From e460202d6c824f61a3f315546a67619701730fce Mon Sep 17 00:00:00 2001 From: "nf-osi[bot]" Date: Mon, 19 Aug 2024 20:41:27 +0000 Subject: [PATCH] Rebuild NF.jsonld, json --- NF.jsonld | 34018 ++++++++++--------- registered-json-schemas/Dataset.json | 1 + registered-json-schemas/PortalDataset.json | 41 +- registered-json-schemas/PortalStudy.json | 35 +- registered-json-schemas/Superdataset.json | 1 + 5 files changed, 17098 insertions(+), 16998 deletions(-) diff --git a/NF.jsonld b/NF.jsonld index a0fde761..2125f9f2 100644 --- a/NF.jsonld +++ b/NF.jsonld @@ -2322,5501 +2322,10589 @@ "sms:validationRules": [] }, { - "@id": "bts:AlbanyMedicalCollege", + "@id": "bts:MassSpecAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AlbanyMedicalCollege", + "rdfs:comment": "Template for raw mass spec-based proteomics data.", + "rdfs:label": "MassSpecAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:ProteinAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Albany Medical College", + "sms:displayName": "MassSpecAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:AlbertEinsteinCollegeofMedicine", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AlbertEinsteinCollegeofMedicine", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Albert Einstein College of Medicine", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:AlliantInternationalUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AlliantInternationalUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Component" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Alliant International University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:AmericanUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AmericanUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Filename" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "American University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ArizonaStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ArizonaStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:FileFormat" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Arizona State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:AuburnUniversity,Auburn", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AuburnUniversity,Auburn", - "rdfs:subClassOf": [ + "@id": "bts:ResourceType" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Auburn University, Auburn", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:AugustaUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AugustaUniversity", - "rdfs:subClassOf": [ + "@id": "bts:DataType" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Augusta University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BaylorCollegeofMedicine", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BaylorCollegeofMedicine", - "rdfs:subClassOf": [ + "@id": "bts:DataSubtype" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Baylor College of Medicine", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BaylorUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BaylorUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Assay" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Baylor University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BoiseStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BoiseStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:IndividualID" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Boise State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BostonCollege", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BostonCollege", - "rdfs:subClassOf": [ + "@id": "bts:Species" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Boston College", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BostonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BostonUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Sex" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Boston University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BowlingGreenStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BowlingGreenStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Age" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Bowling Green State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BrandeisUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BrandeisUniversity", - "rdfs:subClassOf": [ + "@id": "bts:AgeUnit" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Brandeis University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BrighamYoungUniversity,Provo", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BrighamYoungUniversity,Provo", - "rdfs:subClassOf": [ + "@id": "bts:Diagnosis" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Brigham Young University, Provo", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:BrownUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "BrownUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Nf1Genotype" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Brown University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CUNY,CityCollege", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CUNY,CityCollege", - "rdfs:subClassOf": [ + "@id": "bts:Nf2Genotype" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "CUNY, City College", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CUNY,HunterCollege", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CUNY,HunterCollege", - "rdfs:subClassOf": [ + "@id": "bts:TumorType" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "CUNY, Hunter College", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CUNY,JohnJayCollegeofCriminalJustice", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CUNY,JohnJayCollegeofCriminalJustice", - "rdfs:subClassOf": [ + "@id": "bts:ModelSystemName" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "CUNY, John Jay College of Criminal Justice", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CUNY,QueensCollege", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CUNY,QueensCollege", - "rdfs:subClassOf": [ + "@id": "bts:Organ" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "CUNY, Queens College", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CaliforniaInstituteofTechnology", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CaliforniaInstituteofTechnology", - "rdfs:subClassOf": [ + "@id": "bts:Comments" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "California Institute of Technology", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CaliforniaPolytechnicStateUniversity,SanLuisObispo", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CaliforniaPolytechnicStateUniversity,SanLuisObispo", - "rdfs:subClassOf": [ + "@id": "bts:ParentSpecimenID" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "California Polytechnic State University, San Luis Obispo", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CaliforniaStateUniversity,LongBeach", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CaliforniaStateUniversity,LongBeach", - "rdfs:subClassOf": [ + "@id": "bts:SpecimenID" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "California State University, Long Beach", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CaliforniaStateUniversity,Northridge", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CaliforniaStateUniversity,Northridge", - "rdfs:subClassOf": [ + "@id": "bts:AliquotID" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "California State University, Northridge", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CaliforniaStateUniversity,Sacramento", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CaliforniaStateUniversity,Sacramento", - "rdfs:subClassOf": [ + "@id": "bts:Platform" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "California State University, Sacramento", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CarnegieMellonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CarnegieMellonUniversity", - "rdfs:subClassOf": [ + "@id": "bts:ProteinExtractSource" + }, { - "@id": "bts:Institution" + "@id": "bts:DataCollectionMode" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Carnegie Mellon University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CaseWesternReserveUniversity", + "@id": "bts:Component", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CaseWesternReserveUniversity", + "rdfs:comment": "Type of metadata template; provide the same one for all items/rows.", + "rdfs:label": "Component", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Case Western Reserve University", - "sms:required": "sms:false", + "sms:displayName": "Component", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:CatholicUniversityofAmerica", + "@id": "bts:Filename", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CatholicUniversityofAmerica", + "rdfs:comment": "The name of the file.", + "rdfs:label": "Filename", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Catholic University of America", + "sms:displayName": "Filename", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CentralMichiganUniversity", + "@id": "bts:FileFormat", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CentralMichiganUniversity", + "rdfs:comment": "Defined format of the data file, typically corresponding to extension, but sometimes indicating more general group of files produced by the same tool or software", + "rdfs:label": "FileFormat", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Central Michigan University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ChapmanUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ChapmanUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Chapman University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Children'sHospitalofPhiladelphia", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Children'sHospitalofPhiladelphia", - "rdfs:subClassOf": [ + "@id": "bts:7z" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Children's Hospital of Philadelphia", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CincinnatiChildren'sHospitalMedicalCenter", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CincinnatiChildren'sHospitalMedicalCenter", - "rdfs:subClassOf": [ + "@id": "bts:DICOM" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Cincinnati Children's Hospital Medical Center", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CityofHope", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CityofHope", - "rdfs:subClassOf": [ + "@id": "bts:MATLABdata" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "City of Hope", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ClarksonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ClarksonUniversity", - "rdfs:subClassOf": [ + "@id": "bts:MATLABscript" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Clarkson University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ClemsonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ClemsonUniversity", - "rdfs:subClassOf": [ + "@id": "bts:NWB" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Clemson University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ClevelandStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ClevelandStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:PAR" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Cleveland State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ColdSpringHarborLaboratory", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ColdSpringHarborLaboratory", - "rdfs:subClassOf": [ + "@id": "bts:Pythonscript" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Cold Spring Harbor Laboratory", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:ColoradoStateUniversity,FortCollins", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ColoradoStateUniversity,FortCollins", - "rdfs:subClassOf": [ + "@id": "bts:Rscript" + }, { - "@id": "bts:Institution" + "@id": "bts:RCC" + }, + { + "@id": "bts:RData" + }, + { + "@id": "bts:REC" + }, + { + "@id": "bts:SDAT" + }, + { + "@id": "bts:SPAR" + }, + { + "@id": "bts:Sentrixdescriptorfile" + }, + { + "@id": "bts:Ab1" + }, + { + "@id": "bts:Abf" + }, + { + "@id": "bts:Ai" + }, + { + "@id": "bts:Avi" + }, + { + "@id": "bts:Bai" + }, + { + "@id": "bts:Bam" + }, + { + "@id": "bts:Bashscript" + }, + { + "@id": "bts:Bcf" + }, + { + "@id": "bts:Bed" + }, + { + "@id": "bts:BedbroadPeak" + }, + { + "@id": "bts:BedgappedPeak" + }, + { + "@id": "bts:BednarrowPeak" + }, + { + "@id": "bts:Bedgraph" + }, + { + "@id": "bts:Bgzip" + }, + { + "@id": "bts:Bigwig" + }, + { + "@id": "bts:Bmp" + }, + { + "@id": "bts:Bpm" + }, + { + "@id": "bts:Cel" + }, + { + "@id": "bts:Chp" + }, + { + "@id": "bts:Cnn" + }, + { + "@id": "bts:Cnr" + }, + { + "@id": "bts:Cns" + }, + { + "@id": "bts:Cram" + }, + { + "@id": "bts:Crai" + }, + { + "@id": "bts:Csi" + }, + { + "@id": "bts:Csv" + }, + { + "@id": "bts:Ctab" + }, + { + "@id": "bts:Czi" + }, + { + "@id": "bts:Dat" + }, + { + "@id": "bts:Doc" + }, + { + "@id": "bts:Dockerimage" + }, + { + "@id": "bts:Dup" + }, + { + "@id": "bts:Edat3" + }, + { + "@id": "bts:Excel" + }, + { + "@id": "bts:Fasta" + }, + { + "@id": "bts:Fastq" + }, + { + "@id": "bts:Fcs" + }, + { + "@id": "bts:Fig" + }, + { + "@id": "bts:Flagstat" + }, + { + "@id": "bts:Gct" + }, + { + "@id": "bts:Gff3" + }, + { + "@id": "bts:Gtf" + }, + { + "@id": "bts:Gzip" + }, + { + "@id": "bts:Hdf5" + }, + { + "@id": "bts:Hdr" + }, + { + "@id": "bts:Hic" + }, + { + "@id": "bts:Html" + }, + { + "@id": "bts:Hyperlink" + }, + { + "@id": "bts:Idat" + }, + { + "@id": "bts:Idx" + }, + { + "@id": "bts:Img" + }, + { + "@id": "bts:Jpg" + }, + { + "@id": "bts:Js" + }, + { + "@id": "bts:Json" + }, + { + "@id": "bts:Lif" + }, + { + "@id": "bts:Locs" + }, + { + "@id": "bts:Maf" + }, + { + "@id": "bts:Md" + }, + { + "@id": "bts:Mov" + }, + { + "@id": "bts:MPEG-4" + }, + { + "@id": "bts:Msf" + }, + { + "@id": "bts:Mtx" + }, + { + "@id": "bts:MzML" + }, + { + "@id": "bts:Nii" + }, + { + "@id": "bts:Ome-tiff" + }, + { + "@id": "bts:Pdf" + }, + { + "@id": "bts:Plink" + }, + { + "@id": "bts:Png" + }, + { + "@id": "bts:Powerpoint" + }, + { + "@id": "bts:Pzfx" + }, + { + "@id": "bts:Psydat" + }, + { + "@id": "bts:Raw" + }, + { + "@id": "bts:Rds" + }, + { + "@id": "bts:Recal" + }, + { + "@id": "bts:Rmd" + }, + { + "@id": "bts:Sam" + }, + { + "@id": "bts:Sav" + }, + { + "@id": "bts:Sdf" + }, + { + "@id": "bts:Seg" + }, + { + "@id": "bts:Sf" + }, + { + "@id": "bts:Sif" + }, + { + "@id": "bts:Sqlite" + }, + { + "@id": "bts:Sra" + }, + { + "@id": "bts:Svg" + }, + { + "@id": "bts:Svs" + }, + { + "@id": "bts:TagAlign" + }, + { + "@id": "bts:Tar" + }, + { + "@id": "bts:Tbi" + }, + { + "@id": "bts:Tif" + }, + { + "@id": "bts:Tom" + }, + { + "@id": "bts:Tranches" + }, + { + "@id": "bts:Tsv" + }, + { + "@id": "bts:Txt" + }, + { + "@id": "bts:Vcf" + }, + { + "@id": "bts:Wiggle" + }, + { + "@id": "bts:Xml" + }, + { + "@id": "bts:Yaml" + }, + { + "@id": "bts:Zip" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Colorado State University, Fort Collins", - "sms:required": "sms:false", + "sms:displayName": "fileFormat", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:ColumbiaU.intheCityofNewYork", + "@id": "bts:ResourceType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ColumbiaU.intheCityofNewYork", + "rdfs:comment": "The type of resource being stored and annotated", + "rdfs:label": "ResourceType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Columbia U. in the City of New York", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:CornellUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CornellUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:ExperimentalData" + }, + { + "@id": "bts:Result" + }, + { + "@id": "bts:Tool" + }, + { + "@id": "bts:Workflowreport" + }, + { + "@id": "bts:Report" + }, + { + "@id": "bts:Metadata" + }, + { + "@id": "bts:Protocol" + }, + { + "@id": "bts:Weblink" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Cornell University", - "sms:required": "sms:false", + "sms:displayName": "resourceType", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:CreightonUniversity", + "@id": "bts:DataType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CreightonUniversity", + "rdfs:comment": "Links an entity to data types that the entity represents/contains. This is closely tied to the assay property. For example, a file of dataType `genomicVariants` might have an assay value of `whole genome sequencing`.\n", + "rdfs:label": "DataType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Creighton University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Dana-FarberCancerInstitute", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Dana-FarberCancerInstitute", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Dana-Farber Cancer Institute", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:DartmouthCollege", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "DartmouthCollege", - "rdfs:subClassOf": [ + "@id": "bts:Immunoassay" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Dartmouth College", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:DelawareStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "DelawareStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Behaviorprocess" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Delaware State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:DrexelUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "DrexelUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Clinical" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Drexel University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:DukeUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "DukeUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Demographics" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Duke University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:DuquesneUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "DuquesneUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Particlecharacterization" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Duquesne University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:EastCarolinaUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "EastCarolinaUniversity", - "rdfs:subClassOf": [ + "@id": "bts:DrugCombinationScreen" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "East Carolina University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:EastTennesseeStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "EastTennesseeStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:IsoformExpression" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "East Tennessee State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:EasternVirginiaMedicalSchool", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "EasternVirginiaMedicalSchool", - "rdfs:subClassOf": [ + "@id": "bts:Proteomics" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Eastern Virginia Medical School", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:EmoryUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "EmoryUniversity", - "rdfs:subClassOf": [ + "@id": "bts:SurveyData" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Emory University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:EutropicsPharmaceuticals", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "EutropicsPharmaceuticals", - "rdfs:subClassOf": [ + "@id": "bts:Kinomics" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Eutropics Pharmaceuticals", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:FloridaA&MUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "FloridaA&MUniversity", - "rdfs:subClassOf": [ + "@id": "bts:SomaticVariants" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Florida A&M University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:FloridaAtlanticUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "FloridaAtlanticUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Volume" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Florida Atlantic University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:FloridaInstituteofTechnology", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "FloridaInstituteofTechnology", - "rdfs:subClassOf": [ + "@id": "bts:Characteristic" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Florida Institute of Technology", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:FloridaInternationalUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "FloridaInternationalUniversity", - "rdfs:subClassOf": [ + "@id": "bts:DrugScreen" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Florida International University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:FloridaStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "FloridaStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:GeneExpression" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Florida State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:FordhamUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "FordhamUniversity", - "rdfs:subClassOf": [ + "@id": "bts:AlignedReads" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Fordham University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:GeorgeMasonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "GeorgeMasonUniversity", - "rdfs:subClassOf": [ + "@id": "bts:GenomicFeatures" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "George Mason University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:GeorgeWashingtonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "GeorgeWashingtonUniversity", - "rdfs:subClassOf": [ + "@id": "bts:GenomicVariants" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "George Washington University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:GeorgetownUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "GeorgetownUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Rawcounts" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Georgetown University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:GeorgiaInstituteofTechnology", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "GeorgiaInstituteofTechnology", - "rdfs:subClassOf": [ + "@id": "bts:RawIntensities" + }, { - "@id": "bts:Institution" + "@id": "bts:NormalizedIntensities" + }, + { + "@id": "bts:PharmacokineticStudy" + }, + { + "@id": "bts:Maskimage" + }, + { + "@id": "bts:ChromatinActivity" + }, + { + "@id": "bts:StructuralVariants" + }, + { + "@id": "bts:GermlineVariants" + }, + { + "@id": "bts:CopyNumberVariants" + }, + { + "@id": "bts:Image" + }, + { + "@id": "bts:Network" + }, + { + "@id": "bts:CellularPhysiology" + }, + { + "@id": "bts:Metabolomics" + }, + { + "@id": "bts:AnnotatedSomaticVariants" + }, + { + "@id": "bts:AnnotatedGermlineVariants" + }, + { + "@id": "bts:Weight" + }, + { + "@id": "bts:Electrophysiology" + }, + { + "@id": "bts:Audiotranscript" + }, + { + "@id": "bts:DataIndex" + }, + { + "@id": "bts:DescriptiveMetadata" + }, + { + "@id": "bts:StructuralMetadata" + }, + { + "@id": "bts:AdministrativeMetadata" + }, + { + "@id": "bts:ReferenceMetadata" + }, + { + "@id": "bts:StatisticalMetadata" + }, + { + "@id": "bts:LegalMetadata" + }, + { + "@id": "bts:WorkflowMetadata" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Georgia Institute of Technology", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:GeorgiaStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "GeorgiaStateUniversity", - "rdfs:subClassOf": [ + "sms:displayName": "dataType", + "sms:required": "sms:true", + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:DataSubtype" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Georgia State University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HarvardUniversity", + "@id": "bts:DataSubtype", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HarvardUniversity", + "rdfs:comment": "Further qualification of dataType, which may be used to indicate the state of processing of the data, aggregation of the data, or presence of metadata.", + "rdfs:label": "DataSubtype", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Harvard University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:HenriMondorHospitalParisEstCreteilFrance", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HenriMondorHospitalParisEstCreteilFrance", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Normalized" + }, + { + "@id": "bts:DataMatrix" + }, + { + "@id": "bts:Raw" + }, + { + "@id": "bts:Processed" + }, + { + "@id": "bts:Metadata" + }, + { + "@id": "bts:Representative" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Henri Mondor Hospital Paris Est Creteil France", - "sms:required": "sms:false", + "sms:displayName": "dataSubtype", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:HowardUniversity", + "@id": "bts:Assay", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HowardUniversity", + "rdfs:comment": "The technology used to generate the data in this file.", + "rdfs:label": "Assay", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Howard University", - "sms:required": "sms:false", + "schema:rangeIncludes": [ + { + "@id": "bts:2DAlamarBlueabsorbance" + }, + { + "@id": "bts:2DAlamarBluefluorescence" + }, + { + "@id": "bts:3Dconfocalimaging" + }, + { + "@id": "bts:3Delectronmicroscopy" + }, + { + "@id": "bts:3Dimaging" + }, + { + "@id": "bts:3Dmicrotissueviability" + }, + { + "@id": "bts:Actigraphy" + }, + { + "@id": "bts:AlgometRxNociometer" + }, + { + "@id": "bts:ATAC-seq" + }, + { + "@id": "bts:ATPaseactivityassay" + }, + { + "@id": "bts:BrdUproliferationassay" + }, + { + "@id": "bts:CAPP-seq" + }, + { + "@id": "bts:CUT&RUN" + }, + { + "@id": "bts:ChIP-seq" + }, + { + "@id": "bts:ChildBehaviorChecklistforAges1.5-5" + }, + { + "@id": "bts:ChildBehaviorChecklistforAges6-18" + }, + { + "@id": "bts:CODEX" + }, + { + "@id": "bts:Corsiblocks" + }, + { + "@id": "bts:DNAopticalmapping" + }, + { + "@id": "bts:ELISA" + }, + { + "@id": "bts:ERRbisulfitesequencing" + }, + { + "@id": "bts:EdUproliferationassay" + }, + { + "@id": "bts:FIA-MSMS" + }, + { + "@id": "bts:FLIPRhigh-throughputcellularscreening" + }, + { + "@id": "bts:FluorescenceInSituHybridization" + }, + { + "@id": "bts:Focusgroup" + }, + { + "@id": "bts:FTIRspectroscopy" + }, + { + "@id": "bts:HI-C" + }, + { + "@id": "bts:HPLC" + }, + { + "@id": "bts:Interview" + }, + { + "@id": "bts:ISO-seq" + }, + { + "@id": "bts:MIB/MS" + }, + { + "@id": "bts:Matrigel-basedtumorigenesisassay" + }, + { + "@id": "bts:MudPIT" + }, + { + "@id": "bts:NIHToolbox" + }, + { + "@id": "bts:NOMe-seq" + }, + { + "@id": "bts:RNAarray" + }, + { + "@id": "bts:RNA-seq" + }, + { + "@id": "bts:RPPA" + }, + { + "@id": "bts:RiccardiandAblonscales" + }, + { + "@id": "bts:SNParray" + }, + { + "@id": "bts:SUSHI" + }, + { + "@id": "bts:Sangersequencing" + }, + { + "@id": "bts:SocialResponsivenessScale" + }, + { + "@id": "bts:SocialResponsivenessScale,SecondEdition" + }, + { + "@id": "bts:Tcellreceptorrepertoiresequencing" + }, + { + "@id": "bts:TIDE" + }, + { + "@id": "bts:TMTquantitation" + }, + { + "@id": "bts:VonFreytest" + }, + { + "@id": "bts:Activeavoidancelearningbehaviorassay" + }, + { + "@id": "bts:Array" + }, + { + "@id": "bts:Atomicforcemicroscopy" + }, + { + "@id": "bts:Autoradiography" + }, + { + "@id": "bts:Bisulfitesequencing" + }, + { + "@id": "bts:Bloodchemistrymeasurement" + }, + { + "@id": "bts:BluenativePAGE" + }, + { + "@id": "bts:Bodysizetraitmeasurement" + }, + { + "@id": "bts:Brightfieldmicroscopy" + }, + { + "@id": "bts:CAMP-GloMaxAssay" + }, + { + "@id": "bts:Calciumretentioncapacityassay" + }, + { + "@id": "bts:Cellcompetition" + }, + { + "@id": "bts:Cellcount" + }, + { + "@id": "bts:Cellpainting" + }, + { + "@id": "bts:Cellproliferation" + }, + { + "@id": "bts:Cellviabilityassay" + }, + { + "@id": "bts:Clinicaldata" + }, + { + "@id": "bts:CNF-Skindex" + }, + { + "@id": "bts:Cognitiveassessment" + }, + { + "@id": "bts:Combinationlibraryscreen" + }, + { + "@id": "bts:Combinationscreen" + }, + { + "@id": "bts:ComplexIIenzymeactivityassay" + }, + { + "@id": "bts:Compoundscreen" + }, + { + "@id": "bts:Contextualconditioningbehaviorassay" + }, + { + "@id": "bts:ConventionalMRI" + }, + { + "@id": "bts:Children'sDermatologyLifeQualityIndexQuestionnaire" + }, + { + "@id": "bts:Differentialscanningcalorimetry" + }, + { + "@id": "bts:Dynamiclightscattering" + }, + { + "@id": "bts:Electrochemiluminescence" + }, + { + "@id": "bts:Electrophoreticlightscattering" + }, + { + "@id": "bts:Elevatedplusmazetest" + }, + { + "@id": "bts:FACE-QAppearance-relatedDistress" + }, + { + "@id": "bts:Flowcytometry" + }, + { + "@id": "bts:Focusformingassay" + }, + { + "@id": "bts:FunctionalMRI" + }, + { + "@id": "bts:Gaitmeasurement" + }, + { + "@id": "bts:Gelfiltrationchromatography" + }, + { + "@id": "bts:Gelpermeationchromatography" + }, + { + "@id": "bts:Genotyping" + }, + { + "@id": "bts:Highcontentscreen" + }, + { + "@id": "bts:Highfrequencyultrasound" + }, + { + "@id": "bts:High-performanceliquidchromatography/tandemmassspectrometry" + }, + { + "@id": "bts:Immunoassay" + }, + { + "@id": "bts:Immunocytochemistry" + }, + { + "@id": "bts:Immunofluorescence" + }, + { + "@id": "bts:Immunohistochemistry" + }, + { + "@id": "bts:Insilicosynthesis" + }, + { + "@id": "bts:Invitrotumorigenesis" + }, + { + "@id": "bts:InvivoPDXviability" + }, + { + "@id": "bts:Invivobioluminescence" + }, + { + "@id": "bts:Invivotumorgrowth" + }, + { + "@id": "bts:Jumpinglibrary" + }, + { + "@id": "bts:Labelfreemassspectrometry" + }, + { + "@id": "bts:Laserspeckleimaging" + }, + { + "@id": "bts:Lightscatteringassay" + }, + { + "@id": "bts:Liquidchromatography-electrochemicaldetection" + }, + { + "@id": "bts:Liquidchromatography/massspectrometry" + }, + { + "@id": "bts:Liquidchromatography/tandemmassspectrometry" + }, + { + "@id": "bts:LncRNA-seq" + }, + { + "@id": "bts:Localfieldpotentialrecording" + }, + { + "@id": "bts:Longtermpotentiationassay" + }, + { + "@id": "bts:MRNAcounts" + }, + { + "@id": "bts:Magneticresonancespectroscopy" + }, + { + "@id": "bts:Massspectrometry" + }, + { + "@id": "bts:Massivelyparallelreporterassay" + }, + { + "@id": "bts:Metabolicscreening" + }, + { + "@id": "bts:Methylationarray" + }, + { + "@id": "bts:MiRNAarray" + }, + { + "@id": "bts:MiRNA-seq" + }, + { + "@id": "bts:Microrheology" + }, + { + "@id": "bts:Skindex-16" + }, + { + "@id": "bts:Multi-electrodearray" + }, + { + "@id": "bts:Nanoparticletrackinganalysis" + }, + { + "@id": "bts:NanoStringnCounterAnalysisSystem" + }, + { + "@id": "bts:N-backtask" + }, + { + "@id": "bts:Neuropsychologicalassessment" + }, + { + "@id": "bts:Nextgenerationtargetedsequencing" + }, + { + "@id": "bts:Noveltyresponsebehaviorassay" + }, + { + "@id": "bts:Openfieldtest" + }, + { + "@id": "bts:Opticaltomography" + }, + { + "@id": "bts:Opticalcoherencetomography" + }, + { + "@id": "bts:Optokineticreflexassay" + }, + { + "@id": "bts:Oscillatoryrheology" + }, + { + "@id": "bts:OxBS-seq" + }, + { + "@id": "bts:Oxygenconsumptionassay" + }, + { + "@id": "bts:Patternelectroretinogram" + }, + { + "@id": "bts:Perineurialcellthickness" + }, + { + "@id": "bts:Phase-contrastmicroscopy" + }, + { + "@id": "bts:Photograph" + }, + { + "@id": "bts:Polymerasechainreaction" + }, + { + "@id": "bts:Polysomnography" + }, + { + "@id": "bts:Positronemissiontomography" + }, + { + "@id": "bts:PROMISCognitiveFunction" + }, + { + "@id": "bts:QuantitativePCR" + }, + { + "@id": "bts:Questionnaire" + }, + { + "@id": "bts:Reactiveoxygenspeciesassay" + }, + { + "@id": "bts:Reportergeneassay" + }, + { + "@id": "bts:Rheometry" + }, + { + "@id": "bts:Ribo-seq" + }, + { + "@id": "bts:Rotarodperformancetest" + }, + { + "@id": "bts:SandwichELISA" + }, + { + "@id": "bts:ScCGI-seq" + }, + { + "@id": "bts:Scale" + }, + { + "@id": "bts:SaferSeqS" + }, + { + "@id": "bts:Singlemoleculedrugscreenassay" + }, + { + "@id": "bts:Single-cellRNA-seq" + }, + { + "@id": "bts:SinglecellATAC-seq" + }, + { + "@id": "bts:Single-nucleusRNA-seq" + }, + { + "@id": "bts:Smallmoleculelibraryscreen" + }, + { + "@id": "bts:Sorbitoldehydrogenaseactivitylevelassay" + }, + { + "@id": "bts:Spatialfrequencydomainimaging" + }, + { + "@id": "bts:Spatialtranscriptomics" + }, + { + "@id": "bts:Staticlightscattering" + }, + { + "@id": "bts:Survival" + }, + { + "@id": "bts:Targetedexomesequencing" + }, + { + "@id": "bts:Tractionforcemicroscopy" + }, + { + "@id": "bts:Twinspotassay" + }, + { + "@id": "bts:Ultrahigh-performanceliquidchromatography/tandemmassspectrometry" + }, + { + "@id": "bts:Westernblot" + }, + { + "@id": "bts:Wholeexomesequencing" + }, + { + "@id": "bts:Wholegenomesequencing" + }, + { + "@id": "bts:Whole-cellpatchclamp" + }, + { + "@id": "bts:STRprofile" + } + ], + "sms:displayName": "assay", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:IndividualID", + "@type": "rdfs:Class", + "rdfs:comment": "A unique identifier (non-PII) that represents the individual from which the data came. This could be a patient or animal ID.", + "rdfs:label": "IndividualID", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "individualID", + "sms:required": "sms:true", + "sms:validationRules": [ + "list like" + ] + }, + { + "@id": "bts:Species", + "@type": "rdfs:Class", + "rdfs:comment": "The name of a species (typically a taxonomic group) of organism.", + "rdfs:label": "Species", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Rattusnorvegicus" + }, + { + "@id": "bts:Gallusgallus" + }, + { + "@id": "bts:Pantroglodytes" + }, + { + "@id": "bts:Musmusculus(humanized)" + }, + { + "@id": "bts:Homosapiens" + }, + { + "@id": "bts:Daniorerio" + }, + { + "@id": "bts:Drosophilamelanogaster" + }, + { + "@id": "bts:Rhesusmacaque" + }, + { + "@id": "bts:Susscrofa" + }, + { + "@id": "bts:Oryctolaguscuniculus" + }, + { + "@id": "bts:Musmusculus" + } + ], + "sms:displayName": "species", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:Sex", + "@type": "rdfs:Class", + "rdfs:comment": "Phenotypic expression of chromosomal makeup that defines a study subject as male, female, or other.", + "rdfs:label": "Sex", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Male" + }, + { + "@id": "bts:Female" + }, + { + "@id": "bts:Unknown" + }, + { + "@id": "bts:NotApplicable" + } + ], + "sms:displayName": "sex", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Age", + "@type": "rdfs:Class", + "rdfs:comment": "A numeric value representing age of the individual. Use with `ageUnit`.", + "rdfs:label": "Age", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "age", + "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:AgeUnit" + } + ], + "sms:validationRules": [ + "num" + ] + }, + { + "@id": "bts:AgeUnit", + "@type": "rdfs:Class", + "rdfs:comment": "A time unit that can be used with a given age value, e.g. years.", + "rdfs:label": "AgeUnit", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Seconds" + }, + { + "@id": "bts:Minutes" + }, + { + "@id": "bts:Hours" + }, + { + "@id": "bts:Days" + }, + { + "@id": "bts:Weeks" + }, + { + "@id": "bts:Months" + }, + { + "@id": "bts:Years" + } + ], + "sms:displayName": "ageUnit", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Diagnosis", + "@type": "rdfs:Class", + "rdfs:comment": "Diagnosis for the individual given signs and symptoms. Use the most specific diagnosis term that applies.", + "rdfs:label": "Diagnosis", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Neurofibromatosistype1" + }, + { + "@id": "bts:Schwannomatosis" + }, + { + "@id": "bts:NF2-relatedschwannomatosis" + }, + { + "@id": "bts:SMARCB1-relatedschwannomatosis" + }, + { + "@id": "bts:LZTR1-relatedschwannomatosis" + }, + { + "@id": "bts:22q-relatedschwannomatosis" + }, + { + "@id": "bts:Schwannomatosis-NOS" + }, + { + "@id": "bts:Schwannomatosis-NEC" + }, + { + "@id": "bts:SporadicSchwannoma" + }, + { + "@id": "bts:NoonanSyndrome" + }, + { + "@id": "bts:NotApplicable" + } + ], + "sms:displayName": "diagnosis", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1Genotype", + "@type": "rdfs:Class", + "rdfs:comment": "Genotype of NF1 gene in the biospecimen from which the data were derived, if known.", + "rdfs:label": "Nf1Genotype", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:-/-" + }, + { + "@id": "bts:+/-" + }, + { + "@id": "bts:+/+" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "nf1Genotype", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf2Genotype", + "@type": "rdfs:Class", + "rdfs:comment": "Genotype of NF2 gene in the biospecimen from which the data were derived, if known", + "rdfs:label": "Nf2Genotype", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:-/-" + }, + { + "@id": "bts:+/-" + }, + { + "@id": "bts:+/+" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "nf2Genotype", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:TumorType", + "@type": "rdfs:Class", + "rdfs:comment": "The type of tumor that the biospecimen used to generate the data were collected from.", + "rdfs:label": "TumorType", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:DiffuseAstrocytoma" + }, + { + "@id": "bts:SubcutaneousNeurofibroma" + }, + { + "@id": "bts:PilomyxoidAstrocytoma" + }, + { + "@id": "bts:JuvenileMyelomonocyticLeukemia" + }, + { + "@id": "bts:AnaplasticAstrocytoma" + }, + { + "@id": "bts:MalignantPeripheralNerveSheathTumor" + }, + { + "@id": "bts:LocalizedNeurofibroma" + }, + { + "@id": "bts:CutaneousNeurofibroma" + }, + { + "@id": "bts:ColorectalAdenocarcinoma" + }, + { + "@id": "bts:AnaplasticPilocyticAstrocytoma" + }, + { + "@id": "bts:Schwannoma" + }, + { + "@id": "bts:HemorrhagicNeoplasm" + }, + { + "@id": "bts:NotApplicable" + }, + { + "@id": "bts:PilocyticAstrocytoma" + }, + { + "@id": "bts:Ganglioglioma" + }, + { + "@id": "bts:PlexiformNeurofibroma" + }, + { + "@id": "bts:NF2-AssociatedTumor" + }, + { + "@id": "bts:Fibrosarcoma" + }, + { + "@id": "bts:Low-GradeGliomaNOS" + }, + { + "@id": "bts:Glioblastoma" + }, + { + "@id": "bts:AnaplasticPleomorphicXanthoastrocytoma" + }, + { + "@id": "bts:GlioblastomaMultiforme" + }, + { + "@id": "bts:Unknown" + }, + { + "@id": "bts:AtypicalPilocyticAstrocytoma" + }, + { + "@id": "bts:OpticPathwayGlioma" + }, + { + "@id": "bts:DiffuseInfiltratingNeurofibroma" + }, + { + "@id": "bts:Fibromatosis" + }, + { + "@id": "bts:NeurofibromawithDegenerativeAtypia" + }, + { + "@id": "bts:NecroticNeoplasm" + }, + { + "@id": "bts:PleomorphicXanthoastrocytoma" + }, + { + "@id": "bts:Teratoma" + }, + { + "@id": "bts:Sarcoma" + }, + { + "@id": "bts:MassiveSoftTissueNeurofibroma" + }, + { + "@id": "bts:Glioma" + }, + { + "@id": "bts:Oligoastrocytoma" + }, + { + "@id": "bts:ColorectalCarcinoma" + }, + { + "@id": "bts:Meningioma" + }, + { + "@id": "bts:ANNUBP" + }, + { + "@id": "bts:High-GradeGliomaNOS" + }, + { + "@id": "bts:NF1-AssociatedTumor" + }, + { + "@id": "bts:AtypicalNeurofibroma" + }, + { + "@id": "bts:CellularNeurofibroma" + }, + { + "@id": "bts:Neurofibroma" + }, + { + "@id": "bts:RecurrentMPNST" + }, + { + "@id": "bts:AnaplasticGanglioglioma" + }, + { + "@id": "bts:Tumor" + }, + { + "@id": "bts:Metastatictumor" + }, + { + "@id": "bts:Metastatic/recurrenttumor" + }, + { + "@id": "bts:Recurrenttumor" + }, + { + "@id": "bts:Melanoma" + }, + { + "@id": "bts:NodularNeurofibroma" + } + ], + "sms:displayName": "tumorType", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:ModelSystemName", + "@type": "rdfs:Class", + "rdfs:comment": " HEK293 (cell line), Minnesota5 (swine strain), DXL (poultry strain), RB51 (vaccine strain of Brucella abortus)", + "rdfs:label": "ModelSystemName", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:HEK293NF1-/-withWTmNf1cDNA" + }, + { + "@id": "bts:SZ-NF4" + }, + { + "@id": "bts:Nf1-/-HEK293" + }, + { + "@id": "bts:HEK293NF1-/-Exon52R2550X#5" + }, + { + "@id": "bts:HBE135-E6E7" + }, + { + "@id": "bts:NCC-MPNST5-C1" + }, + { + "@id": "bts:Sc93.1" + }, + { + "@id": "bts:JHU2-079-PDX" + }, + { + "@id": "bts:HEK293NF1-/-withR192XmNf1cDNA" + }, + { + "@id": "bts:IcNF98.4c" + }, + { + "@id": "bts:ST88-14" + }, + { + "@id": "bts:HTERTNF1ipNF95.6" + }, + { + "@id": "bts:IcNF99.1" + }, + { + "@id": "bts:CNF00.10a" + }, + { + "@id": "bts:IPSCY489C;Exon13crypticsplice" + }, + { + "@id": "bts:3PNFSiPSsvMM11" + }, + { + "@id": "bts:HTERTNF1ipnNF09.4" + }, + { + "@id": "bts:S520" + }, + { + "@id": "bts:SchwanncellNF1-/-withR681XmNf1cDNA" + }, + { + "@id": "bts:JH-2-002-CL" + }, + { + "@id": "bts:NCC-MPNST2-C1" + }, + { + "@id": "bts:HEK293NF1-/-withR1306XmNf1cDNA" + }, + { + "@id": "bts:WTES" + }, + { + "@id": "bts:Fb93.1" + }, + { + "@id": "bts:CNF04.9a" + }, + { + "@id": "bts:JHU2-103-PDX" + }, + { + "@id": "bts:5PNFTDiPSsvPM6" + }, + { + "@id": "bts:NCC-MPNST1-C1" + }, + { + "@id": "bts:7PNFSiPSrvPM12" + }, + { + "@id": "bts:HEK293NF1-/-withR681XmNf1cDNA" + }, + { + "@id": "bts:GM23338" + }, + { + "@id": "bts:HTERTNF1ipnNF95.11c" + }, + { + "@id": "bts:T265" + }, + { + "@id": "bts:HEK293NF1-/-clone2" + }, + { + "@id": "bts:SNF02.2" + }, + { + "@id": "bts:IPSCNF1WT" + }, + { + "@id": "bts:IcNF98.4d" + }, + { + "@id": "bts:NF2-/-AC007-hTERT" + }, + { + "@id": "bts:HEK293NF1-/-withWTtaggedmNf1cDNA" + }, + { + "@id": "bts:NCC-MPNST3-C1" + }, + { + "@id": "bts:HEK293" + }, + { + "@id": "bts:Dh5alpha" + }, + { + "@id": "bts:IcNF97.2a" + }, + { + "@id": "bts:SchwanncellNF1-/-(iPN97.4#24)" + }, + { + "@id": "bts:CNF97.5" + }, + { + "@id": "bts:NCC-MPNST4-C1" + }, + { + "@id": "bts:NMS-2" + }, + { + "@id": "bts:CNF99.1" + }, + { + "@id": "bts:HiPSC" + }, + { + "@id": "bts:AC007-hTERT" + }, + { + "@id": "bts:ScienCellSchwanncells" + }, + { + "@id": "bts:IcNF04.9a" + }, + { + "@id": "bts:90-8" + }, + { + "@id": "bts:SchwanncellNF1-/-withWTtaggedmNf1cDNA" + }, + { + "@id": "bts:IPSCNF1+/-BJFF.6bkgd" + }, + { + "@id": "bts:JHU2-079-CL" + }, + { + "@id": "bts:CNF97.2b" + }, + { + "@id": "bts:JHU2-002-CL" + }, + { + "@id": "bts:NF1" + }, + { + "@id": "bts:SZ-NF1" + }, + { + "@id": "bts:3PNFFiPSsvPM2" + }, + { + "@id": "bts:HTERTNF1ipNF05.5(Mixedclones)" + }, + { + "@id": "bts:HTERTipn02.32λ" + }, + { + "@id": "bts:JHU2-103-CL" + }, + { + "@id": "bts:HEK293NF1-/-Exon17#A15G629Rcrypticsplice" + }, + { + "@id": "bts:Lis42NF11N" + }, + { + "@id": "bts:ELK-TADLuciferaseReporterHEK293StableNF1-/-" + }, + { + "@id": "bts:Humanforeskinfibroblasts" + }, + { + "@id": "bts:IcNF00.10a" + }, + { + "@id": "bts:HEK293NF1-/-withR1947XmNf1cDNA" + }, + { + "@id": "bts:Nf1-/-Epitheliallungcells" + }, + { + "@id": "bts:Nf2-/-SchwannSC(mouse)(PMID26554010)" + }, + { + "@id": "bts:STS-26T" + }, + { + "@id": "bts:HEK293NF1-/-withR461XmNf1cDNA" + }, + { + "@id": "bts:I28cNF" + }, + { + "@id": "bts:SNF94.3" + }, + { + "@id": "bts:Nf1-/-skin-derivedprecursorcells" + }, + { + "@id": "bts:HTERTipn02.8" + }, + { + "@id": "bts:Dhh-Cre;NF1Arg681*/floxSchwannCells" + }, + { + "@id": "bts:KCL024" + }, + { + "@id": "bts:IcNF97.2b" + }, + { + "@id": "bts:HeLaSilenciXNF1" + }, + { + "@id": "bts:HTERTNF1ipNF95.11bC/T" + }, + { + "@id": "bts:HEK293NF1-/-Exon47insT#14" + }, + { + "@id": "bts:HS-PSS" + }, + { + "@id": "bts:YST-1" + }, + { + "@id": "bts:M3MPNST" + }, + { + "@id": "bts:S462.TY" + }, + { + "@id": "bts:S462" + }, + { + "@id": "bts:HEK293NF1-/-Exon17#B48G629Rcrypticsplice" + }, + { + "@id": "bts:GM11602" + }, + { + "@id": "bts:Lis47NF12N" + }, + { + "@id": "bts:HTERTNF1sipnNF95.12B" + }, + { + "@id": "bts:KCL025" + }, + { + "@id": "bts:SchwanncellNF1-/-withR816XmNf1cDNA" + }, + { + "@id": "bts:HiPSC-SCP" + }, + { + "@id": "bts:SNF96.2" + }, + { + "@id": "bts:CNF98.4c" + }, + { + "@id": "bts:NF1-R68XEmbryoniccells" + }, + { + "@id": "bts:BJFF.6" + }, + { + "@id": "bts:Ben-Men-1" + }, + { + "@id": "bts:HEK293NF1-/-withR816XmNf1cDNA" + }, + { + "@id": "bts:HTERTNF1ipNF05.5" + }, + { + "@id": "bts:I18cNF" + }, + { + "@id": "bts:HTERTSCipn97.4" + }, + { + "@id": "bts:I21cNF" + }, + { + "@id": "bts:CNF98.4d" + }, + { + "@id": "bts:28cNF" + }, + { + "@id": "bts:SC4[Mouseschwannoma]" + }, + { + "@id": "bts:CNF18.1a" + }, + { + "@id": "bts:Nf1Arg681*/Arg681*ES" + }, + { + "@id": "bts:GM11601" + }, + { + "@id": "bts:HEK293NF1-/-withR2550XmNf1cDNA" + }, + { + "@id": "bts:JH-2-103-CL" + }, + { + "@id": "bts:HS-Sch-2" + }, + { + "@id": "bts:HTERTNF1ipn02.32λ" + }, + { + "@id": "bts:ELK-TADLuciferaseReporterHEK293Stable" + }, + { + "@id": "bts:6PNFSiPSrvPM2" + }, + { + "@id": "bts:HTERTNF1ipNF03.3" + }, + { + "@id": "bts:JH-2-079-CL" + }, + { + "@id": "bts:HTERTNF1ipNF04.4" + }, + { + "@id": "bts:Nf1Arg681*/Arg681*MEFs" + }, + { + "@id": "bts:Nf1Arg681*/+ES" + }, + { + "@id": "bts:CNF97.2a" + }, + { + "@id": "bts:Schwanncelli28cNFNF1-/-(#14)" + }, + { + "@id": "bts:HTERTNF1ipNF00.6" + }, + { + "@id": "bts:NCC-MPNST3-X2-C1" + }, + { + "@id": "bts:JHU2-002-PDX" + }, + { + "@id": "bts:HTERTNF1ipNF95.11bC" + }, + { + "@id": "bts:5PNFTDiPSsvMM4" + }, + { + "@id": "bts:HTERTNF1ipn06.2A" + }, + { + "@id": "bts:HTERTSCipn02.8" + }, + { + "@id": "bts:SZ-NF2" + }, + { + "@id": "bts:SMPNST" + }, + { + "@id": "bts:B6;129S2-Trp53tm1TyjNf1tm1Tyj/J" + }, + { + "@id": "bts:Prss56Cre;R26mT" + }, + { + "@id": "bts:B6.129S1-Nf1tm1Cbr/J" + }, + { + "@id": "bts:Nf1-OPG" + }, + { + "@id": "bts:C57BL/6J" + }, + { + "@id": "bts:NRG" + }, + { + "@id": "bts:Nf1-OPG-Arg816" + }, + { + "@id": "bts:NODscidgamma" + }, + { + "@id": "bts:B6.129S2-Nf1tm1Tyj/J" + }, + { + "@id": "bts:B6;129-Trp53tm1TyjNf1tm1TyjSuz12Gt(Betageo)1Khe/KcichJ" + }, + { + "@id": "bts:B6.129(Cg)-Nf1tm1Par/J" + }, + { + "@id": "bts:GFAP-Cre;Nf1-G848R/Flox" + }, + { + "@id": "bts:GFAP-Cre;Nf1-R681X/Flox" + }, + { + "@id": "bts:GFAP-Cre;Nf1-C383X/Flox" + }, + { + "@id": "bts:Nf1-C848R/Flox" + }, + { + "@id": "bts:Nf1-R681X/Flox" + }, + { + "@id": "bts:Nf1-C383X/Flox" + }, + { + "@id": "bts:Nf1flox/flox" + } + ], + "sms:displayName": "modelSystemName", + "sms:required": "sms:false", + "sms:validationRules": [ + "list like" + ] + }, + { + "@id": "bts:Organ", + "@type": "rdfs:Class", + "rdfs:comment": "A unique macroscopic (gross) anatomic structure that performs specific functions. It is composed of various tissues. An organ is part of an anatomic system or a body region.", + "rdfs:label": "Organ", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Kidney" + }, + { + "@id": "bts:Ovary" + }, + { + "@id": "bts:Lung" + }, + { + "@id": "bts:Bonemarrow" + }, + { + "@id": "bts:Prostate" + }, + { + "@id": "bts:Breast" + }, + { + "@id": "bts:Mesentery" + }, + { + "@id": "bts:Mammarygland" + }, + { + "@id": "bts:Colon" + }, + { + "@id": "bts:Spleen" + }, + { + "@id": "bts:BursaOfFabricius" + }, + { + "@id": "bts:Nose" + }, + { + "@id": "bts:Brain" + }, + { + "@id": "bts:Pancreas" + }, + { + "@id": "bts:Liver" + }, + { + "@id": "bts:Blood" + }, + { + "@id": "bts:Lymphnode" + }, + { + "@id": "bts:Nerves" + }, + { + "@id": "bts:Skin" + }, + { + "@id": "bts:Eye" + } + ], + "sms:displayName": "organ", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Comments", + "@type": "rdfs:Class", + "rdfs:comment": "Brief free-text comments that may also be important to understanding the resource.", + "rdfs:label": "Comments", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "comments", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ParentSpecimenID", + "@type": "rdfs:Class", + "rdfs:comment": "A unique identifier (non-PII) that represents the parent specimen (sample) from which the data came from, e.g. the single parent tumor that was subsectioned into several samples. The parentSpecimenID can be the same as specimenID when there is no subsectioning.\n", + "rdfs:label": "ParentSpecimenID", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "parentSpecimenID", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SpecimenID", + "@type": "rdfs:Class", + "rdfs:comment": "A unique identifier (non-PII) that represents the subspecimen (subsample) from which the data came, e.g. an ID that distinguishes between different parts of the same parent tumor specimen.\n", + "rdfs:label": "SpecimenID", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "specimenID", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:AliquotID", + "@type": "rdfs:Class", + "rdfs:comment": "A unique identifier (non-PII) that represents the aliquots used for e.g. replicate runs. This is linked to the specimenID.", + "rdfs:label": "AliquotID", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "aliquotID", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Platform", + "@type": "rdfs:Class", + "rdfs:comment": "A sequencing platform, microscope, spectroscope/plate reader, or other platform for collecting data.", + "rdfs:label": "Platform", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:10xVisiumSpatialGeneExpression" + }, + { + "@id": "bts:2DCellTiter-Glo" + }, + { + "@id": "bts:2DIncucyte" + }, + { + "@id": "bts:AffymetrixGenome-WideHumanSNP5.0Array" + }, + { + "@id": "bts:AffymetrixGenome-WideHumanSNP6.0Array" + }, + { + "@id": "bts:AffymetrixHumanGene1.0STArray" + }, + { + "@id": "bts:AffymetrixHumanGenomeU133Plus2.0Array" + }, + { + "@id": "bts:AffymetrixU133AB" + }, + { + "@id": "bts:Agilent44Karray" + }, + { + "@id": "bts:BDFACSCalibur" + }, + { + "@id": "bts:BGISEQ-500" + }, + { + "@id": "bts:BionanoIrys" + }, + { + "@id": "bts:Caliper" + }, + { + "@id": "bts:CherryImagingFACEPlatform" + }, + { + "@id": "bts:CherryImagingTRACEPlatform" + }, + { + "@id": "bts:ChromiumX" + }, + { + "@id": "bts:EnVision2103MultiplateReader" + }, + { + "@id": "bts:GEDiscoveryMR7503T" + }, + { + "@id": "bts:GEOptimaMR450W1.5T" + }, + { + "@id": "bts:GESignaHDxt1.5T" + }, + { + "@id": "bts:GESignaGenesis1.5T" + }, + { + "@id": "bts:GESignaHDxt3T" + }, + { + "@id": "bts:GESignaPremier3T" + }, + { + "@id": "bts:GESignaExcite1.5T" + }, + { + "@id": "bts:HitachiEchelon1.5T" + }, + { + "@id": "bts:HitachiOasis1.2T" + }, + { + "@id": "bts:IVISSpectrumInVivoImagingSystem" + }, + { + "@id": "bts:Illumina1M" + }, + { + "@id": "bts:IlluminaGenomeAnalyzerIIx" + }, + { + "@id": "bts:IlluminaHiSeq2000" + }, + { + "@id": "bts:IlluminaHiSeq2500" + }, + { + "@id": "bts:IlluminaHiSeq3000" + }, + { + "@id": "bts:IlluminaHiSeq4000" + }, + { + "@id": "bts:IlluminaHiSeqX" + }, + { + "@id": "bts:IlluminaHuman660W-Quadv1.0BeadChip" + }, + { + "@id": "bts:IlluminaHumanHap300" + }, + { + "@id": "bts:IlluminaHumanMethylation450" + }, + { + "@id": "bts:IlluminaHumanOmni1-Quadv1.0" + }, + { + "@id": "bts:IlluminaHumanOmniExpress-24v1.0BeadChip" + }, + { + "@id": "bts:IlluminaHumanOmniExpress-24v1.2BeadChip" + }, + { + "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv1.0(850k)" + }, + { + "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv2.0(935k)" + }, + { + "@id": "bts:IlluminaMiSeq" + }, + { + "@id": "bts:IlluminaMouseWG-6v2.0expressionbeadchip" + }, + { + "@id": "bts:IlluminaNextSeq1000" + }, + { + "@id": "bts:IlluminaNextSeq2000" + }, + { + "@id": "bts:IlluminaNextSeq500" + }, + { + "@id": "bts:IlluminaNextSeq550" + }, + { + "@id": "bts:IlluminaNovaSeq6000" + }, + { + "@id": "bts:IlluminaNovaSeqX" + }, + { + "@id": "bts:IlluminaNovaSeqXPlus" + }, + { + "@id": "bts:IlluminaOmni2pt5M" + }, + { + "@id": "bts:IlluminaOmni5M" + }, + { + "@id": "bts:IlluminaWholeGenomeDASL" + }, + { + "@id": "bts:Illuminah650" + }, + { + "@id": "bts:InfiniumHumanOmniExpressExome" + }, + { + "@id": "bts:LI-COROdysseyCLx" + }, + { + "@id": "bts:LTQOrbitrapXL" + }, + { + "@id": "bts:LeicaAperioAT2" + }, + { + "@id": "bts:LeicaMZ16" + }, + { + "@id": "bts:LeicaS9Stereomicroscope" + }, + { + "@id": "bts:LifeVizInfinitySystem" + }, + { + "@id": "bts:LifeVizMicroSystem" + }, + { + "@id": "bts:MGIT-series" + }, + { + "@id": "bts:MalvernZetasizer" + }, + { + "@id": "bts:NanoFCM" + }, + { + "@id": "bts:NanoStringHumannCounterPanCancerIO360Panel" + }, + { + "@id": "bts:NanostringCounter" + }, + { + "@id": "bts:NanostringGeoMx" + }, + { + "@id": "bts:NotApplicable" + }, + { + "@id": "bts:OlympusDP80" + }, + { + "@id": "bts:OlympusIX73" + }, + { + "@id": "bts:OrbitrapFusionLumosTribrid" + }, + { + "@id": "bts:OtherPlatform" + }, + { + "@id": "bts:OxfordNanopore" + }, + { + "@id": "bts:PacBioRSII" + }, + { + "@id": "bts:PacBioSequelIISystem" + }, + { + "@id": "bts:PacBioSequelIIeSystem" + }, + { + "@id": "bts:Pannoramic250Flash" + }, + { + "@id": "bts:Perlegen300Karray" + }, + { + "@id": "bts:PhilipsAchieva1.5T" + }, + { + "@id": "bts:PhilipsAchieva3T" + }, + { + "@id": "bts:PhilipsInteraAchieva3T" + }, + { + "@id": "bts:PhilipsIngenia1.5T" + }, + { + "@id": "bts:PhilipsIngenia3T" + }, + { + "@id": "bts:PhilipsPanorama1.0T" + }, + { + "@id": "bts:PromegaGloMaxDiscover" + }, + { + "@id": "bts:QExativeHF" + }, + { + "@id": "bts:Scale" + }, + { + "@id": "bts:SiemensAvanto1.5T" + }, + { + "@id": "bts:SiemensAvantoFit1.5T" + }, + { + "@id": "bts:SiemensMagnetomAera1.5T" + }, + { + "@id": "bts:SiemensMagnetomEspree1.5T" + }, + { + "@id": "bts:SiemensMagnetomPrisma3T" + }, + { + "@id": "bts:SiemensMagnetomSkyra3T" + }, + { + "@id": "bts:SiemensMagnetomTrio3T" + }, + { + "@id": "bts:SiemensMagnetomVerio3T" + }, + { + "@id": "bts:SiemensMagnetomPrismaFit3T" + }, + { + "@id": "bts:SpectramaxMSeries" + }, + { + "@id": "bts:TOOsonixSystemONE-M" + }, + { + "@id": "bts:ToshibaVantageTitan1.5T" + }, + { + "@id": "bts:VarioskanLUX" + }, + { + "@id": "bts:VectraH13DImagingSystem" + }, + { + "@id": "bts:Vevo3100ImagingSystem" + }, + { + "@id": "bts:XF24ExtracellularFluxAnalyzer" + }, + { + "@id": "bts:ZeissLSM" + }, + { + "@id": "bts:ZeissLSM700" + }, + { + "@id": "bts:ZeissLSM980" + }, + { + "@id": "bts:ZenoElectronicWalkway" + }, + { + "@id": "bts:ZetaView" + } + ], + "sms:displayName": "platform", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:ProteinExtractSource", + "@type": "rdfs:Class", + "rdfs:comment": "Source of the extracted protein used in the experiment", + "rdfs:label": "ProteinExtractSource", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Celllysate" + }, + { + "@id": "bts:Cytoplasm" + }, + { + "@id": "bts:Mitochondria" + }, + { + "@id": "bts:Nuclearextract" + } + ], + "sms:displayName": "proteinExtractSource", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:DataCollectionMode", + "@type": "rdfs:Class", + "rdfs:comment": "Mode of data collection in tandem MS assays. Either DDA (data-dependent acquisition) or DIA (data-independent) acquisition.", + "rdfs:label": "DataCollectionMode", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:DDA" + }, + { + "@id": "bts:DIA" + }, + { + "@id": "bts:Other" + } + ], + "sms:displayName": "dataCollectionMode", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:ProteinAssayTemplate", + "@type": "rdfs:Class", + "rdfs:comment": "Abstract template for data from some assay of protein structure and function. Data should be instantiated with more specific template.", + "rdfs:label": "ProteinAssayTemplate", + "rdfs:subClassOf": [ + { + "@id": "bts:BiologicalAssayDataTemplate" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "ProteinAssayTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:ProteinExtractSource" + } + ], + "sms:validationRules": [] + }, + { + "@id": "bts:ClinicalAssayTemplate", + "@type": "rdfs:Class", + "rdfs:comment": "General template for typically tabular **individual-level** data. This can include repeated measures and a drug treatment context.\n", + "rdfs:label": "ClinicalAssayTemplate", + "rdfs:subClassOf": [ + { + "@id": "bts:BiologicalAssayDataTemplate" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "ClinicalAssayTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ExperimentalFactor" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:TimepointUnit" + }, + { + "@id": "bts:CompoundName" + }, + { + "@id": "bts:CompoundDose" + }, + { + "@id": "bts:CompoundDoseUnit" + } + ], + "sms:validationRules": [] + }, + { + "@id": "bts:ExperimentalFactor", + "@type": "rdfs:Class", + "rdfs:comment": "An ontology concept for experimental factor measured with this data.", + "rdfs:label": "ExperimentalFactor", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Braingrowthmeasurement" + }, + { + "@id": "bts:Brainvolumemeasurement" + }, + { + "@id": "bts:Bodyweight" + }, + { + "@id": "bts:Clinicallaboratorymeasurement" + }, + { + "@id": "bts:Cognitivefunctionmeasurement" + }, + { + "@id": "bts:Gaitmeasurement" + }, + { + "@id": "bts:Motordevelopmentmeasurement" + }, + { + "@id": "bts:Painmeasurement" + } + ], + "sms:displayName": "experimentalFactor", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ExperimentalCondition", + "@type": "rdfs:Class", + "rdfs:comment": "A free-text description of the experimental condition (e.g. 5 mM doxorubicin).", + "rdfs:label": "ExperimentalCondition", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "experimentalCondition", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:TimepointUnit", + "@type": "rdfs:Class", + "rdfs:comment": "For timed experiments this represents the unit of time measured", + "rdfs:label": "TimepointUnit", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Seconds" + }, + { + "@id": "bts:Minutes" + }, + { + "@id": "bts:Hours" + }, + { + "@id": "bts:Days" + }, + { + "@id": "bts:Weeks" + }, + { + "@id": "bts:Months" + }, + { + "@id": "bts:Years" + } + ], + "sms:displayName": "timepointUnit", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HumboldtStateUniversity", + "@id": "bts:CompoundName", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HumboldtStateUniversity", + "rdfs:comment": "//pubchem.ncbi.nlm.nih.gov/compound/10127622)", + "rdfs:label": "CompoundName", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Humboldt State University", + "sms:displayName": "compoundName", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcahnSchoolofMedicineatMountSinai", + "@id": "bts:CompoundDose", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IcahnSchoolofMedicineatMountSinai", + "rdfs:comment": "A dose quantity for the treatment compound. To be used with compoundDoseUnit.", + "rdfs:label": "CompoundDose", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Icahn School of Medicine at Mount Sinai", + "sms:displayName": "compoundDose", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:CompoundDoseUnit" + } + ], "sms:validationRules": [] }, { - "@id": "bts:IdahoStateUniversity", + "@id": "bts:CompoundDoseUnit", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IdahoStateUniversity", + "rdfs:comment": "A unit associated with the value(s) in compoundDose.", + "rdfs:label": "CompoundDoseUnit", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "compoundDoseUnit", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:BiologicalAssayDataTemplate", + "@type": "rdfs:Class", + "rdfs:comment": "A template defining basic metadata on deposited data artifacts (i.e. files) from experimental assays involving biosamples. This is an abstract template; \"real\" template subclasses define additional properties appropriate for the type of data file (e.g. imaging vs sequencing).\n", + "rdfs:label": "BiologicalAssayDataTemplate", + "rdfs:subClassOf": [ + { + "@id": "bts:Template" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "BiologicalAssayDataTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + } + ], + "sms:validationRules": [] + }, + { + "@id": "bts:ScRNASeqTemplate", + "@type": "rdfs:Class", + "rdfs:comment": "Template for describing raw data from single-cell RNA-seq.", + "rdfs:label": "ScRNASeqTemplate", + "rdfs:subClassOf": [ + { + "@id": "bts:ScSequencingAssayTemplate" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "ScRNASeqTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:CellType" + }, + { + "@id": "bts:IsCellLine" + }, + { + "@id": "bts:CellID" + }, + { + "@id": "bts:DissociationMethod" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryKitID" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + }, + { + "@id": "bts:AuxiliaryAsset" + } + ], + "sms:validationRules": [] + }, + { + "@id": "bts:NucleicAcidSource", + "@type": "rdfs:Class", + "rdfs:comment": "Source of the extracted nucleic acid used in the experiment", + "rdfs:label": "NucleicAcidSource", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Bulkcell" + }, + { + "@id": "bts:Bulknuclei" + }, + { + "@id": "bts:Mitochondria" + }, + { + "@id": "bts:Singlecell" + }, + { + "@id": "bts:Singlenucleus" + } + ], + "sms:displayName": "nucleicAcidSource", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SpecimenPreparationMethod", + "@type": "rdfs:Class", + "rdfs:comment": "Term that represents preservation of the sample before usage in, e.g. sequencing", + "rdfs:label": "SpecimenPreparationMethod", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Freshcollected" + }, + { + "@id": "bts:Flashfrozen" + }, + { + "@id": "bts:FFPE" + }, + { + "@id": "bts:Cryopreserved" + }, + { + "@id": "bts:OCT" + }, + { + "@id": "bts:RNAlater" + }, + { + "@id": "bts:Formalin-fixed" + }, + { + "@id": "bts:Ethanol" + }, + { + "@id": "bts:Viablyfrozen" + } + ], + "sms:displayName": "specimenPreparationMethod", + "sms:required": "sms:true", + "sms:validationRules": [] + }, + { + "@id": "bts:CellType", + "@type": "rdfs:Class", + "rdfs:comment": "A cell type is a distinct morphological or functional form of cell.", + "rdfs:label": "CellType", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Monocytes" + }, + { + "@id": "bts:Macrophages" + }, + { + "@id": "bts:IPSC-derivedneuron" + }, + { + "@id": "bts:Lymphoblast" + }, + { + "@id": "bts:IPSC" + }, + { + "@id": "bts:DRG/nerverootneurospherecell" + }, + { + "@id": "bts:CD138+" + }, + { + "@id": "bts:Schwannoma" + }, + { + "@id": "bts:IPSC-derivedtelencephalicorganoids" + }, + { + "@id": "bts:Monocyte-derivedmicroglia" + }, + { + "@id": "bts:Microglia" + }, + { + "@id": "bts:SH-SY5Y" + }, + { + "@id": "bts:CNON" + }, + { + "@id": "bts:NeuN+" + }, + { + "@id": "bts:CulturedMullerglia" + }, + { + "@id": "bts:B-lymphocytes" + }, + { + "@id": "bts:Round" + }, + { + "@id": "bts:Epithelial" + }, + { + "@id": "bts:Epithelial-like" + }, + { + "@id": "bts:CD8+T-Cells" + }, + { + "@id": "bts:GLUtamatergicneurons" + }, + { + "@id": "bts:Arachnoid" + }, + { + "@id": "bts:GABAergicneurons" + }, + { + "@id": "bts:Schwann" + }, + { + "@id": "bts:IPSC-derivedglia" + }, + { + "@id": "bts:IPSC-derivedastrocytes" + }, + { + "@id": "bts:IPSC-derivedneuronalprogenitorcell" + }, + { + "@id": "bts:Oligodendrocyte" + }, + { + "@id": "bts:Fibroblast" + }, + { + "@id": "bts:Astrocytes" + }, + { + "@id": "bts:Schwanncellprecursor" + }, + { + "@id": "bts:NeuN-" + }, + { + "@id": "bts:Embryonicstemcells" + }, + { + "@id": "bts:Teratoma" + }, + { + "@id": "bts:Meningioma" + } + ], + "sms:displayName": "cellType", + "sms:required": "sms:false", + "sms:validationRules": [ + "list like" + ] + }, + { + "@id": "bts:IsCellLine", + "@type": "rdfs:Class", + "rdfs:comment": "Whether or not sample source is a cell line (Yes; No)", + "rdfs:label": "IsCellLine", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "schema:rangeIncludes": [ + { + "@id": "bts:Yes" + }, + { + "@id": "bts:No" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Idaho State University", + "sms:displayName": "isCellLine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IllinoisInstituteofTechnology", + "@id": "bts:CellID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IllinoisInstituteofTechnology", + "rdfs:comment": "Also known as cell barcode, this value can be added for single-cell experiments to identify data at the cell level.", + "rdfs:label": "CellID", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illinois Institute of Technology", + "sms:displayName": "cellID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IllinoisStateUniversity", + "@id": "bts:DissociationMethod", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IllinoisStateUniversity", + "rdfs:comment": "Procedure by which a biological specimen is dissociated into individual cells or a cell suspension", + "rdfs:label": "DissociationMethod", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illinois State University", + "schema:rangeIncludes": [ + { + "@id": "bts:10xV2" + }, + { + "@id": "bts:FACS" + }, + { + "@id": "bts:FluidigmC1" + }, + { + "@id": "bts:Drop-seq" + }, + { + "@id": "bts:InDrop" + }, + { + "@id": "bts:Mouthpipette" + }, + { + "@id": "bts:Enzymatic" + }, + { + "@id": "bts:Mechanical" + } + ], + "sms:displayName": "dissociationMethod", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IndianaUniversity", + "@id": "bts:RunType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IndianaUniversity", + "rdfs:comment": "Sequencing run type.", + "rdfs:label": "RunType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Indiana University", + "schema:rangeIncludes": [ + { + "@id": "bts:PairedEnd" + }, + { + "@id": "bts:SingleEnd" + } + ], + "sms:displayName": "runType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IndianaUniversity,Bloomington", + "@id": "bts:LibraryStrand", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IndianaUniversity,Bloomington", + "rdfs:comment": "Strandedness of paired-end RNA-Sequencing data. This is an important parameter for RNA-seq analysis.", + "rdfs:label": "LibraryStrand", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Indiana University, Bloomington", - "sms:required": "sms:false", + "schema:rangeIncludes": [ + { + "@id": "bts:FirstStranded" + }, + { + "@id": "bts:SecondStranded" + }, + { + "@id": "bts:Unstranded" + }, + { + "@id": "bts:NotApplicable" + } + ], + "sms:displayName": "libraryStrand", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:IndianaUniversity-PurdueUniversityatIndianapolis", + "@id": "bts:LibraryKitID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IndianaUniversity-PurdueUniversityatIndianapolis", + "rdfs:comment": "Library kit ID.", + "rdfs:label": "LibraryKitID", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Indiana University-Purdue University at Indianapolis", + "sms:displayName": "libraryKitID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Institutd'InvestigacióBiomédicadeBellvitge", + "@id": "bts:LibraryPrep", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Institutd'InvestigacióBiomédicadeBellvitge", + "rdfs:comment": "The general strategy by which the library was prepared", + "rdfs:label": "LibraryPrep", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Institut d'Investigació Biomédica de Bellvitge", + "schema:rangeIncludes": [ + { + "@id": "bts:LncRNAenrichment" + }, + { + "@id": "bts:MiRNAenrichment" + }, + { + "@id": "bts:PolyAselection" + }, + { + "@id": "bts:RRNAdepletion" + } + ], + "sms:displayName": "libraryPrep", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Institutd'InvestigacióenCiènciesdelaSalutGermansTriasiPujol", + "@id": "bts:LibraryPreparationMethod", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Institutd'InvestigacióenCiènciesdelaSalutGermansTriasiPujol", + "rdfs:comment": "Method by which library was prepared", + "rdfs:label": "LibraryPreparationMethod", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Institut d'Investigació en Ciències de la Salut Germans Trias i Pujol", - "sms:required": "sms:false", + "schema:rangeIncludes": [ + { + "@id": "bts:10x" + }, + { + "@id": "bts:CEL-seq" + }, + { + "@id": "bts:Drop-Seq" + }, + { + "@id": "bts:GTAC@WUSTLin-houseprep" + }, + { + "@id": "bts:IDTxGenExomeResearchPanel" + }, + { + "@id": "bts:IlluminaTruSeqDNANano" + }, + { + "@id": "bts:IlluminaTn5Transposase" + }, + { + "@id": "bts:IlluminaRibo-ZeroPlus" + }, + { + "@id": "bts:KAPAHyperPrepKitPCR-free" + }, + { + "@id": "bts:KAPARNAHyperPrepKitwithRiboErase(HMR)" + }, + { + "@id": "bts:KAPAmRNAHyperPrepKit" + }, + { + "@id": "bts:NEBNextmRNALibraryPrepReagentSetforIllumina" + }, + { + "@id": "bts:Omni-ATAC" + }, + { + "@id": "bts:QuantSeqFWDV2withUDI" + }, + { + "@id": "bts:Smart-seq2" + }, + { + "@id": "bts:Smart-seq4" + }, + { + "@id": "bts:TruSeq" + }, + { + "@id": "bts:TruSeqstandardtotalRNAlibrarykit" + }, + { + "@id": "bts:OxfordNanoporeDirectRNASequencingKit" + }, + { + "@id": "bts:QIAseqFXDNALibraryKit" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "libraryPreparationMethod", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:Inserm", + "@id": "bts:ReadPair", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Inserm", + "rdfs:comment": "The read of origin, Read 1 or Read 2", + "rdfs:label": "ReadPair", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Inserm", + "sms:displayName": "readPair", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "inRange 1 2" + ] }, { - "@id": "bts:IowaStateUniversity", + "@id": "bts:ReadLength", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "IowaStateUniversity", + "rdfs:comment": "Number of base pairs (bp) sequenced for a read", + "rdfs:label": "ReadLength", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Iowa State University", + "sms:displayName": "readLength", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "int" + ] }, { - "@id": "bts:JAX", + "@id": "bts:ReadDepth", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "JAX", + "rdfs:comment": "If available, the coverage statistic as output from bedtools coverage or samtools stats.", + "rdfs:label": "ReadDepth", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JAX", + "sms:displayName": "readDepth", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "int" + ] }, { - "@id": "bts:JacksonStateUniversity", + "@id": "bts:TargetDepth", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "JacksonStateUniversity", + "rdfs:comment": "The targeted read depth prior to sequencing.", + "rdfs:label": "TargetDepth", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Jackson State University", + "sms:displayName": "targetDepth", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JohnsHopkinsUniversity", + "@id": "bts:BatchID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "JohnsHopkinsUniversity", + "rdfs:comment": "Batch identifier, can be used in any context where added batch information is helpful, such as different sequencing runs or collection times.", + "rdfs:label": "BatchID", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Johns Hopkins University", + "sms:displayName": "batchID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KansasStateUniversity", + "@id": "bts:AuxiliaryAsset", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "KansasStateUniversity", + "rdfs:comment": "URI to supplemental asset(s), e.g. QC reports or other auxiliary files to support the processing, analysis, or interpretation of the current entity.\n", + "rdfs:label": "AuxiliaryAsset", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Kansas State University", + "sms:displayName": "auxiliaryAsset", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KentStateUniversity", + "@id": "bts:ScSequencingAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "KentStateUniversity", + "rdfs:comment": "General template for raw RNA/DNA data, i.e. sequence data from a sequencing assay.", + "rdfs:label": "ScSequencingAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:GeneticsAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Kent State University", + "sms:displayName": "ScSequencingAssayTemplate", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:CellType" + }, + { + "@id": "bts:IsCellLine" + }, + { + "@id": "bts:CellID" + }, + { + "@id": "bts:DissociationMethod" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryKitID" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + }, + { + "@id": "bts:AuxiliaryAsset" + } + ], "sms:validationRules": [] }, { - "@id": "bts:LangstonUniversity", + "@id": "bts:GeneralMeasureDataTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LangstonUniversity", + "rdfs:comment": "General template for data in tabular form that aggregates tissue-level or cellular-level data.\n", + "rdfs:label": "GeneralMeasureDataTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Langston University", + "sms:displayName": "GeneralMeasureDataTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:LehighUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LehighUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:ExperimentalFactor" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" + }, + { + "@id": "bts:CompoundName" + }, + { + "@id": "bts:CompoundDose" + }, + { + "@id": "bts:CompoundDoseUnit" + }, { - "@id": "bts:Institution" + "@id": "bts:GenePerturbed" + }, + { + "@id": "bts:GenePerturbationType" + }, + { + "@id": "bts:GenePerturbationTechnology" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Lehigh University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LeibnizInstituteonAging–FritzLipmannInstitute", + "@id": "bts:ExperimentalTimepoint", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LeibnizInstituteonAging–FritzLipmannInstitute", + "rdfs:comment": "The numeric value indicating the time elapsed from the beginning of the experiment at which the specimen was collected. Use in tandem with timePointUnit", + "rdfs:label": "ExperimentalTimepoint", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Leibniz Institute on Aging – Fritz Lipmann Institute", + "sms:displayName": "experimentalTimepoint", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:LomaLindaUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LomaLindaUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:TimepointUnit" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Loma Linda University", - "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:LongIslandUniversity", + "@id": "bts:GenePerturbed", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LongIslandUniversity", + "rdfs:comment": "The HUGO gene symbol for the gene that is perturbed.", + "rdfs:label": "GenePerturbed", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Long Island University", + "sms:displayName": "genePerturbed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LouisianaStateUniversity,BatonRouge", + "@id": "bts:GenePerturbationType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LouisianaStateUniversity,BatonRouge", + "rdfs:comment": "Specific way in which a single gene was perturbed in a sample", + "rdfs:label": "GenePerturbationType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Louisiana State University, Baton Rouge", + "sms:displayName": "genePerturbationType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LouisianaStateUniversity,HealthSciencesCenter,NewOrleans", + "@id": "bts:GenePerturbationTechnology", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LouisianaStateUniversity,HealthSciencesCenter,NewOrleans", + "rdfs:comment": "Technology used to perturb gene", + "rdfs:label": "GenePerturbationTechnology", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Louisiana State University, Health Sciences Center, New Orleans", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:LouisianaStateUniversity,HealthSciencesCenter,Shreveport", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LouisianaStateUniversity,HealthSciencesCenter,Shreveport", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:RNAi" + }, + { + "@id": "bts:CRISPR" + }, + { + "@id": "bts:CRERecombinase" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Louisiana State University, Health Sciences Center, Shreveport", + "sms:displayName": "genePerturbationTechnology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LouisianaTechUniversity", + "@id": "bts:MaterialScienceAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LouisianaTechUniversity", + "rdfs:comment": "General template for describing data for a materials science assay.", + "rdfs:label": "MaterialScienceAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:NonBiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Louisiana Tech University", + "sms:displayName": "MaterialScienceAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:LoyolaUniversity,Chicago", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LoyolaUniversity,Chicago", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:MaterialType" + }, + { + "@id": "bts:ConcentrationMaterial" + }, + { + "@id": "bts:ConcentrationMaterialUnit" + }, + { + "@id": "bts:ConcentrationNaCl" + }, + { + "@id": "bts:ConcentrationNaClUnit" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Loyola University, Chicago", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:L’InsermdansParisetl’Île-de-FranceCentreNord", + "@id": "bts:MaterialType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "L’InsermdansParisetl’Île-de-FranceCentreNord", + "rdfs:comment": "Type of material in the characterization", + "rdfs:label": "MaterialType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "L’Inserm dans Paris et l’Île-de-France Centre Nord", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MarquetteUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MarquetteUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Nanoparticles" + }, + { + "@id": "bts:Polymericnanoparticles" + }, + { + "@id": "bts:Smallmolecule" + }, + { + "@id": "bts:DNA" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Marquette University", + "sms:displayName": "materialType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MarshallUniversity", + "@id": "bts:ConcentrationMaterial", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MarshallUniversity", + "rdfs:comment": "Numeric value for concentration of the material", + "rdfs:label": "ConcentrationMaterial", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Marshall University", + "sms:displayName": "concentrationMaterial", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:MassachusettsGeneralHospital", + "@id": "bts:ConcentrationMaterialUnit", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MassachusettsGeneralHospital", + "rdfs:comment": "Unit used for the material concentration, e.g. mg/mL", + "rdfs:label": "ConcentrationMaterialUnit", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Massachusetts General Hospital", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MassachusettsInstituteofTechnology", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MassachusettsInstituteofTechnology", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Mg/mL" + }, + { + "@id": "bts:MM" + }, + { + "@id": "bts:Particles/mL" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Massachusetts Institute of Technology", + "sms:displayName": "concentrationMaterialUnit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MayoClinic", + "@id": "bts:ConcentrationNaCl", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MayoClinic", + "rdfs:comment": "Numeric value for NaCl concentration", + "rdfs:label": "ConcentrationNaCl", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mayo Clinic", + "sms:displayName": "concentrationNaCl", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MayoClinicinArizona", + "@id": "bts:ConcentrationNaClUnit", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MayoClinicinArizona", + "rdfs:comment": "Unit used for the NaCl concentration, e.g. mM", + "rdfs:label": "ConcentrationNaClUnit", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mayo Clinic in Arizona", + "schema:rangeIncludes": [ + { + "@id": "bts:Mg/mL" + }, + { + "@id": "bts:MM" + }, + { + "@id": "bts:Particles/mL" + } + ], + "sms:displayName": "concentrationNaClUnit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MedicalCollegeofWisconsin", + "@id": "bts:NonBiologicalAssayDataTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MedicalCollegeofWisconsin", + "rdfs:comment": "Describes data artifacts (i.e. files) from an experimental/physical-sciences assay where input specimens are more at the level of synthesized molecules or inorganic materials.\n", + "rdfs:label": "NonBiologicalAssayDataTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Template" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Medical College of Wisconsin", + "sms:displayName": "NonBiologicalAssayDataTemplate", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + } + ], "sms:validationRules": [] }, { - "@id": "bts:MedicalUniversityofSouthCarolina", + "@id": "bts:RNASeqTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MedicalUniversityofSouthCarolina", + "rdfs:comment": "Template for describing raw data from (bulk) RNA-sequencing", + "rdfs:label": "RNASeqTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BulkSequencingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Medical University of South Carolina", + "sms:displayName": "RNASeqTemplate", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + } + ], "sms:validationRules": [] }, { - "@id": "bts:MemorialSloanKetteringCancerCenter", + "@id": "bts:SpecimenType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MemorialSloanKetteringCancerCenter", + "rdfs:comment": "The type of a material sample taken from a biological entity for testing, diagnostic, propagation, treatment or research purposes. This includes particular types of cellular molecules, cells, tissues, organs, body fluids, embryos, and body excretory substances.\n", + "rdfs:label": "SpecimenType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Memorial Sloan Kettering Cancer Center", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MercerUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MercerUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ + { + "@id": "bts:Cerebralcortex" + }, + { + "@id": "bts:Bonemarrow" + }, + { + "@id": "bts:Plasma" + }, + { + "@id": "bts:DorsalRootGanglion" + }, + { + "@id": "bts:Opticnerve" + }, + { + "@id": "bts:Tumor-adjacentnormal" + }, + { + "@id": "bts:Serum" + }, + { + "@id": "bts:Spheroid" + }, + { + "@id": "bts:Sciaticnerve" + }, + { + "@id": "bts:Meninges" + }, + { + "@id": "bts:Nervetissue" + }, + { + "@id": "bts:BuccalMucosa" + }, + { + "@id": "bts:Embryonictissue" + }, + { + "@id": "bts:Wholebrain" + }, + { + "@id": "bts:Microtissue" + }, + { + "@id": "bts:Retina" + }, + { + "@id": "bts:CDXtissue" + }, + { + "@id": "bts:Organoid" + }, + { + "@id": "bts:Splenocyte" + }, + { + "@id": "bts:Blood" + }, + { + "@id": "bts:Connectivetissue" + }, + { + "@id": "bts:Primarytumor" + }, + { + "@id": "bts:PDXtissue" + }, + { + "@id": "bts:BuffyCoat" + }, { - "@id": "bts:Institution" + "@id": "bts:Saliva" + }, + { + "@id": "bts:Mucus" + }, + { + "@id": "bts:Urine" + }, + { + "@id": "bts:Stool" + }, + { + "@id": "bts:Sweat" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Mercer University", + "sms:displayName": "specimenType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MiamiUniversity", + "@id": "bts:BulkSequencingAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MiamiUniversity", + "rdfs:comment": "General template for raw (level 1) RNA/DNA data, i.e. sequence data from a sequencing assay.", + "rdfs:label": "BulkSequencingAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:GeneticsAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Miami University", + "sms:displayName": "BulkSequencingAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MichiganStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MichiganStateUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Michigan State University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MichiganTechnologicalUniversity", + "@id": "bts:Template", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MichiganTechnologicalUniversity", + "rdfs:comment": "A collection of fields representing some entity.", + "rdfs:label": "Template", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Michigan Technological University", + "sms:displayName": "Template", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MississippiStateUniversity", + "@id": "bts:BiospecimenTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MississippiStateUniversity", + "rdfs:comment": "Specimen-level data, whether from human or animal.", + "rdfs:label": "BiospecimenTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mississippi State University", + "sms:displayName": "BiospecimenTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MissouriUniversityofScienceandTechnology", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MissouriUniversityofScienceandTechnology", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:IndividualID" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:BodySite" + }, + { + "@id": "bts:ExperimentalCondition" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Missouri University of Science and Technology", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MontanaStateUniversity,Bozeman", + "@id": "bts:BodySite", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MontanaStateUniversity,Bozeman", + "rdfs:comment": "Sample location referring to a named area of the body, inclusive of gross anatomical structures and organ parts.", + "rdfs:label": "BodySite", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Montana State University, Bozeman", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MontclairStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MontclairStateUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Axilla" + }, + { + "@id": "bts:Groin" + }, + { + "@id": "bts:Leg" + }, + { + "@id": "bts:Thoracicspine" + }, + { + "@id": "bts:Forearm" + }, + { + "@id": "bts:Acetabulum" + }, + { + "@id": "bts:Muscle" + }, + { + "@id": "bts:Finger" + }, + { + "@id": "bts:Iliacspine" + }, + { + "@id": "bts:Head" + }, + { + "@id": "bts:Neck" + }, + { + "@id": "bts:Shoulder" + }, + { + "@id": "bts:Back" + }, + { + "@id": "bts:Spine" + }, + { + "@id": "bts:Scalp" + }, + { + "@id": "bts:Scapula" + }, + { + "@id": "bts:Pelvis" + }, + { + "@id": "bts:Dorsolateralprefrontalcortex" + }, + { + "@id": "bts:Occcipitallobe" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Montclair State University", + "sms:displayName": "bodySite", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MorehouseSchoolofMedicine", + "@id": "bts:PartialTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MorehouseSchoolofMedicine", + "rdfs:comment": "A template for collecting a subset of contextual data; not intended to be a standalone template but rather a subdocument.", + "rdfs:label": "PartialTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Morehouse School of Medicine", + "sms:displayName": "PartialTemplate", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MorganStateUniversity", + "@id": "bts:PortalStudy", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MorganStateUniversity", + "rdfs:comment": "//nf.synapse.org/Explore/Studies.\n", + "rdfs:label": "PortalStudy", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Morgan State University", + "sms:displayName": "PortalStudy", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:NCICenterforCancerResearch", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NCICenterforCancerResearch", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:StudyId" + }, + { + "@id": "bts:StudyName" + }, + { + "@id": "bts:StudyLeads" + }, + { + "@id": "bts:Summary" + }, + { + "@id": "bts:Institutions" + }, + { + "@id": "bts:FundingAgency" + }, + { + "@id": "bts:Initiative" + }, + { + "@id": "bts:StudyStatus" + }, + { + "@id": "bts:DataStatus" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:Manifestation" + }, + { + "@id": "bts:DiseaseFocus" + }, + { + "@id": "bts:RelatedStudies" + }, + { + "@id": "bts:GrantDOI" + }, + { + "@id": "bts:AccessRequirements" + }, + { + "@id": "bts:AcknowledgementStatements" + }, + { + "@id": "bts:StudyFileviewId" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "NCI Center for Cancer Research", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NationalInstitutesofHealth", + "@id": "bts:StudyId", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NationalInstitutesofHealth", + "rdfs:comment": "Id of study.", + "rdfs:label": "StudyId", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "National Institutes of Health", - "sms:required": "sms:false", + "sms:displayName": "studyId", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:NewJerseyInstituteofTechnology", + "@id": "bts:StudyName", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NewJerseyInstituteofTechnology", + "rdfs:comment": "Name of a study.", + "rdfs:label": "StudyName", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "New Jersey Institute of Technology", - "sms:required": "sms:false", + "sms:displayName": "studyName", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:NewMexicoStateUniversity", + "@id": "bts:StudyLeads", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NewMexicoStateUniversity", + "rdfs:comment": "Individuals with lead roles in a study.", + "rdfs:label": "StudyLeads", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "New Mexico State University", - "sms:required": "sms:false", + "sms:displayName": "studyLeads", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:NewYorkMedicalCollege", + "@id": "bts:Summary", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NewYorkMedicalCollege", + "rdfs:comment": "A short description (an abstract).", + "rdfs:label": "Summary", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "New York Medical College", - "sms:required": "sms:false", + "sms:displayName": "summary", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:NewYorkUniversity", + "@id": "bts:Institutions", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NewYorkUniversity", + "rdfs:label": "Institutions", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "New York University", + "sms:displayName": "institutions", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NorthCarolinaCentralUniversity", + "@id": "bts:FundingAgency", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NorthCarolinaCentralUniversity", + "rdfs:comment": "Refers to the funding organization for the generated resource. This annotation is handled by the DCC.", + "rdfs:label": "FundingAgency", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "North Carolina Central University", + "sms:displayName": "fundingAgency", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NorthCarolinaStateUniversity", + "@id": "bts:Initiative", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NorthCarolinaStateUniversity", + "rdfs:comment": "Refers to a funding initiative. Typically handled by the DCC.", + "rdfs:label": "Initiative", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "North Carolina State University", + "sms:displayName": "initiative", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NorthDakotaStateUniversity", + "@id": "bts:StudyStatus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NorthDakotaStateUniversity", + "rdfs:comment": "Status of a study.", + "rdfs:label": "StudyStatus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "North Dakota State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:NortheastOhioMedicalUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NortheastOhioMedicalUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Active" + }, + { + "@id": "bts:Completed" + }, + { + "@id": "bts:Withdrawn" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Northeast Ohio Medical University", - "sms:required": "sms:false", + "sms:displayName": "studyStatus", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:NortheasternUniversity", + "@id": "bts:DataStatus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NortheasternUniversity", + "rdfs:comment": "Overall status of data in a study.", + "rdfs:label": "DataStatus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Northeastern University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:NorthernArizonaUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NorthernArizonaUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:DataNotExpected" + }, + { + "@id": "bts:DataPending" + }, + { + "@id": "bts:UnderEmbargo" + }, + { + "@id": "bts:RollingRelease" + }, + { + "@id": "bts:PartiallyAvailable" + }, + { + "@id": "bts:Available" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Northern Arizona University", - "sms:required": "sms:false", + "sms:displayName": "dataStatus", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:NorthernIllinoisUniversity", + "@id": "bts:Manifestation", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NorthernIllinoisUniversity", + "rdfs:comment": "An associated phenotype characteristic.", + "rdfs:label": "Manifestation", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Northern Illinois University", + "sms:displayName": "manifestation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NorthwesternUniversity", + "@id": "bts:DiseaseFocus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NorthwesternUniversity", + "rdfs:comment": "Disease that acts as the main topic.", + "rdfs:label": "DiseaseFocus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Northwestern University", + "sms:displayName": "diseaseFocus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NovaSoutheasternUniversity", + "@id": "bts:RelatedStudies", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NovaSoutheasternUniversity", + "rdfs:comment": "Studies similar to the current study. Subproperty of `relatedResource`.", + "rdfs:label": "RelatedStudies", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nova Southeastern University", + "sms:displayName": "relatedStudies", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OhioStateUniversity", + "@id": "bts:GrantDOI", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "OhioStateUniversity", + "rdfs:comment": "Doi of a grant (e.g. in ProposalCentral) that can be associated with the entity.", + "rdfs:label": "GrantDOI", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Ohio State University", + "sms:displayName": "grantDOI", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OhioUniversity", + "@id": "bts:AccessRequirements", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "OhioUniversity", + "rdfs:comment": "Statement describing access requirements for an entity.", + "rdfs:label": "AccessRequirements", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Ohio University", + "sms:displayName": "accessRequirements", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OklahomaStateUniversity,Stillwater", + "@id": "bts:AcknowledgementStatements", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "OklahomaStateUniversity,Stillwater", + "rdfs:comment": "Statement describing how resource use should be acknowledged.", + "rdfs:label": "AcknowledgementStatements", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oklahoma State University, Stillwater", + "sms:displayName": "acknowledgementStatements", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OregonHealthandScienceUniversity", + "@id": "bts:StudyFileviewId", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "OregonHealthandScienceUniversity", + "rdfs:comment": "Links a Synapse project to its fileview.", + "rdfs:label": "StudyFileviewId", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oregon Health and Science University", + "sms:displayName": "studyFileviewId", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OregonStateUniversity", + "@id": "bts:ImagingAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "OregonStateUniversity", + "rdfs:comment": "General template for describing imaging data.", + "rdfs:label": "ImagingAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oregon State University", + "sms:displayName": "ImagingAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:PacificNorthwestNationalLaboratory", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PacificNorthwestNationalLaboratory", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:AssayTarget" + }, + { + "@id": "bts:AuxiliaryAsset" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Pacific Northwest National Laboratory", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PenningtonBiomedicalResearchCenter", + "@id": "bts:AssayTarget", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PenningtonBiomedicalResearchCenter", + "rdfs:comment": "Target of the assay such as a HUGO gene symbol, cell type, or tissue region depending on the capabilities of the assay.", + "rdfs:label": "AssayTarget", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pennington Biomedical Research Center", + "sms:displayName": "assayTarget", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PennsylvaniaStateUniversity,UniversityParkandHersheyMedicalCenter", + "@id": "bts:GenomicsAssayTemplateExtended", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PennsylvaniaStateUniversity,UniversityParkandHersheyMedicalCenter", + "rdfs:comment": "Genomics assay template but with additional experiment data.", + "rdfs:label": "GenomicsAssayTemplateExtended", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:GenomicsAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pennsylvania State University, University Park and Hershey Medical Center", + "sms:displayName": "GenomicsAssayTemplateExtended", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" + }, + { + "@id": "bts:GenePerturbed" + }, + { + "@id": "bts:GenePerturbationTechnology" + }, + { + "@id": "bts:GenePerturbationType" + } + ], "sms:validationRules": [] }, { - "@id": "bts:PortlandStateUniversity", + "@id": "bts:GenomicsAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PortlandStateUniversity", + "rdfs:comment": "Alias to BulkSequencingAssayTemplate, use for sequence data on a large scale when there is no template available that is more specific.", + "rdfs:label": "GenomicsAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BulkSequencingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Portland State University", + "sms:displayName": "GenomicsAssayTemplate", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + } + ], "sms:validationRules": [] }, { - "@id": "bts:PrairieViewA&MUniversity", + "@id": "bts:ProteinArrayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PrairieViewA&MUniversity", + "rdfs:comment": "Template for array- and immuno-based proteomics data.", + "rdfs:label": "ProteinArrayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:ProteinAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Prairie View A&M University", + "sms:displayName": "ProteinArrayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:PrincetonUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PrincetonUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Princeton University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:PurdueUniversity,WestLafayette", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PurdueUniversity,WestLafayette", - "rdfs:subClassOf": [ + "@id": "bts:Platform" + }, { - "@id": "bts:Institution" + "@id": "bts:ProteinExtractSource" + }, + { + "@id": "bts:AntibodyID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Purdue University, West Lafayette", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PusanNationalUniversity", + "@id": "bts:AntibodyID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "PusanNationalUniversity", + "rdfs:comment": "Antibody ID such as RRID if available, otherwise use vendor ID.", + "rdfs:label": "AntibodyID", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pusan National University", + "sms:displayName": "antibodyID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RensselaerPolytechnicInstitute", + "@id": "bts:PdxGenomicsAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RensselaerPolytechnicInstitute", + "rdfs:comment": "Raw genomics data from patient-derived xenograft (PDX) experiment, with additional PDX-relevant metadata.", + "rdfs:label": "PdxGenomicsAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:GenomicsAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rensselaer Polytechnic Institute", + "sms:displayName": "PdxGenomicsAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:RiceUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RiceUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + }, + { + "@id": "bts:TransplantationType" + }, + { + "@id": "bts:TransplantationRecipientSpecies" + }, + { + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Rice University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RochesterInstituteofTechnology", + "@id": "bts:TransplantationRecipientSpecies", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RochesterInstituteofTechnology", + "rdfs:comment": "Species into which donor was grown", + "rdfs:label": "TransplantationRecipientSpecies", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rochester Institute of Technology", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:RockefellerUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RockefellerUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Human" + }, + { + "@id": "bts:Mouse" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Rockefeller University", + "sms:displayName": "transplantationRecipientSpecies", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RosalindFranklinUniversityofMedicineandScience", + "@id": "bts:TransplantationRecipientTissue", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RosalindFranklinUniversityofMedicineandScience", + "rdfs:comment": "Tissue into which a xenograph sample is transplanted", + "rdfs:label": "TransplantationRecipientTissue", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rosalind Franklin University of Medicine and Science", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:RoyalNorthShoreHospital", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RoyalNorthShoreHospital", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Cerebralcortex" + }, + { + "@id": "bts:Bonemarrow" + }, + { + "@id": "bts:Plasma" + }, + { + "@id": "bts:DorsalRootGanglion" + }, + { + "@id": "bts:Opticnerve" + }, + { + "@id": "bts:Tumor-adjacentnormal" + }, + { + "@id": "bts:Serum" + }, + { + "@id": "bts:Spheroid" + }, + { + "@id": "bts:Sciaticnerve" + }, + { + "@id": "bts:Meninges" + }, + { + "@id": "bts:Nervetissue" + }, + { + "@id": "bts:BuccalMucosa" + }, + { + "@id": "bts:Embryonictissue" + }, + { + "@id": "bts:Wholebrain" + }, + { + "@id": "bts:Microtissue" + }, + { + "@id": "bts:Retina" + }, + { + "@id": "bts:CDXtissue" + }, + { + "@id": "bts:Organoid" + }, + { + "@id": "bts:Splenocyte" + }, + { + "@id": "bts:Blood" + }, + { + "@id": "bts:Connectivetissue" + }, + { + "@id": "bts:Primarytumor" + }, + { + "@id": "bts:PDXtissue" + }, + { + "@id": "bts:BuffyCoat" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Royal North Shore Hospital", + "sms:displayName": "transplantationRecipientTissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RushUniversity", + "@id": "bts:LightScatteringAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RushUniversity", + "rdfs:comment": "Template for dynamic or static light scattering data adapted from ISA-TAB-Nano specs.", + "rdfs:label": "LightScatteringAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:MaterialScienceAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rush University", + "sms:displayName": "LightScatteringAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:RutgersStateUniversityofNewJersey,NewBrunswick", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RutgersStateUniversityofNewJersey,NewBrunswick", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:MaterialType" + }, + { + "@id": "bts:ConcentrationMaterial" + }, + { + "@id": "bts:ConcentrationMaterialUnit" + }, + { + "@id": "bts:ConcentrationNaCl" + }, + { + "@id": "bts:ConcentrationNaClUnit" + }, + { + "@id": "bts:PH" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Rutgers State University of New Jersey, New Brunswick", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RutgersStateUniversityofNewJersey,Newark", + "@id": "bts:PH", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "RutgersStateUniversityofNewJersey,Newark", + "rdfs:comment": "Numeric value for pH (range 0-14)", + "rdfs:label": "PH", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rutgers State University of New Jersey, Newark", + "sms:displayName": "pH", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:SUNY,BinghamtonUniversity", + "@id": "bts:ProcessedAlignedReadsTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SUNY,BinghamtonUniversity", + "rdfs:comment": "Template for describing aligned reads (e.g. BAM/CRAM files) from a sequencing assay. The QC meta are extracted from samtools stats when available and are the same metrics preferred by GDC. \n", + "rdfs:label": "ProcessedAlignedReadsTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SUNY, Binghamton University", + "sms:displayName": "ProcessedAlignedReadsTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:SUNY,DownstateHealthSciencesUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SUNY,DownstateHealthSciencesUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:GenomicReference" + }, + { + "@id": "bts:GenomicReferenceLink" + }, + { + "@id": "bts:AverageInsertSize" + }, + { + "@id": "bts:AverageReadLength" + }, + { + "@id": "bts:AverageBaseQuality" + }, + { + "@id": "bts:PairsOnDifferentChr" + }, + { + "@id": "bts:ReadsDuplicatedPercent" + }, + { + "@id": "bts:ReadsMappedPercent" + }, + { + "@id": "bts:MeanCoverage" + }, + { + "@id": "bts:ProportionCoverage10x" + }, + { + "@id": "bts:ProportionCoverage30x" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TotalReads" + }, + { + "@id": "bts:Workflow" + }, + { + "@id": "bts:WorkflowLink" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "SUNY, Downstate Health Sciences University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:SageBionetworks", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SageBionetworks", - "rdfs:subClassOf": [ + "@id": "bts:AuxiliaryAsset" + }, { - "@id": "bts:Institution" + "@id": "bts:SpecimenID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Sage Bionetworks", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SaintLouisUniversity", + "@id": "bts:GenomicReference", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SaintLouisUniversity", + "rdfs:comment": "Version of genome reference used for alignment in processing workflow", + "rdfs:label": "GenomicReference", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Saint Louis University", - "sms:required": "sms:false", + "sms:displayName": "genomicReference", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:SanDiegoStateUniversity", + "@id": "bts:GenomicReferenceLink", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SanDiegoStateUniversity", + "rdfs:comment": "Link to genome reference data file used for alignment in processing workflow", + "rdfs:label": "GenomicReferenceLink", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "San Diego State University", + "sms:displayName": "genomicReferenceLink", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SanFranciscoStateUniversity", + "@id": "bts:AverageInsertSize", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SanFranciscoStateUniversity", + "rdfs:comment": "Average insert size as reported by samtools", + "rdfs:label": "AverageInsertSize", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "San Francisco State University", + "sms:displayName": "averageInsertSize", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SanJoseStateUniversity", + "@id": "bts:AverageReadLength", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SanJoseStateUniversity", + "rdfs:comment": "Average read length collected from samtools", + "rdfs:label": "AverageReadLength", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "San Jose State University", + "sms:displayName": "averageReadLength", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ScrippsResearchInstitute", + "@id": "bts:AverageBaseQuality", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ScrippsResearchInstitute", + "rdfs:comment": "Average base quality collected from samtools", + "rdfs:label": "AverageBaseQuality", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Scripps Research Institute", + "sms:displayName": "averageBaseQuality", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SeattleChildren's", + "@id": "bts:PairsOnDifferentChr", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SeattleChildren's", + "rdfs:comment": "Pairs on different chromosomes collected from samtools", + "rdfs:label": "PairsOnDifferentChr", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Seattle Children's", + "sms:displayName": "pairsOnDifferentChr", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "int" + ] }, { - "@id": "bts:SouthDakotaStateUniversity", + "@id": "bts:ReadsDuplicatedPercent", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SouthDakotaStateUniversity", + "rdfs:comment": "Percent of duplicated reads collected from samtools", + "rdfs:label": "ReadsDuplicatedPercent", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "South Dakota State University", + "sms:displayName": "readsDuplicatedPercent", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SouthernIllinoisUniversity,Carbondale", + "@id": "bts:ReadsMappedPercent", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SouthernIllinoisUniversity,Carbondale", + "rdfs:comment": "Percent of mapped reads collected from samtools", + "rdfs:label": "ReadsMappedPercent", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Southern Illinois University, Carbondale", + "sms:displayName": "readsMappedPercent", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:SouthernIllinoisUniversity,Edwardsville", + "@id": "bts:MeanCoverage", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SouthernIllinoisUniversity,Edwardsville", + "rdfs:comment": "Mean coverage for whole genome sequencing, or mean target coverage for whole exome and targeted sequencing, collected from Picard Tools", + "rdfs:label": "MeanCoverage", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Southern Illinois University, Edwardsville", + "sms:displayName": "meanCoverage", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SouthernMethodistUniversity", + "@id": "bts:ProportionCoverage10x", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SouthernMethodistUniversity", + "rdfs:comment": "Proportion of all reference bases for whole genome sequencing, or targeted bases for whole exome and targeted sequencing, that achieves 10X or greater coverage from Picard Tools", + "rdfs:label": "ProportionCoverage10x", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Southern Methodist University", + "sms:displayName": "proportionCoverage10x", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:StanfordUniversity", + "@id": "bts:ProportionCoverage30x", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StanfordUniversity", + "rdfs:comment": "Proportion of all reference bases for whole genome sequencing, or targeted bases for whole exome and targeted sequencing, that achieves 30X or greater coverage from Picard Tools", + "rdfs:label": "ProportionCoverage30x", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Stanford University", + "sms:displayName": "proportionCoverage30x", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:StateUniversityofNewYorkPolytechnicInstitute", + "@id": "bts:TotalReads", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StateUniversityofNewYorkPolytechnicInstitute", + "rdfs:comment": "If available, the total number of reads collected from samtools.", + "rdfs:label": "TotalReads", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "State University of New York Polytechnic Institute", + "sms:displayName": "totalReads", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "int" + ] }, { - "@id": "bts:StateUniversityofNewYork,Albany", + "@id": "bts:Workflow", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StateUniversityofNewYork,Albany", + "rdfs:comment": "Name and version of the workflow used to generate/analyze the data", + "rdfs:label": "Workflow", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "State University of New York, Albany", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:StateUniversityofNewYork,Buffalo", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StateUniversityofNewYork,Buffalo", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "State University of New York, Buffalo", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:StateUniversityofNewYork,UpstateMedicalUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StateUniversityofNewYork,UpstateMedicalUniversity", - "rdfs:subClassOf": [ + "@id": "bts:CNVkit" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "State University of New York, Upstate Medical University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:StevensInstituteofTechnology", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StevensInstituteofTechnology", - "rdfs:subClassOf": [ + "@id": "bts:DeepVariant" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Stevens Institute of Technology", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:StonyBrookUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "StonyBrookUniversity", - "rdfs:subClassOf": [ + "@id": "bts:DESeq2" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Stony Brook University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:SyracuseUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SyracuseUniversity", - "rdfs:subClassOf": [ + "@id": "bts:FastQC" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Syracuse University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:TempleUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TempleUniversity", - "rdfs:subClassOf": [ + "@id": "bts:FreeBayes" + }, { - "@id": "bts:Institution" + "@id": "bts:GATKBaseRecalibration" + }, + { + "@id": "bts:GATKMarkDuplicates" + }, + { + "@id": "bts:MultiQC" + }, + { + "@id": "bts:Mutect2" + }, + { + "@id": "bts:Sarek" + }, + { + "@id": "bts:STARandSalmon" + }, + { + "@id": "bts:Strelka2" + }, + { + "@id": "bts:StringTie" + }, + { + "@id": "bts:TrimGalore" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Temple University", + "sms:displayName": "workflow", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:TennesseeStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TennesseeStateUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:WorkflowLink" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Tennessee State University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TennesseeTechnologicalUniversity", + "@id": "bts:WorkflowLink", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TennesseeTechnologicalUniversity", + "rdfs:comment": "Workflow URL reference", + "rdfs:label": "WorkflowLink", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Tennessee Technological University", + "sms:displayName": "workflowLink", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TexasA&MUniversity", + "@id": "bts:HumanCohortTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TexasA&MUniversity", + "rdfs:comment": "Data of biosamples from human patients. Adapted from Table 2 of http://nrs.harvard.edu/urn-3:HUL.InstRepos:32725809. This template should be used when biosamples are from NF patients to provides a more valuable characterization and make additional gene-phenotype insights possible.\n", + "rdfs:label": "HumanCohortTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Texas A&M University", + "sms:displayName": "HumanCohortTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:TexasChristianUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TexasChristianUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:DiagnosisAgeGroup" + }, + { + "@id": "bts:Inheritance" + }, + { + "@id": "bts:Mosaicism" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:GermlineMutationIndicator" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:VitalStatus" + }, + { + "@id": "bts:WHOPerformanceStatus" + }, + { + "@id": "bts:PainStatus" + }, + { + "@id": "bts:TumorTreatmentStatus" + }, + { + "@id": "bts:CafeaulaitMacules" + }, + { + "@id": "bts:SkinFoldFreckling" + }, + { + "@id": "bts:IrisLischNodules" + }, + { + "@id": "bts:DermalNeurofibromas" + }, + { + "@id": "bts:SubcutaneousNodularNeurofibromas" + }, + { + "@id": "bts:DiffuseDermalNeurofibromas" + }, + { + "@id": "bts:SpinalNeurofibromas" + }, + { + "@id": "bts:PlexiformNeurofibromas" + }, + { + "@id": "bts:OpticGlioma" + }, + { + "@id": "bts:HeartDefect" + }, + { + "@id": "bts:VascularDisease" + }, + { + "@id": "bts:PubertyOnset" + }, + { + "@id": "bts:Stature" + }, + { + "@id": "bts:PeripheralNeuropathy" + }, + { + "@id": "bts:AqueductalStenosis" + }, + { + "@id": "bts:LongBoneDysplasia" + }, + { + "@id": "bts:SphenoidDysplasia" + }, + { + "@id": "bts:Scoliosis" + }, + { + "@id": "bts:IntellectualDisability" + }, + { + "@id": "bts:LearningDisability" + }, + { + "@id": "bts:AttentionDeficitDisorder" + }, + { + "@id": "bts:Pheochromocytoma" + }, + { + "@id": "bts:GlomusTumor" + }, + { + "@id": "bts:MPNST" + }, + { + "@id": "bts:NonopticGlioma" + }, + { + "@id": "bts:GIST" + }, + { + "@id": "bts:Leukemia" + }, + { + "@id": "bts:BreastCancer" + }, + { + "@id": "bts:OtherTumors" + }, + { + "@id": "bts:VestibularSchwannoma" + }, + { + "@id": "bts:Meningioma" + }, + { + "@id": "bts:GliomaOrEpendymoma" + }, + { + "@id": "bts:SpinalSchwannoma" + }, + { + "@id": "bts:DermalSchwannoma" + }, + { + "@id": "bts:NonvestibularCranialSchwannoma" + }, + { + "@id": "bts:Lenticularopacity" + }, + { + "@id": "bts:NonvestibularSchwannomas" + }, { - "@id": "bts:Institution" + "@id": "bts:NumberOfSchwannomas" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Texas Christian University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TexasStateUniversity", + "@id": "bts:DiagnosisAgeGroup", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TexasStateUniversity", + "rdfs:comment": "Age group of the individual at the time of diagnosis.", + "rdfs:label": "DiagnosisAgeGroup", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Texas State University", + "schema:rangeIncludes": [ + { + "@id": "bts:Infancy" + }, + { + "@id": "bts:Childhood" + }, + { + "@id": "bts:Adolescence" + }, + { + "@id": "bts:Adulthood" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "diagnosisAgeGroup", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TexasTechUniversity", + "@id": "bts:Inheritance", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TexasTechUniversity", + "rdfs:comment": "Describes whether known inheritance from a parent.", + "rdfs:label": "Inheritance", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Texas Tech University", + "schema:rangeIncludes": [ + { + "@id": "bts:Parentaffected" + }, + { + "@id": "bts:Parentnotaffected" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "inheritance", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TexasTechUniversityofHealthSciencesCenter", + "@id": "bts:Mosaicism", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TexasTechUniversityofHealthSciencesCenter", + "rdfs:comment": "Whether individual is mosaic.", + "rdfs:label": "Mosaicism", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Texas Tech University of Health Sciences Center", + "schema:rangeIncludes": [ + { + "@id": "bts:Mosaic" + }, + { + "@id": "bts:Notmosaic" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "mosaicism", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ThomasJeffersonUniversity", + "@id": "bts:GermlineMutationIndicator", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ThomasJeffersonUniversity", + "rdfs:comment": "Indicates a summary testing result for individual's germline mutation only.", + "rdfs:label": "GermlineMutationIndicator", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Thomas Jefferson University", + "schema:rangeIncludes": [ + { + "@id": "bts:Nottested" + }, + { + "@id": "bts:Testedbutunknown" + } + ], + "sms:displayName": "germlineMutationIndicator", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TuftsUniversity", + "@id": "bts:VitalStatus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TuftsUniversity", + "rdfs:comment": "Vital status of the patient.", + "rdfs:label": "VitalStatus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Tufts University", + "schema:rangeIncludes": [ + { + "@id": "bts:Alive" + }, + { + "@id": "bts:Deceased" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "vitalStatus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TulaneUniversity", + "@id": "bts:WHOPerformanceStatus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TulaneUniversity", + "rdfs:comment": "Score on the WHO scale describing patient's functional abilities.", + "rdfs:label": "WHOPerformanceStatus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Tulane University", + "schema:rangeIncludes": [ + { + "@id": "bts:0" + }, + { + "@id": "bts:1" + }, + { + "@id": "bts:2" + }, + { + "@id": "bts:3" + }, + { + "@id": "bts:4" + } + ], + "sms:displayName": "WHOPerformanceStatus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TuskegeeUniversity", + "@id": "bts:PainStatus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "TuskegeeUniversity", + "rdfs:comment": "Pain status rating.", + "rdfs:label": "PainStatus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Tuskegee University", + "schema:rangeIncludes": [ + { + "@id": "bts:Notaproblem" + }, + { + "@id": "bts:Occasional" + }, + { + "@id": "bts:Disabling" + } + ], + "sms:displayName": "painStatus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniformedServicesUniversityoftheHealthSciences", + "@id": "bts:TumorTreatmentStatus", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniformedServicesUniversityoftheHealthSciences", + "rdfs:comment": "Tumor treatment status for the individual.", + "rdfs:label": "TumorTreatmentStatus", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Uniformed Services University of the Health Sciences", + "schema:rangeIncludes": [ + { + "@id": "bts:Nospecifictherapy" + }, + { + "@id": "bts:Chemotherapy" + }, + { + "@id": "bts:Surgery" + }, + { + "@id": "bts:Radiation" + }, + { + "@id": "bts:Targetedtherapy" + }, + { + "@id": "bts:Clinicaltrial" + } + ], + "sms:displayName": "tumorTreatmentStatus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityCollegeofLondon", + "@id": "bts:CafeaulaitMacules", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityCollegeofLondon", + "rdfs:comment": "Characterization of cafe-au-lait macules.", + "rdfs:label": "CafeaulaitMacules", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University College of London", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "cafeaulaitMacules", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityHealthNetwork", + "@id": "bts:SkinFoldFreckling", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityHealthNetwork", + "rdfs:comment": "Characterization of skin fold freckling.", + "rdfs:label": "SkinFoldFreckling", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University Health Network", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "skinFoldFreckling", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAkron", + "@id": "bts:IrisLischNodules", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAkron", + "rdfs:comment": "Characterization of the manifestation of Iris Lisch Nodules.", + "rdfs:label": "IrisLischNodules", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Akron", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "IrisLischNodules", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAlabama", + "@id": "bts:DermalNeurofibromas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAlabama", + "rdfs:comment": "Characterization of the manifestation of Dermal neurofibromas.", + "rdfs:label": "DermalNeurofibromas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Alabama", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Scattered" + }, + { + "@id": "bts:Dense" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "dermalNeurofibromas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAlabama,Birmingham", + "@id": "bts:SubcutaneousNodularNeurofibromas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAlabama,Birmingham", + "rdfs:comment": "Characterization of the manifestation of Subcutaneous nodular neurofibromas.", + "rdfs:label": "SubcutaneousNodularNeurofibromas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Alabama, Birmingham", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Scattered" + }, + { + "@id": "bts:Dense" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "subcutaneousNodularNeurofibromas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAlabama,Huntsville", + "@id": "bts:DiffuseDermalNeurofibromas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAlabama,Huntsville", + "rdfs:comment": "Characterization of the manifestation of Diffuse dermal neurofibromas.", + "rdfs:label": "DiffuseDermalNeurofibromas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Alabama, Huntsville", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Scattered" + }, + { + "@id": "bts:Dense" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "diffuseDermalNeurofibromas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAlabama,Tuscaloosa", + "@id": "bts:SpinalNeurofibromas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAlabama,Tuscaloosa", + "rdfs:comment": "Characterization of the manifestation of Spinal neurofibromas.", + "rdfs:label": "SpinalNeurofibromas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Alabama, Tuscaloosa", + "schema:rangeIncludes": [ + { + "@id": "bts:Notimaged" + }, + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Levels1-3" + }, + { + "@id": "bts:Alllevels" + } + ], + "sms:displayName": "spinalNeurofibromas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAlaska,Anchorage", + "@id": "bts:PlexiformNeurofibromas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAlaska,Anchorage", + "rdfs:comment": "Characterization of the manifestation of Plexiform neurofibromas.", + "rdfs:label": "PlexiformNeurofibromas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Alaska, Anchorage", + "schema:rangeIncludes": [ + { + "@id": "bts:Present" + }, + { + "@id": "bts:AbsentbyMRI" + }, + { + "@id": "bts:Absentclinically-noMRI" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "plexiformNeurofibromas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofAlaska,Fairbanks", + "@id": "bts:OpticGlioma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofAlaska,Fairbanks", + "rdfs:comment": "Characterization of the manifestation of Optic glioma.", + "rdfs:label": "OpticGlioma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Alaska, Fairbanks", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present-asymptomatic" + }, + { + "@id": "bts:Present-symptomatic-nottreated" + }, + { + "@id": "bts:Present-symptomatic-treated" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "opticGlioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofArizona", + "@id": "bts:HeartDefect", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofArizona", + "rdfs:comment": "Characterization of the manifestation of Heart defect.", + "rdfs:label": "HeartDefect", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Arizona", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "heartDefect", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofArkansasforMedicalSciences", + "@id": "bts:VascularDisease", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofArkansasforMedicalSciences", + "rdfs:comment": "Characterization of the manifestation of Vascular disease.", + "rdfs:label": "VascularDisease", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Arkansas for Medical Sciences", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "vascularDisease", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofArkansas,Fayetteville", + "@id": "bts:PubertyOnset", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofArkansas,Fayetteville", + "rdfs:comment": "Puberty onset.", + "rdfs:label": "PubertyOnset", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Arkansas, Fayetteville", + "schema:rangeIncludes": [ + { + "@id": "bts:Prebubertal" + }, + { + "@id": "bts:Precocious" + }, + { + "@id": "bts:Normal" + }, + { + "@id": "bts:Late" + } + ], + "sms:displayName": "pubertyOnset", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofBaltimore", + "@id": "bts:Stature", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofBaltimore", + "rdfs:comment": "Stature of the individual.", + "rdfs:label": "Stature", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Baltimore", + "schema:rangeIncludes": [ + { + "@id": "bts:<5thcentile" + }, + { + "@id": "bts:5th-95thcentile" + }, + { + "@id": "bts:>95thcentile" + } + ], + "sms:displayName": "stature", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,Berkeley", + "@id": "bts:PeripheralNeuropathy", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,Berkeley", + "rdfs:comment": "Characterization of the manifestation of Peripheral neuropathy.", + "rdfs:label": "PeripheralNeuropathy", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Berkeley", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "peripheralNeuropathy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,Davis", + "@id": "bts:AqueductalStenosis", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,Davis", + "rdfs:comment": "Characterization of the manifestation of aqueductal stenosis.", + "rdfs:label": "AqueductalStenosis", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Davis", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "aqueductalStenosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,Irvine", + "@id": "bts:LongBoneDysplasia", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,Irvine", + "rdfs:comment": "Characterization of the manifestation of Long bone dysplasia.", + "rdfs:label": "LongBoneDysplasia", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Irvine", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "longBoneDysplasia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,LosAngeles", + "@id": "bts:SphenoidDysplasia", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,LosAngeles", + "rdfs:comment": "Characterization of the manifestation of Sphenoid dysplasia.", + "rdfs:label": "SphenoidDysplasia", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Los Angeles", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "sphenoidDysplasia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,Merced", + "@id": "bts:Scoliosis", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,Merced", + "rdfs:comment": "Characterization of the manifestation of Scoliosis.", + "rdfs:label": "Scoliosis", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Merced", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "scoliosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,Riverside", + "@id": "bts:IntellectualDisability", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,Riverside", + "rdfs:comment": "Characterization of the manifestation of Intellectual disability.", + "rdfs:label": "IntellectualDisability", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Riverside", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "intellectualDisability", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,SanDiego", + "@id": "bts:LearningDisability", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,SanDiego", + "rdfs:comment": "Characterization of the manifestation of Learning disability.", + "rdfs:label": "LearningDisability", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, San Diego", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "learningDisability", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,SanFrancisco", + "@id": "bts:AttentionDeficitDisorder", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,SanFrancisco", + "rdfs:comment": "Characterization of the manifestation of Attention Deficit Disorder.", + "rdfs:label": "AttentionDeficitDisorder", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, San Francisco", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "attentionDeficitDisorder", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,SantaBarbara", + "@id": "bts:Pheochromocytoma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,SantaBarbara", + "rdfs:comment": "Characterization of the manifestation of Pheochromocytoma.", + "rdfs:label": "Pheochromocytoma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Santa Barbara", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "pheochromocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCalifornia,SantaCruz", + "@id": "bts:GlomusTumor", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCalifornia,SantaCruz", + "rdfs:comment": "Characterization of the manifestation of Glomus tumor.", + "rdfs:label": "GlomusTumor", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of California, Santa Cruz", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "glomusTumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCambridge", + "@id": "bts:MPNST", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCambridge", + "rdfs:label": "MPNST", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Cambridge", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "MPNST", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCentralFlorida", + "@id": "bts:NonopticGlioma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCentralFlorida", + "rdfs:comment": "Characterization of the manifestation of Nonoptic glioma.", + "rdfs:label": "NonopticGlioma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Central Florida", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "nonopticGlioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofChicago", + "@id": "bts:GIST", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofChicago", + "rdfs:comment": "Characterization of the manifestation of Gastrointestinal stromal tumor (GIST).", + "rdfs:label": "GIST", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Chicago", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "GIST", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofCincinnati", + "@id": "bts:Leukemia", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofCincinnati", + "rdfs:comment": "Characterization of the manifestation of Leukemia.", + "rdfs:label": "Leukemia", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Cincinnati", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "leukemia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofColoradoBoulder", + "@id": "bts:BreastCancer", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "UniversityofColoradoBoulder", + "rdfs:label": "BreastCancer", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Colorado Boulder", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "Breast Cancer", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofColoradoDenverandAnschutzMedicalCampus", + "@id": "bts:OtherTumors", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofColoradoDenverandAnschutzMedicalCampus", + "rdfs:comment": "Characterization of the manifestation of other tumors.", + "rdfs:label": "OtherTumors", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Colorado Denver and Anschutz Medical Campus", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "otherTumors", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofConnecticut", + "@id": "bts:VestibularSchwannoma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofConnecticut", + "rdfs:comment": "Characterization of the manifestation of Vestibular schwannoma.", + "rdfs:label": "VestibularSchwannoma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Connecticut", + "schema:rangeIncludes": [ + { + "@id": "bts:Notimaged" + }, + { + "@id": "bts:Absentbyimaging" + }, + { + "@id": "bts:Unilateral" + }, + { + "@id": "bts:Bilateral" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "vestibularSchwannoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofDayton", + "@id": "bts:Meningioma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "UniversityofDayton", + "rdfs:label": "Meningioma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:CellType" + }, + { + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Dayton", + "schema:rangeIncludes": [ + { + "@id": "bts:Notimaged" + }, + { + "@id": "bts:Absentbyimaging" + }, + { + "@id": "bts:Single" + }, + { + "@id": "bts:Multiple" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "Meningioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofDelaware", + "@id": "bts:GliomaOrEpendymoma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofDelaware", + "rdfs:comment": "Characterization of the manifestation of Glioma or ependymoma.", + "rdfs:label": "GliomaOrEpendymoma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Delaware", + "schema:rangeIncludes": [ + { + "@id": "bts:Notimaged" + }, + { + "@id": "bts:Absentbyimaging" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "gliomaOrEpendymoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofDenver", + "@id": "bts:SpinalSchwannoma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofDenver", + "rdfs:comment": "Characterization of the manifestation of Spinal schwannoma.", + "rdfs:label": "SpinalSchwannoma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Denver", + "schema:rangeIncludes": [ + { + "@id": "bts:Notimaged" + }, + { + "@id": "bts:Absentbyimaging" + }, + { + "@id": "bts:Single" + }, + { + "@id": "bts:Multiple" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "spinalSchwannoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofFlorida", + "@id": "bts:DermalSchwannoma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofFlorida", + "rdfs:comment": "Characterization of the manifestation of Dermal schwannoma.", + "rdfs:label": "DermalSchwannoma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Florida", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "dermalSchwannoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofGeorgia", + "@id": "bts:NonvestibularCranialSchwannoma", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofGeorgia", + "rdfs:comment": "Characterization of the manifestation of Nonvestibular cranial schwannoma.", + "rdfs:label": "NonvestibularCranialSchwannoma", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Georgia", + "schema:rangeIncludes": [ + { + "@id": "bts:Notimaged" + }, + { + "@id": "bts:Absentbyimaging" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "nonvestibularCranialSchwannoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofGlasgow", + "@id": "bts:Lenticularopacity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "UniversityofGlasgow", + "rdfs:label": "Lenticularopacity", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Glasgow", + "sms:displayName": "lenticularopacity", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofHawaii,Manoa", + "@id": "bts:NonvestibularSchwannomas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofHawaii,Manoa", + "rdfs:comment": "Characterization of the manifestation of Nonvestibular schwannomas.", + "rdfs:label": "NonvestibularSchwannomas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Hawaii, Manoa", + "schema:rangeIncludes": [ + { + "@id": "bts:Onlybyimagingevidence" + }, + { + "@id": "bts:1pathogicallyconfirmed" + }, + { + "@id": "bts:2ormore,atleast1pathogicallyconfirmed" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "nonvestibularSchwannomas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofHouston", + "@id": "bts:NumberOfSchwannomas", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofHouston", + "rdfs:comment": "Number of schwannomas.", + "rdfs:label": "NumberOfSchwannomas", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Houston", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofIdaho", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofIdaho", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ + { + "@id": "bts:Single" + }, { - "@id": "bts:Institution" + "@id": "bts:Scattered" + }, + { + "@id": "bts:Dense" + }, + { + "@id": "bts:Unknown" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Idaho", + "sms:displayName": "numberOfSchwannomas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofIllinois,Chicago", + "@id": "bts:ProtocolTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofIllinois,Chicago", + "rdfs:comment": "Template for describing a protocol document.", + "rdfs:label": "ProtocolTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Template" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Illinois, Chicago", + "sms:displayName": "ProtocolTemplate", "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Title" + }, + { + "@id": "bts:Author" + }, + { + "@id": "bts:Citation" + }, + { + "@id": "bts:License" + }, + { + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:ProtocolPurpose" + }, + { + "@id": "bts:SampleType" + }, + { + "@id": "bts:Comments" + } + ], "sms:validationRules": [] }, { - "@id": "bts:UniversityofIllinois,Urbana-Champaign", + "@id": "bts:Title", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofIllinois,Urbana-Champaign", + "rdfs:comment": "Title of a resource.", + "rdfs:label": "Title", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Illinois, Urbana-Champaign", - "sms:required": "sms:false", + "sms:displayName": "title", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:UniversityofIowa", + "@id": "bts:Author", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofIowa", + "rdfs:comment": "The author of the resource; preferably use an ORCID ID, GitHub profile link, etc., if available and a text name if not.", + "rdfs:label": "Author", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Iowa", + "sms:displayName": "author", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofKansas", + "@id": "bts:Citation", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofKansas", + "rdfs:comment": "Citation (e.g. doi) that usage of data or resource should be cited with.", + "rdfs:label": "Citation", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Kansas", + "sms:displayName": "citation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofKentucky", + "@id": "bts:ProtocolAssay", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofKentucky", + "rdfs:comment": "Main assay type that this protocol is related to, e.g. this is a prep protocol for single-cell RNA-seq assay. This is especially helpful for newly-developed or in-house assays.\n", + "rdfs:label": "ProtocolAssay", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Kentucky", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofLouisianaatLafayette", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofLouisianaatLafayette", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ + { + "@id": "bts:2DAlamarBlueabsorbance" + }, + { + "@id": "bts:2DAlamarBluefluorescence" + }, + { + "@id": "bts:3Dconfocalimaging" + }, + { + "@id": "bts:3Delectronmicroscopy" + }, + { + "@id": "bts:3Dimaging" + }, + { + "@id": "bts:3Dmicrotissueviability" + }, + { + "@id": "bts:Actigraphy" + }, + { + "@id": "bts:AlgometRxNociometer" + }, + { + "@id": "bts:ATAC-seq" + }, + { + "@id": "bts:ATPaseactivityassay" + }, + { + "@id": "bts:BrdUproliferationassay" + }, + { + "@id": "bts:CAPP-seq" + }, + { + "@id": "bts:CUT&RUN" + }, + { + "@id": "bts:ChIP-seq" + }, + { + "@id": "bts:ChildBehaviorChecklistforAges1.5-5" + }, + { + "@id": "bts:ChildBehaviorChecklistforAges6-18" + }, + { + "@id": "bts:CODEX" + }, + { + "@id": "bts:Corsiblocks" + }, + { + "@id": "bts:DNAopticalmapping" + }, + { + "@id": "bts:ELISA" + }, + { + "@id": "bts:ERRbisulfitesequencing" + }, + { + "@id": "bts:EdUproliferationassay" + }, + { + "@id": "bts:FIA-MSMS" + }, + { + "@id": "bts:FLIPRhigh-throughputcellularscreening" + }, + { + "@id": "bts:FluorescenceInSituHybridization" + }, + { + "@id": "bts:Focusgroup" + }, + { + "@id": "bts:FTIRspectroscopy" + }, + { + "@id": "bts:HI-C" + }, + { + "@id": "bts:HPLC" + }, + { + "@id": "bts:Interview" + }, + { + "@id": "bts:ISO-seq" + }, + { + "@id": "bts:MIB/MS" + }, + { + "@id": "bts:Matrigel-basedtumorigenesisassay" + }, + { + "@id": "bts:MudPIT" + }, + { + "@id": "bts:NIHToolbox" + }, + { + "@id": "bts:NOMe-seq" + }, + { + "@id": "bts:RNAarray" + }, + { + "@id": "bts:RNA-seq" + }, + { + "@id": "bts:RPPA" + }, + { + "@id": "bts:RiccardiandAblonscales" + }, + { + "@id": "bts:SNParray" + }, + { + "@id": "bts:SUSHI" + }, + { + "@id": "bts:Sangersequencing" + }, + { + "@id": "bts:SocialResponsivenessScale" + }, + { + "@id": "bts:SocialResponsivenessScale,SecondEdition" + }, + { + "@id": "bts:Tcellreceptorrepertoiresequencing" + }, + { + "@id": "bts:TIDE" + }, + { + "@id": "bts:TMTquantitation" + }, + { + "@id": "bts:VonFreytest" + }, + { + "@id": "bts:Activeavoidancelearningbehaviorassay" + }, + { + "@id": "bts:Array" + }, + { + "@id": "bts:Atomicforcemicroscopy" + }, + { + "@id": "bts:Autoradiography" + }, + { + "@id": "bts:Bisulfitesequencing" + }, + { + "@id": "bts:Bloodchemistrymeasurement" + }, + { + "@id": "bts:BluenativePAGE" + }, + { + "@id": "bts:Bodysizetraitmeasurement" + }, + { + "@id": "bts:Brightfieldmicroscopy" + }, + { + "@id": "bts:CAMP-GloMaxAssay" + }, + { + "@id": "bts:Calciumretentioncapacityassay" + }, + { + "@id": "bts:Cellcompetition" + }, + { + "@id": "bts:Cellcount" + }, + { + "@id": "bts:Cellpainting" + }, + { + "@id": "bts:Cellproliferation" + }, + { + "@id": "bts:Cellviabilityassay" + }, + { + "@id": "bts:Clinicaldata" + }, + { + "@id": "bts:CNF-Skindex" + }, + { + "@id": "bts:Cognitiveassessment" + }, + { + "@id": "bts:Combinationlibraryscreen" + }, + { + "@id": "bts:Combinationscreen" + }, + { + "@id": "bts:ComplexIIenzymeactivityassay" + }, + { + "@id": "bts:Compoundscreen" + }, + { + "@id": "bts:Contextualconditioningbehaviorassay" + }, + { + "@id": "bts:ConventionalMRI" + }, + { + "@id": "bts:Children'sDermatologyLifeQualityIndexQuestionnaire" + }, + { + "@id": "bts:Differentialscanningcalorimetry" + }, + { + "@id": "bts:Dynamiclightscattering" + }, + { + "@id": "bts:Electrochemiluminescence" + }, + { + "@id": "bts:Electrophoreticlightscattering" + }, + { + "@id": "bts:Elevatedplusmazetest" + }, + { + "@id": "bts:FACE-QAppearance-relatedDistress" + }, + { + "@id": "bts:Flowcytometry" + }, + { + "@id": "bts:Focusformingassay" + }, + { + "@id": "bts:FunctionalMRI" + }, + { + "@id": "bts:Gaitmeasurement" + }, + { + "@id": "bts:Gelfiltrationchromatography" + }, + { + "@id": "bts:Gelpermeationchromatography" + }, + { + "@id": "bts:Genotyping" + }, + { + "@id": "bts:Highcontentscreen" + }, + { + "@id": "bts:Highfrequencyultrasound" + }, + { + "@id": "bts:High-performanceliquidchromatography/tandemmassspectrometry" + }, + { + "@id": "bts:Immunoassay" + }, + { + "@id": "bts:Immunocytochemistry" + }, + { + "@id": "bts:Immunofluorescence" + }, + { + "@id": "bts:Immunohistochemistry" + }, + { + "@id": "bts:Insilicosynthesis" + }, + { + "@id": "bts:Invitrotumorigenesis" + }, + { + "@id": "bts:InvivoPDXviability" + }, + { + "@id": "bts:Invivobioluminescence" + }, + { + "@id": "bts:Invivotumorgrowth" + }, + { + "@id": "bts:Jumpinglibrary" + }, + { + "@id": "bts:Labelfreemassspectrometry" + }, + { + "@id": "bts:Laserspeckleimaging" + }, + { + "@id": "bts:Lightscatteringassay" + }, + { + "@id": "bts:Liquidchromatography-electrochemicaldetection" + }, + { + "@id": "bts:Liquidchromatography/massspectrometry" + }, + { + "@id": "bts:Liquidchromatography/tandemmassspectrometry" + }, + { + "@id": "bts:LncRNA-seq" + }, + { + "@id": "bts:Localfieldpotentialrecording" + }, + { + "@id": "bts:Longtermpotentiationassay" + }, + { + "@id": "bts:MRNAcounts" + }, + { + "@id": "bts:Magneticresonancespectroscopy" + }, + { + "@id": "bts:Massspectrometry" + }, + { + "@id": "bts:Massivelyparallelreporterassay" + }, + { + "@id": "bts:Metabolicscreening" + }, + { + "@id": "bts:Methylationarray" + }, + { + "@id": "bts:MiRNAarray" + }, + { + "@id": "bts:MiRNA-seq" + }, + { + "@id": "bts:Microrheology" + }, + { + "@id": "bts:Skindex-16" + }, + { + "@id": "bts:Multi-electrodearray" + }, + { + "@id": "bts:Nanoparticletrackinganalysis" + }, + { + "@id": "bts:NanoStringnCounterAnalysisSystem" + }, + { + "@id": "bts:N-backtask" + }, + { + "@id": "bts:Neuropsychologicalassessment" + }, + { + "@id": "bts:Nextgenerationtargetedsequencing" + }, + { + "@id": "bts:Noveltyresponsebehaviorassay" + }, + { + "@id": "bts:Openfieldtest" + }, + { + "@id": "bts:Opticaltomography" + }, + { + "@id": "bts:Opticalcoherencetomography" + }, + { + "@id": "bts:Optokineticreflexassay" + }, + { + "@id": "bts:Oscillatoryrheology" + }, + { + "@id": "bts:OxBS-seq" + }, + { + "@id": "bts:Oxygenconsumptionassay" + }, + { + "@id": "bts:Patternelectroretinogram" + }, + { + "@id": "bts:Perineurialcellthickness" + }, + { + "@id": "bts:Phase-contrastmicroscopy" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Louisiana at Lafayette", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofLouisville", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofLouisville", - "rdfs:subClassOf": [ + "@id": "bts:Photograph" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Louisville", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMaine", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMaine", - "rdfs:subClassOf": [ + "@id": "bts:Polymerasechainreaction" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Maine", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMaryland,BaltimoreCounty", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMaryland,BaltimoreCounty", - "rdfs:subClassOf": [ + "@id": "bts:Polysomnography" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Maryland, Baltimore County", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMaryland,EasternShore", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMaryland,EasternShore", - "rdfs:subClassOf": [ + "@id": "bts:Positronemissiontomography" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Maryland, Eastern Shore", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMassachusetts,Amherst", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMassachusetts,Amherst", - "rdfs:subClassOf": [ + "@id": "bts:PROMISCognitiveFunction" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Massachusetts, Amherst", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMassachusetts,Boston", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMassachusetts,Boston", - "rdfs:subClassOf": [ + "@id": "bts:QuantitativePCR" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Massachusetts, Boston", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMassachusetts,Dartmouth", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMassachusetts,Dartmouth", - "rdfs:subClassOf": [ + "@id": "bts:Questionnaire" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Massachusetts, Dartmouth", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMassachusetts,Lowell", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMassachusetts,Lowell", - "rdfs:subClassOf": [ + "@id": "bts:Reactiveoxygenspeciesassay" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Massachusetts, Lowell", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMassachusetts,MedicalSchool", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMassachusetts,MedicalSchool", - "rdfs:subClassOf": [ + "@id": "bts:Reportergeneassay" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Massachusetts, Medical School", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMemphis", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMemphis", - "rdfs:subClassOf": [ + "@id": "bts:Rheometry" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Memphis", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMiami", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMiami", - "rdfs:subClassOf": [ + "@id": "bts:Ribo-seq" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Miami", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMichigan,AnnArbor", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMichigan,AnnArbor", - "rdfs:subClassOf": [ + "@id": "bts:Rotarodperformancetest" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Michigan, Ann Arbor", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMinnesota,Duluth", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMinnesota,Duluth", - "rdfs:subClassOf": [ + "@id": "bts:SandwichELISA" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Minnesota, Duluth", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMinnesota,TwinCities", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMinnesota,TwinCities", - "rdfs:subClassOf": [ + "@id": "bts:ScCGI-seq" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Minnesota, Twin Cities", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMississippi", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMississippi", - "rdfs:subClassOf": [ + "@id": "bts:Scale" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Mississippi", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMissouri,Columbia", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMissouri,Columbia", - "rdfs:subClassOf": [ + "@id": "bts:SaferSeqS" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Missouri, Columbia", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMissouri,KansasCity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMissouri,KansasCity", - "rdfs:subClassOf": [ + "@id": "bts:Singlemoleculedrugscreenassay" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Missouri, Kansas City", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMissouri,SaintLouis", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMissouri,SaintLouis", - "rdfs:subClassOf": [ + "@id": "bts:Single-cellRNA-seq" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Missouri, Saint Louis", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofMontana,Missoula", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofMontana,Missoula", - "rdfs:subClassOf": [ + "@id": "bts:SinglecellATAC-seq" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Montana, Missoula", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNebraska,Lincoln", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNebraska,Lincoln", - "rdfs:subClassOf": [ + "@id": "bts:Single-nucleusRNA-seq" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Nebraska, Lincoln", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNebraska,MedicalCenter", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNebraska,MedicalCenter", - "rdfs:subClassOf": [ + "@id": "bts:Smallmoleculelibraryscreen" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Nebraska, Medical Center", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNebraska,Omaha", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNebraska,Omaha", - "rdfs:subClassOf": [ + "@id": "bts:Sorbitoldehydrogenaseactivitylevelassay" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Nebraska, Omaha", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNevada,LasVegas", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNevada,LasVegas", - "rdfs:subClassOf": [ + "@id": "bts:Spatialfrequencydomainimaging" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Nevada, Las Vegas", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNevada,Reno", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNevada,Reno", - "rdfs:subClassOf": [ + "@id": "bts:Spatialtranscriptomics" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Nevada, Reno", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNewHampshire", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNewHampshire", - "rdfs:subClassOf": [ + "@id": "bts:Staticlightscattering" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of New Hampshire", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNewMexico", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNewMexico", - "rdfs:subClassOf": [ + "@id": "bts:Survival" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of New Mexico", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNewOrleans", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNewOrleans", - "rdfs:subClassOf": [ + "@id": "bts:Targetedexomesequencing" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of New Orleans", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNorthCarolina,ChapelHill", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthCarolina,ChapelHill", - "rdfs:subClassOf": [ + "@id": "bts:Tractionforcemicroscopy" + }, + { + "@id": "bts:Twinspotassay" + }, + { + "@id": "bts:Ultrahigh-performanceliquidchromatography/tandemmassspectrometry" + }, + { + "@id": "bts:Westernblot" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of North Carolina, Chapel Hill", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNorthCarolina,Charlotte", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthCarolina,Charlotte", - "rdfs:subClassOf": [ + "@id": "bts:Wholeexomesequencing" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of North Carolina, Charlotte", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNorthCarolina,Greensboro", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthCarolina,Greensboro", - "rdfs:subClassOf": [ + "@id": "bts:Wholegenomesequencing" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of North Carolina, Greensboro", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNorthCarolina,Wilmington", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthCarolina,Wilmington", - "rdfs:subClassOf": [ + "@id": "bts:Whole-cellpatchclamp" + }, { - "@id": "bts:Institution" + "@id": "bts:STRprofile" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of North Carolina, Wilmington", + "sms:displayName": "protocolAssay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofNorthDakota", + "@id": "bts:ProtocolPurpose", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthDakota", + "rdfs:comment": "Brief description of the protocol purpose.", + "rdfs:label": "ProtocolPurpose", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of North Dakota", + "sms:displayName": "protocolPurpose", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofNorthTexas,Denton", + "@id": "bts:SampleType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthTexas,Denton", + "rdfs:comment": "Type of sample used", + "rdfs:label": "SampleType", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of North Texas, Denton", + "sms:displayName": "sampleType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofNorthTexas,HealthScienceCenter", + "@id": "bts:EpigenomiscAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNorthTexas,HealthScienceCenter", + "rdfs:comment": "Template for describing raw data from epigenetics sequencing assays such as bisulfite sequencing.", + "rdfs:label": "EpigenomiscAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BulkSequencingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of North Texas, Health Science Center", + "sms:displayName": "EpigenomiscAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofNotreDame", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofNotreDame", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Notre Dame", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofOklahoma", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofOklahoma", - "rdfs:subClassOf": [ + "@id": "bts:Component" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Oklahoma", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofOregon", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofOregon", - "rdfs:subClassOf": [ + "@id": "bts:Filename" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Oregon", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofPennsylvania", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofPennsylvania", - "rdfs:subClassOf": [ + "@id": "bts:FileFormat" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Pennsylvania", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofPittsburgh,Pittsburgh", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofPittsburgh,Pittsburgh", - "rdfs:subClassOf": [ + "@id": "bts:ResourceType" + }, { - "@id": "bts:Institution" + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + }, + { + "@id": "bts:BisulfiteConversionKitID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Pittsburgh, Pittsburgh", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofPlymouth", + "@id": "bts:BisulfiteConversionKitID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofPlymouth", + "rdfs:comment": "Name of kit used in bisulfite conversion.", + "rdfs:label": "BisulfiteConversionKitID", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Plymouth", + "sms:displayName": "bisulfiteConversionKitID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofPuertoRico,Mayaguez", + "@id": "bts:ProcessedExpressionTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofPuertoRico,Mayaguez", + "rdfs:comment": "Template for quantified gene/protein expression data that are still represented as one file per sample.", + "rdfs:label": "ProcessedExpressionTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Puerto Rico, Mayaguez", + "sms:displayName": "ProcessedExpressionTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofPuertoRico,MedicalSciencesCampus", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofPuertoRico,MedicalSciencesCampus", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ExpressionUnit" + }, + { + "@id": "bts:Workflow" + }, + { + "@id": "bts:WorkflowLink" + }, + { + "@id": "bts:AuxiliaryAsset" + }, + { + "@id": "bts:SpecimenID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Puerto Rico, Medical Sciences Campus", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofPuertoRico,RioPiedras", + "@id": "bts:ExpressionUnit", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofPuertoRico,RioPiedras", + "rdfs:comment": "Measure used for transcript expression quantification", + "rdfs:label": "ExpressionUnit", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Puerto Rico, Rio Piedras", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofRhodeIsland", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofRhodeIsland", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:TPM" + }, + { + "@id": "bts:RPKM" + }, + { + "@id": "bts:FPKM" + }, + { + "@id": "bts:Counts" + }, + { + "@id": "bts:RawCounts" + }, + { + "@id": "bts:NormalizedCounts" + }, + { + "@id": "bts:Other" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Rhode Island", + "sms:displayName": "expressionUnit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofRochester", + "@id": "bts:GenomicsArrayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofRochester", + "rdfs:comment": "A template for describing raw data from array-based genomics/epigenomics, e.g. CEL files.", + "rdfs:label": "GenomicsArrayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:GeneticsAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Rochester", + "sms:displayName": "GenomicsArrayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofSouthAlabama", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthAlabama", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of South Alabama", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofSouthCarolina,Columbia", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthCarolina,Columbia", - "rdfs:subClassOf": [ + "@id": "bts:SpecimenPreparationMethod" + }, { - "@id": "bts:Institution" + "@id": "bts:Channel" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of South Carolina, Columbia", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofSouthDakota", + "@id": "bts:Channel", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthDakota", + "rdfs:comment": "Color channel used to generate data file.", + "rdfs:label": "Channel", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of South Dakota", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofSouthFlorida,SaintPetersburg", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthFlorida,SaintPetersburg", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Cy3" + }, + { + "@id": "bts:Cy5" + }, + { + "@id": "bts:NotApplicable" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of South Florida, Saint Petersburg", - "sms:required": "sms:false", + "sms:displayName": "channel", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:UniversityofSouthFlorida,Tampa", + "@id": "bts:GeneticsAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthFlorida,Tampa", + "rdfs:comment": "Template for relatively raw data of RNA/DNA structure and expression. This is an abstract template encapsulating data from low-throughput to high-throughput assays, sequencing-based or non-sequencing based (e.g. microarrays, optical genome mapping). In practice, data are more specifically typed and matched to one of the templates below.\n", + "rdfs:label": "GeneticsAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of South Florida, Tampa", + "sms:displayName": "GeneticsAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofSouthernCalifornia", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthernCalifornia", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Southern California", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofSouthernMississippi", + "@id": "bts:ProteomicsAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofSouthernMississippi", + "rdfs:comment": "Alias to MassSpecAssayTemplate for backwards-compatibility.", + "rdfs:label": "ProteomicsAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:MassSpecAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Southern Mississippi", + "sms:displayName": "ProteomicsAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTennessee,HealthScienceCenter", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTennessee,HealthScienceCenter", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:ProteinExtractSource" + }, + { + "@id": "bts:DataCollectionMode" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Tennessee, Health Science Center", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTennessee,Knoxville", + "@id": "bts:WGSTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTennessee,Knoxville", + "rdfs:comment": "Template for describing raw data from Whole Genome Sequencing (WGS)", + "rdfs:label": "WGSTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BulkSequencingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Tennessee, Knoxville", + "sms:displayName": "WGSTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTexasHealthScienceCenter,Houston", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasHealthScienceCenter,Houston", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Texas Health Science Center, Houston", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexasHealthScienceCenter,SanAntonio", + "@id": "bts:ProcessedMergedDataTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasHealthScienceCenter,SanAntonio", + "rdfs:comment": "Further processed data with multiple samples aggregated into one file. This may be also be known as level-4 data. Unlike level-2 and level-3 data, individual-level attributes such as age and sex are no longer surfaced on the data file directly.\n", + "rdfs:label": "ProcessedMergedDataTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas Health Science Center, San Antonio", + "sms:displayName": "ProcessedMergedDataTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTexasHealthScienceCenter,Tyler", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasHealthScienceCenter,Tyler", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Workflow" + }, + { + "@id": "bts:WorkflowLink" + }, + { + "@id": "bts:AuxiliaryAsset" + }, + { + "@id": "bts:Assay" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Texas Health Science Center, Tyler", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexasM.D.AndersonCancerCenter", + "@id": "bts:UpdateMilestoneReport", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasM.D.AndersonCancerCenter", + "rdfs:comment": "Metadata template for updating milestone report values in NF studies -- currently a supported feature for NTAP and GFF.", + "rdfs:label": "UpdateMilestoneReport", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:PartialTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas M. D. Anderson Cancer Center", + "sms:displayName": "UpdateMilestoneReport", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTexasMedicalBranchatGalveston", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasMedicalBranchatGalveston", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Filename" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:ProgressReportNumber" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Texas Medical Branch at Galveston", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexasRioGrandeValley", + "@id": "bts:ProgressReportNumber", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasRioGrandeValley", + "rdfs:comment": " if submitting data for the 6-month milestone report for NTAP, progressReportNumber=1. Also if submitting data associated with first milestone, progressReportNumber =1", + "rdfs:label": "ProgressReportNumber", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas Rio Grande Valley", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTexasSouthwesternMedicalCenter", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexasSouthwesternMedicalCenter", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ + { + "@id": "bts:1" + }, + { + "@id": "bts:2" + }, + { + "@id": "bts:3" + }, + { + "@id": "bts:4" + }, + { + "@id": "bts:5" + }, + { + "@id": "bts:6" + }, + { + "@id": "bts:7" + }, + { + "@id": "bts:8" + }, { - "@id": "bts:Institution" + "@id": "bts:9" + }, + { + "@id": "bts:10" + }, + { + "@id": "bts:NotApplicable" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Texas Southwestern Medical Center", + "sms:displayName": "progressReportNumber", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexas,Arlington", + "@id": "bts:MethylationArrayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexas,Arlington", + "rdfs:comment": "Template for raw data files (idat) from DNA methylation arrays.", + "rdfs:label": "MethylationArrayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:GenomicsArrayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas, Arlington", + "sms:displayName": "MethylationArrayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTexas,Austin", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexas,Austin", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:Channel" + }, + { + "@id": "bts:ChipID" + }, + { + "@id": "bts:ChipPosition" + }, + { + "@id": "bts:PlateName" + }, + { + "@id": "bts:PlateWell" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Texas, Austin", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexas,Dallas", + "@id": "bts:ChipID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexas,Dallas", + "rdfs:comment": "User-specified identifier for the chip used to perform the methylation microarray.", + "rdfs:label": "ChipID", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas, Dallas", + "sms:displayName": "chipID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexas,ElPaso", + "@id": "bts:ChipPosition", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexas,ElPaso", + "rdfs:comment": "User-specified identifier for the specific position on the chip that the sample was loaded into to perform the methylation microarray.", + "rdfs:label": "ChipPosition", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas, El Paso", + "sms:displayName": "chipPosition", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTexas,SanAntonio", + "@id": "bts:PlateName", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTexas,SanAntonio", + "rdfs:comment": "User-specified identifier of the plate used to prepare the sample for analysis.", + "rdfs:label": "PlateName", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Texas, San Antonio", + "sms:displayName": "plateName", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofToledo", + "@id": "bts:PlateWell", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofToledo", + "rdfs:comment": "User-specified identifier for the specific well of the plate used to prepare the sample for analysis.", + "rdfs:label": "PlateWell", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Toledo", + "sms:displayName": "plateWell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofTulsa", + "@id": "bts:PharmacokineticsAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTulsa", + "rdfs:comment": "Generic template for describing data from a pharmacokinetics assay.", + "rdfs:label": "PharmacokineticsAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Tulsa", + "sms:displayName": "PharmacokineticsAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofTurku", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofTurku", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:CompoundName" + }, + { + "@id": "bts:CompoundDose" + }, + { + "@id": "bts:CompoundDoseUnit" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Turku", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofUtah", + "@id": "bts:ElectrophysiologyAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofUtah", + "rdfs:comment": "Template for raw electrophysiology data (electrical recordings).", + "rdfs:label": "ElectrophysiologyAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Utah", + "sms:displayName": "ElectrophysiologyAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofVermont", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofVermont", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:BodySite" + }, + { + "@id": "bts:CellType" + }, + { + "@id": "bts:RecordingSource" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:AuxiliaryAsset" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Vermont", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofVirginia,Charlottesville", + "@id": "bts:RecordingSource", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofVirginia,Charlottesville", + "rdfs:comment": "Source of electrophysiology recording.", + "rdfs:label": "RecordingSource", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Virginia, Charlottesville", + "schema:rangeIncludes": [ + { + "@id": "bts:Electrode" + }, + { + "@id": "bts:Tetrode" + }, + { + "@id": "bts:Shank" + }, + { + "@id": "bts:Utaharray" + }, + { + "@id": "bts:Otherelectrodearray" + } + ], + "sms:displayName": "recordingSource", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofWashington,Seattle", + "@id": "bts:MicroscopyAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofWashington,Seattle", + "rdfs:comment": "Template for data from a microscopy data.", + "rdfs:label": "MicroscopyAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:ImagingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Washington, Seattle", + "sms:displayName": "MicroscopyAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofWestFlorida", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofWestFlorida", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:AssayTarget" + }, + { + "@id": "bts:AuxiliaryAsset" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Objective" + }, + { + "@id": "bts:NominalMagnification" + }, + { + "@id": "bts:LensAperture" + }, + { + "@id": "bts:WorkingDistance" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of West Florida", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:UniversityofWisconsin-Madison", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofWisconsin-Madison", - "rdfs:subClassOf": [ + "@id": "bts:WorkingDistanceUnit" + }, { - "@id": "bts:Institution" + "@id": "bts:Immersion" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "University of Wisconsin-Madison", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofWisconsin-Milwaukee", + "@id": "bts:Objective", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofWisconsin-Milwaukee", + "rdfs:comment": "Microscope objective.", + "rdfs:label": "Objective", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Wisconsin-Milwaukee", + "sms:displayName": "objective", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UniversityofWyoming", + "@id": "bts:NominalMagnification", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversityofWyoming", + "rdfs:comment": "magnification of the lens as specified by the manufacturer - i.e. '60' is a 60X lens.", + "rdfs:label": "NominalMagnification", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "University of Wyoming", + "sms:displayName": "nominalMagnification", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:UniversitéParis-EstCréteil", + "@id": "bts:LensAperture", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UniversitéParis-EstCréteil", + "rdfs:comment": "Numerical aperture of the lens. Floating point value > 0.", + "rdfs:label": "LensAperture", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Université Paris-Est Créteil", + "sms:displayName": "lensAperture", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:UtahStateUniversity", + "@id": "bts:WorkingDistance", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "UtahStateUniversity", + "rdfs:comment": "Working distance of the lens expressed as a floating point number > 0.", + "rdfs:label": "WorkingDistance", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Utah State University", + "sms:displayName": "workingDistance", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:VanAndelResearchInstitute", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "VanAndelResearchInstitute", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:WorkingDistanceUnit" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Van Andel Research Institute", - "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "num" + ] }, { - "@id": "bts:VanderbiltUniversity", + "@id": "bts:WorkingDistanceUnit", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "VanderbiltUniversity", + "rdfs:comment": "Unit for working distance.", + "rdfs:label": "WorkingDistanceUnit", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Vanderbilt University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:VillanovaUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "VillanovaUniversity", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Villanova University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:VirginiaCommonwealthUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "VirginiaCommonwealthUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Angstrom" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Virginia Commonwealth University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:VirginiaPolytechnicInstituteandStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "VirginiaPolytechnicInstituteandStateUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Nanometer" + }, { - "@id": "bts:Institution" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Virginia Polytechnic Institute and State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:WakeForestUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WakeForestUniversity", - "rdfs:subClassOf": [ + "@id": "bts:Micrometer" + }, { - "@id": "bts:Institution" + "@id": "bts:Millimeter" + }, + { + "@id": "bts:Centimeter" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Wake Forest University", + "sms:displayName": "workingDistanceUnit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WashingtonStateUniversity", + "@id": "bts:Immersion", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WashingtonStateUniversity", + "rdfs:comment": "Immersion medium", + "rdfs:label": "Immersion", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Washington State University", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:WashingtonUniversityinSt.Louis", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WashingtonUniversityinSt.Louis", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Institution" + "@id": "bts:Air" + }, + { + "@id": "bts:Oil" + }, + { + "@id": "bts:Water" + }, + { + "@id": "bts:Other" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Washington University in St. Louis", + "sms:displayName": "immersion", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WayneStateUniversity", + "@id": "bts:ImmunoMicroscopyTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WayneStateUniversity", + "rdfs:comment": "Template for describing immunofluorescence or immunohistochemistry images.", + "rdfs:label": "ImmunoMicroscopyTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:MicroscopyAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Wayne State University", + "sms:displayName": "ImmunoMicroscopyTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:WestVirginiaUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WestVirginiaUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:AssayTarget" + }, + { + "@id": "bts:AuxiliaryAsset" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Objective" + }, + { + "@id": "bts:NominalMagnification" + }, + { + "@id": "bts:LensAperture" + }, + { + "@id": "bts:WorkingDistance" + }, + { + "@id": "bts:WorkingDistanceUnit" + }, + { + "@id": "bts:Immersion" + }, + { + "@id": "bts:AntibodyID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "West Virginia University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WesternMichiganUniversity", + "@id": "bts:AnimalIndividualTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WesternMichiganUniversity", + "rdfs:comment": "Template for non-human individual-level data.", + "rdfs:label": "AnimalIndividualTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Western Michigan University", + "sms:displayName": "AnimalIndividualTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:WichitaStateUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WichitaStateUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Institution" + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:DiagnosisAgeGroup" + }, + { + "@id": "bts:Inheritance" + }, + { + "@id": "bts:Mosaicism" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:GermlineMutation" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:ModelSystemName" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Wichita State University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:William&Mary", + "@id": "bts:GermlineMutation", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "William&Mary", + "rdfs:comment": "The individual's actual germline mutation.", + "rdfs:label": "GermlineMutation", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "William & Mary", + "sms:displayName": "germlineMutation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WorcesterPolytechnicInstitute", + "@id": "bts:PlateBasedReporterAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "WorcesterPolytechnicInstitute", + "rdfs:comment": "Generic template for describing data from a plate-based reporter assay.", + "rdfs:label": "PlateBasedReporterAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Institution" + "@id": "bts:BiologicalAssayDataTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Worcester Polytechnic Institute", + "sms:displayName": "PlateBasedReporterAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:YaleUniversity", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "YaleUniversity", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:AssayTarget" + }, + { + "@id": "bts:CompoundName" + }, + { + "@id": "bts:CompoundDose" + }, + { + "@id": "bts:CompoundDoseUnit" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" + }, { - "@id": "bts:Institution" + "@id": "bts:ReporterGene" + }, + { + "@id": "bts:ReporterSubstance" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Yale University", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProportionCoverage30x", + "@id": "bts:ReporterGene", "@type": "rdfs:Class", - "rdfs:comment": "Proportion of all reference bases for whole genome sequencing, or targeted bases for whole exome and targeted sequencing, that achieves 30X or greater coverage from Picard Tools", - "rdfs:label": "ProportionCoverage30x", + "rdfs:comment": "A gene which produces an easily assayed phenotype. Often used for expression studies of heterologous promoters.", + "rdfs:label": "ReporterGene", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -7825,17 +12913,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "proportionCoverage30x", + "sms:displayName": "reporterGene", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:Description", + "@id": "bts:ReporterSubstance", "@type": "rdfs:Class", - "rdfs:comment": "Text describing a resource.", - "rdfs:label": "Description", + "rdfs:comment": "A biological material (clone, oligo, etc.) on an array which will report on some biosequence or biosequences.", + "rdfs:label": "ReporterSubstance", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -7844,133 +12930,115 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "description", + "sms:displayName": "reporterSubstance", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CompoundDoseUnit", + "@id": "bts:MRIAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "A unit associated with the value(s) in compoundDose.", - "rdfs:label": "CompoundDoseUnit", + "rdfs:comment": "Template for describing MRI data.", + "rdfs:label": "MRIAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ImagingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "compoundDoseUnit", + "sms:displayName": "MRIAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:IsStranded", - "@type": "rdfs:Class", - "rdfs:comment": "Whether or not the library is stranded (Yes; No)", - "rdfs:label": "IsStranded", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Thing" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ + "@id": "bts:Component" + }, { - "@id": "bts:Yes" + "@id": "bts:Filename" }, { - "@id": "bts:No" - } - ], - "sms:displayName": "isStranded", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Yes", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Yes", - "rdfs:subClassOf": [ + "@id": "bts:FileFormat" + }, { - "@id": "bts:IsStranded" + "@id": "bts:ResourceType" }, { - "@id": "bts:IsCellLine" + "@id": "bts:DataType" }, { - "@id": "bts:IsMultiIndividual" + "@id": "bts:DataSubtype" }, { - "@id": "bts:IsPairedEnd" + "@id": "bts:Assay" }, { - "@id": "bts:IsMultiSpecimen" + "@id": "bts:IndividualID" }, { - "@id": "bts:IsPrimaryCell" + "@id": "bts:Species" }, { - "@id": "bts:IsXenograft" + "@id": "bts:Sex" }, { - "@id": "bts:FailedQC" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Yes", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:No", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "No", - "rdfs:subClassOf": [ + "@id": "bts:Age" + }, { - "@id": "bts:IsStranded" + "@id": "bts:AgeUnit" }, { - "@id": "bts:IsCellLine" + "@id": "bts:Diagnosis" }, { - "@id": "bts:IsMultiIndividual" + "@id": "bts:Nf1Genotype" }, { - "@id": "bts:IsPairedEnd" + "@id": "bts:Nf2Genotype" }, { - "@id": "bts:IsMultiSpecimen" + "@id": "bts:TumorType" }, { - "@id": "bts:IsPrimaryCell" + "@id": "bts:ModelSystemName" }, { - "@id": "bts:IsXenograft" + "@id": "bts:Organ" }, { - "@id": "bts:FailedQC" + "@id": "bts:Comments" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:AssayTarget" + }, + { + "@id": "bts:AuxiliaryAsset" + }, + { + "@id": "bts:BodySite" + }, + { + "@id": "bts:MRISequence" + }, + { + "@id": "bts:ExperimentalCondition" + }, + { + "@id": "bts:ExperimentalTimepoint" + }, + { + "@id": "bts:TimepointUnit" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "No", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicReferenceLink", + "@id": "bts:MRISequence", "@type": "rdfs:Class", - "rdfs:comment": "Link to genome reference data file used for alignment in processing workflow", - "rdfs:label": "GenomicReferenceLink", + "rdfs:comment": "A mode used in MRI imaging", + "rdfs:label": "MRISequence", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -7979,217 +13047,213 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genomicReferenceLink", + "schema:rangeIncludes": [ + { + "@id": "bts:PD-weighted" + }, + { + "@id": "bts:ShortTauInversionRecovery" + }, + { + "@id": "bts:T1-weighted" + }, + { + "@id": "bts:T2-weighted" + } + ], + "sms:displayName": "MRISequence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProgrammingLanguage", + "@id": "bts:WESTemplate", "@type": "rdfs:Class", - "rdfs:comment": "A computer programming language", - "rdfs:label": "ProgrammingLanguage", + "rdfs:comment": "Template for describing raw data from Whole Exome Sequencing (WES/WXS)", + "rdfs:label": "WESTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:BulkSequencingAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ + "sms:displayName": "WESTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ { - "@id": "bts:Python" + "@id": "bts:Component" }, { - "@id": "bts:R" + "@id": "bts:Filename" }, { - "@id": "bts:MATLAB" + "@id": "bts:FileFormat" }, { - "@id": "bts:Java" + "@id": "bts:ResourceType" }, { - "@id": "bts:C" + "@id": "bts:DataType" }, { - "@id": "bts:C++" + "@id": "bts:DataSubtype" }, { - "@id": "bts:C#" + "@id": "bts:Assay" }, { - "@id": "bts:Javascript" + "@id": "bts:IndividualID" }, { - "@id": "bts:Bash" - } - ], - "sms:displayName": "programmingLanguage", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Python", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Python", - "rdfs:subClassOf": [ + "@id": "bts:Species" + }, { - "@id": "bts:ProgrammingLanguage" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Python", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:R", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "R", - "rdfs:subClassOf": [ + "@id": "bts:Sex" + }, { - "@id": "bts:ProgrammingLanguage" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "R", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:MATLAB", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MATLAB", - "rdfs:subClassOf": [ + "@id": "bts:Age" + }, { - "@id": "bts:ProgrammingLanguage" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "MATLAB", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Java", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Java", - "rdfs:subClassOf": [ + "@id": "bts:AgeUnit" + }, { - "@id": "bts:ProgrammingLanguage" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "Java", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:C", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "C", - "rdfs:subClassOf": [ + "@id": "bts:Diagnosis" + }, { - "@id": "bts:CaptureArea" + "@id": "bts:Nf1Genotype" }, { - "@id": "bts:ProgrammingLanguage" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "C", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:C++", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "C++", - "rdfs:subClassOf": [ + "@id": "bts:Nf2Genotype" + }, { - "@id": "bts:ProgrammingLanguage" + "@id": "bts:TumorType" + }, + { + "@id": "bts:ModelSystemName" + }, + { + "@id": "bts:Organ" + }, + { + "@id": "bts:Comments" + }, + { + "@id": "bts:ParentSpecimenID" + }, + { + "@id": "bts:SpecimenID" + }, + { + "@id": "bts:AliquotID" + }, + { + "@id": "bts:Platform" + }, + { + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:SpecimenPreparationMethod" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:RunType" + }, + { + "@id": "bts:LibraryStrand" + }, + { + "@id": "bts:LibraryPrep" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:ReadPair" + }, + { + "@id": "bts:ReadLength" + }, + { + "@id": "bts:ReadDepth" + }, + { + "@id": "bts:TargetDepth" + }, + { + "@id": "bts:BatchID" + }, + { + "@id": "bts:TargetCaptureKitID" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "C++", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:C#", + "@id": "bts:TargetCaptureKitID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "C#", + "rdfs:comment": "A unique identifier for the kit used to construct a genomic library using target capture-based techniques, which should be composed of the vendor name, kit name and kit version.\n", + "rdfs:label": "TargetCaptureKitID", "rdfs:subClassOf": [ { - "@id": "bts:ProgrammingLanguage" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "C#", + "sms:displayName": "targetCaptureKitID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Javascript", + "@id": "bts:SourceCodeTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Javascript", + "rdfs:comment": "Template for describing scripts or software code.", + "rdfs:label": "SourceCodeTemplate", "rdfs:subClassOf": [ { - "@id": "bts:ProgrammingLanguage" + "@id": "bts:Template" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Javascript", + "sms:displayName": "SourceCodeTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Bash", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Bash", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ + { + "@id": "bts:Title" + }, + { + "@id": "bts:Author" + }, + { + "@id": "bts:Citation" + }, + { + "@id": "bts:License" + }, { "@id": "bts:ProgrammingLanguage" + }, + { + "@id": "bts:RuntimePlatform" + }, + { + "@id": "bts:Documentation" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "bash", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SlideID", + "@id": "bts:ProgrammingLanguage", "@type": "rdfs:Class", - "rdfs:comment": "Unique identifier printed on the label of each Visium slide. The serial number starts with V followed by a number which can range between one through five and ends with a dash and a three digit number, such as 123.\n", - "rdfs:label": "SlideID", + "rdfs:comment": "A computer programming language", + "rdfs:label": "ProgrammingLanguage", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -8198,32 +13262,44 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "slideID", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:SourceName", - "@type": "rdfs:Class", - "rdfs:comment": "Intended for non-biological samples, tf the sample is a nanoparticle sample or some chemical substance not derived from a biological material, the corresponding source name should refer to the starting sample that was modified by a protocol for the assay.\n", - "rdfs:label": "SourceName", - "rdfs:subClassOf": [ + "schema:rangeIncludes": [ { - "@id": "bts:Thing" + "@id": "bts:Python" + }, + { + "@id": "bts:R" + }, + { + "@id": "bts:MATLAB" + }, + { + "@id": "bts:Java" + }, + { + "@id": "bts:C" + }, + { + "@id": "bts:C++" + }, + { + "@id": "bts:C#" + }, + { + "@id": "bts:Javascript" + }, + { + "@id": "bts:Bash" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "sourceName", + "sms:displayName": "programmingLanguage", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mosaicism", + "@id": "bts:RuntimePlatform", "@type": "rdfs:Class", - "rdfs:comment": "Whether individual is mosaic.", - "rdfs:label": "Mosaicism", + "rdfs:comment": "Runtime platform or script interpreter dependencies (e.g. Java v1, Python 2.3).", + "rdfs:label": "RuntimePlatform", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -8232,165 +13308,208 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Mosaic" - }, - { - "@id": "bts:Notmosaic" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "mosaicism", + "sms:displayName": "runtimePlatform", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mosaic", + "@id": "bts:Documentation", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Mosaic", + "rdfs:comment": "URL to any documentation describing the resource and its use.", + "rdfs:label": "Documentation", "rdfs:subClassOf": [ { - "@id": "bts:Mosaicism" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mosaic", + "sms:displayName": "documentation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Notmosaic", + "@id": "bts:EpigeneticsAssayTemplate", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Notmosaic", + "rdfs:comment": "Alias for EpigenomiscAssayTemplate for backwards-compatibility.", + "rdfs:label": "EpigeneticsAssayTemplate", "rdfs:subClassOf": [ { - "@id": "bts:Mosaicism" + "@id": "bts:EpigenomiscAssayTemplate" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "not mosaic", + "sms:displayName": "EpigeneticsAssayTemplate", "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:Unknown", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Unknown", - "rdfs:subClassOf": [ + "sms:requiresDependency": [ { - "@id": "bts:Mosaicism" + "@id": "bts:Component" }, { - "@id": "bts:DermalSchwannoma" + "@id": "bts:Filename" }, { - "@id": "bts:BreastCancer" + "@id": "bts:FileFormat" }, { - "@id": "bts:OtherTumors" + "@id": "bts:ResourceType" }, { - "@id": "bts:GIST" + "@id": "bts:DataType" }, { - "@id": "bts:NonopticGlioma" + "@id": "bts:DataSubtype" }, { - "@id": "bts:PeripheralNeuropathy" + "@id": "bts:Assay" }, { - "@id": "bts:Scoliosis" + "@id": "bts:IndividualID" }, { - "@id": "bts:IntellectualDisability" + "@id": "bts:Species" }, { - "@id": "bts:MPNST" + "@id": "bts:Sex" }, { - "@id": "bts:AqueductalStenosis" + "@id": "bts:Age" }, { - "@id": "bts:IrisLischNodules" + "@id": "bts:AgeUnit" }, { - "@id": "bts:HeartDefect" + "@id": "bts:Diagnosis" }, { - "@id": "bts:Pheochromocytoma" + "@id": "bts:Nf1Genotype" }, { - "@id": "bts:Inheritance" + "@id": "bts:Nf2Genotype" }, { - "@id": "bts:LearningDisability" + "@id": "bts:TumorType" }, { - "@id": "bts:LenticularOpacity" + "@id": "bts:ModelSystemName" }, { - "@id": "bts:CafeaulaitMacules" + "@id": "bts:Organ" }, { - "@id": "bts:LongBoneDysplasia" + "@id": "bts:Comments" }, { - "@id": "bts:GlomusTumor" + "@id": "bts:ParentSpecimenID" }, { - "@id": "bts:SphenoidDysplasia" + "@id": "bts:SpecimenID" }, { - "@id": "bts:SkinFoldFreckling" + "@id": "bts:AliquotID" }, { - "@id": "bts:Leukemia" + "@id": "bts:Platform" }, { - "@id": "bts:VascularDisease" + "@id": "bts:NucleicAcidSource" }, { - "@id": "bts:AttentionDeficitDisorder" + "@id": "bts:SpecimenPreparationMethod" }, { - "@id": "bts:VitalStatus" + "@id": "bts:SpecimenType" }, { - "@id": "bts:Sex" + "@id": "bts:RunType" }, { - "@id": "bts:DiffuseDermalNeurofibromas" + "@id": "bts:LibraryStrand" }, { - "@id": "bts:NumberOfSchwannomas" + "@id": "bts:LibraryPrep" }, { - "@id": "bts:PlexiformNeurofibromas" + "@id": "bts:LibraryPreparationMethod" }, { - "@id": "bts:DermalNeurofibromas" + "@id": "bts:ReadPair" }, { - "@id": "bts:NonvestibularCranialSchwannoma" + "@id": "bts:ReadLength" }, { - "@id": "bts:NonvestibularSchwannomas" + "@id": "bts:ReadDepth" }, { - "@id": "bts:SubcutaneousNodularNeurofibromas" + "@id": "bts:TargetDepth" }, { - "@id": "bts:GliomaOrEpendymoma" + "@id": "bts:BatchID" + }, + { + "@id": "bts:BisulfiteConversionKitID" + } + ], + "sms:validationRules": [] + }, + { + "@id": "bts:ProcessedVariantCallsTemplate", + "@type": "rdfs:Class", + "rdfs:comment": "Template for describing either simple germline/somatic variant calls output data (VCF/MAF) as well as structural variants (e.g. CNVs).", + "rdfs:label": "ProcessedVariantCallsTemplate", + "rdfs:subClassOf": [ + { + "@id": "bts:BiologicalAssayDataTemplate" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "ProcessedVariantCallsTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ + { + "@id": "bts:Component" + }, + { + "@id": "bts:Filename" + }, + { + "@id": "bts:FileFormat" + }, + { + "@id": "bts:ResourceType" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:DataSubtype" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:IndividualID" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:Age" + }, + { + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:Diagnosis" }, { "@id": "bts:Nf1Genotype" @@ -8399,39 +13518,57 @@ "@id": "bts:Nf2Genotype" }, { - "@id": "bts:SpinalSchwannoma" + "@id": "bts:TumorType" }, { - "@id": "bts:OpticGlioma" + "@id": "bts:ModelSystemName" }, { - "@id": "bts:VestibularSchwannoma" + "@id": "bts:Organ" }, { - "@id": "bts:DiagnosisAgeGroup" + "@id": "bts:Comments" }, { - "@id": "bts:Meningioma" + "@id": "bts:IsFilteredReads" }, { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Workflow" }, { - "@id": "bts:TumorType" + "@id": "bts:WorkflowLink" + }, + { + "@id": "bts:AuxiliaryAsset" + }, + { + "@id": "bts:SpecimenID" + } + ], + "sms:validationRules": [] + }, + { + "@id": "bts:IsFilteredReads", + "@type": "rdfs:Class", + "rdfs:comment": "Whether the reads in the processed result has been filtered by adding a 'PASS' filter or other filters as determined by the data generator", + "rdfs:label": "IsFilteredReads", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Unknown", + "sms:displayName": "isFilteredReads", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReadPairOrientation", + "@id": "bts:PortalDataset", "@type": "rdfs:Class", - "rdfs:comment": "The relative orientation of the reads in a paired-end protocol", - "rdfs:label": "ReadPairOrientation", + "rdfs:comment": "//nf.synapse.org/Explore/Datasets. \n", + "rdfs:label": "PortalDataset", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -8440,97 +13577,150 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ + "sms:displayName": "PortalDataset", + "sms:required": "sms:false", + "sms:requiresDependency": [ { - "@id": "bts:Fr-firststrand" + "@id": "bts:Title" }, { - "@id": "bts:Inward" + "@id": "bts:Creator" }, { - "@id": "bts:Matching" + "@id": "bts:Contributor" }, { - "@id": "bts:Outward" + "@id": "bts:Description" + }, + { + "@id": "bts:AccessType" + }, + { + "@id": "bts:License" + }, + { + "@id": "bts:Assay" + }, + { + "@id": "bts:DataType" + }, + { + "@id": "bts:Species" + }, + { + "@id": "bts:StudyId" + }, + { + "@id": "bts:Manifestation" + }, + { + "@id": "bts:DiseaseFocus" + }, + { + "@id": "bts:FundingAgency" + }, + { + "@id": "bts:Series" + }, + { + "@id": "bts:VisualizeDataOn" + }, + { + "@id": "bts:YearProcessed" + }, + { + "@id": "bts:YearPublished" } ], - "sms:displayName": "readPairOrientation", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fr-firststrand", + "@id": "bts:Creator", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Fr-firststrand", + "rdfs:comment": "An entity responsible for making the resource.", + "rdfs:label": "Creator", "rdfs:subClassOf": [ { - "@id": "bts:ReadPairOrientation" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fr-firststrand", - "sms:required": "sms:false", + "sms:displayName": "creator", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:Inward", + "@id": "bts:Contributor", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Inward", + "rdfs:comment": "An entity responsible for making contributions to the resource.", + "rdfs:label": "Contributor", "rdfs:subClassOf": [ { - "@id": "bts:ReadPairOrientation" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "inward", + "sms:displayName": "contributor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Matching", + "@id": "bts:Description", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Matching", + "rdfs:comment": "Text describing a resource.", + "rdfs:label": "Description", "rdfs:subClassOf": [ { - "@id": "bts:ReadPairOrientation" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "matching", + "sms:displayName": "description", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Outward", + "@id": "bts:AccessType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Outward", + "rdfs:comment": "Indicates access type / possible procedures needed for access to the resource.", + "rdfs:label": "AccessType", "rdfs:subClassOf": [ { - "@id": "bts:ReadPairOrientation" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "outward", - "sms:required": "sms:false", + "schema:rangeIncludes": [ + { + "@id": "bts:PublicAccess" + }, + { + "@id": "bts:OpenAccess" + }, + { + "@id": "bts:ControlledAccess" + }, + { + "@id": "bts:PrivateAccess" + } + ], + "sms:displayName": "accessType", + "sms:required": "sms:true", "sms:validationRules": [] }, { - "@id": "bts:FileSize", + "@id": "bts:Series", "@type": "rdfs:Class", - "rdfs:comment": "Size of file in bytes.", - "rdfs:label": "FileSize", + "rdfs:comment": "Title of a custom series that this resource is part of, if any.", + "rdfs:label": "Series", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -8539,15 +13729,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fileSize", + "sms:displayName": "series", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DermalSchwannoma", + "@id": "bts:VisualizeDataOn", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Dermal schwannoma.", - "rdfs:label": "DermalSchwannoma", + "rdfs:comment": "TBD", + "rdfs:label": "VisualizeDataOn", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -8556,216 +13746,175 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, + "sms:displayName": "visualizeDataOn", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:YearProcessed", + "@type": "rdfs:Class", + "rdfs:comment": "Year in which the resource was processed/derived, if applicable. This is only required for data processed by NF-OSI for tracking purposes, optional for community-contributed datasets. \n", + "rdfs:label": "YearProcessed", + "rdfs:subClassOf": [ { - "@id": "bts:Unknown" + "@id": "bts:Thing" } ], - "sms:displayName": "dermalSchwannoma", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "yearProcessed", "sms:required": "sms:false", - "sms:validationRules": [] + "sms:validationRules": [ + "int" + ] }, { - "@id": "bts:Absent", + "@id": "bts:YearPublished", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Absent", + "rdfs:comment": "Year in which the resource was published/generally made available.", + "rdfs:label": "YearPublished", "rdfs:subClassOf": [ { - "@id": "bts:DermalSchwannoma" - }, - { - "@id": "bts:OpticGlioma" - }, - { - "@id": "bts:BreastCancer" - }, - { - "@id": "bts:OtherTumors" - }, - { - "@id": "bts:DiffuseDermalNeurofibromas" - }, + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "yearPublished", + "sms:required": "sms:false", + "sms:validationRules": [ + "int" + ] + }, + { + "@id": "bts:FlowCytometryTemplate", + "@type": "rdfs:Class", + "rdfs:comment": "Template for flow cytometry assay", + "rdfs:label": "FlowCytometryTemplate", + "rdfs:subClassOf": [ { - "@id": "bts:GIST" - }, + "@id": "bts:BiologicalAssayDataTemplate" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "FlowCytometryTemplate", + "sms:required": "sms:false", + "sms:requiresDependency": [ { - "@id": "bts:NonopticGlioma" + "@id": "bts:Component" }, { - "@id": "bts:PeripheralNeuropathy" + "@id": "bts:Filename" }, { - "@id": "bts:Scoliosis" + "@id": "bts:FileFormat" }, { - "@id": "bts:IntellectualDisability" + "@id": "bts:ResourceType" }, { - "@id": "bts:MPNST" + "@id": "bts:DataType" }, { - "@id": "bts:AqueductalStenosis" + "@id": "bts:DataSubtype" }, { - "@id": "bts:IrisLischNodules" + "@id": "bts:Assay" }, { - "@id": "bts:HeartDefect" + "@id": "bts:IndividualID" }, { - "@id": "bts:Pheochromocytoma" + "@id": "bts:Species" }, { - "@id": "bts:LearningDisability" + "@id": "bts:Sex" }, { - "@id": "bts:LenticularOpacity" + "@id": "bts:Age" }, { - "@id": "bts:CafeaulaitMacules" + "@id": "bts:AgeUnit" }, { - "@id": "bts:DermalNeurofibromas" + "@id": "bts:Diagnosis" }, { - "@id": "bts:LongBoneDysplasia" + "@id": "bts:Nf1Genotype" }, { - "@id": "bts:GlomusTumor" + "@id": "bts:Nf2Genotype" }, { - "@id": "bts:SphenoidDysplasia" + "@id": "bts:TumorType" }, { - "@id": "bts:SkinFoldFreckling" + "@id": "bts:ModelSystemName" }, { - "@id": "bts:Leukemia" + "@id": "bts:Organ" }, { - "@id": "bts:SubcutaneousNodularNeurofibromas" + "@id": "bts:Comments" }, { - "@id": "bts:VascularDisease" + "@id": "bts:Platform" }, { - "@id": "bts:AttentionDeficitDisorder" + "@id": "bts:CellType" }, { - "@id": "bts:SpinalNeurofibromas" + "@id": "bts:AuxiliaryAsset" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "absent", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Present", + "@id": "bts:WorkflowReport", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Present", + "rdfs:comment": "Template used for miscellaneous workflow reports and accessory files", + "rdfs:label": "WorkflowReport", "rdfs:subClassOf": [ { - "@id": "bts:PlexiformNeurofibromas" - }, - { - "@id": "bts:DermalSchwannoma" - }, - { - "@id": "bts:BreastCancer" - }, - { - "@id": "bts:OtherTumors" - }, - { - "@id": "bts:GIST" - }, - { - "@id": "bts:NonopticGlioma" - }, - { - "@id": "bts:PeripheralNeuropathy" - }, - { - "@id": "bts:Scoliosis" - }, - { - "@id": "bts:IntellectualDisability" - }, - { - "@id": "bts:MPNST" - }, - { - "@id": "bts:AqueductalStenosis" - }, - { - "@id": "bts:IrisLischNodules" - }, - { - "@id": "bts:HeartDefect" - }, - { - "@id": "bts:Pheochromocytoma" - }, - { - "@id": "bts:LearningDisability" - }, - { - "@id": "bts:LenticularOpacity" - }, - { - "@id": "bts:CafeaulaitMacules" - }, - { - "@id": "bts:LongBoneDysplasia" - }, - { - "@id": "bts:GlomusTumor" - }, - { - "@id": "bts:SphenoidDysplasia" - }, + "@id": "bts:Template" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "WorkflowReport", + "sms:required": "sms:false", + "sms:requiresDependency": [ { - "@id": "bts:SkinFoldFreckling" + "@id": "bts:ResourceType" }, { - "@id": "bts:Leukemia" + "@id": "bts:Assay" }, { - "@id": "bts:VascularDisease" + "@id": "bts:FileFormat" }, { - "@id": "bts:AttentionDeficitDisorder" + "@id": "bts:RelatedDataset" }, { - "@id": "bts:NonvestibularCranialSchwannoma" + "@id": "bts:Workflow" }, { - "@id": "bts:GliomaOrEpendymoma" + "@id": "bts:WorkflowLink" } ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "sms:displayName": "present", - "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BenefactorId", + "@id": "bts:RelatedDataset", "@type": "rdfs:Class", - "rdfs:comment": "The id of the resource from which access control is inherited.", - "rdfs:label": "BenefactorId", + "rdfs:comment": "Reference to a relevant dataset entity.", + "rdfs:label": "RelatedDataset", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -8774,6483 +13923,5506 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "benefactorId", + "sms:displayName": "relatedDataset", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpinalSchwannoma", + "@id": "bts:AlbanyMedicalCollege", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Spinal schwannoma.", - "rdfs:label": "SpinalSchwannoma", + "rdfs:comment": "TBD", + "rdfs:label": "AlbanyMedicalCollege", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notimaged" - }, - { - "@id": "bts:Absentbyimaging" - }, - { - "@id": "bts:Single" - }, - { - "@id": "bts:Multiple" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "spinalSchwannoma", + "sms:displayName": "Albany Medical College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Notimaged", + "@id": "bts:AlbertEinsteinCollegeofMedicine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Notimaged", + "rdfs:label": "AlbertEinsteinCollegeofMedicine", "rdfs:subClassOf": [ { - "@id": "bts:SpinalSchwannoma" - }, - { - "@id": "bts:SpinalNeurofibromas" - }, - { - "@id": "bts:VestibularSchwannoma" - }, - { - "@id": "bts:NonvestibularCranialSchwannoma" - }, - { - "@id": "bts:Meningioma" - }, - { - "@id": "bts:GliomaOrEpendymoma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "not imaged", + "sms:displayName": "Albert Einstein College of Medicine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Absentbyimaging", + "@id": "bts:AlliantInternationalUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Absentbyimaging", + "rdfs:label": "AlliantInternationalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpinalSchwannoma" - }, - { - "@id": "bts:VestibularSchwannoma" - }, - { - "@id": "bts:NonvestibularCranialSchwannoma" - }, - { - "@id": "bts:Meningioma" - }, - { - "@id": "bts:GliomaOrEpendymoma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "absent by imaging", + "sms:displayName": "Alliant International University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Single", + "@id": "bts:AmericanUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Single", + "rdfs:label": "AmericanUniversity", "rdfs:subClassOf": [ { - "@id": "bts:NumberOfSchwannomas" - }, - { - "@id": "bts:SpinalSchwannoma" - }, - { - "@id": "bts:Meningioma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single", + "sms:displayName": "American University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Multiple", + "@id": "bts:ArizonaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Multiple", + "rdfs:label": "ArizonaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpinalSchwannoma" - }, - { - "@id": "bts:Meningioma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Multiple", + "sms:displayName": "Arizona State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AccessType", + "@id": "bts:AuburnUniversity,Auburn", "@type": "rdfs:Class", - "rdfs:comment": "Indicates access type / possible procedures needed for access to the resource.", - "rdfs:label": "AccessType", + "rdfs:comment": "TBD", + "rdfs:label": "AuburnUniversity,Auburn", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:PublicAccess" - }, - { - "@id": "bts:OpenAccess" - }, - { - "@id": "bts:ControlledAccess" - }, - { - "@id": "bts:PrivateAccess" - } - ], - "sms:displayName": "accessType", - "sms:required": "sms:true", + "sms:displayName": "Auburn University, Auburn", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PublicAccess", + "@id": "bts:AugustaUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PublicAccess", + "rdfs:label": "AugustaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:AccessType" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Public Access", + "sms:displayName": "Augusta University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OpenAccess", + "@id": "bts:BaylorCollegeofMedicine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OpenAccess", + "rdfs:label": "BaylorCollegeofMedicine", "rdfs:subClassOf": [ { - "@id": "bts:AccessType" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Open Access", + "sms:displayName": "Baylor College of Medicine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ControlledAccess", + "@id": "bts:BaylorUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ControlledAccess", + "rdfs:label": "BaylorUniversity", "rdfs:subClassOf": [ { - "@id": "bts:AccessType" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Controlled Access", + "sms:displayName": "Baylor University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PrivateAccess", + "@id": "bts:BoiseStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PrivateAccess", + "rdfs:label": "BoiseStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:AccessType" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Private Access", + "sms:displayName": "Boise State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpinalNeurofibromas", + "@id": "bts:BostonCollege", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Spinal neurofibromas.", - "rdfs:label": "SpinalNeurofibromas", + "rdfs:comment": "TBD", + "rdfs:label": "BostonCollege", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notimaged" - }, - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Levels1-3" - }, - { - "@id": "bts:Alllevels" - } - ], - "sms:displayName": "spinalNeurofibromas", + "sms:displayName": "Boston College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Levels1-3", + "@id": "bts:BostonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Levels1-3", + "rdfs:label": "BostonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpinalNeurofibromas" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "levels 1-3", + "sms:displayName": "Boston University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Alllevels", + "@id": "bts:BowlingGreenStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Alllevels", + "rdfs:label": "BowlingGreenStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpinalNeurofibromas" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "all levels", + "sms:displayName": "Bowling Green State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OpticGlioma", + "@id": "bts:BrandeisUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Optic glioma.", - "rdfs:label": "OpticGlioma", + "rdfs:comment": "TBD", + "rdfs:label": "BrandeisUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present-asymptomatic" - }, - { - "@id": "bts:Present-symptomatic-nottreated" - }, - { - "@id": "bts:Present-symptomatic-treated" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "opticGlioma", + "sms:displayName": "Brandeis University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Present-asymptomatic", + "@id": "bts:BrighamYoungUniversity,Provo", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Present-asymptomatic", + "rdfs:label": "BrighamYoungUniversity,Provo", "rdfs:subClassOf": [ { - "@id": "bts:OpticGlioma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "present - asymptomatic", + "sms:displayName": "Brigham Young University, Provo", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Present-symptomatic-nottreated", + "@id": "bts:BrownUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Present-symptomatic-nottreated", + "rdfs:label": "BrownUniversity", "rdfs:subClassOf": [ { - "@id": "bts:OpticGlioma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "present - symptomatic - not treated", + "sms:displayName": "Brown University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Present-symptomatic-treated", + "@id": "bts:CUNY,CityCollege", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Present-symptomatic-treated", + "rdfs:label": "CUNY,CityCollege", "rdfs:subClassOf": [ { - "@id": "bts:OpticGlioma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "present - symptomatic - treated", + "sms:displayName": "CUNY, City College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CreatedOn", + "@id": "bts:CUNY,HunterCollege", "@type": "rdfs:Class", - "rdfs:comment": "Refers to when the resource was created.", - "rdfs:label": "CreatedOn", + "rdfs:comment": "TBD", + "rdfs:label": "CUNY,HunterCollege", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "createdOn", + "sms:displayName": "CUNY, Hunter College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProtocolPurpose", + "@id": "bts:CUNY,JohnJayCollegeofCriminalJustice", "@type": "rdfs:Class", - "rdfs:comment": "Brief description of the protocol purpose.", - "rdfs:label": "ProtocolPurpose", + "rdfs:comment": "TBD", + "rdfs:label": "CUNY,JohnJayCollegeofCriminalJustice", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "protocolPurpose", + "sms:displayName": "CUNY, John Jay College of Criminal Justice", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GrantDOI", + "@id": "bts:CUNY,QueensCollege", "@type": "rdfs:Class", - "rdfs:comment": "Doi of a grant (e.g. in ProposalCentral) that can be associated with the entity.", - "rdfs:label": "GrantDOI", + "rdfs:comment": "TBD", + "rdfs:label": "CUNY,QueensCollege", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "grantDOI", + "sms:displayName": "CUNY, Queens College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BreastCancer", + "@id": "bts:CaliforniaInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BreastCancer", + "rdfs:label": "CaliforniaInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "Breast Cancer", + "sms:displayName": "California Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReporterSubstance", + "@id": "bts:CaliforniaPolytechnicStateUniversity,SanLuisObispo", "@type": "rdfs:Class", - "rdfs:comment": "A biological material (clone, oligo, etc.) on an array which will report on some biosequence or biosequences.", - "rdfs:label": "ReporterSubstance", + "rdfs:comment": "TBD", + "rdfs:label": "CaliforniaPolytechnicStateUniversity,SanLuisObispo", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "reporterSubstance", + "sms:displayName": "California Polytechnic State University, San Luis Obispo", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SlideVersion", + "@id": "bts:CaliforniaStateUniversity,LongBeach", "@type": "rdfs:Class", - "rdfs:comment": "Version of imaging slide used. Slide version is critical for the analysis of the sequencing data as different slides have different capture area layouts.", - "rdfs:label": "SlideVersion", + "rdfs:comment": "TBD", + "rdfs:label": "CaliforniaStateUniversity,LongBeach", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:V1" - }, - { - "@id": "bts:V2" - }, - { - "@id": "bts:V3" - }, - { - "@id": "bts:V4" - } - ], - "sms:displayName": "slideVersion", + "sms:displayName": "California State University, Long Beach", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:V1", + "@id": "bts:CaliforniaStateUniversity,Northridge", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "V1", + "rdfs:label": "CaliforniaStateUniversity,Northridge", "rdfs:subClassOf": [ { - "@id": "bts:SlideVersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "V1", + "sms:displayName": "California State University, Northridge", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:V2", + "@id": "bts:CaliforniaStateUniversity,Sacramento", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "V2", + "rdfs:label": "CaliforniaStateUniversity,Sacramento", "rdfs:subClassOf": [ { - "@id": "bts:SlideVersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "V2", + "sms:displayName": "California State University, Sacramento", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:V3", + "@id": "bts:CarnegieMellonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "V3", + "rdfs:label": "CarnegieMellonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SlideVersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "V3", + "sms:displayName": "Carnegie Mellon University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:V4", + "@id": "bts:CaseWesternReserveUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "V4", + "rdfs:label": "CaseWesternReserveUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SlideVersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "V4", + "sms:displayName": "Case Western Reserve University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReporterGene", + "@id": "bts:CatholicUniversityofAmerica", "@type": "rdfs:Class", - "rdfs:comment": "A gene which produces an easily assayed phenotype. Often used for expression studies of heterologous promoters.", - "rdfs:label": "ReporterGene", + "rdfs:comment": "TBD", + "rdfs:label": "CatholicUniversityofAmerica", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "reporterGene", + "sms:displayName": "Catholic University of America", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1Genotype", + "@id": "bts:CentralMichiganUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Genotype of NF1 gene in the biospecimen from which the data were derived, if known.", - "rdfs:label": "Nf1Genotype", + "rdfs:comment": "TBD", + "rdfs:label": "CentralMichiganUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:-/-" - }, - { - "@id": "bts:+/-" - }, - { - "@id": "bts:+/+" - }, + "sms:displayName": "Central Michigan University", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ChapmanUniversity", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ChapmanUniversity", + "rdfs:subClassOf": [ { - "@id": "bts:Unknown" + "@id": "bts:Institution" } ], - "sms:displayName": "nf1Genotype", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Chapman University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:-/-", + "@id": "bts:Children'sHospitalofPhiladelphia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "-/-", + "rdfs:label": "Children'sHospitalofPhiladelphia", "rdfs:subClassOf": [ { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "-/-", + "sms:displayName": "Children's Hospital of Philadelphia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:+/-", + "@id": "bts:CincinnatiChildren'sHospitalMedicalCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "+/-", + "rdfs:label": "CincinnatiChildren'sHospitalMedicalCenter", "rdfs:subClassOf": [ { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "+/-", + "sms:displayName": "Cincinnati Children's Hospital Medical Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:+/+", + "@id": "bts:CityofHope", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "+/+", + "rdfs:label": "CityofHope", "rdfs:subClassOf": [ { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "+/+", + "sms:displayName": "City of Hope", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Diagnosis", + "@id": "bts:ClarksonUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Diagnosis for the individual given signs and symptoms. Use the most specific diagnosis term that applies.", - "rdfs:label": "Diagnosis", + "rdfs:comment": "TBD", + "rdfs:label": "ClarksonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Neurofibromatosistype1" - }, - { - "@id": "bts:Schwannomatosis" - }, - { - "@id": "bts:NF2-relatedschwannomatosis" - }, - { - "@id": "bts:SMARCB1-relatedschwannomatosis" - }, - { - "@id": "bts:LZTR1-relatedschwannomatosis" - }, - { - "@id": "bts:22q-relatedschwannomatosis" - }, - { - "@id": "bts:Schwannomatosis-NOS" - }, - { - "@id": "bts:Schwannomatosis-NEC" - }, - { - "@id": "bts:SporadicSchwannoma" - }, - { - "@id": "bts:NoonanSyndrome" - }, + "sms:displayName": "Clarkson University", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ClemsonUniversity", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ClemsonUniversity", + "rdfs:subClassOf": [ { - "@id": "bts:NotApplicable" + "@id": "bts:Institution" } - ], - "sms:displayName": "diagnosis", - "sms:required": "sms:true", + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Clemson University", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Neurofibromatosistype1", + "@id": "bts:ClevelandStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Neurofibromatosistype1", + "rdfs:label": "ClevelandStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Neurofibromatosis type 1", + "sms:displayName": "Cleveland State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwannomatosis", + "@id": "bts:ColdSpringHarborLaboratory", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Schwannomatosis", + "rdfs:label": "ColdSpringHarborLaboratory", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwannomatosis", + "sms:displayName": "Cold Spring Harbor Laboratory", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NF2-relatedschwannomatosis", + "@id": "bts:ColoradoStateUniversity,FortCollins", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NF2-relatedschwannomatosis", + "rdfs:label": "ColoradoStateUniversity,FortCollins", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NF2-related schwannomatosis", + "sms:displayName": "Colorado State University, Fort Collins", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SMARCB1-relatedschwannomatosis", + "@id": "bts:ColumbiaU.intheCityofNewYork", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SMARCB1-relatedschwannomatosis", + "rdfs:label": "ColumbiaU.intheCityofNewYork", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SMARCB1-related schwannomatosis", + "sms:displayName": "Columbia U. in the City of New York", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LZTR1-relatedschwannomatosis", + "@id": "bts:CornellUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LZTR1-relatedschwannomatosis", + "rdfs:label": "CornellUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "LZTR1-related schwannomatosis", + "sms:displayName": "Cornell University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:22q-relatedschwannomatosis", + "@id": "bts:CreightonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "22q-relatedschwannomatosis", + "rdfs:label": "CreightonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "22q-related schwannomatosis", + "sms:displayName": "Creighton University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwannomatosis-NOS", + "@id": "bts:Dana-FarberCancerInstitute", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Schwannomatosis-NOS", + "rdfs:label": "Dana-FarberCancerInstitute", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwannomatosis-NOS", + "sms:displayName": "Dana-Farber Cancer Institute", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwannomatosis-NEC", + "@id": "bts:DartmouthCollege", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Schwannomatosis-NEC", + "rdfs:label": "DartmouthCollege", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwannomatosis-NEC", + "sms:displayName": "Dartmouth College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SporadicSchwannoma", + "@id": "bts:DelawareStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SporadicSchwannoma", + "rdfs:label": "DelawareStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Sporadic Schwannoma", + "sms:displayName": "Delaware State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NoonanSyndrome", + "@id": "bts:DrexelUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NoonanSyndrome", + "rdfs:label": "DrexelUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Diagnosis" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Noonan Syndrome", + "sms:displayName": "Drexel University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NotApplicable", + "@id": "bts:DukeUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NotApplicable", + "rdfs:label": "DukeUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Channel" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:ProgressReportNumber" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:Platform" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Not Applicable", + "sms:displayName": "Duke University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TargetDepth", + "@id": "bts:DuquesneUniversity", "@type": "rdfs:Class", - "rdfs:comment": "The targeted read depth prior to sequencing.", - "rdfs:label": "TargetDepth", + "rdfs:comment": "TBD", + "rdfs:label": "DuquesneUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "targetDepth", + "sms:displayName": "Duquesne University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AccessRequirements", + "@id": "bts:EastCarolinaUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Statement describing access requirements for an entity.", - "rdfs:label": "AccessRequirements", + "rdfs:comment": "TBD", + "rdfs:label": "EastCarolinaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "accessRequirements", + "sms:displayName": "East Carolina University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Creator", + "@id": "bts:EastTennesseeStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "An entity responsible for making the resource.", - "rdfs:label": "Creator", + "rdfs:comment": "TBD", + "rdfs:label": "EastTennesseeStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "creator", - "sms:required": "sms:true", + "sms:displayName": "East Tennessee State University", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Age", + "@id": "bts:EasternVirginiaMedicalSchool", "@type": "rdfs:Class", - "rdfs:comment": "A numeric value representing age of the individual. Use with `ageUnit`.", - "rdfs:label": "Age", + "rdfs:comment": "TBD", + "rdfs:label": "EasternVirginiaMedicalSchool", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "age", + "sms:displayName": "Eastern Virginia Medical School", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:AgeUnit" - } - ], - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:AgeUnit", + "@id": "bts:EmoryUniversity", "@type": "rdfs:Class", - "rdfs:comment": "A time unit that can be used with a given age value, e.g. years.", - "rdfs:label": "AgeUnit", + "rdfs:comment": "TBD", + "rdfs:label": "EmoryUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Seconds" - }, - { - "@id": "bts:Minutes" - }, - { - "@id": "bts:Hours" - }, - { - "@id": "bts:Days" - }, - { - "@id": "bts:Weeks" - }, - { - "@id": "bts:Months" - }, - { - "@id": "bts:Years" - } - ], - "sms:displayName": "ageUnit", + "sms:displayName": "Emory University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsCellLine", + "@id": "bts:EutropicsPharmaceuticals", "@type": "rdfs:Class", - "rdfs:comment": "Whether or not sample source is a cell line (Yes; No)", - "rdfs:label": "IsCellLine", + "rdfs:comment": "TBD", + "rdfs:label": "EutropicsPharmaceuticals", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Yes" - }, - { - "@id": "bts:No" - } - ], - "sms:displayName": "isCellLine", + "sms:displayName": "Eutropics Pharmaceuticals", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LibraryPreparationMethod", + "@id": "bts:FloridaA&MUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Method by which library was prepared", - "rdfs:label": "LibraryPreparationMethod", + "rdfs:comment": "TBD", + "rdfs:label": "FloridaA&MUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:10x" - }, - { - "@id": "bts:CEL-seq" - }, - { - "@id": "bts:Drop-Seq" - }, - { - "@id": "bts:GTAC@WUSTLin-houseprep" - }, - { - "@id": "bts:IDTxGenExomeResearchPanel" - }, - { - "@id": "bts:IlluminaTruSeqDNANano" - }, - { - "@id": "bts:IlluminaTn5Transposase" - }, - { - "@id": "bts:IlluminaRibo-ZeroPlus" - }, - { - "@id": "bts:KAPAHyperPrepKitPCR-free" - }, - { - "@id": "bts:KAPARNAHyperPrepKitwithRiboErase(HMR)" - }, - { - "@id": "bts:KAPAmRNAHyperPrepKit" - }, - { - "@id": "bts:NEBNextmRNALibraryPrepReagentSetforIllumina" - }, - { - "@id": "bts:Omni-ATAC" - }, - { - "@id": "bts:QuantSeqFWDV2withUDI" - }, - { - "@id": "bts:Smart-seq2" - }, - { - "@id": "bts:Smart-seq4" - }, - { - "@id": "bts:TruSeq" - }, - { - "@id": "bts:TruSeqstandardtotalRNAlibrarykit" - }, - { - "@id": "bts:OxfordNanoporeDirectRNASequencingKit" - }, - { - "@id": "bts:QIAseqFXDNALibraryKit" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "libraryPreparationMethod", - "sms:required": "sms:true", + "sms:displayName": "Florida A&M University", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:10x", + "@id": "bts:FloridaAtlanticUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "10x", + "rdfs:label": "FloridaAtlanticUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "10x", + "sms:displayName": "Florida Atlantic University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CEL-seq", + "@id": "bts:FloridaInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CEL-seq", + "rdfs:label": "FloridaInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CEL-seq", + "sms:displayName": "Florida Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Drop-Seq", + "@id": "bts:FloridaInternationalUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Drop-Seq", + "rdfs:label": "FloridaInternationalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Drop-Seq", + "sms:displayName": "Florida International University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GTAC@WUSTLin-houseprep", + "@id": "bts:FloridaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GTAC@WUSTLin-houseprep", + "rdfs:label": "FloridaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GTAC@WUSTL in-house prep", + "sms:displayName": "Florida State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IDTxGenExomeResearchPanel", + "@id": "bts:FordhamUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IDTxGenExomeResearchPanel", + "rdfs:label": "FordhamUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "IDT xGen Exome Research Panel", + "sms:displayName": "Fordham University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaTruSeqDNANano", + "@id": "bts:GeorgeMasonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaTruSeqDNANano", + "rdfs:label": "GeorgeMasonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina TruSeq DNA Nano", + "sms:displayName": "George Mason University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaTn5Transposase", + "@id": "bts:GeorgeWashingtonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaTn5Transposase", + "rdfs:label": "GeorgeWashingtonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Tn5 Transposase", + "sms:displayName": "George Washington University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaRibo-ZeroPlus", + "@id": "bts:GeorgetownUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaRibo-ZeroPlus", + "rdfs:label": "GeorgetownUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Ribo-Zero Plus", + "sms:displayName": "Georgetown University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KAPAHyperPrepKitPCR-free", + "@id": "bts:GeorgiaInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "KAPAHyperPrepKitPCR-free", + "rdfs:label": "GeorgiaInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "KAPA HyperPrep Kit PCR-free", + "sms:displayName": "Georgia Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KAPARNAHyperPrepKitwithRiboErase(HMR)", + "@id": "bts:GeorgiaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "KAPARNAHyperPrepKitwithRiboErase(HMR)", + "rdfs:label": "GeorgiaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "KAPA RNA HyperPrep Kit with RiboErase (HMR)", + "sms:displayName": "Georgia State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KAPAmRNAHyperPrepKit", + "@id": "bts:HarvardUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "KAPAmRNAHyperPrepKit", + "rdfs:label": "HarvardUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "KAPA mRNA HyperPrep Kit", + "sms:displayName": "Harvard University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NEBNextmRNALibraryPrepReagentSetforIllumina", + "@id": "bts:HenriMondorHospitalParisEstCreteilFrance", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NEBNextmRNALibraryPrepReagentSetforIllumina", + "rdfs:label": "HenriMondorHospitalParisEstCreteilFrance", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NEBNext mRNA Library Prep Reagent Set for Illumina", + "sms:displayName": "Henri Mondor Hospital Paris Est Creteil France", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Omni-ATAC", + "@id": "bts:HowardUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Omni-ATAC", + "rdfs:label": "HowardUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Omni-ATAC", + "sms:displayName": "Howard University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:QuantSeqFWDV2withUDI", + "@id": "bts:HumboldtStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "QuantSeqFWDV2withUDI", + "rdfs:label": "HumboldtStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "QuantSeq FWD V2 with UDI", + "sms:displayName": "Humboldt State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Smart-seq2", + "@id": "bts:IcahnSchoolofMedicineatMountSinai", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Smart-seq2", + "rdfs:label": "IcahnSchoolofMedicineatMountSinai", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Smart-seq2", + "sms:displayName": "Icahn School of Medicine at Mount Sinai", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Smart-seq4", + "@id": "bts:IdahoStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Smart-seq4", + "rdfs:label": "IdahoStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Smart-seq4", + "sms:displayName": "Idaho State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TruSeq", + "@id": "bts:IllinoisInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TruSeq", + "rdfs:label": "IllinoisInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TruSeq", + "sms:displayName": "Illinois Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TruSeqstandardtotalRNAlibrarykit", + "@id": "bts:IllinoisStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TruSeqstandardtotalRNAlibrarykit", + "rdfs:label": "IllinoisStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TruSeq standard total RNA library kit", + "sms:displayName": "Illinois State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OxfordNanoporeDirectRNASequencingKit", + "@id": "bts:IndianaUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OxfordNanoporeDirectRNASequencingKit", + "rdfs:label": "IndianaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oxford Nanopore Direct RNA Sequencing Kit", + "sms:displayName": "Indiana University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:QIAseqFXDNALibraryKit", + "@id": "bts:IndianaUniversity,Bloomington", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "QIAseqFXDNALibraryKit", + "rdfs:label": "IndianaUniversity,Bloomington", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "QIAseq FX DNA Library Kit", + "sms:displayName": "Indiana University, Bloomington", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Publisher", + "@id": "bts:IndianaUniversity-PurdueUniversityatIndianapolis", "@type": "rdfs:Class", - "rdfs:comment": "An entity responsible for making the resource available.", - "rdfs:label": "Publisher", + "rdfs:comment": "TBD", + "rdfs:label": "IndianaUniversity-PurdueUniversityatIndianapolis", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "publisher", + "sms:displayName": "Indiana University-Purdue University at Indianapolis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AverageBaseQuality", + "@id": "bts:Institutd'InvestigacióBiomédicadeBellvitge", "@type": "rdfs:Class", - "rdfs:comment": "Average base quality collected from samtools", - "rdfs:label": "AverageBaseQuality", + "rdfs:comment": "TBD", + "rdfs:label": "Institutd'InvestigacióBiomédicadeBellvitge", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "averageBaseQuality", + "sms:displayName": "Institut d'Investigació Biomédica de Bellvitge", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sex", + "@id": "bts:Institutd'InvestigacióenCiènciesdelaSalutGermansTriasiPujol", "@type": "rdfs:Class", - "rdfs:comment": "Phenotypic expression of chromosomal makeup that defines a study subject as male, female, or other.", - "rdfs:label": "Sex", + "rdfs:comment": "TBD", + "rdfs:label": "Institutd'InvestigacióenCiènciesdelaSalutGermansTriasiPujol", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Male" - }, - { - "@id": "bts:Female" - }, - { - "@id": "bts:Unknown" - }, + "sms:displayName": "Institut d'Investigació en Ciències de la Salut Germans Trias i Pujol", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Inserm", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Inserm", + "rdfs:subClassOf": [ { - "@id": "bts:NotApplicable" + "@id": "bts:Institution" } ], - "sms:displayName": "sex", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Inserm", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Male", + "@id": "bts:IowaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Male", + "rdfs:label": "IowaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Sex" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Male", + "sms:displayName": "Iowa State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Female", + "@id": "bts:JAX", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Female", + "rdfs:label": "JAX", "rdfs:subClassOf": [ { - "@id": "bts:Sex" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Female", + "sms:displayName": "JAX", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CreatedBy", + "@id": "bts:JacksonStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Refers to the user who created the resource.", - "rdfs:label": "CreatedBy", + "rdfs:comment": "TBD", + "rdfs:label": "JacksonStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "createdBy", + "sms:displayName": "Jackson State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OtherTumors", + "@id": "bts:JohnsHopkinsUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of other tumors.", - "rdfs:label": "OtherTumors", + "rdfs:comment": "TBD", + "rdfs:label": "JohnsHopkinsUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "otherTumors", + "sms:displayName": "Johns Hopkins University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenePerturbationType", + "@id": "bts:KansasStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Specific way in which a single gene was perturbed in a sample", - "rdfs:label": "GenePerturbationType", + "rdfs:comment": "TBD", + "rdfs:label": "KansasStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genePerturbationType", + "sms:displayName": "Kansas State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PainStatus", + "@id": "bts:KentStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Pain status rating.", - "rdfs:label": "PainStatus", + "rdfs:comment": "TBD", + "rdfs:label": "KentStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notaproblem" - }, - { - "@id": "bts:Occasional" - }, - { - "@id": "bts:Disabling" - } - ], - "sms:displayName": "painStatus", + "sms:displayName": "Kent State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Notaproblem", + "@id": "bts:LangstonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Notaproblem", + "rdfs:label": "LangstonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:PainStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "not a problem", + "sms:displayName": "Langston University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Occasional", + "@id": "bts:LehighUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Occasional", + "rdfs:label": "LehighUniversity", "rdfs:subClassOf": [ { - "@id": "bts:PainStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "occasional", + "sms:displayName": "Lehigh University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Disabling", + "@id": "bts:LeibnizInstituteonAging–FritzLipmannInstitute", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Disabling", + "rdfs:label": "LeibnizInstituteonAging–FritzLipmannInstitute", "rdfs:subClassOf": [ { - "@id": "bts:PainStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "disabling", + "sms:displayName": "Leibniz Institute on Aging – Fritz Lipmann Institute", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CompoundDose", + "@id": "bts:LomaLindaUniversity", "@type": "rdfs:Class", - "rdfs:comment": "A dose quantity for the treatment compound. To be used with compoundDoseUnit.", - "rdfs:label": "CompoundDose", + "rdfs:comment": "TBD", + "rdfs:label": "LomaLindaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "compoundDose", + "sms:displayName": "Loma Linda University", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:CompoundDoseUnit" - } - ], "sms:validationRules": [] }, { - "@id": "bts:ReadDepth", + "@id": "bts:LongIslandUniversity", "@type": "rdfs:Class", - "rdfs:comment": "If available, the coverage statistic as output from bedtools coverage or samtools stats.", - "rdfs:label": "ReadDepth", + "rdfs:comment": "TBD", + "rdfs:label": "LongIslandUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "readDepth", + "sms:displayName": "Long Island University", "sms:required": "sms:false", - "sms:validationRules": [ - "int" - ] + "sms:validationRules": [] }, { - "@id": "bts:InChIKey", + "@id": "bts:LouisianaStateUniversity,BatonRouge", "@type": "rdfs:Class", - "rdfs:comment": "//pubchem.ncbi.nlm.nih.gov/compound/10127622#section=InChI-Key). This is a more reliable identifier than the compound name and should be used if available.\n", - "rdfs:label": "InChIKey", + "rdfs:comment": "TBD", + "rdfs:label": "LouisianaStateUniversity,BatonRouge", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "InChIKey", + "sms:displayName": "Louisiana State University, Baton Rouge", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ConcentrationMaterial", + "@id": "bts:LouisianaStateUniversity,HealthSciencesCenter,NewOrleans", "@type": "rdfs:Class", - "rdfs:comment": "Numeric value for concentration of the material", - "rdfs:label": "ConcentrationMaterial", + "rdfs:comment": "TBD", + "rdfs:label": "LouisianaStateUniversity,HealthSciencesCenter,NewOrleans", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "concentrationMaterial", + "sms:displayName": "Louisiana State University, Health Sciences Center, New Orleans", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:FileCount", + "@id": "bts:LouisianaStateUniversity,HealthSciencesCenter,Shreveport", "@type": "rdfs:Class", - "rdfs:comment": "Number of files in the resource collection.", - "rdfs:label": "FileCount", + "rdfs:comment": "TBD", + "rdfs:label": "LouisianaStateUniversity,HealthSciencesCenter,Shreveport", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fileCount", + "sms:displayName": "Louisiana State University, Health Sciences Center, Shreveport", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AssayTarget", + "@id": "bts:LouisianaTechUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Target of the assay such as a HUGO gene symbol, cell type, or tissue region depending on the capabilities of the assay.", - "rdfs:label": "AssayTarget", + "rdfs:comment": "TBD", + "rdfs:label": "LouisianaTechUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "assayTarget", + "sms:displayName": "Louisiana Tech University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReadLength", + "@id": "bts:LoyolaUniversity,Chicago", "@type": "rdfs:Class", - "rdfs:comment": "Number of base pairs (bp) sequenced for a read", - "rdfs:label": "ReadLength", + "rdfs:comment": "TBD", + "rdfs:label": "LoyolaUniversity,Chicago", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "readLength", + "sms:displayName": "Loyola University, Chicago", "sms:required": "sms:false", - "sms:validationRules": [ - "int" - ] + "sms:validationRules": [] }, { - "@id": "bts:TumorTreatmentStatus", + "@id": "bts:L’InsermdansParisetl’Île-de-FranceCentreNord", "@type": "rdfs:Class", - "rdfs:comment": "Tumor treatment status for the individual.", - "rdfs:label": "TumorTreatmentStatus", + "rdfs:comment": "TBD", + "rdfs:label": "L’InsermdansParisetl’Île-de-FranceCentreNord", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Nospecifictherapy" - }, - { - "@id": "bts:Chemotherapy" - }, - { - "@id": "bts:Surgery" - }, - { - "@id": "bts:Radiation" - }, - { - "@id": "bts:Targetedtherapy" - }, - { - "@id": "bts:Clinicaltrial" - } - ], - "sms:displayName": "tumorTreatmentStatus", + "sms:displayName": "L’Inserm dans Paris et l’Île-de-France Centre Nord", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nospecifictherapy", + "@id": "bts:MarquetteUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nospecifictherapy", + "rdfs:label": "MarquetteUniversity", "rdfs:subClassOf": [ { - "@id": "bts:TumorTreatmentStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "no specific therapy", + "sms:displayName": "Marquette University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Chemotherapy", + "@id": "bts:MarshallUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Chemotherapy", + "rdfs:label": "MarshallUniversity", "rdfs:subClassOf": [ { - "@id": "bts:TumorTreatmentStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "chemotherapy", + "sms:displayName": "Marshall University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Surgery", + "@id": "bts:MassachusettsGeneralHospital", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Surgery", + "rdfs:label": "MassachusettsGeneralHospital", "rdfs:subClassOf": [ { - "@id": "bts:TumorTreatmentStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "surgery", + "sms:displayName": "Massachusetts General Hospital", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Radiation", + "@id": "bts:MassachusettsInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Radiation", + "rdfs:label": "MassachusettsInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:TumorTreatmentStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "radiation", + "sms:displayName": "Massachusetts Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Targetedtherapy", + "@id": "bts:MayoClinic", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Targetedtherapy", + "rdfs:label": "MayoClinic", "rdfs:subClassOf": [ { - "@id": "bts:TumorTreatmentStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "targeted therapy", + "sms:displayName": "Mayo Clinic", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Clinicaltrial", + "@id": "bts:MayoClinicinArizona", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Clinicaltrial", + "rdfs:label": "MayoClinicinArizona", "rdfs:subClassOf": [ { - "@id": "bts:TumorTreatmentStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "clinical trial", + "sms:displayName": "Mayo Clinic in Arizona", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StudyId", + "@id": "bts:MedicalCollegeofWisconsin", "@type": "rdfs:Class", - "rdfs:comment": "Id of study.", - "rdfs:label": "StudyId", + "rdfs:comment": "TBD", + "rdfs:label": "MedicalCollegeofWisconsin", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "studyId", - "sms:required": "sms:true", + "sms:displayName": "Medical College of Wisconsin", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Filename", + "@id": "bts:MedicalUniversityofSouthCarolina", "@type": "rdfs:Class", - "rdfs:comment": "The name of the file.", - "rdfs:label": "Filename", + "rdfs:comment": "TBD", + "rdfs:label": "MedicalUniversityofSouthCarolina", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Filename", + "sms:displayName": "Medical University of South Carolina", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DiffuseDermalNeurofibromas", + "@id": "bts:MemorialSloanKetteringCancerCenter", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Diffuse dermal neurofibromas.", - "rdfs:label": "DiffuseDermalNeurofibromas", + "rdfs:comment": "TBD", + "rdfs:label": "MemorialSloanKetteringCancerCenter", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Scattered" - }, - { - "@id": "bts:Dense" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "diffuseDermalNeurofibromas", + "sms:displayName": "Memorial Sloan Kettering Cancer Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Scattered", + "@id": "bts:MercerUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Scattered", + "rdfs:label": "MercerUniversity", "rdfs:subClassOf": [ { - "@id": "bts:DiffuseDermalNeurofibromas" - }, - { - "@id": "bts:NumberOfSchwannomas" - }, - { - "@id": "bts:DermalNeurofibromas" - }, - { - "@id": "bts:SubcutaneousNodularNeurofibromas" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "scattered", + "sms:displayName": "Mercer University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dense", + "@id": "bts:MiamiUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dense", + "rdfs:label": "MiamiUniversity", "rdfs:subClassOf": [ { - "@id": "bts:DiffuseDermalNeurofibromas" - }, - { - "@id": "bts:NumberOfSchwannomas" - }, - { - "@id": "bts:DermalNeurofibromas" - }, - { - "@id": "bts:SubcutaneousNodularNeurofibromas" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dense", + "sms:displayName": "Miami University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReadStrandOrigin", + "@id": "bts:MichiganStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "The strand from which the read originates in a strand-specific protocol", - "rdfs:label": "ReadStrandOrigin", + "rdfs:comment": "TBD", + "rdfs:label": "MichiganStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Forward" - }, - { - "@id": "bts:Reverse" - } - ], - "sms:displayName": "readStrandOrigin", + "sms:displayName": "Michigan State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Forward", + "@id": "bts:MichiganTechnologicalUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Forward", + "rdfs:label": "MichiganTechnologicalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ReadStrandOrigin" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "forward", + "sms:displayName": "Michigan Technological University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Reverse", + "@id": "bts:MississippiStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Reverse", + "rdfs:label": "MississippiStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ReadStrandOrigin" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "reverse", + "sms:displayName": "Mississippi State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Series", + "@id": "bts:MissouriUniversityofScienceandTechnology", "@type": "rdfs:Class", - "rdfs:comment": "Title of a custom series that this resource is part of, if any.", - "rdfs:label": "Series", + "rdfs:comment": "TBD", + "rdfs:label": "MissouriUniversityofScienceandTechnology", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "series", + "sms:displayName": "Missouri University of Science and Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Seconds", + "@id": "bts:MontanaStateUniversity,Bozeman", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Seconds", + "rdfs:label": "MontanaStateUniversity,Bozeman", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "seconds", + "sms:displayName": "Montana State University, Bozeman", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Minutes", + "@id": "bts:MontclairStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Minutes", + "rdfs:label": "MontclairStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "minutes", + "sms:displayName": "Montclair State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Hours", + "@id": "bts:MorehouseSchoolofMedicine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Hours", + "rdfs:label": "MorehouseSchoolofMedicine", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hours", + "sms:displayName": "Morehouse School of Medicine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Days", + "@id": "bts:MorganStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Days", + "rdfs:label": "MorganStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "days", + "sms:displayName": "Morgan State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Weeks", + "@id": "bts:NCICenterforCancerResearch", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Weeks", + "rdfs:label": "NCICenterforCancerResearch", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "weeks", + "sms:displayName": "NCI Center for Cancer Research", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Months", + "@id": "bts:NationalInstitutesofHealth", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Months", + "rdfs:label": "NationalInstitutesofHealth", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "months", + "sms:displayName": "National Institutes of Health", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Years", + "@id": "bts:NewJerseyInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Years", + "rdfs:label": "NewJerseyInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:TimepointUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "years", + "sms:displayName": "New Jersey Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProgressReportNumber", + "@id": "bts:NewMexicoStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": " if submitting data for the 6-month milestone report for NTAP, progressReportNumber=1. Also if submitting data associated with first milestone, progressReportNumber =1", - "rdfs:label": "ProgressReportNumber", + "rdfs:comment": "TBD", + "rdfs:label": "NewMexicoStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:1" - }, - { - "@id": "bts:2" - }, - { - "@id": "bts:3" - }, - { - "@id": "bts:4" - }, - { - "@id": "bts:5" - }, - { - "@id": "bts:6" - }, - { - "@id": "bts:7" - }, - { - "@id": "bts:8" - }, - { - "@id": "bts:9" - }, - { - "@id": "bts:10" - }, + "sms:displayName": "New Mexico State University", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:NewYorkMedicalCollege", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NewYorkMedicalCollege", + "rdfs:subClassOf": [ { - "@id": "bts:NotApplicable" + "@id": "bts:Institution" } ], - "sms:displayName": "progressReportNumber", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "New York Medical College", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:1", + "@id": "bts:NewYorkUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "1", + "rdfs:label": "NewYorkUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" - }, - { - "@id": "bts:WHOPerformanceStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "1", + "sms:displayName": "New York University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:2", + "@id": "bts:NorthCarolinaCentralUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "2", + "rdfs:label": "NorthCarolinaCentralUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" - }, - { - "@id": "bts:WHOPerformanceStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "2", + "sms:displayName": "North Carolina Central University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3", + "@id": "bts:NorthCarolinaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3", + "rdfs:label": "NorthCarolinaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" - }, - { - "@id": "bts:WHOPerformanceStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3", + "sms:displayName": "North Carolina State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:4", + "@id": "bts:NorthDakotaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "4", + "rdfs:label": "NorthDakotaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" - }, - { - "@id": "bts:WHOPerformanceStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "4", + "sms:displayName": "North Dakota State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:5", + "@id": "bts:NortheastOhioMedicalUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "5", + "rdfs:label": "NortheastOhioMedicalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "5", + "sms:displayName": "Northeast Ohio Medical University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:6", + "@id": "bts:NortheasternUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "6", + "rdfs:label": "NortheasternUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "6", + "sms:displayName": "Northeastern University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:7", + "@id": "bts:NorthernArizonaUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "7", + "rdfs:label": "NorthernArizonaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "7", + "sms:displayName": "Northern Arizona University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:8", + "@id": "bts:NorthernIllinoisUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "8", + "rdfs:label": "NorthernIllinoisUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "8", + "sms:displayName": "Northern Illinois University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:9", + "@id": "bts:NorthwesternUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "9", + "rdfs:label": "NorthwesternUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "9", + "sms:displayName": "Northwestern University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:10", + "@id": "bts:NovaSoutheasternUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "10", + "rdfs:label": "NovaSoutheasternUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "10", + "sms:displayName": "Nova Southeastern University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpecimenPreparationMethod", + "@id": "bts:OhioStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Term that represents preservation of the sample before usage in, e.g. sequencing", - "rdfs:label": "SpecimenPreparationMethod", + "rdfs:comment": "TBD", + "rdfs:label": "OhioStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Freshcollected" - }, - { - "@id": "bts:Flashfrozen" - }, - { - "@id": "bts:FFPE" - }, - { - "@id": "bts:Cryopreserved" - }, - { - "@id": "bts:OCT" - }, - { - "@id": "bts:RNAlater" - }, - { - "@id": "bts:Formalin-fixed" - }, - { - "@id": "bts:Ethanol" - }, - { - "@id": "bts:Viablyfrozen" - } - ], - "sms:displayName": "specimenPreparationMethod", - "sms:required": "sms:true", + "sms:displayName": "Ohio State University", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Freshcollected", + "@id": "bts:OhioUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Freshcollected", + "rdfs:label": "OhioUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Fresh collected", + "sms:displayName": "Ohio University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Flashfrozen", + "@id": "bts:OklahomaStateUniversity,Stillwater", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Flashfrozen", + "rdfs:label": "OklahomaStateUniversity,Stillwater", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Flash frozen", + "sms:displayName": "Oklahoma State University, Stillwater", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FFPE", + "@id": "bts:OregonHealthandScienceUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FFPE", + "rdfs:label": "OregonHealthandScienceUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FFPE", + "sms:displayName": "Oregon Health and Science University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cryopreserved", + "@id": "bts:OregonStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cryopreserved", + "rdfs:label": "OregonStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cryopreserved", + "sms:displayName": "Oregon State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OCT", + "@id": "bts:PacificNorthwestNationalLaboratory", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OCT", + "rdfs:label": "PacificNorthwestNationalLaboratory", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "OCT", + "sms:displayName": "Pacific Northwest National Laboratory", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RNAlater", + "@id": "bts:PenningtonBiomedicalResearchCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RNAlater", + "rdfs:label": "PenningtonBiomedicalResearchCenter", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RNAlater", + "sms:displayName": "Pennington Biomedical Research Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Formalin-fixed", + "@id": "bts:PennsylvaniaStateUniversity,UniversityParkandHersheyMedicalCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Formalin-fixed", + "rdfs:label": "PennsylvaniaStateUniversity,UniversityParkandHersheyMedicalCenter", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "formalin-fixed", + "sms:displayName": "Pennsylvania State University, University Park and Hershey Medical Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ethanol", + "@id": "bts:PortlandStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ethanol", + "rdfs:label": "PortlandStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ethanol", + "sms:displayName": "Portland State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Viablyfrozen", + "@id": "bts:PrairieViewA&MUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Viablyfrozen", + "rdfs:label": "PrairieViewA&MUniversity", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenPreparationMethod" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Viably frozen", + "sms:displayName": "Prairie View A&M University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsMultiIndividual", + "@id": "bts:PrincetonUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Whether or not a file has data for multiple individuals (Yes; No)", - "rdfs:label": "IsMultiIndividual", + "rdfs:comment": "TBD", + "rdfs:label": "PrincetonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Yes" - }, - { - "@id": "bts:No" - } - ], - "sms:displayName": "isMultiIndividual", + "sms:displayName": "Princeton University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LibraryStrand", + "@id": "bts:PurdueUniversity,WestLafayette", "@type": "rdfs:Class", - "rdfs:comment": "Strandedness of paired-end RNA-Sequencing data. This is an important parameter for RNA-seq analysis.", - "rdfs:label": "LibraryStrand", + "rdfs:comment": "TBD", + "rdfs:label": "PurdueUniversity,WestLafayette", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:FirstStranded" - }, - { - "@id": "bts:SecondStranded" - }, - { - "@id": "bts:Unstranded" - }, - { - "@id": "bts:NotApplicable" - } - ], - "sms:displayName": "libraryStrand", - "sms:required": "sms:true", + "sms:displayName": "Purdue University, West Lafayette", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FirstStranded", + "@id": "bts:PusanNationalUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FirstStranded", + "rdfs:label": "PusanNationalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryStrand" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FirstStranded", + "sms:displayName": "Pusan National University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SecondStranded", + "@id": "bts:RensselaerPolytechnicInstitute", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SecondStranded", + "rdfs:label": "RensselaerPolytechnicInstitute", "rdfs:subClassOf": [ { - "@id": "bts:LibraryStrand" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SecondStranded", + "sms:displayName": "Rensselaer Polytechnic Institute", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Unstranded", + "@id": "bts:RiceUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Unstranded", + "rdfs:label": "RiceUniversity", "rdfs:subClassOf": [ { - "@id": "bts:LibraryStrand" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Unstranded", + "sms:displayName": "Rice University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GIST", + "@id": "bts:RochesterInstituteofTechnology", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Gastrointestinal stromal tumor (GIST).", - "rdfs:label": "GIST", + "rdfs:comment": "TBD", + "rdfs:label": "RochesterInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "GIST", + "sms:displayName": "Rochester Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Immersion", + "@id": "bts:RockefellerUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Immersion medium", - "rdfs:label": "Immersion", + "rdfs:comment": "TBD", + "rdfs:label": "RockefellerUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Air" - }, - { - "@id": "bts:Oil" - }, - { - "@id": "bts:Water" - }, - { - "@id": "bts:Other" - } - ], - "sms:displayName": "immersion", + "sms:displayName": "Rockefeller University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Air", + "@id": "bts:RosalindFranklinUniversityofMedicineandScience", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Air", + "rdfs:label": "RosalindFranklinUniversityofMedicineandScience", "rdfs:subClassOf": [ { - "@id": "bts:Immersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "air", + "sms:displayName": "Rosalind Franklin University of Medicine and Science", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Oil", + "@id": "bts:RoyalNorthShoreHospital", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Oil", + "rdfs:label": "RoyalNorthShoreHospital", "rdfs:subClassOf": [ { - "@id": "bts:Immersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "oil", + "sms:displayName": "Royal North Shore Hospital", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Water", + "@id": "bts:RushUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Water", + "rdfs:label": "RushUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Immersion" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "water", + "sms:displayName": "Rush University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Other", + "@id": "bts:RutgersStateUniversityofNewJersey,NewBrunswick", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Other", + "rdfs:label": "RutgersStateUniversityofNewJersey,NewBrunswick", "rdfs:subClassOf": [ { - "@id": "bts:DataCollectionMode" - }, - { - "@id": "bts:Immersion" - }, - { - "@id": "bts:ExpressionUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Other", + "sms:displayName": "Rutgers State University of New Jersey, New Brunswick", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CaptureArea", + "@id": "bts:RutgersStateUniversityofNewJersey,Newark", "@type": "rdfs:Class", - "rdfs:comment": " A1, B1, C1, D1 for Visium slides with 6.5 mm Capture Area and A, B for CytAssist slides with 11 mm Capture Area. Both CytAssist slides with 6.5 mm Capture Area and Gateway Slides contain only two slide areas, A1 and D1.\n", - "rdfs:label": "CaptureArea", + "rdfs:comment": "TBD", + "rdfs:label": "RutgersStateUniversityofNewJersey,Newark", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:A" - }, - { - "@id": "bts:B" - }, - { - "@id": "bts:C" - }, - { - "@id": "bts:D" - }, - { - "@id": "bts:A1" - }, - { - "@id": "bts:B1" - }, - { - "@id": "bts:C1" - }, - { - "@id": "bts:D1" - } - ], - "sms:displayName": "captureArea", + "sms:displayName": "Rutgers State University of New Jersey, Newark", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:A", + "@id": "bts:SUNY,BinghamtonUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "A", + "rdfs:label": "SUNY,BinghamtonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "A", + "sms:displayName": "SUNY, Binghamton University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B", + "@id": "bts:SUNY,DownstateHealthSciencesUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B", + "rdfs:label": "SUNY,DownstateHealthSciencesUniversity", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B", + "sms:displayName": "SUNY, Downstate Health Sciences University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:D", + "@id": "bts:SageBionetworks", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "D", + "rdfs:label": "SageBionetworks", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "D", + "sms:displayName": "Sage Bionetworks", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:A1", + "@id": "bts:SaintLouisUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "A1", + "rdfs:label": "SaintLouisUniversity", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "A1", + "sms:displayName": "Saint Louis University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B1", + "@id": "bts:SanDiegoStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B1", + "rdfs:label": "SanDiegoStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B1", + "sms:displayName": "San Diego State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:C1", + "@id": "bts:SanFranciscoStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "C1", + "rdfs:label": "SanFranciscoStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "C1", + "sms:displayName": "San Francisco State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:D1", + "@id": "bts:SanJoseStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "D1", + "rdfs:label": "SanJoseStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:CaptureArea" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "D1", + "sms:displayName": "San Jose State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ExperimentalFactor", + "@id": "bts:ScrippsResearchInstitute", "@type": "rdfs:Class", - "rdfs:comment": "An ontology concept for experimental factor measured with this data.", - "rdfs:label": "ExperimentalFactor", + "rdfs:comment": "TBD", + "rdfs:label": "ScrippsResearchInstitute", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Braingrowthmeasurement" - }, - { - "@id": "bts:Brainvolumemeasurement" - }, - { - "@id": "bts:Bodyweight" - }, - { - "@id": "bts:Clinicallaboratorymeasurement" - }, - { - "@id": "bts:Cognitivefunctionmeasurement" - }, - { - "@id": "bts:Gaitmeasurement" - }, - { - "@id": "bts:Motordevelopmentmeasurement" - }, + "sms:displayName": "Scripps Research Institute", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SeattleChildren's", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SeattleChildren's", + "rdfs:subClassOf": [ { - "@id": "bts:Painmeasurement" + "@id": "bts:Institution" } ], - "sms:displayName": "experimentalFactor", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Seattle Children's", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Braingrowthmeasurement", + "@id": "bts:SouthDakotaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Braingrowthmeasurement", + "rdfs:label": "SouthDakotaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "brain growth measurement", + "sms:displayName": "South Dakota State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Brainvolumemeasurement", + "@id": "bts:SouthernIllinoisUniversity,Carbondale", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Brainvolumemeasurement", + "rdfs:label": "SouthernIllinoisUniversity,Carbondale", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "brain volume measurement", + "sms:displayName": "Southern Illinois University, Carbondale", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bodyweight", + "@id": "bts:SouthernIllinoisUniversity,Edwardsville", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bodyweight", + "rdfs:label": "SouthernIllinoisUniversity,Edwardsville", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "body weight", + "sms:displayName": "Southern Illinois University, Edwardsville", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Clinicallaboratorymeasurement", + "@id": "bts:SouthernMethodistUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Clinicallaboratorymeasurement", + "rdfs:label": "SouthernMethodistUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "clinical laboratory measurement", + "sms:displayName": "Southern Methodist University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cognitivefunctionmeasurement", + "@id": "bts:StanfordUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cognitivefunctionmeasurement", + "rdfs:label": "StanfordUniversity", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cognitive function measurement", + "sms:displayName": "Stanford University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gaitmeasurement", + "@id": "bts:StateUniversityofNewYorkPolytechnicInstitute", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gaitmeasurement", + "rdfs:label": "StateUniversityofNewYorkPolytechnicInstitute", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" - }, - { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gait measurement", + "sms:displayName": "State University of New York Polytechnic Institute", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Motordevelopmentmeasurement", + "@id": "bts:StateUniversityofNewYork,Albany", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Motordevelopmentmeasurement", + "rdfs:label": "StateUniversityofNewYork,Albany", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "motor development measurement", + "sms:displayName": "State University of New York, Albany", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Painmeasurement", + "@id": "bts:StateUniversityofNewYork,Buffalo", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Painmeasurement", + "rdfs:label": "StateUniversityofNewYork,Buffalo", "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalFactor" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pain measurement", + "sms:displayName": "State University of New York, Buffalo", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Stature", + "@id": "bts:StateUniversityofNewYork,UpstateMedicalUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Stature of the individual.", - "rdfs:label": "Stature", + "rdfs:comment": "TBD", + "rdfs:label": "StateUniversityofNewYork,UpstateMedicalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:<5thcentile" - }, - { - "@id": "bts:5th-95thcentile" - }, - { - "@id": "bts:>95thcentile" - } - ], - "sms:displayName": "stature", + "sms:displayName": "State University of New York, Upstate Medical University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:<5thcentile", + "@id": "bts:StevensInstituteofTechnology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "<5thcentile", + "rdfs:label": "StevensInstituteofTechnology", "rdfs:subClassOf": [ { - "@id": "bts:Stature" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "< 5th centile", + "sms:displayName": "Stevens Institute of Technology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:5th-95thcentile", + "@id": "bts:StonyBrookUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "5th-95thcentile", + "rdfs:label": "StonyBrookUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Stature" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "5th-95th centile", + "sms:displayName": "Stony Brook University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:>95thcentile", + "@id": "bts:SyracuseUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": ">95thcentile", + "rdfs:label": "SyracuseUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Stature" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "> 95th centile", + "sms:displayName": "Syracuse University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReadPair", + "@id": "bts:TempleUniversity", "@type": "rdfs:Class", - "rdfs:comment": "The read of origin, Read 1 or Read 2", - "rdfs:label": "ReadPair", + "rdfs:comment": "TBD", + "rdfs:label": "TempleUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "readPair", + "sms:displayName": "Temple University", "sms:required": "sms:false", - "sms:validationRules": [ - "inRange 1 2" - ] + "sms:validationRules": [] }, { - "@id": "bts:WorkingDistanceUnit", + "@id": "bts:TennesseeStateUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Unit for working distance.", - "rdfs:label": "WorkingDistanceUnit", + "rdfs:comment": "TBD", + "rdfs:label": "TennesseeStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Angstrom" - }, - { - "@id": "bts:Nanometer" - }, - { - "@id": "bts:Micrometer" - }, - { - "@id": "bts:Millimeter" - }, - { - "@id": "bts:Centimeter" - } - ], - "sms:displayName": "workingDistanceUnit", + "sms:displayName": "Tennessee State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Angstrom", + "@id": "bts:TennesseeTechnologicalUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Angstrom", + "rdfs:label": "TennesseeTechnologicalUniversity", "rdfs:subClassOf": [ { - "@id": "bts:WorkingDistanceUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "angstrom", + "sms:displayName": "Tennessee Technological University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nanometer", + "@id": "bts:TexasA&MUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nanometer", + "rdfs:label": "TexasA&MUniversity", "rdfs:subClassOf": [ { - "@id": "bts:WorkingDistanceUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nanometer", + "sms:displayName": "Texas A&M University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Micrometer", + "@id": "bts:TexasChristianUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Micrometer", + "rdfs:label": "TexasChristianUniversity", "rdfs:subClassOf": [ { - "@id": "bts:WorkingDistanceUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "micrometer", + "sms:displayName": "Texas Christian University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Millimeter", + "@id": "bts:TexasStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Millimeter", + "rdfs:label": "TexasStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:WorkingDistanceUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "millimeter", + "sms:displayName": "Texas State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Centimeter", + "@id": "bts:TexasTechUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Centimeter", + "rdfs:label": "TexasTechUniversity", "rdfs:subClassOf": [ { - "@id": "bts:WorkingDistanceUnit" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "centimeter", + "sms:displayName": "Texas Tech University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NonopticGlioma", + "@id": "bts:TexasTechUniversityofHealthSciencesCenter", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Nonoptic glioma.", - "rdfs:label": "NonopticGlioma", + "rdfs:comment": "TBD", + "rdfs:label": "TexasTechUniversityofHealthSciencesCenter", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "nonopticGlioma", + "sms:displayName": "Texas Tech University of Health Sciences Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GermlineMutationIndicator", + "@id": "bts:ThomasJeffersonUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Indicates a summary testing result for individual's germline mutation only.", - "rdfs:label": "GermlineMutationIndicator", + "rdfs:comment": "TBD", + "rdfs:label": "ThomasJeffersonUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Nottested" - }, - { - "@id": "bts:Testedbutunknown" - } - ], - "sms:displayName": "germlineMutationIndicator", + "sms:displayName": "Thomas Jefferson University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nottested", + "@id": "bts:TuftsUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nottested", + "rdfs:label": "TuftsUniversity", "rdfs:subClassOf": [ { - "@id": "bts:GermlineMutationIndicator" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "not tested", + "sms:displayName": "Tufts University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Testedbutunknown", + "@id": "bts:TulaneUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Testedbutunknown", + "rdfs:label": "TulaneUniversity", "rdfs:subClassOf": [ { - "@id": "bts:GermlineMutationIndicator" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tested but unknown", + "sms:displayName": "Tulane University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AntibodyID", + "@id": "bts:TuskegeeUniversity", "@type": "rdfs:Class", - "rdfs:comment": "Antibody ID such as RRID if available, otherwise use vendor ID.", - "rdfs:label": "AntibodyID", + "rdfs:comment": "TBD", + "rdfs:label": "TuskegeeUniversity", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "antibodyID", + "sms:displayName": "Tuskegee University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpecimenIDSource", + "@id": "bts:UniformedServicesUniversityoftheHealthSciences", "@type": "rdfs:Class", - "rdfs:comment": "Optional annotation describing where the specimen ID source derived from, e.g. the biobank providing samples or a providing lab.", - "rdfs:label": "SpecimenIDSource", + "rdfs:comment": "TBD", + "rdfs:label": "UniformedServicesUniversityoftheHealthSciences", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "specimenIDSource", + "sms:displayName": "Uniformed Services University of the Health Sciences", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:VestibularSchwannoma", + "@id": "bts:UniversityCollegeofLondon", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Vestibular schwannoma.", - "rdfs:label": "VestibularSchwannoma", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityCollegeofLondon", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notimaged" - }, - { - "@id": "bts:Absentbyimaging" - }, - { - "@id": "bts:Unilateral" - }, - { - "@id": "bts:Bilateral" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "vestibularSchwannoma", + "sms:displayName": "University College of London", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Unilateral", + "@id": "bts:UniversityHealthNetwork", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Unilateral", + "rdfs:label": "UniversityHealthNetwork", "rdfs:subClassOf": [ { - "@id": "bts:VestibularSchwannoma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "unilateral", + "sms:displayName": "University Health Network", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bilateral", + "@id": "bts:UniversityofAkron", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bilateral", + "rdfs:label": "UniversityofAkron", "rdfs:subClassOf": [ { - "@id": "bts:VestibularSchwannoma" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bilateral", + "sms:displayName": "University of Akron", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsPairedEnd", + "@id": "bts:UniversityofAlabama", "@type": "rdfs:Class", - "rdfs:comment": "(Legacy/deprecated annotation) Whether or not is paired-end sequencing (Yes; No).", - "rdfs:label": "IsPairedEnd", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofAlabama", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Yes" - }, - { - "@id": "bts:No" - } - ], - "sms:displayName": "isPairedEnd", + "sms:displayName": "University of Alabama", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PlateName", + "@id": "bts:UniversityofAlabama,Birmingham", "@type": "rdfs:Class", - "rdfs:comment": "User-specified identifier of the plate used to prepare the sample for analysis.", - "rdfs:label": "PlateName", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofAlabama,Birmingham", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "plateName", + "sms:displayName": "University of Alabama, Birmingham", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NumberOfSchwannomas", + "@id": "bts:UniversityofAlabama,Huntsville", "@type": "rdfs:Class", - "rdfs:comment": "Number of schwannomas.", - "rdfs:label": "NumberOfSchwannomas", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofAlabama,Huntsville", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Single" - }, - { - "@id": "bts:Scattered" - }, - { - "@id": "bts:Dense" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "numberOfSchwannomas", + "sms:displayName": "University of Alabama, Huntsville", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataStatus", + "@id": "bts:UniversityofAlabama,Tuscaloosa", "@type": "rdfs:Class", - "rdfs:comment": "Overall status of data in a study.", - "rdfs:label": "DataStatus", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofAlabama,Tuscaloosa", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:DataNotExpected" - }, - { - "@id": "bts:DataPending" - }, - { - "@id": "bts:UnderEmbargo" - }, - { - "@id": "bts:RollingRelease" - }, - { - "@id": "bts:PartiallyAvailable" - }, - { - "@id": "bts:Available" - } - ], - "sms:displayName": "dataStatus", - "sms:required": "sms:true", + "sms:displayName": "University of Alabama, Tuscaloosa", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataNotExpected", + "@id": "bts:UniversityofAlaska,Anchorage", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DataNotExpected", + "rdfs:label": "UniversityofAlaska,Anchorage", "rdfs:subClassOf": [ { - "@id": "bts:DataStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Data Not Expected", + "sms:displayName": "University of Alaska, Anchorage", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataPending", + "@id": "bts:UniversityofAlaska,Fairbanks", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DataPending", + "rdfs:label": "UniversityofAlaska,Fairbanks", "rdfs:subClassOf": [ { - "@id": "bts:DataStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Data Pending", + "sms:displayName": "University of Alaska, Fairbanks", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:UnderEmbargo", + "@id": "bts:UniversityofArizona", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "UnderEmbargo", + "rdfs:label": "UniversityofArizona", "rdfs:subClassOf": [ { - "@id": "bts:DataStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Under Embargo", + "sms:displayName": "University of Arizona", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RollingRelease", + "@id": "bts:UniversityofArkansasforMedicalSciences", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RollingRelease", + "rdfs:label": "UniversityofArkansasforMedicalSciences", "rdfs:subClassOf": [ { - "@id": "bts:DataStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rolling Release", + "sms:displayName": "University of Arkansas for Medical Sciences", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PartiallyAvailable", + "@id": "bts:UniversityofArkansas,Fayetteville", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PartiallyAvailable", + "rdfs:label": "UniversityofArkansas,Fayetteville", "rdfs:subClassOf": [ { - "@id": "bts:DataStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Partially Available", + "sms:displayName": "University of Arkansas, Fayetteville", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Available", + "@id": "bts:UniversityofBaltimore", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Available", + "rdfs:label": "UniversityofBaltimore", "rdfs:subClassOf": [ { - "@id": "bts:DataStatus" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Available", + "sms:displayName": "University of Baltimore", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ContentSize", + "@id": "bts:UniversityofCalifornia,Berkeley", "@type": "rdfs:Class", - "rdfs:comment": "(Files only) File size, usually calculated by the backend.", - "rdfs:label": "ContentSize", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,Berkeley", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "contentSize", + "sms:displayName": "University of California, Berkeley", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TargetCaptureKitID", + "@id": "bts:UniversityofCalifornia,Davis", "@type": "rdfs:Class", - "rdfs:comment": "A unique identifier for the kit used to construct a genomic library using target capture-based techniques, which should be composed of the vendor name, kit name and kit version.\n", - "rdfs:label": "TargetCaptureKitID", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,Davis", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "targetCaptureKitID", + "sms:displayName": "University of California, Davis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AliquotID", + "@id": "bts:UniversityofCalifornia,Irvine", "@type": "rdfs:Class", - "rdfs:comment": "A unique identifier (non-PII) that represents the aliquots used for e.g. replicate runs. This is linked to the specimenID.", - "rdfs:label": "AliquotID", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,Irvine", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "aliquotID", + "sms:displayName": "University of California, Irvine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Initiative", + "@id": "bts:UniversityofCalifornia,LosAngeles", "@type": "rdfs:Class", - "rdfs:comment": "Refers to a funding initiative. Typically handled by the DCC.", - "rdfs:label": "Initiative", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,LosAngeles", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "initiative", + "sms:displayName": "University of California, Los Angeles", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NominalMagnification", + "@id": "bts:UniversityofCalifornia,Merced", "@type": "rdfs:Class", - "rdfs:comment": "magnification of the lens as specified by the manufacturer - i.e. '60' is a 60X lens.", - "rdfs:label": "NominalMagnification", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,Merced", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nominalMagnification", + "sms:displayName": "University of California, Merced", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:GenePerturbationTechnology", + "@id": "bts:UniversityofCalifornia,Riverside", "@type": "rdfs:Class", - "rdfs:comment": "Technology used to perturb gene", - "rdfs:label": "GenePerturbationTechnology", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,Riverside", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:RNAi" - }, - { - "@id": "bts:CRISPR" - }, + "sms:displayName": "University of California, Riverside", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:UniversityofCalifornia,SanDiego", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCalifornia,SanDiego", + "rdfs:subClassOf": [ { - "@id": "bts:CRERecombinase" + "@id": "bts:Institution" } ], - "sms:displayName": "genePerturbationTechnology", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "University of California, San Diego", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RNAi", + "@id": "bts:UniversityofCalifornia,SanFrancisco", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RNAi", + "rdfs:label": "UniversityofCalifornia,SanFrancisco", "rdfs:subClassOf": [ { - "@id": "bts:GenePerturbationTechnology" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RNAi", + "sms:displayName": "University of California, San Francisco", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CRISPR", + "@id": "bts:UniversityofCalifornia,SantaBarbara", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CRISPR", + "rdfs:label": "UniversityofCalifornia,SantaBarbara", "rdfs:subClassOf": [ { - "@id": "bts:GenePerturbationTechnology" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CRISPR", + "sms:displayName": "University of California, Santa Barbara", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CRERecombinase", + "@id": "bts:UniversityofCalifornia,SantaCruz", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CRERecombinase", + "rdfs:label": "UniversityofCalifornia,SantaCruz", "rdfs:subClassOf": [ { - "@id": "bts:GenePerturbationTechnology" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CRE Recombinase", + "sms:displayName": "University of California, Santa Cruz", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RelatedResource", + "@id": "bts:UniversityofCambridge", "@type": "rdfs:Class", - "rdfs:comment": "A related resource.", - "rdfs:label": "RelatedResource", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCambridge", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "relatedResource", + "sms:displayName": "University of Cambridge", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpecimenID", + "@id": "bts:UniversityofCentralFlorida", "@type": "rdfs:Class", - "rdfs:comment": "A unique identifier (non-PII) that represents the subspecimen (subsample) from which the data came, e.g. an ID that distinguishes between different parts of the same parent tumor specimen.\n", - "rdfs:label": "SpecimenID", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCentralFlorida", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "specimenID", - "sms:required": "sms:true", + "sms:displayName": "University of Central Florida", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Comments", + "@id": "bts:UniversityofChicago", "@type": "rdfs:Class", - "rdfs:comment": "Brief free-text comments that may also be important to understanding the resource.", - "rdfs:label": "Comments", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofChicago", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "comments", + "sms:displayName": "University of Chicago", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FileFormat", + "@id": "bts:UniversityofCincinnati", "@type": "rdfs:Class", - "rdfs:comment": "Defined format of the data file, typically corresponding to extension, but sometimes indicating more general group of files produced by the same tool or software", - "rdfs:label": "FileFormat", + "rdfs:comment": "TBD", + "rdfs:label": "UniversityofCincinnati", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:7z" - }, - { - "@id": "bts:DICOM" - }, - { - "@id": "bts:MATLABdata" - }, - { - "@id": "bts:MATLABscript" - }, - { - "@id": "bts:NWB" - }, - { - "@id": "bts:PAR" - }, - { - "@id": "bts:Pythonscript" - }, - { - "@id": "bts:Rscript" - }, - { - "@id": "bts:RCC" - }, - { - "@id": "bts:RData" - }, - { - "@id": "bts:REC" - }, - { - "@id": "bts:SDAT" - }, - { - "@id": "bts:SPAR" - }, - { - "@id": "bts:Sentrixdescriptorfile" - }, - { - "@id": "bts:Ab1" - }, - { - "@id": "bts:Abf" - }, - { - "@id": "bts:Ai" - }, - { - "@id": "bts:Avi" - }, - { - "@id": "bts:Bai" - }, - { - "@id": "bts:Bam" - }, - { - "@id": "bts:Bashscript" - }, - { - "@id": "bts:Bcf" - }, - { - "@id": "bts:Bed" - }, - { - "@id": "bts:BedbroadPeak" - }, - { - "@id": "bts:BedgappedPeak" - }, - { - "@id": "bts:BednarrowPeak" - }, - { - "@id": "bts:Bedgraph" - }, - { - "@id": "bts:Bgzip" - }, - { - "@id": "bts:Bigwig" - }, - { - "@id": "bts:Bmp" - }, - { - "@id": "bts:Bpm" - }, - { - "@id": "bts:Cel" - }, - { - "@id": "bts:Chp" - }, - { - "@id": "bts:Cnn" - }, - { - "@id": "bts:Cnr" - }, - { - "@id": "bts:Cns" - }, - { - "@id": "bts:Cram" - }, - { - "@id": "bts:Crai" - }, - { - "@id": "bts:Csi" - }, - { - "@id": "bts:Csv" - }, - { - "@id": "bts:Ctab" - }, - { - "@id": "bts:Czi" - }, - { - "@id": "bts:Dat" - }, - { - "@id": "bts:Doc" - }, - { - "@id": "bts:Dockerimage" - }, - { - "@id": "bts:Dup" - }, - { - "@id": "bts:Edat3" - }, - { - "@id": "bts:Excel" - }, - { - "@id": "bts:Fasta" - }, - { - "@id": "bts:Fastq" - }, - { - "@id": "bts:Fcs" - }, - { - "@id": "bts:Fig" - }, - { - "@id": "bts:Flagstat" - }, - { - "@id": "bts:Gct" - }, - { - "@id": "bts:Gff3" - }, - { - "@id": "bts:Gtf" - }, - { - "@id": "bts:Gzip" - }, - { - "@id": "bts:Hdf5" - }, - { - "@id": "bts:Hdr" - }, - { - "@id": "bts:Hic" - }, - { - "@id": "bts:Html" - }, - { - "@id": "bts:Hyperlink" - }, - { - "@id": "bts:Idat" - }, - { - "@id": "bts:Idx" - }, - { - "@id": "bts:Img" - }, - { - "@id": "bts:Jpg" - }, - { - "@id": "bts:Js" - }, - { - "@id": "bts:Json" - }, - { - "@id": "bts:Lif" - }, - { - "@id": "bts:Locs" - }, - { - "@id": "bts:Maf" - }, - { - "@id": "bts:Md" - }, - { - "@id": "bts:Mov" - }, - { - "@id": "bts:MPEG-4" - }, - { - "@id": "bts:Msf" - }, - { - "@id": "bts:Mtx" - }, - { - "@id": "bts:MzML" - }, - { - "@id": "bts:Nii" - }, - { - "@id": "bts:Ome-tiff" - }, - { - "@id": "bts:Pdf" - }, - { - "@id": "bts:Plink" - }, - { - "@id": "bts:Png" - }, - { - "@id": "bts:Powerpoint" - }, - { - "@id": "bts:Pzfx" - }, - { - "@id": "bts:Psydat" - }, - { - "@id": "bts:Raw" - }, - { - "@id": "bts:Rds" - }, - { - "@id": "bts:Recal" - }, - { - "@id": "bts:Rmd" - }, - { - "@id": "bts:Sam" - }, - { - "@id": "bts:Sav" - }, - { - "@id": "bts:Sdf" - }, - { - "@id": "bts:Seg" - }, - { - "@id": "bts:Sf" - }, - { - "@id": "bts:Sif" - }, - { - "@id": "bts:Sqlite" - }, - { - "@id": "bts:Sra" - }, - { - "@id": "bts:Svg" - }, - { - "@id": "bts:Svs" - }, - { - "@id": "bts:TagAlign" - }, - { - "@id": "bts:Tar" - }, - { - "@id": "bts:Tbi" - }, - { - "@id": "bts:Tif" - }, - { - "@id": "bts:Tom" - }, - { - "@id": "bts:Tranches" - }, - { - "@id": "bts:Tsv" - }, - { - "@id": "bts:Txt" - }, - { - "@id": "bts:Vcf" - }, - { - "@id": "bts:Wiggle" - }, - { - "@id": "bts:Xml" - }, - { - "@id": "bts:Yaml" - }, - { - "@id": "bts:Zip" - } - ], - "sms:displayName": "fileFormat", - "sms:required": "sms:true", + "sms:displayName": "University of Cincinnati", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:7z", + "@id": "bts:UniversityofColoradoBoulder", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "7z", + "rdfs:label": "UniversityofColoradoBoulder", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "7z", + "sms:displayName": "University of Colorado Boulder", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DICOM", + "@id": "bts:UniversityofColoradoDenverandAnschutzMedicalCampus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DICOM", + "rdfs:label": "UniversityofColoradoDenverandAnschutzMedicalCampus", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DICOM", + "sms:displayName": "University of Colorado Denver and Anschutz Medical Campus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MATLABdata", + "@id": "bts:UniversityofConnecticut", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MATLABdata", + "rdfs:label": "UniversityofConnecticut", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MATLAB data", + "sms:displayName": "University of Connecticut", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MATLABscript", + "@id": "bts:UniversityofDayton", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MATLABscript", + "rdfs:label": "UniversityofDayton", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MATLAB script", + "sms:displayName": "University of Dayton", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NWB", + "@id": "bts:UniversityofDelaware", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NWB", + "rdfs:label": "UniversityofDelaware", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NWB", + "sms:displayName": "University of Delaware", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PAR", + "@id": "bts:UniversityofDenver", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PAR", + "rdfs:label": "UniversityofDenver", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PAR", + "sms:displayName": "University of Denver", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pythonscript", + "@id": "bts:UniversityofFlorida", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pythonscript", + "rdfs:label": "UniversityofFlorida", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Python script", + "sms:displayName": "University of Florida", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rscript", + "@id": "bts:UniversityofGeorgia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rscript", + "rdfs:label": "UniversityofGeorgia", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "R script", + "sms:displayName": "University of Georgia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RCC", + "@id": "bts:UniversityofGlasgow", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RCC", + "rdfs:label": "UniversityofGlasgow", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RCC", + "sms:displayName": "University of Glasgow", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RData", + "@id": "bts:UniversityofHawaii,Manoa", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RData", + "rdfs:label": "UniversityofHawaii,Manoa", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RData", + "sms:displayName": "University of Hawaii, Manoa", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:REC", + "@id": "bts:UniversityofHouston", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "REC", + "rdfs:label": "UniversityofHouston", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "REC", + "sms:displayName": "University of Houston", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SDAT", + "@id": "bts:UniversityofIdaho", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SDAT", + "rdfs:label": "UniversityofIdaho", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SDAT", + "sms:displayName": "University of Idaho", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SPAR", + "@id": "bts:UniversityofIllinois,Chicago", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SPAR", + "rdfs:label": "UniversityofIllinois,Chicago", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SPAR", + "sms:displayName": "University of Illinois, Chicago", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sentrixdescriptorfile", + "@id": "bts:UniversityofIllinois,Urbana-Champaign", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sentrixdescriptorfile", + "rdfs:label": "UniversityofIllinois,Urbana-Champaign", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Sentrix descriptor file", + "sms:displayName": "University of Illinois, Urbana-Champaign", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ab1", + "@id": "bts:UniversityofIowa", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ab1", + "rdfs:label": "UniversityofIowa", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ab1", + "sms:displayName": "University of Iowa", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Abf", + "@id": "bts:UniversityofKansas", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Abf", + "rdfs:label": "UniversityofKansas", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "abf", + "sms:displayName": "University of Kansas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ai", + "@id": "bts:UniversityofKentucky", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ai", + "rdfs:label": "UniversityofKentucky", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ai", + "sms:displayName": "University of Kentucky", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Avi", + "@id": "bts:UniversityofLouisianaatLafayette", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Avi", + "rdfs:label": "UniversityofLouisianaatLafayette", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "avi", + "sms:displayName": "University of Louisiana at Lafayette", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bai", + "@id": "bts:UniversityofLouisville", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bai", + "rdfs:label": "UniversityofLouisville", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bai", + "sms:displayName": "University of Louisville", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bam", + "@id": "bts:UniversityofMaine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bam", + "rdfs:label": "UniversityofMaine", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bam", + "sms:displayName": "University of Maine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bashscript", + "@id": "bts:UniversityofMaryland,BaltimoreCounty", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bashscript", + "rdfs:label": "UniversityofMaryland,BaltimoreCounty", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bash script", + "sms:displayName": "University of Maryland, Baltimore County", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bcf", + "@id": "bts:UniversityofMaryland,EasternShore", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bcf", + "rdfs:label": "UniversityofMaryland,EasternShore", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bcf", + "sms:displayName": "University of Maryland, Eastern Shore", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bed", + "@id": "bts:UniversityofMassachusetts,Amherst", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bed", + "rdfs:label": "UniversityofMassachusetts,Amherst", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bed", + "sms:displayName": "University of Massachusetts, Amherst", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BedbroadPeak", + "@id": "bts:UniversityofMassachusetts,Boston", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BedbroadPeak", + "rdfs:label": "UniversityofMassachusetts,Boston", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bed broadPeak", + "sms:displayName": "University of Massachusetts, Boston", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BedgappedPeak", + "@id": "bts:UniversityofMassachusetts,Dartmouth", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BedgappedPeak", + "rdfs:label": "UniversityofMassachusetts,Dartmouth", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bed gappedPeak", + "sms:displayName": "University of Massachusetts, Dartmouth", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BednarrowPeak", + "@id": "bts:UniversityofMassachusetts,Lowell", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BednarrowPeak", + "rdfs:label": "UniversityofMassachusetts,Lowell", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bed narrowPeak", + "sms:displayName": "University of Massachusetts, Lowell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bedgraph", + "@id": "bts:UniversityofMassachusetts,MedicalSchool", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bedgraph", + "rdfs:label": "UniversityofMassachusetts,MedicalSchool", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bedgraph", + "sms:displayName": "University of Massachusetts, Medical School", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bgzip", + "@id": "bts:UniversityofMemphis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bgzip", + "rdfs:label": "UniversityofMemphis", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bgzip", + "sms:displayName": "University of Memphis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bigwig", + "@id": "bts:UniversityofMiami", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bigwig", + "rdfs:label": "UniversityofMiami", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bigwig", + "sms:displayName": "University of Miami", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bmp", + "@id": "bts:UniversityofMichigan,AnnArbor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bmp", + "rdfs:label": "UniversityofMichigan,AnnArbor", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bmp", + "sms:displayName": "University of Michigan, Ann Arbor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bpm", + "@id": "bts:UniversityofMinnesota,Duluth", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bpm", + "rdfs:label": "UniversityofMinnesota,Duluth", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bpm", + "sms:displayName": "University of Minnesota, Duluth", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cel", + "@id": "bts:UniversityofMinnesota,TwinCities", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cel", + "rdfs:label": "UniversityofMinnesota,TwinCities", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cel", + "sms:displayName": "University of Minnesota, Twin Cities", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Chp", + "@id": "bts:UniversityofMississippi", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Chp", + "rdfs:label": "UniversityofMississippi", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "chp", + "sms:displayName": "University of Mississippi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cnn", + "@id": "bts:UniversityofMissouri,Columbia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cnn", + "rdfs:label": "UniversityofMissouri,Columbia", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cnn", + "sms:displayName": "University of Missouri, Columbia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cnr", + "@id": "bts:UniversityofMissouri,KansasCity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cnr", + "rdfs:label": "UniversityofMissouri,KansasCity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cnr", + "sms:displayName": "University of Missouri, Kansas City", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cns", + "@id": "bts:UniversityofMissouri,SaintLouis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cns", + "rdfs:label": "UniversityofMissouri,SaintLouis", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cns", + "sms:displayName": "University of Missouri, Saint Louis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cram", + "@id": "bts:UniversityofMontana,Missoula", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cram", + "rdfs:label": "UniversityofMontana,Missoula", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cram", + "sms:displayName": "University of Montana, Missoula", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Crai", + "@id": "bts:UniversityofNebraska,Lincoln", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Crai", + "rdfs:label": "UniversityofNebraska,Lincoln", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "crai", + "sms:displayName": "University of Nebraska, Lincoln", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Csi", + "@id": "bts:UniversityofNebraska,MedicalCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Csi", + "rdfs:label": "UniversityofNebraska,MedicalCenter", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "csi", + "sms:displayName": "University of Nebraska, Medical Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Csv", + "@id": "bts:UniversityofNebraska,Omaha", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Csv", + "rdfs:label": "UniversityofNebraska,Omaha", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "csv", + "sms:displayName": "University of Nebraska, Omaha", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ctab", + "@id": "bts:UniversityofNevada,LasVegas", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ctab", + "rdfs:label": "UniversityofNevada,LasVegas", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ctab", + "sms:displayName": "University of Nevada, Las Vegas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Czi", + "@id": "bts:UniversityofNevada,Reno", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Czi", + "rdfs:label": "UniversityofNevada,Reno", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "czi", + "sms:displayName": "University of Nevada, Reno", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dat", + "@id": "bts:UniversityofNewHampshire", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dat", + "rdfs:label": "UniversityofNewHampshire", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dat", + "sms:displayName": "University of New Hampshire", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Doc", + "@id": "bts:UniversityofNewMexico", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Doc", + "rdfs:label": "UniversityofNewMexico", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "doc", + "sms:displayName": "University of New Mexico", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dockerimage", + "@id": "bts:UniversityofNewOrleans", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dockerimage", + "rdfs:label": "UniversityofNewOrleans", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "docker image", + "sms:displayName": "University of New Orleans", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dup", + "@id": "bts:UniversityofNorthCarolina,ChapelHill", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dup", + "rdfs:label": "UniversityofNorthCarolina,ChapelHill", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dup", + "sms:displayName": "University of North Carolina, Chapel Hill", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Edat3", + "@id": "bts:UniversityofNorthCarolina,Charlotte", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Edat3", + "rdfs:label": "UniversityofNorthCarolina,Charlotte", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "edat3", + "sms:displayName": "University of North Carolina, Charlotte", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Excel", + "@id": "bts:UniversityofNorthCarolina,Greensboro", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Excel", + "rdfs:label": "UniversityofNorthCarolina,Greensboro", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "excel", + "sms:displayName": "University of North Carolina, Greensboro", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fasta", + "@id": "bts:UniversityofNorthCarolina,Wilmington", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fasta", + "rdfs:label": "UniversityofNorthCarolina,Wilmington", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fasta", + "sms:displayName": "University of North Carolina, Wilmington", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fastq", + "@id": "bts:UniversityofNorthDakota", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fastq", + "rdfs:label": "UniversityofNorthDakota", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fastq", + "sms:displayName": "University of North Dakota", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fcs", + "@id": "bts:UniversityofNorthTexas,Denton", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fcs", + "rdfs:label": "UniversityofNorthTexas,Denton", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fcs", + "sms:displayName": "University of North Texas, Denton", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fig", + "@id": "bts:UniversityofNorthTexas,HealthScienceCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fig", + "rdfs:label": "UniversityofNorthTexas,HealthScienceCenter", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fig", + "sms:displayName": "University of North Texas, Health Science Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Flagstat", + "@id": "bts:UniversityofNotreDame", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Flagstat", + "rdfs:label": "UniversityofNotreDame", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "flagstat", + "sms:displayName": "University of Notre Dame", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gct", + "@id": "bts:UniversityofOklahoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gct", + "rdfs:label": "UniversityofOklahoma", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gct", + "sms:displayName": "University of Oklahoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gff3", + "@id": "bts:UniversityofOregon", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gff3", + "rdfs:label": "UniversityofOregon", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gff3", + "sms:displayName": "University of Oregon", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gtf", + "@id": "bts:UniversityofPennsylvania", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gtf", + "rdfs:label": "UniversityofPennsylvania", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gtf", + "sms:displayName": "University of Pennsylvania", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gzip", + "@id": "bts:UniversityofPittsburgh,Pittsburgh", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gzip", + "rdfs:label": "UniversityofPittsburgh,Pittsburgh", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gzip", + "sms:displayName": "University of Pittsburgh, Pittsburgh", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Hdf5", + "@id": "bts:UniversityofPlymouth", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Hdf5", + "rdfs:label": "UniversityofPlymouth", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hdf5", + "sms:displayName": "University of Plymouth", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Hdr", + "@id": "bts:UniversityofPuertoRico,Mayaguez", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Hdr", + "rdfs:label": "UniversityofPuertoRico,Mayaguez", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hdr", + "sms:displayName": "University of Puerto Rico, Mayaguez", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Hic", + "@id": "bts:UniversityofPuertoRico,MedicalSciencesCampus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Hic", + "rdfs:label": "UniversityofPuertoRico,MedicalSciencesCampus", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hic", + "sms:displayName": "University of Puerto Rico, Medical Sciences Campus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Html", + "@id": "bts:UniversityofPuertoRico,RioPiedras", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Html", + "rdfs:label": "UniversityofPuertoRico,RioPiedras", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "html", + "sms:displayName": "University of Puerto Rico, Rio Piedras", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Hyperlink", + "@id": "bts:UniversityofRhodeIsland", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Hyperlink", + "rdfs:label": "UniversityofRhodeIsland", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hyperlink", + "sms:displayName": "University of Rhode Island", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Idat", + "@id": "bts:UniversityofRochester", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Idat", + "rdfs:label": "UniversityofRochester", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "idat", + "sms:displayName": "University of Rochester", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Idx", + "@id": "bts:UniversityofSouthAlabama", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Idx", + "rdfs:label": "UniversityofSouthAlabama", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "idx", + "sms:displayName": "University of South Alabama", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Img", + "@id": "bts:UniversityofSouthCarolina,Columbia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Img", + "rdfs:label": "UniversityofSouthCarolina,Columbia", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "img", + "sms:displayName": "University of South Carolina, Columbia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Jpg", + "@id": "bts:UniversityofSouthDakota", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Jpg", + "rdfs:label": "UniversityofSouthDakota", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "jpg", + "sms:displayName": "University of South Dakota", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Js", + "@id": "bts:UniversityofSouthFlorida,SaintPetersburg", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Js", + "rdfs:label": "UniversityofSouthFlorida,SaintPetersburg", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "js", + "sms:displayName": "University of South Florida, Saint Petersburg", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Json", + "@id": "bts:UniversityofSouthFlorida,Tampa", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Json", + "rdfs:label": "UniversityofSouthFlorida,Tampa", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "json", + "sms:displayName": "University of South Florida, Tampa", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lif", + "@id": "bts:UniversityofSouthernCalifornia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lif", + "rdfs:label": "UniversityofSouthernCalifornia", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lif", + "sms:displayName": "University of Southern California", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Locs", + "@id": "bts:UniversityofSouthernMississippi", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Locs", + "rdfs:label": "UniversityofSouthernMississippi", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "locs", + "sms:displayName": "University of Southern Mississippi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Maf", + "@id": "bts:UniversityofTennessee,HealthScienceCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Maf", + "rdfs:label": "UniversityofTennessee,HealthScienceCenter", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "maf", + "sms:displayName": "University of Tennessee, Health Science Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Md", + "@id": "bts:UniversityofTennessee,Knoxville", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Md", + "rdfs:label": "UniversityofTennessee,Knoxville", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "md", + "sms:displayName": "University of Tennessee, Knoxville", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mov", + "@id": "bts:UniversityofTexasHealthScienceCenter,Houston", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mov", + "rdfs:label": "UniversityofTexasHealthScienceCenter,Houston", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mov", + "sms:displayName": "University of Texas Health Science Center, Houston", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MPEG-4", + "@id": "bts:UniversityofTexasHealthScienceCenter,SanAntonio", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MPEG-4", + "rdfs:label": "UniversityofTexasHealthScienceCenter,SanAntonio", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MPEG-4", + "sms:displayName": "University of Texas Health Science Center, San Antonio", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Msf", + "@id": "bts:UniversityofTexasHealthScienceCenter,Tyler", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Msf", + "rdfs:label": "UniversityofTexasHealthScienceCenter,Tyler", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "msf", + "sms:displayName": "University of Texas Health Science Center, Tyler", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mtx", + "@id": "bts:UniversityofTexasM.D.AndersonCancerCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mtx", + "rdfs:label": "UniversityofTexasM.D.AndersonCancerCenter", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mtx", + "sms:displayName": "University of Texas M. D. Anderson Cancer Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MzML", + "@id": "bts:UniversityofTexasMedicalBranchatGalveston", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MzML", + "rdfs:label": "UniversityofTexasMedicalBranchatGalveston", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mzML", + "sms:displayName": "University of Texas Medical Branch at Galveston", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nii", + "@id": "bts:UniversityofTexasRioGrandeValley", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nii", + "rdfs:label": "UniversityofTexasRioGrandeValley", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nii", + "sms:displayName": "University of Texas Rio Grande Valley", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ome-tiff", + "@id": "bts:UniversityofTexasSouthwesternMedicalCenter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ome-tiff", + "rdfs:label": "UniversityofTexasSouthwesternMedicalCenter", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ome-tiff", + "sms:displayName": "University of Texas Southwestern Medical Center", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pdf", + "@id": "bts:UniversityofTexas,Arlington", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pdf", + "rdfs:label": "UniversityofTexas,Arlington", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pdf", + "sms:displayName": "University of Texas, Arlington", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Plink", + "@id": "bts:UniversityofTexas,Austin", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Plink", + "rdfs:label": "UniversityofTexas,Austin", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "plink", + "sms:displayName": "University of Texas, Austin", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Png", + "@id": "bts:UniversityofTexas,Dallas", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Png", + "rdfs:label": "UniversityofTexas,Dallas", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "png", + "sms:displayName": "University of Texas, Dallas", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Powerpoint", + "@id": "bts:UniversityofTexas,ElPaso", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Powerpoint", + "rdfs:label": "UniversityofTexas,ElPaso", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "powerpoint", + "sms:displayName": "University of Texas, El Paso", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pzfx", + "@id": "bts:UniversityofTexas,SanAntonio", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pzfx", + "rdfs:label": "UniversityofTexas,SanAntonio", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pzfx", + "sms:displayName": "University of Texas, San Antonio", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Psydat", + "@id": "bts:UniversityofToledo", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Psydat", + "rdfs:label": "UniversityofToledo", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "psydat", + "sms:displayName": "University of Toledo", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Raw", + "@id": "bts:UniversityofTulsa", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Raw", + "rdfs:label": "UniversityofTulsa", "rdfs:subClassOf": [ { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "raw", + "sms:displayName": "University of Tulsa", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rds", + "@id": "bts:UniversityofTurku", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rds", + "rdfs:label": "UniversityofTurku", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "rds", + "sms:displayName": "University of Turku", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Recal", + "@id": "bts:UniversityofUtah", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Recal", + "rdfs:label": "UniversityofUtah", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "recal", + "sms:displayName": "University of Utah", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rmd", + "@id": "bts:UniversityofVermont", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rmd", + "rdfs:label": "UniversityofVermont", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "rmd", + "sms:displayName": "University of Vermont", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sam", + "@id": "bts:UniversityofVirginia,Charlottesville", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sam", + "rdfs:label": "UniversityofVirginia,Charlottesville", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sam", + "sms:displayName": "University of Virginia, Charlottesville", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sav", + "@id": "bts:UniversityofWashington,Seattle", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sav", + "rdfs:label": "UniversityofWashington,Seattle", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sav", + "sms:displayName": "University of Washington, Seattle", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sdf", + "@id": "bts:UniversityofWestFlorida", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sdf", + "rdfs:label": "UniversityofWestFlorida", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sdf", + "sms:displayName": "University of West Florida", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Seg", + "@id": "bts:UniversityofWisconsin-Madison", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Seg", + "rdfs:label": "UniversityofWisconsin-Madison", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "seg", + "sms:displayName": "University of Wisconsin-Madison", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sf", + "@id": "bts:UniversityofWisconsin-Milwaukee", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sf", + "rdfs:label": "UniversityofWisconsin-Milwaukee", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sf", + "sms:displayName": "University of Wisconsin-Milwaukee", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sif", + "@id": "bts:UniversityofWyoming", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sif", + "rdfs:label": "UniversityofWyoming", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sif", + "sms:displayName": "University of Wyoming", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sqlite", + "@id": "bts:UniversitéParis-EstCréteil", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sqlite", + "rdfs:label": "UniversitéParis-EstCréteil", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sqlite", + "sms:displayName": "Université Paris-Est Créteil", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sra", + "@id": "bts:UtahStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sra", + "rdfs:label": "UtahStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sra", + "sms:displayName": "Utah State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Svg", + "@id": "bts:VanAndelResearchInstitute", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Svg", + "rdfs:label": "VanAndelResearchInstitute", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "svg", + "sms:displayName": "Van Andel Research Institute", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Svs", + "@id": "bts:VanderbiltUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Svs", + "rdfs:label": "VanderbiltUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "svs", + "sms:displayName": "Vanderbilt University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TagAlign", + "@id": "bts:VillanovaUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TagAlign", + "rdfs:label": "VillanovaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tagAlign", + "sms:displayName": "Villanova University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tar", + "@id": "bts:VirginiaCommonwealthUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tar", + "rdfs:label": "VirginiaCommonwealthUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tar", + "sms:displayName": "Virginia Commonwealth University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tbi", + "@id": "bts:VirginiaPolytechnicInstituteandStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tbi", + "rdfs:label": "VirginiaPolytechnicInstituteandStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tbi", + "sms:displayName": "Virginia Polytechnic Institute and State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tif", + "@id": "bts:WakeForestUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tif", + "rdfs:label": "WakeForestUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tif", + "sms:displayName": "Wake Forest University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tom", + "@id": "bts:WashingtonStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tom", + "rdfs:label": "WashingtonStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tom", + "sms:displayName": "Washington State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tranches", + "@id": "bts:WashingtonUniversityinSt.Louis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tranches", + "rdfs:label": "WashingtonUniversityinSt.Louis", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tranches", + "sms:displayName": "Washington University in St. Louis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tsv", + "@id": "bts:WayneStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tsv", + "rdfs:label": "WayneStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tsv", + "sms:displayName": "Wayne State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Txt", + "@id": "bts:WestVirginiaUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Txt", + "rdfs:label": "WestVirginiaUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "txt", + "sms:displayName": "West Virginia University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Vcf", + "@id": "bts:WesternMichiganUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Vcf", + "rdfs:label": "WesternMichiganUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "vcf", + "sms:displayName": "Western Michigan University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Wiggle", + "@id": "bts:WichitaStateUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Wiggle", + "rdfs:label": "WichitaStateUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "wiggle", + "sms:displayName": "Wichita State University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Xml", + "@id": "bts:William&Mary", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Xml", + "rdfs:label": "William&Mary", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "xml", + "sms:displayName": "William & Mary", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Yaml", + "@id": "bts:WorcesterPolytechnicInstitute", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Yaml", + "rdfs:label": "WorcesterPolytechnicInstitute", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "yaml", + "sms:displayName": "Worcester Polytechnic Institute", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Zip", + "@id": "bts:YaleUniversity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Zip", + "rdfs:label": "YaleUniversity", "rdfs:subClassOf": [ { - "@id": "bts:FileFormat" + "@id": "bts:Institution" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "zip", + "sms:displayName": "Yale University", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf2Genotype", + "@id": "bts:IsStranded", "@type": "rdfs:Class", - "rdfs:comment": "Genotype of NF2 gene in the biospecimen from which the data were derived, if known", - "rdfs:label": "Nf2Genotype", + "rdfs:comment": "Whether or not the library is stranded (Yes; No)", + "rdfs:label": "IsStranded", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -15261,339 +19433,467 @@ }, "schema:rangeIncludes": [ { - "@id": "bts:-/-" - }, - { - "@id": "bts:+/-" - }, - { - "@id": "bts:+/+" + "@id": "bts:Yes" }, { - "@id": "bts:Unknown" + "@id": "bts:No" } ], - "sms:displayName": "nf2Genotype", + "sms:displayName": "isStranded", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PeripheralNeuropathy", + "@id": "bts:Yes", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Peripheral neuropathy.", - "rdfs:label": "PeripheralNeuropathy", + "rdfs:comment": "TBD", + "rdfs:label": "Yes", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:IsStranded" + }, + { + "@id": "bts:IsCellLine" + }, + { + "@id": "bts:IsMultiIndividual" + }, + { + "@id": "bts:IsPairedEnd" + }, + { + "@id": "bts:IsMultiSpecimen" + }, + { + "@id": "bts:IsPrimaryCell" + }, + { + "@id": "bts:IsXenograft" + }, + { + "@id": "bts:FailedQC" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ + "sms:displayName": "Yes", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:No", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "No", + "rdfs:subClassOf": [ { - "@id": "bts:Absent" + "@id": "bts:IsStranded" }, { - "@id": "bts:Present" + "@id": "bts:IsCellLine" }, { - "@id": "bts:Unknown" + "@id": "bts:IsMultiIndividual" + }, + { + "@id": "bts:IsPairedEnd" + }, + { + "@id": "bts:IsMultiSpecimen" + }, + { + "@id": "bts:IsPrimaryCell" + }, + { + "@id": "bts:IsXenograft" + }, + { + "@id": "bts:FailedQC" } ], - "sms:displayName": "peripheralNeuropathy", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "No", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Component", + "@id": "bts:Python", "@type": "rdfs:Class", - "rdfs:comment": "Type of metadata template; provide the same one for all items/rows.", - "rdfs:label": "Component", + "rdfs:comment": "TBD", + "rdfs:label": "Python", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Component", - "sms:required": "sms:true", + "sms:displayName": "Python", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Scoliosis", + "@id": "bts:R", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Scoliosis.", - "rdfs:label": "Scoliosis", + "rdfs:comment": "TBD", + "rdfs:label": "R", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "scoliosis", + "sms:displayName": "R", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Species", + "@id": "bts:MATLAB", "@type": "rdfs:Class", - "rdfs:comment": "The name of a species (typically a taxonomic group) of organism.", - "rdfs:label": "Species", + "rdfs:comment": "TBD", + "rdfs:label": "MATLAB", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Rattusnorvegicus" - }, - { - "@id": "bts:Gallusgallus" - }, - { - "@id": "bts:Pantroglodytes" - }, - { - "@id": "bts:Musmusculus(humanized)" - }, - { - "@id": "bts:Homosapiens" - }, - { - "@id": "bts:Daniorerio" - }, - { - "@id": "bts:Drosophilamelanogaster" - }, - { - "@id": "bts:Rhesusmacaque" - }, - { - "@id": "bts:Susscrofa" - }, - { - "@id": "bts:Oryctolaguscuniculus" - }, - { - "@id": "bts:Musmusculus" - } - ], - "sms:displayName": "species", - "sms:required": "sms:true", + "sms:displayName": "MATLAB", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rattusnorvegicus", + "@id": "bts:Java", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rattusnorvegicus", + "rdfs:label": "Java", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rattus norvegicus", + "sms:displayName": "Java", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gallusgallus", + "@id": "bts:C", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gallusgallus", + "rdfs:label": "C", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:CaptureArea" + }, + { + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Gallus gallus", + "sms:displayName": "C", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pantroglodytes", + "@id": "bts:C++", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pantroglodytes", + "rdfs:label": "C++", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pan troglodytes", + "sms:displayName": "C++", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Musmusculus(humanized)", + "@id": "bts:C#", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Musmusculus(humanized)", + "rdfs:label": "C#", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mus musculus (humanized)", + "sms:displayName": "C#", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Homosapiens", + "@id": "bts:Javascript", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Homosapiens", + "rdfs:label": "Javascript", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Homo sapiens", + "sms:displayName": "Javascript", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Daniorerio", + "@id": "bts:Bash", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Daniorerio", + "rdfs:label": "Bash", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:ProgrammingLanguage" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Danio rerio", + "sms:displayName": "bash", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Drosophilamelanogaster", + "@id": "bts:SlideID", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Drosophilamelanogaster", + "rdfs:comment": "Unique identifier printed on the label of each Visium slide. The serial number starts with V followed by a number which can range between one through five and ends with a dash and a three digit number, such as 123.\n", + "rdfs:label": "SlideID", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Drosophila melanogaster", + "sms:displayName": "slideID", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rhesusmacaque", + "@id": "bts:SourceName", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Rhesusmacaque", + "rdfs:comment": "Intended for non-biological samples, tf the sample is a nanoparticle sample or some chemical substance not derived from a biological material, the corresponding source name should refer to the starting sample that was modified by a protocol for the assay.\n", + "rdfs:label": "SourceName", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Rhesus macaque", + "sms:displayName": "sourceName", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Susscrofa", + "@id": "bts:Mosaic", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Susscrofa", + "rdfs:label": "Mosaic", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:Mosaicism" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Sus scrofa", + "sms:displayName": "mosaic", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Oryctolaguscuniculus", + "@id": "bts:Notmosaic", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Oryctolaguscuniculus", + "rdfs:label": "Notmosaic", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:Mosaicism" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oryctolagus cuniculus", + "sms:displayName": "not mosaic", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Musmusculus", + "@id": "bts:Unknown", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Musmusculus", + "rdfs:label": "Unknown", "rdfs:subClassOf": [ { - "@id": "bts:Species" + "@id": "bts:Mosaicism" + }, + { + "@id": "bts:DermalSchwannoma" + }, + { + "@id": "bts:BreastCancer" + }, + { + "@id": "bts:OtherTumors" + }, + { + "@id": "bts:GIST" + }, + { + "@id": "bts:NonopticGlioma" + }, + { + "@id": "bts:PeripheralNeuropathy" + }, + { + "@id": "bts:Scoliosis" + }, + { + "@id": "bts:IntellectualDisability" + }, + { + "@id": "bts:MPNST" + }, + { + "@id": "bts:AqueductalStenosis" + }, + { + "@id": "bts:IrisLischNodules" + }, + { + "@id": "bts:HeartDefect" + }, + { + "@id": "bts:Pheochromocytoma" + }, + { + "@id": "bts:Inheritance" + }, + { + "@id": "bts:LearningDisability" + }, + { + "@id": "bts:LenticularOpacity" + }, + { + "@id": "bts:CafeaulaitMacules" + }, + { + "@id": "bts:LongBoneDysplasia" + }, + { + "@id": "bts:GlomusTumor" + }, + { + "@id": "bts:SphenoidDysplasia" + }, + { + "@id": "bts:SkinFoldFreckling" + }, + { + "@id": "bts:Leukemia" + }, + { + "@id": "bts:VascularDisease" + }, + { + "@id": "bts:AttentionDeficitDisorder" + }, + { + "@id": "bts:VitalStatus" + }, + { + "@id": "bts:Sex" + }, + { + "@id": "bts:DiffuseDermalNeurofibromas" + }, + { + "@id": "bts:NumberOfSchwannomas" + }, + { + "@id": "bts:PlexiformNeurofibromas" + }, + { + "@id": "bts:DermalNeurofibromas" + }, + { + "@id": "bts:NonvestibularCranialSchwannoma" + }, + { + "@id": "bts:NonvestibularSchwannomas" + }, + { + "@id": "bts:SubcutaneousNodularNeurofibromas" + }, + { + "@id": "bts:GliomaOrEpendymoma" + }, + { + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" + }, + { + "@id": "bts:SpinalSchwannoma" + }, + { + "@id": "bts:OpticGlioma" + }, + { + "@id": "bts:VestibularSchwannoma" + }, + { + "@id": "bts:DiagnosisAgeGroup" + }, + { + "@id": "bts:Meningioma" + }, + { + "@id": "bts:LibraryPreparationMethod" + }, + { + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mus musculus", + "sms:displayName": "Unknown", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ConcreteType", + "@id": "bts:ReadPairOrientation", "@type": "rdfs:Class", - "rdfs:comment": "Refers to the class model the data platform uses for representing the resource. This is a low-level field set by the platform and is not a user annotation.", - "rdfs:label": "ConcreteType", + "rdfs:comment": "The relative orientation of the reads in a paired-end protocol", + "rdfs:label": "ReadPairOrientation", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -15602,83 +19902,97 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "concreteType", + "schema:rangeIncludes": [ + { + "@id": "bts:Fr-firststrand" + }, + { + "@id": "bts:Inward" + }, + { + "@id": "bts:Matching" + }, + { + "@id": "bts:Outward" + } + ], + "sms:displayName": "readPairOrientation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Allograft", + "@id": "bts:Fr-firststrand", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Allograft", + "rdfs:label": "Fr-firststrand", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationType" + "@id": "bts:ReadPairOrientation" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "allograft", + "sms:displayName": "fr-firststrand", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Xenograft", + "@id": "bts:Inward", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Xenograft", + "rdfs:label": "Inward", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationType" + "@id": "bts:ReadPairOrientation" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "xenograft", + "sms:displayName": "inward", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Autograft", + "@id": "bts:Matching", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Autograft", + "rdfs:label": "Matching", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationType" + "@id": "bts:ReadPairOrientation" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "autograft", + "sms:displayName": "matching", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Isograft", + "@id": "bts:Outward", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Isograft", + "rdfs:label": "Outward", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationType" + "@id": "bts:ReadPairOrientation" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "isograft", + "sms:displayName": "outward", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:YearPublished", + "@id": "bts:FileSize", "@type": "rdfs:Class", - "rdfs:comment": "Year in which the resource was published/generally made available.", - "rdfs:label": "YearPublished", + "rdfs:comment": "Size of file in bytes.", + "rdfs:label": "FileSize", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -15687,62 +20001,205 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "yearPublished", + "sms:displayName": "fileSize", "sms:required": "sms:false", - "sms:validationRules": [ - "int" - ] + "sms:validationRules": [] }, { - "@id": "bts:FundingAgency", + "@id": "bts:Absent", "@type": "rdfs:Class", - "rdfs:comment": "Refers to the funding organization for the generated resource. This annotation is handled by the DCC.", - "rdfs:label": "FundingAgency", + "rdfs:comment": "TBD", + "rdfs:label": "Absent", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DermalSchwannoma" + }, + { + "@id": "bts:OpticGlioma" + }, + { + "@id": "bts:BreastCancer" + }, + { + "@id": "bts:OtherTumors" + }, + { + "@id": "bts:DiffuseDermalNeurofibromas" + }, + { + "@id": "bts:GIST" + }, + { + "@id": "bts:NonopticGlioma" + }, + { + "@id": "bts:PeripheralNeuropathy" + }, + { + "@id": "bts:Scoliosis" + }, + { + "@id": "bts:IntellectualDisability" + }, + { + "@id": "bts:MPNST" + }, + { + "@id": "bts:AqueductalStenosis" + }, + { + "@id": "bts:IrisLischNodules" + }, + { + "@id": "bts:HeartDefect" + }, + { + "@id": "bts:Pheochromocytoma" + }, + { + "@id": "bts:LearningDisability" + }, + { + "@id": "bts:LenticularOpacity" + }, + { + "@id": "bts:CafeaulaitMacules" + }, + { + "@id": "bts:DermalNeurofibromas" + }, + { + "@id": "bts:LongBoneDysplasia" + }, + { + "@id": "bts:GlomusTumor" + }, + { + "@id": "bts:SphenoidDysplasia" + }, + { + "@id": "bts:SkinFoldFreckling" + }, + { + "@id": "bts:Leukemia" + }, + { + "@id": "bts:SubcutaneousNodularNeurofibromas" + }, + { + "@id": "bts:VascularDisease" + }, + { + "@id": "bts:AttentionDeficitDisorder" + }, + { + "@id": "bts:SpinalNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fundingAgency", + "sms:displayName": "absent", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IntellectualDisability", + "@id": "bts:Present", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Intellectual disability.", - "rdfs:label": "IntellectualDisability", + "rdfs:comment": "TBD", + "rdfs:label": "Present", "rdfs:subClassOf": [ { - "@id": "bts:Thing" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ + "@id": "bts:PlexiformNeurofibromas" + }, { - "@id": "bts:Absent" + "@id": "bts:DermalSchwannoma" }, { - "@id": "bts:Present" + "@id": "bts:BreastCancer" }, { - "@id": "bts:Unknown" + "@id": "bts:OtherTumors" + }, + { + "@id": "bts:GIST" + }, + { + "@id": "bts:NonopticGlioma" + }, + { + "@id": "bts:PeripheralNeuropathy" + }, + { + "@id": "bts:Scoliosis" + }, + { + "@id": "bts:IntellectualDisability" + }, + { + "@id": "bts:MPNST" + }, + { + "@id": "bts:AqueductalStenosis" + }, + { + "@id": "bts:IrisLischNodules" + }, + { + "@id": "bts:HeartDefect" + }, + { + "@id": "bts:Pheochromocytoma" + }, + { + "@id": "bts:LearningDisability" + }, + { + "@id": "bts:LenticularOpacity" + }, + { + "@id": "bts:CafeaulaitMacules" + }, + { + "@id": "bts:LongBoneDysplasia" + }, + { + "@id": "bts:GlomusTumor" + }, + { + "@id": "bts:SphenoidDysplasia" + }, + { + "@id": "bts:SkinFoldFreckling" + }, + { + "@id": "bts:Leukemia" + }, + { + "@id": "bts:VascularDisease" + }, + { + "@id": "bts:AttentionDeficitDisorder" + }, + { + "@id": "bts:NonvestibularCranialSchwannoma" + }, + { + "@id": "bts:GliomaOrEpendymoma" } ], - "sms:displayName": "intellectualDisability", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "present", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PlexiformNeurofibromas", + "@id": "bts:BenefactorId", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Plexiform neurofibromas.", - "rdfs:label": "PlexiformNeurofibromas", + "rdfs:comment": "The id of the resource from which access control is inherited.", + "rdfs:label": "BenefactorId", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -15751,264 +20208,272 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ + "sms:displayName": "benefactorId", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Notimaged", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Notimaged", + "rdfs:subClassOf": [ { - "@id": "bts:Present" + "@id": "bts:SpinalSchwannoma" }, { - "@id": "bts:AbsentbyMRI" + "@id": "bts:SpinalNeurofibromas" }, { - "@id": "bts:Absentclinically-noMRI" + "@id": "bts:VestibularSchwannoma" }, { - "@id": "bts:Unknown" + "@id": "bts:NonvestibularCranialSchwannoma" + }, + { + "@id": "bts:Meningioma" + }, + { + "@id": "bts:GliomaOrEpendymoma" } ], - "sms:displayName": "plexiformNeurofibromas", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "not imaged", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AbsentbyMRI", + "@id": "bts:Absentbyimaging", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AbsentbyMRI", + "rdfs:label": "Absentbyimaging", "rdfs:subClassOf": [ { - "@id": "bts:PlexiformNeurofibromas" + "@id": "bts:SpinalSchwannoma" + }, + { + "@id": "bts:VestibularSchwannoma" + }, + { + "@id": "bts:NonvestibularCranialSchwannoma" + }, + { + "@id": "bts:Meningioma" + }, + { + "@id": "bts:GliomaOrEpendymoma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "absent by MRI", + "sms:displayName": "absent by imaging", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Absentclinically-noMRI", + "@id": "bts:Single", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Absentclinically-noMRI", + "rdfs:label": "Single", "rdfs:subClassOf": [ { - "@id": "bts:PlexiformNeurofibromas" + "@id": "bts:NumberOfSchwannomas" + }, + { + "@id": "bts:SpinalSchwannoma" + }, + { + "@id": "bts:Meningioma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "absent clinically - no MRI", + "sms:displayName": "single", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NucleicAcidSource", + "@id": "bts:Multiple", "@type": "rdfs:Class", - "rdfs:comment": "Source of the extracted nucleic acid used in the experiment", - "rdfs:label": "NucleicAcidSource", + "rdfs:comment": "TBD", + "rdfs:label": "Multiple", "rdfs:subClassOf": [ { - "@id": "bts:Thing" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ - { - "@id": "bts:Bulkcell" - }, - { - "@id": "bts:Bulknuclei" - }, - { - "@id": "bts:Mitochondria" - }, - { - "@id": "bts:Singlecell" + "@id": "bts:SpinalSchwannoma" }, { - "@id": "bts:Singlenucleus" + "@id": "bts:Meningioma" } ], - "sms:displayName": "nucleicAcidSource", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Multiple", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bulkcell", + "@id": "bts:PublicAccess", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bulkcell", + "rdfs:label": "PublicAccess", "rdfs:subClassOf": [ { - "@id": "bts:NucleicAcidSource" + "@id": "bts:AccessType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bulk cell", + "sms:displayName": "Public Access", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bulknuclei", + "@id": "bts:OpenAccess", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bulknuclei", + "rdfs:label": "OpenAccess", "rdfs:subClassOf": [ { - "@id": "bts:NucleicAcidSource" + "@id": "bts:AccessType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bulk nuclei", + "sms:displayName": "Open Access", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mitochondria", + "@id": "bts:ControlledAccess", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mitochondria", + "rdfs:label": "ControlledAccess", "rdfs:subClassOf": [ { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:ProteinExtractSource" + "@id": "bts:AccessType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mitochondria", + "sms:displayName": "Controlled Access", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Singlecell", + "@id": "bts:PrivateAccess", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Singlecell", + "rdfs:label": "PrivateAccess", "rdfs:subClassOf": [ { - "@id": "bts:NucleicAcidSource" + "@id": "bts:AccessType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single cell", + "sms:displayName": "Private Access", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Singlenucleus", + "@id": "bts:Levels1-3", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Singlenucleus", + "rdfs:label": "Levels1-3", "rdfs:subClassOf": [ { - "@id": "bts:NucleicAcidSource" + "@id": "bts:SpinalNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single nucleus", + "sms:displayName": "levels 1-3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MeanCoverage", + "@id": "bts:Alllevels", "@type": "rdfs:Class", - "rdfs:comment": "Mean coverage for whole genome sequencing, or mean target coverage for whole exome and targeted sequencing, collected from Picard Tools", - "rdfs:label": "MeanCoverage", + "rdfs:comment": "TBD", + "rdfs:label": "Alllevels", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:SpinalNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "meanCoverage", + "sms:displayName": "all levels", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Channel", + "@id": "bts:Present-asymptomatic", "@type": "rdfs:Class", - "rdfs:comment": "Color channel used to generate data file.", - "rdfs:label": "Channel", + "rdfs:comment": "TBD", + "rdfs:label": "Present-asymptomatic", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:OpticGlioma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Cy3" - }, - { - "@id": "bts:Cy5" - }, - { - "@id": "bts:NotApplicable" - } - ], - "sms:displayName": "channel", - "sms:required": "sms:true", + "sms:displayName": "present - asymptomatic", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cy3", + "@id": "bts:Present-symptomatic-nottreated", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cy3", + "rdfs:label": "Present-symptomatic-nottreated", "rdfs:subClassOf": [ { - "@id": "bts:Channel" + "@id": "bts:OpticGlioma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cy3", + "sms:displayName": "present - symptomatic - not treated", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cy5", + "@id": "bts:Present-symptomatic-treated", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cy5", + "rdfs:label": "Present-symptomatic-treated", "rdfs:subClassOf": [ { - "@id": "bts:Channel" + "@id": "bts:OpticGlioma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cy5", + "sms:displayName": "present - symptomatic - treated", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenePerturbed", + "@id": "bts:CreatedOn", "@type": "rdfs:Class", - "rdfs:comment": "The HUGO gene symbol for the gene that is perturbed.", - "rdfs:label": "GenePerturbed", + "rdfs:comment": "Refers to when the resource was created.", + "rdfs:label": "CreatedOn", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -16017,15 +20482,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genePerturbed", + "sms:displayName": "createdOn", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Type", + "@id": "bts:SlideVersion", "@type": "rdfs:Class", - "rdfs:comment": "Refers to the type of the resource on the platform, e.g. “file”.", - "rdfs:label": "Type", + "rdfs:comment": "Version of imaging slide used. Slide version is critical for the analysis of the sequencing data as different slides have different capture area layouts.", + "rdfs:label": "SlideVersion", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -16034,855 +20499,753 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "type", + "schema:rangeIncludes": [ + { + "@id": "bts:V1" + }, + { + "@id": "bts:V2" + }, + { + "@id": "bts:V3" + }, + { + "@id": "bts:V4" + } + ], + "sms:displayName": "slideVersion", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Etag", + "@id": "bts:V1", "@type": "rdfs:Class", - "rdfs:comment": "Synapse employs an Optimistic Concurrency Control (OCC) scheme to handle concurrent updates. The E-Tag changes every time an entity is updated it is used to detect when a client's current representation of an entity is out-of-date.", - "rdfs:label": "Etag", + "rdfs:comment": "TBD", + "rdfs:label": "V1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:SlideVersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "etag", + "sms:displayName": "V1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RuntimePlatform", + "@id": "bts:V2", "@type": "rdfs:Class", - "rdfs:comment": "Runtime platform or script interpreter dependencies (e.g. Java v1, Python 2.3).", - "rdfs:label": "RuntimePlatform", + "rdfs:comment": "TBD", + "rdfs:label": "V2", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:SlideVersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "runtimePlatform", + "sms:displayName": "V2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MPNST", + "@id": "bts:V3", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MPNST", + "rdfs:label": "V3", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:SlideVersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "MPNST", + "sms:displayName": "V3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1SomaticMutation", + "@id": "bts:V4", "@type": "rdfs:Class", - "rdfs:comment": "NF1 somatic mutation, i.e. in tumor samples.", - "rdfs:label": "Nf1SomaticMutation", + "rdfs:comment": "TBD", + "rdfs:label": "V4", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:SlideVersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nf1SomaticMutation", + "sms:displayName": "V4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Manifestation", + "@id": "bts:-/-", "@type": "rdfs:Class", - "rdfs:comment": "An associated phenotype characteristic.", - "rdfs:label": "Manifestation", + "rdfs:comment": "TBD", + "rdfs:label": "-/-", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "manifestation", + "sms:displayName": "-/-", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AqueductalStenosis", + "@id": "bts:+/-", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of aqueductal stenosis.", - "rdfs:label": "AqueductalStenosis", + "rdfs:comment": "TBD", + "rdfs:label": "+/-", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "aqueductalStenosis", + "sms:displayName": "+/-", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IrisLischNodules", + "@id": "bts:+/+", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Iris Lisch Nodules.", - "rdfs:label": "IrisLischNodules", + "rdfs:comment": "TBD", + "rdfs:label": "+/+", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Nf1Genotype" + }, + { + "@id": "bts:Nf2Genotype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "IrisLischNodules", + "sms:displayName": "+/+", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ConcentrationNaCl", + "@id": "bts:Neurofibromatosistype1", "@type": "rdfs:Class", - "rdfs:comment": "Numeric value for NaCl concentration", - "rdfs:label": "ConcentrationNaCl", + "rdfs:comment": "TBD", + "rdfs:label": "Neurofibromatosistype1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "concentrationNaCl", + "sms:displayName": "Neurofibromatosis type 1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ResourceType", + "@id": "bts:Schwannomatosis", "@type": "rdfs:Class", - "rdfs:comment": "The type of resource being stored and annotated", - "rdfs:label": "ResourceType", + "rdfs:comment": "TBD", + "rdfs:label": "Schwannomatosis", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:ExperimentalData" - }, - { - "@id": "bts:Result" - }, - { - "@id": "bts:Tool" - }, - { - "@id": "bts:Workflowreport" - }, - { - "@id": "bts:Report" - }, - { - "@id": "bts:Metadata" - }, - { - "@id": "bts:Protocol" - }, - { - "@id": "bts:Weblink" - } - ], - "sms:displayName": "resourceType", - "sms:required": "sms:true", + "sms:displayName": "Schwannomatosis", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ExperimentalData", + "@id": "bts:NF2-relatedschwannomatosis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ExperimentalData", + "rdfs:label": "NF2-relatedschwannomatosis", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "experimentalData", + "sms:displayName": "NF2-related schwannomatosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Result", + "@id": "bts:SMARCB1-relatedschwannomatosis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Result", + "rdfs:label": "SMARCB1-relatedschwannomatosis", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "result", + "sms:displayName": "SMARCB1-related schwannomatosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tool", + "@id": "bts:LZTR1-relatedschwannomatosis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tool", + "rdfs:label": "LZTR1-relatedschwannomatosis", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tool", + "sms:displayName": "LZTR1-related schwannomatosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Workflowreport", + "@id": "bts:22q-relatedschwannomatosis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Workflowreport", + "rdfs:label": "22q-relatedschwannomatosis", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "workflow report", + "sms:displayName": "22q-related schwannomatosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Report", + "@id": "bts:Schwannomatosis-NOS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Report", + "rdfs:label": "Schwannomatosis-NOS", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "report", + "sms:displayName": "Schwannomatosis-NOS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Protocol", + "@id": "bts:Schwannomatosis-NEC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Protocol", + "rdfs:label": "Schwannomatosis-NEC", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "protocol", + "sms:displayName": "Schwannomatosis-NEC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Weblink", + "@id": "bts:SporadicSchwannoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Weblink", + "rdfs:label": "SporadicSchwannoma", "rdfs:subClassOf": [ { - "@id": "bts:ResourceType" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "weblink", + "sms:displayName": "Sporadic Schwannoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DissociationMethod", + "@id": "bts:NoonanSyndrome", "@type": "rdfs:Class", - "rdfs:comment": "Procedure by which a biological specimen is dissociated into individual cells or a cell suspension", - "rdfs:label": "DissociationMethod", + "rdfs:comment": "TBD", + "rdfs:label": "NoonanSyndrome", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Diagnosis" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:10xV2" - }, + "sms:displayName": "Noonan Syndrome", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:NotApplicable", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NotApplicable", + "rdfs:subClassOf": [ { - "@id": "bts:FACS" + "@id": "bts:Channel" }, { - "@id": "bts:FluidigmC1" + "@id": "bts:Sex" }, { - "@id": "bts:Drop-seq" + "@id": "bts:LibraryStrand" }, { - "@id": "bts:InDrop" + "@id": "bts:Diagnosis" }, { - "@id": "bts:Mouthpipette" + "@id": "bts:ProgressReportNumber" }, { - "@id": "bts:Enzymatic" + "@id": "bts:TumorType" }, { - "@id": "bts:Mechanical" - } - ], - "sms:displayName": "dissociationMethod", - "sms:required": "sms:false", - "sms:validationRules": [] - }, - { - "@id": "bts:10xV2", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "10xV2", - "rdfs:subClassOf": [ - { - "@id": "bts:DissociationMethod" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "10x_v2", + "sms:displayName": "Not Applicable", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FACS", + "@id": "bts:10x", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FACS", + "rdfs:label": "10x", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FACS", + "sms:displayName": "10x", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FluidigmC1", + "@id": "bts:CEL-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FluidigmC1", + "rdfs:label": "CEL-seq", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Fluidigm C1", + "sms:displayName": "CEL-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Drop-seq", + "@id": "bts:Drop-Seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Drop-seq", + "rdfs:label": "Drop-Seq", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "drop-seq", + "sms:displayName": "Drop-Seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:InDrop", + "@id": "bts:GTAC@WUSTLin-houseprep", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "InDrop", + "rdfs:label": "GTAC@WUSTLin-houseprep", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "inDrop", + "sms:displayName": "GTAC@WUSTL in-house prep", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mouthpipette", + "@id": "bts:IDTxGenExomeResearchPanel", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mouthpipette", + "rdfs:label": "IDTxGenExomeResearchPanel", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mouth pipette", + "sms:displayName": "IDT xGen Exome Research Panel", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Enzymatic", + "@id": "bts:IlluminaTruSeqDNANano", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Enzymatic", + "rdfs:label": "IlluminaTruSeqDNANano", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "enzymatic", + "sms:displayName": "Illumina TruSeq DNA Nano", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mechanical", + "@id": "bts:IlluminaTn5Transposase", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mechanical", + "rdfs:label": "IlluminaTn5Transposase", "rdfs:subClassOf": [ { - "@id": "bts:DissociationMethod" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mechanical", + "sms:displayName": "Illumina Tn5 Transposase", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MaterialType", + "@id": "bts:IlluminaRibo-ZeroPlus", "@type": "rdfs:Class", - "rdfs:comment": "Type of material in the characterization", - "rdfs:label": "MaterialType", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaRibo-ZeroPlus", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Nanoparticles" - }, - { - "@id": "bts:Polymericnanoparticles" - }, - { - "@id": "bts:Smallmolecule" - }, - { - "@id": "bts:DNA" - } - ], - "sms:displayName": "materialType", + "sms:displayName": "Illumina Ribo-Zero Plus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nanoparticles", + "@id": "bts:KAPAHyperPrepKitPCR-free", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nanoparticles", + "rdfs:label": "KAPAHyperPrepKitPCR-free", "rdfs:subClassOf": [ { - "@id": "bts:MaterialType" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nanoparticles", + "sms:displayName": "KAPA HyperPrep Kit PCR-free", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Polymericnanoparticles", + "@id": "bts:KAPARNAHyperPrepKitwithRiboErase(HMR)", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Polymericnanoparticles", + "rdfs:label": "KAPARNAHyperPrepKitwithRiboErase(HMR)", "rdfs:subClassOf": [ { - "@id": "bts:MaterialType" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Polymeric nanoparticles", + "sms:displayName": "KAPA RNA HyperPrep Kit with RiboErase (HMR)", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Smallmolecule", + "@id": "bts:KAPAmRNAHyperPrepKit", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Smallmolecule", + "rdfs:label": "KAPAmRNAHyperPrepKit", "rdfs:subClassOf": [ { - "@id": "bts:MaterialType" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "small molecule", + "sms:displayName": "KAPA mRNA HyperPrep Kit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DNA", + "@id": "bts:NEBNextmRNALibraryPrepReagentSetforIllumina", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DNA", + "rdfs:label": "NEBNextmRNALibraryPrepReagentSetforIllumina", "rdfs:subClassOf": [ { - "@id": "bts:MaterialType" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DNA", + "sms:displayName": "NEBNext mRNA Library Prep Reagent Set for Illumina", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AuxiliaryAsset", + "@id": "bts:Omni-ATAC", "@type": "rdfs:Class", - "rdfs:comment": "URI to supplemental asset(s), e.g. QC reports or other auxiliary files to support the processing, analysis, or interpretation of the current entity.\n", - "rdfs:label": "AuxiliaryAsset", + "rdfs:comment": "TBD", + "rdfs:label": "Omni-ATAC", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "auxiliaryAsset", + "sms:displayName": "Omni-ATAC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HeartDefect", + "@id": "bts:QuantSeqFWDV2withUDI", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Heart defect.", - "rdfs:label": "HeartDefect", + "rdfs:comment": "TBD", + "rdfs:label": "QuantSeqFWDV2withUDI", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "heartDefect", + "sms:displayName": "QuantSeq FWD V2 with UDI", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Doi", + "@id": "bts:Smart-seq2", "@type": "rdfs:Class", - "rdfs:comment": "Digital object identifier of the resource.", - "rdfs:label": "Doi", + "rdfs:comment": "TBD", + "rdfs:label": "Smart-seq2", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "doi", + "sms:displayName": "Smart-seq2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReadsDuplicatedPercent", + "@id": "bts:Smart-seq4", "@type": "rdfs:Class", - "rdfs:comment": "Percent of duplicated reads collected from samtools", - "rdfs:label": "ReadsDuplicatedPercent", + "rdfs:comment": "TBD", + "rdfs:label": "Smart-seq4", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "readsDuplicatedPercent", + "sms:displayName": "Smart-seq4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pheochromocytoma", + "@id": "bts:TruSeq", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Pheochromocytoma.", - "rdfs:label": "Pheochromocytoma", + "rdfs:comment": "TBD", + "rdfs:label": "TruSeq", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "pheochromocytoma", + "sms:displayName": "TruSeq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsMultiSpecimen", + "@id": "bts:TruSeqstandardtotalRNAlibrarykit", "@type": "rdfs:Class", - "rdfs:comment": "Whether or not a file has data for multiple specimens (Yes; No)", - "rdfs:label": "IsMultiSpecimen", + "rdfs:comment": "TBD", + "rdfs:label": "TruSeqstandardtotalRNAlibrarykit", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Yes" - }, - { - "@id": "bts:No" - } - ], - "sms:displayName": "isMultiSpecimen", + "sms:displayName": "TruSeq standard total RNA library kit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MRISequence", + "@id": "bts:OxfordNanoporeDirectRNASequencingKit", "@type": "rdfs:Class", - "rdfs:comment": "A mode used in MRI imaging", - "rdfs:label": "MRISequence", + "rdfs:comment": "TBD", + "rdfs:label": "OxfordNanoporeDirectRNASequencingKit", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:PD-weighted" - }, - { - "@id": "bts:ShortTauInversionRecovery" - }, - { - "@id": "bts:T1-weighted" - }, - { - "@id": "bts:T2-weighted" - } - ], - "sms:displayName": "MRISequence", + "sms:displayName": "Oxford Nanopore Direct RNA Sequencing Kit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PD-weighted", + "@id": "bts:QIAseqFXDNALibraryKit", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PD-weighted", + "rdfs:label": "QIAseqFXDNALibraryKit", "rdfs:subClassOf": [ { - "@id": "bts:MRISequence" + "@id": "bts:LibraryPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PD-weighted", + "sms:displayName": "QIAseq FX DNA Library Kit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ShortTauInversionRecovery", + "@id": "bts:Publisher", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ShortTauInversionRecovery", + "rdfs:comment": "An entity responsible for making the resource available.", + "rdfs:label": "Publisher", "rdfs:subClassOf": [ { - "@id": "bts:MRISequence" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Short Tau Inversion Recovery", + "sms:displayName": "publisher", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:T1-weighted", + "@id": "bts:Male", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "T1-weighted", + "rdfs:label": "Male", "rdfs:subClassOf": [ { - "@id": "bts:MRISequence" + "@id": "bts:Sex" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "T1-weighted", + "sms:displayName": "Male", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:T2-weighted", + "@id": "bts:Female", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "T2-weighted", + "rdfs:label": "Female", "rdfs:subClassOf": [ { - "@id": "bts:MRISequence" + "@id": "bts:Sex" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "T2-weighted", + "sms:displayName": "Female", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DatasetSizeInBytes", + "@id": "bts:CreatedBy", "@type": "rdfs:Class", - "rdfs:comment": "Size of dataset entity in bytes. Auto-calculated by Synapse.", - "rdfs:label": "DatasetSizeInBytes", + "rdfs:comment": "Refers to the user who created the resource.", + "rdfs:label": "CreatedBy", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -16891,266 +21254,254 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "datasetSizeInBytes", + "sms:displayName": "createdBy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DiagnosisAgeGroup", + "@id": "bts:Notaproblem", "@type": "rdfs:Class", - "rdfs:comment": "Age group of the individual at the time of diagnosis.", - "rdfs:label": "DiagnosisAgeGroup", + "rdfs:comment": "TBD", + "rdfs:label": "Notaproblem", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:PainStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Infancy" - }, - { - "@id": "bts:Childhood" - }, - { - "@id": "bts:Adolescence" - }, - { - "@id": "bts:Adulthood" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "diagnosisAgeGroup", + "sms:displayName": "not a problem", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Infancy", + "@id": "bts:Occasional", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Infancy", + "rdfs:label": "Occasional", "rdfs:subClassOf": [ { - "@id": "bts:DiagnosisAgeGroup" + "@id": "bts:PainStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "infancy", + "sms:displayName": "occasional", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Childhood", + "@id": "bts:Disabling", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Childhood", + "rdfs:label": "Disabling", "rdfs:subClassOf": [ { - "@id": "bts:DiagnosisAgeGroup" + "@id": "bts:PainStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "childhood", + "sms:displayName": "disabling", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Adolescence", + "@id": "bts:InChIKey", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Adolescence", + "rdfs:comment": "//pubchem.ncbi.nlm.nih.gov/compound/10127622#section=InChI-Key). This is a more reliable identifier than the compound name and should be used if available.\n", + "rdfs:label": "InChIKey", "rdfs:subClassOf": [ { - "@id": "bts:DiagnosisAgeGroup" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "adolescence", + "sms:displayName": "InChIKey", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Adulthood", + "@id": "bts:FileCount", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Adulthood", + "rdfs:comment": "Number of files in the resource collection.", + "rdfs:label": "FileCount", "rdfs:subClassOf": [ { - "@id": "bts:DiagnosisAgeGroup" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "adulthood", + "sms:displayName": "fileCount", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:YearProcessed", + "@id": "bts:Nospecifictherapy", "@type": "rdfs:Class", - "rdfs:comment": "Year in which the resource was processed/derived, if applicable. This is only required for data processed by NF-OSI for tracking purposes, optional for community-contributed datasets. \n", - "rdfs:label": "YearProcessed", + "rdfs:comment": "TBD", + "rdfs:label": "Nospecifictherapy", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:TumorTreatmentStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "yearProcessed", + "sms:displayName": "no specific therapy", "sms:required": "sms:false", - "sms:validationRules": [ - "int" - ] + "sms:validationRules": [] }, { - "@id": "bts:ReferenceSequence", + "@id": "bts:Chemotherapy", "@type": "rdfs:Class", - "rdfs:comment": "Syntactic sequences that has a role as reference of an annotation.", - "rdfs:label": "ReferenceSequence", + "rdfs:comment": "TBD", + "rdfs:label": "Chemotherapy", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:TumorTreatmentStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "referenceSequence", + "sms:displayName": "chemotherapy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Title", + "@id": "bts:Surgery", "@type": "rdfs:Class", - "rdfs:comment": "Title of a resource.", - "rdfs:label": "Title", + "rdfs:comment": "TBD", + "rdfs:label": "Surgery", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:TumorTreatmentStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "title", - "sms:required": "sms:true", + "sms:displayName": "surgery", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Documentation", + "@id": "bts:Radiation", "@type": "rdfs:Class", - "rdfs:comment": "URL to any documentation describing the resource and its use.", - "rdfs:label": "Documentation", + "rdfs:comment": "TBD", + "rdfs:label": "Radiation", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:TumorTreatmentStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "documentation", + "sms:displayName": "radiation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RelatedDataset", + "@id": "bts:Targetedtherapy", "@type": "rdfs:Class", - "rdfs:comment": "Reference to a relevant dataset entity.", - "rdfs:label": "RelatedDataset", + "rdfs:comment": "TBD", + "rdfs:label": "Targetedtherapy", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:TumorTreatmentStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "relatedDataset", + "sms:displayName": "targeted therapy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Inheritance", + "@id": "bts:Clinicaltrial", "@type": "rdfs:Class", - "rdfs:comment": "Describes whether known inheritance from a parent.", - "rdfs:label": "Inheritance", + "rdfs:comment": "TBD", + "rdfs:label": "Clinicaltrial", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:TumorTreatmentStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Parentaffected" - }, - { - "@id": "bts:Parentnotaffected" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "inheritance", + "sms:displayName": "clinical trial", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Parentaffected", + "@id": "bts:Scattered", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Parentaffected", + "rdfs:label": "Scattered", "rdfs:subClassOf": [ { - "@id": "bts:Inheritance" + "@id": "bts:DiffuseDermalNeurofibromas" + }, + { + "@id": "bts:NumberOfSchwannomas" + }, + { + "@id": "bts:DermalNeurofibromas" + }, + { + "@id": "bts:SubcutaneousNodularNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "parent affected", + "sms:displayName": "scattered", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Parentnotaffected", + "@id": "bts:Dense", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Parentnotaffected", + "rdfs:label": "Dense", "rdfs:subClassOf": [ { - "@id": "bts:Inheritance" + "@id": "bts:DiffuseDermalNeurofibromas" + }, + { + "@id": "bts:NumberOfSchwannomas" + }, + { + "@id": "bts:DermalNeurofibromas" + }, + { + "@id": "bts:SubcutaneousNodularNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "parent not affected", + "sms:displayName": "dense", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ConcentrationMaterialUnit", + "@id": "bts:ReadStrandOrigin", "@type": "rdfs:Class", - "rdfs:comment": "Unit used for the material concentration, e.g. mg/mL", - "rdfs:label": "ConcentrationMaterialUnit", + "rdfs:comment": "The strand from which the read originates in a strand-specific protocol", + "rdfs:label": "ReadStrandOrigin", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -17161,736 +21512,680 @@ }, "schema:rangeIncludes": [ { - "@id": "bts:Mg/mL" - }, - { - "@id": "bts:MM" + "@id": "bts:Forward" }, { - "@id": "bts:Particles/mL" + "@id": "bts:Reverse" } ], - "sms:displayName": "concentrationMaterialUnit", + "sms:displayName": "readStrandOrigin", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mg/mL", + "@id": "bts:Forward", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mg/mL", + "rdfs:label": "Forward", "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationMaterialUnit" - }, - { - "@id": "bts:ConcentrationNaClUnit" + "@id": "bts:ReadStrandOrigin" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mg/mL", + "sms:displayName": "forward", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MM", + "@id": "bts:Reverse", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MM", + "rdfs:label": "Reverse", "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationMaterialUnit" - }, - { - "@id": "bts:ConcentrationNaClUnit" + "@id": "bts:ReadStrandOrigin" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mM", + "sms:displayName": "reverse", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Particles/mL", + "@id": "bts:Seconds", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Particles/mL", + "rdfs:label": "Seconds", "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationMaterialUnit" + "@id": "bts:AgeUnit" }, { - "@id": "bts:ConcentrationNaClUnit" + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "particles/mL", + "sms:displayName": "seconds", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProportionCoverage10x", + "@id": "bts:Minutes", "@type": "rdfs:Class", - "rdfs:comment": "Proportion of all reference bases for whole genome sequencing, or targeted bases for whole exome and targeted sequencing, that achieves 10X or greater coverage from Picard Tools", - "rdfs:label": "ProportionCoverage10x", + "rdfs:comment": "TBD", + "rdfs:label": "Minutes", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "proportionCoverage10x", + "sms:displayName": "minutes", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:StudyName", + "@id": "bts:Hours", "@type": "rdfs:Class", - "rdfs:comment": "Name of a study.", - "rdfs:label": "StudyName", + "rdfs:comment": "TBD", + "rdfs:label": "Hours", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "studyName", - "sms:required": "sms:true", + "sms:displayName": "hours", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LibraryID", + "@id": "bts:Days", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LibraryID", + "rdfs:label": "Days", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "libraryID", + "sms:displayName": "days", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Author", + "@id": "bts:Weeks", "@type": "rdfs:Class", - "rdfs:comment": "The author of the resource; preferably use an ORCID ID, GitHub profile link, etc., if available and a text name if not.", - "rdfs:label": "Author", + "rdfs:comment": "TBD", + "rdfs:label": "Weeks", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "author", + "sms:displayName": "weeks", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Summary", + "@id": "bts:Months", "@type": "rdfs:Class", - "rdfs:comment": "A short description (an abstract).", - "rdfs:label": "Summary", + "rdfs:comment": "TBD", + "rdfs:label": "Months", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "summary", - "sms:required": "sms:true", + "sms:displayName": "months", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsPrimaryCell", + "@id": "bts:Years", "@type": "rdfs:Class", - "rdfs:comment": "Whether or not cellType is primary (Yes; No)", - "rdfs:label": "IsPrimaryCell", + "rdfs:comment": "TBD", + "rdfs:label": "Years", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:AgeUnit" + }, + { + "@id": "bts:TimepointUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Yes" - }, - { - "@id": "bts:No" - } - ], - "sms:displayName": "isPrimaryCell", + "sms:displayName": "years", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Citation", + "@id": "bts:1", "@type": "rdfs:Class", - "rdfs:comment": "Citation (e.g. doi) that usage of data or resource should be cited with.", - "rdfs:label": "Citation", + "rdfs:comment": "TBD", + "rdfs:label": "1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProgressReportNumber" + }, + { + "@id": "bts:WHOPerformanceStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "citation", + "sms:displayName": "1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SampleType", + "@id": "bts:2", "@type": "rdfs:Class", - "rdfs:comment": "Type of sample used", - "rdfs:label": "SampleType", + "rdfs:comment": "TBD", + "rdfs:label": "2", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProgressReportNumber" + }, + { + "@id": "bts:WHOPerformanceStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sampleType", + "sms:displayName": "2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RecordingSource", + "@id": "bts:3", "@type": "rdfs:Class", - "rdfs:comment": "Source of electrophysiology recording.", - "rdfs:label": "RecordingSource", + "rdfs:comment": "TBD", + "rdfs:label": "3", "rdfs:subClassOf": [ { - "@id": "bts:Thing" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ - { - "@id": "bts:Electrode" - }, - { - "@id": "bts:Tetrode" - }, - { - "@id": "bts:Shank" - }, - { - "@id": "bts:Utaharray" + "@id": "bts:ProgressReportNumber" }, { - "@id": "bts:Otherelectrodearray" + "@id": "bts:WHOPerformanceStatus" } ], - "sms:displayName": "recordingSource", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Electrode", + "@id": "bts:4", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Electrode", + "rdfs:label": "4", "rdfs:subClassOf": [ { - "@id": "bts:RecordingSource" + "@id": "bts:ProgressReportNumber" + }, + { + "@id": "bts:WHOPerformanceStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "electrode", + "sms:displayName": "4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tetrode", + "@id": "bts:5", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tetrode", + "rdfs:label": "5", "rdfs:subClassOf": [ { - "@id": "bts:RecordingSource" + "@id": "bts:ProgressReportNumber" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tetrode", + "sms:displayName": "5", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Shank", + "@id": "bts:6", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Shank", + "rdfs:label": "6", "rdfs:subClassOf": [ { - "@id": "bts:RecordingSource" + "@id": "bts:ProgressReportNumber" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "shank", + "sms:displayName": "6", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Utaharray", + "@id": "bts:7", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Utaharray", + "rdfs:label": "7", "rdfs:subClassOf": [ { - "@id": "bts:RecordingSource" + "@id": "bts:ProgressReportNumber" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Utah array", + "sms:displayName": "7", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Otherelectrodearray", + "@id": "bts:8", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Otherelectrodearray", + "rdfs:label": "8", "rdfs:subClassOf": [ { - "@id": "bts:RecordingSource" + "@id": "bts:ProgressReportNumber" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "other electrode array", + "sms:displayName": "8", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Workflow", + "@id": "bts:9", "@type": "rdfs:Class", - "rdfs:comment": "Name and version of the workflow used to generate/analyze the data", - "rdfs:label": "Workflow", + "rdfs:comment": "TBD", + "rdfs:label": "9", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProgressReportNumber" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:CNVkit" - }, - { - "@id": "bts:DeepVariant" - }, - { - "@id": "bts:DESeq2" - }, - { - "@id": "bts:FastQC" - }, - { - "@id": "bts:FreeBayes" - }, - { - "@id": "bts:GATKBaseRecalibration" - }, - { - "@id": "bts:GATKMarkDuplicates" - }, - { - "@id": "bts:MultiQC" - }, - { - "@id": "bts:Mutect2" - }, - { - "@id": "bts:Sarek" - }, - { - "@id": "bts:STARandSalmon" - }, - { - "@id": "bts:Strelka2" - }, - { - "@id": "bts:StringTie" - }, - { - "@id": "bts:TrimGalore" - } - ], - "sms:displayName": "workflow", + "sms:displayName": "9", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:WorkflowLink" - } - ], "sms:validationRules": [] }, { - "@id": "bts:CNVkit", + "@id": "bts:10", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNVkit", + "rdfs:label": "10", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:ProgressReportNumber" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CNVkit", + "sms:displayName": "10", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DeepVariant", + "@id": "bts:Freshcollected", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DeepVariant", + "rdfs:label": "Freshcollected", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DeepVariant", + "sms:displayName": "Fresh collected", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DESeq2", + "@id": "bts:Flashfrozen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DESeq2", + "rdfs:label": "Flashfrozen", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DESeq2", + "sms:displayName": "Flash frozen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FastQC", + "@id": "bts:FFPE", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FastQC", + "rdfs:label": "FFPE", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FastQC", + "sms:displayName": "FFPE", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FreeBayes", + "@id": "bts:Cryopreserved", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FreeBayes", + "rdfs:label": "Cryopreserved", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FreeBayes", + "sms:displayName": "Cryopreserved", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GATKBaseRecalibration", + "@id": "bts:OCT", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GATKBaseRecalibration", + "rdfs:label": "OCT", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GATK BaseRecalibration", + "sms:displayName": "OCT", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GATKMarkDuplicates", + "@id": "bts:RNAlater", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GATKMarkDuplicates", + "rdfs:label": "RNAlater", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GATK MarkDuplicates", + "sms:displayName": "RNAlater", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MultiQC", + "@id": "bts:Formalin-fixed", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MultiQC", + "rdfs:label": "Formalin-fixed", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MultiQC", + "sms:displayName": "formalin-fixed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mutect2", + "@id": "bts:Ethanol", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mutect2", + "rdfs:label": "Ethanol", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mutect2", + "sms:displayName": "ethanol", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sarek", + "@id": "bts:Viablyfrozen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sarek", + "rdfs:label": "Viablyfrozen", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:SpecimenPreparationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Sarek", + "sms:displayName": "Viably frozen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:STARandSalmon", + "@id": "bts:IsMultiIndividual", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "STARandSalmon", + "rdfs:comment": "Whether or not a file has data for multiple individuals (Yes; No)", + "rdfs:label": "IsMultiIndividual", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "STAR and Salmon", + "schema:rangeIncludes": [ + { + "@id": "bts:Yes" + }, + { + "@id": "bts:No" + } + ], + "sms:displayName": "isMultiIndividual", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Strelka2", + "@id": "bts:FirstStranded", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Strelka2", + "rdfs:label": "FirstStranded", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:LibraryStrand" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Strelka2", + "sms:displayName": "FirstStranded", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StringTie", + "@id": "bts:SecondStranded", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "StringTie", + "rdfs:label": "SecondStranded", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:LibraryStrand" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "StringTie", + "sms:displayName": "SecondStranded", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TrimGalore", + "@id": "bts:Unstranded", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TrimGalore", + "rdfs:label": "Unstranded", "rdfs:subClassOf": [ { - "@id": "bts:Workflow" + "@id": "bts:LibraryStrand" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TrimGalore", + "sms:displayName": "Unstranded", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WorkflowLink", + "@id": "bts:Air", "@type": "rdfs:Class", - "rdfs:comment": "Workflow URL reference", - "rdfs:label": "WorkflowLink", + "rdfs:comment": "TBD", + "rdfs:label": "Air", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Immersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "workflowLink", + "sms:displayName": "air", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PH", + "@id": "bts:Oil", "@type": "rdfs:Class", - "rdfs:comment": "Numeric value for pH (range 0-14)", - "rdfs:label": "PH", + "rdfs:comment": "TBD", + "rdfs:label": "Oil", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Immersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pH", + "sms:displayName": "oil", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:PairsOnDifferentChr", + "@id": "bts:Water", "@type": "rdfs:Class", - "rdfs:comment": "Pairs on different chromosomes collected from samtools", - "rdfs:label": "PairsOnDifferentChr", + "rdfs:comment": "TBD", + "rdfs:label": "Water", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Immersion" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pairsOnDifferentChr", + "sms:displayName": "water", "sms:required": "sms:false", - "sms:validationRules": [ - "int" - ] + "sms:validationRules": [] }, { - "@id": "bts:ConcentrationNaClUnit", + "@id": "bts:Other", "@type": "rdfs:Class", - "rdfs:comment": "Unit used for the NaCl concentration, e.g. mM", - "rdfs:label": "ConcentrationNaClUnit", + "rdfs:comment": "TBD", + "rdfs:label": "Other", "rdfs:subClassOf": [ { - "@id": "bts:Thing" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ - { - "@id": "bts:Mg/mL" + "@id": "bts:DataCollectionMode" }, { - "@id": "bts:MM" + "@id": "bts:Immersion" }, { - "@id": "bts:Particles/mL" + "@id": "bts:ExpressionUnit" } ], - "sms:displayName": "concentrationNaClUnit", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Other", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TransplantationRecipientTissue", + "@id": "bts:CaptureArea", "@type": "rdfs:Class", - "rdfs:comment": "Tissue into which a xenograph sample is transplanted", - "rdfs:label": "TransplantationRecipientTissue", + "rdfs:comment": " A1, B1, C1, D1 for Visium slides with 6.5 mm Capture Area and A, B for CytAssist slides with 11 mm Capture Area. Both CytAssist slides with 6.5 mm Capture Area and Gateway Slides contain only two slide areas, A1 and D1.\n", + "rdfs:label": "CaptureArea", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -17901,573 +22196,521 @@ }, "schema:rangeIncludes": [ { - "@id": "bts:Cerebralcortex" - }, - { - "@id": "bts:Bonemarrow" - }, - { - "@id": "bts:Plasma" - }, - { - "@id": "bts:DorsalRootGanglion" - }, - { - "@id": "bts:Opticnerve" - }, - { - "@id": "bts:Tumor-adjacentnormal" - }, - { - "@id": "bts:Serum" - }, - { - "@id": "bts:Spheroid" - }, - { - "@id": "bts:Sciaticnerve" - }, - { - "@id": "bts:Meninges" - }, - { - "@id": "bts:Nervetissue" - }, - { - "@id": "bts:BuccalMucosa" - }, - { - "@id": "bts:Embryonictissue" - }, - { - "@id": "bts:Wholebrain" - }, - { - "@id": "bts:Microtissue" - }, - { - "@id": "bts:Retina" - }, - { - "@id": "bts:CDXtissue" + "@id": "bts:A" }, { - "@id": "bts:Organoid" + "@id": "bts:B" }, { - "@id": "bts:Splenocyte" + "@id": "bts:C" }, { - "@id": "bts:Blood" + "@id": "bts:D" }, { - "@id": "bts:Connectivetissue" + "@id": "bts:A1" }, { - "@id": "bts:Primarytumor" + "@id": "bts:B1" }, { - "@id": "bts:PDXtissue" + "@id": "bts:C1" }, { - "@id": "bts:BuffyCoat" + "@id": "bts:D1" } ], - "sms:displayName": "transplantationRecipientTissue", + "sms:displayName": "captureArea", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cerebralcortex", + "@id": "bts:A", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cerebralcortex", + "rdfs:label": "A", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:CaptureArea" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cerebral cortex", + "sms:displayName": "A", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bonemarrow", + "@id": "bts:B", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bonemarrow", + "rdfs:label": "B", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:Organ" + "@id": "bts:CaptureArea" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bone marrow", + "sms:displayName": "B", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Plasma", + "@id": "bts:D", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Plasma", + "rdfs:label": "D", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:CaptureArea" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "plasma", + "sms:displayName": "D", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DorsalRootGanglion", + "@id": "bts:A1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DorsalRootGanglion", + "rdfs:label": "A1", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:CaptureArea" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Dorsal Root Ganglion", + "sms:displayName": "A1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Opticnerve", + "@id": "bts:B1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Opticnerve", + "rdfs:label": "B1", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, + "@id": "bts:CaptureArea" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "B1", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:C1", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "C1", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:CaptureArea" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "optic nerve", + "sms:displayName": "C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tumor-adjacentnormal", + "@id": "bts:D1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tumor-adjacentnormal", + "rdfs:label": "D1", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, + "@id": "bts:CaptureArea" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "D1", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Braingrowthmeasurement", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Braingrowthmeasurement", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:ExperimentalFactor" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "tumor-adjacent normal", + "sms:displayName": "brain growth measurement", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Serum", + "@id": "bts:Brainvolumemeasurement", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Serum", + "rdfs:label": "Brainvolumemeasurement", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, + "@id": "bts:ExperimentalFactor" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "brain volume measurement", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Bodyweight", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Bodyweight", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:ExperimentalFactor" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "serum", + "sms:displayName": "body weight", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Spheroid", + "@id": "bts:Clinicallaboratorymeasurement", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Spheroid", + "rdfs:label": "Clinicallaboratorymeasurement", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, + "@id": "bts:ExperimentalFactor" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "clinical laboratory measurement", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Cognitivefunctionmeasurement", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Cognitivefunctionmeasurement", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:ExperimentalFactor" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "spheroid", + "sms:displayName": "cognitive function measurement", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sciaticnerve", + "@id": "bts:Gaitmeasurement", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sciaticnerve", + "rdfs:label": "Gaitmeasurement", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" + "@id": "bts:ExperimentalFactor" }, { - "@id": "bts:SpecimenType" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sciatic nerve", + "sms:displayName": "gait measurement", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Meninges", + "@id": "bts:Motordevelopmentmeasurement", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Meninges", + "rdfs:label": "Motordevelopmentmeasurement", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:ExperimentalFactor" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "meninges", + "sms:displayName": "motor development measurement", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nervetissue", + "@id": "bts:Painmeasurement", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nervetissue", + "rdfs:label": "Painmeasurement", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:ExperimentalFactor" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nerve tissue", + "sms:displayName": "pain measurement", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BuccalMucosa", + "@id": "bts:<5thcentile", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BuccalMucosa", + "rdfs:label": "<5thcentile", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:Stature" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Buccal Mucosa", + "sms:displayName": "< 5th centile", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Embryonictissue", + "@id": "bts:5th-95thcentile", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Embryonictissue", + "rdfs:label": "5th-95thcentile", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:Stature" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "embryonic tissue", + "sms:displayName": "5th-95th centile", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Wholebrain", + "@id": "bts:>95thcentile", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Wholebrain", + "rdfs:label": ">95thcentile", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:Stature" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "whole brain", + "sms:displayName": "> 95th centile", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Microtissue", + "@id": "bts:Angstrom", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Microtissue", + "rdfs:label": "Angstrom", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:WorkingDistanceUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "microtissue", + "sms:displayName": "angstrom", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Retina", + "@id": "bts:Nanometer", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Retina", + "rdfs:label": "Nanometer", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:WorkingDistanceUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "retina", + "sms:displayName": "nanometer", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CDXtissue", + "@id": "bts:Micrometer", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CDXtissue", + "rdfs:label": "Micrometer", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:WorkingDistanceUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CDX tissue", + "sms:displayName": "micrometer", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Organoid", + "@id": "bts:Millimeter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Organoid", + "rdfs:label": "Millimeter", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:WorkingDistanceUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "organoid", + "sms:displayName": "millimeter", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Splenocyte", + "@id": "bts:Centimeter", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Splenocyte", + "rdfs:label": "Centimeter", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:WorkingDistanceUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "splenocyte", + "sms:displayName": "centimeter", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Blood", + "@id": "bts:Nottested", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Blood", + "rdfs:label": "Nottested", "rdfs:subClassOf": [ { - "@id": "bts:Organ" - }, - { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:GermlineMutationIndicator" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "blood", + "sms:displayName": "not tested", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Connectivetissue", + "@id": "bts:Testedbutunknown", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Connectivetissue", + "rdfs:label": "Testedbutunknown", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:GermlineMutationIndicator" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "connective tissue", + "sms:displayName": "tested but unknown", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Primarytumor", + "@id": "bts:SpecimenIDSource", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Primarytumor", + "rdfs:comment": "Optional annotation describing where the specimen ID source derived from, e.g. the biobank providing samples or a providing lab.", + "rdfs:label": "SpecimenIDSource", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "primary tumor", + "sms:displayName": "specimenIDSource", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PDXtissue", + "@id": "bts:Unilateral", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PDXtissue", + "rdfs:label": "Unilateral", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:VestibularSchwannoma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PDX tissue", + "sms:displayName": "unilateral", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BuffyCoat", + "@id": "bts:Bilateral", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BuffyCoat", + "rdfs:label": "Bilateral", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:SpecimenType" + "@id": "bts:VestibularSchwannoma" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Buffy Coat", + "sms:displayName": "bilateral", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpecimenType", + "@id": "bts:IsPairedEnd", "@type": "rdfs:Class", - "rdfs:comment": "The type of a material sample taken from a biological entity for testing, diagnostic, propagation, treatment or research purposes. This includes particular types of cellular molecules, cells, tissues, organs, body fluids, embryos, and body excretory substances.\n", - "rdfs:label": "SpecimenType", + "rdfs:comment": "(Legacy/deprecated annotation) Whether or not is paired-end sequencing (Yes; No).", + "rdfs:label": "IsPairedEnd", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -18478,204 +22721,123 @@ }, "schema:rangeIncludes": [ { - "@id": "bts:Cerebralcortex" - }, - { - "@id": "bts:Bonemarrow" - }, - { - "@id": "bts:Plasma" - }, - { - "@id": "bts:DorsalRootGanglion" - }, - { - "@id": "bts:Opticnerve" - }, - { - "@id": "bts:Tumor-adjacentnormal" - }, - { - "@id": "bts:Serum" - }, - { - "@id": "bts:Spheroid" - }, - { - "@id": "bts:Sciaticnerve" - }, - { - "@id": "bts:Meninges" - }, - { - "@id": "bts:Nervetissue" - }, - { - "@id": "bts:BuccalMucosa" - }, - { - "@id": "bts:Embryonictissue" - }, - { - "@id": "bts:Wholebrain" - }, - { - "@id": "bts:Microtissue" - }, - { - "@id": "bts:Retina" - }, - { - "@id": "bts:CDXtissue" - }, - { - "@id": "bts:Organoid" - }, - { - "@id": "bts:Splenocyte" - }, - { - "@id": "bts:Blood" - }, - { - "@id": "bts:Connectivetissue" - }, - { - "@id": "bts:Primarytumor" - }, - { - "@id": "bts:PDXtissue" - }, - { - "@id": "bts:BuffyCoat" - }, - { - "@id": "bts:Saliva" - }, - { - "@id": "bts:Mucus" - }, - { - "@id": "bts:Urine" - }, - { - "@id": "bts:Stool" + "@id": "bts:Yes" }, { - "@id": "bts:Sweat" + "@id": "bts:No" } ], - "sms:displayName": "specimenType", + "sms:displayName": "isPairedEnd", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Saliva", + "@id": "bts:DataNotExpected", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Saliva", + "rdfs:label": "DataNotExpected", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:DataStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "saliva", + "sms:displayName": "Data Not Expected", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mucus", + "@id": "bts:DataPending", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mucus", + "rdfs:label": "DataPending", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:DataStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mucus", + "sms:displayName": "Data Pending", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Urine", + "@id": "bts:UnderEmbargo", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Urine", + "rdfs:label": "UnderEmbargo", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:DataStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "urine", + "sms:displayName": "Under Embargo", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Stool", + "@id": "bts:RollingRelease", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Stool", + "rdfs:label": "RollingRelease", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:DataStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "stool", + "sms:displayName": "Rolling Release", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sweat", + "@id": "bts:PartiallyAvailable", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sweat", + "rdfs:label": "PartiallyAvailable", "rdfs:subClassOf": [ { - "@id": "bts:SpecimenType" + "@id": "bts:DataStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sweat", + "sms:displayName": "Partially Available", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DatasetItemCount", + "@id": "bts:Available", "@type": "rdfs:Class", - "rdfs:comment": "Count of files in dataset. Auto-calculated by Synapse.", - "rdfs:label": "DatasetItemCount", + "rdfs:comment": "TBD", + "rdfs:label": "Available", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "datasetItemCount", + "sms:displayName": "Available", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataFileHandleId", + "@id": "bts:ContentSize", "@type": "rdfs:Class", - "rdfs:comment": "(Files only) Refers to the id of the file.", - "rdfs:label": "DataFileHandleId", + "rdfs:comment": "(Files only) File size, usually calculated by the backend.", + "rdfs:label": "ContentSize", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -18684,68 +22846,66 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dataFileHandleId", + "sms:displayName": "contentSize", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IndividualIdSource", + "@id": "bts:RNAi", "@type": "rdfs:Class", - "rdfs:comment": "Database or repository to which individual ID maps", - "rdfs:label": "IndividualIdSource", + "rdfs:comment": "TBD", + "rdfs:label": "RNAi", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:GenePerturbationTechnology" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "individualIdSource", + "sms:displayName": "RNAi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TotalReads", + "@id": "bts:CRISPR", "@type": "rdfs:Class", - "rdfs:comment": "If available, the total number of reads collected from samtools.", - "rdfs:label": "TotalReads", + "rdfs:comment": "TBD", + "rdfs:label": "CRISPR", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:GenePerturbationTechnology" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "totalReads", + "sms:displayName": "CRISPR", "sms:required": "sms:false", - "sms:validationRules": [ - "int" - ] + "sms:validationRules": [] }, { - "@id": "bts:Contributor", + "@id": "bts:CRERecombinase", "@type": "rdfs:Class", - "rdfs:comment": "An entity responsible for making contributions to the resource.", - "rdfs:label": "Contributor", + "rdfs:comment": "TBD", + "rdfs:label": "CRERecombinase", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:GenePerturbationTechnology" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "contributor", + "sms:displayName": "CRE Recombinase", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataType", + "@id": "bts:RelatedResource", "@type": "rdfs:Class", - "rdfs:comment": "Links an entity to data types that the entity represents/contains. This is closely tied to the assay property. For example, a file of dataType `genomicVariants` might have an assay value of `whole genome sequencing`.\n", - "rdfs:label": "DataType", + "rdfs:comment": "A related resource.", + "rdfs:label": "RelatedResource", "rdfs:subClassOf": [ { "@id": "bts:Thing" @@ -18754,11689 +22914,10259 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Immunoassay" - }, - { - "@id": "bts:Behaviorprocess" - }, - { - "@id": "bts:Clinical" - }, - { - "@id": "bts:Demographics" - }, - { - "@id": "bts:Particlecharacterization" - }, - { - "@id": "bts:DrugCombinationScreen" - }, - { - "@id": "bts:IsoformExpression" - }, - { - "@id": "bts:Proteomics" - }, - { - "@id": "bts:SurveyData" - }, - { - "@id": "bts:Kinomics" - }, - { - "@id": "bts:SomaticVariants" - }, - { - "@id": "bts:Volume" - }, - { - "@id": "bts:Characteristic" - }, - { - "@id": "bts:DrugScreen" - }, - { - "@id": "bts:GeneExpression" - }, - { - "@id": "bts:AlignedReads" - }, - { - "@id": "bts:GenomicFeatures" - }, - { - "@id": "bts:GenomicVariants" - }, - { - "@id": "bts:Rawcounts" - }, - { - "@id": "bts:RawIntensities" - }, - { - "@id": "bts:NormalizedIntensities" - }, - { - "@id": "bts:PharmacokineticStudy" - }, - { - "@id": "bts:Maskimage" - }, - { - "@id": "bts:ChromatinActivity" - }, - { - "@id": "bts:StructuralVariants" - }, - { - "@id": "bts:GermlineVariants" - }, - { - "@id": "bts:CopyNumberVariants" - }, - { - "@id": "bts:Image" - }, - { - "@id": "bts:Network" - }, - { - "@id": "bts:CellularPhysiology" - }, - { - "@id": "bts:Metabolomics" - }, - { - "@id": "bts:AnnotatedSomaticVariants" - }, - { - "@id": "bts:AnnotatedGermlineVariants" - }, - { - "@id": "bts:Weight" - }, - { - "@id": "bts:Electrophysiology" - }, - { - "@id": "bts:Audiotranscript" - }, - { - "@id": "bts:DataIndex" - }, - { - "@id": "bts:DescriptiveMetadata" - }, - { - "@id": "bts:StructuralMetadata" - }, - { - "@id": "bts:AdministrativeMetadata" - }, - { - "@id": "bts:ReferenceMetadata" - }, - { - "@id": "bts:StatisticalMetadata" - }, - { - "@id": "bts:LegalMetadata" - }, + "sms:displayName": "relatedResource", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:7z", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "7z", + "rdfs:subClassOf": [ { - "@id": "bts:WorkflowMetadata" + "@id": "bts:FileFormat" } ], - "sms:displayName": "dataType", - "sms:required": "sms:true", - "sms:requiresDependency": [ + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "7z", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:DICOM", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "DICOM", + "rdfs:subClassOf": [ { - "@id": "bts:DataSubtype" + "@id": "bts:FileFormat" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "DICOM", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Immunoassay", + "@id": "bts:MATLABdata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Immunoassay", + "rdfs:label": "MATLABdata", "rdfs:subClassOf": [ { - "@id": "bts:DataType" - }, - { - "@id": "bts:ProtocolAssay" - }, + "@id": "bts:FileFormat" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "MATLAB data", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:MATLABscript", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "MATLABscript", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "immunoassay", + "sms:displayName": "MATLAB script", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Behaviorprocess", + "@id": "bts:NWB", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Behaviorprocess", + "rdfs:label": "NWB", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "behavior process", + "sms:displayName": "NWB", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Clinical", + "@id": "bts:PAR", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Clinical", + "rdfs:label": "PAR", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "clinical", + "sms:displayName": "PAR", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Demographics", + "@id": "bts:Pythonscript", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Demographics", + "rdfs:label": "Pythonscript", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "demographics", + "sms:displayName": "Python script", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Particlecharacterization", + "@id": "bts:Rscript", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Particlecharacterization", + "rdfs:label": "Rscript", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "particle characterization", + "sms:displayName": "R script", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DrugCombinationScreen", + "@id": "bts:RCC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DrugCombinationScreen", + "rdfs:label": "RCC", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "drugCombinationScreen", + "sms:displayName": "RCC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsoformExpression", + "@id": "bts:RData", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IsoformExpression", + "rdfs:label": "RData", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "isoformExpression", + "sms:displayName": "RData", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Proteomics", + "@id": "bts:REC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Proteomics", + "rdfs:label": "REC", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "proteomics", + "sms:displayName": "REC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SurveyData", + "@id": "bts:SDAT", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SurveyData", + "rdfs:label": "SDAT", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "surveyData", + "sms:displayName": "SDAT", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Kinomics", + "@id": "bts:SPAR", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Kinomics", + "rdfs:label": "SPAR", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "kinomics", + "sms:displayName": "SPAR", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SomaticVariants", + "@id": "bts:Sentrixdescriptorfile", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SomaticVariants", + "rdfs:label": "Sentrixdescriptorfile", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SomaticVariants", + "sms:displayName": "Sentrix descriptor file", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Volume", + "@id": "bts:Ab1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Volume", + "rdfs:label": "Ab1", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Volume", + "sms:displayName": "ab1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Characteristic", + "@id": "bts:Abf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Characteristic", + "rdfs:label": "Abf", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "characteristic", + "sms:displayName": "abf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GeneExpression", + "@id": "bts:Ai", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GeneExpression", + "rdfs:label": "Ai", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "geneExpression", + "sms:displayName": "ai", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AlignedReads", + "@id": "bts:Avi", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AlignedReads", + "rdfs:label": "Avi", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "AlignedReads", + "sms:displayName": "avi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicFeatures", + "@id": "bts:Bai", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GenomicFeatures", + "rdfs:label": "Bai", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genomicFeatures", + "sms:displayName": "bai", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicVariants", + "@id": "bts:Bam", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GenomicVariants", + "rdfs:label": "Bam", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genomicVariants", + "sms:displayName": "bam", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rawcounts", + "@id": "bts:Bashscript", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rawcounts", + "rdfs:label": "Bashscript", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "raw counts", + "sms:displayName": "bash script", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RawIntensities", + "@id": "bts:Bcf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RawIntensities", + "rdfs:label": "Bcf", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RawIntensities", + "sms:displayName": "bcf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NormalizedIntensities", + "@id": "bts:Bed", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NormalizedIntensities", + "rdfs:label": "Bed", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NormalizedIntensities", + "sms:displayName": "bed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PharmacokineticStudy", + "@id": "bts:BedbroadPeak", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PharmacokineticStudy", + "rdfs:label": "BedbroadPeak", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pharmacokinetic Study", + "sms:displayName": "bed broadPeak", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Maskimage", + "@id": "bts:BedgappedPeak", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Maskimage", + "rdfs:label": "BedgappedPeak", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mask image", + "sms:displayName": "bed gappedPeak", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChromatinActivity", + "@id": "bts:BednarrowPeak", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ChromatinActivity", + "rdfs:label": "BednarrowPeak", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "chromatinActivity", + "sms:displayName": "bed narrowPeak", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StructuralVariants", + "@id": "bts:Bedgraph", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "StructuralVariants", + "rdfs:label": "Bedgraph", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "StructuralVariants", + "sms:displayName": "bedgraph", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GermlineVariants", + "@id": "bts:Bgzip", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GermlineVariants", + "rdfs:label": "Bgzip", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GermlineVariants", + "sms:displayName": "bgzip", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CopyNumberVariants", + "@id": "bts:Bigwig", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CopyNumberVariants", + "rdfs:label": "Bigwig", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CopyNumberVariants", + "sms:displayName": "bigwig", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Image", + "@id": "bts:Bmp", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Image", + "rdfs:label": "Bmp", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "image", + "sms:displayName": "bmp", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Network", + "@id": "bts:Bpm", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Network", + "rdfs:label": "Bpm", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "network", + "sms:displayName": "bpm", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CellularPhysiology", + "@id": "bts:Cel", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CellularPhysiology", + "rdfs:label": "Cel", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cellularPhysiology", + "sms:displayName": "cel", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Metabolomics", + "@id": "bts:Chp", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Metabolomics", + "rdfs:label": "Chp", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "metabolomics", + "sms:displayName": "chp", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnnotatedSomaticVariants", + "@id": "bts:Cnn", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AnnotatedSomaticVariants", + "rdfs:label": "Cnn", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "AnnotatedSomaticVariants", + "sms:displayName": "cnn", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnnotatedGermlineVariants", + "@id": "bts:Cnr", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AnnotatedGermlineVariants", + "rdfs:label": "Cnr", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "AnnotatedGermlineVariants", + "sms:displayName": "cnr", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Weight", + "@id": "bts:Cns", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Weight", + "rdfs:label": "Cns", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Weight", + "sms:displayName": "cns", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Electrophysiology", + "@id": "bts:Cram", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Electrophysiology", + "rdfs:label": "Cram", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "electrophysiology", + "sms:displayName": "cram", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Audiotranscript", + "@id": "bts:Crai", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Audiotranscript", + "rdfs:label": "Crai", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "audio transcript", + "sms:displayName": "crai", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataIndex", + "@id": "bts:Csi", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DataIndex", + "rdfs:label": "Csi", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dataIndex", + "sms:displayName": "csi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DescriptiveMetadata", + "@id": "bts:Csv", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DescriptiveMetadata", + "rdfs:label": "Csv", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Descriptive Metadata", + "sms:displayName": "csv", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StructuralMetadata", + "@id": "bts:Ctab", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "StructuralMetadata", + "rdfs:label": "Ctab", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Structural Metadata", + "sms:displayName": "ctab", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AdministrativeMetadata", + "@id": "bts:Czi", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AdministrativeMetadata", + "rdfs:label": "Czi", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Administrative Metadata", + "sms:displayName": "czi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReferenceMetadata", + "@id": "bts:Dat", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ReferenceMetadata", + "rdfs:label": "Dat", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Reference Metadata", + "sms:displayName": "dat", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StatisticalMetadata", + "@id": "bts:Doc", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "StatisticalMetadata", + "rdfs:label": "Doc", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Statistical Metadata", + "sms:displayName": "doc", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LegalMetadata", + "@id": "bts:Dockerimage", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LegalMetadata", + "rdfs:label": "Dockerimage", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Legal Metadata", + "sms:displayName": "docker image", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WorkflowMetadata", + "@id": "bts:Dup", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "WorkflowMetadata", + "rdfs:label": "Dup", "rdfs:subClassOf": [ { - "@id": "bts:DataType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Workflow Metadata", + "sms:displayName": "dup", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataSubtype", + "@id": "bts:Edat3", "@type": "rdfs:Class", - "rdfs:comment": "Further qualification of dataType, which may be used to indicate the state of processing of the data, aggregation of the data, or presence of metadata.", - "rdfs:label": "DataSubtype", + "rdfs:comment": "TBD", + "rdfs:label": "Edat3", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ + "sms:displayName": "edat3", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Excel", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Excel", + "rdfs:subClassOf": [ { - "@id": "bts:Normalized" - }, + "@id": "bts:FileFormat" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "excel", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Fasta", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Fasta", + "rdfs:subClassOf": [ { - "@id": "bts:DataMatrix" - }, + "@id": "bts:FileFormat" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "fasta", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Fastq", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Fastq", + "rdfs:subClassOf": [ { - "@id": "bts:Raw" - }, + "@id": "bts:FileFormat" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "fastq", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Fcs", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Fcs", + "rdfs:subClassOf": [ { - "@id": "bts:Processed" - }, + "@id": "bts:FileFormat" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "fcs", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Fig", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Fig", + "rdfs:subClassOf": [ { - "@id": "bts:Metadata" - }, + "@id": "bts:FileFormat" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "fig", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Flagstat", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Flagstat", + "rdfs:subClassOf": [ { - "@id": "bts:Representative" + "@id": "bts:FileFormat" } ], - "sms:displayName": "dataSubtype", - "sms:required": "sms:true", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "flagstat", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TimepointUnit", + "@id": "bts:Gct", "@type": "rdfs:Class", - "rdfs:comment": "For timed experiments this represents the unit of time measured", - "rdfs:label": "TimepointUnit", + "rdfs:comment": "TBD", + "rdfs:label": "Gct", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Seconds" - }, - { - "@id": "bts:Minutes" - }, - { - "@id": "bts:Hours" - }, - { - "@id": "bts:Days" - }, - { - "@id": "bts:Weeks" - }, - { - "@id": "bts:Months" - }, - { - "@id": "bts:Years" - } - ], - "sms:displayName": "timepointUnit", + "sms:displayName": "gct", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WHOPerformanceStatus", + "@id": "bts:Gff3", "@type": "rdfs:Class", - "rdfs:comment": "Score on the WHO scale describing patient's functional abilities.", - "rdfs:label": "WHOPerformanceStatus", + "rdfs:comment": "TBD", + "rdfs:label": "Gff3", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:0" - }, - { - "@id": "bts:1" - }, - { - "@id": "bts:2" - }, - { - "@id": "bts:3" - }, - { - "@id": "bts:4" - } - ], - "sms:displayName": "WHOPerformanceStatus", + "sms:displayName": "gff3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:0", + "@id": "bts:Gtf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "0", + "rdfs:label": "Gtf", "rdfs:subClassOf": [ { - "@id": "bts:WHOPerformanceStatus" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "0", + "sms:displayName": "gtf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CurrentVersion", + "@id": "bts:Gzip", "@type": "rdfs:Class", - "rdfs:comment": "(Versionable entities only) The current version number of the resource.", - "rdfs:label": "CurrentVersion", + "rdfs:comment": "TBD", + "rdfs:label": "Gzip", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "currentVersion", + "sms:displayName": "gzip", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicReference", + "@id": "bts:Hdf5", "@type": "rdfs:Class", - "rdfs:comment": "Version of genome reference used for alignment in processing workflow", - "rdfs:label": "GenomicReference", + "rdfs:comment": "TBD", + "rdfs:label": "Hdf5", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genomicReference", - "sms:required": "sms:true", + "sms:displayName": "hdf5", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Normalized", + "@id": "bts:Hdr", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Normalized", + "rdfs:label": "Hdr", "rdfs:subClassOf": [ { - "@id": "bts:DataSubtype" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "normalized", + "sms:displayName": "hdr", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataMatrix", + "@id": "bts:Hic", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DataMatrix", + "rdfs:label": "Hic", "rdfs:subClassOf": [ { - "@id": "bts:DataSubtype" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dataMatrix", + "sms:displayName": "hic", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Processed", + "@id": "bts:Html", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Processed", + "rdfs:label": "Html", "rdfs:subClassOf": [ { - "@id": "bts:DataSubtype" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "processed", + "sms:displayName": "html", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Representative", + "@id": "bts:Hyperlink", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Representative", + "rdfs:label": "Hyperlink", "rdfs:subClassOf": [ { - "@id": "bts:DataSubtype" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "representative", + "sms:displayName": "hyperlink", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Organ", + "@id": "bts:Idat", "@type": "rdfs:Class", - "rdfs:comment": "A unique macroscopic (gross) anatomic structure that performs specific functions. It is composed of various tissues. An organ is part of an anatomic system or a body region.", - "rdfs:label": "Organ", + "rdfs:comment": "TBD", + "rdfs:label": "Idat", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Kidney" - }, - { - "@id": "bts:Ovary" - }, - { - "@id": "bts:Lung" - }, - { - "@id": "bts:Bonemarrow" - }, - { - "@id": "bts:Prostate" - }, - { - "@id": "bts:Breast" - }, - { - "@id": "bts:Mesentery" - }, - { - "@id": "bts:Mammarygland" - }, - { - "@id": "bts:Colon" - }, - { - "@id": "bts:Spleen" - }, - { - "@id": "bts:BursaOfFabricius" - }, - { - "@id": "bts:Nose" - }, - { - "@id": "bts:Brain" - }, - { - "@id": "bts:Pancreas" - }, - { - "@id": "bts:Liver" - }, - { - "@id": "bts:Blood" - }, - { - "@id": "bts:Lymphnode" - }, - { - "@id": "bts:Nerves" - }, - { - "@id": "bts:Skin" - }, - { - "@id": "bts:Eye" - } - ], - "sms:displayName": "organ", + "sms:displayName": "idat", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Kidney", + "@id": "bts:Idx", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Kidney", + "rdfs:label": "Idx", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "kidney", + "sms:displayName": "idx", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ovary", + "@id": "bts:Img", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ovary", + "rdfs:label": "Img", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ovary", + "sms:displayName": "img", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lung", + "@id": "bts:Jpg", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lung", + "rdfs:label": "Jpg", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lung", + "sms:displayName": "jpg", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Prostate", + "@id": "bts:Js", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Prostate", + "rdfs:label": "Js", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "prostate", + "sms:displayName": "js", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Breast", + "@id": "bts:Json", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Breast", + "rdfs:label": "Json", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "breast", + "sms:displayName": "json", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mesentery", + "@id": "bts:Lif", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mesentery", + "rdfs:label": "Lif", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mesentery", + "sms:displayName": "lif", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mammarygland", + "@id": "bts:Locs", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mammarygland", + "rdfs:label": "Locs", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mammary gland", + "sms:displayName": "locs", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Colon", + "@id": "bts:Maf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Colon", + "rdfs:label": "Maf", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "colon", + "sms:displayName": "maf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Spleen", + "@id": "bts:Md", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Spleen", + "rdfs:label": "Md", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "spleen", + "sms:displayName": "md", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BursaOfFabricius", + "@id": "bts:Mov", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BursaOfFabricius", + "rdfs:label": "Mov", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Bursa Of Fabricius", + "sms:displayName": "mov", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nose", + "@id": "bts:MPEG-4", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nose", + "rdfs:label": "MPEG-4", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nose", + "sms:displayName": "MPEG-4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Brain", + "@id": "bts:Msf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Brain", + "rdfs:label": "Msf", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "brain", + "sms:displayName": "msf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pancreas", + "@id": "bts:Mtx", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pancreas", + "rdfs:label": "Mtx", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pancreas", + "sms:displayName": "mtx", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Liver", + "@id": "bts:MzML", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Liver", + "rdfs:label": "MzML", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "liver", + "sms:displayName": "mzML", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lymphnode", + "@id": "bts:Nii", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lymphnode", + "rdfs:label": "Nii", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lymph node", + "sms:displayName": "nii", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nerves", + "@id": "bts:Ome-tiff", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nerves", + "rdfs:label": "Ome-tiff", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nerves", + "sms:displayName": "ome-tiff", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Skin", + "@id": "bts:Pdf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Skin", + "rdfs:label": "Pdf", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "skin", + "sms:displayName": "pdf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Eye", + "@id": "bts:Plink", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Eye", + "rdfs:label": "Plink", "rdfs:subClassOf": [ { - "@id": "bts:Organ" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "eye", + "sms:displayName": "plink", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LearningDisability", + "@id": "bts:Png", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Learning disability.", - "rdfs:label": "LearningDisability", + "rdfs:comment": "TBD", + "rdfs:label": "Png", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, + "sms:displayName": "png", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Powerpoint", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Powerpoint", + "rdfs:subClassOf": [ { - "@id": "bts:Unknown" + "@id": "bts:FileFormat" } ], - "sms:displayName": "learningDisability", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "powerpoint", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Id", + "@id": "bts:Pzfx", "@type": "rdfs:Class", - "rdfs:comment": "The entity id for the resource automatically assigned by the platform.", - "rdfs:label": "Id", + "rdfs:comment": "TBD", + "rdfs:label": "Pzfx", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "id", + "sms:displayName": "pzfx", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsXenograft", + "@id": "bts:Psydat", "@type": "rdfs:Class", - "rdfs:comment": "Whether or not sample source is a xenograft (Yes; No)", - "rdfs:label": "IsXenograft", + "rdfs:comment": "TBD", + "rdfs:label": "Psydat", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ + "sms:displayName": "psydat", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Raw", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Raw", + "rdfs:subClassOf": [ { - "@id": "bts:Yes" + "@id": "bts:DataSubtype" }, { - "@id": "bts:No" + "@id": "bts:FileFormat" } ], - "sms:displayName": "isXenograft", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "raw", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ResourceId", + "@id": "bts:Rds", "@type": "rdfs:Class", - "rdfs:comment": "A UUID for a Resource from the NF Research Tools Database", - "rdfs:label": "ResourceId", + "rdfs:comment": "TBD", + "rdfs:label": "Rds", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Resource_id", + "sms:displayName": "rds", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LenticularOpacity", + "@id": "bts:Recal", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Lenticular opacity.", - "rdfs:label": "LenticularOpacity", + "rdfs:comment": "TBD", + "rdfs:label": "Recal", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "lenticularOpacity", + "sms:displayName": "recal", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DrugScreenType", + "@id": "bts:Rmd", "@type": "rdfs:Class", - "rdfs:comment": "String describing general class of drug screen", - "rdfs:label": "DrugScreenType", + "rdfs:comment": "TBD", + "rdfs:label": "Rmd", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Combinationlibraryscreen" - }, - { - "@id": "bts:Combinationscreen" - }, - { - "@id": "bts:Singlemolecule" - }, - { - "@id": "bts:Smallmoleculelibraryscreen" - } - ], - "sms:displayName": "drugScreenType", + "sms:displayName": "rmd", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Combinationlibraryscreen", + "@id": "bts:Sam", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Combinationlibraryscreen", + "rdfs:label": "Sam", "rdfs:subClassOf": [ { - "@id": "bts:DrugScreenType" - }, - { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "combination library screen", + "sms:displayName": "sam", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Combinationscreen", + "@id": "bts:Sav", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Combinationscreen", + "rdfs:label": "Sav", "rdfs:subClassOf": [ { - "@id": "bts:DrugScreenType" - }, - { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "combination screen", + "sms:displayName": "sav", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Singlemolecule", + "@id": "bts:Sdf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Singlemolecule", + "rdfs:label": "Sdf", "rdfs:subClassOf": [ { - "@id": "bts:DrugScreenType" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single molecule", + "sms:displayName": "sdf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Smallmoleculelibraryscreen", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Smallmoleculelibraryscreen", - "rdfs:subClassOf": [ - { - "@id": "bts:DrugScreenType" - }, - { - "@id": "bts:ProtocolAssay" - }, + "@id": "bts:Seg", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Seg", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "small molecule library screen", + "sms:displayName": "seg", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ExperimentalCondition", + "@id": "bts:Sf", "@type": "rdfs:Class", - "rdfs:comment": "A free-text description of the experimental condition (e.g. 5 mM doxorubicin).", - "rdfs:label": "ExperimentalCondition", + "rdfs:comment": "TBD", + "rdfs:label": "Sf", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "experimentalCondition", + "sms:displayName": "sf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CafeaulaitMacules", + "@id": "bts:Sif", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of cafe-au-lait macules.", - "rdfs:label": "CafeaulaitMacules", + "rdfs:comment": "TBD", + "rdfs:label": "Sif", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "cafeaulaitMacules", + "sms:displayName": "sif", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ModelSystemName", + "@id": "bts:Sqlite", "@type": "rdfs:Class", - "rdfs:comment": " HEK293 (cell line), Minnesota5 (swine strain), DXL (poultry strain), RB51 (vaccine strain of Brucella abortus)", - "rdfs:label": "ModelSystemName", + "rdfs:comment": "TBD", + "rdfs:label": "Sqlite", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:HEK293NF1-/-withWTmNf1cDNA" - }, - { - "@id": "bts:SZ-NF4" - }, - { - "@id": "bts:Nf1-/-HEK293" - }, - { - "@id": "bts:HEK293NF1-/-Exon52R2550X#5" - }, - { - "@id": "bts:HBE135-E6E7" - }, - { - "@id": "bts:NCC-MPNST5-C1" - }, - { - "@id": "bts:Sc93.1" - }, - { - "@id": "bts:JHU2-079-PDX" - }, - { - "@id": "bts:HEK293NF1-/-withR192XmNf1cDNA" - }, - { - "@id": "bts:IcNF98.4c" - }, - { - "@id": "bts:ST88-14" - }, - { - "@id": "bts:HTERTNF1ipNF95.6" - }, - { - "@id": "bts:IcNF99.1" - }, - { - "@id": "bts:CNF00.10a" - }, - { - "@id": "bts:IPSCY489C;Exon13crypticsplice" - }, - { - "@id": "bts:3PNFSiPSsvMM11" - }, - { - "@id": "bts:HTERTNF1ipnNF09.4" - }, - { - "@id": "bts:S520" - }, - { - "@id": "bts:SchwanncellNF1-/-withR681XmNf1cDNA" - }, - { - "@id": "bts:JH-2-002-CL" - }, - { - "@id": "bts:NCC-MPNST2-C1" - }, - { - "@id": "bts:HEK293NF1-/-withR1306XmNf1cDNA" - }, - { - "@id": "bts:WTES" - }, - { - "@id": "bts:Fb93.1" - }, - { - "@id": "bts:CNF04.9a" - }, - { - "@id": "bts:JHU2-103-PDX" - }, - { - "@id": "bts:5PNFTDiPSsvPM6" - }, - { - "@id": "bts:NCC-MPNST1-C1" - }, - { - "@id": "bts:7PNFSiPSrvPM12" - }, - { - "@id": "bts:HEK293NF1-/-withR681XmNf1cDNA" - }, - { - "@id": "bts:GM23338" - }, - { - "@id": "bts:HTERTNF1ipnNF95.11c" - }, - { - "@id": "bts:T265" - }, - { - "@id": "bts:HEK293NF1-/-clone2" - }, - { - "@id": "bts:SNF02.2" - }, - { - "@id": "bts:IPSCNF1WT" - }, - { - "@id": "bts:IcNF98.4d" - }, - { - "@id": "bts:NF2-/-AC007-hTERT" - }, - { - "@id": "bts:HEK293NF1-/-withWTtaggedmNf1cDNA" - }, - { - "@id": "bts:NCC-MPNST3-C1" - }, - { - "@id": "bts:HEK293" - }, - { - "@id": "bts:Dh5alpha" - }, - { - "@id": "bts:IcNF97.2a" - }, - { - "@id": "bts:SchwanncellNF1-/-(iPN97.4#24)" - }, - { - "@id": "bts:CNF97.5" - }, - { - "@id": "bts:NCC-MPNST4-C1" - }, - { - "@id": "bts:NMS-2" - }, - { - "@id": "bts:CNF99.1" - }, - { - "@id": "bts:HiPSC" - }, - { - "@id": "bts:AC007-hTERT" - }, - { - "@id": "bts:ScienCellSchwanncells" - }, - { - "@id": "bts:IcNF04.9a" - }, - { - "@id": "bts:90-8" - }, - { - "@id": "bts:SchwanncellNF1-/-withWTtaggedmNf1cDNA" - }, - { - "@id": "bts:IPSCNF1+/-BJFF.6bkgd" - }, - { - "@id": "bts:JHU2-079-CL" - }, - { - "@id": "bts:CNF97.2b" - }, - { - "@id": "bts:JHU2-002-CL" - }, - { - "@id": "bts:NF1" - }, - { - "@id": "bts:SZ-NF1" - }, - { - "@id": "bts:3PNFFiPSsvPM2" - }, - { - "@id": "bts:HTERTNF1ipNF05.5(Mixedclones)" - }, - { - "@id": "bts:HTERTipn02.32λ" - }, - { - "@id": "bts:JHU2-103-CL" - }, - { - "@id": "bts:HEK293NF1-/-Exon17#A15G629Rcrypticsplice" - }, - { - "@id": "bts:Lis42NF11N" - }, - { - "@id": "bts:ELK-TADLuciferaseReporterHEK293StableNF1-/-" - }, - { - "@id": "bts:Humanforeskinfibroblasts" - }, - { - "@id": "bts:IcNF00.10a" - }, - { - "@id": "bts:HEK293NF1-/-withR1947XmNf1cDNA" - }, - { - "@id": "bts:Nf1-/-Epitheliallungcells" - }, - { - "@id": "bts:Nf2-/-SchwannSC(mouse)(PMID26554010)" - }, - { - "@id": "bts:STS-26T" - }, - { - "@id": "bts:HEK293NF1-/-withR461XmNf1cDNA" - }, - { - "@id": "bts:I28cNF" - }, - { - "@id": "bts:SNF94.3" - }, - { - "@id": "bts:Nf1-/-skin-derivedprecursorcells" - }, - { - "@id": "bts:HTERTipn02.8" - }, - { - "@id": "bts:Dhh-Cre;NF1Arg681*/floxSchwannCells" - }, - { - "@id": "bts:KCL024" - }, - { - "@id": "bts:IcNF97.2b" - }, - { - "@id": "bts:HeLaSilenciXNF1" - }, - { - "@id": "bts:HTERTNF1ipNF95.11bC/T" - }, - { - "@id": "bts:HEK293NF1-/-Exon47insT#14" - }, - { - "@id": "bts:HS-PSS" - }, - { - "@id": "bts:YST-1" - }, - { - "@id": "bts:M3MPNST" - }, - { - "@id": "bts:S462.TY" - }, - { - "@id": "bts:S462" - }, - { - "@id": "bts:HEK293NF1-/-Exon17#B48G629Rcrypticsplice" - }, - { - "@id": "bts:GM11602" - }, - { - "@id": "bts:Lis47NF12N" - }, - { - "@id": "bts:HTERTNF1sipnNF95.12B" - }, - { - "@id": "bts:KCL025" - }, - { - "@id": "bts:SchwanncellNF1-/-withR816XmNf1cDNA" - }, - { - "@id": "bts:HiPSC-SCP" - }, - { - "@id": "bts:SNF96.2" - }, - { - "@id": "bts:CNF98.4c" - }, - { - "@id": "bts:NF1-R68XEmbryoniccells" - }, - { - "@id": "bts:BJFF.6" - }, - { - "@id": "bts:Ben-Men-1" - }, - { - "@id": "bts:HEK293NF1-/-withR816XmNf1cDNA" - }, - { - "@id": "bts:HTERTNF1ipNF05.5" - }, - { - "@id": "bts:I18cNF" - }, - { - "@id": "bts:HTERTSCipn97.4" - }, - { - "@id": "bts:I21cNF" - }, - { - "@id": "bts:CNF98.4d" - }, - { - "@id": "bts:28cNF" - }, - { - "@id": "bts:SC4[Mouseschwannoma]" - }, - { - "@id": "bts:CNF18.1a" - }, - { - "@id": "bts:Nf1Arg681*/Arg681*ES" - }, - { - "@id": "bts:GM11601" - }, - { - "@id": "bts:HEK293NF1-/-withR2550XmNf1cDNA" - }, - { - "@id": "bts:JH-2-103-CL" - }, - { - "@id": "bts:HS-Sch-2" - }, - { - "@id": "bts:HTERTNF1ipn02.32λ" - }, - { - "@id": "bts:ELK-TADLuciferaseReporterHEK293Stable" - }, - { - "@id": "bts:6PNFSiPSrvPM2" - }, - { - "@id": "bts:HTERTNF1ipNF03.3" - }, - { - "@id": "bts:JH-2-079-CL" - }, - { - "@id": "bts:HTERTNF1ipNF04.4" - }, - { - "@id": "bts:Nf1Arg681*/Arg681*MEFs" - }, - { - "@id": "bts:Nf1Arg681*/+ES" - }, - { - "@id": "bts:CNF97.2a" - }, - { - "@id": "bts:Schwanncelli28cNFNF1-/-(#14)" - }, - { - "@id": "bts:HTERTNF1ipNF00.6" - }, - { - "@id": "bts:NCC-MPNST3-X2-C1" - }, - { - "@id": "bts:JHU2-002-PDX" - }, - { - "@id": "bts:HTERTNF1ipNF95.11bC" - }, - { - "@id": "bts:5PNFTDiPSsvMM4" - }, - { - "@id": "bts:HTERTNF1ipn06.2A" - }, - { - "@id": "bts:HTERTSCipn02.8" - }, - { - "@id": "bts:SZ-NF2" - }, - { - "@id": "bts:SMPNST" - }, - { - "@id": "bts:B6;129S2-Trp53tm1TyjNf1tm1Tyj/J" - }, - { - "@id": "bts:Prss56Cre;R26mT" - }, - { - "@id": "bts:B6.129S1-Nf1tm1Cbr/J" - }, - { - "@id": "bts:Nf1-OPG" - }, - { - "@id": "bts:C57BL/6J" - }, - { - "@id": "bts:NRG" - }, - { - "@id": "bts:Nf1-OPG-Arg816" - }, - { - "@id": "bts:NODscidgamma" - }, - { - "@id": "bts:B6.129S2-Nf1tm1Tyj/J" - }, - { - "@id": "bts:B6;129-Trp53tm1TyjNf1tm1TyjSuz12Gt(Betageo)1Khe/KcichJ" - }, - { - "@id": "bts:B6.129(Cg)-Nf1tm1Par/J" - }, - { - "@id": "bts:GFAP-Cre;Nf1-G848R/Flox" - }, - { - "@id": "bts:GFAP-Cre;Nf1-R681X/Flox" - }, - { - "@id": "bts:GFAP-Cre;Nf1-C383X/Flox" - }, - { - "@id": "bts:Nf1-C848R/Flox" - }, - { - "@id": "bts:Nf1-R681X/Flox" - }, - { - "@id": "bts:Nf1-C383X/Flox" - }, + "sms:displayName": "sqlite", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Sra", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Sra", + "rdfs:subClassOf": [ { - "@id": "bts:Nf1flox/flox" + "@id": "bts:FileFormat" } ], - "sms:displayName": "modelSystemName", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "sra", "sms:required": "sms:false", - "sms:validationRules": [ - "list like" - ] + "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withWTmNf1cDNA", + "@id": "bts:Svg", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withWTmNf1cDNA", + "rdfs:label": "Svg", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with WT mNf1 cDNA", + "sms:displayName": "svg", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SZ-NF4", + "@id": "bts:Svs", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SZ-NF4", + "rdfs:label": "Svs", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SZ-NF4", + "sms:displayName": "svs", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-/-HEK293", + "@id": "bts:TagAlign", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-/-HEK293", + "rdfs:label": "TagAlign", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-/- HEK 293", + "sms:displayName": "tagAlign", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-Exon52R2550X#5", + "@id": "bts:Tar", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-Exon52R2550X#5", + "rdfs:label": "Tar", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- Exon 52 R2550X #5", + "sms:displayName": "tar", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HBE135-E6E7", + "@id": "bts:Tbi", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HBE135-E6E7", + "rdfs:label": "Tbi", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HBE135-E6E7", + "sms:displayName": "tbi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NCC-MPNST5-C1", + "@id": "bts:Tif", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NCC-MPNST5-C1", + "rdfs:label": "Tif", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NCC-MPNST5-C1", + "sms:displayName": "tif", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sc93.1", + "@id": "bts:Tom", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sc93.1", + "rdfs:label": "Tom", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sc93.1", + "sms:displayName": "tom", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JHU2-079-PDX", + "@id": "bts:Tranches", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JHU2-079-PDX", + "rdfs:label": "Tranches", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JHU 2-079-PDX", + "sms:displayName": "tranches", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR192XmNf1cDNA", + "@id": "bts:Tsv", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR192XmNf1cDNA", + "rdfs:label": "Tsv", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R192X mNf1 cDNA", + "sms:displayName": "tsv", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF98.4c", + "@id": "bts:Txt", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF98.4c", + "rdfs:label": "Txt", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF98.4c", + "sms:displayName": "txt", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ST88-14", + "@id": "bts:Vcf", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ST88-14", + "rdfs:label": "Vcf", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ST88-14", + "sms:displayName": "vcf", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF95.6", + "@id": "bts:Wiggle", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF95.6", + "rdfs:label": "Wiggle", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF95.6", + "sms:displayName": "wiggle", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF99.1", + "@id": "bts:Xml", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF99.1", + "rdfs:label": "Xml", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF99.1", + "sms:displayName": "xml", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF00.10a", + "@id": "bts:Yaml", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF00.10a", + "rdfs:label": "Yaml", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF00.10a", + "sms:displayName": "yaml", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSCY489C;Exon13crypticsplice", + "@id": "bts:Zip", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSCY489C;Exon13crypticsplice", + "rdfs:label": "Zip", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:FileFormat" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC Y489C; Exon 13 cryptic splice", + "sms:displayName": "zip", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3PNFSiPSsvMM11", + "@id": "bts:Rattusnorvegicus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3PNFSiPSsvMM11", + "rdfs:label": "Rattusnorvegicus", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3PNF_SiPSsv_MM_11", + "sms:displayName": "Rattus norvegicus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipnNF09.4", + "@id": "bts:Gallusgallus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipnNF09.4", + "rdfs:label": "Gallusgallus", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipnNF09.4", + "sms:displayName": "Gallus gallus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:S520", + "@id": "bts:Pantroglodytes", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "S520", + "rdfs:label": "Pantroglodytes", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "S520", + "sms:displayName": "Pan troglodytes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SchwanncellNF1-/-withR681XmNf1cDNA", + "@id": "bts:Musmusculus(humanized)", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SchwanncellNF1-/-withR681XmNf1cDNA", + "rdfs:label": "Musmusculus(humanized)", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwann cell NF1 -/- with R681X mNf1 cDNA", + "sms:displayName": "Mus musculus (humanized)", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JH-2-002-CL", + "@id": "bts:Homosapiens", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JH-2-002-CL", + "rdfs:label": "Homosapiens", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JH-2-002-CL", + "sms:displayName": "Homo sapiens", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NCC-MPNST2-C1", + "@id": "bts:Daniorerio", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NCC-MPNST2-C1", + "rdfs:label": "Daniorerio", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NCC-MPNST2-C1", + "sms:displayName": "Danio rerio", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR1306XmNf1cDNA", + "@id": "bts:Drosophilamelanogaster", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR1306XmNf1cDNA", + "rdfs:label": "Drosophilamelanogaster", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R1306X mNf1 cDNA", + "sms:displayName": "Drosophila melanogaster", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WTES", + "@id": "bts:Rhesusmacaque", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "WTES", + "rdfs:label": "Rhesusmacaque", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "WT ES", + "sms:displayName": "Rhesus macaque", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fb93.1", + "@id": "bts:Susscrofa", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fb93.1", + "rdfs:label": "Susscrofa", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Fb93.1", + "sms:displayName": "Sus scrofa", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF04.9a", + "@id": "bts:Oryctolaguscuniculus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF04.9a", + "rdfs:label": "Oryctolaguscuniculus", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF04.9a", + "sms:displayName": "Oryctolagus cuniculus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JHU2-103-PDX", + "@id": "bts:Musmusculus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JHU2-103-PDX", + "rdfs:label": "Musmusculus", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Species" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JHU 2-103-PDX", + "sms:displayName": "Mus musculus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:5PNFTDiPSsvPM6", + "@id": "bts:ConcreteType", + "@type": "rdfs:Class", + "rdfs:comment": "Refers to the class model the data platform uses for representing the resource. This is a low-level field set by the platform and is not a user annotation.", + "rdfs:label": "ConcreteType", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "concreteType", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Allograft", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "5PNFTDiPSsvPM6", + "rdfs:label": "Allograft", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "5PNF_TDiPSsv_PM_6", + "sms:displayName": "allograft", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NCC-MPNST1-C1", + "@id": "bts:Xenograft", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NCC-MPNST1-C1", + "rdfs:label": "Xenograft", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NCC-MPNST1-C1", + "sms:displayName": "xenograft", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:7PNFSiPSrvPM12", + "@id": "bts:Autograft", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "7PNFSiPSrvPM12", + "rdfs:label": "Autograft", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "7PNF_SiPSrv_PM_12", + "sms:displayName": "autograft", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR681XmNf1cDNA", + "@id": "bts:Isograft", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR681XmNf1cDNA", + "rdfs:label": "Isograft", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R681X mNf1 cDNA", + "sms:displayName": "isograft", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GM23338", + "@id": "bts:AbsentbyMRI", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GM23338", + "rdfs:label": "AbsentbyMRI", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:PlexiformNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GM23338", + "sms:displayName": "absent by MRI", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipnNF95.11c", + "@id": "bts:Absentclinically-noMRI", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipnNF95.11c", + "rdfs:label": "Absentclinically-noMRI", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:PlexiformNeurofibromas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipnNF95.11c", + "sms:displayName": "absent clinically - no MRI", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:T265", + "@id": "bts:Bulkcell", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "T265", + "rdfs:label": "Bulkcell", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:NucleicAcidSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "T265", + "sms:displayName": "bulk cell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-clone2", + "@id": "bts:Bulknuclei", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-clone2", + "rdfs:label": "Bulknuclei", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:NucleicAcidSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- clone 2", + "sms:displayName": "bulk nuclei", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SNF02.2", + "@id": "bts:Mitochondria", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SNF02.2", + "rdfs:label": "Mitochondria", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:NucleicAcidSource" + }, + { + "@id": "bts:ProteinExtractSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sNF02.2", + "sms:displayName": "mitochondria", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSCNF1WT", + "@id": "bts:Singlecell", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSCNF1WT", + "rdfs:label": "Singlecell", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:NucleicAcidSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC NF1 WT", + "sms:displayName": "single cell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF98.4d", + "@id": "bts:Singlenucleus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF98.4d", + "rdfs:label": "Singlenucleus", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:NucleicAcidSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF98.4d", + "sms:displayName": "single nucleus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NF2-/-AC007-hTERT", + "@id": "bts:Cy3", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NF2-/-AC007-hTERT", + "rdfs:label": "Cy3", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Channel" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NF2-/- AC007-hTERT", + "sms:displayName": "Cy3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withWTtaggedmNf1cDNA", + "@id": "bts:Cy5", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withWTtaggedmNf1cDNA", + "rdfs:label": "Cy5", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Channel" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with WT tagged mNf1 cDNA", + "sms:displayName": "Cy5", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NCC-MPNST3-C1", + "@id": "bts:Type", + "@type": "rdfs:Class", + "rdfs:comment": "Refers to the type of the resource on the platform, e.g. “file”.", + "rdfs:label": "Type", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "type", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Etag", + "@type": "rdfs:Class", + "rdfs:comment": "Synapse employs an Optimistic Concurrency Control (OCC) scheme to handle concurrent updates. The E-Tag changes every time an entity is updated it is used to detect when a client's current representation of an entity is out-of-date.", + "rdfs:label": "Etag", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "etag", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1SomaticMutation", + "@type": "rdfs:Class", + "rdfs:comment": "NF1 somatic mutation, i.e. in tumor samples.", + "rdfs:label": "Nf1SomaticMutation", + "rdfs:subClassOf": [ + { + "@id": "bts:Thing" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "nf1SomaticMutation", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ExperimentalData", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NCC-MPNST3-C1", + "rdfs:label": "ExperimentalData", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NCC-MPNST3-C1", + "sms:displayName": "experimentalData", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293", + "@id": "bts:Result", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293", + "rdfs:label": "Result", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293", + "sms:displayName": "result", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dh5alpha", + "@id": "bts:Tool", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dh5alpha", + "rdfs:label": "Tool", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Dh5 alpha", + "sms:displayName": "tool", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF97.2a", + "@id": "bts:Workflowreport", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF97.2a", + "rdfs:label": "Workflowreport", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF97.2a", + "sms:displayName": "workflow report", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SchwanncellNF1-/-(iPN97.4#24)", + "@id": "bts:Report", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SchwanncellNF1-/-(iPN97.4#24)", + "rdfs:label": "Report", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwann cell NF1 -/- (iPN97.4 #24)", + "sms:displayName": "report", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF97.5", + "@id": "bts:Protocol", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF97.5", + "rdfs:label": "Protocol", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF97.5", + "sms:displayName": "protocol", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NCC-MPNST4-C1", + "@id": "bts:Weblink", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NCC-MPNST4-C1", + "rdfs:label": "Weblink", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ResourceType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NCC-MPNST4-C1", + "sms:displayName": "weblink", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NMS-2", + "@id": "bts:10xV2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NMS-2", + "rdfs:label": "10xV2", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NMS-2", + "sms:displayName": "10x_v2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF99.1", + "@id": "bts:FACS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF99.1", + "rdfs:label": "FACS", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF99.1", + "sms:displayName": "FACS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HiPSC", + "@id": "bts:FluidigmC1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HiPSC", + "rdfs:label": "FluidigmC1", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hiPSC", + "sms:displayName": "Fluidigm C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AC007-hTERT", + "@id": "bts:Drop-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AC007-hTERT", + "rdfs:label": "Drop-seq", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "AC007-hTERT", + "sms:displayName": "drop-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ScienCellSchwanncells", + "@id": "bts:InDrop", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ScienCellSchwanncells", + "rdfs:label": "InDrop", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ScienCell Schwann cells", + "sms:displayName": "inDrop", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF04.9a", + "@id": "bts:Mouthpipette", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF04.9a", + "rdfs:label": "Mouthpipette", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF04.9a", + "sms:displayName": "mouth pipette", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:90-8", + "@id": "bts:Enzymatic", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "90-8", + "rdfs:label": "Enzymatic", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "90-8", + "sms:displayName": "enzymatic", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SchwanncellNF1-/-withWTtaggedmNf1cDNA", + "@id": "bts:Mechanical", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SchwanncellNF1-/-withWTtaggedmNf1cDNA", + "rdfs:label": "Mechanical", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DissociationMethod" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwann cell NF1 -/- with WT tagged mNf1 cDNA", + "sms:displayName": "mechanical", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSCNF1+/-BJFF.6bkgd", + "@id": "bts:Nanoparticles", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSCNF1+/-BJFF.6bkgd", + "rdfs:label": "Nanoparticles", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MaterialType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC NF1 +/- BJFF.6 bkgd", + "sms:displayName": "nanoparticles", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JHU2-079-CL", + "@id": "bts:Polymericnanoparticles", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JHU2-079-CL", + "rdfs:label": "Polymericnanoparticles", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MaterialType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JHU 2-079-CL", + "sms:displayName": "Polymeric nanoparticles", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF97.2b", + "@id": "bts:Smallmolecule", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF97.2b", + "rdfs:label": "Smallmolecule", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MaterialType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF97.2b", + "sms:displayName": "small molecule", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JHU2-002-CL", + "@id": "bts:DNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JHU2-002-CL", + "rdfs:label": "DNA", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MaterialType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JHU 2-002-CL", + "sms:displayName": "DNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NF1", + "@id": "bts:Doi", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NF1", + "rdfs:comment": "Digital object identifier of the resource.", + "rdfs:label": "Doi", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NF1", + "sms:displayName": "doi", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SZ-NF1", + "@id": "bts:IsMultiSpecimen", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SZ-NF1", + "rdfs:comment": "Whether or not a file has data for multiple specimens (Yes; No)", + "rdfs:label": "IsMultiSpecimen", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SZ-NF1", + "schema:rangeIncludes": [ + { + "@id": "bts:Yes" + }, + { + "@id": "bts:No" + } + ], + "sms:displayName": "isMultiSpecimen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3PNFFiPSsvPM2", + "@id": "bts:PD-weighted", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3PNFFiPSsvPM2", + "rdfs:label": "PD-weighted", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MRISequence" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3PNF_FiPSsv_PM_2", + "sms:displayName": "PD-weighted", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF05.5(Mixedclones)", + "@id": "bts:ShortTauInversionRecovery", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF05.5(Mixedclones)", + "rdfs:label": "ShortTauInversionRecovery", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MRISequence" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF05.5 (Mixed clones)", + "sms:displayName": "Short Tau Inversion Recovery", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTipn02.32λ", + "@id": "bts:T1-weighted", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTipn02.32λ", + "rdfs:label": "T1-weighted", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MRISequence" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT ipn02.3 2λ", + "sms:displayName": "T1-weighted", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JHU2-103-CL", + "@id": "bts:T2-weighted", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JHU2-103-CL", + "rdfs:label": "T2-weighted", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:MRISequence" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JHU 2-103-CL", + "sms:displayName": "T2-weighted", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-Exon17#A15G629Rcrypticsplice", + "@id": "bts:DatasetSizeInBytes", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-Exon17#A15G629Rcrypticsplice", + "rdfs:comment": "Size of dataset entity in bytes. Auto-calculated by Synapse.", + "rdfs:label": "DatasetSizeInBytes", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- Exon 17 #A15 G629R cryptic splice", + "sms:displayName": "datasetSizeInBytes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lis42NF11N", + "@id": "bts:Infancy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lis42NF11N", + "rdfs:label": "Infancy", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DiagnosisAgeGroup" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Lis42_NF1_1N", + "sms:displayName": "infancy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ELK-TADLuciferaseReporterHEK293StableNF1-/-", + "@id": "bts:Childhood", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ELK-TADLuciferaseReporterHEK293StableNF1-/-", + "rdfs:label": "Childhood", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DiagnosisAgeGroup" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ELK-TAD Luciferase Reporter HEK293 Stable NF1 -/-", + "sms:displayName": "childhood", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Humanforeskinfibroblasts", + "@id": "bts:Adolescence", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Humanforeskinfibroblasts", + "rdfs:label": "Adolescence", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DiagnosisAgeGroup" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "human foreskin fibroblasts", + "sms:displayName": "adolescence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF00.10a", + "@id": "bts:Adulthood", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF00.10a", + "rdfs:label": "Adulthood", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DiagnosisAgeGroup" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF00.10a", + "sms:displayName": "adulthood", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR1947XmNf1cDNA", + "@id": "bts:ReferenceSequence", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR1947XmNf1cDNA", + "rdfs:comment": "Syntactic sequences that has a role as reference of an annotation.", + "rdfs:label": "ReferenceSequence", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R1947X mNf1 cDNA", + "sms:displayName": "referenceSequence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-/-Epitheliallungcells", + "@id": "bts:Parentaffected", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-/-Epitheliallungcells", + "rdfs:label": "Parentaffected", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Inheritance" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-/- Epithelial lung cells", + "sms:displayName": "parent affected", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf2-/-SchwannSC(mouse)(PMID26554010)", + "@id": "bts:Parentnotaffected", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf2-/-SchwannSC(mouse)(PMID26554010)", + "rdfs:label": "Parentnotaffected", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Inheritance" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf2-/- Schwann SC (mouse) (PMID26554010)", + "sms:displayName": "parent not affected", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:STS-26T", + "@id": "bts:Mg/mL", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "STS-26T", + "rdfs:label": "Mg/mL", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ConcentrationMaterialUnit" + }, + { + "@id": "bts:ConcentrationNaClUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "STS-26T", + "sms:displayName": "mg/mL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR461XmNf1cDNA", + "@id": "bts:MM", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR461XmNf1cDNA", + "rdfs:label": "MM", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ConcentrationMaterialUnit" + }, + { + "@id": "bts:ConcentrationNaClUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R461X mNf1 cDNA", + "sms:displayName": "mM", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:I28cNF", + "@id": "bts:Particles/mL", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "I28cNF", + "rdfs:label": "Particles/mL", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:ConcentrationMaterialUnit" + }, + { + "@id": "bts:ConcentrationNaClUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "i28cNF", + "sms:displayName": "particles/mL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SNF94.3", + "@id": "bts:IsPrimaryCell", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "SNF94.3", + "rdfs:comment": "Whether or not cellType is primary (Yes; No)", + "rdfs:label": "IsPrimaryCell", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sNF94.3", + "schema:rangeIncludes": [ + { + "@id": "bts:Yes" + }, + { + "@id": "bts:No" + } + ], + "sms:displayName": "isPrimaryCell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-/-skin-derivedprecursorcells", + "@id": "bts:Electrode", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-/-skin-derivedprecursorcells", + "rdfs:label": "Electrode", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:RecordingSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-/- skin-derived precursor cells", + "sms:displayName": "electrode", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTipn02.8", + "@id": "bts:Tetrode", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTipn02.8", + "rdfs:label": "Tetrode", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:RecordingSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT ipn02.8", + "sms:displayName": "tetrode", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dhh-Cre;NF1Arg681*/floxSchwannCells", + "@id": "bts:Shank", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dhh-Cre;NF1Arg681*/floxSchwannCells", + "rdfs:label": "Shank", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:RecordingSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Dhh-Cre; NF1Arg681*/flox Schwann Cells", + "sms:displayName": "shank", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KCL024", + "@id": "bts:Utaharray", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "KCL024", + "rdfs:label": "Utaharray", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:RecordingSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "KCL024", + "sms:displayName": "Utah array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IcNF97.2b", + "@id": "bts:Otherelectrodearray", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IcNF97.2b", + "rdfs:label": "Otherelectrodearray", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:RecordingSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "icNF97.2b", + "sms:displayName": "other electrode array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HeLaSilenciXNF1", + "@id": "bts:CNVkit", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HeLaSilenciXNF1", + "rdfs:label": "CNVkit", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HeLa SilenciX NF1", + "sms:displayName": "CNVkit", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF95.11bC/T", + "@id": "bts:DeepVariant", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF95.11bC/T", + "rdfs:label": "DeepVariant", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF95.11b C/T", + "sms:displayName": "DeepVariant", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-Exon47insT#14", + "@id": "bts:DESeq2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-Exon47insT#14", + "rdfs:label": "DESeq2", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- Exon 47 insT #14", + "sms:displayName": "DESeq2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HS-PSS", + "@id": "bts:FastQC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HS-PSS", + "rdfs:label": "FastQC", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HS-PSS", + "sms:displayName": "FastQC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:YST-1", + "@id": "bts:FreeBayes", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "YST-1", + "rdfs:label": "FreeBayes", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "YST-1", + "sms:displayName": "FreeBayes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:M3MPNST", + "@id": "bts:GATKBaseRecalibration", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "M3MPNST", + "rdfs:label": "GATKBaseRecalibration", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "M3 MPNST", + "sms:displayName": "GATK BaseRecalibration", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:S462.TY", + "@id": "bts:GATKMarkDuplicates", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "S462.TY", + "rdfs:label": "GATKMarkDuplicates", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "S462.TY", + "sms:displayName": "GATK MarkDuplicates", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:S462", + "@id": "bts:MultiQC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "S462", + "rdfs:label": "MultiQC", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "S462", + "sms:displayName": "MultiQC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-Exon17#B48G629Rcrypticsplice", + "@id": "bts:Mutect2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-Exon17#B48G629Rcrypticsplice", + "rdfs:label": "Mutect2", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- Exon 17 #B48 G629R cryptic splice", + "sms:displayName": "Mutect2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GM11602", + "@id": "bts:Sarek", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GM11602", + "rdfs:label": "Sarek", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GM11602", + "sms:displayName": "Sarek", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lis47NF12N", + "@id": "bts:STARandSalmon", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lis47NF12N", + "rdfs:label": "STARandSalmon", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Lis47_NF1_2N", + "sms:displayName": "STAR and Salmon", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1sipnNF95.12B", + "@id": "bts:Strelka2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1sipnNF95.12B", + "rdfs:label": "Strelka2", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 sipnNF95.12B", + "sms:displayName": "Strelka2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:KCL025", + "@id": "bts:StringTie", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "KCL025", + "rdfs:label": "StringTie", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "KCL025", + "sms:displayName": "StringTie", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SchwanncellNF1-/-withR816XmNf1cDNA", + "@id": "bts:TrimGalore", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SchwanncellNF1-/-withR816XmNf1cDNA", + "rdfs:label": "TrimGalore", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Workflow" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwann cell NF1 -/- with R816X mNf1 cDNA", + "sms:displayName": "TrimGalore", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HiPSC-SCP", + "@id": "bts:Cerebralcortex", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HiPSC-SCP", + "rdfs:label": "Cerebralcortex", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hiPSC-SCP", + "sms:displayName": "cerebral cortex", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SNF96.2", + "@id": "bts:Bonemarrow", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SNF96.2", + "rdfs:label": "Bonemarrow", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" + }, + { + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sNF96.2", + "sms:displayName": "bone marrow", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF98.4c", + "@id": "bts:Plasma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF98.4c", + "rdfs:label": "Plasma", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF98.4c", + "sms:displayName": "plasma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NF1-R68XEmbryoniccells", + "@id": "bts:DorsalRootGanglion", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NF1-R68XEmbryoniccells", + "rdfs:label": "DorsalRootGanglion", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NF1-R68X Embryonic cells", + "sms:displayName": "Dorsal Root Ganglion", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BJFF.6", + "@id": "bts:Opticnerve", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BJFF.6", + "rdfs:label": "Opticnerve", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BJFF.6", + "sms:displayName": "optic nerve", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ben-Men-1", + "@id": "bts:Tumor-adjacentnormal", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ben-Men-1", + "rdfs:label": "Tumor-adjacentnormal", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Ben-Men-1", + "sms:displayName": "tumor-adjacent normal", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR816XmNf1cDNA", + "@id": "bts:Serum", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR816XmNf1cDNA", + "rdfs:label": "Serum", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R816X mNf1 cDNA", + "sms:displayName": "serum", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF05.5", + "@id": "bts:Spheroid", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF05.5", + "rdfs:label": "Spheroid", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF05.5", + "sms:displayName": "spheroid", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:I18cNF", + "@id": "bts:Sciaticnerve", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "I18cNF", + "rdfs:label": "Sciaticnerve", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "i18cNF", + "sms:displayName": "sciatic nerve", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTSCipn97.4", + "@id": "bts:Meninges", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTSCipn97.4", + "rdfs:label": "Meninges", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT SC ipn97.4", + "sms:displayName": "meninges", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:I21cNF", + "@id": "bts:Nervetissue", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "I21cNF", + "rdfs:label": "Nervetissue", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "i21cNF", + "sms:displayName": "nerve tissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF98.4d", + "@id": "bts:BuccalMucosa", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF98.4d", + "rdfs:label": "BuccalMucosa", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF98.4d", + "sms:displayName": "Buccal Mucosa", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:28cNF", + "@id": "bts:Embryonictissue", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "28cNF", + "rdfs:label": "Embryonictissue", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "28cNF", + "sms:displayName": "embryonic tissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SC4[Mouseschwannoma]", + "@id": "bts:Wholebrain", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SC4[Mouseschwannoma]", + "rdfs:label": "Wholebrain", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SC4 [Mouse schwannoma]", + "sms:displayName": "whole brain", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF18.1a", + "@id": "bts:Microtissue", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF18.1a", + "rdfs:label": "Microtissue", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF18.1a", + "sms:displayName": "microtissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1Arg681*/Arg681*ES", + "@id": "bts:Retina", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1Arg681*/Arg681*ES", + "rdfs:label": "Retina", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1Arg681*/Arg681* ES", + "sms:displayName": "retina", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GM11601", + "@id": "bts:CDXtissue", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GM11601", + "rdfs:label": "CDXtissue", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GM11601", + "sms:displayName": "CDX tissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HEK293NF1-/-withR2550XmNf1cDNA", + "@id": "bts:Organoid", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HEK293NF1-/-withR2550XmNf1cDNA", + "rdfs:label": "Organoid", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HEK293 NF1 -/- with R2550X mNf1 cDNA", + "sms:displayName": "organoid", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JH-2-103-CL", + "@id": "bts:Splenocyte", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JH-2-103-CL", + "rdfs:label": "Splenocyte", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JH-2-103-CL", + "sms:displayName": "splenocyte", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HS-Sch-2", + "@id": "bts:Blood", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HS-Sch-2", + "rdfs:label": "Blood", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Organ" + }, + { + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HS-Sch-2", + "sms:displayName": "blood", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipn02.32λ", + "@id": "bts:Connectivetissue", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipn02.32λ", + "rdfs:label": "Connectivetissue", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipn02.3 2λ", + "sms:displayName": "connective tissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ELK-TADLuciferaseReporterHEK293Stable", + "@id": "bts:Primarytumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ELK-TADLuciferaseReporterHEK293Stable", + "rdfs:label": "Primarytumor", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ELK-TAD Luciferase Reporter HEK293 Stable", + "sms:displayName": "primary tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:6PNFSiPSrvPM2", + "@id": "bts:PDXtissue", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "6PNFSiPSrvPM2", + "rdfs:label": "PDXtissue", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "6PNF_SiPSrv_PM_2", + "sms:displayName": "PDX tissue", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF03.3", + "@id": "bts:BuffyCoat", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF03.3", + "rdfs:label": "BuffyCoat", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:TransplantationRecipientTissue" + }, + { + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF03.3", + "sms:displayName": "Buffy Coat", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JH-2-079-CL", + "@id": "bts:Saliva", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JH-2-079-CL", + "rdfs:label": "Saliva", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JH-2-079-CL", + "sms:displayName": "saliva", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF04.4", + "@id": "bts:Mucus", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF04.4", + "rdfs:label": "Mucus", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF04.4", + "sms:displayName": "mucus", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1Arg681*/Arg681*MEFs", + "@id": "bts:Urine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1Arg681*/Arg681*MEFs", + "rdfs:label": "Urine", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1Arg681*/Arg681* MEFs", + "sms:displayName": "urine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1Arg681*/+ES", + "@id": "bts:Stool", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1Arg681*/+ES", + "rdfs:label": "Stool", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1Arg681*/+ ES", + "sms:displayName": "stool", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF97.2a", + "@id": "bts:Sweat", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF97.2a", + "rdfs:label": "Sweat", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:SpecimenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF97.2a", + "sms:displayName": "sweat", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwanncelli28cNFNF1-/-(#14)", + "@id": "bts:DatasetItemCount", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Schwanncelli28cNFNF1-/-(#14)", + "rdfs:comment": "Count of files in dataset. Auto-calculated by Synapse.", + "rdfs:label": "DatasetItemCount", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwann cell i28cNF NF1 -/- (#14)", + "sms:displayName": "datasetItemCount", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF00.6", + "@id": "bts:DataFileHandleId", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF00.6", + "rdfs:comment": "(Files only) Refers to the id of the file.", + "rdfs:label": "DataFileHandleId", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF00.6", + "sms:displayName": "dataFileHandleId", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NCC-MPNST3-X2-C1", + "@id": "bts:IndividualIdSource", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "NCC-MPNST3-X2-C1", + "rdfs:comment": "Database or repository to which individual ID maps", + "rdfs:label": "IndividualIdSource", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NCC-MPNST3-X2-C1", + "sms:displayName": "individualIdSource", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JHU2-002-PDX", + "@id": "bts:Immunoassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JHU2-002-PDX", + "rdfs:label": "Immunoassay", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" + }, + { + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "JHU 2-002-PDX", + "sms:displayName": "immunoassay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipNF95.11bC", + "@id": "bts:Behaviorprocess", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipNF95.11bC", + "rdfs:label": "Behaviorprocess", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipNF95.11b C", + "sms:displayName": "behavior process", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:5PNFTDiPSsvMM4", + "@id": "bts:Clinical", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "5PNFTDiPSsvMM4", + "rdfs:label": "Clinical", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "5PNF_TDiPSsv_MM_4", + "sms:displayName": "clinical", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTNF1ipn06.2A", + "@id": "bts:Demographics", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTNF1ipn06.2A", + "rdfs:label": "Demographics", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT NF1 ipn06.2 A", + "sms:displayName": "demographics", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HTERTSCipn02.8", + "@id": "bts:Particlecharacterization", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HTERTSCipn02.8", + "rdfs:label": "Particlecharacterization", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "hTERT SC ipn02.8", + "sms:displayName": "particle characterization", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SZ-NF2", + "@id": "bts:DrugCombinationScreen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SZ-NF2", + "rdfs:label": "DrugCombinationScreen", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SZ-NF2", + "sms:displayName": "drugCombinationScreen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SMPNST", + "@id": "bts:IsoformExpression", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SMPNST", + "rdfs:label": "IsoformExpression", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sMPNST", + "sms:displayName": "isoformExpression", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B6;129S2-Trp53tm1TyjNf1tm1Tyj/J", + "@id": "bts:Proteomics", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B6;129S2-Trp53tm1TyjNf1tm1Tyj/J", + "rdfs:label": "Proteomics", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B6;129S2-Trp53tm1Tyj Nf1tm1Tyj/J", + "sms:displayName": "proteomics", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Prss56Cre;R26mT", + "@id": "bts:SurveyData", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Prss56Cre;R26mT", + "rdfs:label": "SurveyData", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Prss56Cre;R26mT", + "sms:displayName": "surveyData", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B6.129S1-Nf1tm1Cbr/J", + "@id": "bts:Kinomics", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B6.129S1-Nf1tm1Cbr/J", + "rdfs:label": "Kinomics", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B6.129S1-Nf1tm1Cbr/J", + "sms:displayName": "kinomics", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-OPG", + "@id": "bts:SomaticVariants", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-OPG", + "rdfs:label": "SomaticVariants", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-OPG", + "sms:displayName": "SomaticVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:C57BL/6J", + "@id": "bts:Volume", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "C57BL/6J", + "rdfs:label": "Volume", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "C57BL/6J", + "sms:displayName": "Volume", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NRG", + "@id": "bts:Characteristic", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NRG", + "rdfs:label": "Characteristic", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NRG", + "sms:displayName": "characteristic", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-OPG-Arg816", + "@id": "bts:GeneExpression", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-OPG-Arg816", + "rdfs:label": "GeneExpression", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-OPG-Arg816", + "sms:displayName": "geneExpression", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NODscidgamma", + "@id": "bts:AlignedReads", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NODscidgamma", + "rdfs:label": "AlignedReads", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NOD scid gamma", + "sms:displayName": "AlignedReads", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B6.129S2-Nf1tm1Tyj/J", + "@id": "bts:GenomicFeatures", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B6.129S2-Nf1tm1Tyj/J", + "rdfs:label": "GenomicFeatures", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B6.129S2-Nf1tm1Tyj/J", + "sms:displayName": "genomicFeatures", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B6;129-Trp53tm1TyjNf1tm1TyjSuz12Gt(Betageo)1Khe/KcichJ", + "@id": "bts:GenomicVariants", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B6;129-Trp53tm1TyjNf1tm1TyjSuz12Gt(Betageo)1Khe/KcichJ", + "rdfs:label": "GenomicVariants", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B6;129-Trp53tm1Tyj Nf1tm1Tyj Suz12Gt(Betageo)1Khe/KcichJ", + "sms:displayName": "genomicVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B6.129(Cg)-Nf1tm1Par/J", + "@id": "bts:Rawcounts", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B6.129(Cg)-Nf1tm1Par/J", + "rdfs:label": "Rawcounts", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B6.129(Cg)-Nf1tm1Par/J", + "sms:displayName": "raw counts", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GFAP-Cre;Nf1-G848R/Flox", + "@id": "bts:RawIntensities", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GFAP-Cre;Nf1-G848R/Flox", + "rdfs:label": "RawIntensities", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GFAP-Cre; Nf1-G848R/Flox", + "sms:displayName": "RawIntensities", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GFAP-Cre;Nf1-R681X/Flox", + "@id": "bts:NormalizedIntensities", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GFAP-Cre;Nf1-R681X/Flox", + "rdfs:label": "NormalizedIntensities", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GFAP-Cre; Nf1-R681X/Flox", + "sms:displayName": "NormalizedIntensities", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GFAP-Cre;Nf1-C383X/Flox", + "@id": "bts:PharmacokineticStudy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GFAP-Cre;Nf1-C383X/Flox", + "rdfs:label": "PharmacokineticStudy", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GFAP-Cre; Nf1-C383X/Flox", + "sms:displayName": "Pharmacokinetic Study", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-C848R/Flox", + "@id": "bts:Maskimage", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-C848R/Flox", + "rdfs:label": "Maskimage", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-C848R/Flox", + "sms:displayName": "mask image", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-R681X/Flox", + "@id": "bts:ChromatinActivity", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-R681X/Flox", + "rdfs:label": "ChromatinActivity", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-R681X/Flox", + "sms:displayName": "chromatinActivity", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1-C383X/Flox", + "@id": "bts:StructuralVariants", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1-C383X/Flox", + "rdfs:label": "StructuralVariants", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1-C383X/Flox", + "sms:displayName": "StructuralVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1flox/flox", + "@id": "bts:GermlineVariants", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nf1flox/flox", + "rdfs:label": "GermlineVariants", "rdfs:subClassOf": [ { - "@id": "bts:ModelSystemName" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nf1flox/flox", + "sms:displayName": "GermlineVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DermalNeurofibromas", + "@id": "bts:CopyNumberVariants", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Dermal neurofibromas.", - "rdfs:label": "DermalNeurofibromas", + "rdfs:comment": "TBD", + "rdfs:label": "CopyNumberVariants", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Scattered" - }, - { - "@id": "bts:Dense" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "dermalNeurofibromas", + "sms:displayName": "CopyNumberVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PlateWell", + "@id": "bts:Image", "@type": "rdfs:Class", - "rdfs:comment": "User-specified identifier for the specific well of the plate used to prepare the sample for analysis.", - "rdfs:label": "PlateWell", + "rdfs:comment": "TBD", + "rdfs:label": "Image", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "plateWell", + "sms:displayName": "image", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChipID", + "@id": "bts:Network", "@type": "rdfs:Class", - "rdfs:comment": "User-specified identifier for the chip used to perform the methylation microarray.", - "rdfs:label": "ChipID", + "rdfs:comment": "TBD", + "rdfs:label": "Network", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "chipID", + "sms:displayName": "network", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProteinExtractSource", + "@id": "bts:CellularPhysiology", "@type": "rdfs:Class", - "rdfs:comment": "Source of the extracted protein used in the experiment", - "rdfs:label": "ProteinExtractSource", + "rdfs:comment": "TBD", + "rdfs:label": "CellularPhysiology", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Celllysate" - }, - { - "@id": "bts:Cytoplasm" - }, - { - "@id": "bts:Mitochondria" - }, - { - "@id": "bts:Nuclearextract" - } - ], - "sms:displayName": "proteinExtractSource", + "sms:displayName": "cellularPhysiology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Celllysate", + "@id": "bts:Metabolomics", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Celllysate", + "rdfs:label": "Metabolomics", "rdfs:subClassOf": [ { - "@id": "bts:ProteinExtractSource" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cell lysate", + "sms:displayName": "metabolomics", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cytoplasm", + "@id": "bts:AnnotatedSomaticVariants", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cytoplasm", + "rdfs:label": "AnnotatedSomaticVariants", "rdfs:subClassOf": [ { - "@id": "bts:ProteinExtractSource" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cytoplasm", + "sms:displayName": "AnnotatedSomaticVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nuclearextract", + "@id": "bts:AnnotatedGermlineVariants", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nuclearextract", + "rdfs:label": "AnnotatedGermlineVariants", "rdfs:subClassOf": [ { - "@id": "bts:ProteinExtractSource" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nuclear extract", + "sms:displayName": "AnnotatedGermlineVariants", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DataCollectionMode", + "@id": "bts:Weight", "@type": "rdfs:Class", - "rdfs:comment": "Mode of data collection in tandem MS assays. Either DDA (data-dependent acquisition) or DIA (data-independent) acquisition.", - "rdfs:label": "DataCollectionMode", + "rdfs:comment": "TBD", + "rdfs:label": "Weight", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:DDA" - }, - { - "@id": "bts:DIA" - }, - { - "@id": "bts:Other" - } - ], - "sms:displayName": "dataCollectionMode", - "sms:required": "sms:true", + "sms:displayName": "Weight", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DDA", + "@id": "bts:Electrophysiology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DDA", + "rdfs:label": "Electrophysiology", "rdfs:subClassOf": [ { - "@id": "bts:DataCollectionMode" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DDA", + "sms:displayName": "electrophysiology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DIA", + "@id": "bts:Audiotranscript", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DIA", + "rdfs:label": "Audiotranscript", "rdfs:subClassOf": [ { - "@id": "bts:DataCollectionMode" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DIA", + "sms:displayName": "audio transcript", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BodySite", + "@id": "bts:DataIndex", "@type": "rdfs:Class", - "rdfs:comment": "Sample location referring to a named area of the body, inclusive of gross anatomical structures and organ parts.", - "rdfs:label": "BodySite", + "rdfs:comment": "TBD", + "rdfs:label": "DataIndex", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Axilla" - }, - { - "@id": "bts:Groin" - }, - { - "@id": "bts:Leg" - }, - { - "@id": "bts:Thoracicspine" - }, - { - "@id": "bts:Forearm" - }, - { - "@id": "bts:Acetabulum" - }, - { - "@id": "bts:Muscle" - }, - { - "@id": "bts:Finger" - }, - { - "@id": "bts:Iliacspine" - }, - { - "@id": "bts:Head" - }, - { - "@id": "bts:Neck" - }, - { - "@id": "bts:Shoulder" - }, - { - "@id": "bts:Back" - }, - { - "@id": "bts:Spine" - }, - { - "@id": "bts:Scalp" - }, - { - "@id": "bts:Scapula" - }, - { - "@id": "bts:Pelvis" - }, - { - "@id": "bts:Dorsolateralprefrontalcortex" - }, - { - "@id": "bts:Occcipitallobe" - } - ], - "sms:displayName": "bodySite", + "sms:displayName": "dataIndex", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Axilla", + "@id": "bts:DescriptiveMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Axilla", + "rdfs:label": "DescriptiveMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "axilla", + "sms:displayName": "Descriptive Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Groin", + "@id": "bts:StructuralMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Groin", + "rdfs:label": "StructuralMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "groin", + "sms:displayName": "Structural Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Leg", + "@id": "bts:AdministrativeMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Leg", + "rdfs:label": "AdministrativeMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "leg", + "sms:displayName": "Administrative Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Thoracicspine", + "@id": "bts:ReferenceMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Thoracicspine", + "rdfs:label": "ReferenceMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "thoracic spine", + "sms:displayName": "Reference Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Forearm", + "@id": "bts:StatisticalMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Forearm", + "rdfs:label": "StatisticalMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "forearm", + "sms:displayName": "Statistical Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Acetabulum", + "@id": "bts:LegalMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Acetabulum", + "rdfs:label": "LegalMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "acetabulum", + "sms:displayName": "Legal Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Muscle", + "@id": "bts:WorkflowMetadata", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Muscle", + "rdfs:label": "WorkflowMetadata", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "muscle", + "sms:displayName": "Workflow Metadata", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Finger", + "@id": "bts:0", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Finger", + "rdfs:label": "0", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:WHOPerformanceStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "finger", + "sms:displayName": "0", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Iliacspine", + "@id": "bts:CurrentVersion", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Iliacspine", + "rdfs:comment": "(Versionable entities only) The current version number of the resource.", + "rdfs:label": "CurrentVersion", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iliac spine", + "sms:displayName": "currentVersion", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Head", + "@id": "bts:Normalized", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Head", + "rdfs:label": "Normalized", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataSubtype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "head", + "sms:displayName": "normalized", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Neck", + "@id": "bts:DataMatrix", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Neck", + "rdfs:label": "DataMatrix", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataSubtype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "neck", + "sms:displayName": "dataMatrix", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Shoulder", + "@id": "bts:Processed", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Shoulder", + "rdfs:label": "Processed", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataSubtype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "shoulder", + "sms:displayName": "processed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Back", + "@id": "bts:Representative", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Back", + "rdfs:label": "Representative", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:DataSubtype" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "back", + "sms:displayName": "representative", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Spine", + "@id": "bts:Kidney", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Spine", + "rdfs:label": "Kidney", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "spine", + "sms:displayName": "kidney", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Scalp", + "@id": "bts:Ovary", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Scalp", + "rdfs:label": "Ovary", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "scalp", + "sms:displayName": "ovary", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Scapula", + "@id": "bts:Lung", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Scapula", + "rdfs:label": "Lung", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "scapula", + "sms:displayName": "lung", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pelvis", + "@id": "bts:Prostate", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pelvis", + "rdfs:label": "Prostate", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pelvis", + "sms:displayName": "prostate", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dorsolateralprefrontalcortex", + "@id": "bts:Breast", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dorsolateralprefrontalcortex", + "rdfs:label": "Breast", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dorsolateral prefrontal cortex", + "sms:displayName": "breast", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Occcipitallobe", + "@id": "bts:Mesentery", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Occcipitallobe", + "rdfs:label": "Mesentery", "rdfs:subClassOf": [ { - "@id": "bts:BodySite" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "occcipital lobe", + "sms:displayName": "mesentery", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LongBoneDysplasia", + "@id": "bts:Mammarygland", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Long bone dysplasia.", - "rdfs:label": "LongBoneDysplasia", + "rdfs:comment": "TBD", + "rdfs:label": "Mammarygland", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "longBoneDysplasia", + "sms:displayName": "mammary gland", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LibraryPrep", + "@id": "bts:Colon", "@type": "rdfs:Class", - "rdfs:comment": "The general strategy by which the library was prepared", - "rdfs:label": "LibraryPrep", + "rdfs:comment": "TBD", + "rdfs:label": "Colon", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:LncRNAenrichment" - }, - { - "@id": "bts:MiRNAenrichment" - }, - { - "@id": "bts:PolyAselection" - }, - { - "@id": "bts:RRNAdepletion" - } - ], - "sms:displayName": "libraryPrep", + "sms:displayName": "colon", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LncRNAenrichment", + "@id": "bts:Spleen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LncRNAenrichment", + "rdfs:label": "Spleen", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPrep" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lncRNAenrichment", + "sms:displayName": "spleen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MiRNAenrichment", + "@id": "bts:BursaOfFabricius", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MiRNAenrichment", + "rdfs:label": "BursaOfFabricius", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPrep" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "miRNAenrichment", + "sms:displayName": "Bursa Of Fabricius", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PolyAselection", + "@id": "bts:Nose", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PolyAselection", + "rdfs:label": "Nose", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPrep" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "polyAselection", + "sms:displayName": "nose", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RRNAdepletion", + "@id": "bts:Brain", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RRNAdepletion", + "rdfs:label": "Brain", "rdfs:subClassOf": [ { - "@id": "bts:LibraryPrep" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "rRNAdepletion", + "sms:displayName": "brain", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TumorType", + "@id": "bts:Pancreas", "@type": "rdfs:Class", - "rdfs:comment": "The type of tumor that the biospecimen used to generate the data were collected from.", - "rdfs:label": "TumorType", + "rdfs:comment": "TBD", + "rdfs:label": "Pancreas", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:DiffuseAstrocytoma" - }, - { - "@id": "bts:SubcutaneousNeurofibroma" - }, - { - "@id": "bts:PilomyxoidAstrocytoma" - }, - { - "@id": "bts:JuvenileMyelomonocyticLeukemia" - }, - { - "@id": "bts:AnaplasticAstrocytoma" - }, - { - "@id": "bts:MalignantPeripheralNerveSheathTumor" - }, - { - "@id": "bts:LocalizedNeurofibroma" - }, - { - "@id": "bts:CutaneousNeurofibroma" - }, - { - "@id": "bts:ColorectalAdenocarcinoma" - }, - { - "@id": "bts:AnaplasticPilocyticAstrocytoma" - }, - { - "@id": "bts:Schwannoma" - }, - { - "@id": "bts:HemorrhagicNeoplasm" - }, - { - "@id": "bts:NotApplicable" - }, - { - "@id": "bts:PilocyticAstrocytoma" - }, - { - "@id": "bts:Ganglioglioma" - }, - { - "@id": "bts:PlexiformNeurofibroma" - }, - { - "@id": "bts:NF2-AssociatedTumor" - }, - { - "@id": "bts:Fibrosarcoma" - }, - { - "@id": "bts:Low-GradeGliomaNOS" - }, - { - "@id": "bts:Glioblastoma" - }, - { - "@id": "bts:AnaplasticPleomorphicXanthoastrocytoma" - }, - { - "@id": "bts:GlioblastomaMultiforme" - }, - { - "@id": "bts:Unknown" - }, - { - "@id": "bts:AtypicalPilocyticAstrocytoma" - }, - { - "@id": "bts:OpticPathwayGlioma" - }, - { - "@id": "bts:DiffuseInfiltratingNeurofibroma" - }, - { - "@id": "bts:Fibromatosis" - }, - { - "@id": "bts:NeurofibromawithDegenerativeAtypia" - }, - { - "@id": "bts:NecroticNeoplasm" - }, - { - "@id": "bts:PleomorphicXanthoastrocytoma" - }, - { - "@id": "bts:Teratoma" - }, - { - "@id": "bts:Sarcoma" - }, - { - "@id": "bts:MassiveSoftTissueNeurofibroma" - }, - { - "@id": "bts:Glioma" - }, - { - "@id": "bts:Oligoastrocytoma" - }, - { - "@id": "bts:ColorectalCarcinoma" - }, - { - "@id": "bts:Meningioma" - }, - { - "@id": "bts:ANNUBP" - }, - { - "@id": "bts:High-GradeGliomaNOS" - }, - { - "@id": "bts:NF1-AssociatedTumor" - }, - { - "@id": "bts:AtypicalNeurofibroma" - }, - { - "@id": "bts:CellularNeurofibroma" - }, - { - "@id": "bts:Neurofibroma" - }, - { - "@id": "bts:RecurrentMPNST" - }, - { - "@id": "bts:AnaplasticGanglioglioma" - }, - { - "@id": "bts:Tumor" - }, - { - "@id": "bts:Metastatictumor" - }, - { - "@id": "bts:Metastatic/recurrenttumor" - }, - { - "@id": "bts:Recurrenttumor" - }, - { - "@id": "bts:Melanoma" - }, - { - "@id": "bts:NodularNeurofibroma" - } - ], - "sms:displayName": "tumorType", - "sms:required": "sms:true", + "sms:displayName": "pancreas", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DiffuseAstrocytoma", + "@id": "bts:Liver", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DiffuseAstrocytoma", + "rdfs:label": "Liver", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Diffuse Astrocytoma", + "sms:displayName": "liver", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SubcutaneousNeurofibroma", + "@id": "bts:Lymphnode", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SubcutaneousNeurofibroma", + "rdfs:label": "Lymphnode", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Subcutaneous Neurofibroma", + "sms:displayName": "lymph node", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PilomyxoidAstrocytoma", + "@id": "bts:Nerves", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PilomyxoidAstrocytoma", + "rdfs:label": "Nerves", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pilomyxoid Astrocytoma", + "sms:displayName": "nerves", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:JuvenileMyelomonocyticLeukemia", + "@id": "bts:Skin", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "JuvenileMyelomonocyticLeukemia", + "rdfs:label": "Skin", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Juvenile Myelomonocytic Leukemia", + "sms:displayName": "skin", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnaplasticAstrocytoma", + "@id": "bts:Eye", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AnaplasticAstrocytoma", + "rdfs:label": "Eye", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Organ" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Anaplastic Astrocytoma", + "sms:displayName": "eye", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MalignantPeripheralNerveSheathTumor", + "@id": "bts:Id", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "MalignantPeripheralNerveSheathTumor", + "rdfs:comment": "The entity id for the resource automatically assigned by the platform.", + "rdfs:label": "Id", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Malignant Peripheral Nerve Sheath Tumor", + "sms:displayName": "id", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LocalizedNeurofibroma", + "@id": "bts:IsXenograft", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "LocalizedNeurofibroma", + "rdfs:comment": "Whether or not sample source is a xenograft (Yes; No)", + "rdfs:label": "IsXenograft", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Localized Neurofibroma", + "schema:rangeIncludes": [ + { + "@id": "bts:Yes" + }, + { + "@id": "bts:No" + } + ], + "sms:displayName": "isXenograft", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CutaneousNeurofibroma", + "@id": "bts:ResourceId", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "CutaneousNeurofibroma", + "rdfs:comment": "A UUID for a Resource from the NF Research Tools Database", + "rdfs:label": "ResourceId", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cutaneous Neurofibroma", + "sms:displayName": "Resource_id", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ColorectalAdenocarcinoma", + "@id": "bts:LenticularOpacity", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "ColorectalAdenocarcinoma", + "rdfs:comment": "Characterization of the manifestation of Lenticular opacity.", + "rdfs:label": "LenticularOpacity", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Colorectal Adenocarcinoma", + "schema:rangeIncludes": [ + { + "@id": "bts:Absent" + }, + { + "@id": "bts:Present" + }, + { + "@id": "bts:Unknown" + } + ], + "sms:displayName": "lenticularOpacity", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnaplasticPilocyticAstrocytoma", + "@id": "bts:DrugScreenType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "AnaplasticPilocyticAstrocytoma", + "rdfs:comment": "String describing general class of drug screen", + "rdfs:label": "DrugScreenType", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Anaplastic Pilocytic Astrocytoma", + "schema:rangeIncludes": [ + { + "@id": "bts:Combinationlibraryscreen" + }, + { + "@id": "bts:Combinationscreen" + }, + { + "@id": "bts:Singlemolecule" + }, + { + "@id": "bts:Smallmoleculelibraryscreen" + } + ], + "sms:displayName": "drugScreenType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwannoma", + "@id": "bts:Combinationlibraryscreen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Schwannoma", + "rdfs:label": "Combinationlibraryscreen", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:DrugScreenType" }, { - "@id": "bts:TumorType" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "schwannoma", + "sms:displayName": "combination library screen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HemorrhagicNeoplasm", + "@id": "bts:Combinationscreen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HemorrhagicNeoplasm", + "rdfs:label": "Combinationscreen", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:DrugScreenType" + }, + { + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Hemorrhagic Neoplasm", + "sms:displayName": "combination screen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PilocyticAstrocytoma", + "@id": "bts:Singlemolecule", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PilocyticAstrocytoma", + "rdfs:label": "Singlemolecule", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:DrugScreenType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pilocytic Astrocytoma", + "sms:displayName": "single molecule", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ganglioglioma", + "@id": "bts:Smallmoleculelibraryscreen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ganglioglioma", + "rdfs:label": "Smallmoleculelibraryscreen", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:DrugScreenType" + }, + { + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Ganglioglioma", + "sms:displayName": "small molecule library screen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PlexiformNeurofibroma", + "@id": "bts:HEK293NF1-/-withWTmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PlexiformNeurofibroma", + "rdfs:label": "HEK293NF1-/-withWTmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Plexiform Neurofibroma", + "sms:displayName": "HEK293 NF1 -/- with WT mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NF2-AssociatedTumor", + "@id": "bts:SZ-NF4", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NF2-AssociatedTumor", + "rdfs:label": "SZ-NF4", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NF2-Associated Tumor", + "sms:displayName": "SZ-NF4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fibrosarcoma", + "@id": "bts:Nf1-/-HEK293", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fibrosarcoma", + "rdfs:label": "Nf1-/-HEK293", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Fibrosarcoma", + "sms:displayName": "Nf1-/- HEK 293", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Low-GradeGliomaNOS", + "@id": "bts:HEK293NF1-/-Exon52R2550X#5", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Low-GradeGliomaNOS", + "rdfs:label": "HEK293NF1-/-Exon52R2550X#5", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Low-Grade Glioma NOS", + "sms:displayName": "HEK293 NF1 -/- Exon 52 R2550X #5", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Glioblastoma", + "@id": "bts:HBE135-E6E7", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Glioblastoma", + "rdfs:label": "HBE135-E6E7", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Glioblastoma", + "sms:displayName": "HBE135-E6E7", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnaplasticPleomorphicXanthoastrocytoma", + "@id": "bts:NCC-MPNST5-C1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AnaplasticPleomorphicXanthoastrocytoma", + "rdfs:label": "NCC-MPNST5-C1", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Anaplastic Pleomorphic Xanthoastrocytoma", + "sms:displayName": "NCC-MPNST5-C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GlioblastomaMultiforme", + "@id": "bts:Sc93.1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GlioblastomaMultiforme", + "rdfs:label": "Sc93.1", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Glioblastoma Multiforme", + "sms:displayName": "sc93.1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AtypicalPilocyticAstrocytoma", + "@id": "bts:JHU2-079-PDX", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AtypicalPilocyticAstrocytoma", + "rdfs:label": "JHU2-079-PDX", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Atypical Pilocytic Astrocytoma", + "sms:displayName": "JHU 2-079-PDX", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OpticPathwayGlioma", + "@id": "bts:HEK293NF1-/-withR192XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OpticPathwayGlioma", + "rdfs:label": "HEK293NF1-/-withR192XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Optic Pathway Glioma", + "sms:displayName": "HEK293 NF1 -/- with R192X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DiffuseInfiltratingNeurofibroma", + "@id": "bts:IcNF98.4c", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DiffuseInfiltratingNeurofibroma", + "rdfs:label": "IcNF98.4c", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Diffuse Infiltrating Neurofibroma", + "sms:displayName": "icNF98.4c", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fibromatosis", + "@id": "bts:ST88-14", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fibromatosis", + "rdfs:label": "ST88-14", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Fibromatosis", + "sms:displayName": "ST88-14", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NeurofibromawithDegenerativeAtypia", + "@id": "bts:HTERTNF1ipNF95.6", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NeurofibromawithDegenerativeAtypia", + "rdfs:label": "HTERTNF1ipNF95.6", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Neurofibroma with Degenerative Atypia", + "sms:displayName": "hTERT NF1 ipNF95.6", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NecroticNeoplasm", + "@id": "bts:IcNF99.1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NecroticNeoplasm", + "rdfs:label": "IcNF99.1", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Necrotic Neoplasm", + "sms:displayName": "icNF99.1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PleomorphicXanthoastrocytoma", + "@id": "bts:CNF00.10a", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PleomorphicXanthoastrocytoma", + "rdfs:label": "CNF00.10a", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pleomorphic Xanthoastrocytoma", + "sms:displayName": "cNF00.10a", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Teratoma", + "@id": "bts:IPSCY489C;Exon13crypticsplice", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Teratoma", + "rdfs:label": "IPSCY489C;Exon13crypticsplice", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" - }, - { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "teratoma", + "sms:displayName": "iPSC Y489C; Exon 13 cryptic splice", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sarcoma", + "@id": "bts:3PNFSiPSsvMM11", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sarcoma", + "rdfs:label": "3PNFSiPSsvMM11", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Sarcoma", + "sms:displayName": "3PNF_SiPSsv_MM_11", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MassiveSoftTissueNeurofibroma", + "@id": "bts:HTERTNF1ipnNF09.4", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MassiveSoftTissueNeurofibroma", + "rdfs:label": "HTERTNF1ipnNF09.4", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Massive Soft Tissue Neurofibroma", + "sms:displayName": "hTERT NF1 ipnNF09.4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Glioma", + "@id": "bts:S520", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Glioma", + "rdfs:label": "S520", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Glioma", + "sms:displayName": "S520", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Oligoastrocytoma", + "@id": "bts:SchwanncellNF1-/-withR681XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Oligoastrocytoma", + "rdfs:label": "SchwanncellNF1-/-withR681XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oligoastrocytoma", + "sms:displayName": "Schwann cell NF1 -/- with R681X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ColorectalCarcinoma", + "@id": "bts:JH-2-002-CL", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ColorectalCarcinoma", + "rdfs:label": "JH-2-002-CL", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Colorectal Carcinoma", + "sms:displayName": "JH-2-002-CL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Meningioma", + "@id": "bts:NCC-MPNST2-C1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Meningioma", + "rdfs:label": "NCC-MPNST2-C1", "rdfs:subClassOf": [ { - "@id": "bts:CellType" - }, - { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notimaged" - }, - { - "@id": "bts:Absentbyimaging" - }, - { - "@id": "bts:Single" - }, - { - "@id": "bts:Multiple" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "meningioma", + "sms:displayName": "NCC-MPNST2-C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ANNUBP", + "@id": "bts:HEK293NF1-/-withR1306XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ANNUBP", + "rdfs:label": "HEK293NF1-/-withR1306XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ANNUBP", + "sms:displayName": "HEK293 NF1 -/- with R1306X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:High-GradeGliomaNOS", + "@id": "bts:WTES", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "High-GradeGliomaNOS", + "rdfs:label": "WTES", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "High-Grade Glioma NOS", + "sms:displayName": "WT ES", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NF1-AssociatedTumor", + "@id": "bts:Fb93.1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NF1-AssociatedTumor", + "rdfs:label": "Fb93.1", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NF1-Associated Tumor", + "sms:displayName": "Fb93.1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AtypicalNeurofibroma", + "@id": "bts:CNF04.9a", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AtypicalNeurofibroma", + "rdfs:label": "CNF04.9a", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Atypical Neurofibroma", + "sms:displayName": "cNF04.9a", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CellularNeurofibroma", + "@id": "bts:JHU2-103-PDX", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CellularNeurofibroma", + "rdfs:label": "JHU2-103-PDX", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cellular Neurofibroma", + "sms:displayName": "JHU 2-103-PDX", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Neurofibroma", + "@id": "bts:5PNFTDiPSsvPM6", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Neurofibroma", + "rdfs:label": "5PNFTDiPSsvPM6", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Neurofibroma", + "sms:displayName": "5PNF_TDiPSsv_PM_6", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RecurrentMPNST", + "@id": "bts:NCC-MPNST1-C1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RecurrentMPNST", + "rdfs:label": "NCC-MPNST1-C1", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Recurrent MPNST", + "sms:displayName": "NCC-MPNST1-C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnaplasticGanglioglioma", + "@id": "bts:7PNFSiPSrvPM12", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AnaplasticGanglioglioma", + "rdfs:label": "7PNFSiPSrvPM12", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Anaplastic Ganglioglioma", + "sms:displayName": "7PNF_SiPSrv_PM_12", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Metastatictumor", + "@id": "bts:HEK293NF1-/-withR681XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Metastatictumor", + "rdfs:label": "HEK293NF1-/-withR681XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "metastatic tumor", + "sms:displayName": "HEK293 NF1 -/- with R681X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Metastatic/recurrenttumor", + "@id": "bts:GM23338", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Metastatic/recurrenttumor", + "rdfs:label": "GM23338", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "metastatic/recurrent tumor", + "sms:displayName": "GM23338", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Recurrenttumor", + "@id": "bts:HTERTNF1ipnNF95.11c", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Recurrenttumor", + "rdfs:label": "HTERTNF1ipnNF95.11c", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "recurrent tumor", + "sms:displayName": "hTERT NF1 ipnNF95.11c", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Melanoma", + "@id": "bts:T265", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Melanoma", + "rdfs:label": "T265", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Melanoma", + "sms:displayName": "T265", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NodularNeurofibroma", + "@id": "bts:HEK293NF1-/-clone2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NodularNeurofibroma", + "rdfs:label": "HEK293NF1-/-clone2", "rdfs:subClassOf": [ { - "@id": "bts:TumorType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nodular Neurofibroma", + "sms:displayName": "HEK293 NF1 -/- clone 2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WorkingDistance", + "@id": "bts:SNF02.2", "@type": "rdfs:Class", - "rdfs:comment": "Working distance of the lens expressed as a floating point number > 0.", - "rdfs:label": "WorkingDistance", + "rdfs:comment": "TBD", + "rdfs:label": "SNF02.2", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "workingDistance", + "sms:displayName": "sNF02.2", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:WorkingDistanceUnit" - } - ], - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:NonvestibularCranialSchwannoma", + "@id": "bts:IPSCNF1WT", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Nonvestibular cranial schwannoma.", - "rdfs:label": "NonvestibularCranialSchwannoma", + "rdfs:comment": "TBD", + "rdfs:label": "IPSCNF1WT", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notimaged" - }, - { - "@id": "bts:Absentbyimaging" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "nonvestibularCranialSchwannoma", + "sms:displayName": "iPSC NF1 WT", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ExpressionUnit", + "@id": "bts:IcNF98.4d", "@type": "rdfs:Class", - "rdfs:comment": "Measure used for transcript expression quantification", - "rdfs:label": "ExpressionUnit", - "rdfs:subClassOf": [ - { - "@id": "bts:Thing" - } - ], - "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ - { - "@id": "bts:TPM" - }, - { - "@id": "bts:RPKM" - }, - { - "@id": "bts:FPKM" - }, - { - "@id": "bts:Counts" - }, - { - "@id": "bts:RawCounts" - }, - { - "@id": "bts:NormalizedCounts" - }, + "rdfs:comment": "TBD", + "rdfs:label": "IcNF98.4d", + "rdfs:subClassOf": [ { - "@id": "bts:Other" + "@id": "bts:ModelSystemName" } ], - "sms:displayName": "expressionUnit", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "icNF98.4d", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TPM", + "@id": "bts:NF2-/-AC007-hTERT", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TPM", + "rdfs:label": "NF2-/-AC007-hTERT", "rdfs:subClassOf": [ { - "@id": "bts:ExpressionUnit" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TPM", + "sms:displayName": "NF2-/- AC007-hTERT", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RPKM", + "@id": "bts:HEK293NF1-/-withWTtaggedmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RPKM", + "rdfs:label": "HEK293NF1-/-withWTtaggedmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:ExpressionUnit" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RPKM", + "sms:displayName": "HEK293 NF1 -/- with WT tagged mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FPKM", + "@id": "bts:NCC-MPNST3-C1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FPKM", + "rdfs:label": "NCC-MPNST3-C1", "rdfs:subClassOf": [ { - "@id": "bts:ExpressionUnit" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FPKM", + "sms:displayName": "NCC-MPNST3-C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Counts", + "@id": "bts:HEK293", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Counts", + "rdfs:label": "HEK293", "rdfs:subClassOf": [ { - "@id": "bts:ExpressionUnit" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Counts", + "sms:displayName": "HEK293", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RawCounts", + "@id": "bts:Dh5alpha", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RawCounts", + "rdfs:label": "Dh5alpha", "rdfs:subClassOf": [ { - "@id": "bts:ExpressionUnit" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Raw Counts", + "sms:displayName": "Dh5 alpha", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NormalizedCounts", + "@id": "bts:IcNF97.2a", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NormalizedCounts", + "rdfs:label": "IcNF97.2a", "rdfs:subClassOf": [ { - "@id": "bts:ExpressionUnit" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Normalized Counts", + "sms:displayName": "icNF97.2a", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PubertyOnset", + "@id": "bts:SchwanncellNF1-/-(iPN97.4#24)", "@type": "rdfs:Class", - "rdfs:comment": "Puberty onset.", - "rdfs:label": "PubertyOnset", + "rdfs:comment": "TBD", + "rdfs:label": "SchwanncellNF1-/-(iPN97.4#24)", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Prebubertal" - }, - { - "@id": "bts:Precocious" - }, - { - "@id": "bts:Normal" - }, - { - "@id": "bts:Late" - } - ], - "sms:displayName": "pubertyOnset", + "sms:displayName": "Schwann cell NF1 -/- (iPN97.4 #24)", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Prebubertal", + "@id": "bts:CNF97.5", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Prebubertal", + "rdfs:label": "CNF97.5", "rdfs:subClassOf": [ { - "@id": "bts:PubertyOnset" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "prebubertal", + "sms:displayName": "cNF97.5", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Precocious", + "@id": "bts:NCC-MPNST4-C1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Precocious", + "rdfs:label": "NCC-MPNST4-C1", "rdfs:subClassOf": [ { - "@id": "bts:PubertyOnset" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "precocious", + "sms:displayName": "NCC-MPNST4-C1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Normal", + "@id": "bts:NMS-2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Normal", + "rdfs:label": "NMS-2", "rdfs:subClassOf": [ { - "@id": "bts:PubertyOnset" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "normal", + "sms:displayName": "NMS-2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Late", + "@id": "bts:CNF99.1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Late", + "rdfs:label": "CNF99.1", "rdfs:subClassOf": [ { - "@id": "bts:PubertyOnset" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "late", + "sms:displayName": "cNF99.1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ReadsMappedPercent", + "@id": "bts:HiPSC", "@type": "rdfs:Class", - "rdfs:comment": "Percent of mapped reads collected from samtools", - "rdfs:label": "ReadsMappedPercent", + "rdfs:comment": "TBD", + "rdfs:label": "HiPSC", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "readsMappedPercent", + "sms:displayName": "hiPSC", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:GlomusTumor", + "@id": "bts:AC007-hTERT", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Glomus tumor.", - "rdfs:label": "GlomusTumor", + "rdfs:comment": "TBD", + "rdfs:label": "AC007-hTERT", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "glomusTumor", + "sms:displayName": "AC007-hTERT", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StudyStatus", + "@id": "bts:ScienCellSchwanncells", "@type": "rdfs:Class", - "rdfs:comment": "Status of a study.", - "rdfs:label": "StudyStatus", + "rdfs:comment": "TBD", + "rdfs:label": "ScienCellSchwanncells", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Active" - }, - { - "@id": "bts:Completed" - }, - { - "@id": "bts:Withdrawn" - } - ], - "sms:displayName": "studyStatus", - "sms:required": "sms:true", + "sms:displayName": "ScienCell Schwann cells", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Active", + "@id": "bts:IcNF04.9a", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Active", + "rdfs:label": "IcNF04.9a", "rdfs:subClassOf": [ { - "@id": "bts:StudyStatus" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Active", + "sms:displayName": "icNF04.9a", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Completed", + "@id": "bts:90-8", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Completed", + "rdfs:label": "90-8", "rdfs:subClassOf": [ { - "@id": "bts:StudyStatus" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Completed", + "sms:displayName": "90-8", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Withdrawn", + "@id": "bts:SchwanncellNF1-/-withWTtaggedmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Withdrawn", + "rdfs:label": "SchwanncellNF1-/-withWTtaggedmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:StudyStatus" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Withdrawn", + "sms:displayName": "Schwann cell NF1 -/- with WT tagged mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SphenoidDysplasia", + "@id": "bts:IPSCNF1+/-BJFF.6bkgd", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Sphenoid dysplasia.", - "rdfs:label": "SphenoidDysplasia", + "rdfs:comment": "TBD", + "rdfs:label": "IPSCNF1+/-BJFF.6bkgd", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "sphenoidDysplasia", + "sms:displayName": "iPSC NF1 +/- BJFF.6 bkgd", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NonvestibularSchwannomas", + "@id": "bts:JHU2-079-CL", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Nonvestibular schwannomas.", - "rdfs:label": "NonvestibularSchwannomas", + "rdfs:comment": "TBD", + "rdfs:label": "JHU2-079-CL", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Onlybyimagingevidence" - }, - { - "@id": "bts:1pathogicallyconfirmed" - }, - { - "@id": "bts:2ormore,atleast1pathogicallyconfirmed" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "nonvestibularSchwannomas", + "sms:displayName": "JHU 2-079-CL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Onlybyimagingevidence", + "@id": "bts:CNF97.2b", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Onlybyimagingevidence", + "rdfs:label": "CNF97.2b", "rdfs:subClassOf": [ { - "@id": "bts:NonvestibularSchwannomas" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "only by imaging evidence", + "sms:displayName": "cNF97.2b", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:1pathogicallyconfirmed", + "@id": "bts:JHU2-002-CL", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "1pathogicallyconfirmed", + "rdfs:label": "JHU2-002-CL", "rdfs:subClassOf": [ { - "@id": "bts:NonvestibularSchwannomas" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "1 pathogically confirmed", + "sms:displayName": "JHU 2-002-CL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:2ormore,atleast1pathogicallyconfirmed", + "@id": "bts:NF1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "2ormore,atleast1pathogicallyconfirmed", + "rdfs:label": "NF1", "rdfs:subClassOf": [ { - "@id": "bts:NonvestibularSchwannomas" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "2 or more, at least 1 pathogically confirmed", + "sms:displayName": "NF1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GermlineMutation", + "@id": "bts:SZ-NF1", "@type": "rdfs:Class", - "rdfs:comment": "The individual's actual germline mutation.", - "rdfs:label": "GermlineMutation", + "rdfs:comment": "TBD", + "rdfs:label": "SZ-NF1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "germlineMutation", + "sms:displayName": "SZ-NF1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SkinFoldFreckling", + "@id": "bts:3PNFFiPSsvPM2", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of skin fold freckling.", - "rdfs:label": "SkinFoldFreckling", + "rdfs:comment": "TBD", + "rdfs:label": "3PNFFiPSsvPM2", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "skinFoldFreckling", + "sms:displayName": "3PNF_FiPSsv_PM_2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ContentType", + "@id": "bts:HTERTNF1ipNF05.5(Mixedclones)", "@type": "rdfs:Class", - "rdfs:comment": "Refers to the type of content.", - "rdfs:label": "ContentType", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTNF1ipNF05.5(Mixedclones)", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "contentType", + "sms:displayName": "hTERT NF1 ipNF05.5 (Mixed clones)", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Objective", + "@id": "bts:HTERTipn02.32λ", "@type": "rdfs:Class", - "rdfs:comment": "Microscope objective.", - "rdfs:label": "Objective", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTipn02.32λ", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "objective", + "sms:displayName": "hTERT ipn02.3 2λ", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Leukemia", + "@id": "bts:JHU2-103-CL", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Leukemia.", - "rdfs:label": "Leukemia", + "rdfs:comment": "TBD", + "rdfs:label": "JHU2-103-CL", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "leukemia", + "sms:displayName": "JHU 2-103-CL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SubcutaneousNodularNeurofibromas", + "@id": "bts:HEK293NF1-/-Exon17#A15G629Rcrypticsplice", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Subcutaneous nodular neurofibromas.", - "rdfs:label": "SubcutaneousNodularNeurofibromas", + "rdfs:comment": "TBD", + "rdfs:label": "HEK293NF1-/-Exon17#A15G629Rcrypticsplice", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Scattered" - }, - { - "@id": "bts:Dense" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "subcutaneousNodularNeurofibromas", + "sms:displayName": "HEK293 NF1 -/- Exon 17 #A15 G629R cryptic splice", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AverageInsertSize", + "@id": "bts:Lis42NF11N", "@type": "rdfs:Class", - "rdfs:comment": "Average insert size as reported by samtools", - "rdfs:label": "AverageInsertSize", + "rdfs:comment": "TBD", + "rdfs:label": "Lis42NF11N", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "averageInsertSize", + "sms:displayName": "Lis42_NF1_1N", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CellID", + "@id": "bts:ELK-TADLuciferaseReporterHEK293StableNF1-/-", "@type": "rdfs:Class", - "rdfs:comment": "Also known as cell barcode, this value can be added for single-cell experiments to identify data at the cell level.", - "rdfs:label": "CellID", + "rdfs:comment": "TBD", + "rdfs:label": "ELK-TADLuciferaseReporterHEK293StableNF1-/-", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cellID", + "sms:displayName": "ELK-TAD Luciferase Reporter HEK293 Stable NF1 -/-", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BatchID", + "@id": "bts:Humanforeskinfibroblasts", "@type": "rdfs:Class", - "rdfs:comment": "Batch identifier, can be used in any context where added batch information is helpful, such as different sequencing runs or collection times.", - "rdfs:label": "BatchID", + "rdfs:comment": "TBD", + "rdfs:label": "Humanforeskinfibroblasts", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "batchID", + "sms:displayName": "human foreskin fibroblasts", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IndividualID", + "@id": "bts:IcNF00.10a", "@type": "rdfs:Class", - "rdfs:comment": "A unique identifier (non-PII) that represents the individual from which the data came. This could be a patient or animal ID.", - "rdfs:label": "IndividualID", + "rdfs:comment": "TBD", + "rdfs:label": "IcNF00.10a", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "individualID", - "sms:required": "sms:true", - "sms:validationRules": [ - "list like" - ] + "sms:displayName": "icNF00.10a", + "sms:required": "sms:false", + "sms:validationRules": [] }, { - "@id": "bts:FailedQC", + "@id": "bts:HEK293NF1-/-withR1947XmNf1cDNA", "@type": "rdfs:Class", - "rdfs:comment": "Whether the sample or data failed QC checks (Yes, No)", - "rdfs:label": "FailedQC", + "rdfs:comment": "TBD", + "rdfs:label": "HEK293NF1-/-withR1947XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Yes" - }, - { - "@id": "bts:No" - } - ], - "sms:displayName": "failedQC", + "sms:displayName": "HEK293 NF1 -/- with R1947X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:VascularDisease", + "@id": "bts:Nf1-/-Epitheliallungcells", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Vascular disease.", - "rdfs:label": "VascularDisease", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1-/-Epitheliallungcells", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "vascularDisease", + "sms:displayName": "Nf1-/- Epithelial lung cells", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CompoundName", + "@id": "bts:Nf2-/-SchwannSC(mouse)(PMID26554010)", "@type": "rdfs:Class", - "rdfs:comment": "//pubchem.ncbi.nlm.nih.gov/compound/10127622)", - "rdfs:label": "CompoundName", + "rdfs:comment": "TBD", + "rdfs:label": "Nf2-/-SchwannSC(mouse)(PMID26554010)", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "compoundName", + "sms:displayName": "Nf2-/- Schwann SC (mouse) (PMID26554010)", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nf1GermlineMutation", + "@id": "bts:STS-26T", "@type": "rdfs:Class", - "rdfs:comment": "NF1 germline mutation.", - "rdfs:label": "Nf1GermlineMutation", + "rdfs:comment": "TBD", + "rdfs:label": "STS-26T", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nf1GermlineMutation", + "sms:displayName": "STS-26T", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IsFilteredReads", + "@id": "bts:HEK293NF1-/-withR461XmNf1cDNA", "@type": "rdfs:Class", - "rdfs:comment": "Whether the reads in the processed result has been filtered by adding a 'PASS' filter or other filters as determined by the data generator", - "rdfs:label": "IsFilteredReads", + "rdfs:comment": "TBD", + "rdfs:label": "HEK293NF1-/-withR461XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "isFilteredReads", + "sms:displayName": "HEK293 NF1 -/- with R461X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RunType", + "@id": "bts:I28cNF", "@type": "rdfs:Class", - "rdfs:comment": "Sequencing run type.", - "rdfs:label": "RunType", + "rdfs:comment": "TBD", + "rdfs:label": "I28cNF", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:PairedEnd" - }, - { - "@id": "bts:SingleEnd" - } - ], - "sms:displayName": "runType", + "sms:displayName": "i28cNF", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PairedEnd", + "@id": "bts:SNF94.3", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PairedEnd", + "rdfs:label": "SNF94.3", "rdfs:subClassOf": [ { - "@id": "bts:RunType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pairedEnd", + "sms:displayName": "sNF94.3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SingleEnd", + "@id": "bts:Nf1-/-skin-derivedprecursorcells", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SingleEnd", + "rdfs:label": "Nf1-/-skin-derivedprecursorcells", "rdfs:subClassOf": [ { - "@id": "bts:RunType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "singleEnd", + "sms:displayName": "Nf1-/- skin-derived precursor cells", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LensAperture", + "@id": "bts:HTERTipn02.8", "@type": "rdfs:Class", - "rdfs:comment": "Numerical aperture of the lens. Floating point value > 0.", - "rdfs:label": "LensAperture", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTipn02.8", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lensAperture", + "sms:displayName": "hTERT ipn02.8", "sms:required": "sms:false", - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:ReferenceSet", + "@id": "bts:Dhh-Cre;NF1Arg681*/floxSchwannCells", "@type": "rdfs:Class", - "rdfs:comment": "A set of references (e.g., canonical assembled contigs) which defines a common coordinate space for comparing reference-aligned experimental data.", - "rdfs:label": "ReferenceSet", + "rdfs:comment": "TBD", + "rdfs:label": "Dhh-Cre;NF1Arg681*/floxSchwannCells", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "referenceSet", + "sms:displayName": "Dhh-Cre; NF1Arg681*/flox Schwann Cells", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AttentionDeficitDisorder", + "@id": "bts:KCL024", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Attention Deficit Disorder.", - "rdfs:label": "AttentionDeficitDisorder", + "rdfs:comment": "TBD", + "rdfs:label": "KCL024", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Absent" - }, - { - "@id": "bts:Present" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "attentionDeficitDisorder", + "sms:displayName": "KCL024", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ParentId", + "@id": "bts:IcNF97.2b", "@type": "rdfs:Class", - "rdfs:comment": "The id of the parent resource, i.e. the parent folder on the platform. ", - "rdfs:label": "ParentId", + "rdfs:comment": "TBD", + "rdfs:label": "IcNF97.2b", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "parentId", + "sms:displayName": "icNF97.2b", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DiseaseFocus", + "@id": "bts:HeLaSilenciXNF1", "@type": "rdfs:Class", - "rdfs:comment": "Disease that acts as the main topic.", - "rdfs:label": "DiseaseFocus", + "rdfs:comment": "TBD", + "rdfs:label": "HeLaSilenciXNF1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "diseaseFocus", + "sms:displayName": "HeLa SilenciX NF1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TransplantationRecipientSpecies", + "@id": "bts:HTERTNF1ipNF95.11bC/T", "@type": "rdfs:Class", - "rdfs:comment": "Species into which donor was grown", - "rdfs:label": "TransplantationRecipientSpecies", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTNF1ipNF95.11bC/T", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Human" - }, - { - "@id": "bts:Mouse" - } - ], - "sms:displayName": "transplantationRecipientSpecies", + "sms:displayName": "hTERT NF1 ipNF95.11b C/T", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Human", + "@id": "bts:HEK293NF1-/-Exon47insT#14", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Human", + "rdfs:label": "HEK293NF1-/-Exon47insT#14", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientSpecies" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Human", + "sms:displayName": "HEK293 NF1 -/- Exon 47 insT #14", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Mouse", + "@id": "bts:HS-PSS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Mouse", + "rdfs:label": "HS-PSS", "rdfs:subClassOf": [ { - "@id": "bts:TransplantationRecipientSpecies" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Mouse", + "sms:displayName": "HS-PSS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AcknowledgementStatements", + "@id": "bts:YST-1", "@type": "rdfs:Class", - "rdfs:comment": "Statement describing how resource use should be acknowledged.", - "rdfs:label": "AcknowledgementStatements", + "rdfs:comment": "TBD", + "rdfs:label": "YST-1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "acknowledgementStatements", + "sms:displayName": "YST-1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ExperimentId", + "@id": "bts:M3MPNST", "@type": "rdfs:Class", - "rdfs:comment": "When applicable, an optional identifier that can be used to distinguish or group the experiments that generated the data; also can be used to denote internal batch reference if needed.", - "rdfs:label": "ExperimentId", + "rdfs:comment": "TBD", + "rdfs:label": "M3MPNST", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "experimentId", + "sms:displayName": "M3 MPNST", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CellType", + "@id": "bts:S462.TY", "@type": "rdfs:Class", - "rdfs:comment": "A cell type is a distinct morphological or functional form of cell.", - "rdfs:label": "CellType", + "rdfs:comment": "TBD", + "rdfs:label": "S462.TY", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Monocytes" - }, - { - "@id": "bts:Macrophages" - }, - { - "@id": "bts:IPSC-derivedneuron" - }, - { - "@id": "bts:Lymphoblast" - }, - { - "@id": "bts:IPSC" - }, - { - "@id": "bts:DRG/nerverootneurospherecell" - }, - { - "@id": "bts:CD138+" - }, - { - "@id": "bts:Schwannoma" - }, - { - "@id": "bts:IPSC-derivedtelencephalicorganoids" - }, - { - "@id": "bts:Monocyte-derivedmicroglia" - }, - { - "@id": "bts:Microglia" - }, - { - "@id": "bts:SH-SY5Y" - }, - { - "@id": "bts:CNON" - }, - { - "@id": "bts:NeuN+" - }, - { - "@id": "bts:CulturedMullerglia" - }, - { - "@id": "bts:B-lymphocytes" - }, - { - "@id": "bts:Round" - }, - { - "@id": "bts:Epithelial" - }, - { - "@id": "bts:Epithelial-like" - }, - { - "@id": "bts:CD8+T-Cells" - }, - { - "@id": "bts:GLUtamatergicneurons" - }, - { - "@id": "bts:Arachnoid" - }, - { - "@id": "bts:GABAergicneurons" - }, - { - "@id": "bts:Schwann" - }, - { - "@id": "bts:IPSC-derivedglia" - }, - { - "@id": "bts:IPSC-derivedastrocytes" - }, - { - "@id": "bts:IPSC-derivedneuronalprogenitorcell" - }, - { - "@id": "bts:Oligodendrocyte" - }, - { - "@id": "bts:Fibroblast" - }, - { - "@id": "bts:Astrocytes" - }, - { - "@id": "bts:Schwanncellprecursor" - }, - { - "@id": "bts:NeuN-" - }, - { - "@id": "bts:Embryonicstemcells" - }, - { - "@id": "bts:Teratoma" - }, - { - "@id": "bts:Meningioma" - } - ], - "sms:displayName": "cellType", + "sms:displayName": "S462.TY", "sms:required": "sms:false", - "sms:validationRules": [ - "list like" - ] + "sms:validationRules": [] }, { - "@id": "bts:Monocytes", + "@id": "bts:S462", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Monocytes", + "rdfs:label": "S462", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "monocytes", + "sms:displayName": "S462", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Macrophages", + "@id": "bts:HEK293NF1-/-Exon17#B48G629Rcrypticsplice", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Macrophages", + "rdfs:label": "HEK293NF1-/-Exon17#B48G629Rcrypticsplice", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "macrophages", + "sms:displayName": "HEK293 NF1 -/- Exon 17 #B48 G629R cryptic splice", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSC-derivedneuron", + "@id": "bts:GM11602", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSC-derivedneuron", + "rdfs:label": "GM11602", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC-derived neuron", + "sms:displayName": "GM11602", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lymphoblast", + "@id": "bts:Lis47NF12N", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lymphoblast", + "rdfs:label": "Lis47NF12N", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lymphoblast", + "sms:displayName": "Lis47_NF1_2N", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSC", + "@id": "bts:HTERTNF1sipnNF95.12B", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSC", + "rdfs:label": "HTERTNF1sipnNF95.12B", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC", + "sms:displayName": "hTERT NF1 sipnNF95.12B", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DRG/nerverootneurospherecell", + "@id": "bts:KCL025", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DRG/nerverootneurospherecell", + "rdfs:label": "KCL025", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DRG/nerve root neurosphere cell", + "sms:displayName": "KCL025", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CD138+", + "@id": "bts:SchwanncellNF1-/-withR816XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CD138+", + "rdfs:label": "SchwanncellNF1-/-withR816XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CD138+", + "sms:displayName": "Schwann cell NF1 -/- with R816X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSC-derivedtelencephalicorganoids", + "@id": "bts:HiPSC-SCP", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSC-derivedtelencephalicorganoids", + "rdfs:label": "HiPSC-SCP", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC-derived telencephalic organoids", + "sms:displayName": "hiPSC-SCP", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Monocyte-derivedmicroglia", + "@id": "bts:SNF96.2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Monocyte-derivedmicroglia", + "rdfs:label": "SNF96.2", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "monocyte-derived microglia", + "sms:displayName": "sNF96.2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Microglia", + "@id": "bts:CNF98.4c", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Microglia", + "rdfs:label": "CNF98.4c", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "microglia", + "sms:displayName": "cNF98.4c", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SH-SY5Y", + "@id": "bts:NF1-R68XEmbryoniccells", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SH-SY5Y", + "rdfs:label": "NF1-R68XEmbryoniccells", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SH-SY5Y", + "sms:displayName": "NF1-R68X Embryonic cells", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNON", + "@id": "bts:BJFF.6", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNON", + "rdfs:label": "BJFF.6", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CNON", + "sms:displayName": "BJFF.6", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NeuN+", + "@id": "bts:Ben-Men-1", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NeuN+", + "rdfs:label": "Ben-Men-1", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NeuN+", + "sms:displayName": "Ben-Men-1", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CulturedMullerglia", + "@id": "bts:HEK293NF1-/-withR816XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CulturedMullerglia", + "rdfs:label": "HEK293NF1-/-withR816XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cultured Muller glia", + "sms:displayName": "HEK293 NF1 -/- with R816X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:B-lymphocytes", + "@id": "bts:HTERTNF1ipNF05.5", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "B-lymphocytes", + "rdfs:label": "HTERTNF1ipNF05.5", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "B-lymphocytes", + "sms:displayName": "hTERT NF1 ipNF05.5", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Round", + "@id": "bts:I18cNF", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Round", + "rdfs:label": "I18cNF", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "round", + "sms:displayName": "i18cNF", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Epithelial", + "@id": "bts:HTERTSCipn97.4", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Epithelial", + "rdfs:label": "HTERTSCipn97.4", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "epithelial", + "sms:displayName": "hTERT SC ipn97.4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Epithelial-like", + "@id": "bts:I21cNF", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Epithelial-like", + "rdfs:label": "I21cNF", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "epithelial-like", + "sms:displayName": "i21cNF", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CD8+T-Cells", + "@id": "bts:CNF98.4d", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CD8+T-Cells", + "rdfs:label": "CNF98.4d", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CD8+ T-Cells", + "sms:displayName": "cNF98.4d", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GLUtamatergicneurons", + "@id": "bts:28cNF", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GLUtamatergicneurons", + "rdfs:label": "28cNF", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GLUtamatergic neurons", + "sms:displayName": "28cNF", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Arachnoid", + "@id": "bts:SC4[Mouseschwannoma]", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Arachnoid", + "rdfs:label": "SC4[Mouseschwannoma]", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "arachnoid", + "sms:displayName": "SC4 [Mouse schwannoma]", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GABAergicneurons", + "@id": "bts:CNF18.1a", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GABAergicneurons", + "rdfs:label": "CNF18.1a", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GABAergic neurons", + "sms:displayName": "cNF18.1a", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwann", + "@id": "bts:Nf1Arg681*/Arg681*ES", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Schwann", + "rdfs:label": "Nf1Arg681*/Arg681*ES", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "schwann", + "sms:displayName": "Nf1Arg681*/Arg681* ES", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSC-derivedglia", + "@id": "bts:GM11601", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSC-derivedglia", + "rdfs:label": "GM11601", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC-derived glia", + "sms:displayName": "GM11601", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSC-derivedastrocytes", + "@id": "bts:HEK293NF1-/-withR2550XmNf1cDNA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSC-derivedastrocytes", + "rdfs:label": "HEK293NF1-/-withR2550XmNf1cDNA", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC-derived astrocytes", + "sms:displayName": "HEK293 NF1 -/- with R2550X mNf1 cDNA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IPSC-derivedneuronalprogenitorcell", + "@id": "bts:JH-2-103-CL", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IPSC-derivedneuronalprogenitorcell", + "rdfs:label": "JH-2-103-CL", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "iPSC-derived neuronal progenitor cell", + "sms:displayName": "JH-2-103-CL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Oligodendrocyte", + "@id": "bts:HS-Sch-2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Oligodendrocyte", + "rdfs:label": "HS-Sch-2", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "oligodendrocyte", + "sms:displayName": "HS-Sch-2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Fibroblast", + "@id": "bts:HTERTNF1ipn02.32λ", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Fibroblast", + "rdfs:label": "HTERTNF1ipn02.32λ", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "fibroblast", + "sms:displayName": "hTERT NF1 ipn02.3 2λ", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Astrocytes", + "@id": "bts:ELK-TADLuciferaseReporterHEK293Stable", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Astrocytes", + "rdfs:label": "ELK-TADLuciferaseReporterHEK293Stable", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "astrocytes", + "sms:displayName": "ELK-TAD Luciferase Reporter HEK293 Stable", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Schwanncellprecursor", + "@id": "bts:6PNFSiPSrvPM2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Schwanncellprecursor", + "rdfs:label": "6PNFSiPSrvPM2", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Schwann cell precursor", + "sms:displayName": "6PNF_SiPSrv_PM_2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NeuN-", + "@id": "bts:HTERTNF1ipNF03.3", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NeuN-", + "rdfs:label": "HTERTNF1ipNF03.3", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NeuN-", + "sms:displayName": "hTERT NF1 ipNF03.3", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Embryonicstemcells", + "@id": "bts:JH-2-079-CL", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Embryonicstemcells", + "rdfs:label": "JH-2-079-CL", "rdfs:subClassOf": [ { - "@id": "bts:CellType" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Embryonic stem cells", + "sms:displayName": "JH-2-079-CL", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ModifiedBy", + "@id": "bts:HTERTNF1ipNF04.4", "@type": "rdfs:Class", - "rdfs:comment": "Refers to a user who last modified the resource on the platform.", - "rdfs:label": "ModifiedBy", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTNF1ipNF04.4", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "modifiedBy", + "sms:displayName": "hTERT NF1 ipNF04.4", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ParentSpecimenID", + "@id": "bts:Nf1Arg681*/Arg681*MEFs", "@type": "rdfs:Class", - "rdfs:comment": "A unique identifier (non-PII) that represents the parent specimen (sample) from which the data came from, e.g. the single parent tumor that was subsectioned into several samples. The parentSpecimenID can be the same as specimenID when there is no subsectioning.\n", - "rdfs:label": "ParentSpecimenID", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1Arg681*/Arg681*MEFs", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "parentSpecimenID", + "sms:displayName": "Nf1Arg681*/Arg681* MEFs", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ExperimentalTimepoint", + "@id": "bts:Nf1Arg681*/+ES", "@type": "rdfs:Class", - "rdfs:comment": "The numeric value indicating the time elapsed from the beginning of the experiment at which the specimen was collected. Use in tandem with timePointUnit", - "rdfs:label": "ExperimentalTimepoint", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1Arg681*/+ES", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "experimentalTimepoint", + "sms:displayName": "Nf1Arg681*/+ ES", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:TimepointUnit" - } - ], - "sms:validationRules": [ - "num" - ] + "sms:validationRules": [] }, { - "@id": "bts:VitalStatus", + "@id": "bts:CNF97.2a", "@type": "rdfs:Class", - "rdfs:comment": "Vital status of the patient.", - "rdfs:label": "VitalStatus", + "rdfs:comment": "TBD", + "rdfs:label": "CNF97.2a", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Alive" - }, - { - "@id": "bts:Deceased" - }, - { - "@id": "bts:Unknown" - } - ], - "sms:displayName": "vitalStatus", + "sms:displayName": "cNF97.2a", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Alive", + "@id": "bts:Schwanncelli28cNFNF1-/-(#14)", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Alive", + "rdfs:label": "Schwanncelli28cNFNF1-/-(#14)", "rdfs:subClassOf": [ { - "@id": "bts:VitalStatus" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "alive", + "sms:displayName": "Schwann cell i28cNF NF1 -/- (#14)", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Deceased", + "@id": "bts:HTERTNF1ipNF00.6", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Deceased", + "rdfs:label": "HTERTNF1ipNF00.6", "rdfs:subClassOf": [ { - "@id": "bts:VitalStatus" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "deceased", + "sms:displayName": "hTERT NF1 ipNF00.6", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProtocolAssay", + "@id": "bts:NCC-MPNST3-X2-C1", "@type": "rdfs:Class", - "rdfs:comment": "Main assay type that this protocol is related to, e.g. this is a prep protocol for single-cell RNA-seq assay. This is especially helpful for newly-developed or in-house assays.\n", - "rdfs:label": "ProtocolAssay", + "rdfs:comment": "TBD", + "rdfs:label": "NCC-MPNST3-X2-C1", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:2DAlamarBlueabsorbance" - }, - { - "@id": "bts:2DAlamarBluefluorescence" - }, - { - "@id": "bts:3Dconfocalimaging" - }, - { - "@id": "bts:3Delectronmicroscopy" - }, - { - "@id": "bts:3Dimaging" - }, - { - "@id": "bts:3Dmicrotissueviability" - }, - { - "@id": "bts:Actigraphy" - }, - { - "@id": "bts:AlgometRxNociometer" - }, - { - "@id": "bts:ATAC-seq" - }, - { - "@id": "bts:ATPaseactivityassay" - }, - { - "@id": "bts:BrdUproliferationassay" - }, - { - "@id": "bts:CAPP-seq" - }, - { - "@id": "bts:CUT&RUN" - }, - { - "@id": "bts:ChIP-seq" - }, - { - "@id": "bts:ChildBehaviorChecklistforAges1.5-5" - }, - { - "@id": "bts:ChildBehaviorChecklistforAges6-18" - }, - { - "@id": "bts:CODEX" - }, - { - "@id": "bts:Corsiblocks" - }, - { - "@id": "bts:DNAopticalmapping" - }, - { - "@id": "bts:ELISA" - }, - { - "@id": "bts:ERRbisulfitesequencing" - }, - { - "@id": "bts:EdUproliferationassay" - }, - { - "@id": "bts:FIA-MSMS" - }, - { - "@id": "bts:FLIPRhigh-throughputcellularscreening" - }, - { - "@id": "bts:FluorescenceInSituHybridization" - }, - { - "@id": "bts:Focusgroup" - }, - { - "@id": "bts:FTIRspectroscopy" - }, - { - "@id": "bts:HI-C" - }, - { - "@id": "bts:HPLC" - }, - { - "@id": "bts:Interview" - }, - { - "@id": "bts:ISO-seq" - }, - { - "@id": "bts:MIB/MS" - }, - { - "@id": "bts:Matrigel-basedtumorigenesisassay" - }, - { - "@id": "bts:MudPIT" - }, - { - "@id": "bts:NIHToolbox" - }, - { - "@id": "bts:NOMe-seq" - }, - { - "@id": "bts:RNAarray" - }, - { - "@id": "bts:RNA-seq" - }, - { - "@id": "bts:RPPA" - }, - { - "@id": "bts:RiccardiandAblonscales" - }, - { - "@id": "bts:SNParray" - }, - { - "@id": "bts:SUSHI" - }, - { - "@id": "bts:Sangersequencing" - }, - { - "@id": "bts:SocialResponsivenessScale" - }, - { - "@id": "bts:SocialResponsivenessScale,SecondEdition" - }, - { - "@id": "bts:Tcellreceptorrepertoiresequencing" - }, - { - "@id": "bts:TIDE" - }, - { - "@id": "bts:TMTquantitation" - }, - { - "@id": "bts:VonFreytest" - }, - { - "@id": "bts:Activeavoidancelearningbehaviorassay" - }, - { - "@id": "bts:Array" - }, - { - "@id": "bts:Atomicforcemicroscopy" - }, - { - "@id": "bts:Autoradiography" - }, - { - "@id": "bts:Bisulfitesequencing" - }, - { - "@id": "bts:Bloodchemistrymeasurement" - }, - { - "@id": "bts:BluenativePAGE" - }, - { - "@id": "bts:Bodysizetraitmeasurement" - }, - { - "@id": "bts:Brightfieldmicroscopy" - }, - { - "@id": "bts:CAMP-GloMaxAssay" - }, - { - "@id": "bts:Calciumretentioncapacityassay" - }, - { - "@id": "bts:Cellcompetition" - }, - { - "@id": "bts:Cellcount" - }, - { - "@id": "bts:Cellproliferation" - }, - { - "@id": "bts:Cellviabilityassay" - }, - { - "@id": "bts:Clinicaldata" - }, - { - "@id": "bts:CNF-Skindex" - }, - { - "@id": "bts:Cognitiveassessment" - }, - { - "@id": "bts:Combinationlibraryscreen" - }, - { - "@id": "bts:Combinationscreen" - }, - { - "@id": "bts:ComplexIIenzymeactivityassay" - }, - { - "@id": "bts:Compoundscreen" - }, - { - "@id": "bts:Contextualconditioningbehaviorassay" - }, - { - "@id": "bts:ConventionalMRI" - }, - { - "@id": "bts:Children'sDermatologyLifeQualityIndexQuestionnaire" - }, - { - "@id": "bts:Differentialscanningcalorimetry" - }, - { - "@id": "bts:Dynamiclightscattering" - }, - { - "@id": "bts:Electrochemiluminescence" - }, - { - "@id": "bts:Electrophoreticlightscattering" - }, - { - "@id": "bts:Elevatedplusmazetest" - }, - { - "@id": "bts:FACE-QAppearance-relatedDistress" - }, - { - "@id": "bts:Flowcytometry" - }, - { - "@id": "bts:Focusformingassay" - }, - { - "@id": "bts:FunctionalMRI" - }, - { - "@id": "bts:Gaitmeasurement" - }, - { - "@id": "bts:Gelfiltrationchromatography" - }, - { - "@id": "bts:Gelpermeationchromatography" - }, - { - "@id": "bts:Genotyping" - }, - { - "@id": "bts:Highcontentscreen" - }, - { - "@id": "bts:Highfrequencyultrasound" - }, - { - "@id": "bts:High-performanceliquidchromatography/tandemmassspectrometry" - }, - { - "@id": "bts:Immunoassay" - }, - { - "@id": "bts:Immunocytochemistry" - }, - { - "@id": "bts:Immunofluorescence" - }, - { - "@id": "bts:Immunohistochemistry" - }, - { - "@id": "bts:Insilicosynthesis" - }, - { - "@id": "bts:Invitrotumorigenesis" - }, - { - "@id": "bts:InvivoPDXviability" - }, - { - "@id": "bts:Invivobioluminescence" - }, - { - "@id": "bts:Invivotumorgrowth" - }, - { - "@id": "bts:Jumpinglibrary" - }, - { - "@id": "bts:Labelfreemassspectrometry" - }, - { - "@id": "bts:Laserspeckleimaging" - }, - { - "@id": "bts:Lightscatteringassay" - }, - { - "@id": "bts:Liquidchromatography-electrochemicaldetection" - }, - { - "@id": "bts:Liquidchromatography/massspectrometry" - }, - { - "@id": "bts:Liquidchromatography/tandemmassspectrometry" - }, - { - "@id": "bts:LncRNA-seq" - }, - { - "@id": "bts:Localfieldpotentialrecording" - }, - { - "@id": "bts:Longtermpotentiationassay" - }, - { - "@id": "bts:MRNAcounts" - }, - { - "@id": "bts:Magneticresonancespectroscopy" - }, - { - "@id": "bts:Massspectrometry" - }, - { - "@id": "bts:Massivelyparallelreporterassay" - }, - { - "@id": "bts:Metabolicscreening" - }, - { - "@id": "bts:Methylationarray" - }, - { - "@id": "bts:MiRNAarray" - }, - { - "@id": "bts:MiRNA-seq" - }, - { - "@id": "bts:Microrheology" - }, - { - "@id": "bts:Skindex-16" - }, - { - "@id": "bts:Multi-electrodearray" - }, - { - "@id": "bts:Nanoparticletrackinganalysis" - }, - { - "@id": "bts:NanoStringnCounterAnalysisSystem" - }, - { - "@id": "bts:N-backtask" - }, - { - "@id": "bts:Neuropsychologicalassessment" - }, - { - "@id": "bts:Nextgenerationtargetedsequencing" - }, - { - "@id": "bts:Noveltyresponsebehaviorassay" - }, - { - "@id": "bts:Openfieldtest" - }, - { - "@id": "bts:Opticaltomography" - }, - { - "@id": "bts:Opticalcoherencetomography" - }, - { - "@id": "bts:Optokineticreflexassay" - }, - { - "@id": "bts:Oscillatoryrheology" - }, - { - "@id": "bts:OxBS-seq" - }, - { - "@id": "bts:Oxygenconsumptionassay" - }, - { - "@id": "bts:Patternelectroretinogram" - }, - { - "@id": "bts:Perineurialcellthickness" - }, - { - "@id": "bts:Phase-contrastmicroscopy" - }, - { - "@id": "bts:Photograph" - }, - { - "@id": "bts:Polymerasechainreaction" - }, - { - "@id": "bts:Polysomnography" - }, - { - "@id": "bts:Positronemissiontomography" - }, - { - "@id": "bts:PROMISCognitiveFunction" - }, - { - "@id": "bts:QuantitativePCR" - }, - { - "@id": "bts:Questionnaire" - }, - { - "@id": "bts:Reactiveoxygenspeciesassay" - }, - { - "@id": "bts:Reportergeneassay" - }, - { - "@id": "bts:Rheometry" - }, - { - "@id": "bts:Ribo-seq" - }, - { - "@id": "bts:Rotarodperformancetest" - }, + "sms:displayName": "NCC-MPNST3-X2-C1", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:JHU2-002-PDX", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "JHU2-002-PDX", + "rdfs:subClassOf": [ { - "@id": "bts:SandwichELISA" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "JHU 2-002-PDX", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:HTERTNF1ipNF95.11bC", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTNF1ipNF95.11bC", + "rdfs:subClassOf": [ { - "@id": "bts:ScCGI-seq" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "hTERT NF1 ipNF95.11b C", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:5PNFTDiPSsvMM4", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "5PNFTDiPSsvMM4", + "rdfs:subClassOf": [ { - "@id": "bts:Scale" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "5PNF_TDiPSsv_MM_4", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:HTERTNF1ipn06.2A", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTNF1ipn06.2A", + "rdfs:subClassOf": [ { - "@id": "bts:SaferSeqS" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "hTERT NF1 ipn06.2 A", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:HTERTSCipn02.8", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "HTERTSCipn02.8", + "rdfs:subClassOf": [ { - "@id": "bts:Singlemoleculedrugscreenassay" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "hTERT SC ipn02.8", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SZ-NF2", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SZ-NF2", + "rdfs:subClassOf": [ { - "@id": "bts:Single-cellRNA-seq" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "SZ-NF2", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SMPNST", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SMPNST", + "rdfs:subClassOf": [ { - "@id": "bts:SinglecellATAC-seq" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "sMPNST", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:B6;129S2-Trp53tm1TyjNf1tm1Tyj/J", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "B6;129S2-Trp53tm1TyjNf1tm1Tyj/J", + "rdfs:subClassOf": [ { - "@id": "bts:Single-nucleusRNA-seq" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "B6;129S2-Trp53tm1Tyj Nf1tm1Tyj/J", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Prss56Cre;R26mT", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Prss56Cre;R26mT", + "rdfs:subClassOf": [ { - "@id": "bts:Smallmoleculelibraryscreen" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Prss56Cre;R26mT", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:B6.129S1-Nf1tm1Cbr/J", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "B6.129S1-Nf1tm1Cbr/J", + "rdfs:subClassOf": [ { - "@id": "bts:Sorbitoldehydrogenaseactivitylevelassay" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "B6.129S1-Nf1tm1Cbr/J", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1-OPG", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1-OPG", + "rdfs:subClassOf": [ { - "@id": "bts:Spatialfrequencydomainimaging" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Nf1-OPG", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:C57BL/6J", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "C57BL/6J", + "rdfs:subClassOf": [ { - "@id": "bts:Spatialtranscriptomics" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "C57BL/6J", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:NRG", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NRG", + "rdfs:subClassOf": [ { - "@id": "bts:Staticlightscattering" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "NRG", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1-OPG-Arg816", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1-OPG-Arg816", + "rdfs:subClassOf": [ { - "@id": "bts:Survival" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Nf1-OPG-Arg816", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:NODscidgamma", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NODscidgamma", + "rdfs:subClassOf": [ { - "@id": "bts:Targetedexomesequencing" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "NOD scid gamma", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:B6.129S2-Nf1tm1Tyj/J", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "B6.129S2-Nf1tm1Tyj/J", + "rdfs:subClassOf": [ { - "@id": "bts:Tractionforcemicroscopy" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "B6.129S2-Nf1tm1Tyj/J", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:B6;129-Trp53tm1TyjNf1tm1TyjSuz12Gt(Betageo)1Khe/KcichJ", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "B6;129-Trp53tm1TyjNf1tm1TyjSuz12Gt(Betageo)1Khe/KcichJ", + "rdfs:subClassOf": [ { - "@id": "bts:Twinspotassay" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "B6;129-Trp53tm1Tyj Nf1tm1Tyj Suz12Gt(Betageo)1Khe/KcichJ", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:B6.129(Cg)-Nf1tm1Par/J", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "B6.129(Cg)-Nf1tm1Par/J", + "rdfs:subClassOf": [ { - "@id": "bts:Ultrahigh-performanceliquidchromatography/tandemmassspectrometry" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "B6.129(Cg)-Nf1tm1Par/J", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:GFAP-Cre;Nf1-G848R/Flox", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "GFAP-Cre;Nf1-G848R/Flox", + "rdfs:subClassOf": [ { - "@id": "bts:Westernblot" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "GFAP-Cre; Nf1-G848R/Flox", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:GFAP-Cre;Nf1-R681X/Flox", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "GFAP-Cre;Nf1-R681X/Flox", + "rdfs:subClassOf": [ { - "@id": "bts:Wholeexomesequencing" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "GFAP-Cre; Nf1-R681X/Flox", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:GFAP-Cre;Nf1-C383X/Flox", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "GFAP-Cre;Nf1-C383X/Flox", + "rdfs:subClassOf": [ { - "@id": "bts:Wholegenomesequencing" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "GFAP-Cre; Nf1-C383X/Flox", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1-C848R/Flox", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1-C848R/Flox", + "rdfs:subClassOf": [ { - "@id": "bts:Whole-cellpatchclamp" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Nf1-C848R/Flox", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1-R681X/Flox", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1-R681X/Flox", + "rdfs:subClassOf": [ { - "@id": "bts:STRprofile" + "@id": "bts:ModelSystemName" } ], - "sms:displayName": "protocolAssay", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Nf1-R681X/Flox", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:2DAlamarBlueabsorbance", + "@id": "bts:Nf1-C383X/Flox", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "2DAlamarBlueabsorbance", + "rdfs:label": "Nf1-C383X/Flox", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, + "@id": "bts:ModelSystemName" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Nf1-C383X/Flox", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Nf1flox/flox", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Nf1flox/flox", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:ModelSystemName" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "2D AlamarBlue absorbance", + "sms:displayName": "Nf1flox/flox", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:2DAlamarBluefluorescence", + "@id": "bts:Celllysate", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "2DAlamarBluefluorescence", + "rdfs:label": "Celllysate", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, + "@id": "bts:ProteinExtractSource" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "cell lysate", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Cytoplasm", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Cytoplasm", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:ProteinExtractSource" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "2D AlamarBlue fluorescence", + "sms:displayName": "cytoplasm", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3Dconfocalimaging", + "@id": "bts:Nuclearextract", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3Dconfocalimaging", + "rdfs:label": "Nuclearextract", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, + "@id": "bts:ProteinExtractSource" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "nuclear extract", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:DDA", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "DDA", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:DataCollectionMode" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3D confocal imaging", + "sms:displayName": "DDA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3Delectronmicroscopy", + "@id": "bts:DIA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3Delectronmicroscopy", + "rdfs:label": "DIA", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, + "@id": "bts:DataCollectionMode" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "DIA", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Axilla", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Axilla", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3D electron microscopy", + "sms:displayName": "axilla", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3Dimaging", + "@id": "bts:Groin", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3Dimaging", + "rdfs:label": "Groin", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3D imaging", + "sms:displayName": "groin", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:3Dmicrotissueviability", + "@id": "bts:Leg", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "3Dmicrotissueviability", + "rdfs:label": "Leg", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "3D microtissue viability", + "sms:displayName": "leg", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Actigraphy", + "@id": "bts:Thoracicspine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Actigraphy", + "rdfs:label": "Thoracicspine", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "actigraphy", + "sms:displayName": "thoracic spine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AlgometRxNociometer", + "@id": "bts:Forearm", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AlgometRxNociometer", + "rdfs:label": "Forearm", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "AlgometRx Nociometer", + "sms:displayName": "forearm", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ATAC-seq", + "@id": "bts:Acetabulum", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ATAC-seq", + "rdfs:label": "Acetabulum", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ATAC-seq", + "sms:displayName": "acetabulum", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ATPaseactivityassay", + "@id": "bts:Muscle", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ATPaseactivityassay", + "rdfs:label": "Muscle", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ATPase activity assay", + "sms:displayName": "muscle", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BrdUproliferationassay", + "@id": "bts:Finger", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BrdUproliferationassay", + "rdfs:label": "Finger", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BrdU proliferation assay", + "sms:displayName": "finger", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CAPP-seq", + "@id": "bts:Iliacspine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CAPP-seq", + "rdfs:label": "Iliacspine", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CAPP-seq", + "sms:displayName": "iliac spine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CUT&RUN", + "@id": "bts:Head", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CUT&RUN", + "rdfs:label": "Head", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CUT&RUN", + "sms:displayName": "head", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChIP-seq", + "@id": "bts:Neck", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ChIP-seq", + "rdfs:label": "Neck", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ChIP-seq", + "sms:displayName": "neck", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChildBehaviorChecklistforAges1.5-5", + "@id": "bts:Shoulder", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ChildBehaviorChecklistforAges1.5-5", + "rdfs:label": "Shoulder", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Child Behavior Checklist for Ages 1.5-5", + "sms:displayName": "shoulder", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChildBehaviorChecklistforAges6-18", + "@id": "bts:Back", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ChildBehaviorChecklistforAges6-18", + "rdfs:label": "Back", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Child Behavior Checklist for Ages 6-18", + "sms:displayName": "back", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CODEX", + "@id": "bts:Spine", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CODEX", + "rdfs:label": "Spine", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "CODEX", + "sms:displayName": "spine", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Corsiblocks", + "@id": "bts:Scalp", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Corsiblocks", + "rdfs:label": "Scalp", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Corsi blocks", + "sms:displayName": "scalp", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:DNAopticalmapping", + "@id": "bts:Scapula", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "DNAopticalmapping", + "rdfs:label": "Scapula", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "DNA optical mapping", + "sms:displayName": "scapula", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ELISA", + "@id": "bts:Pelvis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ELISA", + "rdfs:label": "Pelvis", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ELISA", + "sms:displayName": "pelvis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ERRbisulfitesequencing", + "@id": "bts:Dorsolateralprefrontalcortex", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ERRbisulfitesequencing", + "rdfs:label": "Dorsolateralprefrontalcortex", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ERR bisulfite sequencing", + "sms:displayName": "dorsolateral prefrontal cortex", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:EdUproliferationassay", + "@id": "bts:Occcipitallobe", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "EdUproliferationassay", + "rdfs:label": "Occcipitallobe", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:BodySite" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "EdU proliferation assay", + "sms:displayName": "occcipital lobe", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FIA-MSMS", + "@id": "bts:LncRNAenrichment", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FIA-MSMS", + "rdfs:label": "LncRNAenrichment", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:LibraryPrep" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FIA-MSMS", + "sms:displayName": "lncRNAenrichment", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FLIPRhigh-throughputcellularscreening", + "@id": "bts:MiRNAenrichment", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FLIPRhigh-throughputcellularscreening", + "rdfs:label": "MiRNAenrichment", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:LibraryPrep" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FLIPR high-throughput cellular screening", + "sms:displayName": "miRNAenrichment", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FluorescenceInSituHybridization", + "@id": "bts:PolyAselection", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FluorescenceInSituHybridization", + "rdfs:label": "PolyAselection", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:LibraryPrep" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Fluorescence In Situ Hybridization", + "sms:displayName": "polyAselection", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Focusgroup", + "@id": "bts:RRNAdepletion", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Focusgroup", + "rdfs:label": "RRNAdepletion", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:LibraryPrep" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Focus group", + "sms:displayName": "rRNAdepletion", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FTIRspectroscopy", + "@id": "bts:DiffuseAstrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FTIRspectroscopy", + "rdfs:label": "DiffuseAstrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FTIR spectroscopy", + "sms:displayName": "Diffuse Astrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HI-C", + "@id": "bts:SubcutaneousNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HI-C", + "rdfs:label": "SubcutaneousNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HI-C", + "sms:displayName": "Subcutaneous Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HPLC", + "@id": "bts:PilomyxoidAstrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HPLC", + "rdfs:label": "PilomyxoidAstrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HPLC", + "sms:displayName": "Pilomyxoid Astrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Interview", + "@id": "bts:JuvenileMyelomonocyticLeukemia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Interview", + "rdfs:label": "JuvenileMyelomonocyticLeukemia", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Interview", + "sms:displayName": "Juvenile Myelomonocytic Leukemia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ISO-seq", + "@id": "bts:AnaplasticAstrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ISO-seq", + "rdfs:label": "AnaplasticAstrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ISO-seq", + "sms:displayName": "Anaplastic Astrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MIB/MS", + "@id": "bts:MalignantPeripheralNerveSheathTumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MIB/MS", + "rdfs:label": "MalignantPeripheralNerveSheathTumor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MIB/MS", + "sms:displayName": "Malignant Peripheral Nerve Sheath Tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Matrigel-basedtumorigenesisassay", + "@id": "bts:LocalizedNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Matrigel-basedtumorigenesisassay", + "rdfs:label": "LocalizedNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Matrigel-based tumorigenesis assay", + "sms:displayName": "Localized Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MudPIT", + "@id": "bts:CutaneousNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MudPIT", + "rdfs:label": "CutaneousNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MudPIT", + "sms:displayName": "Cutaneous Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NIHToolbox", + "@id": "bts:ColorectalAdenocarcinoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NIHToolbox", + "rdfs:label": "ColorectalAdenocarcinoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NIH Toolbox", + "sms:displayName": "Colorectal Adenocarcinoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NOMe-seq", + "@id": "bts:AnaplasticPilocyticAstrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NOMe-seq", + "rdfs:label": "AnaplasticPilocyticAstrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NOMe-seq", + "sms:displayName": "Anaplastic Pilocytic Astrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RNAarray", + "@id": "bts:Schwannoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RNAarray", + "rdfs:label": "Schwannoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" + "@id": "bts:CellType" }, { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RNA array", + "sms:displayName": "schwannoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RNA-seq", + "@id": "bts:HemorrhagicNeoplasm", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RNA-seq", + "rdfs:label": "HemorrhagicNeoplasm", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RNA-seq", + "sms:displayName": "Hemorrhagic Neoplasm", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RPPA", + "@id": "bts:PilocyticAstrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RPPA", + "rdfs:label": "PilocyticAstrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RPPA", + "sms:displayName": "Pilocytic Astrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RiccardiandAblonscales", + "@id": "bts:Ganglioglioma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "RiccardiandAblonscales", + "rdfs:label": "Ganglioglioma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Riccardi and Ablon scales", + "sms:displayName": "Ganglioglioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SNParray", + "@id": "bts:PlexiformNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SNParray", + "rdfs:label": "PlexiformNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SNP array", + "sms:displayName": "Plexiform Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SUSHI", + "@id": "bts:NF2-AssociatedTumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SUSHI", + "rdfs:label": "NF2-AssociatedTumor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SUSHI", + "sms:displayName": "NF2-Associated Tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sangersequencing", + "@id": "bts:Fibrosarcoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sangersequencing", + "rdfs:label": "Fibrosarcoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Sanger sequencing", + "sms:displayName": "Fibrosarcoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SocialResponsivenessScale", + "@id": "bts:Low-GradeGliomaNOS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SocialResponsivenessScale", + "rdfs:label": "Low-GradeGliomaNOS", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Social Responsiveness Scale", + "sms:displayName": "Low-Grade Glioma NOS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SocialResponsivenessScale,SecondEdition", + "@id": "bts:Glioblastoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SocialResponsivenessScale,SecondEdition", + "rdfs:label": "Glioblastoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Social Responsiveness Scale, Second Edition", + "sms:displayName": "Glioblastoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tcellreceptorrepertoiresequencing", + "@id": "bts:AnaplasticPleomorphicXanthoastrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tcellreceptorrepertoiresequencing", + "rdfs:label": "AnaplasticPleomorphicXanthoastrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "T cell receptor repertoire sequencing", + "sms:displayName": "Anaplastic Pleomorphic Xanthoastrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TIDE", + "@id": "bts:GlioblastomaMultiforme", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TIDE", + "rdfs:label": "GlioblastomaMultiforme", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TIDE", + "sms:displayName": "Glioblastoma Multiforme", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TMTquantitation", + "@id": "bts:AtypicalPilocyticAstrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TMTquantitation", + "rdfs:label": "AtypicalPilocyticAstrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TMT quantitation", + "sms:displayName": "Atypical Pilocytic Astrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:VonFreytest", + "@id": "bts:OpticPathwayGlioma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "VonFreytest", + "rdfs:label": "OpticPathwayGlioma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Von Frey test", + "sms:displayName": "Optic Pathway Glioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Activeavoidancelearningbehaviorassay", + "@id": "bts:DiffuseInfiltratingNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Activeavoidancelearningbehaviorassay", + "rdfs:label": "DiffuseInfiltratingNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "active avoidance learning behavior assay", + "sms:displayName": "Diffuse Infiltrating Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Array", + "@id": "bts:Fibromatosis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Array", + "rdfs:label": "Fibromatosis", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "array", + "sms:displayName": "Fibromatosis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Atomicforcemicroscopy", + "@id": "bts:NeurofibromawithDegenerativeAtypia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Atomicforcemicroscopy", + "rdfs:label": "NeurofibromawithDegenerativeAtypia", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "atomic force microscopy", + "sms:displayName": "Neurofibroma with Degenerative Atypia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Autoradiography", + "@id": "bts:NecroticNeoplasm", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Autoradiography", + "rdfs:label": "NecroticNeoplasm", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "autoradiography", + "sms:displayName": "Necrotic Neoplasm", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bisulfitesequencing", + "@id": "bts:PleomorphicXanthoastrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bisulfitesequencing", + "rdfs:label": "PleomorphicXanthoastrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bisulfite sequencing", + "sms:displayName": "Pleomorphic Xanthoastrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bloodchemistrymeasurement", + "@id": "bts:Teratoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bloodchemistrymeasurement", + "rdfs:label": "Teratoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" + "@id": "bts:TumorType" }, { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "blood chemistry measurement", + "sms:displayName": "teratoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BluenativePAGE", + "@id": "bts:Sarcoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BluenativePAGE", + "rdfs:label": "Sarcoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "blue native PAGE", + "sms:displayName": "Sarcoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Bodysizetraitmeasurement", + "@id": "bts:MassiveSoftTissueNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Bodysizetraitmeasurement", + "rdfs:label": "MassiveSoftTissueNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "body size trait measurement", + "sms:displayName": "Massive Soft Tissue Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Brightfieldmicroscopy", + "@id": "bts:Glioma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Brightfieldmicroscopy", + "rdfs:label": "Glioma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "brightfield microscopy", + "sms:displayName": "Glioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CAMP-GloMaxAssay", + "@id": "bts:Oligoastrocytoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CAMP-GloMaxAssay", + "rdfs:label": "Oligoastrocytoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cAMP-Glo Max Assay", + "sms:displayName": "Oligoastrocytoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Calciumretentioncapacityassay", + "@id": "bts:ColorectalCarcinoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Calciumretentioncapacityassay", + "rdfs:label": "ColorectalCarcinoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "calcium retention capacity assay", + "sms:displayName": "Colorectal Carcinoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cellcompetition", + "@id": "bts:ANNUBP", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cellcompetition", + "rdfs:label": "ANNUBP", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cell competition", + "sms:displayName": "ANNUBP", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cellcount", + "@id": "bts:High-GradeGliomaNOS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cellcount", + "rdfs:label": "High-GradeGliomaNOS", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cell count", + "sms:displayName": "High-Grade Glioma NOS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cellproliferation", + "@id": "bts:NF1-AssociatedTumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cellproliferation", + "rdfs:label": "NF1-AssociatedTumor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cell proliferation", + "sms:displayName": "NF1-Associated Tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cellviabilityassay", + "@id": "bts:AtypicalNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cellviabilityassay", + "rdfs:label": "AtypicalNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cell viability assay", + "sms:displayName": "Atypical Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Clinicaldata", + "@id": "bts:CellularNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Clinicaldata", + "rdfs:label": "CellularNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "clinical data", + "sms:displayName": "Cellular Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CNF-Skindex", + "@id": "bts:Neurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CNF-Skindex", + "rdfs:label": "Neurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cNF-Skindex", + "sms:displayName": "Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Cognitiveassessment", + "@id": "bts:RecurrentMPNST", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Cognitiveassessment", + "rdfs:label": "RecurrentMPNST", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "cognitive assessment", + "sms:displayName": "Recurrent MPNST", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ComplexIIenzymeactivityassay", + "@id": "bts:AnaplasticGanglioglioma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ComplexIIenzymeactivityassay", + "rdfs:label": "AnaplasticGanglioglioma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "complex II enzyme activity assay", + "sms:displayName": "Anaplastic Ganglioglioma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Compoundscreen", + "@id": "bts:Metastatictumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Compoundscreen", + "rdfs:label": "Metastatictumor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "compound screen", + "sms:displayName": "metastatic tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Contextualconditioningbehaviorassay", + "@id": "bts:Metastatic/recurrenttumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Contextualconditioningbehaviorassay", + "rdfs:label": "Metastatic/recurrenttumor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "contextual conditioning behavior assay", + "sms:displayName": "metastatic/recurrent tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ConventionalMRI", + "@id": "bts:Recurrenttumor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ConventionalMRI", + "rdfs:label": "Recurrenttumor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "conventional MRI", + "sms:displayName": "recurrent tumor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Children'sDermatologyLifeQualityIndexQuestionnaire", + "@id": "bts:Melanoma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Children'sDermatologyLifeQualityIndexQuestionnaire", + "rdfs:label": "Melanoma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Children's Dermatology Life Quality Index Questionnaire", + "sms:displayName": "Melanoma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Differentialscanningcalorimetry", + "@id": "bts:NodularNeurofibroma", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Differentialscanningcalorimetry", + "rdfs:label": "NodularNeurofibroma", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TumorType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "differential scanning calorimetry", + "sms:displayName": "Nodular Neurofibroma", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Dynamiclightscattering", + "@id": "bts:TPM", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Dynamiclightscattering", + "rdfs:label": "TPM", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:ExpressionUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "dynamic light scattering", + "sms:displayName": "TPM", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Electrochemiluminescence", + "@id": "bts:RPKM", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Electrochemiluminescence", + "rdfs:label": "RPKM", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:ExpressionUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "electrochemiluminescence", + "sms:displayName": "RPKM", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Electrophoreticlightscattering", + "@id": "bts:FPKM", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Electrophoreticlightscattering", + "rdfs:label": "FPKM", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:ExpressionUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "electrophoretic light scattering", + "sms:displayName": "FPKM", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Elevatedplusmazetest", + "@id": "bts:Counts", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Elevatedplusmazetest", + "rdfs:label": "Counts", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:ExpressionUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "elevated plus maze test", + "sms:displayName": "Counts", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FACE-QAppearance-relatedDistress", + "@id": "bts:RawCounts", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FACE-QAppearance-relatedDistress", + "rdfs:label": "RawCounts", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:ExpressionUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FACE-Q Appearance-related Distress", + "sms:displayName": "Raw Counts", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Flowcytometry", + "@id": "bts:NormalizedCounts", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Flowcytometry", + "rdfs:label": "NormalizedCounts", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:ExpressionUnit" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "flow cytometry", + "sms:displayName": "Normalized Counts", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Focusformingassay", + "@id": "bts:Prebubertal", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Focusformingassay", + "rdfs:label": "Prebubertal", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:PubertyOnset" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "focus forming assay", + "sms:displayName": "prebubertal", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FunctionalMRI", + "@id": "bts:Precocious", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "FunctionalMRI", + "rdfs:label": "Precocious", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:PubertyOnset" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "functional MRI", + "sms:displayName": "precocious", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gelfiltrationchromatography", + "@id": "bts:Normal", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gelfiltrationchromatography", + "rdfs:label": "Normal", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:PubertyOnset" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gel filtration chromatography", + "sms:displayName": "normal", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Gelpermeationchromatography", + "@id": "bts:Late", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Gelpermeationchromatography", + "rdfs:label": "Late", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:PubertyOnset" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "gel permeation chromatography", + "sms:displayName": "late", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Genotyping", + "@id": "bts:Active", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Genotyping", + "rdfs:label": "Active", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:StudyStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "genotyping", + "sms:displayName": "Active", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Highcontentscreen", + "@id": "bts:Completed", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Highcontentscreen", + "rdfs:label": "Completed", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:StudyStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "high content screen", + "sms:displayName": "Completed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Highfrequencyultrasound", + "@id": "bts:Withdrawn", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Highfrequencyultrasound", + "rdfs:label": "Withdrawn", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:StudyStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "high frequency ultrasound", + "sms:displayName": "Withdrawn", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:High-performanceliquidchromatography/tandemmassspectrometry", + "@id": "bts:Onlybyimagingevidence", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "High-performanceliquidchromatography/tandemmassspectrometry", + "rdfs:label": "Onlybyimagingevidence", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:NonvestibularSchwannomas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "high-performance liquid chromatography/tandem mass spectrometry", + "sms:displayName": "only by imaging evidence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Immunocytochemistry", + "@id": "bts:1pathogicallyconfirmed", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Immunocytochemistry", + "rdfs:label": "1pathogicallyconfirmed", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:NonvestibularSchwannomas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "immunocytochemistry", + "sms:displayName": "1 pathogically confirmed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Immunofluorescence", + "@id": "bts:2ormore,atleast1pathogicallyconfirmed", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Immunofluorescence", + "rdfs:label": "2ormore,atleast1pathogicallyconfirmed", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:NonvestibularSchwannomas" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "immunofluorescence", + "sms:displayName": "2 or more, at least 1 pathogically confirmed", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Immunohistochemistry", + "@id": "bts:ContentType", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Immunohistochemistry", + "rdfs:comment": "Refers to the type of content.", + "rdfs:label": "ContentType", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "immunohistochemistry", + "sms:displayName": "contentType", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Insilicosynthesis", + "@id": "bts:FailedQC", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Insilicosynthesis", + "rdfs:comment": "Whether the sample or data failed QC checks (Yes, No)", + "rdfs:label": "FailedQC", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "in silico synthesis", + "schema:rangeIncludes": [ + { + "@id": "bts:Yes" + }, + { + "@id": "bts:No" + } + ], + "sms:displayName": "failedQC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Invitrotumorigenesis", + "@id": "bts:Nf1GermlineMutation", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Invitrotumorigenesis", + "rdfs:comment": "NF1 germline mutation.", + "rdfs:label": "Nf1GermlineMutation", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "in vitro tumorigenesis", + "sms:displayName": "nf1GermlineMutation", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:InvivoPDXviability", + "@id": "bts:PairedEnd", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "InvivoPDXviability", + "rdfs:label": "PairedEnd", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:RunType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "in vivo PDX viability", + "sms:displayName": "pairedEnd", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Invivobioluminescence", + "@id": "bts:SingleEnd", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Invivobioluminescence", + "rdfs:label": "SingleEnd", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:RunType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "in vivo bioluminescence", + "sms:displayName": "singleEnd", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Invivotumorgrowth", + "@id": "bts:ReferenceSet", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Invivotumorgrowth", + "rdfs:comment": "A set of references (e.g., canonical assembled contigs) which defines a common coordinate space for comparing reference-aligned experimental data.", + "rdfs:label": "ReferenceSet", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "in vivo tumor growth", + "sms:displayName": "referenceSet", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Jumpinglibrary", - "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Jumpinglibrary", + "@id": "bts:ParentId", + "@type": "rdfs:Class", + "rdfs:comment": "The id of the parent resource, i.e. the parent folder on the platform. ", + "rdfs:label": "ParentId", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "jumping library", + "sms:displayName": "parentId", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Labelfreemassspectrometry", + "@id": "bts:Human", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Labelfreemassspectrometry", + "rdfs:label": "Human", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TransplantationRecipientSpecies" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "label free mass spectrometry", + "sms:displayName": "Human", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Laserspeckleimaging", + "@id": "bts:Mouse", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Laserspeckleimaging", + "rdfs:label": "Mouse", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:TransplantationRecipientSpecies" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "laser speckle imaging", + "sms:displayName": "Mouse", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lightscatteringassay", + "@id": "bts:ExperimentId", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Lightscatteringassay", + "rdfs:comment": "When applicable, an optional identifier that can be used to distinguish or group the experiments that generated the data; also can be used to denote internal batch reference if needed.", + "rdfs:label": "ExperimentId", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "light scattering assay", + "sms:displayName": "experimentId", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Liquidchromatography-electrochemicaldetection", + "@id": "bts:Monocytes", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Liquidchromatography-electrochemicaldetection", + "rdfs:label": "Monocytes", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "liquid chromatography-electrochemical detection", + "sms:displayName": "monocytes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Liquidchromatography/massspectrometry", + "@id": "bts:Macrophages", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Liquidchromatography/massspectrometry", + "rdfs:label": "Macrophages", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "liquid chromatography/mass spectrometry", + "sms:displayName": "macrophages", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Liquidchromatography/tandemmassspectrometry", + "@id": "bts:IPSC-derivedneuron", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Liquidchromatography/tandemmassspectrometry", + "rdfs:label": "IPSC-derivedneuron", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "liquid chromatography/tandem mass spectrometry", + "sms:displayName": "iPSC-derived neuron", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LncRNA-seq", + "@id": "bts:Lymphoblast", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LncRNA-seq", + "rdfs:label": "Lymphoblast", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lncRNA-seq", + "sms:displayName": "lymphoblast", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Localfieldpotentialrecording", + "@id": "bts:IPSC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Localfieldpotentialrecording", + "rdfs:label": "IPSC", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "local field potential recording", + "sms:displayName": "iPSC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Longtermpotentiationassay", + "@id": "bts:DRG/nerverootneurospherecell", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Longtermpotentiationassay", + "rdfs:label": "DRG/nerverootneurospherecell", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "long term potentiation assay", + "sms:displayName": "DRG/nerve root neurosphere cell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MRNAcounts", + "@id": "bts:CD138+", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MRNAcounts", + "rdfs:label": "CD138+", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mRNA counts", + "sms:displayName": "CD138+", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Magneticresonancespectroscopy", + "@id": "bts:IPSC-derivedtelencephalicorganoids", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Magneticresonancespectroscopy", + "rdfs:label": "IPSC-derivedtelencephalicorganoids", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "magnetic resonance spectroscopy", + "sms:displayName": "iPSC-derived telencephalic organoids", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Massspectrometry", + "@id": "bts:Monocyte-derivedmicroglia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Massspectrometry", + "rdfs:label": "Monocyte-derivedmicroglia", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "mass spectrometry", + "sms:displayName": "monocyte-derived microglia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Massivelyparallelreporterassay", + "@id": "bts:Microglia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Massivelyparallelreporterassay", + "rdfs:label": "Microglia", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "massively parallel reporter assay", + "sms:displayName": "microglia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Metabolicscreening", + "@id": "bts:SH-SY5Y", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Metabolicscreening", + "rdfs:label": "SH-SY5Y", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "metabolic screening", + "sms:displayName": "SH-SY5Y", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Methylationarray", + "@id": "bts:CNON", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Methylationarray", + "rdfs:label": "CNON", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "methylation array", + "sms:displayName": "CNON", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MiRNAarray", + "@id": "bts:NeuN+", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MiRNAarray", + "rdfs:label": "NeuN+", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "miRNA array", + "sms:displayName": "NeuN+", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MiRNA-seq", + "@id": "bts:CulturedMullerglia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MiRNA-seq", + "rdfs:label": "CulturedMullerglia", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "miRNA-seq", + "sms:displayName": "cultured Muller glia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Microrheology", + "@id": "bts:B-lymphocytes", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Microrheology", + "rdfs:label": "B-lymphocytes", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "microrheology", + "sms:displayName": "B-lymphocytes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Skindex-16", + "@id": "bts:Round", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Skindex-16", + "rdfs:label": "Round", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Skindex-16", + "sms:displayName": "round", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Multi-electrodearray", + "@id": "bts:Epithelial", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Multi-electrodearray", + "rdfs:label": "Epithelial", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "multi-electrode array", + "sms:displayName": "epithelial", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nanoparticletrackinganalysis", + "@id": "bts:Epithelial-like", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nanoparticletrackinganalysis", + "rdfs:label": "Epithelial-like", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "nanoparticle tracking analysis", + "sms:displayName": "epithelial-like", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NanoStringnCounterAnalysisSystem", + "@id": "bts:CD8+T-Cells", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NanoStringnCounterAnalysisSystem", + "rdfs:label": "CD8+T-Cells", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NanoString nCounter Analysis System", + "sms:displayName": "CD8+ T-Cells", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:N-backtask", + "@id": "bts:GLUtamatergicneurons", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "N-backtask", + "rdfs:label": "GLUtamatergicneurons", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "n-back task", + "sms:displayName": "GLUtamatergic neurons", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Neuropsychologicalassessment", + "@id": "bts:Arachnoid", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Neuropsychologicalassessment", + "rdfs:label": "Arachnoid", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "neuropsychological assessment", + "sms:displayName": "arachnoid", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Nextgenerationtargetedsequencing", + "@id": "bts:GABAergicneurons", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Nextgenerationtargetedsequencing", + "rdfs:label": "GABAergicneurons", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "next generation targeted sequencing", + "sms:displayName": "GABAergic neurons", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Noveltyresponsebehaviorassay", + "@id": "bts:Schwann", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Noveltyresponsebehaviorassay", + "rdfs:label": "Schwann", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "novelty response behavior assay", + "sms:displayName": "schwann", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Openfieldtest", + "@id": "bts:IPSC-derivedglia", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Openfieldtest", + "rdfs:label": "IPSC-derivedglia", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "open field test", + "sms:displayName": "iPSC-derived glia", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Opticaltomography", + "@id": "bts:IPSC-derivedastrocytes", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Opticaltomography", + "rdfs:label": "IPSC-derivedastrocytes", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "optical tomography", + "sms:displayName": "iPSC-derived astrocytes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Opticalcoherencetomography", + "@id": "bts:IPSC-derivedneuronalprogenitorcell", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Opticalcoherencetomography", + "rdfs:label": "IPSC-derivedneuronalprogenitorcell", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "optical coherence tomography", + "sms:displayName": "iPSC-derived neuronal progenitor cell", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Optokineticreflexassay", + "@id": "bts:Oligodendrocyte", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Optokineticreflexassay", + "rdfs:label": "Oligodendrocyte", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "optokinetic reflex assay", + "sms:displayName": "oligodendrocyte", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Oscillatoryrheology", + "@id": "bts:Fibroblast", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Oscillatoryrheology", + "rdfs:label": "Fibroblast", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "oscillatory rheology", + "sms:displayName": "fibroblast", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OxBS-seq", + "@id": "bts:Astrocytes", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OxBS-seq", + "rdfs:label": "Astrocytes", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "oxBS-seq", + "sms:displayName": "astrocytes", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Oxygenconsumptionassay", + "@id": "bts:Schwanncellprecursor", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Oxygenconsumptionassay", + "rdfs:label": "Schwanncellprecursor", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "oxygen consumption assay", + "sms:displayName": "Schwann cell precursor", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Patternelectroretinogram", + "@id": "bts:NeuN-", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Patternelectroretinogram", + "rdfs:label": "NeuN-", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "pattern electroretinogram", + "sms:displayName": "NeuN-", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Perineurialcellthickness", + "@id": "bts:Embryonicstemcells", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Perineurialcellthickness", + "rdfs:label": "Embryonicstemcells", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:CellType" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "perineurial cell thickness", + "sms:displayName": "Embryonic stem cells", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Phase-contrastmicroscopy", + "@id": "bts:ModifiedBy", "@type": "rdfs:Class", - "rdfs:comment": "TBD", - "rdfs:label": "Phase-contrastmicroscopy", + "rdfs:comment": "Refers to a user who last modified the resource on the platform.", + "rdfs:label": "ModifiedBy", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:Thing" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "phase-contrast microscopy", + "sms:displayName": "modifiedBy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Photograph", + "@id": "bts:Alive", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Photograph", + "rdfs:label": "Alive", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:VitalStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "photograph", + "sms:displayName": "alive", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Polymerasechainreaction", + "@id": "bts:Deceased", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Polymerasechainreaction", + "rdfs:label": "Deceased", "rdfs:subClassOf": [ { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:Assay" + "@id": "bts:VitalStatus" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "polymerase chain reaction", + "sms:displayName": "deceased", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Polysomnography", + "@id": "bts:2DAlamarBlueabsorbance", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Polysomnography", + "rdfs:label": "2DAlamarBlueabsorbance", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30448,15 +33178,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "polysomnography", + "sms:displayName": "2D AlamarBlue absorbance", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Positronemissiontomography", + "@id": "bts:2DAlamarBluefluorescence", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Positronemissiontomography", + "rdfs:label": "2DAlamarBluefluorescence", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30468,15 +33198,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "positron emission tomography", + "sms:displayName": "2D AlamarBlue fluorescence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PROMISCognitiveFunction", + "@id": "bts:3Dconfocalimaging", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PROMISCognitiveFunction", + "rdfs:label": "3Dconfocalimaging", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30488,15 +33218,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PROMIS Cognitive Function", + "sms:displayName": "3D confocal imaging", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:QuantitativePCR", + "@id": "bts:3Delectronmicroscopy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "QuantitativePCR", + "rdfs:label": "3Delectronmicroscopy", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30508,15 +33238,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "quantitative PCR", + "sms:displayName": "3D electron microscopy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Questionnaire", + "@id": "bts:3Dimaging", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Questionnaire", + "rdfs:label": "3Dimaging", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30528,15 +33258,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "questionnaire", + "sms:displayName": "3D imaging", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Reactiveoxygenspeciesassay", + "@id": "bts:3Dmicrotissueviability", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Reactiveoxygenspeciesassay", + "rdfs:label": "3Dmicrotissueviability", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30548,15 +33278,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "reactive oxygen species assay", + "sms:displayName": "3D microtissue viability", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Reportergeneassay", + "@id": "bts:Actigraphy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Reportergeneassay", + "rdfs:label": "Actigraphy", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30568,15 +33298,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "reporter gene assay", + "sms:displayName": "actigraphy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rheometry", + "@id": "bts:AlgometRxNociometer", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rheometry", + "rdfs:label": "AlgometRxNociometer", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30588,15 +33318,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "rheometry", + "sms:displayName": "AlgometRx Nociometer", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ribo-seq", + "@id": "bts:ATAC-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ribo-seq", + "rdfs:label": "ATAC-seq", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30608,15 +33338,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ribo-seq", + "sms:displayName": "ATAC-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Rotarodperformancetest", + "@id": "bts:ATPaseactivityassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Rotarodperformancetest", + "rdfs:label": "ATPaseactivityassay", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30628,15 +33358,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "rotarod performance test", + "sms:displayName": "ATPase activity assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SandwichELISA", + "@id": "bts:BrdUproliferationassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SandwichELISA", + "rdfs:label": "BrdUproliferationassay", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30648,15 +33378,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sandwich ELISA", + "sms:displayName": "BrdU proliferation assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ScCGI-seq", + "@id": "bts:CAPP-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ScCGI-seq", + "rdfs:label": "CAPP-seq", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30668,19 +33398,16 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "scCGI-seq", + "sms:displayName": "CAPP-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Scale", + "@id": "bts:CUT&RUN", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Scale", + "rdfs:label": "CUT&RUN", "rdfs:subClassOf": [ - { - "@id": "bts:Platform" - }, { "@id": "bts:ProtocolAssay" }, @@ -30691,15 +33418,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Scale", + "sms:displayName": "CUT&RUN", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SaferSeqS", + "@id": "bts:ChIP-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SaferSeqS", + "rdfs:label": "ChIP-seq", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30711,15 +33438,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SaferSeqS", + "sms:displayName": "ChIP-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Singlemoleculedrugscreenassay", + "@id": "bts:ChildBehaviorChecklistforAges1.5-5", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Singlemoleculedrugscreenassay", + "rdfs:label": "ChildBehaviorChecklistforAges1.5-5", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30731,15 +33458,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single molecule drug screen assay", + "sms:displayName": "Child Behavior Checklist for Ages 1.5-5", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Single-cellRNA-seq", + "@id": "bts:ChildBehaviorChecklistforAges6-18", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Single-cellRNA-seq", + "rdfs:label": "ChildBehaviorChecklistforAges6-18", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30751,15 +33478,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single-cell RNA-seq", + "sms:displayName": "Child Behavior Checklist for Ages 6-18", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SinglecellATAC-seq", + "@id": "bts:CODEX", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SinglecellATAC-seq", + "rdfs:label": "CODEX", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30771,15 +33498,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single cell ATAC-seq", + "sms:displayName": "CODEX", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Single-nucleusRNA-seq", + "@id": "bts:Corsiblocks", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Single-nucleusRNA-seq", + "rdfs:label": "Corsiblocks", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30791,15 +33518,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "single-nucleus RNA-seq", + "sms:displayName": "Corsi blocks", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Sorbitoldehydrogenaseactivitylevelassay", + "@id": "bts:DNAopticalmapping", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Sorbitoldehydrogenaseactivitylevelassay", + "rdfs:label": "DNAopticalmapping", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30811,15 +33538,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "sorbitol dehydrogenase activity level assay", + "sms:displayName": "DNA optical mapping", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Spatialfrequencydomainimaging", + "@id": "bts:ELISA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Spatialfrequencydomainimaging", + "rdfs:label": "ELISA", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30831,15 +33558,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "spatial frequency domain imaging", + "sms:displayName": "ELISA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Spatialtranscriptomics", + "@id": "bts:ERRbisulfitesequencing", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Spatialtranscriptomics", + "rdfs:label": "ERRbisulfitesequencing", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30851,15 +33578,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "spatial transcriptomics", + "sms:displayName": "ERR bisulfite sequencing", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Staticlightscattering", + "@id": "bts:EdUproliferationassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Staticlightscattering", + "rdfs:label": "EdUproliferationassay", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30871,15 +33598,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "static light scattering", + "sms:displayName": "EdU proliferation assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Survival", + "@id": "bts:FIA-MSMS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Survival", + "rdfs:label": "FIA-MSMS", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30891,15 +33618,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "survival", + "sms:displayName": "FIA-MSMS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Targetedexomesequencing", + "@id": "bts:FLIPRhigh-throughputcellularscreening", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Targetedexomesequencing", + "rdfs:label": "FLIPRhigh-throughputcellularscreening", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30911,15 +33638,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "targeted exome sequencing", + "sms:displayName": "FLIPR high-throughput cellular screening", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Tractionforcemicroscopy", + "@id": "bts:FluorescenceInSituHybridization", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Tractionforcemicroscopy", + "rdfs:label": "FluorescenceInSituHybridization", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30931,15 +33658,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "traction force microscopy", + "sms:displayName": "Fluorescence In Situ Hybridization", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Twinspotassay", + "@id": "bts:Focusgroup", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Twinspotassay", + "rdfs:label": "Focusgroup", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30951,15 +33678,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "twin spot assay", + "sms:displayName": "Focus group", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Ultrahigh-performanceliquidchromatography/tandemmassspectrometry", + "@id": "bts:FTIRspectroscopy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Ultrahigh-performanceliquidchromatography/tandemmassspectrometry", + "rdfs:label": "FTIRspectroscopy", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30971,15 +33698,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ultra high-performance liquid chromatography/tandem mass spectrometry", + "sms:displayName": "FTIR spectroscopy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Westernblot", + "@id": "bts:HI-C", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Westernblot", + "rdfs:label": "HI-C", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -30991,15 +33718,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "western blot", + "sms:displayName": "HI-C", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Wholeexomesequencing", + "@id": "bts:HPLC", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Wholeexomesequencing", + "rdfs:label": "HPLC", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -31011,15 +33738,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "whole exome sequencing", + "sms:displayName": "HPLC", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Wholegenomesequencing", + "@id": "bts:Interview", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Wholegenomesequencing", + "rdfs:label": "Interview", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -31031,15 +33758,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "whole genome sequencing", + "sms:displayName": "Interview", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Whole-cellpatchclamp", + "@id": "bts:ISO-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Whole-cellpatchclamp", + "rdfs:label": "ISO-seq", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -31051,15 +33778,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "whole-cell patch clamp", + "sms:displayName": "ISO-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:STRprofile", + "@id": "bts:MIB/MS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "STRprofile", + "rdfs:label": "MIB/MS", "rdfs:subClassOf": [ { "@id": "bts:ProtocolAssay" @@ -31071,2692 +33798,2718 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "STR profile", + "sms:displayName": "MIB/MS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BisulfiteConversionKitID", + "@id": "bts:Matrigel-basedtumorigenesisassay", "@type": "rdfs:Class", - "rdfs:comment": "Name of kit used in bisulfite conversion.", - "rdfs:label": "BisulfiteConversionKitID", + "rdfs:comment": "TBD", + "rdfs:label": "Matrigel-basedtumorigenesisassay", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "bisulfiteConversionKitID", + "sms:displayName": "Matrigel-based tumorigenesis assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChipPosition", + "@id": "bts:MudPIT", "@type": "rdfs:Class", - "rdfs:comment": "User-specified identifier for the specific position on the chip that the sample was loaded into to perform the methylation microarray.", - "rdfs:label": "ChipPosition", + "rdfs:comment": "TBD", + "rdfs:label": "MudPIT", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "chipPosition", + "sms:displayName": "MudPIT", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Assay", + "@id": "bts:NIHToolbox", "@type": "rdfs:Class", - "rdfs:comment": "The technology used to generate the data in this file.", - "rdfs:label": "Assay", + "rdfs:comment": "TBD", + "rdfs:label": "NIHToolbox", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { - "@id": "http://schema.biothings.io" - }, - "schema:rangeIncludes": [ - { - "@id": "bts:2DAlamarBlueabsorbance" - }, - { - "@id": "bts:2DAlamarBluefluorescence" - }, - { - "@id": "bts:3Dconfocalimaging" - }, - { - "@id": "bts:3Delectronmicroscopy" - }, - { - "@id": "bts:3Dimaging" - }, - { - "@id": "bts:3Dmicrotissueviability" - }, - { - "@id": "bts:Actigraphy" - }, - { - "@id": "bts:AlgometRxNociometer" - }, - { - "@id": "bts:ATAC-seq" - }, - { - "@id": "bts:ATPaseactivityassay" - }, - { - "@id": "bts:BrdUproliferationassay" - }, - { - "@id": "bts:CAPP-seq" - }, - { - "@id": "bts:CUT&RUN" - }, - { - "@id": "bts:ChIP-seq" - }, - { - "@id": "bts:ChildBehaviorChecklistforAges1.5-5" - }, - { - "@id": "bts:ChildBehaviorChecklistforAges6-18" - }, - { - "@id": "bts:CODEX" - }, - { - "@id": "bts:Corsiblocks" - }, - { - "@id": "bts:DNAopticalmapping" - }, - { - "@id": "bts:ELISA" - }, - { - "@id": "bts:ERRbisulfitesequencing" - }, - { - "@id": "bts:EdUproliferationassay" - }, - { - "@id": "bts:FIA-MSMS" - }, - { - "@id": "bts:FLIPRhigh-throughputcellularscreening" - }, - { - "@id": "bts:FluorescenceInSituHybridization" - }, - { - "@id": "bts:Focusgroup" - }, - { - "@id": "bts:FTIRspectroscopy" - }, - { - "@id": "bts:HI-C" - }, - { - "@id": "bts:HPLC" - }, - { - "@id": "bts:Interview" - }, - { - "@id": "bts:ISO-seq" - }, - { - "@id": "bts:MIB/MS" - }, - { - "@id": "bts:Matrigel-basedtumorigenesisassay" - }, - { - "@id": "bts:MudPIT" - }, - { - "@id": "bts:NIHToolbox" - }, - { - "@id": "bts:NOMe-seq" - }, - { - "@id": "bts:RNAarray" - }, - { - "@id": "bts:RNA-seq" - }, - { - "@id": "bts:RPPA" - }, - { - "@id": "bts:RiccardiandAblonscales" - }, - { - "@id": "bts:SNParray" - }, - { - "@id": "bts:SUSHI" - }, - { - "@id": "bts:Sangersequencing" - }, - { - "@id": "bts:SocialResponsivenessScale" - }, - { - "@id": "bts:SocialResponsivenessScale,SecondEdition" - }, - { - "@id": "bts:Tcellreceptorrepertoiresequencing" - }, - { - "@id": "bts:TIDE" - }, - { - "@id": "bts:TMTquantitation" - }, - { - "@id": "bts:VonFreytest" - }, - { - "@id": "bts:Activeavoidancelearningbehaviorassay" - }, - { - "@id": "bts:Array" - }, - { - "@id": "bts:Atomicforcemicroscopy" - }, - { - "@id": "bts:Autoradiography" - }, - { - "@id": "bts:Bisulfitesequencing" - }, - { - "@id": "bts:Bloodchemistrymeasurement" - }, - { - "@id": "bts:BluenativePAGE" - }, - { - "@id": "bts:Bodysizetraitmeasurement" - }, - { - "@id": "bts:Brightfieldmicroscopy" - }, - { - "@id": "bts:CAMP-GloMaxAssay" - }, - { - "@id": "bts:Calciumretentioncapacityassay" - }, - { - "@id": "bts:Cellcompetition" - }, - { - "@id": "bts:Cellcount" - }, - { - "@id": "bts:Cellproliferation" - }, - { - "@id": "bts:Cellviabilityassay" - }, - { - "@id": "bts:Clinicaldata" - }, - { - "@id": "bts:CNF-Skindex" - }, - { - "@id": "bts:Cognitiveassessment" - }, - { - "@id": "bts:Combinationlibraryscreen" - }, - { - "@id": "bts:Combinationscreen" - }, - { - "@id": "bts:ComplexIIenzymeactivityassay" - }, - { - "@id": "bts:Compoundscreen" - }, - { - "@id": "bts:Contextualconditioningbehaviorassay" - }, - { - "@id": "bts:ConventionalMRI" - }, - { - "@id": "bts:Children'sDermatologyLifeQualityIndexQuestionnaire" - }, - { - "@id": "bts:Differentialscanningcalorimetry" - }, - { - "@id": "bts:Dynamiclightscattering" - }, - { - "@id": "bts:Electrochemiluminescence" - }, - { - "@id": "bts:Electrophoreticlightscattering" - }, - { - "@id": "bts:Elevatedplusmazetest" - }, - { - "@id": "bts:FACE-QAppearance-relatedDistress" - }, - { - "@id": "bts:Flowcytometry" - }, - { - "@id": "bts:Focusformingassay" - }, - { - "@id": "bts:FunctionalMRI" - }, - { - "@id": "bts:Gaitmeasurement" - }, - { - "@id": "bts:Gelfiltrationchromatography" - }, - { - "@id": "bts:Gelpermeationchromatography" - }, - { - "@id": "bts:Genotyping" - }, - { - "@id": "bts:Highcontentscreen" - }, - { - "@id": "bts:Highfrequencyultrasound" - }, - { - "@id": "bts:High-performanceliquidchromatography/tandemmassspectrometry" - }, - { - "@id": "bts:Immunoassay" - }, - { - "@id": "bts:Immunocytochemistry" - }, - { - "@id": "bts:Immunofluorescence" - }, - { - "@id": "bts:Immunohistochemistry" - }, - { - "@id": "bts:Insilicosynthesis" - }, - { - "@id": "bts:Invitrotumorigenesis" - }, - { - "@id": "bts:InvivoPDXviability" - }, - { - "@id": "bts:Invivobioluminescence" - }, - { - "@id": "bts:Invivotumorgrowth" - }, - { - "@id": "bts:Jumpinglibrary" - }, - { - "@id": "bts:Labelfreemassspectrometry" - }, - { - "@id": "bts:Laserspeckleimaging" - }, - { - "@id": "bts:Lightscatteringassay" - }, - { - "@id": "bts:Liquidchromatography-electrochemicaldetection" - }, - { - "@id": "bts:Liquidchromatography/massspectrometry" - }, - { - "@id": "bts:Liquidchromatography/tandemmassspectrometry" - }, - { - "@id": "bts:LncRNA-seq" - }, - { - "@id": "bts:Localfieldpotentialrecording" - }, - { - "@id": "bts:Longtermpotentiationassay" - }, - { - "@id": "bts:MRNAcounts" - }, - { - "@id": "bts:Magneticresonancespectroscopy" - }, - { - "@id": "bts:Massspectrometry" - }, - { - "@id": "bts:Massivelyparallelreporterassay" - }, - { - "@id": "bts:Metabolicscreening" - }, - { - "@id": "bts:Methylationarray" - }, - { - "@id": "bts:MiRNAarray" - }, - { - "@id": "bts:MiRNA-seq" - }, - { - "@id": "bts:Microrheology" - }, - { - "@id": "bts:Skindex-16" - }, + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "NIH Toolbox", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:NOMe-seq", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NOMe-seq", + "rdfs:subClassOf": [ { - "@id": "bts:Multi-electrodearray" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Nanoparticletrackinganalysis" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "NOMe-seq", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:RNAarray", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "RNAarray", + "rdfs:subClassOf": [ { - "@id": "bts:NanoStringnCounterAnalysisSystem" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:N-backtask" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "RNA array", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:RNA-seq", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "RNA-seq", + "rdfs:subClassOf": [ { - "@id": "bts:Neuropsychologicalassessment" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Nextgenerationtargetedsequencing" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "RNA-seq", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:RPPA", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "RPPA", + "rdfs:subClassOf": [ { - "@id": "bts:Noveltyresponsebehaviorassay" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Openfieldtest" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "RPPA", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:RiccardiandAblonscales", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "RiccardiandAblonscales", + "rdfs:subClassOf": [ { - "@id": "bts:Opticaltomography" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Opticalcoherencetomography" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Riccardi and Ablon scales", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SNParray", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SNParray", + "rdfs:subClassOf": [ { - "@id": "bts:Optokineticreflexassay" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Oscillatoryrheology" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "SNP array", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SUSHI", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SUSHI", + "rdfs:subClassOf": [ { - "@id": "bts:OxBS-seq" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Oxygenconsumptionassay" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "SUSHI", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Sangersequencing", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Sangersequencing", + "rdfs:subClassOf": [ { - "@id": "bts:Patternelectroretinogram" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Perineurialcellthickness" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Sanger sequencing", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SocialResponsivenessScale", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SocialResponsivenessScale", + "rdfs:subClassOf": [ { - "@id": "bts:Phase-contrastmicroscopy" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Photograph" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Social Responsiveness Scale", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:SocialResponsivenessScale,SecondEdition", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SocialResponsivenessScale,SecondEdition", + "rdfs:subClassOf": [ { - "@id": "bts:Polymerasechainreaction" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Polysomnography" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Social Responsiveness Scale, Second Edition", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Tcellreceptorrepertoiresequencing", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Tcellreceptorrepertoiresequencing", + "rdfs:subClassOf": [ { - "@id": "bts:Positronemissiontomography" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:PROMISCognitiveFunction" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "T cell receptor repertoire sequencing", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:TIDE", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "TIDE", + "rdfs:subClassOf": [ { - "@id": "bts:QuantitativePCR" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Questionnaire" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "TIDE", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:TMTquantitation", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "TMTquantitation", + "rdfs:subClassOf": [ { - "@id": "bts:Reactiveoxygenspeciesassay" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Reportergeneassay" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "TMT quantitation", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:VonFreytest", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "VonFreytest", + "rdfs:subClassOf": [ { - "@id": "bts:Rheometry" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Ribo-seq" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Von Frey test", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Activeavoidancelearningbehaviorassay", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Activeavoidancelearningbehaviorassay", + "rdfs:subClassOf": [ { - "@id": "bts:Rotarodperformancetest" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:SandwichELISA" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "active avoidance learning behavior assay", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Array", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Array", + "rdfs:subClassOf": [ { - "@id": "bts:ScCGI-seq" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Scale" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "array", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Atomicforcemicroscopy", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Atomicforcemicroscopy", + "rdfs:subClassOf": [ { - "@id": "bts:SaferSeqS" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Singlemoleculedrugscreenassay" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "atomic force microscopy", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Autoradiography", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Autoradiography", + "rdfs:subClassOf": [ { - "@id": "bts:Single-cellRNA-seq" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:SinglecellATAC-seq" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "autoradiography", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Bisulfitesequencing", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Bisulfitesequencing", + "rdfs:subClassOf": [ { - "@id": "bts:Single-nucleusRNA-seq" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Smallmoleculelibraryscreen" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "bisulfite sequencing", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Bloodchemistrymeasurement", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Bloodchemistrymeasurement", + "rdfs:subClassOf": [ { - "@id": "bts:Sorbitoldehydrogenaseactivitylevelassay" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Spatialfrequencydomainimaging" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "blood chemistry measurement", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:BluenativePAGE", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "BluenativePAGE", + "rdfs:subClassOf": [ { - "@id": "bts:Spatialtranscriptomics" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Staticlightscattering" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "blue native PAGE", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Bodysizetraitmeasurement", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Bodysizetraitmeasurement", + "rdfs:subClassOf": [ { - "@id": "bts:Survival" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Targetedexomesequencing" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "body size trait measurement", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Brightfieldmicroscopy", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Brightfieldmicroscopy", + "rdfs:subClassOf": [ { - "@id": "bts:Tractionforcemicroscopy" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Twinspotassay" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "brightfield microscopy", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:CAMP-GloMaxAssay", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "CAMP-GloMaxAssay", + "rdfs:subClassOf": [ { - "@id": "bts:Ultrahigh-performanceliquidchromatography/tandemmassspectrometry" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Westernblot" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "cAMP-Glo Max Assay", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Calciumretentioncapacityassay", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Calciumretentioncapacityassay", + "rdfs:subClassOf": [ { - "@id": "bts:Wholeexomesequencing" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Wholegenomesequencing" - }, + "@id": "bts:Assay" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "calcium retention capacity assay", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Cellcompetition", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Cellcompetition", + "rdfs:subClassOf": [ { - "@id": "bts:Whole-cellpatchclamp" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:STRprofile" + "@id": "bts:Assay" } ], - "sms:displayName": "assay", - "sms:required": "sms:true", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "cell competition", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StudyFileviewId", + "@id": "bts:Cellcount", "@type": "rdfs:Class", - "rdfs:comment": "Links a Synapse project to its fileview.", - "rdfs:label": "StudyFileviewId", + "rdfs:comment": "TBD", + "rdfs:label": "Cellcount", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "studyFileviewId", + "sms:displayName": "cell count", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AverageReadLength", + "@id": "bts:Cellpainting", "@type": "rdfs:Class", - "rdfs:comment": "Average read length collected from samtools", - "rdfs:label": "AverageReadLength", + "rdfs:comment": "TBD", + "rdfs:label": "Cellpainting", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "averageReadLength", + "sms:displayName": "cell painting", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GliomaOrEpendymoma", + "@id": "bts:Cellproliferation", "@type": "rdfs:Class", - "rdfs:comment": "Characterization of the manifestation of Glioma or ependymoma.", - "rdfs:label": "GliomaOrEpendymoma", + "rdfs:comment": "TBD", + "rdfs:label": "Cellproliferation", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:Notimaged" - }, - { - "@id": "bts:Absentbyimaging" - }, + "sms:displayName": "cell proliferation", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Cellviabilityassay", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Cellviabilityassay", + "rdfs:subClassOf": [ { - "@id": "bts:Present" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:Unknown" + "@id": "bts:Assay" } ], - "sms:displayName": "gliomaOrEpendymoma", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "cell viability assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RelatedStudies", + "@id": "bts:Clinicaldata", "@type": "rdfs:Class", - "rdfs:comment": "Studies similar to the current study. Subproperty of `relatedResource`.", - "rdfs:label": "RelatedStudies", + "rdfs:comment": "TBD", + "rdfs:label": "Clinicaldata", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "relatedStudies", + "sms:displayName": "clinical data", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Platform", + "@id": "bts:CNF-Skindex", "@type": "rdfs:Class", - "rdfs:comment": "A sequencing platform, microscope, spectroscope/plate reader, or other platform for collecting data.", - "rdfs:label": "Platform", + "rdfs:comment": "TBD", + "rdfs:label": "CNF-Skindex", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "schema:rangeIncludes": [ - { - "@id": "bts:10xVisiumSpatialGeneExpression" - }, - { - "@id": "bts:2DCellTiter-Glo" - }, - { - "@id": "bts:2DIncucyte" - }, - { - "@id": "bts:AffymetrixGenome-WideHumanSNP5.0Array" - }, - { - "@id": "bts:AffymetrixGenome-WideHumanSNP6.0Array" - }, - { - "@id": "bts:AffymetrixHumanGene1.0STArray" - }, - { - "@id": "bts:AffymetrixHumanGenomeU133Plus2.0Array" - }, - { - "@id": "bts:AffymetrixU133AB" - }, - { - "@id": "bts:Agilent44Karray" - }, - { - "@id": "bts:BDFACSCalibur" - }, - { - "@id": "bts:BGISEQ-500" - }, - { - "@id": "bts:BionanoIrys" - }, - { - "@id": "bts:Caliper" - }, - { - "@id": "bts:CherryImagingFACEPlatform" - }, - { - "@id": "bts:CherryImagingTRACEPlatform" - }, - { - "@id": "bts:ChromiumX" - }, - { - "@id": "bts:EnVision2103MultiplateReader" - }, - { - "@id": "bts:GEDiscoveryMR7503T" - }, - { - "@id": "bts:GEOptimaMR450W1.5T" - }, - { - "@id": "bts:GESignaHDxt1.5T" - }, - { - "@id": "bts:GESignaGenesis1.5T" - }, - { - "@id": "bts:GESignaHDxt3T" - }, - { - "@id": "bts:GESignaPremier3T" - }, - { - "@id": "bts:GESignaExcite1.5T" - }, - { - "@id": "bts:HitachiEchelon1.5T" - }, - { - "@id": "bts:HitachiOasis1.2T" - }, - { - "@id": "bts:IVISSpectrumInVivoImagingSystem" - }, - { - "@id": "bts:Illumina1M" - }, - { - "@id": "bts:IlluminaGenomeAnalyzerIIx" - }, - { - "@id": "bts:IlluminaHiSeq2000" - }, - { - "@id": "bts:IlluminaHiSeq2500" - }, - { - "@id": "bts:IlluminaHiSeq3000" - }, - { - "@id": "bts:IlluminaHiSeq4000" - }, - { - "@id": "bts:IlluminaHiSeqX" - }, - { - "@id": "bts:IlluminaHuman660W-Quadv1.0BeadChip" - }, - { - "@id": "bts:IlluminaHumanHap300" - }, - { - "@id": "bts:IlluminaHumanMethylation450" - }, - { - "@id": "bts:IlluminaHumanOmni1-Quadv1.0" - }, - { - "@id": "bts:IlluminaHumanOmniExpress-24v1.0BeadChip" - }, - { - "@id": "bts:IlluminaHumanOmniExpress-24v1.2BeadChip" - }, - { - "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv1.0(850k)" - }, - { - "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv2.0(935k)" - }, - { - "@id": "bts:IlluminaMiSeq" - }, - { - "@id": "bts:IlluminaMouseWG-6v2.0expressionbeadchip" - }, - { - "@id": "bts:IlluminaNextSeq1000" - }, - { - "@id": "bts:IlluminaNextSeq2000" - }, - { - "@id": "bts:IlluminaNextSeq500" - }, - { - "@id": "bts:IlluminaNextSeq550" - }, - { - "@id": "bts:IlluminaNovaSeq6000" - }, - { - "@id": "bts:IlluminaNovaSeqX" - }, - { - "@id": "bts:IlluminaNovaSeqXPlus" - }, - { - "@id": "bts:IlluminaOmni2pt5M" - }, - { - "@id": "bts:IlluminaOmni5M" - }, - { - "@id": "bts:IlluminaWholeGenomeDASL" - }, - { - "@id": "bts:Illuminah650" - }, - { - "@id": "bts:InfiniumHumanOmniExpressExome" - }, - { - "@id": "bts:LI-COROdysseyCLx" - }, - { - "@id": "bts:LTQOrbitrapXL" - }, - { - "@id": "bts:LeicaAperioAT2" - }, - { - "@id": "bts:LeicaMZ16" - }, - { - "@id": "bts:LeicaS9Stereomicroscope" - }, - { - "@id": "bts:LifeVizInfinitySystem" - }, - { - "@id": "bts:LifeVizMicroSystem" - }, - { - "@id": "bts:MGIT-series" - }, - { - "@id": "bts:MalvernZetasizer" - }, - { - "@id": "bts:NanoFCM" - }, - { - "@id": "bts:NanoStringHumannCounterPanCancerIO360Panel" - }, - { - "@id": "bts:NanostringCounter" - }, - { - "@id": "bts:NanostringGeoMx" - }, - { - "@id": "bts:NotApplicable" - }, - { - "@id": "bts:OlympusDP80" - }, - { - "@id": "bts:OlympusIX73" - }, - { - "@id": "bts:OrbitrapFusionLumosTribrid" - }, - { - "@id": "bts:OtherPlatform" - }, - { - "@id": "bts:OxfordNanopore" - }, - { - "@id": "bts:PacBioRSII" - }, - { - "@id": "bts:PacBioSequelIISystem" - }, - { - "@id": "bts:PacBioSequelIIeSystem" - }, - { - "@id": "bts:Pannoramic250Flash" - }, - { - "@id": "bts:Perlegen300Karray" - }, - { - "@id": "bts:PhilipsAchieva1.5T" - }, - { - "@id": "bts:PhilipsAchieva3T" - }, - { - "@id": "bts:PhilipsInteraAchieva3T" - }, - { - "@id": "bts:PhilipsIngenia1.5T" - }, - { - "@id": "bts:PhilipsIngenia3T" - }, - { - "@id": "bts:PhilipsPanorama1.0T" - }, - { - "@id": "bts:PromegaGloMaxDiscover" - }, - { - "@id": "bts:QExativeHF" - }, - { - "@id": "bts:Scale" - }, - { - "@id": "bts:SiemensAvanto1.5T" - }, - { - "@id": "bts:SiemensAvantoFit1.5T" - }, - { - "@id": "bts:SiemensMagnetomAera1.5T" - }, - { - "@id": "bts:SiemensMagnetomEspree1.5T" - }, - { - "@id": "bts:SiemensMagnetomPrisma3T" - }, - { - "@id": "bts:SiemensMagnetomSkyra3T" - }, - { - "@id": "bts:SiemensMagnetomTrio3T" - }, - { - "@id": "bts:SiemensMagnetomVerio3T" - }, - { - "@id": "bts:SiemensMagnetomPrismaFit3T" - }, - { - "@id": "bts:SpectramaxMSeries" - }, - { - "@id": "bts:TOOsonixSystemONE-M" - }, - { - "@id": "bts:ToshibaVantageTitan1.5T" - }, - { - "@id": "bts:VarioskanLUX" - }, - { - "@id": "bts:VectraH13DImagingSystem" - }, - { - "@id": "bts:Vevo3100ImagingSystem" - }, - { - "@id": "bts:XF24ExtracellularFluxAnalyzer" - }, - { - "@id": "bts:ZeissLSM" - }, - { - "@id": "bts:ZeissLSM700" - }, + "sms:displayName": "cNF-Skindex", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:Cognitiveassessment", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Cognitiveassessment", + "rdfs:subClassOf": [ { - "@id": "bts:ZeissLSM980" + "@id": "bts:ProtocolAssay" }, { - "@id": "bts:ZenoElectronicWalkway" + "@id": "bts:Assay" } ], - "sms:displayName": "platform", - "sms:required": "sms:true", + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "cognitive assessment", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:10xVisiumSpatialGeneExpression", + "@id": "bts:ComplexIIenzymeactivityassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "10xVisiumSpatialGeneExpression", + "rdfs:label": "ComplexIIenzymeactivityassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "10x Visium Spatial Gene Expression", + "sms:displayName": "complex II enzyme activity assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:2DCellTiter-Glo", + "@id": "bts:Compoundscreen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "2DCellTiter-Glo", + "rdfs:label": "Compoundscreen", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "2D CellTiter-Glo", + "sms:displayName": "compound screen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:2DIncucyte", + "@id": "bts:Contextualconditioningbehaviorassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "2DIncucyte", + "rdfs:label": "Contextualconditioningbehaviorassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "2D Incucyte", + "sms:displayName": "contextual conditioning behavior assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AffymetrixGenome-WideHumanSNP5.0Array", + "@id": "bts:ConventionalMRI", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AffymetrixGenome-WideHumanSNP5.0Array", + "rdfs:label": "ConventionalMRI", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Affymetrix Genome-Wide Human SNP 5.0 Array", + "sms:displayName": "conventional MRI", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AffymetrixGenome-WideHumanSNP6.0Array", + "@id": "bts:Children'sDermatologyLifeQualityIndexQuestionnaire", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AffymetrixGenome-WideHumanSNP6.0Array", + "rdfs:label": "Children'sDermatologyLifeQualityIndexQuestionnaire", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Affymetrix Genome-Wide Human SNP 6.0 Array", + "sms:displayName": "Children's Dermatology Life Quality Index Questionnaire", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AffymetrixHumanGene1.0STArray", + "@id": "bts:Differentialscanningcalorimetry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AffymetrixHumanGene1.0STArray", + "rdfs:label": "Differentialscanningcalorimetry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Affymetrix Human Gene 1.0 ST Array", + "sms:displayName": "differential scanning calorimetry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AffymetrixHumanGenomeU133Plus2.0Array", + "@id": "bts:Dynamiclightscattering", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AffymetrixHumanGenomeU133Plus2.0Array", + "rdfs:label": "Dynamiclightscattering", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Affymetrix Human Genome U133 Plus 2.0 Array", + "sms:displayName": "dynamic light scattering", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AffymetrixU133AB", + "@id": "bts:Electrochemiluminescence", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "AffymetrixU133AB", + "rdfs:label": "Electrochemiluminescence", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Affymetrix U133AB", + "sms:displayName": "electrochemiluminescence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Agilent44Karray", + "@id": "bts:Electrophoreticlightscattering", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Agilent44Karray", + "rdfs:label": "Electrophoreticlightscattering", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Agilent 44Karray", + "sms:displayName": "electrophoretic light scattering", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BDFACSCalibur", + "@id": "bts:Elevatedplusmazetest", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BDFACSCalibur", + "rdfs:label": "Elevatedplusmazetest", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BD FACS Calibur", + "sms:displayName": "elevated plus maze test", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BGISEQ-500", + "@id": "bts:FACE-QAppearance-relatedDistress", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BGISEQ-500", + "rdfs:label": "FACE-QAppearance-relatedDistress", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BGISEQ-500", + "sms:displayName": "FACE-Q Appearance-related Distress", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BionanoIrys", + "@id": "bts:Flowcytometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "BionanoIrys", + "rdfs:label": "Flowcytometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Bionano Irys", + "sms:displayName": "flow cytometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Caliper", + "@id": "bts:Focusformingassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Caliper", + "rdfs:label": "Focusformingassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Caliper", + "sms:displayName": "focus forming assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CherryImagingFACEPlatform", + "@id": "bts:FunctionalMRI", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CherryImagingFACEPlatform", + "rdfs:label": "FunctionalMRI", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cherry Imaging FACE Platform", + "sms:displayName": "functional MRI", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:CherryImagingTRACEPlatform", + "@id": "bts:Gelfiltrationchromatography", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "CherryImagingTRACEPlatform", + "rdfs:label": "Gelfiltrationchromatography", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Cherry Imaging TRACE Platform", + "sms:displayName": "gel filtration chromatography", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ChromiumX", + "@id": "bts:Gelpermeationchromatography", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ChromiumX", + "rdfs:label": "Gelpermeationchromatography", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Chromium X", + "sms:displayName": "gel permeation chromatography", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:EnVision2103MultiplateReader", + "@id": "bts:Genotyping", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "EnVision2103MultiplateReader", + "rdfs:label": "Genotyping", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "EnVision 2103 Multiplate Reader", + "sms:displayName": "genotyping", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GEDiscoveryMR7503T", + "@id": "bts:Highcontentscreen", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GEDiscoveryMR7503T", + "rdfs:label": "Highcontentscreen", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Discovery MR750 3T", + "sms:displayName": "high content screen", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GEOptimaMR450W1.5T", + "@id": "bts:Highfrequencyultrasound", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GEOptimaMR450W1.5T", + "rdfs:label": "Highfrequencyultrasound", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Optima MR450W 1.5T", + "sms:displayName": "high frequency ultrasound", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GESignaHDxt1.5T", + "@id": "bts:High-performanceliquidchromatography/tandemmassspectrometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GESignaHDxt1.5T", + "rdfs:label": "High-performanceliquidchromatography/tandemmassspectrometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Signa HDxt 1.5T", + "sms:displayName": "high-performance liquid chromatography/tandem mass spectrometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GESignaGenesis1.5T", + "@id": "bts:Immunocytochemistry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GESignaGenesis1.5T", + "rdfs:label": "Immunocytochemistry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Signa Genesis 1.5T", + "sms:displayName": "immunocytochemistry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GESignaHDxt3T", + "@id": "bts:Immunofluorescence", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GESignaHDxt3T", + "rdfs:label": "Immunofluorescence", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Signa HDxt 3T", + "sms:displayName": "immunofluorescence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GESignaPremier3T", + "@id": "bts:Immunohistochemistry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GESignaPremier3T", + "rdfs:label": "Immunohistochemistry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Signa Premier 3T", + "sms:displayName": "immunohistochemistry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GESignaExcite1.5T", + "@id": "bts:Insilicosynthesis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "GESignaExcite1.5T", + "rdfs:label": "Insilicosynthesis", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GE Signa Excite 1.5T", + "sms:displayName": "in silico synthesis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HitachiEchelon1.5T", + "@id": "bts:Invitrotumorigenesis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HitachiEchelon1.5T", + "rdfs:label": "Invitrotumorigenesis", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Hitachi Echelon 1.5T", + "sms:displayName": "in vitro tumorigenesis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HitachiOasis1.2T", + "@id": "bts:InvivoPDXviability", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "HitachiOasis1.2T", + "rdfs:label": "InvivoPDXviability", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Hitachi Oasis 1.2T", + "sms:displayName": "in vivo PDX viability", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IVISSpectrumInVivoImagingSystem", + "@id": "bts:Invivobioluminescence", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IVISSpectrumInVivoImagingSystem", + "rdfs:label": "Invivobioluminescence", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "IVIS Spectrum In Vivo Imaging System", + "sms:displayName": "in vivo bioluminescence", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Illumina1M", + "@id": "bts:Invivotumorgrowth", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Illumina1M", + "rdfs:label": "Invivotumorgrowth", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina 1M", + "sms:displayName": "in vivo tumor growth", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaGenomeAnalyzerIIx", + "@id": "bts:Jumpinglibrary", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaGenomeAnalyzerIIx", + "rdfs:label": "Jumpinglibrary", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Genome Analyzer IIx", + "sms:displayName": "jumping library", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHiSeq2000", + "@id": "bts:Labelfreemassspectrometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHiSeq2000", + "rdfs:label": "Labelfreemassspectrometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HiSeq 2000", + "sms:displayName": "label free mass spectrometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHiSeq2500", + "@id": "bts:Laserspeckleimaging", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHiSeq2500", + "rdfs:label": "Laserspeckleimaging", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HiSeq 2500", + "sms:displayName": "laser speckle imaging", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHiSeq3000", + "@id": "bts:Lightscatteringassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHiSeq3000", + "rdfs:label": "Lightscatteringassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HiSeq 3000", + "sms:displayName": "light scattering assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHiSeq4000", + "@id": "bts:Liquidchromatography-electrochemicaldetection", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHiSeq4000", + "rdfs:label": "Liquidchromatography-electrochemicaldetection", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HiSeq 4000", + "sms:displayName": "liquid chromatography-electrochemical detection", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHiSeqX", + "@id": "bts:Liquidchromatography/massspectrometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHiSeqX", + "rdfs:label": "Liquidchromatography/massspectrometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HiSeq X", + "sms:displayName": "liquid chromatography/mass spectrometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHuman660W-Quadv1.0BeadChip", + "@id": "bts:Liquidchromatography/tandemmassspectrometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHuman660W-Quadv1.0BeadChip", + "rdfs:label": "Liquidchromatography/tandemmassspectrometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Human660W-Quad v1.0 BeadChip", + "sms:displayName": "liquid chromatography/tandem mass spectrometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHumanHap300", + "@id": "bts:LncRNA-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHumanHap300", + "rdfs:label": "LncRNA-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HumanHap300", + "sms:displayName": "lncRNA-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHumanMethylation450", + "@id": "bts:Localfieldpotentialrecording", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHumanMethylation450", + "rdfs:label": "Localfieldpotentialrecording", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HumanMethylation450", + "sms:displayName": "local field potential recording", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHumanOmni1-Quadv1.0", + "@id": "bts:Longtermpotentiationassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHumanOmni1-Quadv1.0", + "rdfs:label": "Longtermpotentiationassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HumanOmni1-Quadv1.0", + "sms:displayName": "long term potentiation assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHumanOmniExpress-24v1.0BeadChip", + "@id": "bts:MRNAcounts", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHumanOmniExpress-24v1.0BeadChip", + "rdfs:label": "MRNAcounts", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HumanOmniExpress-24 v1.0 BeadChip", + "sms:displayName": "mRNA counts", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaHumanOmniExpress-24v1.2BeadChip", + "@id": "bts:Magneticresonancespectroscopy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaHumanOmniExpress-24v1.2BeadChip", + "rdfs:label": "Magneticresonancespectroscopy", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina HumanOmniExpress-24 v1.2 BeadChip", + "sms:displayName": "magnetic resonance spectroscopy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv1.0(850k)", + "@id": "bts:Massspectrometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaInfiniumMethylationEPICBeadChipv1.0(850k)", + "rdfs:label": "Massspectrometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Infinium MethylationEPIC BeadChip v1.0 (850k)", + "sms:displayName": "mass spectrometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv2.0(935k)", + "@id": "bts:Massivelyparallelreporterassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaInfiniumMethylationEPICBeadChipv2.0(935k)", + "rdfs:label": "Massivelyparallelreporterassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Infinium MethylationEPIC BeadChip v2.0 (935k)", + "sms:displayName": "massively parallel reporter assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaMiSeq", + "@id": "bts:Metabolicscreening", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaMiSeq", + "rdfs:label": "Metabolicscreening", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina MiSeq", + "sms:displayName": "metabolic screening", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaMouseWG-6v2.0expressionbeadchip", + "@id": "bts:Methylationarray", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaMouseWG-6v2.0expressionbeadchip", + "rdfs:label": "Methylationarray", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina MouseWG-6 v2.0 expression beadchip", + "sms:displayName": "methylation array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNextSeq1000", + "@id": "bts:MiRNAarray", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNextSeq1000", + "rdfs:label": "MiRNAarray", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NextSeq 1000", + "sms:displayName": "miRNA array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNextSeq2000", + "@id": "bts:MiRNA-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNextSeq2000", + "rdfs:label": "MiRNA-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NextSeq 2000", + "sms:displayName": "miRNA-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNextSeq500", + "@id": "bts:Microrheology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNextSeq500", + "rdfs:label": "Microrheology", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NextSeq 500", + "sms:displayName": "microrheology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNextSeq550", + "@id": "bts:Skindex-16", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNextSeq550", + "rdfs:label": "Skindex-16", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NextSeq 550", + "sms:displayName": "Skindex-16", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNovaSeq6000", + "@id": "bts:Multi-electrodearray", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNovaSeq6000", + "rdfs:label": "Multi-electrodearray", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NovaSeq 6000", + "sms:displayName": "multi-electrode array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNovaSeqX", + "@id": "bts:Nanoparticletrackinganalysis", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNovaSeqX", + "rdfs:label": "Nanoparticletrackinganalysis", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NovaSeq X", + "sms:displayName": "nanoparticle tracking analysis", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaNovaSeqXPlus", + "@id": "bts:NanoStringnCounterAnalysisSystem", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaNovaSeqXPlus", + "rdfs:label": "NanoStringnCounterAnalysisSystem", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina NovaSeq X Plus", + "sms:displayName": "NanoString nCounter Analysis System", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaOmni2pt5M", + "@id": "bts:N-backtask", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaOmni2pt5M", + "rdfs:label": "N-backtask", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Omni2pt5M", + "sms:displayName": "n-back task", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaOmni5M", + "@id": "bts:Neuropsychologicalassessment", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaOmni5M", + "rdfs:label": "Neuropsychologicalassessment", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina Omni5M", + "sms:displayName": "neuropsychological assessment", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:IlluminaWholeGenomeDASL", + "@id": "bts:Nextgenerationtargetedsequencing", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "IlluminaWholeGenomeDASL", + "rdfs:label": "Nextgenerationtargetedsequencing", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina WholeGenome DASL", + "sms:displayName": "next generation targeted sequencing", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Illuminah650", + "@id": "bts:Noveltyresponsebehaviorassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Illuminah650", + "rdfs:label": "Noveltyresponsebehaviorassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Illumina h650", + "sms:displayName": "novelty response behavior assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:InfiniumHumanOmniExpressExome", + "@id": "bts:Openfieldtest", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "InfiniumHumanOmniExpressExome", + "rdfs:label": "Openfieldtest", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Infinium HumanOmniExpressExome", + "sms:displayName": "open field test", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LI-COROdysseyCLx", + "@id": "bts:Opticaltomography", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LI-COROdysseyCLx", + "rdfs:label": "Opticaltomography", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "LI-COR Odyssey CLx", + "sms:displayName": "optical tomography", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LTQOrbitrapXL", + "@id": "bts:Opticalcoherencetomography", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LTQOrbitrapXL", + "rdfs:label": "Opticalcoherencetomography", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "LTQ Orbitrap XL", + "sms:displayName": "optical coherence tomography", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LeicaAperioAT2", + "@id": "bts:Optokineticreflexassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LeicaAperioAT2", + "rdfs:label": "Optokineticreflexassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Leica Aperio AT2", + "sms:displayName": "optokinetic reflex assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LeicaMZ16", + "@id": "bts:Oscillatoryrheology", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LeicaMZ16", + "rdfs:label": "Oscillatoryrheology", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Leica MZ16", + "sms:displayName": "oscillatory rheology", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LeicaS9Stereomicroscope", + "@id": "bts:OxBS-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LeicaS9Stereomicroscope", + "rdfs:label": "OxBS-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Leica S9 Stereomicroscope", + "sms:displayName": "oxBS-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LifeVizInfinitySystem", + "@id": "bts:Oxygenconsumptionassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LifeVizInfinitySystem", + "rdfs:label": "Oxygenconsumptionassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "LifeViz Infinity System", + "sms:displayName": "oxygen consumption assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LifeVizMicroSystem", + "@id": "bts:Patternelectroretinogram", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "LifeVizMicroSystem", + "rdfs:label": "Patternelectroretinogram", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "LifeViz Micro System", + "sms:displayName": "pattern electroretinogram", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MGIT-series", + "@id": "bts:Perineurialcellthickness", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MGIT-series", + "rdfs:label": "Perineurialcellthickness", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MGI T-series", + "sms:displayName": "perineurial cell thickness", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MalvernZetasizer", + "@id": "bts:Phase-contrastmicroscopy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "MalvernZetasizer", + "rdfs:label": "Phase-contrastmicroscopy", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Malvern Zetasizer", + "sms:displayName": "phase-contrast microscopy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NanoFCM", + "@id": "bts:Photograph", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NanoFCM", + "rdfs:label": "Photograph", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NanoFCM", + "sms:displayName": "photograph", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NanoStringHumannCounterPanCancerIO360Panel", + "@id": "bts:Polymerasechainreaction", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NanoStringHumannCounterPanCancerIO360Panel", + "rdfs:label": "Polymerasechainreaction", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NanoString Human nCounter PanCancer IO360 Panel", + "sms:displayName": "polymerase chain reaction", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NanostringCounter", + "@id": "bts:Polysomnography", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NanostringCounter", + "rdfs:label": "Polysomnography", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nanostring Counter", + "sms:displayName": "polysomnography", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NanostringGeoMx", + "@id": "bts:Positronemissiontomography", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "NanostringGeoMx", + "rdfs:label": "Positronemissiontomography", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Nanostring GeoMx", + "sms:displayName": "positron emission tomography", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OlympusDP80", + "@id": "bts:PROMISCognitiveFunction", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OlympusDP80", + "rdfs:label": "PROMISCognitiveFunction", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Olympus DP80", + "sms:displayName": "PROMIS Cognitive Function", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OlympusIX73", + "@id": "bts:QuantitativePCR", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OlympusIX73", + "rdfs:label": "QuantitativePCR", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Olympus IX73", + "sms:displayName": "quantitative PCR", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OrbitrapFusionLumosTribrid", + "@id": "bts:Questionnaire", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OrbitrapFusionLumosTribrid", + "rdfs:label": "Questionnaire", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Orbitrap Fusion Lumos Tribrid", + "sms:displayName": "questionnaire", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OtherPlatform", + "@id": "bts:Reactiveoxygenspeciesassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OtherPlatform", + "rdfs:label": "Reactiveoxygenspeciesassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Other Platform", + "sms:displayName": "reactive oxygen species assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:OxfordNanopore", + "@id": "bts:Reportergeneassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "OxfordNanopore", + "rdfs:label": "Reportergeneassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Oxford Nanopore", + "sms:displayName": "reporter gene assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PacBioRSII", + "@id": "bts:Rheometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PacBioRSII", + "rdfs:label": "Rheometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PacBio RS II", + "sms:displayName": "rheometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PacBioSequelIISystem", + "@id": "bts:Ribo-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PacBioSequelIISystem", + "rdfs:label": "Ribo-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PacBio Sequel II System", + "sms:displayName": "ribo-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PacBioSequelIIeSystem", + "@id": "bts:Rotarodperformancetest", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PacBioSequelIIeSystem", + "rdfs:label": "Rotarodperformancetest", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PacBio Sequel IIe System", + "sms:displayName": "rotarod performance test", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Pannoramic250Flash", + "@id": "bts:SandwichELISA", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Pannoramic250Flash", + "rdfs:label": "SandwichELISA", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Pannoramic 250 Flash", + "sms:displayName": "sandwich ELISA", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Perlegen300Karray", + "@id": "bts:ScCGI-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Perlegen300Karray", + "rdfs:label": "ScCGI-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Perlegen 300Karray", + "sms:displayName": "scCGI-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PhilipsAchieva1.5T", + "@id": "bts:Scale", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PhilipsAchieva1.5T", + "rdfs:label": "Scale", "rdfs:subClassOf": [ { "@id": "bts:Platform" + }, + { + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Philips Achieva 1.5T", + "sms:displayName": "Scale", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PhilipsAchieva3T", + "@id": "bts:SaferSeqS", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PhilipsAchieva3T", + "rdfs:label": "SaferSeqS", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Philips Achieva 3T", + "sms:displayName": "SaferSeqS", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PhilipsInteraAchieva3T", + "@id": "bts:Singlemoleculedrugscreenassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PhilipsInteraAchieva3T", + "rdfs:label": "Singlemoleculedrugscreenassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Philips Intera Achieva 3T", + "sms:displayName": "single molecule drug screen assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PhilipsIngenia1.5T", + "@id": "bts:Single-cellRNA-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PhilipsIngenia1.5T", + "rdfs:label": "Single-cellRNA-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Philips Ingenia 1.5T", + "sms:displayName": "single-cell RNA-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PhilipsIngenia3T", + "@id": "bts:SinglecellATAC-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PhilipsIngenia3T", + "rdfs:label": "SinglecellATAC-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Philips Ingenia 3T", + "sms:displayName": "single cell ATAC-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PhilipsPanorama1.0T", + "@id": "bts:Single-nucleusRNA-seq", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PhilipsPanorama1.0T", + "rdfs:label": "Single-nucleusRNA-seq", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Philips Panorama 1.0T", + "sms:displayName": "single-nucleus RNA-seq", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PromegaGloMaxDiscover", + "@id": "bts:Sorbitoldehydrogenaseactivitylevelassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "PromegaGloMaxDiscover", + "rdfs:label": "Sorbitoldehydrogenaseactivitylevelassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Promega GloMax Discover", + "sms:displayName": "sorbitol dehydrogenase activity level assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:QExativeHF", + "@id": "bts:Spatialfrequencydomainimaging", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "QExativeHF", + "rdfs:label": "Spatialfrequencydomainimaging", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Q Exative HF", + "sms:displayName": "spatial frequency domain imaging", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensAvanto1.5T", + "@id": "bts:Spatialtranscriptomics", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensAvanto1.5T", + "rdfs:label": "Spatialtranscriptomics", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Avanto 1.5T", + "sms:displayName": "spatial transcriptomics", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensAvantoFit1.5T", + "@id": "bts:Staticlightscattering", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensAvantoFit1.5T", + "rdfs:label": "Staticlightscattering", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Avanto Fit 1.5T", + "sms:displayName": "static light scattering", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomAera1.5T", + "@id": "bts:Survival", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomAera1.5T", + "rdfs:label": "Survival", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Aera 1.5T", + "sms:displayName": "survival", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomEspree1.5T", + "@id": "bts:Targetedexomesequencing", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomEspree1.5T", + "rdfs:label": "Targetedexomesequencing", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Espree 1.5T", + "sms:displayName": "targeted exome sequencing", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomPrisma3T", + "@id": "bts:Tractionforcemicroscopy", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomPrisma3T", + "rdfs:label": "Tractionforcemicroscopy", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Prisma 3T", + "sms:displayName": "traction force microscopy", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomSkyra3T", + "@id": "bts:Twinspotassay", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomSkyra3T", + "rdfs:label": "Twinspotassay", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Skyra 3T", + "sms:displayName": "twin spot assay", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomTrio3T", + "@id": "bts:Ultrahigh-performanceliquidchromatography/tandemmassspectrometry", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomTrio3T", + "rdfs:label": "Ultrahigh-performanceliquidchromatography/tandemmassspectrometry", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Trio 3T", + "sms:displayName": "ultra high-performance liquid chromatography/tandem mass spectrometry", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomVerio3T", + "@id": "bts:Westernblot", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomVerio3T", + "rdfs:label": "Westernblot", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Verio 3T", + "sms:displayName": "western blot", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SiemensMagnetomPrismaFit3T", + "@id": "bts:Wholeexomesequencing", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SiemensMagnetomPrismaFit3T", + "rdfs:label": "Wholeexomesequencing", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Siemens Magnetom Prisma Fit 3T", + "sms:displayName": "whole exome sequencing", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SpectramaxMSeries", + "@id": "bts:Wholegenomesequencing", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "SpectramaxMSeries", + "rdfs:label": "Wholegenomesequencing", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Spectramax M Series", + "sms:displayName": "whole genome sequencing", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:TOOsonixSystemONE-M", + "@id": "bts:Whole-cellpatchclamp", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "TOOsonixSystemONE-M", + "rdfs:label": "Whole-cellpatchclamp", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "TOOsonix System ONE-M", + "sms:displayName": "whole-cell patch clamp", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ToshibaVantageTitan1.5T", + "@id": "bts:STRprofile", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ToshibaVantageTitan1.5T", + "rdfs:label": "STRprofile", "rdfs:subClassOf": [ { - "@id": "bts:Platform" + "@id": "bts:ProtocolAssay" + }, + { + "@id": "bts:Assay" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Toshiba Vantage Titan 1.5T", + "sms:displayName": "STR profile", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:VarioskanLUX", + "@id": "bts:10xVisiumSpatialGeneExpression", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "VarioskanLUX", + "rdfs:label": "10xVisiumSpatialGeneExpression", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33765,15 +36518,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Varioskan LUX", + "sms:displayName": "10x Visium Spatial Gene Expression", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:VectraH13DImagingSystem", + "@id": "bts:2DCellTiter-Glo", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "VectraH13DImagingSystem", + "rdfs:label": "2DCellTiter-Glo", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33782,15 +36535,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Vectra H1 3D Imaging System", + "sms:displayName": "2D CellTiter-Glo", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Vevo3100ImagingSystem", + "@id": "bts:2DIncucyte", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Vevo3100ImagingSystem", + "rdfs:label": "2DIncucyte", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33799,15 +36552,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Vevo 3100 Imaging System", + "sms:displayName": "2D Incucyte", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:XF24ExtracellularFluxAnalyzer", + "@id": "bts:AffymetrixGenome-WideHumanSNP5.0Array", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "XF24ExtracellularFluxAnalyzer", + "rdfs:label": "AffymetrixGenome-WideHumanSNP5.0Array", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33816,15 +36569,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "XF24 Extracellular Flux Analyzer", + "sms:displayName": "Affymetrix Genome-Wide Human SNP 5.0 Array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ZeissLSM", + "@id": "bts:AffymetrixGenome-WideHumanSNP6.0Array", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ZeissLSM", + "rdfs:label": "AffymetrixGenome-WideHumanSNP6.0Array", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33833,15 +36586,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Zeiss LSM", + "sms:displayName": "Affymetrix Genome-Wide Human SNP 6.0 Array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ZeissLSM700", + "@id": "bts:AffymetrixHumanGene1.0STArray", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ZeissLSM700", + "rdfs:label": "AffymetrixHumanGene1.0STArray", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33850,15 +36603,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Zeiss LSM 700", + "sms:displayName": "Affymetrix Human Gene 1.0 ST Array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ZeissLSM980", + "@id": "bts:AffymetrixHumanGenomeU133Plus2.0Array", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ZeissLSM980", + "rdfs:label": "AffymetrixHumanGenomeU133Plus2.0Array", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33867,15 +36620,15 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Zeiss LSM 980", + "sms:displayName": "Affymetrix Human Genome U133 Plus 2.0 Array", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ZenoElectronicWalkway", + "@id": "bts:AffymetrixU133AB", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "ZenoElectronicWalkway", + "rdfs:label": "AffymetrixU133AB", "rdfs:subClassOf": [ { "@id": "bts:Platform" @@ -33884,4409 +36637,1708 @@ "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Zeno Electronic Walkway", + "sms:displayName": "Affymetrix U133AB", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:StudyLeads", + "@id": "bts:Agilent44Karray", "@type": "rdfs:Class", - "rdfs:comment": "Individuals with lead roles in a study.", - "rdfs:label": "StudyLeads", + "rdfs:comment": "TBD", + "rdfs:label": "Agilent44Karray", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "studyLeads", - "sms:required": "sms:true", + "sms:displayName": "Agilent 44Karray", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MassSpecAssayTemplate", + "@id": "bts:BDFACSCalibur", "@type": "rdfs:Class", - "rdfs:comment": "Template for raw mass spec-based proteomics data.", - "rdfs:label": "MassSpecAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "BDFACSCalibur", "rdfs:subClassOf": [ { - "@id": "bts:ProteinAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MassSpecAssayTemplate", + "sms:displayName": "BD FACS Calibur", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:Platform" - }, - { - "@id": "bts:ProteinExtractSource" - }, - { - "@id": "bts:DataCollectionMode" - } - ], "sms:validationRules": [] }, { - "@id": "bts:ProteinAssayTemplate", + "@id": "bts:BGISEQ-500", "@type": "rdfs:Class", - "rdfs:comment": "Abstract template for data from some assay of protein structure and function. Data should be instantiated with more specific template.", - "rdfs:label": "ProteinAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "BGISEQ-500", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProteinAssayTemplate", + "sms:displayName": "BGISEQ-500", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:Platform" - }, - { - "@id": "bts:ProteinExtractSource" - } - ], "sms:validationRules": [] }, { - "@id": "bts:ClinicalAssayTemplate", + "@id": "bts:BionanoIrys", "@type": "rdfs:Class", - "rdfs:comment": "General template for typically tabular **individual-level** data. This can include repeated measures and a drug treatment context.\n", - "rdfs:label": "ClinicalAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "BionanoIrys", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ClinicalAssayTemplate", + "sms:displayName": "Bionano Irys", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ExperimentalFactor" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:TimepointUnit" - }, - { - "@id": "bts:CompoundName" - }, - { - "@id": "bts:CompoundDose" - }, - { - "@id": "bts:CompoundDoseUnit" - } - ], "sms:validationRules": [] }, { - "@id": "bts:BiologicalAssayDataTemplate", + "@id": "bts:Caliper", "@type": "rdfs:Class", - "rdfs:comment": "A template defining basic metadata on deposited data artifacts (i.e. files) from experimental assays involving biosamples. This is an abstract template; \"real\" template subclasses define additional properties appropriate for the type of data file (e.g. imaging vs sequencing).\n", - "rdfs:label": "BiologicalAssayDataTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "Caliper", "rdfs:subClassOf": [ { - "@id": "bts:Template" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BiologicalAssayDataTemplate", + "sms:displayName": "Caliper", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - } - ], "sms:validationRules": [] }, { - "@id": "bts:ScRNASeqTemplate", + "@id": "bts:CherryImagingFACEPlatform", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing raw data from single-cell RNA-seq.", - "rdfs:label": "ScRNASeqTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "CherryImagingFACEPlatform", "rdfs:subClassOf": [ { - "@id": "bts:ScSequencingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ScRNASeqTemplate", + "sms:displayName": "Cherry Imaging FACE Platform", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:CherryImagingTRACEPlatform", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "CherryImagingTRACEPlatform", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:CellType" - }, - { - "@id": "bts:IsCellLine" - }, - { - "@id": "bts:CellID" - }, - { - "@id": "bts:DissociationMethod" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, - { - "@id": "bts:AuxiliaryAsset" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Cherry Imaging TRACE Platform", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ScSequencingAssayTemplate", + "@id": "bts:ChromiumX", "@type": "rdfs:Class", - "rdfs:comment": "General template for raw RNA/DNA data, i.e. sequence data from a sequencing assay.", - "rdfs:label": "ScSequencingAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "ChromiumX", "rdfs:subClassOf": [ { - "@id": "bts:GeneticsAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ScSequencingAssayTemplate", + "sms:displayName": "Chromium X", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:EnVision2103MultiplateReader", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "EnVision2103MultiplateReader", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:CellType" - }, - { - "@id": "bts:IsCellLine" - }, - { - "@id": "bts:CellID" - }, - { - "@id": "bts:DissociationMethod" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, - { - "@id": "bts:AuxiliaryAsset" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "EnVision 2103 Multiplate Reader", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GeneralMeasureDataTemplate", + "@id": "bts:GEDiscoveryMR7503T", "@type": "rdfs:Class", - "rdfs:comment": "General template for data in tabular form that aggregates tissue-level or cellular-level data.\n", - "rdfs:label": "GeneralMeasureDataTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "GEDiscoveryMR7503T", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GeneralMeasureDataTemplate", + "sms:displayName": "GE Discovery MR750 3T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:ExperimentalFactor" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" - }, - { - "@id": "bts:CompoundName" - }, - { - "@id": "bts:CompoundDose" - }, - { - "@id": "bts:CompoundDoseUnit" - }, - { - "@id": "bts:GenePerturbed" - }, - { - "@id": "bts:GenePerturbationType" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:GEOptimaMR450W1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "GEOptimaMR450W1.5T", + "rdfs:subClassOf": [ { - "@id": "bts:GenePerturbationTechnology" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "GE Optima MR450W 1.5T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MaterialScienceAssayTemplate", + "@id": "bts:GESignaHDxt1.5T", "@type": "rdfs:Class", - "rdfs:comment": "General template for describing data for a materials science assay.", - "rdfs:label": "MaterialScienceAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "GESignaHDxt1.5T", "rdfs:subClassOf": [ { - "@id": "bts:NonBiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MaterialScienceAssayTemplate", + "sms:displayName": "GE Signa HDxt 1.5T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:GESignaGenesis1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "GESignaGenesis1.5T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:MaterialType" - }, - { - "@id": "bts:ConcentrationMaterial" - }, - { - "@id": "bts:ConcentrationMaterialUnit" - }, - { - "@id": "bts:ConcentrationNaCl" - }, - { - "@id": "bts:ConcentrationNaClUnit" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "GE Signa Genesis 1.5T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:NonBiologicalAssayDataTemplate", + "@id": "bts:GESignaHDxt3T", "@type": "rdfs:Class", - "rdfs:comment": "Describes data artifacts (i.e. files) from an experimental/physical-sciences assay where input specimens are more at the level of synthesized molecules or inorganic materials.\n", - "rdfs:label": "NonBiologicalAssayDataTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "GESignaHDxt3T", "rdfs:subClassOf": [ { - "@id": "bts:Template" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "NonBiologicalAssayDataTemplate", + "sms:displayName": "GE Signa HDxt 3T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:GESignaPremier3T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "GESignaPremier3T", + "rdfs:subClassOf": [ { - "@id": "bts:Assay" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "GE Signa Premier 3T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:RNASeqTemplate", + "@id": "bts:GESignaExcite1.5T", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing raw data from (bulk) RNA-sequencing", - "rdfs:label": "RNASeqTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "GESignaExcite1.5T", "rdfs:subClassOf": [ { - "@id": "bts:BulkSequencingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "RNASeqTemplate", + "sms:displayName": "GE Signa Excite 1.5T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:HitachiEchelon1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "HitachiEchelon1.5T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Hitachi Echelon 1.5T", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:HitachiOasis1.2T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "HitachiOasis1.2T", + "rdfs:subClassOf": [ { - "@id": "bts:TargetDepth" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Hitachi Oasis 1.2T", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IVISSpectrumInVivoImagingSystem", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IVISSpectrumInVivoImagingSystem", + "rdfs:subClassOf": [ { - "@id": "bts:BatchID" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "IVIS Spectrum In Vivo Imaging System", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BulkSequencingAssayTemplate", + "@id": "bts:Illumina1M", "@type": "rdfs:Class", - "rdfs:comment": "General template for raw (level 1) RNA/DNA data, i.e. sequence data from a sequencing assay.", - "rdfs:label": "BulkSequencingAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "Illumina1M", "rdfs:subClassOf": [ { - "@id": "bts:GeneticsAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BulkSequencingAssayTemplate", + "sms:displayName": "Illumina 1M", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaGenomeAnalyzerIIx", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaGenomeAnalyzerIIx", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina Genome Analyzer IIx", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Template", + "@id": "bts:IlluminaHiSeq2000", "@type": "rdfs:Class", - "rdfs:comment": "A collection of fields representing some entity.", - "rdfs:label": "Template", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHiSeq2000", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "Template", + "sms:displayName": "Illumina HiSeq 2000", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:BiospecimenTemplate", + "@id": "bts:IlluminaHiSeq2500", "@type": "rdfs:Class", - "rdfs:comment": "Specimen-level data, whether from human or animal.", - "rdfs:label": "BiospecimenTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHiSeq2500", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "BiospecimenTemplate", + "sms:displayName": "Illumina HiSeq 2500", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:BodySite" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaHiSeq3000", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHiSeq3000", + "rdfs:subClassOf": [ { - "@id": "bts:ExperimentalCondition" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina HiSeq 3000", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PartialTemplate", + "@id": "bts:IlluminaHiSeq4000", "@type": "rdfs:Class", - "rdfs:comment": "A template for collecting a subset of contextual data; not intended to be a standalone template but rather a subdocument.", - "rdfs:label": "PartialTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHiSeq4000", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PartialTemplate", + "sms:displayName": "Illumina HiSeq 4000", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PortalStudy", + "@id": "bts:IlluminaHiSeqX", "@type": "rdfs:Class", - "rdfs:comment": "//nf.synapse.org/Explore/Studies.\n", - "rdfs:label": "PortalStudy", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHiSeqX", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PortalStudy", + "sms:displayName": "Illumina HiSeq X", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:StudyId" - }, - { - "@id": "bts:StudyName" - }, - { - "@id": "bts:StudyLeads" - }, - { - "@id": "bts:Summary" - }, - { - "@id": "bts:Institutions" - }, - { - "@id": "bts:FundingAgency" - }, - { - "@id": "bts:Initiative" - }, - { - "@id": "bts:StudyStatus" - }, - { - "@id": "bts:DataStatus" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:Manifestation" - }, - { - "@id": "bts:DiseaseFocus" - }, - { - "@id": "bts:RelatedStudies" - }, - { - "@id": "bts:GrantDOI" - }, - { - "@id": "bts:AccessRequirements" - }, - { - "@id": "bts:AcknowledgementStatements" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaHuman660W-Quadv1.0BeadChip", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHuman660W-Quadv1.0BeadChip", + "rdfs:subClassOf": [ { - "@id": "bts:StudyFileviewId" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina Human660W-Quad v1.0 BeadChip", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Institutions", + "@id": "bts:IlluminaHumanHap300", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Institutions", + "rdfs:label": "IlluminaHumanHap300", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "institutions", + "sms:displayName": "Illumina HumanHap300", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ImagingAssayTemplate", + "@id": "bts:IlluminaHumanMethylation450", "@type": "rdfs:Class", - "rdfs:comment": "General template for describing imaging data.", - "rdfs:label": "ImagingAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHumanMethylation450", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ImagingAssayTemplate", + "sms:displayName": "Illumina HumanMethylation450", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaHumanOmni1-Quadv1.0", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHumanOmni1-Quadv1.0", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:AssayTarget" - }, - { - "@id": "bts:AuxiliaryAsset" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina HumanOmni1-Quadv1.0", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicsAssayTemplateExtended", + "@id": "bts:IlluminaHumanOmniExpress-24v1.0BeadChip", "@type": "rdfs:Class", - "rdfs:comment": "Genomics assay template but with additional experiment data.", - "rdfs:label": "GenomicsAssayTemplateExtended", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHumanOmniExpress-24v1.0BeadChip", "rdfs:subClassOf": [ { - "@id": "bts:GenomicsAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GenomicsAssayTemplateExtended", + "sms:displayName": "Illumina HumanOmniExpress-24 v1.0 BeadChip", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" - }, - { - "@id": "bts:GenePerturbed" - }, - { - "@id": "bts:GenePerturbationTechnology" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaHumanOmniExpress-24v1.2BeadChip", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaHumanOmniExpress-24v1.2BeadChip", + "rdfs:subClassOf": [ { - "@id": "bts:GenePerturbationType" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina HumanOmniExpress-24 v1.2 BeadChip", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicsAssayTemplate", + "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv1.0(850k)", "@type": "rdfs:Class", - "rdfs:comment": "Alias to BulkSequencingAssayTemplate, use for sequence data on a large scale when there is no template available that is more specific.", - "rdfs:label": "GenomicsAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaInfiniumMethylationEPICBeadChipv1.0(850k)", "rdfs:subClassOf": [ { - "@id": "bts:BulkSequencingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GenomicsAssayTemplate", + "sms:displayName": "Illumina Infinium MethylationEPIC BeadChip v1.0 (850k)", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaInfiniumMethylationEPICBeadChipv2.0(935k)", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaInfiniumMethylationEPICBeadChipv2.0(935k)", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina Infinium MethylationEPIC BeadChip v2.0 (935k)", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProteinArrayTemplate", + "@id": "bts:IlluminaMiSeq", "@type": "rdfs:Class", - "rdfs:comment": "Template for array- and immuno-based proteomics data.", - "rdfs:label": "ProteinArrayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaMiSeq", "rdfs:subClassOf": [ { - "@id": "bts:ProteinAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProteinArrayTemplate", + "sms:displayName": "Illumina MiSeq", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaMouseWG-6v2.0expressionbeadchip", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaMouseWG-6v2.0expressionbeadchip", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:ProteinExtractSource" - }, - { - "@id": "bts:AntibodyID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina MouseWG-6 v2.0 expression beadchip", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PdxGenomicsAssayTemplate", + "@id": "bts:IlluminaNextSeq1000", "@type": "rdfs:Class", - "rdfs:comment": "Raw genomics data from patient-derived xenograft (PDX) experiment, with additional PDX-relevant metadata.", - "rdfs:label": "PdxGenomicsAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNextSeq1000", "rdfs:subClassOf": [ { - "@id": "bts:GenomicsAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PdxGenomicsAssayTemplate", + "sms:displayName": "Illumina NextSeq 1000", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaNextSeq2000", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNextSeq2000", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, - { - "@id": "bts:TransplantationType" - }, - { - "@id": "bts:TransplantationRecipientSpecies" - }, - { - "@id": "bts:TransplantationRecipientTissue" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina NextSeq 2000", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:LightScatteringAssayTemplate", + "@id": "bts:IlluminaNextSeq500", "@type": "rdfs:Class", - "rdfs:comment": "Template for dynamic or static light scattering data adapted from ISA-TAB-Nano specs.", - "rdfs:label": "LightScatteringAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNextSeq500", "rdfs:subClassOf": [ { - "@id": "bts:MaterialScienceAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "LightScatteringAssayTemplate", + "sms:displayName": "Illumina NextSeq 500", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaNextSeq550", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNextSeq550", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:SpecimenID" - }, + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina NextSeq 550", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaNovaSeq6000", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNovaSeq6000", + "rdfs:subClassOf": [ { - "@id": "bts:MaterialType" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina NovaSeq 6000", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaNovaSeqX", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNovaSeqX", + "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationMaterial" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina NovaSeq X", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaNovaSeqXPlus", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaNovaSeqXPlus", + "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationMaterialUnit" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina NovaSeq X Plus", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaOmni2pt5M", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaOmni2pt5M", + "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationNaCl" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina Omni2pt5M", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaOmni5M", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaOmni5M", + "rdfs:subClassOf": [ { - "@id": "bts:ConcentrationNaClUnit" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina Omni5M", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:IlluminaWholeGenomeDASL", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "IlluminaWholeGenomeDASL", + "rdfs:subClassOf": [ { - "@id": "bts:PH" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Illumina WholeGenome DASL", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProcessedAlignedReadsTemplate", + "@id": "bts:Illuminah650", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing aligned reads (e.g. BAM/CRAM files) from a sequencing assay. The QC meta are extracted from samtools stats when available and are the same metrics preferred by GDC. \n", - "rdfs:label": "ProcessedAlignedReadsTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "Illuminah650", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProcessedAlignedReadsTemplate", + "sms:displayName": "Illumina h650", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:GenomicReference" - }, - { - "@id": "bts:GenomicReferenceLink" - }, - { - "@id": "bts:AverageInsertSize" - }, - { - "@id": "bts:AverageReadLength" - }, - { - "@id": "bts:AverageBaseQuality" - }, - { - "@id": "bts:PairsOnDifferentChr" - }, - { - "@id": "bts:ReadsDuplicatedPercent" - }, - { - "@id": "bts:ReadsMappedPercent" - }, - { - "@id": "bts:MeanCoverage" - }, - { - "@id": "bts:ProportionCoverage10x" - }, - { - "@id": "bts:ProportionCoverage30x" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TotalReads" - }, - { - "@id": "bts:Workflow" - }, - { - "@id": "bts:WorkflowLink" - }, - { - "@id": "bts:AuxiliaryAsset" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:InfiniumHumanOmniExpressExome", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "InfiniumHumanOmniExpressExome", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenID" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Infinium HumanOmniExpressExome", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:HumanCohortTemplate", + "@id": "bts:LI-COROdysseyCLx", "@type": "rdfs:Class", - "rdfs:comment": "Data of biosamples from human patients. Adapted from Table 2 of http://nrs.harvard.edu/urn-3:HUL.InstRepos:32725809. This template should be used when biosamples are from NF patients to provides a more valuable characterization and make additional gene-phenotype insights possible.\n", - "rdfs:label": "HumanCohortTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "LI-COROdysseyCLx", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "HumanCohortTemplate", + "sms:displayName": "LI-COR Odyssey CLx", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:DiagnosisAgeGroup" - }, - { - "@id": "bts:Inheritance" - }, - { - "@id": "bts:Mosaicism" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:GermlineMutationIndicator" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:VitalStatus" - }, - { - "@id": "bts:WHOPerformanceStatus" - }, - { - "@id": "bts:PainStatus" - }, - { - "@id": "bts:TumorTreatmentStatus" - }, - { - "@id": "bts:CafeaulaitMacules" - }, - { - "@id": "bts:SkinFoldFreckling" - }, - { - "@id": "bts:IrisLischNodules" - }, - { - "@id": "bts:DermalNeurofibromas" - }, - { - "@id": "bts:SubcutaneousNodularNeurofibromas" - }, - { - "@id": "bts:DiffuseDermalNeurofibromas" - }, - { - "@id": "bts:SpinalNeurofibromas" - }, - { - "@id": "bts:PlexiformNeurofibromas" - }, - { - "@id": "bts:OpticGlioma" - }, - { - "@id": "bts:HeartDefect" - }, - { - "@id": "bts:VascularDisease" - }, - { - "@id": "bts:PubertyOnset" - }, - { - "@id": "bts:Stature" - }, - { - "@id": "bts:PeripheralNeuropathy" - }, - { - "@id": "bts:AqueductalStenosis" - }, - { - "@id": "bts:LongBoneDysplasia" - }, - { - "@id": "bts:SphenoidDysplasia" - }, - { - "@id": "bts:Scoliosis" - }, - { - "@id": "bts:IntellectualDisability" - }, - { - "@id": "bts:LearningDisability" - }, - { - "@id": "bts:AttentionDeficitDisorder" - }, - { - "@id": "bts:Pheochromocytoma" - }, - { - "@id": "bts:GlomusTumor" - }, - { - "@id": "bts:MPNST" - }, - { - "@id": "bts:NonopticGlioma" - }, - { - "@id": "bts:GIST" - }, - { - "@id": "bts:Leukemia" - }, - { - "@id": "bts:BreastCancer" - }, - { - "@id": "bts:OtherTumors" - }, - { - "@id": "bts:VestibularSchwannoma" - }, - { - "@id": "bts:Meningioma" - }, - { - "@id": "bts:GliomaOrEpendymoma" - }, - { - "@id": "bts:SpinalSchwannoma" - }, - { - "@id": "bts:DermalSchwannoma" - }, - { - "@id": "bts:NonvestibularCranialSchwannoma" - }, - { - "@id": "bts:Lenticularopacity" - }, - { - "@id": "bts:NonvestibularSchwannomas" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:LTQOrbitrapXL", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "LTQOrbitrapXL", + "rdfs:subClassOf": [ { - "@id": "bts:NumberOfSchwannomas" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "LTQ Orbitrap XL", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:Lenticularopacity", + "@id": "bts:LeicaAperioAT2", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "Lenticularopacity", + "rdfs:label": "LeicaAperioAT2", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "lenticularopacity", + "sms:displayName": "Leica Aperio AT2", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProtocolTemplate", + "@id": "bts:LeicaMZ16", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing a protocol document.", - "rdfs:label": "ProtocolTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "LeicaMZ16", "rdfs:subClassOf": [ { - "@id": "bts:Template" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProtocolTemplate", + "sms:displayName": "Leica MZ16", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Title" - }, - { - "@id": "bts:Author" - }, - { - "@id": "bts:Citation" - }, - { - "@id": "bts:License" - }, - { - "@id": "bts:ProtocolAssay" - }, - { - "@id": "bts:ProtocolPurpose" - }, - { - "@id": "bts:SampleType" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:LeicaS9Stereomicroscope", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "LeicaS9Stereomicroscope", + "rdfs:subClassOf": [ { - "@id": "bts:Comments" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Leica S9 Stereomicroscope", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:EpigenomiscAssayTemplate", + "@id": "bts:LifeVizInfinitySystem", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing raw data from epigenetics sequencing assays such as bisulfite sequencing.", - "rdfs:label": "EpigenomiscAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "LifeVizInfinitySystem", "rdfs:subClassOf": [ { - "@id": "bts:BulkSequencingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "EpigenomiscAssayTemplate", + "sms:displayName": "LifeViz Infinity System", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:LifeVizMicroSystem", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "LifeVizMicroSystem", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, - { - "@id": "bts:BisulfiteConversionKitID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "LifeViz Micro System", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProcessedExpressionTemplate", + "@id": "bts:MGIT-series", "@type": "rdfs:Class", - "rdfs:comment": "Template for quantified gene/protein expression data that are still represented as one file per sample.", - "rdfs:label": "ProcessedExpressionTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "MGIT-series", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProcessedExpressionTemplate", + "sms:displayName": "MGI T-series", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ExpressionUnit" - }, - { - "@id": "bts:Workflow" - }, - { - "@id": "bts:WorkflowLink" - }, - { - "@id": "bts:AuxiliaryAsset" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:MalvernZetasizer", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "MalvernZetasizer", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenID" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Malvern Zetasizer", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GenomicsArrayTemplate", + "@id": "bts:NanoFCM", "@type": "rdfs:Class", - "rdfs:comment": "A template for describing raw data from array-based genomics/epigenomics, e.g. CEL files.", - "rdfs:label": "GenomicsArrayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "NanoFCM", "rdfs:subClassOf": [ { - "@id": "bts:GeneticsAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GenomicsArrayTemplate", + "sms:displayName": "NanoFCM", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:NanoStringHumannCounterPanCancerIO360Panel", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NanoStringHumannCounterPanCancerIO360Panel", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:Channel" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "NanoString Human nCounter PanCancer IO360 Panel", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:GeneticsAssayTemplate", + "@id": "bts:NanostringCounter", "@type": "rdfs:Class", - "rdfs:comment": "Template for relatively raw data of RNA/DNA structure and expression. This is an abstract template encapsulating data from low-throughput to high-throughput assays, sequencing-based or non-sequencing based (e.g. microarrays, optical genome mapping). In practice, data are more specifically typed and matched to one of the templates below.\n", - "rdfs:label": "GeneticsAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "NanostringCounter", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "GeneticsAssayTemplate", + "sms:displayName": "Nanostring Counter", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:NanostringGeoMx", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "NanostringGeoMx", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Nanostring GeoMx", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProteomicsAssayTemplate", + "@id": "bts:OlympusDP80", "@type": "rdfs:Class", - "rdfs:comment": "Alias to MassSpecAssayTemplate for backwards-compatibility.", - "rdfs:label": "ProteomicsAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "OlympusDP80", "rdfs:subClassOf": [ { - "@id": "bts:MassSpecAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProteomicsAssayTemplate", + "sms:displayName": "Olympus DP80", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:OlympusIX73", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "OlympusIX73", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:ProteinExtractSource" - }, - { - "@id": "bts:DataCollectionMode" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Olympus IX73", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WGSTemplate", + "@id": "bts:OrbitrapFusionLumosTribrid", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing raw data from Whole Genome Sequencing (WGS)", - "rdfs:label": "WGSTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "OrbitrapFusionLumosTribrid", "rdfs:subClassOf": [ { - "@id": "bts:BulkSequencingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "WGSTemplate", + "sms:displayName": "Orbitrap Fusion Lumos Tribrid", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:OtherPlatform", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "OtherPlatform", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Other Platform", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProcessedMergedDataTemplate", + "@id": "bts:OxfordNanopore", "@type": "rdfs:Class", - "rdfs:comment": "Further processed data with multiple samples aggregated into one file. This may be also be known as level-4 data. Unlike level-2 and level-3 data, individual-level attributes such as age and sex are no longer surfaced on the data file directly.\n", - "rdfs:label": "ProcessedMergedDataTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "OxfordNanopore", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProcessedMergedDataTemplate", + "sms:displayName": "Oxford Nanopore", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Workflow" - }, - { - "@id": "bts:WorkflowLink" - }, - { - "@id": "bts:AuxiliaryAsset" - }, - { - "@id": "bts:Assay" - } - ], "sms:validationRules": [] }, { - "@id": "bts:UpdateMilestoneReport", + "@id": "bts:PacBioRSII", "@type": "rdfs:Class", - "rdfs:comment": "Metadata template for updating milestone report values in NF studies -- currently a supported feature for NTAP and GFF.", - "rdfs:label": "UpdateMilestoneReport", + "rdfs:comment": "TBD", + "rdfs:label": "PacBioRSII", "rdfs:subClassOf": [ { - "@id": "bts:PartialTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "UpdateMilestoneReport", + "sms:displayName": "PacBio RS II", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Filename" - }, - { - "@id": "bts:ResourceType" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:PacBioSequelIISystem", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "PacBioSequelIISystem", + "rdfs:subClassOf": [ { - "@id": "bts:ProgressReportNumber" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "PacBio Sequel II System", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MethylationArrayTemplate", + "@id": "bts:PacBioSequelIIeSystem", "@type": "rdfs:Class", - "rdfs:comment": "Template for raw data files (idat) from DNA methylation arrays.", - "rdfs:label": "MethylationArrayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "PacBioSequelIIeSystem", "rdfs:subClassOf": [ { - "@id": "bts:GenomicsArrayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MethylationArrayTemplate", + "sms:displayName": "PacBio Sequel IIe System", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:Pannoramic250Flash", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "Pannoramic250Flash", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:Channel" - }, - { - "@id": "bts:ChipID" - }, - { - "@id": "bts:ChipPosition" - }, - { - "@id": "bts:PlateName" - }, - { - "@id": "bts:PlateWell" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Pannoramic 250 Flash", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PharmacokineticsAssayTemplate", + "@id": "bts:Perlegen300Karray", "@type": "rdfs:Class", - "rdfs:comment": "Generic template for describing data from a pharmacokinetics assay.", - "rdfs:label": "PharmacokineticsAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "Perlegen300Karray", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PharmacokineticsAssayTemplate", + "sms:displayName": "Perlegen 300Karray", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:PhilipsAchieva1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "PhilipsAchieva1.5T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:CompoundName" - }, - { - "@id": "bts:CompoundDose" - }, - { - "@id": "bts:CompoundDoseUnit" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Philips Achieva 1.5T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ElectrophysiologyAssayTemplate", + "@id": "bts:PhilipsAchieva3T", "@type": "rdfs:Class", - "rdfs:comment": "Template for raw electrophysiology data (electrical recordings).", - "rdfs:label": "ElectrophysiologyAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "PhilipsAchieva3T", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ElectrophysiologyAssayTemplate", + "sms:displayName": "Philips Achieva 3T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:PhilipsInteraAchieva3T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "PhilipsInteraAchieva3T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:BodySite" - }, - { - "@id": "bts:CellType" - }, - { - "@id": "bts:RecordingSource" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:AuxiliaryAsset" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Philips Intera Achieva 3T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MicroscopyAssayTemplate", + "@id": "bts:PhilipsIngenia1.5T", "@type": "rdfs:Class", - "rdfs:comment": "Template for data from a microscopy data.", - "rdfs:label": "MicroscopyAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "PhilipsIngenia1.5T", "rdfs:subClassOf": [ { - "@id": "bts:ImagingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MicroscopyAssayTemplate", + "sms:displayName": "Philips Ingenia 1.5T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:PhilipsIngenia3T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "PhilipsIngenia3T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:AssayTarget" - }, - { - "@id": "bts:AuxiliaryAsset" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:Objective" - }, - { - "@id": "bts:NominalMagnification" - }, - { - "@id": "bts:LensAperture" - }, - { - "@id": "bts:WorkingDistance" - }, - { - "@id": "bts:WorkingDistanceUnit" - }, - { - "@id": "bts:Immersion" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Philips Ingenia 3T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ImmunoMicroscopyTemplate", + "@id": "bts:PhilipsPanorama1.0T", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing immunofluorescence or immunohistochemistry images.", - "rdfs:label": "ImmunoMicroscopyTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "PhilipsPanorama1.0T", "rdfs:subClassOf": [ { - "@id": "bts:MicroscopyAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ImmunoMicroscopyTemplate", + "sms:displayName": "Philips Panorama 1.0T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:PromegaGloMaxDiscover", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "PromegaGloMaxDiscover", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:AssayTarget" - }, - { - "@id": "bts:AuxiliaryAsset" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:Objective" - }, - { - "@id": "bts:NominalMagnification" - }, - { - "@id": "bts:LensAperture" - }, - { - "@id": "bts:WorkingDistance" - }, - { - "@id": "bts:WorkingDistanceUnit" - }, - { - "@id": "bts:Immersion" - }, - { - "@id": "bts:AntibodyID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Promega GloMax Discover", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:AnimalIndividualTemplate", + "@id": "bts:QExativeHF", "@type": "rdfs:Class", - "rdfs:comment": "Template for non-human individual-level data.", - "rdfs:label": "AnimalIndividualTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "QExativeHF", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "AnimalIndividualTemplate", + "sms:displayName": "Q Exative HF", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:DiagnosisAgeGroup" - }, - { - "@id": "bts:Inheritance" - }, - { - "@id": "bts:Mosaicism" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:GermlineMutation" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:ModelSystemName" - } - ], "sms:validationRules": [] }, { - "@id": "bts:PlateBasedReporterAssayTemplate", + "@id": "bts:SiemensAvanto1.5T", "@type": "rdfs:Class", - "rdfs:comment": "Generic template for describing data from a plate-based reporter assay.", - "rdfs:label": "PlateBasedReporterAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensAvanto1.5T", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PlateBasedReporterAssayTemplate", + "sms:displayName": "Siemens Avanto 1.5T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:SiemensAvantoFit1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensAvantoFit1.5T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:AssayTarget" - }, - { - "@id": "bts:CompoundName" - }, - { - "@id": "bts:CompoundDose" - }, - { - "@id": "bts:CompoundDoseUnit" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" - }, - { - "@id": "bts:ReporterGene" - }, - { - "@id": "bts:ReporterSubstance" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Siemens Avanto Fit 1.5T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:MRIAssayTemplate", + "@id": "bts:SiemensMagnetomAera1.5T", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing MRI data.", - "rdfs:label": "MRIAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomAera1.5T", "rdfs:subClassOf": [ { - "@id": "bts:ImagingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "MRIAssayTemplate", + "sms:displayName": "Siemens Magnetom Aera 1.5T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:SiemensMagnetomEspree1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomEspree1.5T", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:AssayTarget" - }, - { - "@id": "bts:AuxiliaryAsset" - }, - { - "@id": "bts:BodySite" - }, - { - "@id": "bts:MRISequence" - }, - { - "@id": "bts:ExperimentalCondition" - }, - { - "@id": "bts:ExperimentalTimepoint" - }, - { - "@id": "bts:TimepointUnit" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Siemens Magnetom Espree 1.5T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WESTemplate", + "@id": "bts:SiemensMagnetomPrisma3T", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing raw data from Whole Exome Sequencing (WES/WXS)", - "rdfs:label": "WESTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomPrisma3T", "rdfs:subClassOf": [ { - "@id": "bts:BulkSequencingAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "WESTemplate", + "sms:displayName": "Siemens Magnetom Prisma 3T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, - { - "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:SiemensMagnetomSkyra3T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomSkyra3T", + "rdfs:subClassOf": [ { - "@id": "bts:TargetCaptureKitID" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Siemens Magnetom Skyra 3T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:SourceCodeTemplate", + "@id": "bts:SiemensMagnetomTrio3T", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing scripts or software code.", - "rdfs:label": "SourceCodeTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomTrio3T", "rdfs:subClassOf": [ { - "@id": "bts:Template" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "SourceCodeTemplate", + "sms:displayName": "Siemens Magnetom Trio 3T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Title" - }, - { - "@id": "bts:Author" - }, - { - "@id": "bts:Citation" - }, - { - "@id": "bts:License" - }, - { - "@id": "bts:ProgrammingLanguage" - }, - { - "@id": "bts:RuntimePlatform" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:SiemensMagnetomVerio3T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomVerio3T", + "rdfs:subClassOf": [ { - "@id": "bts:Documentation" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Siemens Magnetom Verio 3T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:EpigeneticsAssayTemplate", + "@id": "bts:SiemensMagnetomPrismaFit3T", "@type": "rdfs:Class", - "rdfs:comment": "Alias for EpigenomiscAssayTemplate for backwards-compatibility.", - "rdfs:label": "EpigeneticsAssayTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "SiemensMagnetomPrismaFit3T", "rdfs:subClassOf": [ { - "@id": "bts:EpigenomiscAssayTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "EpigeneticsAssayTemplate", + "sms:displayName": "Siemens Magnetom Prisma Fit 3T", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:ParentSpecimenID" - }, - { - "@id": "bts:SpecimenID" - }, - { - "@id": "bts:AliquotID" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:SpectramaxMSeries", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "SpectramaxMSeries", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:NucleicAcidSource" - }, - { - "@id": "bts:SpecimenPreparationMethod" - }, - { - "@id": "bts:SpecimenType" - }, - { - "@id": "bts:RunType" - }, - { - "@id": "bts:LibraryStrand" - }, - { - "@id": "bts:LibraryPrep" - }, - { - "@id": "bts:LibraryPreparationMethod" - }, - { - "@id": "bts:ReadPair" - }, - { - "@id": "bts:ReadLength" - }, - { - "@id": "bts:ReadDepth" - }, - { - "@id": "bts:TargetDepth" - }, - { - "@id": "bts:BatchID" - }, - { - "@id": "bts:BisulfiteConversionKitID" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Spectramax M Series", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:ProcessedVariantCallsTemplate", + "@id": "bts:TOOsonixSystemONE-M", "@type": "rdfs:Class", - "rdfs:comment": "Template for describing either simple germline/somatic variant calls output data (VCF/MAF) as well as structural variants (e.g. CNVs).", - "rdfs:label": "ProcessedVariantCallsTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "TOOsonixSystemONE-M", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "ProcessedVariantCallsTemplate", + "sms:displayName": "TOOsonix System ONE-M", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, - { - "@id": "bts:IsFilteredReads" - }, - { - "@id": "bts:Workflow" - }, - { - "@id": "bts:WorkflowLink" - }, - { - "@id": "bts:AuxiliaryAsset" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:ToshibaVantageTitan1.5T", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ToshibaVantageTitan1.5T", + "rdfs:subClassOf": [ { - "@id": "bts:SpecimenID" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Toshiba Vantage Titan 1.5T", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:PortalDataset", + "@id": "bts:VarioskanLUX", "@type": "rdfs:Class", - "rdfs:comment": "//nf.synapse.org/Explore/Datasets. \n", - "rdfs:label": "PortalDataset", + "rdfs:comment": "TBD", + "rdfs:label": "VarioskanLUX", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "PortalDataset", + "sms:displayName": "Varioskan LUX", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Title" - }, - { - "@id": "bts:Creator" - }, - { - "@id": "bts:Contributor" - }, - { - "@id": "bts:Description" - }, - { - "@id": "bts:AccessType" - }, - { - "@id": "bts:License" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:StudyId" - }, - { - "@id": "bts:Manifestation" - }, - { - "@id": "bts:DiseaseFocus" - }, - { - "@id": "bts:FundingAgency" - }, - { - "@id": "bts:Series" - }, - { - "@id": "bts:VisualizeDataOn" - }, - { - "@id": "bts:YearProcessed" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:VectraH13DImagingSystem", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "VectraH13DImagingSystem", + "rdfs:subClassOf": [ { - "@id": "bts:YearPublished" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Vectra H1 3D Imaging System", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:VisualizeDataOn", + "@id": "bts:Vevo3100ImagingSystem", "@type": "rdfs:Class", "rdfs:comment": "TBD", - "rdfs:label": "VisualizeDataOn", + "rdfs:label": "Vevo3100ImagingSystem", "rdfs:subClassOf": [ { - "@id": "bts:Thing" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "visualizeDataOn", + "sms:displayName": "Vevo 3100 Imaging System", "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:FlowCytometryTemplate", + "@id": "bts:XF24ExtracellularFluxAnalyzer", "@type": "rdfs:Class", - "rdfs:comment": "Template for flow cytometry assay", - "rdfs:label": "FlowCytometryTemplate", + "rdfs:comment": "TBD", + "rdfs:label": "XF24ExtracellularFluxAnalyzer", "rdfs:subClassOf": [ { - "@id": "bts:BiologicalAssayDataTemplate" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "FlowCytometryTemplate", + "sms:displayName": "XF24 Extracellular Flux Analyzer", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:Component" - }, - { - "@id": "bts:Filename" - }, - { - "@id": "bts:FileFormat" - }, - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:DataType" - }, - { - "@id": "bts:DataSubtype" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:IndividualID" - }, - { - "@id": "bts:Species" - }, - { - "@id": "bts:Sex" - }, - { - "@id": "bts:Age" - }, - { - "@id": "bts:AgeUnit" - }, - { - "@id": "bts:Diagnosis" - }, - { - "@id": "bts:Nf1Genotype" - }, - { - "@id": "bts:Nf2Genotype" - }, - { - "@id": "bts:TumorType" - }, - { - "@id": "bts:ModelSystemName" - }, - { - "@id": "bts:Organ" - }, - { - "@id": "bts:Comments" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:ZeissLSM", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ZeissLSM", + "rdfs:subClassOf": [ { "@id": "bts:Platform" - }, - { - "@id": "bts:CellType" - }, - { - "@id": "bts:AuxiliaryAsset" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Zeiss LSM", + "sms:required": "sms:false", "sms:validationRules": [] }, { - "@id": "bts:WorkflowReport", + "@id": "bts:ZeissLSM700", "@type": "rdfs:Class", - "rdfs:comment": "Template used for miscellaneous workflow reports and accessory files", - "rdfs:label": "WorkflowReport", + "rdfs:comment": "TBD", + "rdfs:label": "ZeissLSM700", "rdfs:subClassOf": [ { - "@id": "bts:Template" + "@id": "bts:Platform" } ], "schema:isPartOf": { "@id": "http://schema.biothings.io" }, - "sms:displayName": "WorkflowReport", + "sms:displayName": "Zeiss LSM 700", "sms:required": "sms:false", - "sms:requiresDependency": [ - { - "@id": "bts:ResourceType" - }, - { - "@id": "bts:Assay" - }, - { - "@id": "bts:FileFormat" - }, + "sms:validationRules": [] + }, + { + "@id": "bts:ZeissLSM980", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ZeissLSM980", + "rdfs:subClassOf": [ { - "@id": "bts:RelatedDataset" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Zeiss LSM 980", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ZenoElectronicWalkway", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ZenoElectronicWalkway", + "rdfs:subClassOf": [ { - "@id": "bts:Workflow" - }, + "@id": "bts:Platform" + } + ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "Zeno Electronic Walkway", + "sms:required": "sms:false", + "sms:validationRules": [] + }, + { + "@id": "bts:ZetaView", + "@type": "rdfs:Class", + "rdfs:comment": "TBD", + "rdfs:label": "ZetaView", + "rdfs:subClassOf": [ { - "@id": "bts:WorkflowLink" + "@id": "bts:Platform" } ], + "schema:isPartOf": { + "@id": "http://schema.biothings.io" + }, + "sms:displayName": "ZetaView", + "sms:required": "sms:false", "sms:validationRules": [] }, { diff --git a/registered-json-schemas/Dataset.json b/registered-json-schemas/Dataset.json index 6e34a8e0..898d556e 100644 --- a/registered-json-schemas/Dataset.json +++ b/registered-json-schemas/Dataset.json @@ -29,6 +29,7 @@ "CAPP-seq", "cell competition", "cell count", + "cell painting", "cell proliferation", "cell viability assay", "Child Behavior Checklist for Ages 1.5-5", diff --git a/registered-json-schemas/PortalDataset.json b/registered-json-schemas/PortalDataset.json index 05531ba5..cfb33060 100644 --- a/registered-json-schemas/PortalDataset.json +++ b/registered-json-schemas/PortalDataset.json @@ -79,6 +79,7 @@ "calcium retention capacity assay", "cell competition", "cell count", + "cell painting", "cell proliferation", "cell viability assay", "clinical data", @@ -196,7 +197,10 @@ "items": { "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "creator": { "type": "string" @@ -250,7 +254,10 @@ "title": "dataType" }, "description": { - "type": "string" + "type": [ + "string", + "null" + ] }, "diseaseFocus": { "items": { @@ -333,11 +340,17 @@ "title": "ManifestationEnum", "type": "string" }, - "type": "array", + "type": [ + "array", + "null" + ], "title": "manifestation" }, "series": { - "type": "string" + "type": [ + "string", + "null" + ] }, "species": { "items": { @@ -358,7 +371,10 @@ "title": "SpeciesEnum", "type": "string" }, - "type": "array", + "type": [ + "array", + "null" + ], "title": "species" }, "studyId": { @@ -371,13 +387,22 @@ "items": { "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "yearProcessed": { - "type": "integer" + "type": [ + "integer", + "null" + ] }, "yearPublished": { - "type": "integer" + "type": [ + "integer", + "null" + ] } }, "required": [ diff --git a/registered-json-schemas/PortalStudy.json b/registered-json-schemas/PortalStudy.json index 5783dd39..938934b0 100644 --- a/registered-json-schemas/PortalStudy.json +++ b/registered-json-schemas/PortalStudy.json @@ -4,10 +4,16 @@ "$id": "https://repo-prod.prod.sagebase.org/repo/v1/schema/type/registered/org.synapse.nf-portalstudy", "properties": { "accessRequirements": { - "type": "string" + "type": [ + "string", + "null" + ] }, "acknowledgementStatements": { - "type": "string" + "type": [ + "string", + "null" + ] }, "dataStatus": { "description": "", @@ -67,7 +73,10 @@ "title": "Data", "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "diseaseFocus": { "items": { @@ -85,7 +94,10 @@ "title": "DiseaseFocusEnum", "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "fundingAgency": { "type": "string" @@ -94,7 +106,10 @@ "items": { "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "initiative": { "type": "string" @@ -436,13 +451,19 @@ "items": { "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "relatedStudies": { "items": { "type": "string" }, - "type": "array" + "type": [ + "array", + "null" + ] }, "studyFileviewId": { "type": "string" diff --git a/registered-json-schemas/Superdataset.json b/registered-json-schemas/Superdataset.json index a90e4f8b..11ccce39 100644 --- a/registered-json-schemas/Superdataset.json +++ b/registered-json-schemas/Superdataset.json @@ -29,6 +29,7 @@ "CAPP-seq", "cell competition", "cell count", + "cell painting", "cell proliferation", "cell viability assay", "Child Behavior Checklist for Ages 1.5-5",