingContainer.Content>
+                    <Grid ColumnSpacing="10">
+                        <Grid.ColumnDefinitions>
+                            <ColumnDefinition Width="auto" />
+                            <ColumnDefinition Width="*" />
+                            <ColumnDefinition Width="auto" />
+                        </Grid.ColumnDefinitions>
+
+                        <!--  Icon Type  -->
+                        <ComboBox x:Uid="Profile_IconType"
+                                  Grid.Column="0"
+                                  ItemsSource="{x:Bind Profile.IconTypes}"
+                                  SelectedItem="{x:Bind Profile.CurrentIconType, Mode=TwoWay}">
+                            <ComboBox.ItemTemplate>
+                                <DataTemplate x:DataType="local:EnumEntry">
+                                    <TextBlock Text="{x:Bind EnumName}" />
+                                </DataTemplate>
+                            </ComboBox.ItemTemplate>
+                        </ComboBox>
+
+                        <!--  Built-In Icon  -->
+                        <ComboBox x:Uid="Profile_BuiltInIcon"
+                                  Grid.Column="1"
+                                  ItemsSource="{x:Bind Profile.BuiltInIcons}"
+                                  SelectedItem="{x:Bind Profile.CurrentBuiltInIcon, Mode=TwoWay}"
+                                  Visibility="{x:Bind Profile.UsingBuiltInIcon, Mode=OneWay}">
+                            <ComboBox.ItemTemplate>
+                                <DataTemplate x:DataType="local:EnumEntry">
+                                    <Grid ColumnSpacing="10">
+                                        <Grid.ColumnDefinitions>
+                                            <ColumnDefinition Width="16" />
+                                            <ColumnDefinition Width="*" />
+                                        </Grid.ColumnDefinitions>
+
+                                        <IconSourceElement Grid.Column="0"
+                                                           Width="16"
+                                                           Height="16"
+                                                           IconSource="{x:Bind local:Profiles_Base.BuiltInIconConverter(EnumValue), Mode=OneTime}" />
+                                        <TextBlock Grid.Column="1"
+                                                   Text="{x:Bind EnumName}" />
+                                    </Grid>
+                                </DataTemplate>
+                            </ComboBox.ItemTemplate>
+                        </ComboBox>
+
+                        <!--  Image (File) Icon  -->
+                        <TextBox x:Uid="Profile_IconBox"
+                                 Grid.Column="1"
+                                 MaxWidth="Infinity"
+                                 HorizontalAlignment="Stretch"
+                                 FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
+                                 IsSpellCheckEnabled="False"
+                                 Style="{StaticResource TextBoxSettingStyle}"
+                                 Text="{x:Bind Profile.Icon, Mode=TwoWay}"
+                                 Visibility="{x:Bind Profile.UsingImageIcon, Mode=OneWay}" />
+                        <Button x:Uid="Profile_IconBrowse"
+                                Grid.Column="2"
+                                Margin="0"
+                                VerticalAlignment="Top"
+                                Click="Icon_Click"
+                                Style="{StaticResource BrowseButtonStyle}"
+                                Visibility="{x:Bind Profile.UsingImageIcon, Mode=OneWay}" />
+
+                        <!--  Emoji Icon  -->
+                        <TextBox x:Uid="Profile_IconEmojiBox"
+                                 Grid.Column="1"
+                                 MaxWidth="Infinity"
+                                 FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
+                                 IsSpellCheckEnabled="False"
+                                 Style="{StaticResource TextBoxSettingStyle}"
+                                 Text="{x:Bind Profile.CurrentEmojiIcon, Mode=TwoWay}"
+                                 Visibility="{x:Bind Profile.UsingEmojiIcon, Mode=OneWay}" />
+                    </Grid>
+                </local:SettingContainer.Content>
             </local:SettingContainer>
 
             <!--  Tab Title  -->
diff --git a/src/cascadia/TerminalSettingsEditor/Resources/en-US/Resources.resw b/src/cascadia/TerminalSettingsEditor/Resources/en-US/Resources.resw
index 46524ca62d4..eed91f4ddbc 100644
--- a/src/cascadia/TerminalSettingsEditor/Resources/en-US/Resources.resw
+++ b/src/cascadia/TerminalSettingsEditor/Resources/en-US/Resources.resw
@@ -894,6 +894,10 @@
     <value>Color scheme</value>
     <comment>Header for a control to select the scheme (or set) of colors used in the session. This is selected from a list of options managed by the user.</comment>
   </data>
+  <data name="Profile_ColorScheme.HelpText" xml:space="preserve">
+    <value>Expand to override the foreground, background, and selection background.</value>
+    <comment>Help text for a control to select the scheme (or set) of colors used in the session. Directs the user to expand the control to access overrides for certain values in the color scheme.</comment>
+  </data>
   <data name="Profile_Commandline.[using:Windows.UI.Xaml.Automation]AutomationProperties.Name" xml:space="preserve">
     <value>Command line</value>
     <comment>Name for a control to determine commandline executable (i.e. a .exe file) to run when a terminal session of this profile is launched.</comment>
@@ -1121,6 +1125,10 @@
     <value>Icon</value>
     <comment>Name for a control to determine what icon can be used to represent this profile. This is not necessarily a file path, but can be one.</comment>
   </data>
+  <data name="Profile_IconEmojiBox.[using:Windows.UI.Xaml.Automation]AutomationProperties.Name" xml:space="preserve">
+    <value>Icon</value>
+    <comment>Name for a control to determine what icon can be used to represent this profile.</comment>
+  </data>
   <data name="Profile_Icon.HelpText" xml:space="preserve">
     <value>Emoji or image file location of the icon used in the profile.</value>
     <comment>A description for what the "icon" setting does. Presented near "Profile_Icon".</comment>
@@ -1929,6 +1937,102 @@
     <value>Non-monospace fonts:</value>
     <comment>This is a label that is followed by a list of proportional fonts.</comment>
   </data>
+  <data name="Profile_TabColor.Header" xml:space="preserve">
+    <value>Tab color</value>
+    <comment>Header for a control to determine the color of the tab.</comment>
+  </data>
+  <data name="Profile_Foreground.Header" xml:space="preserve">
+    <value>Foreground</value>
+    <comment>Header for a control to determine the foreground color of text.</comment>
+  </data>
+  <data name="Profile_Background.Header" xml:space="preserve">
+    <value>Background</value>
+    <comment>Header for a control to determine the background color of text.</comment>
+  </data>
+  <data name="Profile_SelectionBackground.Header" xml:space="preserve">
+    <value>Selection background</value>
+    <comment>Header for a control to determine the background color of selected text.</comment>
+  </data>
+  <data name="Profile_CursorColor.Header" xml:space="preserve">
+    <value>Cursor color</value>
+    <comment>Header for a control to determine the color of the cursor.</comment>
+  </data>
+  <data name="Profile_Foreground.HelpText" xml:space="preserve">
+    <value>Overrides the foreground color from the color scheme.</value>
+    <comment>A description for what the "foreground" setting does. Presented near "Profile_Foreground".</comment>
+  </data>
+  <data name="Profile_CursorColor.HelpText" xml:space="preserve">
+    <value>Overrides the cursor color from the color scheme.</value>
+    <comment>A description for what the "cursor color" setting does. Presented near "Profile_CursorColor".</comment>
+  </data>
+  <data name="Profile_Background.HelpText" xml:space="preserve">
+    <value>Overrides the background color from the color scheme.</value>
+    <comment>A description for what the "background" setting does. Presented near "Profile_Background".</comment>
+  </data>
+  <data name="Profile_SelectionBackground.HelpText" xml:space="preserve">
+    <value>Overrides the selection background color from the color scheme.</value>
+    <comment>A description for what the "selection background" setting does. Presented near "Profile_SelectionBackground".</comment>
+  </data>
+  <data name="NullableColorPicker_MoreColorsButton.Content" xml:space="preserve">
+    <value>More colors...</value>
+    <comment>Text label for a button that allows the user to select from more colors in a new window. {Locked="..."}</comment>
+  </data>
+  <data name="NullableColorPicker_ColorPickerContentDialog.Title" xml:space="preserve">
+    <value>Pick a color</value>
+    <comment>Title displayed on a content dialog directing the user to pick a color.</comment>
+  </data>
+  <data name="NullableColorPicker_ColorPickerContentDialog.PrimaryButtonText" xml:space="preserve">
+    <value>OK</value>
+    <comment>Button label for the color picker content dialog. Used as confirmation to apply the selected color.</comment>
+  </data>
+  <data name="NullableColorPicker_ColorPickerContentDialog.SecondaryButtonText" xml:space="preserve">
+    <value>Cancel</value>
+    <comment>Text label for secondary button the color picker content dialog. When clicked, the operation of selecting a color is cancelled by the user.</comment>
+  </data>
+  <data name="Profile_CursorColor_NullableColorPicker.NullColorButtonLabel" xml:space="preserve">
+    <value>Use cursor color from color scheme</value>
+    <comment>Label for a button directing the user to use the cursor color defined in the terminal's current color scheme.</comment>
+  </data>
+  <data name="Profile_Foreground_NullableColorPicker.NullColorButtonLabel" xml:space="preserve">
+    <value>Use foreground color from color scheme</value>
+    <comment>Label for a button directing the user to use the foreground color defined in the terminal's current color scheme.</comment>
+  </data>
+  <data name="Profile_Background_NullableColorPicker.NullColorButtonLabel" xml:space="preserve">
+    <value>Use background color from color scheme</value>
+    <comment>Label for a button directing the user to use the background color defined in the terminal's current color scheme.</comment>
+  </data>
+  <data name="Profile_SelectionBackground_NullableColorPicker.NullColorButtonLabel" xml:space="preserve">
+    <value>Use selection background color from color scheme</value>
+    <comment>Label for a button directing the user to use the selection background color defined in the terminal's current color scheme.</comment>
+  </data>
+  <data name="Profile_IconTypeNone" xml:space="preserve">
+    <value>None</value>
+    <comment>An option to choose from for the "icon style" dropdown. When selected, there will be no icon for the profile.</comment>
+  </data>
+  <data name="Profile_IconTypeImage" xml:space="preserve">
+    <value>File</value>
+    <comment>An option to choose from for the "icon style" dropdown. When selected, a custom image can set for the profile's icon.</comment>
+  </data>
+  <data name="Profile_IconTypeEmoji" xml:space="preserve">
+    <value>Emoji</value>
+    <comment>An option to choose from for the "icon style" dropdown. When selected, an emoji can be set for the profile's icon.</comment>
+  </data>
+  <data name="Profile_IconTypeFontIcon" xml:space="preserve">
+    <value>Built-in Icon</value>
+    <comment>An option to choose from for the "icon style" dropdown. When selected, the user can choose from several preselected options to set the profile's icon.</comment>
+  </data>
+  <data name="Profile_IconEmojiBox.PlaceholderText" xml:space="preserve">
+    <value>Use "Win + period" to open the emoji picker</value>
+    <comment>"Win + period" refers to the OS key binding to open the emoji picker.</comment>
+  </data>
+  <data name="Profile_IconType.[using:Windows.UI.Xaml.Automation]AutomationProperties.Name" xml:space="preserve">
+    <value>Icon type</value>
+    <comment>Accessible name for a control allowing the user to select the type of icon they would like to use.</comment>
+  </data>
+  <data name="Profile_BuiltInIcon.[using:Windows.UI.Xaml.Automation]AutomationProperties.Name" xml:space="preserve">
+    <value>Icon</value>
+    <comment>Accessible name for a control allowing the user to select the icon from a list of built in icons.</comment>
+  </data>
   <data name="Profile_AnswerbackMessage.Header" xml:space="preserve">
     <value>ENQ (Request Terminal Status) response</value>
     <comment>{Locked=ENQ}{Locked="Request Terminal Status"} Header for a control to determine the response to the ENQ escape sequence. This is represented using a text box.</comment>
diff --git a/src/cascadia/TerminalSettingsEditor/SegoeFluentIconList.h b/src/cascadia/TerminalSettingsEditor/SegoeFluentIconList.h
new file mode 100644
index 00000000000..dd4dc480edd
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/SegoeFluentIconList.h
@@ -0,0 +1,1413 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+#pragma once
+
+#include <string>
+
+// Adapted from https://github.com/microsoft/WinUI-Gallery/blob/main/WinUIGallery/DataModel/IconsData.json
+static constexpr std::pair<std::wstring_view, std::wstring_view> s_SegoeFluentIcons[] = {
+    { L"\uE700", L"Global Nav Button" },
+    { L"\uE701", L"Wifi" },
+    { L"\uE702", L"Bluetooth" },
+    { L"\uE703", L"Connect" },
+    { L"\uE704", L"Internet Sharing" },
+    { L"\uE705", L"VPN" },
+    { L"\uE706", L"Brightness" },
+    { L"\uE707", L"Map Pin" },
+    { L"\uE708", L"Quiet Hours" },
+    { L"\uE709", L"Airplane" },
+    { L"\uE70A", L"Tablet" },
+    { L"\uE70B", L"Quick Note" },
+    { L"\uE70C", L"Remembered Device" },
+    { L"\uE70D", L"Chevron Down" },
+    { L"\uE70E", L"Chevron Up" },
+    { L"\uE70F", L"Edit" },
+    { L"\uE710", L"Add" },
+    { L"\uE711", L"Cancel" },
+    { L"\uE712", L"More" },
+    { L"\uE713", L"Settings" },
+    { L"\uE714", L"Video" },
+    { L"\uE715", L"Mail" },
+    { L"\uE716", L"People" },
+    { L"\uE717", L"Phone" },
+    { L"\uE718", L"Pin" },
+    { L"\uE719", L"Shop" },
+    { L"\uE71A", L"Stop" },
+    { L"\uE71B", L"Link" },
+    { L"\uE71C", L"Filter" },
+    { L"\uE71D", L"All Apps" },
+    { L"\uE71E", L"Zoom" },
+    { L"\uE71F", L"Zoom Out" },
+    { L"\uE720", L"Microphone" },
+    { L"\uE721", L"Search" },
+    { L"\uE722", L"Camera" },
+    { L"\uE723", L"Attach" },
+    { L"\uE724", L"Send" },
+    { L"\uE725", L"Send Fill" },
+    { L"\uE726", L"Walk Solid" },
+    { L"\uE727", L"In Private" },
+    { L"\uE728", L"Favorite List" },
+    { L"\uE729", L"Page Solid" },
+    { L"\uE72A", L"Forward" },
+    { L"\uE72B", L"Back" },
+    { L"\uE72C", L"Refresh" },
+    { L"\uE72D", L"Share" },
+    { L"\uE72E", L"Lock" },
+    { L"\uE730", L"Report Hacked" },
+    { L"\uE731", L"EMI" },
+    { L"\uE734", L"Favorite Star" },
+    { L"\uE735", L"Favorite Star Fill" },
+    { L"\uE736", L"Reading Mode" },
+    { L"\uE737", L"Favicon" },
+    { L"\uE738", L"Remove" },
+    { L"\uE739", L"Checkbox" },
+    { L"\uE73A", L"Checkbox Composite" },
+    { L"\uE73B", L"Checkbox Fill" },
+    { L"\uE73C", L"Checkbox Indeterminate" },
+    { L"\uE73D", L"Checkbox Composite Reversed" },
+    { L"\uE73E", L"Check Mark" },
+    { L"\uE73F", L"Back To Window" },
+    { L"\uE740", L"Full Screen" },
+    { L"\uE741", L"Resize Touch Larger" },
+    { L"\uE742", L"Resize Touch Smaller" },
+    { L"\uE743", L"Resize Mouse Small" },
+    { L"\uE744", L"Resize Mouse Medium" },
+    { L"\uE745", L"Resize Mouse Wide" },
+    { L"\uE746", L"Resize Mouse Tall" },
+    { L"\uE747", L"Resize Mouse Large" },
+    { L"\uE748", L"Switch User" },
+    { L"\uE749", L"Print" },
+    { L"\uE74A", L"Up" },
+    { L"\uE74B", L"Down" },
+    { L"\uE74C", L"OEM" },
+    { L"\uE74D", L"Delete" },
+    { L"\uE74E", L"Save" },
+    { L"\uE74F", L"Mute" },
+    { L"\uE750", L"Back Space QWERTY" },
+    { L"\uE751", L"Return Key" },
+    { L"\uE752", L"Up Arrow Shift Key" },
+    { L"\uE753", L"Cloud" },
+    { L"\uE754", L"Flashlight" },
+    { L"\uE755", L"Rotation Lock" },
+    { L"\uE756", L"Command Prompt" },
+    { L"\uE759", L"SIPMove" },
+    { L"\uE75A", L"SIPUndock" },
+    { L"\uE75B", L"SIPRedock" },
+    { L"\uE75C", L"Erase Tool" },
+    { L"\uE75D", L"Underscore Space" },
+    { L"\uE75E", L"Gripper Tool" },
+    { L"\uE75F", L"Dialpad" },
+    { L"\uE760", L"Page Left" },
+    { L"\uE761", L"Page Right" },
+    { L"\uE762", L"Multi Select" },
+    { L"\uE763", L"Keyboard Left Handed" },
+    { L"\uE764", L"Keyboard Right Handed" },
+    { L"\uE765", L"Keyboard Classic" },
+    { L"\uE766", L"Keyboard Split" },
+    { L"\uE767", L"Volume" },
+    { L"\uE768", L"Play" },
+    { L"\uE769", L"Pause" },
+    { L"\uE76B", L"Chevron Left" },
+    { L"\uE76C", L"Chevron Right" },
+    { L"\uE76D", L"Inking Tool" },
+    { L"\uE76E", L"Emoji 2" },
+    { L"\uE76F", L"Gripper Bar Horizontal" },
+    { L"\uE770", L"System" },
+    { L"\uE771", L"Personalize" },
+    { L"\uE772", L"Devices" },
+    { L"\uE773", L"Search And Apps" },
+    { L"\uE774", L"Globe" },
+    { L"\uE775", L"Time Language" },
+    { L"\uE776", L"Ease Of Access" },
+    { L"\uE777", L"Update Restore" },
+    { L"\uE778", L"Hang Up" },
+    { L"\uE779", L"Contact Info" },
+    { L"\uE77A", L"Unpin" },
+    { L"\uE77B", L"Contact" },
+    { L"\uE77C", L"Memo" },
+    { L"\uE77E", L"Incoming Call" },
+    { L"\uE77F", L"Paste" },
+    { L"\uE780", L"Phone Book" },
+    { L"\uE781", L"LEDLight" },
+    { L"\uE783", L"Error" },
+    { L"\uE784", L"Gripper Bar Vertical" },
+    { L"\uE785", L"Unlock" },
+    { L"\uE786", L"Slideshow" },
+    { L"\uE787", L"Calendar" },
+    { L"\uE788", L"Gripper Resize" },
+    { L"\uE789", L"Megaphone" },
+    { L"\uE78A", L"Trim" },
+    { L"\uE78B", L"New Window" },
+    { L"\uE78C", L"Save Local" },
+    { L"\uE790", L"Color" },
+    { L"\uE791", L"Data Sense" },
+    { L"\uE792", L"Save As" },
+    { L"\uE793", L"Light" },
+    { L"\uE799", L"Aspect Ratio" },
+    { L"\uE7A5", L"Data Sense Bar" },
+    { L"\uE7A6", L"Redo" },
+    { L"\uE7A7", L"Undo" },
+    { L"\uE7A8", L"Crop" },
+    { L"\uE7AC", L"Open With" },
+    { L"\uE7AD", L"Rotate" },
+    { L"\uE7B3", L"Red Eye" },
+    { L"\uE7B5", L"Setlock Screen" },
+    { L"\uE7B7", L"Map Pin 2" },
+    { L"\uE7B8", L"Package" },
+    { L"\uE7BA", L"Warning" },
+    { L"\uE7BC", L"Reading List" },
+    { L"\uE7BE", L"Education" },
+    { L"\uE7BF", L"Shopping Cart" },
+    { L"\uE7C0", L"Train" },
+    { L"\uE7C1", L"Flag" },
+    { L"\uE7C2", L"Move" },
+    { L"\uE7C3", L"Page" },
+    { L"\uE7C4", L"Task View" },
+    { L"\uE7C5", L"Browse Photos" },
+    { L"\uE7C6", L"Half Star Left" },
+    { L"\uE7C7", L"Half Star Right" },
+    { L"\uE7C8", L"Record" },
+    { L"\uE7C9", L"Touch Pointer" },
+    { L"\uE7DE", L"Lang JPN" },
+    { L"\uE7E3", L"Ferry" },
+    { L"\uE7E6", L"Highlight" },
+    { L"\uE7E7", L"Action Center Notification" },
+    { L"\uE7E8", L"Power Button" },
+    { L"\uE7EA", L"Resize Touch Narrower" },
+    { L"\uE7EB", L"Resize Touch Shorter" },
+    { L"\uE7EC", L"Driving Mode" },
+    { L"\uE7ED", L"Ringer Silent" },
+    { L"\uE7EE", L"Other User" },
+    { L"\uE7EF", L"Admin" },
+    { L"\uE7F0", L"CC" },
+    { L"\uE7F1", L"SDCard" },
+    { L"\uE7F2", L"Call Forwarding" },
+    { L"\uE7F3", L"Settings Display Sound" },
+    { L"\uE7F4", L"TVMonitor" },
+    { L"\uE7F5", L"Speakers" },
+    { L"\uE7F6", L"Headphone" },
+    { L"\uE7F7", L"Device Laptop Pic" },
+    { L"\uE7F8", L"Device Laptop No Pic" },
+    { L"\uE7F9", L"Device Monitor Right Pic" },
+    { L"\uE7FA", L"Device Monitor Left Pic" },
+    { L"\uE7FB", L"Device Monitor No Pic" },
+    { L"\uE7FC", L"Game" },
+    { L"\uE7FD", L"Horizontal Tab Key" },
+    { L"\uE802", L"Streetside Split Minimize" },
+    { L"\uE803", L"Streetside Split Expand" },
+    { L"\uE804", L"Car" },
+    { L"\uE805", L"Walk" },
+    { L"\uE806", L"Bus" },
+    { L"\uE809", L"Tilt Up" },
+    { L"\uE80A", L"Tilt Down" },
+    { L"\uE80B", L"Call Control" },
+    { L"\uE80C", L"Rotate Map Right" },
+    { L"\uE80D", L"Rotate Map Left" },
+    { L"\uE80F", L"Home" },
+    { L"\uE811", L"Parking Location" },
+    { L"\uE812", L"Map Compass Top" },
+    { L"\uE813", L"Map Compass Bottom" },
+    { L"\uE814", L"Incident Triangle" },
+    { L"\uE815", L"Touch" },
+    { L"\uE816", L"Map Directions" },
+    { L"\uE819", L"Start Point" },
+    { L"\uE81A", L"Stop Point" },
+    { L"\uE81B", L"End Point" },
+    { L"\uE81C", L"History" },
+    { L"\uE81D", L"Location" },
+    { L"\uE81E", L"Map Layers" },
+    { L"\uE81F", L"Accident" },
+    { L"\uE821", L"Work" },
+    { L"\uE822", L"Construction" },
+    { L"\uE823", L"Recent" },
+    { L"\uE825", L"Bank" },
+    { L"\uE826", L"Download Map" },
+    { L"\uE829", L"Inking Tool Fill 2" },
+    { L"\uE82A", L"Highlight Fill 2" },
+    { L"\uE82B", L"Erase Tool Fill" },
+    { L"\uE82C", L"Erase Tool Fill 2" },
+    { L"\uE82D", L"Dictionary" },
+    { L"\uE82E", L"Dictionary Add" },
+    { L"\uE82F", L"Tool Tip" },
+    { L"\uE830", L"Chrome Back" },
+    { L"\uE835", L"Provisioning Package" },
+    { L"\uE836", L"Add Remote Device" },
+    { L"\uE838", L"Folder Open" },
+    { L"\uE839", L"Ethernet" },
+    { L"\uE83A", L"Share Broadband" },
+    { L"\uE83B", L"Direct Access" },
+    { L"\uE83C", L"Dial Up" },
+    { L"\uE83D", L"Defender App" },
+    { L"\uE83E", L"Battery Charging 9" },
+    { L"\uE83F", L"Battery 10" },
+    { L"\uE840", L"Pinned" },
+    { L"\uE841", L"Pin Fill" },
+    { L"\uE842", L"Pinned Fill" },
+    { L"\uE843", L"Period Key" },
+    { L"\uE844", L"Punc Key" },
+    { L"\uE845", L"Rev Toggle Key" },
+    { L"\uE846", L"Right Arrow Key Time 1" },
+    { L"\uE847", L"Right Arrow Key Time 2" },
+    { L"\uE848", L"Left Quote" },
+    { L"\uE849", L"Right Quote" },
+    { L"\uE84A", L"Down Shift Key" },
+    { L"\uE84B", L"Up Shift Key" },
+    { L"\uE84C", L"Punc Key 0" },
+    { L"\uE84D", L"Punc Key Left Bottom" },
+    { L"\uE84E", L"Right Arrow Key Time 3" },
+    { L"\uE84F", L"Right Arrow Key Time 4" },
+    { L"\uE850", L"Battery 0" },
+    { L"\uE851", L"Battery 1" },
+    { L"\uE852", L"Battery 2" },
+    { L"\uE853", L"Battery 3" },
+    { L"\uE854", L"Battery 4" },
+    { L"\uE855", L"Battery 5" },
+    { L"\uE856", L"Battery 6" },
+    { L"\uE857", L"Battery 7" },
+    { L"\uE858", L"Battery 8" },
+    { L"\uE859", L"Battery 9" },
+    { L"\uE85A", L"Battery Charging 0" },
+    { L"\uE85B", L"Battery Charging 1" },
+    { L"\uE85C", L"Battery Charging 2" },
+    { L"\uE85D", L"Battery Charging 3" },
+    { L"\uE85E", L"Battery Charging 4" },
+    { L"\uE85F", L"Battery Charging 5" },
+    { L"\uE860", L"Battery Charging 6" },
+    { L"\uE861", L"Battery Charging 7" },
+    { L"\uE862", L"Battery Charging 8" },
+    { L"\uE863", L"Battery Saver 0" },
+    { L"\uE864", L"Battery Saver 1" },
+    { L"\uE865", L"Battery Saver 2" },
+    { L"\uE866", L"Battery Saver 3" },
+    { L"\uE867", L"Battery Saver 4" },
+    { L"\uE868", L"Battery Saver 5" },
+    { L"\uE869", L"Battery Saver 6" },
+    { L"\uE86A", L"Battery Saver 7" },
+    { L"\uE86B", L"Battery Saver 8" },
+    { L"\uE86C", L"Signal Bars 1" },
+    { L"\uE86D", L"Signal Bars 2" },
+    { L"\uE86E", L"Signal Bars 3" },
+    { L"\uE86F", L"Signal Bars 4" },
+    { L"\uE870", L"Signal Bars 5" },
+    { L"\uE871", L"Signal Not Connected" },
+    { L"\uE872", L"Wifi 1" },
+    { L"\uE873", L"Wifi 2" },
+    { L"\uE874", L"Wifi 3" },
+    { L"\uE875", L"Mob SIMLock" },
+    { L"\uE876", L"Mob SIMMissing" },
+    { L"\uE877", L"Vibrate" },
+    { L"\uE878", L"Roaming International" },
+    { L"\uE879", L"Roaming Domestic" },
+    { L"\uE87A", L"Call Forward International" },
+    { L"\uE87B", L"Call Forward Roaming" },
+    { L"\uE87C", L"Jpn Romaji" },
+    { L"\uE87D", L"Jpn Romaji Lock" },
+    { L"\uE87E", L"Jpn Romaji Shift" },
+    { L"\uE87F", L"Jpn Romaji Shift Lock" },
+    { L"\uE880", L"Status Data Transfer" },
+    { L"\uE881", L"Status Data Transfer VPN" },
+    { L"\uE882", L"Status Dual SIM2" },
+    { L"\uE883", L"Status Dual SIM2VPN" },
+    { L"\uE884", L"Status Dual SIM1" },
+    { L"\uE885", L"Status Dual SIM1VPN" },
+    { L"\uE886", L"Status SGLTE" },
+    { L"\uE887", L"Status SGLTECell" },
+    { L"\uE888", L"Status SGLTEData VPN" },
+    { L"\uE889", L"Status VPN" },
+    { L"\uE88A", L"Wifi Hotspot" },
+    { L"\uE88B", L"Language Kor" },
+    { L"\uE88C", L"Language Cht" },
+    { L"\uE88D", L"Language Chs" },
+    { L"\uE88E", L"USB" },
+    { L"\uE88F", L"Inking Tool Fill" },
+    { L"\uE890", L"View" },
+    { L"\uE891", L"Highlight Fill" },
+    { L"\uE892", L"Previous" },
+    { L"\uE893", L"Next" },
+    { L"\uE894", L"Clear" },
+    { L"\uE895", L"Sync" },
+    { L"\uE896", L"Download" },
+    { L"\uE897", L"Help" },
+    { L"\uE898", L"Upload" },
+    { L"\uE899", L"Emoji" },
+    { L"\uE89A", L"Two Page" },
+    { L"\uE89B", L"Leave Chat" },
+    { L"\uE89C", L"Mail Forward" },
+    { L"\uE89E", L"Rotate Camera" },
+    { L"\uE89F", L"Close Pane" },
+    { L"\uE8A0", L"Open Pane" },
+    { L"\uE8A1", L"Preview Link" },
+    { L"\uE8A2", L"Attach Camera" },
+    { L"\uE8A3", L"Zoom In" },
+    { L"\uE8A4", L"Bookmarks" },
+    { L"\uE8A5", L"Document" },
+    { L"\uE8A6", L"Protected Document" },
+    { L"\uE8A7", L"Open In New Window" },
+    { L"\uE8A8", L"Mail Fill" },
+    { L"\uE8A9", L"View All" },
+    { L"\uE8AA", L"Video Chat" },
+    { L"\uE8AB", L"Switch" },
+    { L"\uE8AC", L"Rename" },
+    { L"\uE8AD", L"Go" },
+    { L"\uE8AE", L"Surface Hub" },
+    { L"\uE8AF", L"Remote" },
+    { L"\uE8B0", L"Click" },
+    { L"\uE8B1", L"Shuffle" },
+    { L"\uE8B2", L"Movies" },
+    { L"\uE8B3", L"Select All" },
+    { L"\uE8B4", L"Orientation" },
+    { L"\uE8B5", L"Import" },
+    { L"\uE8B6", L"Import All" },
+    { L"\uE8B7", L"Folder" },
+    { L"\uE8B8", L"Webcam" },
+    { L"\uE8B9", L"Picture" },
+    { L"\uE8BA", L"Caption" },
+    { L"\uE8BB", L"Chrome Close" },
+    { L"\uE8BC", L"Show Results" },
+    { L"\uE8BD", L"Message" },
+    { L"\uE8BE", L"Leaf" },
+    { L"\uE8BF", L"Calendar Day" },
+    { L"\uE8C0", L"Calendar Week" },
+    { L"\uE8C1", L"Characters" },
+    { L"\uE8C2", L"Mail Reply All" },
+    { L"\uE8C3", L"Read" },
+    { L"\uE8C4", L"Show Bcc" },
+    { L"\uE8C5", L"Hide Bcc" },
+    { L"\uE8C6", L"Cut" },
+    { L"\uE8C7", L"Payment Card" },
+    { L"\uE8C8", L"Copy" },
+    { L"\uE8C9", L"Important" },
+    { L"\uE8CA", L"Mail Reply" },
+    { L"\uE8CB", L"Sort" },
+    { L"\uE8CC", L"Mobile Tablet" },
+    { L"\uE8CD", L"Disconnect Drive" },
+    { L"\uE8CE", L"Map Drive" },
+    { L"\uE8CF", L"Contact Presence" },
+    { L"\uE8D0", L"Priority" },
+    { L"\uE8D1", L"Goto Today" },
+    { L"\uE8D2", L"Font" },
+    { L"\uE8D3", L"Font Color" },
+    { L"\uE8D4", L"Contact 2" },
+    { L"\uE8D5", L"Folder Fill" },
+    { L"\uE8D6", L"Audio" },
+    { L"\uE8D7", L"Permissions" },
+    { L"\uE8D8", L"Disable Updates" },
+    { L"\uE8D9", L"Unfavorite" },
+    { L"\uE8DA", L"Open Local" },
+    { L"\uE8DB", L"Italic" },
+    { L"\uE8DC", L"Underline" },
+    { L"\uE8DD", L"Bold" },
+    { L"\uE8DE", L"Move To Folder" },
+    { L"\uE8DF", L"Like Dislike" },
+    { L"\uE8E0", L"Dislike" },
+    { L"\uE8E1", L"Like" },
+    { L"\uE8E2", L"Align Right" },
+    { L"\uE8E3", L"Align Center" },
+    { L"\uE8E4", L"Align Left" },
+    { L"\uE8E5", L"Open File" },
+    { L"\uE8E6", L"Clear Selection" },
+    { L"\uE8E7", L"Font Decrease" },
+    { L"\uE8E8", L"Font Increase" },
+    { L"\uE8E9", L"Font Size" },
+    { L"\uE8EA", L"Cell Phone" },
+    { L"\uE8EB", L"Reshare" },
+    { L"\uE8EC", L"Tag" },
+    { L"\uE8ED", L"Repeat One" },
+    { L"\uE8EE", L"Repeat All" },
+    { L"\uE8EF", L"Calculator" },
+    { L"\uE8F0", L"Directions" },
+    { L"\uE8F1", L"Library" },
+    { L"\uE8F2", L"Chat Bubbles" },
+    { L"\uE8F3", L"Post Update" },
+    { L"\uE8F4", L"New Folder" },
+    { L"\uE8F5", L"Calendar Reply" },
+    { L"\uE8F6", L"Unsync Folder" },
+    { L"\uE8F7", L"Sync Folder" },
+    { L"\uE8F8", L"Block Contact" },
+    { L"\uE8F9", L"Switch Apps" },
+    { L"\uE8FA", L"Add Friend" },
+    { L"\uE8FB", L"Accept" },
+    { L"\uE8FC", L"Go To Start" },
+    { L"\uE8FD", L"Bulleted List" },
+    { L"\uE8FE", L"Scan" },
+    { L"\uE8FF", L"Preview" },
+    { L"\uE902", L"Group" },
+    { L"\uE904", L"Zero Bars" },
+    { L"\uE905", L"One Bar" },
+    { L"\uE906", L"Two Bars" },
+    { L"\uE907", L"Three Bars" },
+    { L"\uE908", L"Four Bars" },
+    { L"\uE909", L"World" },
+    { L"\uE90A", L"Comment" },
+    { L"\uE90B", L"Music Info" },
+    { L"\uE90C", L"Dock Left" },
+    { L"\uE90D", L"Dock Right" },
+    { L"\uE90E", L"Dock Bottom" },
+    { L"\uE90F", L"Repair" },
+    { L"\uE910", L"Accounts" },
+    { L"\uE911", L"Dull Sound" },
+    { L"\uE912", L"Manage" },
+    { L"\uE913", L"Street" },
+    { L"\uE914", L"Printer 3D" },
+    { L"\uE915", L"Radio Bullet" },
+    { L"\uE916", L"Stopwatch" },
+    { L"\uE91B", L"Photo" },
+    { L"\uE91C", L"Action Center" },
+    { L"\uE91F", L"Full Circle Mask" },
+    { L"\uE921", L"Chrome Minimize" },
+    { L"\uE922", L"Chrome Maximize" },
+    { L"\uE923", L"Chrome Restore" },
+    { L"\uE924", L"Annotation" },
+    { L"\uE925", L"Back Space QWERTY Small" },
+    { L"\uE926", L"Back Space QWERTY Medium" },
+    { L"\uE927", L"Swipe" },
+    { L"\uE928", L"Fingerprint" },
+    { L"\uE929", L"Handwriting" },
+    { L"\uE92C", L"Chrome Back To Window" },
+    { L"\uE92D", L"Chrome Full Screen" },
+    { L"\uE92E", L"Keyboard Standard" },
+    { L"\uE92F", L"Keyboard Dismiss" },
+    { L"\uE930", L"Completed" },
+    { L"\uE931", L"Chrome Annotate" },
+    { L"\uE932", L"Label" },
+    { L"\uE933", L"IBeam" },
+    { L"\uE934", L"IBeam Outline" },
+    { L"\uE935", L"Flick Down" },
+    { L"\uE936", L"Flick Up" },
+    { L"\uE937", L"Flick Left" },
+    { L"\uE938", L"Flick Right" },
+    { L"\uE939", L"Feedback App" },
+    { L"\uE93C", L"Music Album" },
+    { L"\uE93E", L"Streaming" },
+    { L"\uE943", L"Code" },
+    { L"\uE944", L"Return To Window" },
+    { L"\uE945", L"Lightning Bolt" },
+    { L"\uE946", L"Info" },
+    { L"\uE947", L"Calculator Multiply" },
+    { L"\uE948", L"Calculator Addition" },
+    { L"\uE949", L"Calculator Subtract" },
+    { L"\uE94A", L"Calculator Divide" },
+    { L"\uE94B", L"Calculator Squareroot" },
+    { L"\uE94C", L"Calculator Percentage" },
+    { L"\uE94D", L"Calculator Negate" },
+    { L"\uE94E", L"Calculator Equal To" },
+    { L"\uE94F", L"Calculator Backspace" },
+    { L"\uE950", L"Component" },
+    { L"\uE951", L"DMC" },
+    { L"\uE952", L"Dock" },
+    { L"\uE953", L"Multimedia DMS" },
+    { L"\uE954", L"Multimedia DVR" },
+    { L"\uE955", L"Multimedia PMP" },
+    { L"\uE956", L"Printfax Printer File" },
+    { L"\uE957", L"Sensor" },
+    { L"\uE958", L"Storage Optical" },
+    { L"\uE95A", L"Communications" },
+    { L"\uE95B", L"Headset" },
+    { L"\uE95D", L"Projector" },
+    { L"\uE95E", L"Health" },
+    { L"\uE95F", L"Wire" },
+    { L"\uE960", L"Webcam 2" },
+    { L"\uE961", L"Input" },
+    { L"\uE962", L"Mouse" },
+    { L"\uE963", L"Smartcard" },
+    { L"\uE964", L"Smartcard Virtual" },
+    { L"\uE965", L"Media Storage Tower" },
+    { L"\uE966", L"Return Key Sm" },
+    { L"\uE967", L"Game Console" },
+    { L"\uE968", L"Network" },
+    { L"\uE969", L"Storage Network Wireless" },
+    { L"\uE96A", L"Storage Tape" },
+    { L"\uE96D", L"Chevron Up Small" },
+    { L"\uE96E", L"Chevron Down Small" },
+    { L"\uE96F", L"Chevron Left Small" },
+    { L"\uE970", L"Chevron Right Small" },
+    { L"\uE971", L"Chevron Up Med" },
+    { L"\uE972", L"Chevron Down Med" },
+    { L"\uE973", L"Chevron Left Med" },
+    { L"\uE974", L"Chevron Right Med" },
+    { L"\uE975", L"Devices 2" },
+    { L"\uE976", L"Expand Tile" },
+    { L"\uE977", L"PC1" },
+    { L"\uE978", L"Presence Chicklet" },
+    { L"\uE979", L"Presence Chicklet Video" },
+    { L"\uE97A", L"Reply" },
+    { L"\uE97B", L"Set Tile" },
+    { L"\uE97C", L"Type" },
+    { L"\uE97D", L"Korean" },
+    { L"\uE97E", L"Half Alpha" },
+    { L"\uE97F", L"Full Alpha" },
+    { L"\uE980", L"Key 12On" },
+    { L"\uE981", L"Chinese Changjie" },
+    { L"\uE982", L"QWERTY On" },
+    { L"\uE983", L"QWERTY Off" },
+    { L"\uE984", L"Chinese Quick" },
+    { L"\uE985", L"Japanese" },
+    { L"\uE986", L"Full Hiragana" },
+    { L"\uE987", L"Full Katakana" },
+    { L"\uE988", L"Half Katakana" },
+    { L"\uE989", L"Chinese Bo Po Mo Fo" },
+    { L"\uE98A", L"Chinese Pinyin" },
+    { L"\uE98F", L"Construction Cone" },
+    { L"\uE990", L"Xbox One Console" },
+    { L"\uE992", L"Volume 0" },
+    { L"\uE993", L"Volume 1" },
+    { L"\uE994", L"Volume 2" },
+    { L"\uE995", L"Volume 3" },
+    { L"\uE996", L"Battery Unknown" },
+    { L"\uE998", L"Wifi Attention Overlay" },
+    { L"\uE99A", L"Robot" },
+    { L"\uE9A1", L"Tap And Send" },
+    { L"\uE9A6", L"Fit Page" },
+    { L"\uE9A8", L"Password Key Show" },
+    { L"\uE9A9", L"Password Key Hide" },
+    { L"\uE9AA", L"Bidi Ltr" },
+    { L"\uE9AB", L"Bidi Rtl" },
+    { L"\uE9AC", L"Forward Sm" },
+    { L"\uE9AD", L"Comma Key" },
+    { L"\uE9AE", L"Dash Key" },
+    { L"\uE9AF", L"Dull Sound Key" },
+    { L"\uE9B0", L"Half Dull Sound" },
+    { L"\uE9B1", L"Right Double Quote" },
+    { L"\uE9B2", L"Left Double Quote" },
+    { L"\uE9B3", L"Punc Key Right Bottom" },
+    { L"\uE9B4", L"Punc Key 1" },
+    { L"\uE9B5", L"Punc Key 2" },
+    { L"\uE9B6", L"Punc Key 3" },
+    { L"\uE9B7", L"Punc Key 4" },
+    { L"\uE9B8", L"Punc Key 5" },
+    { L"\uE9B9", L"Punc Key 6" },
+    { L"\uE9BA", L"Punc Key 9" },
+    { L"\uE9BB", L"Punc Key 7" },
+    { L"\uE9BC", L"Punc Key 8" },
+    { L"\uE9CA", L"Frigid" },
+    { L"\uE9CE", L"Unknown" },
+    { L"\uE9D2", L"Area Chart" },
+    { L"\uE9D5", L"Check List" },
+    { L"\uE9D9", L"Diagnostic" },
+    { L"\uE9E9", L"Equalizer" },
+    { L"\uE9F3", L"Process" },
+    { L"\uE9F5", L"Processing" },
+    { L"\uE9F9", L"Report Document" },
+    { L"\uEA0C", L"Video Solid" },
+    { L"\uEA0D", L"Mixed Media Badge" },
+    { L"\uEA14", L"Disconnect Display" },
+    { L"\uEA18", L"Shield" },
+    { L"\uEA1F", L"Info 2" },
+    { L"\uEA21", L"Action Center Asterisk" },
+    { L"\uEA24", L"Beta" },
+    { L"\uEA35", L"Save Copy" },
+    { L"\uEA37", L"List" },
+    { L"\uEA38", L"Asterisk" },
+    { L"\uEA39", L"Error Badge" },
+    { L"\uEA3A", L"Circle Ring" },
+    { L"\uEA3B", L"Circle Fill" },
+    { L"\uEA3C", L"Merge Call" },
+    { L"\uEA3D", L"Private Call" },
+    { L"\uEA3F", L"Record 2" },
+    { L"\uEA40", L"All Apps Mirrored" },
+    { L"\uEA41", L"Bookmarks Mirrored" },
+    { L"\uEA42", L"Bulleted List Mirrored" },
+    { L"\uEA43", L"Call Forward International Mirrored" },
+    { L"\uEA44", L"Call Forward Roaming Mirrored" },
+    { L"\uEA47", L"Chrome Back Mirrored" },
+    { L"\uEA48", L"Clear Selection Mirrored" },
+    { L"\uEA49", L"Close Pane Mirrored" },
+    { L"\uEA4A", L"Contact Info Mirrored" },
+    { L"\uEA4B", L"Dock Right Mirrored" },
+    { L"\uEA4C", L"Dock Left Mirrored" },
+    { L"\uEA4E", L"Expand Tile Mirrored" },
+    { L"\uEA4F", L"Go Mirrored" },
+    { L"\uEA50", L"Gripper Resize Mirrored" },
+    { L"\uEA51", L"Help Mirrored" },
+    { L"\uEA52", L"Import Mirrored" },
+    { L"\uEA53", L"Import All Mirrored" },
+    { L"\uEA54", L"Leave Chat Mirrored" },
+    { L"\uEA55", L"List Mirrored" },
+    { L"\uEA56", L"Mail Forward Mirrored" },
+    { L"\uEA57", L"Mail Reply Mirrored" },
+    { L"\uEA58", L"Mail Reply All Mirrored" },
+    { L"\uEA5B", L"Open Pane Mirrored" },
+    { L"\uEA5C", L"Open With Mirrored" },
+    { L"\uEA5E", L"Parking Location Mirrored" },
+    { L"\uEA5F", L"Resize Mouse Medium Mirrored" },
+    { L"\uEA60", L"Resize Mouse Small Mirrored" },
+    { L"\uEA61", L"Resize Mouse Tall Mirrored" },
+    { L"\uEA62", L"Resize Touch Narrower Mirrored" },
+    { L"\uEA63", L"Send Mirrored" },
+    { L"\uEA64", L"Send Fill Mirrored" },
+    { L"\uEA65", L"Show Results Mirrored" },
+    { L"\uEA69", L"Media" },
+    { L"\uEA6A", L"Sync Error" },
+    { L"\uEA6C", L"Devices 3" },
+    { L"\uEA79", L"Slow Motion On" },
+    { L"\uEA80", L"Lightbulb" },
+    { L"\uEA81", L"Status Circle" },
+    { L"\uEA82", L"Status Triangle" },
+    { L"\uEA83", L"Status Error" },
+    { L"\uEA84", L"Status Warning" },
+    { L"\uEA86", L"Puzzle" },
+    { L"\uEA89", L"Calendar Solid" },
+    { L"\uEA8A", L"Home Solid" },
+    { L"\uEA8B", L"Parking Location Solid" },
+    { L"\uEA8C", L"Contact Solid" },
+    { L"\uEA8D", L"Construction Solid" },
+    { L"\uEA8E", L"Accident Solid" },
+    { L"\uEA8F", L"Ringer" },
+    { L"\uEA90", L"PDF" },
+    { L"\uEA91", L"Thought Bubble" },
+    { L"\uEA92", L"Heart Broken" },
+    { L"\uEA93", L"Battery Charging 10" },
+    { L"\uEA94", L"Battery Saver 9" },
+    { L"\uEA95", L"Battery Saver 10" },
+    { L"\uEA97", L"Call Forwarding Mirrored" },
+    { L"\uEA98", L"Multi Select Mirrored" },
+    { L"\uEA99", L"Broom" },
+    { L"\uEAC2", L"Forward Call" },
+    { L"\uEADF", L"Trackers" },
+    { L"\uEAFC", L"Market" },
+    { L"\uEB05", L"Pie Single" },
+    { L"\uEB0F", L"Stock Up" },
+    { L"\uEB11", L"Stock Down" },
+    { L"\uEB3C", L"Design" },
+    { L"\uEB41", L"Website" },
+    { L"\uEB42", L"Drop" },
+    { L"\uEB44", L"Radar" },
+    { L"\uEB47", L"Bus Solid" },
+    { L"\uEB48", L"Ferry Solid" },
+    { L"\uEB49", L"Start Point Solid" },
+    { L"\uEB4A", L"Stop Point Solid" },
+    { L"\uEB4B", L"End Point Solid" },
+    { L"\uEB4C", L"Airplane Solid" },
+    { L"\uEB4D", L"Train Solid" },
+    { L"\uEB4E", L"Work Solid" },
+    { L"\uEB4F", L"Reminder Fill" },
+    { L"\uEB50", L"Reminder" },
+    { L"\uEB51", L"Heart" },
+    { L"\uEB52", L"Heart Fill" },
+    { L"\uEB55", L"Ethernet Error" },
+    { L"\uEB56", L"Ethernet Warning" },
+    { L"\uEB57", L"Status Connecting 1" },
+    { L"\uEB58", L"Status Connecting 2" },
+    { L"\uEB59", L"Status Unsecure" },
+    { L"\uEB5A", L"Wifi Error 0" },
+    { L"\uEB5B", L"Wifi Error 1" },
+    { L"\uEB5C", L"Wifi Error 2" },
+    { L"\uEB5D", L"Wifi Error 3" },
+    { L"\uEB5E", L"Wifi Error 4" },
+    { L"\uEB5F", L"Wifi Warning 0" },
+    { L"\uEB60", L"Wifi Warning 1" },
+    { L"\uEB61", L"Wifi Warning 2" },
+    { L"\uEB62", L"Wifi Warning 3" },
+    { L"\uEB63", L"Wifi Warning 4" },
+    { L"\uEB66", L"Devices 4" },
+    { L"\uEB67", L"NUIIris" },
+    { L"\uEB68", L"NUIFace" },
+    { L"\uEB77", L"Gateway Router" },
+    { L"\uEB7E", L"Edit Mirrored" },
+    { L"\uEB82", L"NUIFPStart Slide Hand" },
+    { L"\uEB83", L"NUIFPStart Slide Action" },
+    { L"\uEB84", L"NUIFPContinue Slide Hand" },
+    { L"\uEB85", L"NUIFPContinue Slide Action" },
+    { L"\uEB86", L"NUIFPRoll Right Hand" },
+    { L"\uEB87", L"NUIFPRoll Right Hand Action" },
+    { L"\uEB88", L"NUIFPRoll Left Hand" },
+    { L"\uEB89", L"NUIFPRoll Left Action" },
+    { L"\uEB8A", L"NUIFPPress Hand" },
+    { L"\uEB8B", L"NUIFPPress Action" },
+    { L"\uEB8C", L"NUIFPPress Repeat Hand" },
+    { L"\uEB8D", L"NUIFPPress Repeat Action" },
+    { L"\uEB90", L"Status Error Full" },
+    { L"\uEB91", L"Task View Expanded" },
+    { L"\uEB95", L"Certificate" },
+    { L"\uEB96", L"Back Space QWERTY Large" },
+    { L"\uEB97", L"Return Key Lg" },
+    { L"\uEB9D", L"Fast Forward" },
+    { L"\uEB9E", L"Rewind" },
+    { L"\uEB9F", L"Photo 2" },
+    { L"\uEBA0", L"Mob Battery 0" },
+    { L"\uEBA1", L"Mob Battery 1" },
+    { L"\uEBA2", L"Mob Battery 2" },
+    { L"\uEBA3", L"Mob Battery 3" },
+    { L"\uEBA4", L"Mob Battery 4" },
+    { L"\uEBA5", L"Mob Battery 5" },
+    { L"\uEBA6", L"Mob Battery 6" },
+    { L"\uEBA7", L"Mob Battery 7" },
+    { L"\uEBA8", L"Mob Battery 8" },
+    { L"\uEBA9", L"Mob Battery 9" },
+    { L"\uEBAA", L"Mob Battery 10" },
+    { L"\uEBAB", L"Mob Battery Charging 0" },
+    { L"\uEBAC", L"Mob Battery Charging 1" },
+    { L"\uEBAD", L"Mob Battery Charging 2" },
+    { L"\uEBAE", L"Mob Battery Charging 3" },
+    { L"\uEBAF", L"Mob Battery Charging 4" },
+    { L"\uEBB0", L"Mob Battery Charging 5" },
+    { L"\uEBB1", L"Mob Battery Charging 6" },
+    { L"\uEBB2", L"Mob Battery Charging 7" },
+    { L"\uEBB3", L"Mob Battery Charging 8" },
+    { L"\uEBB4", L"Mob Battery Charging 9" },
+    { L"\uEBB5", L"Mob Battery Charging 10" },
+    { L"\uEBB6", L"Mob Battery Saver 0" },
+    { L"\uEBB7", L"Mob Battery Saver 1" },
+    { L"\uEBB8", L"Mob Battery Saver 2" },
+    { L"\uEBB9", L"Mob Battery Saver 3" },
+    { L"\uEBBA", L"Mob Battery Saver 4" },
+    { L"\uEBBB", L"Mob Battery Saver 5" },
+    { L"\uEBBC", L"Mob Battery Saver 6" },
+    { L"\uEBBD", L"Mob Battery Saver 7" },
+    { L"\uEBBE", L"Mob Battery Saver 8" },
+    { L"\uEBBF", L"Mob Battery Saver 9" },
+    { L"\uEBC0", L"Mob Battery Saver 10" },
+    { L"\uEBC3", L"Dictionary Cloud" },
+    { L"\uEBC4", L"Reset Drive" },
+    { L"\uEBC5", L"Volume Bars" },
+    { L"\uEBC6", L"Project" },
+    { L"\uEBD2", L"Adjust Hologram" },
+    { L"\uEBD3", L"Cloud Download" },
+    { L"\uEBD4", L"Mob Wifi Call Bars" },
+    { L"\uEBD5", L"Mob Wifi Call 0" },
+    { L"\uEBD6", L"Mob Wifi Call 1" },
+    { L"\uEBD7", L"Mob Wifi Call 2" },
+    { L"\uEBD8", L"Mob Wifi Call 3" },
+    { L"\uEBD9", L"Mob Wifi Call 4" },
+    { L"\uEBDA", L"Family" },
+    { L"\uEBDB", L"Lock Feedback" },
+    { L"\uEBDE", L"Device Discovery" },
+    { L"\uEBE6", L"Wind Direction" },
+    { L"\uEBE7", L"Right Arrow Key Time 0" },
+    { L"\uEBE8", L"Bug" },
+    { L"\uEBFC", L"Tablet Mode" },
+    { L"\uEBFD", L"Status Circle Left" },
+    { L"\uEBFE", L"Status Triangle Left" },
+    { L"\uEBFF", L"Status Error Left" },
+    { L"\uEC00", L"Status Warning Left" },
+    { L"\uEC02", L"Mob Battery Unknown" },
+    { L"\uEC05", L"Network Tower" },
+    { L"\uEC06", L"City Next" },
+    { L"\uEC07", L"City Next 2" },
+    { L"\uEC08", L"Courthouse" },
+    { L"\uEC09", L"Groceries" },
+    { L"\uEC0A", L"Sustainable" },
+    { L"\uEC0B", L"Building Energy" },
+    { L"\uEC11", L"Toggle Filled" },
+    { L"\uEC12", L"Toggle Border" },
+    { L"\uEC13", L"Slider Thumb" },
+    { L"\uEC14", L"Toggle Thumb" },
+    { L"\uEC15", L"Miracast Logo Small" },
+    { L"\uEC16", L"Miracast Logo Large" },
+    { L"\uEC19", L"PLAP" },
+    { L"\uEC1B", L"Badge" },
+    { L"\uEC1E", L"Signal Roaming" },
+    { L"\uEC20", L"Mobile Locked" },
+    { L"\uEC24", L"Insider Hub App" },
+    { L"\uEC25", L"Personal Folder" },
+    { L"\uEC26", L"Home Group" },
+    { L"\uEC27", L"My Network" },
+    { L"\uEC31", L"Keyboard Full" },
+    { L"\uEC32", L"Cafe" },
+    { L"\uEC37", L"Mob Signal 1" },
+    { L"\uEC38", L"Mob Signal 2" },
+    { L"\uEC39", L"Mob Signal 3" },
+    { L"\uEC3A", L"Mob Signal 4" },
+    { L"\uEC3B", L"Mob Signal 5" },
+    { L"\uEC3C", L"Mob Wifi 1" },
+    { L"\uEC3D", L"Mob Wifi 2" },
+    { L"\uEC3E", L"Mob Wifi 3" },
+    { L"\uEC3F", L"Mob Wifi 4" },
+    { L"\uEC40", L"Mob Airplane" },
+    { L"\uEC41", L"Mob Bluetooth" },
+    { L"\uEC42", L"Mob Action Center" },
+    { L"\uEC43", L"Mob Location" },
+    { L"\uEC44", L"Mob Wifi Hotspot" },
+    { L"\uEC45", L"Language Jpn" },
+    { L"\uEC46", L"Mob Quiet Hours" },
+    { L"\uEC47", L"Mob Driving Mode" },
+    { L"\uEC48", L"Speed Off" },
+    { L"\uEC49", L"Speed Medium" },
+    { L"\uEC4A", L"Speed High" },
+    { L"\uEC4E", L"This PC" },
+    { L"\uEC4F", L"Music Note" },
+    { L"\uEC50", L"File Explorer" },
+    { L"\uEC51", L"File Explorer App" },
+    { L"\uEC52", L"Left Arrow Key Time 0" },
+    { L"\uEC54", L"Mic Off" },
+    { L"\uEC55", L"Mic Sleep" },
+    { L"\uEC56", L"Mic Error" },
+    { L"\uEC57", L"Playback Rate 1x" },
+    { L"\uEC58", L"Playback Rate Other" },
+    { L"\uEC59", L"Cash Drawer" },
+    { L"\uEC5A", L"Barcode Scanner" },
+    { L"\uEC5B", L"Receipt Printer" },
+    { L"\uEC5C", L"Mag Stripe Reader" },
+    { L"\uEC61", L"Completed Solid" },
+    { L"\uEC64", L"Companion App" },
+    { L"\uEC6C", L"Favicon 2" },
+    { L"\uEC6D", L"Swipe Reveal Art" },
+    { L"\uEC71", L"Mic On" },
+    { L"\uEC72", L"Mic Clipping" },
+    { L"\uEC74", L"Tablet Selected" },
+    { L"\uEC75", L"Mobile Selected" },
+    { L"\uEC76", L"Laptop Selected" },
+    { L"\uEC77", L"TVMonitor Selected" },
+    { L"\uEC7A", L"Developer Tools" },
+    { L"\uEC7E", L"Mob Call Forwarding" },
+    { L"\uEC7F", L"Mob Call Forwarding Mirrored" },
+    { L"\uEC80", L"Body Cam" },
+    { L"\uEC81", L"Police Car" },
+    { L"\uEC87", L"Draw" },
+    { L"\uEC88", L"Draw Solid" },
+    { L"\uEC8A", L"Lower Brightness" },
+    { L"\uEC8F", L"Scroll Up Down" },
+    { L"\uEC92", L"Date Time" },
+    { L"\uEC94", L"Holo Lens" },
+    { L"\uECA5", L"Tiles" },
+    { L"\uECA7", L"Party Leader" },
+    { L"\uECAA", L"App Icon Default" },
+    { L"\uECAD", L"Calories" },
+    { L"\uECAF", L"POI" },
+    { L"\uECB9", L"Band Battery 0" },
+    { L"\uECBA", L"Band Battery 1" },
+    { L"\uECBB", L"Band Battery 2" },
+    { L"\uECBC", L"Band Battery 3" },
+    { L"\uECBD", L"Band Battery 4" },
+    { L"\uECBE", L"Band Battery 5" },
+    { L"\uECBF", L"Band Battery 6" },
+    { L"\uECC4", L"Add Surface Hub" },
+    { L"\uECC5", L"Dev Update" },
+    { L"\uECC6", L"Unit" },
+    { L"\uECC8", L"Add To" },
+    { L"\uECC9", L"Remove From" },
+    { L"\uECCA", L"Radio Btn Off" },
+    { L"\uECCB", L"Radio Btn On" },
+    { L"\uECCC", L"Radio Bullet 2" },
+    { L"\uECCD", L"Explore Content" },
+    { L"\uECE4", L"Blocked 2" },
+    { L"\uECE7", L"Scroll Mode" },
+    { L"\uECE8", L"Zoom Mode" },
+    { L"\uECE9", L"Pan Mode" },
+    { L"\uECF0", L"Wired USB" },
+    { L"\uECF1", L"Wireless USB" },
+    { L"\uECF3", L"USBSafe Connect" },
+    { L"\uED0C", L"Action Center Notification Mirrored" },
+    { L"\uED0D", L"Action Center Mirrored" },
+    { L"\uED0E", L"Subscription Add" },
+    { L"\uED10", L"Reset Device" },
+    { L"\uED11", L"Subscription Add Mirrored" },
+    { L"\uED14", L"QRCode" },
+    { L"\uED15", L"Feedback" },
+    { L"\uED1A", L"Hide" },
+    { L"\uED1E", L"Subtitles" },
+    { L"\uED1F", L"Subtitles Audio" },
+    { L"\uED25", L"Open Folder Horizontal" },
+    { L"\uED28", L"Calendar Mirrored" },
+    { L"\uED2A", L"Mobe SIM" },
+    { L"\uED2B", L"Mobe SIMNo Profile" },
+    { L"\uED2C", L"Mobe SIMLocked" },
+    { L"\uED2D", L"Mobe SIMBusy" },
+    { L"\uED2E", L"Signal Error" },
+    { L"\uED2F", L"Streaming Enterprise" },
+    { L"\uED30", L"Headphone 0" },
+    { L"\uED31", L"Headphone 1" },
+    { L"\uED32", L"Headphone 2" },
+    { L"\uED33", L"Headphone 3" },
+    { L"\uED35", L"Apps" },
+    { L"\uED39", L"Keyboard Brightness" },
+    { L"\uED3A", L"Keyboard Lower Brightness" },
+    { L"\uED3C", L"Skip Back 10" },
+    { L"\uED3D", L"Skip Forward 30" },
+    { L"\uED41", L"Tree Folder Folder" },
+    { L"\uED42", L"Tree Folder Folder Fill" },
+    { L"\uED43", L"Tree Folder Folder Open" },
+    { L"\uED44", L"Tree Folder Folder Open Fill" },
+    { L"\uED47", L"Multimedia DMP" },
+    { L"\uED4C", L"Keyboard One Handed" },
+    { L"\uED4D", L"Narrator" },
+    { L"\uED53", L"Emoji Tab People" },
+    { L"\uED54", L"Emoji Tab Smiles Animals" },
+    { L"\uED55", L"Emoji Tab Celebration Objects" },
+    { L"\uED56", L"Emoji Tab Food Plants" },
+    { L"\uED57", L"Emoji Tab Transit Places" },
+    { L"\uED58", L"Emoji Tab Symbols" },
+    { L"\uED59", L"Emoji Tab Text Smiles" },
+    { L"\uED5A", L"Emoji Tab Favorites" },
+    { L"\uED5B", L"Emoji Swatch" },
+    { L"\uED5C", L"Connect App" },
+    { L"\uED5D", L"Companion Device Framework" },
+    { L"\uED5E", L"Ruler" },
+    { L"\uED5F", L"Finger Inking" },
+    { L"\uED60", L"Stroke Erase" },
+    { L"\uED61", L"Point Erase" },
+    { L"\uED62", L"Clear All Ink" },
+    { L"\uED63", L"Pencil" },
+    { L"\uED64", L"Marker" },
+    { L"\uED65", L"Inking Caret" },
+    { L"\uED66", L"Inking Color Outline" },
+    { L"\uED67", L"Inking Color Fill" },
+    { L"\uEDA2", L"Hard Drive" },
+    { L"\uEDA3", L"Network Adapter" },
+    { L"\uEDA4", L"Touchscreen" },
+    { L"\uEDA5", L"Network Printer" },
+    { L"\uEDA6", L"Cloud Printer" },
+    { L"\uEDA7", L"Keyboard Shortcut" },
+    { L"\uEDA8", L"Brush Size" },
+    { L"\uEDA9", L"Narrator Forward" },
+    { L"\uEDAA", L"Narrator Forward Mirrored" },
+    { L"\uEDAB", L"Sync Badge 12" },
+    { L"\uEDAC", L"Ringer Badge 12" },
+    { L"\uEDAD", L"Asterisk Badge 12" },
+    { L"\uEDAE", L"Error Badge 12" },
+    { L"\uEDAF", L"Circle Ring Badge 12" },
+    { L"\uEDB0", L"Circle Fill Badge 12" },
+    { L"\uEDB1", L"Important Badge 12" },
+    { L"\uEDB3", L"Mail Badge 12" },
+    { L"\uEDB4", L"Pause Badge 12" },
+    { L"\uEDB5", L"Play Badge 12" },
+    { L"\uEDC6", L"Pen Workspace" },
+    { L"\uEDD5", L"Caret Left 8" },
+    { L"\uEDD6", L"Caret Right 8" },
+    { L"\uEDD7", L"Caret Up 8" },
+    { L"\uEDD8", L"Caret Down 8" },
+    { L"\uEDD9", L"Caret Left Solid 8" },
+    { L"\uEDDA", L"Caret Right Solid 8" },
+    { L"\uEDDB", L"Caret Up Solid 8" },
+    { L"\uEDDC", L"Caret Down Solid 8" },
+    { L"\uEDE0", L"Strikethrough" },
+    { L"\uEDE1", L"Export" },
+    { L"\uEDE2", L"Export Mirrored" },
+    { L"\uEDE3", L"Button Menu" },
+    { L"\uEDE4", L"Cloud Search" },
+    { L"\uEDE5", L"Pinyin IMELogo" },
+    { L"\uEDFB", L"Calligraphy Pen" },
+    { L"\uEE35", L"Reply Mirrored" },
+    { L"\uEE3F", L"Lockscreen Desktop" },
+    { L"\uEE40", L"Task View Settings" },
+    { L"\uEE47", L"Mini Expand 2Mirrored" },
+    { L"\uEE49", L"Mini Contract 2Mirrored" },
+    { L"\uEE4A", L"Play 36" },
+    { L"\uEE56", L"Pen Palette" },
+    { L"\uEE57", L"Guest User" },
+    { L"\uEE63", L"Settings Battery" },
+    { L"\uEE64", L"Taskbar Phone" },
+    { L"\uEE65", L"Lock Screen Glance" },
+    { L"\uEE6F", L"Generic Scan" },
+    { L"\uEE71", L"Image Export" },
+    { L"\uEE77", L"Wifi Ethernet" },
+    { L"\uEE79", L"Action Center Quiet" },
+    { L"\uEE7A", L"Action Center Quiet Notification" },
+    { L"\uEE92", L"Trackers Mirrored" },
+    { L"\uEE93", L"Date Time Mirrored" },
+    { L"\uEE94", L"Wheel" },
+    { L"\uEEA3", L"Virtual Machine Group" },
+    { L"\uEECA", L"Button View 2" },
+    { L"\uEF15", L"Pen Workspace Mirrored" },
+    { L"\uEF16", L"Pen Palette Mirrored" },
+    { L"\uEF17", L"Stroke Erase Mirrored" },
+    { L"\uEF18", L"Point Erase Mirrored" },
+    { L"\uEF19", L"Clear All Ink Mirrored" },
+    { L"\uEF1F", L"Background Toggle" },
+    { L"\uEF20", L"Marquee" },
+    { L"\uEF2C", L"Chrome Close Contrast" },
+    { L"\uEF2D", L"Chrome Minimize Contrast" },
+    { L"\uEF2E", L"Chrome Maximize Contrast" },
+    { L"\uEF2F", L"Chrome Restore Contrast" },
+    { L"\uEF31", L"Traffic Light" },
+    { L"\uEF3B", L"Replay" },
+    { L"\uEF3C", L"Eyedropper" },
+    { L"\uEF3D", L"Line Display" },
+    { L"\uEF3E", L"PINPad" },
+    { L"\uEF3F", L"Signature Capture" },
+    { L"\uEF40", L"Chip Card Credit Card Reader" },
+    { L"\uEF42", L"Market Down" },
+    { L"\uEF58", L"Player Settings" },
+    { L"\uEF6B", L"Landscape Orientation" },
+    { L"\uEF90", L"Flow" },
+    { L"\uEFA5", L"Touchpad" },
+    { L"\uEFA9", L"Speech" },
+    { L"\uF000", L"Knowledge Article" },
+    { L"\uF003", L"Relationship" },
+    { L"\uF012", L"Zip Folder" },
+    { L"\uF080", L"Default APN" },
+    { L"\uF081", L"User APN" },
+    { L"\uF085", L"Double Pinyin" },
+    { L"\uF08C", L"Blue Light" },
+    { L"\uF08D", L"Caret Solid Left" },
+    { L"\uF08E", L"Caret Solid Down" },
+    { L"\uF08F", L"Caret Solid Right" },
+    { L"\uF090", L"Caret Solid Up" },
+    { L"\uF093", L"Button A" },
+    { L"\uF094", L"Button B" },
+    { L"\uF095", L"Button Y" },
+    { L"\uF096", L"Button X" },
+    { L"\uF0AD", L"Arrow Up 8" },
+    { L"\uF0AE", L"Arrow Down 8" },
+    { L"\uF0AF", L"Arrow Right 8" },
+    { L"\uF0B0", L"Arrow Left 8" },
+    { L"\uF0B2", L"Quarentined Items" },
+    { L"\uF0B3", L"Quarentined Items Mirrored" },
+    { L"\uF0B4", L"Protractor" },
+    { L"\uF0B5", L"Checklist Mirrored" },
+    { L"\uF0B6", L"Status Circle 7" },
+    { L"\uF0B7", L"Status Checkmark 7" },
+    { L"\uF0B8", L"Status Error Circle 7" },
+    { L"\uF0B9", L"Connected" },
+    { L"\uF0C6", L"Pencil Fill" },
+    { L"\uF0C7", L"Calligraphy Fill" },
+    { L"\uF0CA", L"Quarter Star Left" },
+    { L"\uF0CB", L"Quarter Star Right" },
+    { L"\uF0CC", L"Three Quarter Star Left" },
+    { L"\uF0CD", L"Three Quarter Star Right" },
+    { L"\uF0CE", L"Quiet Hours Badge 12" },
+    { L"\uF0D2", L"Back Mirrored" },
+    { L"\uF0D3", L"Forward Mirrored" },
+    { L"\uF0D5", L"Chrome Back Contrast" },
+    { L"\uF0D6", L"Chrome Back Contrast Mirrored" },
+    { L"\uF0D7", L"Chrome Back To Window Contrast" },
+    { L"\uF0D8", L"Chrome Full Screen Contrast" },
+    { L"\uF0E2", L"Grid View" },
+    { L"\uF0E3", L"Clipboard List" },
+    { L"\uF0E4", L"Clipboard List Mirrored" },
+    { L"\uF0E5", L"Outline Quarter Star Left" },
+    { L"\uF0E6", L"Outline Quarter Star Right" },
+    { L"\uF0E7", L"Outline Half Star Left" },
+    { L"\uF0E8", L"Outline Half Star Right" },
+    { L"\uF0E9", L"Outline Three Quarter Star Left" },
+    { L"\uF0EA", L"Outline Three Quarter Star Right" },
+    { L"\uF0EB", L"Spatial Volume 0" },
+    { L"\uF0EC", L"Spatial Volume 1" },
+    { L"\uF0ED", L"Spatial Volume 2" },
+    { L"\uF0EE", L"Spatial Volume 3" },
+    { L"\uF0EF", L"Application Guard" },
+    { L"\uF0F7", L"Outline Star Left Half" },
+    { L"\uF0F8", L"Outline Star Right Half" },
+    { L"\uF0F9", L"Chrome Annotate Contrast" },
+    { L"\uF0FB", L"Defender Badge 12" },
+    { L"\uF103", L"Detachable PC" },
+    { L"\uF108", L"Left Stick" },
+    { L"\uF109", L"Right Stick" },
+    { L"\uF10A", L"Trigger Left" },
+    { L"\uF10B", L"Trigger Right" },
+    { L"\uF10C", L"Bumper Left" },
+    { L"\uF10D", L"Bumper Right" },
+    { L"\uF10E", L"Dpad" },
+    { L"\uF110", L"English Punctuation" },
+    { L"\uF111", L"Chinese Punctuation" },
+    { L"\uF119", L"HMD" },
+    { L"\uF11B", L"Ctrl Spatial Right" },
+    { L"\uF126", L"Pagination Dot Outline 10" },
+    { L"\uF127", L"Pagination Dot Solid 10" },
+    { L"\uF128", L"Stroke Erase 2" },
+    { L"\uF129", L"Small Erase" },
+    { L"\uF12A", L"Large Erase" },
+    { L"\uF12B", L"Folder Horizontal" },
+    { L"\uF12E", L"Microphone Listening" },
+    { L"\uF12F", L"Status Exclamation Circle 7" },
+    { L"\uF131", L"Video 360" },
+    { L"\uF133", L"Giftbox Open" },
+    { L"\uF136", L"Status Circle Outer" },
+    { L"\uF137", L"Status Circle Inner" },
+    { L"\uF138", L"Status Circle Ring" },
+    { L"\uF139", L"Status Triangle Outer" },
+    { L"\uF13A", L"Status Triangle Inner" },
+    { L"\uF13B", L"Status Triangle Exclamation" },
+    { L"\uF13C", L"Status Circle Exclamation" },
+    { L"\uF13D", L"Status Circle Error X" },
+    { L"\uF13E", L"Status Circle Checkmark" },
+    { L"\uF13F", L"Status Circle Info" },
+    { L"\uF140", L"Status Circle Block" },
+    { L"\uF141", L"Status Circle Block 2" },
+    { L"\uF142", L"Status Circle Question Mark" },
+    { L"\uF143", L"Status Circle Sync" },
+    { L"\uF146", L"Dial 1" },
+    { L"\uF147", L"Dial 2" },
+    { L"\uF148", L"Dial 3" },
+    { L"\uF149", L"Dial 4" },
+    { L"\uF14A", L"Dial 5" },
+    { L"\uF14B", L"Dial 6" },
+    { L"\uF14C", L"Dial 7" },
+    { L"\uF14D", L"Dial 8" },
+    { L"\uF14E", L"Dial 9" },
+    { L"\uF14F", L"Dial 10" },
+    { L"\uF150", L"Dial 11" },
+    { L"\uF151", L"Dial 12" },
+    { L"\uF152", L"Dial 13" },
+    { L"\uF153", L"Dial 14" },
+    { L"\uF154", L"Dial 15" },
+    { L"\uF155", L"Dial 16" },
+    { L"\uF156", L"Dial Shape 1" },
+    { L"\uF157", L"Dial Shape 2" },
+    { L"\uF158", L"Dial Shape 3" },
+    { L"\uF159", L"Dial Shape 4" },
+    { L"\uF15F", L"Closed Captions International" },
+    { L"\uF161", L"Toll Solid" },
+    { L"\uF163", L"Traffic Congestion Solid" },
+    { L"\uF164", L"Explore Content Single" },
+    { L"\uF165", L"Collapse Content" },
+    { L"\uF166", L"Collapse Content Single" },
+    { L"\uF167", L"Info Solid" },
+    { L"\uF168", L"Group List" },
+    { L"\uF169", L"Caret Bottom Right Solid Center 8" },
+    { L"\uF16A", L"Progress Ring Dots" },
+    { L"\uF16B", L"Checkbox 14" },
+    { L"\uF16C", L"Checkbox Composite 14" },
+    { L"\uF16D", L"Checkbox Indeterminate Combo 14" },
+    { L"\uF16E", L"Checkbox Indeterminate Combo" },
+    { L"\uF175", L"Status Pause 7" },
+    { L"\uF17F", L"Character Appearance" },
+    { L"\uF180", L"Lexicon" },
+    { L"\uF182", L"Screen Time" },
+    { L"\uF191", L"Headless Device" },
+    { L"\uF193", L"Network Sharing" },
+    { L"\uF19D", L"Eye Gaze" },
+    { L"\uF19E", L"Toggle Left" },
+    { L"\uF19F", L"Toggle Right" },
+    { L"\uF1AD", L"Windows Insider" },
+    { L"\uF1CB", L"Chrome Switch" },
+    { L"\uF1CC", L"Chrome Switch Contrast" },
+    { L"\uF1D8", L"Status Checkmark" },
+    { L"\uF1D9", L"Status Checkmark Left" },
+    { L"\uF20C", L"Keyboard Left Aligned" },
+    { L"\uF20D", L"Keyboard Right Aligned" },
+    { L"\uF210", L"Keyboard Settings" },
+    { L"\uF211", L"Network Physical" },
+    { L"\uF22C", L"IOT" },
+    { L"\uF22E", L"Unknown Mirrored" },
+    { L"\uF246", L"View Dashboard" },
+    { L"\uF259", L"Exploit Protection Settings" },
+    { L"\uF260", L"Keyboard Narrow" },
+    { L"\uF261", L"Keyboard 12Key" },
+    { L"\uF26B", L"Keyboard Dock" },
+    { L"\uF26C", L"Keyboard Undock" },
+    { L"\uF26D", L"Keyboard Left Dock" },
+    { L"\uF26E", L"Keyboard Right Dock" },
+    { L"\uF270", L"Ear" },
+    { L"\uF271", L"Pointer Hand" },
+    { L"\uF272", L"Bullseye" },
+    { L"\uF28B", L"Document Approval" },
+    { L"\uF2B7", L"Locale Language" },
+    { L"\uF32A", L"Passive Authentication" },
+    { L"\uF354", L"Color Solid" },
+    { L"\uF384", L"Network Offline" },
+    { L"\uF385", L"Network Connected" },
+    { L"\uF386", L"Network Connected Checkmark" },
+    { L"\uF3B1", L"Sign Out" },
+    { L"\uF3CC", L"Status Info" },
+    { L"\uF3CD", L"Status Info Left" },
+    { L"\uF3E2", L"Nearby Sharing" },
+    { L"\uF3E7", L"Ctrl Spatial Left" },
+    { L"\uF404", L"Interactive Dashboard" },
+    { L"\uF405", L"Decline Call" },
+    { L"\uF406", L"Clipping Tool" },
+    { L"\uF407", L"Rectangular Clipping" },
+    { L"\uF408", L"Free Form Clipping" },
+    { L"\uF413", L"Copy To" },
+    { L"\uF427", L"IDBadge" },
+    { L"\uF439", L"Dynamic Lock" },
+    { L"\uF45E", L"Pen Tips" },
+    { L"\uF45F", L"Pen Tips Mirrored" },
+    { L"\uF460", L"HWPJoin" },
+    { L"\uF461", L"HWPInsert" },
+    { L"\uF462", L"HWPStrike Through" },
+    { L"\uF463", L"HWPScratch Out" },
+    { L"\uF464", L"HWPSplit" },
+    { L"\uF465", L"HWPNew Line" },
+    { L"\uF466", L"HWPOverwrite" },
+    { L"\uF473", L"Mob Wifi Warning 1" },
+    { L"\uF474", L"Mob Wifi Warning 2" },
+    { L"\uF475", L"Mob Wifi Warning 3" },
+    { L"\uF476", L"Mob Wifi Warning 4" },
+    { L"\uF47F", L"Mic Location Combo" },
+    { L"\uF49A", L"Globe 2" },
+    { L"\uF4A5", L"Special Effect Size" },
+    { L"\uF4A9", L"GIF" },
+    { L"\uF4AA", L"Sticker 2" },
+    { L"\uF4BE", L"Surface Hub Selected" },
+    { L"\uF4BF", L"Holo Lens Selected" },
+    { L"\uF4C0", L"Earbud" },
+    { L"\uF4C3", L"Mix Volumes" },
+    { L"\uF540", L"Safe" },
+    { L"\uF552", L"Laptop Secure" },
+    { L"\uF56D", L"Print Default" },
+    { L"\uF56E", L"Page Mirrored" },
+    { L"\uF56F", L"Landscape Orientation Mirrored" },
+    { L"\uF570", L"Color Off" },
+    { L"\uF571", L"Print All Pages" },
+    { L"\uF572", L"Print Custom Range" },
+    { L"\uF573", L"Page Margin Portrait Narrow" },
+    { L"\uF574", L"Page Margin Portrait Normal" },
+    { L"\uF575", L"Page Margin Portrait Moderate" },
+    { L"\uF576", L"Page Margin Portrait Wide" },
+    { L"\uF577", L"Page Margin Landscape Narrow" },
+    { L"\uF578", L"Page Margin Landscape Normal" },
+    { L"\uF579", L"Page Margin Landscape Moderate" },
+    { L"\uF57A", L"Page Margin Landscape Wide" },
+    { L"\uF57B", L"Collate Landscape" },
+    { L"\uF57C", L"Collate Portrait" },
+    { L"\uF57D", L"Collate Portrait Separated" },
+    { L"\uF57E", L"Duplex Landscape One Sided" },
+    { L"\uF57F", L"Duplex Landscape One Sided Mirrored" },
+    { L"\uF580", L"Duplex Landscape Two Sided Long Edge" },
+    { L"\uF581", L"Duplex Landscape Two Sided Long Edge Mirrored" },
+    { L"\uF582", L"Duplex Landscape Two Sided Short Edge" },
+    { L"\uF583", L"Duplex Landscape Two Sided Short Edge Mirrored" },
+    { L"\uF584", L"Duplex Portrait One Sided" },
+    { L"\uF585", L"Duplex Portrait One Sided Mirrored" },
+    { L"\uF586", L"Duplex Portrait Two Sided Long Edge" },
+    { L"\uF587", L"Duplex Portrait Two Sided Long Edge Mirrored" },
+    { L"\uF588", L"Duplex Portrait Two Sided Short Edge" },
+    { L"\uF589", L"Duplex Portrait Two Sided Short Edge Mirrored" },
+    { L"\uF58A", L"PPSOne Landscape" },
+    { L"\uF58B", L"PPSTwo Landscape" },
+    { L"\uF58C", L"PPSTwo Portrait" },
+    { L"\uF58D", L"PPSFour Landscape" },
+    { L"\uF58E", L"PPSFour Portrait" },
+    { L"\uF58F", L"Hole Punch Off" },
+    { L"\uF590", L"Hole Punch Portrait Left" },
+    { L"\uF591", L"Hole Punch Portrait Right" },
+    { L"\uF592", L"Hole Punch Portrait Top" },
+    { L"\uF593", L"Hole Punch Portrait Bottom" },
+    { L"\uF594", L"Hole Punch Landscape Left" },
+    { L"\uF595", L"Hole Punch Landscape Right" },
+    { L"\uF596", L"Hole Punch Landscape Top" },
+    { L"\uF597", L"Hole Punch Landscape Bottom" },
+    { L"\uF598", L"Stapling Off" },
+    { L"\uF599", L"Stapling Portrait Top Left" },
+    { L"\uF59A", L"Stapling Portrait Top Right" },
+    { L"\uF59B", L"Stapling Portrait Bottom Right" },
+    { L"\uF59C", L"Stapling Portrait Two Left" },
+    { L"\uF59D", L"Stapling Portrait Two Right" },
+    { L"\uF59E", L"Stapling Portrait Two Top" },
+    { L"\uF59F", L"Stapling Portrait Two Bottom" },
+    { L"\uF5A0", L"Stapling Portrait Book Binding" },
+    { L"\uF5A1", L"Stapling Landscape Top Left" },
+    { L"\uF5A2", L"Stapling Landscape Top Right" },
+    { L"\uF5A3", L"Stapling Landscape Bottom Left" },
+    { L"\uF5A4", L"Stapling Landscape Bottom Right" },
+    { L"\uF5A5", L"Stapling Landscape Two Left" },
+    { L"\uF5A6", L"Stapling Landscape Two Right" },
+    { L"\uF5A7", L"Stapling Landscape Two Top" },
+    { L"\uF5A8", L"Stapling Landscape Two Bottom" },
+    { L"\uF5A9", L"Stapling Landscape Book Binding" },
+    { L"\uF5AA", L"Status Data Transfer Roaming" },
+    { L"\uF5AB", L"Mob SIMError" },
+    { L"\uF5AC", L"Collate Landscape Separated" },
+    { L"\uF5AD", L"PPSOne Portrait" },
+    { L"\uF5AE", L"Stapling Portrait Bottom Left" },
+    { L"\uF5B0", L"Play Solid" },
+    { L"\uF5E7", L"Repeat Off" },
+    { L"\uF5ED", L"Set" },
+    { L"\uF5EE", L"Set Solid" },
+    { L"\uF5EF", L"Fuzzy Reading" },
+    { L"\uF5F2", L"Vertical Battery 0" },
+    { L"\uF5F3", L"Vertical Battery 1" },
+    { L"\uF5F4", L"Vertical Battery 2" },
+    { L"\uF5F5", L"Vertical Battery 3" },
+    { L"\uF5F6", L"Vertical Battery 4" },
+    { L"\uF5F7", L"Vertical Battery 5" },
+    { L"\uF5F8", L"Vertical Battery 6" },
+    { L"\uF5F9", L"Vertical Battery 7" },
+    { L"\uF5FA", L"Vertical Battery 8" },
+    { L"\uF5FB", L"Vertical Battery 9" },
+    { L"\uF5FC", L"Vertical Battery 10" },
+    { L"\uF5FD", L"Vertical Battery Charging 0" },
+    { L"\uF5FE", L"Vertical Battery Charging 1" },
+    { L"\uF5FF", L"Vertical Battery Charging 2" },
+    { L"\uF600", L"Vertical Battery Charging 3" },
+    { L"\uF601", L"Vertical Battery Charging 4" },
+    { L"\uF602", L"Vertical Battery Charging 5" },
+    { L"\uF603", L"Vertical Battery Charging 6" },
+    { L"\uF604", L"Vertical Battery Charging 7" },
+    { L"\uF605", L"Vertical Battery Charging 8" },
+    { L"\uF606", L"Vertical Battery Charging 9" },
+    { L"\uF607", L"Vertical Battery Charging 10" },
+    { L"\uF608", L"Vertical Battery Unknown" },
+    { L"\uF618", L"SIMError" },
+    { L"\uF619", L"SIMMissing" },
+    { L"\uF61A", L"SIMLock" },
+    { L"\uF61B", L"e SIM" },
+    { L"\uF61C", L"e SIMNo Profile" },
+    { L"\uF61D", L"e SIMLocked" },
+    { L"\uF61E", L"e SIMBusy" },
+    { L"\uF61F", L"Noise Cancelation" },
+    { L"\uF620", L"Noise Cancelation Off" },
+    { L"\uF623", L"Music Sharing" },
+    { L"\uF624", L"Music Sharing Off" },
+    { L"\uF63C", L"Circle Shape Solid" },
+    { L"\uF657", L"Wifi Call Bars" },
+    { L"\uF658", L"Wifi Call 0" },
+    { L"\uF659", L"Wifi Call 1" },
+    { L"\uF65A", L"Wifi Call 2" },
+    { L"\uF65B", L"Wifi Call 3" },
+    { L"\uF65C", L"Wifi Call 4" },
+    { L"\uF69E", L"CHTLanguage Bar" },
+    { L"\uF6A9", L"Compose Mode" },
+    { L"\uF6B8", L"Expressive Input Entry" },
+    { L"\uF6BA", L"Emoji Tab More Symbols" },
+    { L"\uF6FA", L"Web Search" },
+    { L"\uF712", L"Kiosk" },
+    { L"\uF714", L"RTTLogo" },
+    { L"\uF715", L"Voice Call" },
+    { L"\uF716", L"Go To Message" },
+    { L"\uF71A", L"Return To Call" },
+    { L"\uF71C", L"Start Presenting" },
+    { L"\uF71D", L"Stop Presenting" },
+    { L"\uF71E", L"Productivity Mode" },
+    { L"\uF738", L"Set History Status" },
+    { L"\uF739", L"Set History Status 2" },
+    { L"\uF73D", L"Keyboard Settings 20" },
+    { L"\uF73E", L"One Handed Right 20" },
+    { L"\uF73F", L"One Handed Left 20" },
+    { L"\uF740", L"Split 20" },
+    { L"\uF741", L"Full 20" },
+    { L"\uF742", L"Handwriting 20" },
+    { L"\uF743", L"Chevron Left 20" },
+    { L"\uF744", L"Chevron Left 32" },
+    { L"\uF745", L"Chevron Right 20" },
+    { L"\uF746", L"Chevron Right 32" },
+    { L"\uF763", L"Event 12" },
+    { L"\uF781", L"Mic Off 2" },
+    { L"\uF785", L"Delivery Optimization" },
+    { L"\uF78A", L"Cancel Medium" },
+    { L"\uF78B", L"Search Medium" },
+    { L"\uF78C", L"Accept Medium" },
+    { L"\uF78D", L"Reveal Password Medium" },
+    { L"\uF7AD", L"Delete Word" },
+    { L"\uF7AE", L"Delete Word Fill" },
+    { L"\uF7AF", L"Delete Lines" },
+    { L"\uF7B0", L"Delete Lines Fill" },
+    { L"\uF7B1", L"Insert Words" },
+    { L"\uF7B2", L"Insert Words Fill" },
+    { L"\uF7B3", L"Join Words" },
+    { L"\uF7B4", L"Join Words Fill" },
+    { L"\uF7B5", L"Overwrite Words" },
+    { L"\uF7B6", L"Overwrite Words Fill" },
+    { L"\uF7B7", L"Add New Line" },
+    { L"\uF7B8", L"Add New Line Fill" },
+    { L"\uF7B9", L"Overwrite Words Korean" },
+    { L"\uF7BA", L"Overwrite Words Fill Korean" },
+    { L"\uF7BB", L"Education Icon" },
+    { L"\uF7ED", L"Window Snipping" },
+    { L"\uF7EE", L"Video Capture" },
+    { L"\uF809", L"Status Secured" },
+    { L"\uF83B", L"Narrator App" },
+    { L"\uF83D", L"Power Button Update" },
+    { L"\uF83E", L"Restart Update" },
+    { L"\uF83F", L"Update Status Dot" },
+    { L"\uF847", L"Eject" },
+    { L"\uF87B", L"Spelling" },
+    { L"\uF87C", L"Spelling Korean" },
+    { L"\uF87D", L"Spelling Serbian" },
+    { L"\uF87E", L"Spelling Chinese" },
+    { L"\uF89A", L"Folder Select" },
+    { L"\uF8A5", L"Smart Screen" },
+    { L"\uF8A6", L"Exploit Protection" },
+    { L"\uF8AA", L"Add Bold" },
+    { L"\uF8AB", L"Subtract Bold" },
+    { L"\uF8AC", L"Back Solid Bold" },
+    { L"\uF8AD", L"Forward Solid Bold" },
+    { L"\uF8AE", L"Pause Bold" },
+    { L"\uF8AF", L"Click Solid" },
+    { L"\uF8B0", L"Settings Solid" },
+    { L"\uF8B1", L"Microphone Solid Bold" },
+    { L"\uF8B2", L"Speech Solid Bold" },
+    { L"\uF8B3", L"Clicked Out Loud Solid Bold" }
+};
diff --git a/src/cascadia/TerminalSettingsEditor/SettingContainer.cpp b/src/cascadia/TerminalSettingsEditor/SettingContainer.cpp
index 8a32fbacb31..85b4ae30064 100644
--- a/src/cascadia/TerminalSettingsEditor/SettingContainer.cpp
+++ b/src/cascadia/TerminalSettingsEditor/SettingContainer.cpp
@@ -13,6 +13,7 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
     DependencyProperty SettingContainer::_HeaderProperty{ nullptr };
     DependencyProperty SettingContainer::_HelpTextProperty{ nullptr };
     DependencyProperty SettingContainer::_CurrentValueProperty{ nullptr };
+    DependencyProperty SettingContainer::_CurrentValueTemplateProperty{ nullptr };
     DependencyProperty SettingContainer::_HasSettingValueProperty{ nullptr };
     DependencyProperty SettingContainer::_SettingOverrideSourceProperty{ nullptr };
     DependencyProperty SettingContainer::_StartExpandedProperty{ nullptr };
@@ -50,9 +51,18 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
             _CurrentValueProperty =
                 DependencyProperty::Register(
                     L"CurrentValue",
-                    xaml_typename<hstring>(),
+                    xaml_typename<IInspectable>(),
                     xaml_typename<Editor::SettingContainer>(),
-                    PropertyMetadata{ box_value(L"") });
+                    PropertyMetadata{ nullptr });
+        }
+        if (!_CurrentValueTemplateProperty)
+        {
+            _CurrentValueTemplateProperty =
+                DependencyProperty::Register(
+                    L"CurrentValueTemplate",
+                    xaml_typename<Windows::UI::Xaml::DataTemplate>(),
+                    xaml_typename<Editor::SettingContainer>(),
+                    PropertyMetadata{ nullptr });
         }
         if (!_HasSettingValueProperty)
         {
diff --git a/src/cascadia/TerminalSettingsEditor/SettingContainer.h b/src/cascadia/TerminalSettingsEditor/SettingContainer.h
index 9fcb2d24efa..711dcca62df 100644
--- a/src/cascadia/TerminalSettingsEditor/SettingContainer.h
+++ b/src/cascadia/TerminalSettingsEditor/SettingContainer.h
@@ -35,7 +35,8 @@ namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
 
         DEPENDENCY_PROPERTY(Windows::Foundation::IInspectable, Header);
         DEPENDENCY_PROPERTY(hstring, HelpText);
-        DEPENDENCY_PROPERTY(hstring, CurrentValue);
+        DEPENDENCY_PROPERTY(Windows::Foundation::IInspectable, CurrentValue);
+        DEPENDENCY_PROPERTY(Windows::UI::Xaml::DataTemplate, CurrentValueTemplate);
         DEPENDENCY_PROPERTY(bool, HasSettingValue);
         DEPENDENCY_PROPERTY(bool, StartExpanded);
         DEPENDENCY_PROPERTY(IInspectable, SettingOverrideSource);
diff --git a/src/cascadia/TerminalSettingsEditor/SettingContainer.idl b/src/cascadia/TerminalSettingsEditor/SettingContainer.idl
index 8b5fd0eba95..0d2d0d4011f 100644
--- a/src/cascadia/TerminalSettingsEditor/SettingContainer.idl
+++ b/src/cascadia/TerminalSettingsEditor/SettingContainer.idl
@@ -15,9 +15,12 @@ namespace Microsoft.Terminal.Settings.Editor
         String HelpText;
         static Windows.UI.Xaml.DependencyProperty HelpTextProperty { get; };
 
-        String CurrentValue;
+        IInspectable CurrentValue;
         static Windows.UI.Xaml.DependencyProperty CurrentValueProperty { get; };
 
+        Windows.UI.Xaml.DataTemplate CurrentValueTemplate;
+        static Windows.UI.Xaml.DependencyProperty CurrentValueTemplateProperty { get; };
+
         Boolean HasSettingValue;
         static Windows.UI.Xaml.DependencyProperty HasSettingValueProperty { get; };
 
diff --git a/src/cascadia/TerminalSettingsEditor/SettingContainerStyle.xaml b/src/cascadia/TerminalSettingsEditor/SettingContainerStyle.xaml
index 72b254e4e41..13495e6a8a5 100644
--- a/src/cascadia/TerminalSettingsEditor/SettingContainerStyle.xaml
+++ b/src/cascadia/TerminalSettingsEditor/SettingContainerStyle.xaml
@@ -7,6 +7,7 @@
                     xmlns:d="http://schemas.microsoft.com/expression/blend/2008"
                     xmlns:local="using:Microsoft.Terminal.Settings.Editor"
                     xmlns:mc="http://schemas.openxmlformats.org/markup-compatibility/2006"
+                    xmlns:mtu="using:Microsoft.Terminal.UI"
                     xmlns:muxc="using:Microsoft.UI.Xaml.Controls"
                     mc:Ignorable="d">
 
@@ -178,6 +179,16 @@
         <Setter Property="TextWrapping" Value="WrapWholeWords" />
     </Style>
 
+    <DataTemplate x:Key="ExpanderSettingContainerStringPreviewTemplate">
+        <TextBlock MaxWidth="250"
+                   Margin="0,0,-16,0"
+                   HorizontalAlignment="Right"
+                   VerticalAlignment="Center"
+                   FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
+                   Style="{StaticResource SettingsPageItemDescriptionStyle}"
+                   Text="{Binding}" />
+    </DataTemplate>
+
     <!--  A setting container for a setting that has no additional options  -->
     <Style TargetType="local:SettingContainer">
         <Setter Property="Margin" Value="0,4,0,0" />
@@ -250,14 +261,58 @@
                                                Style="{StaticResource SettingsPageItemDescriptionStyle}"
                                                Text="{TemplateBinding HelpText}" />
                                 </StackPanel>
-                                <TextBlock Grid.Column="1"
-                                           MaxWidth="250"
-                                           Margin="0,0,-16,0"
-                                           HorizontalAlignment="Right"
-                                           VerticalAlignment="Center"
-                                           FontFamily="Segoe UI, Segoe Fluent Icons, Segoe MDL2 Assets"
-                                           Style="{StaticResource SettingsPageItemDescriptionStyle}"
-                                           Text="{TemplateBinding CurrentValue}" />
+                                <ContentPresenter Grid.Column="1"
+                                                  Content="{TemplateBinding CurrentValue}"
+                                                  ContentTemplate="{StaticResource ExpanderSettingContainerStringPreviewTemplate}" />
+                            </Grid>
+                        </muxc:Expander.Header>
+                    </muxc:Expander>
+                </ControlTemplate>
+            </Setter.Value>
+        </Setter>
+    </Style>
+
+    <!--  A setting container which can expand. Supports data template override for preview  -->
+    <Style x:Key="ExpanderSettingContainerStyleWithComplexPreview"
+           TargetType="local:SettingContainer">
+        <Setter Property="MaxWidth" Value="1000" />
+        <Setter Property="IsTabStop" Value="False" />
+        <Setter Property="Template">
+            <Setter.Value>
+                <ControlTemplate TargetType="local:SettingContainer">
+                    <muxc:Expander x:Name="Expander"
+                                   Margin="0,4,0,0"
+                                   HorizontalAlignment="Stretch"
+                                   HorizontalContentAlignment="Stretch"
+                                   Content="{TemplateBinding Content}"
+                                   IsExpanded="{TemplateBinding StartExpanded}">
+                        <muxc:Expander.Header>
+                            <Grid MinHeight="64">
+                                <Grid.ColumnDefinitions>
+                                    <ColumnDefinition Width="*" />
+                                    <ColumnDefinition Width="Auto" />
+                                </Grid.ColumnDefinitions>
+                                <StackPanel Style="{StaticResource StackPanelInExpanderStyle}">
+                                    <StackPanel Orientation="Horizontal">
+                                        <TextBlock Style="{StaticResource SettingsPageItemHeaderStyle}"
+                                                   Text="{TemplateBinding Header}" />
+                                        <Button x:Name="ResetButton"
+                                                Style="{StaticResource SettingContainerResetButtonStyle}">
+                                            <FontIcon Glyph="&#xE845;"
+                                                      Style="{StaticResource SettingContainerFontIconStyle}" />
+                                        </Button>
+                                    </StackPanel>
+                                    <TextBlock x:Name="HelpTextBlock"
+                                               Style="{StaticResource SettingsPageItemDescriptionStyle}"
+                                               Text="{TemplateBinding HelpText}" />
+                                </StackPanel>
+                                <ContentPresenter Grid.Column="1"
+                                                  MaxWidth="250"
+                                                  Margin="0,0,-16,0"
+                                                  HorizontalAlignment="Right"
+                                                  VerticalAlignment="Center"
+                                                  Content="{TemplateBinding CurrentValue}"
+                                                  ContentTemplate="{TemplateBinding CurrentValueTemplate}" />
                             </Grid>
                         </muxc:Expander.Header>
                     </muxc:Expander>
diff --git a/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.cpp b/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.cpp
new file mode 100644
index 00000000000..293f225d0c2
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.cpp
@@ -0,0 +1,35 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+#include "pch.h"
+#include "TerminalColorConverters.h"
+#include "ColorToBrushConverter.g.cpp"
+#include "ColorToStringConverter.g.cpp"
+
+using namespace winrt::Microsoft::Terminal::Settings::Model;
+
+namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
+{
+
+    Windows::Foundation::IInspectable ColorToBrushConverter::Convert(Windows::Foundation::IInspectable const& value, Windows::UI::Xaml::Interop::TypeName const& /*targetType*/, Windows::Foundation::IInspectable const& /*parameter*/, hstring const& /*language*/)
+    {
+        const auto color = value.as<Windows::UI::Color>();
+        return Microsoft::Terminal::UI::Converters::ColorToBrush(color);
+    }
+
+    Windows::Foundation::IInspectable ColorToBrushConverter::ConvertBack(Windows::Foundation::IInspectable const& /*value*/, Windows::UI::Xaml::Interop::TypeName const& /*targetType*/, Windows::Foundation::IInspectable const& /*parameter*/, hstring const& /*language*/)
+    {
+        throw hresult_not_implemented();
+    }
+
+    Windows::Foundation::IInspectable ColorToStringConverter::Convert(Windows::Foundation::IInspectable const& value, Windows::UI::Xaml::Interop::TypeName const& /*targetType*/, Windows::Foundation::IInspectable const& /*parameter*/, hstring const& /*language*/)
+    {
+        const auto color = value.as<Windows::UI::Color>();
+        return winrt::box_value(fmt::format(FMT_COMPILE(L"#{:02X}{:02X}{:02X}"), color.R, color.G, color.B));
+    }
+
+    Windows::Foundation::IInspectable ColorToStringConverter::ConvertBack(Windows::Foundation::IInspectable const& /*value*/, Windows::UI::Xaml::Interop::TypeName const& /*targetType*/, Windows::Foundation::IInspectable const& /*parameter*/, hstring const& /*language*/)
+    {
+        throw hresult_not_implemented();
+    }
+}
diff --git a/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.h b/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.h
new file mode 100644
index 00000000000..9c956548a44
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.h
@@ -0,0 +1,33 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+#pragma once
+
+#include "ColorToBrushConverter.g.h"
+#include "ColorToStringConverter.g.h"
+#include "Utils.h"
+
+namespace winrt::Microsoft::Terminal::Settings::Editor::implementation
+{
+    struct ColorToBrushConverter : ColorToBrushConverterT<ColorToBrushConverter>
+    {
+        ColorToBrushConverter() = default;
+
+        Windows::Foundation::IInspectable Convert(Windows::Foundation::IInspectable const& value, Windows::UI::Xaml::Interop::TypeName const& targetType, Windows::Foundation::IInspectable const& parameter, hstring const& language);
+        Windows::Foundation::IInspectable ConvertBack(Windows::Foundation::IInspectable const& value, Windows::UI::Xaml::Interop::TypeName const& targetType, Windows::Foundation::IInspectable const& parameter, hstring const& language);
+    };
+
+    struct ColorToStringConverter : ColorToStringConverterT<ColorToStringConverter>
+    {
+        ColorToStringConverter() = default;
+
+        Windows::Foundation::IInspectable Convert(Windows::Foundation::IInspectable const& value, Windows::UI::Xaml::Interop::TypeName const& targetType, Windows::Foundation::IInspectable const& parameter, hstring const& language);
+        Windows::Foundation::IInspectable ConvertBack(Windows::Foundation::IInspectable const& value, Windows::UI::Xaml::Interop::TypeName const& targetType, Windows::Foundation::IInspectable const& parameter, hstring const& language);
+    };
+};
+
+namespace winrt::Microsoft::Terminal::Settings::Editor::factory_implementation
+{
+    BASIC_FACTORY(ColorToBrushConverter);
+    BASIC_FACTORY(ColorToStringConverter);
+}
diff --git a/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.idl b/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.idl
new file mode 100644
index 00000000000..98f06c89afc
--- /dev/null
+++ b/src/cascadia/TerminalSettingsEditor/TerminalColorConverters.idl
@@ -0,0 +1,15 @@
+// Copyright (c) Microsoft Corporation.
+// Licensed under the MIT license.
+
+namespace Microsoft.Terminal.Settings.Editor
+{
+    runtimeclass ColorToBrushConverter : [default] Windows.UI.Xaml.Data.IValueConverter
+    {
+        ColorToBrushConverter();
+    }
+
+    runtimeclass ColorToStringConverter : [default] Windows.UI.Xaml.Data.IValueConverter
+    {
+        ColorToStringConverter();
+    }
+}
diff --git a/src/cascadia/TerminalSettingsModel/Profile.cpp b/src/cascadia/TerminalSettingsModel/Profile.cpp
index 561a21017fc..73530361719 100644
--- a/src/cascadia/TerminalSettingsModel/Profile.cpp
+++ b/src/cascadia/TerminalSettingsModel/Profile.cpp
@@ -408,6 +408,61 @@ winrt::hstring Profile::_evaluateIcon() const
     return winrt::hstring{ cmdline.c_str() };
 }
 
+bool Profile::HasIcon() const
+{
+    return _Icon.has_value();
+}
+
+winrt::Microsoft::Terminal::Settings::Model::Profile Profile::IconOverrideSource()
+{
+    for (const auto& parent : _parents)
+    {
+        if (auto source{ parent->_getIconOverrideSourceImpl() })
+        {
+            return source;
+        }
+    }
+    return nullptr;
+}
+
+void Profile::ClearIcon()
+{
+    _Icon = std::nullopt;
+    _evaluatedIcon = std::nullopt;
+}
+
+std::optional<winrt::hstring> Profile::_getIconImpl() const
+{
+    if (_Icon)
+    {
+        return _Icon;
+    }
+    for (const auto& parent : _parents)
+    {
+        if (auto val{ parent->_getIconImpl() })
+        {
+            return val;
+        }
+    }
+    return std::nullopt;
+}
+
+winrt::Microsoft::Terminal::Settings::Model::Profile Profile::_getIconOverrideSourceImpl() const
+{
+    if (_Icon)
+    {
+        return *this;
+    }
+    for (const auto& parent : _parents)
+    {
+        if (auto source{ parent->_getIconOverrideSourceImpl() })
+        {
+            return source;
+        }
+    }
+    return nullptr;
+}
+
 // Given a commandLine like the following:
 // * "C:\WINDOWS\System32\cmd.exe"
 // * "pwsh -WorkingDirectory ~"
diff --git a/src/cascadia/TerminalSettingsModel/Profile.h b/src/cascadia/TerminalSettingsModel/Profile.h
index 24fbb7d1f2d..281dcabe0ad 100644
--- a/src/cascadia/TerminalSettingsModel/Profile.h
+++ b/src/cascadia/TerminalSettingsModel/Profile.h
@@ -113,6 +113,9 @@ namespace winrt::Microsoft::Terminal::Settings::Model::implementation
         // Special fields
         hstring Icon() const;
         void Icon(const hstring& value);
+        bool HasIcon() const;
+        Model::Profile IconOverrideSource();
+        void ClearIcon();
 
         WINRT_PROPERTY(bool, Deleted, false);
         WINRT_PROPERTY(OriginTag, Origin, OriginTag::None);
@@ -128,8 +131,6 @@ namespace winrt::Microsoft::Terminal::Settings::Model::implementation
         INHERITABLE_SETTING(Model::Profile, bool, Hidden, false);
         INHERITABLE_SETTING(Model::Profile, guid, Guid, _GenerateGuidForProfile(Name(), Source()));
         INHERITABLE_SETTING(Model::Profile, hstring, Padding, DEFAULT_PADDING);
-        // Icon is _very special_ because we want to customize its setter
-        _BASE_INHERITABLE_SETTING(Model::Profile, std::optional<hstring>, Icon, L"\uE756");
 
     public:
 #define PROFILE_SETTINGS_INITIALIZE(type, name, jsonKey, ...) \
@@ -141,6 +142,7 @@ namespace winrt::Microsoft::Terminal::Settings::Model::implementation
         Model::IAppearanceConfig _DefaultAppearance{ winrt::make<AppearanceConfig>(weak_ref<Model::Profile>(*this)) };
         Model::FontConfig _FontInfo{ winrt::make<FontConfig>(weak_ref<Model::Profile>(*this)) };
 
+        std::optional<hstring> _Icon{ std::nullopt };
         std::optional<winrt::hstring> _evaluatedIcon{ std::nullopt };
         std::set<std::string> _changeLog;
 
@@ -149,6 +151,8 @@ namespace winrt::Microsoft::Terminal::Settings::Model::implementation
         static guid _GenerateGuidForProfile(const std::wstring_view& name, const std::wstring_view& source) noexcept;
 
         winrt::hstring _evaluateIcon() const;
+        std::optional<hstring> _getIconImpl() const;
+        Model::Profile _getIconOverrideSourceImpl() const;
         void _logSettingSet(const std::string_view& setting);
         void _logSettingIfSet(const std::string_view& setting, const bool isSet);