diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime new file mode 120000 index 0000000..fbb7ee0 --- /dev/null +++ b/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md new file mode 100644 index 0000000..0477ed7 --- /dev/null +++ b/node_modules/accepts/HISTORY.md @@ -0,0 +1,212 @@ +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md new file mode 100644 index 0000000..ae36676 --- /dev/null +++ b/node_modules/accepts/README.md @@ -0,0 +1,135 @@ +# accepts + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +```sh +npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app(req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch(accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/accepts.svg +[npm-url]: https://npmjs.org/package/accepts +[node-version-image]: https://img.shields.io/node/v/accepts.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/accepts/master.svg +[travis-url]: https://travis-ci.org/jshttp/accepts +[coveralls-image]: https://img.shields.io/coveralls/jshttp/accepts/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/accepts +[downloads-image]: https://img.shields.io/npm/dm/accepts.svg +[downloads-url]: https://npmjs.org/package/accepts diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js new file mode 100644 index 0000000..e80192a --- /dev/null +++ b/node_modules/accepts/index.js @@ -0,0 +1,231 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts(req) { + if (!(this instanceof Accepts)) + return new Accepts(req) + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + if (!this.headers.accept) return types[0]; + var mimes = types.map(extToMime); + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)); + var first = accepts[0]; + if (!first) return false; + return types[mimes.indexOf(first)]; +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime(type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime(type) { + return typeof type === 'string'; +} diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json new file mode 100644 index 0000000..a7926d0 --- /dev/null +++ b/node_modules/accepts/package.json @@ -0,0 +1,112 @@ +{ + "_args": [ + [ + { + "raw": "accepts@~1.3.3", + "scope": null, + "escapedName": "accepts", + "name": "accepts", + "rawSpec": "~1.3.3", + "spec": ">=1.3.3 <1.4.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "accepts@>=1.3.3 <1.4.0", + "_id": "accepts@1.3.3", + "_inCache": true, + "_location": "/accepts", + "_nodeVersion": "4.4.3", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/accepts-1.3.3.tgz_1462251932032_0.7092335098423064" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.1", + "_phantomChildren": {}, + "_requested": { + "raw": "accepts@~1.3.3", + "scope": null, + "escapedName": "accepts", + "name": "accepts", + "rawSpec": "~1.3.3", + "spec": ">=1.3.3 <1.4.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz", + "_shasum": "c3ca7434938648c3e0d9c1e328dd68b622c284ca", + "_shrinkwrap": null, + "_spec": "accepts@~1.3.3", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.11", + "negotiator": "0.6.1" + }, + "description": "Higher-level content negotiation", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "~1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "c3ca7434938648c3e0d9c1e328dd68b622c284ca", + "tarball": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "gitHead": "3e925b1e65ed7da2798849683d49814680dfa426", + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "accepts", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.3.3" +} diff --git a/node_modules/array-flatten/LICENSE b/node_modules/array-flatten/LICENSE new file mode 100644 index 0000000..983fbe8 --- /dev/null +++ b/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/array-flatten/README.md b/node_modules/array-flatten/README.md new file mode 100644 index 0000000..91fa5b6 --- /dev/null +++ b/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/node_modules/array-flatten/array-flatten.js b/node_modules/array-flatten/array-flatten.js new file mode 100644 index 0000000..089117b --- /dev/null +++ b/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/node_modules/array-flatten/package.json b/node_modules/array-flatten/package.json new file mode 100644 index 0000000..ee327da --- /dev/null +++ b/node_modules/array-flatten/package.json @@ -0,0 +1,96 @@ +{ + "_args": [ + [ + { + "raw": "array-flatten@1.1.1", + "scope": null, + "escapedName": "array-flatten", + "name": "array-flatten", + "rawSpec": "1.1.1", + "spec": "1.1.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "array-flatten@1.1.1", + "_id": "array-flatten@1.1.1", + "_inCache": true, + "_location": "/array-flatten", + "_nodeVersion": "2.3.3", + "_npmUser": { + "name": "blakeembrey", + "email": "hello@blakeembrey.com" + }, + "_npmVersion": "2.11.3", + "_phantomChildren": {}, + "_requested": { + "raw": "array-flatten@1.1.1", + "scope": null, + "escapedName": "array-flatten", + "name": "array-flatten", + "rawSpec": "1.1.1", + "spec": "1.1.1", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2", + "_shrinkwrap": null, + "_spec": "array-flatten@1.1.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "dependencies": {}, + "description": "Flatten an array of nested arrays into a single flat array", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + }, + "directories": {}, + "dist": { + "shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2", + "tarball": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz" + }, + "files": [ + "array-flatten.js", + "LICENSE" + ], + "gitHead": "1963a9189229d408e1e8f585a00c8be9edbd1803", + "homepage": "https://github.com/blakeembrey/array-flatten", + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "license": "MIT", + "main": "array-flatten.js", + "maintainers": [ + { + "name": "blakeembrey", + "email": "hello@blakeembrey.com" + } + ], + "name": "array-flatten", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "1.1.1" +} diff --git a/node_modules/content-disposition/HISTORY.md b/node_modules/content-disposition/HISTORY.md new file mode 100644 index 0000000..53849b6 --- /dev/null +++ b/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,50 @@ +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/node_modules/content-disposition/LICENSE b/node_modules/content-disposition/LICENSE new file mode 100644 index 0000000..b7dce6c --- /dev/null +++ b/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/content-disposition/README.md b/node_modules/content-disposition/README.md new file mode 100644 index 0000000..992d19a --- /dev/null +++ b/node_modules/content-disposition/README.md @@ -0,0 +1,141 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +```js +res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'); +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "€ rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest(req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function (err) { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg?style=flat +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg?style=flat +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/content-disposition.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/content-disposition +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg?style=flat +[downloads-url]: https://npmjs.org/package/content-disposition diff --git a/node_modules/content-disposition/index.js b/node_modules/content-disposition/index.js new file mode 100644 index 0000000..88a0d0a --- /dev/null +++ b/node_modules/content-disposition/index.js @@ -0,0 +1,445 @@ +/*! + * content-disposition + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + */ + +var basename = require('path').basename + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * HT = + * CTL = + * OCTET = + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @api public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @api private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @api private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 6987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @api private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = new Buffer(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @api private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @api private + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @api private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @api private + */ + +function pencode (char) { + var hex = String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() + return hex.length === 1 + ? '%0' + hex + : '%' + hex +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @api private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @api private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/node_modules/content-disposition/package.json b/node_modules/content-disposition/package.json new file mode 100644 index 0000000..87eeaeb --- /dev/null +++ b/node_modules/content-disposition/package.json @@ -0,0 +1,110 @@ +{ + "_args": [ + [ + { + "raw": "content-disposition@0.5.2", + "scope": null, + "escapedName": "content-disposition", + "name": "content-disposition", + "rawSpec": "0.5.2", + "spec": "0.5.2", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "content-disposition@0.5.2", + "_id": "content-disposition@0.5.2", + "_inCache": true, + "_location": "/content-disposition", + "_nodeVersion": "4.6.0", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/content-disposition-0.5.2.tgz_1481246224565_0.35659545403905213" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "content-disposition@0.5.2", + "scope": null, + "escapedName": "content-disposition", + "name": "content-disposition", + "rawSpec": "0.5.2", + "spec": "0.5.2", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz", + "_shasum": "0cf68bb9ddf5f2be7961c3a85178cb85dba78cb4", + "_shrinkwrap": null, + "_spec": "content-disposition@0.5.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/content-disposition/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "Create and parse Content-Disposition header", + "devDependencies": { + "eslint": "3.11.1", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.3.0", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "0cf68bb9ddf5f2be7961c3a85178cb85dba78cb4", + "tarball": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "2a08417377cf55678c9f870b305f3c6c088920f3", + "homepage": "https://github.com/jshttp/content-disposition#readme", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "content-disposition", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/content-disposition.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.5.2" +} diff --git a/node_modules/content-type/HISTORY.md b/node_modules/content-type/HISTORY.md new file mode 100644 index 0000000..01652ff --- /dev/null +++ b/node_modules/content-type/HISTORY.md @@ -0,0 +1,14 @@ +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/node_modules/content-type/LICENSE b/node_modules/content-type/LICENSE new file mode 100644 index 0000000..34b1a2d --- /dev/null +++ b/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/content-type/README.md b/node_modules/content-type/README.md new file mode 100644 index 0000000..3ed6741 --- /dev/null +++ b/node_modules/content-type/README.md @@ -0,0 +1,92 @@ +# content-type + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a content type string. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `content-type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `content-type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({type: 'image/svg+xml'}) +``` + +Format an object into a content type string. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-type.svg +[npm-url]: https://npmjs.org/package/content-type +[node-version-image]: https://img.shields.io/node/v/content-type.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/content-type/master.svg +[travis-url]: https://travis-ci.org/jshttp/content-type +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-type/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-type +[downloads-image]: https://img.shields.io/npm/dm/content-type.svg +[downloads-url]: https://npmjs.org/package/content-type diff --git a/node_modules/content-type/index.js b/node_modules/content-type/index.js new file mode 100644 index 0000000..61ba6b5 --- /dev/null +++ b/node_modules/content-type/index.js @@ -0,0 +1,216 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var paramRegExp = /; *([!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+) */g +var textRegExp = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ +var tokenRegExp = /^[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var qescRegExp = /\\([\u000b\u0020-\u00ff])/g + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var quoteRegExp = /([\\"])/g + +/** + * RegExp to match type in RFC 6838 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var typeRegExp = /^[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+\/[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format(obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !typeRegExp.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!tokenRegExp.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse(string) { + if (!string) { + throw new TypeError('argument string is required') + } + + if (typeof string === 'object') { + // support req/res-like objects as argument + string = getcontenttype(string) + + if (typeof string !== 'string') { + throw new TypeError('content-type header is missing from object'); + } + } + + if (typeof string !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = string.indexOf(';') + var type = index !== -1 + ? string.substr(0, index).trim() + : string.trim() + + if (!typeRegExp.test(type)) { + throw new TypeError('invalid media type') + } + + var key + var match + var obj = new ContentType(type.toLowerCase()) + var value + + paramRegExp.lastIndex = index + + while (match = paramRegExp.exec(string)) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(qescRegExp, '$1') + } + + obj.parameters[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype(obj) { + if (typeof obj.getHeader === 'function') { + // res-like + return obj.getHeader('content-type') + } + + if (typeof obj.headers === 'object') { + // req-like + return obj.headers && obj.headers['content-type'] + } +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring(val) { + var str = String(val) + + // no need to quote tokens + if (tokenRegExp.test(str)) { + return str + } + + if (str.length > 0 && !textRegExp.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(quoteRegExp, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType(type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/node_modules/content-type/package.json b/node_modules/content-type/package.json new file mode 100644 index 0000000..1c91b3b --- /dev/null +++ b/node_modules/content-type/package.json @@ -0,0 +1,104 @@ +{ + "_args": [ + [ + { + "raw": "content-type@~1.0.2", + "scope": null, + "escapedName": "content-type", + "name": "content-type", + "rawSpec": "~1.0.2", + "spec": ">=1.0.2 <1.1.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "content-type@>=1.0.2 <1.1.0", + "_id": "content-type@1.0.2", + "_inCache": true, + "_location": "/content-type", + "_nodeVersion": "4.4.3", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/content-type-1.0.2.tgz_1462852785748_0.5491233412176371" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.1", + "_phantomChildren": {}, + "_requested": { + "raw": "content-type@~1.0.2", + "scope": null, + "escapedName": "content-type", + "name": "content-type", + "rawSpec": "~1.0.2", + "spec": ">=1.0.2 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.2.tgz", + "_shasum": "b7d113aee7a8dd27bd21133c4dc2529df1721eed", + "_shrinkwrap": null, + "_spec": "content-type@~1.0.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/content-type/issues" + }, + "dependencies": {}, + "description": "Create and parse HTTP Content-Type header", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "~1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "b7d113aee7a8dd27bd21133c4dc2529df1721eed", + "tarball": "https://registry.npmjs.org/content-type/-/content-type-1.0.2.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "8118763adfbbac80cf1254191889330aec8b8be7", + "homepage": "https://github.com/jshttp/content-type#readme", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "content-type", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/content-type.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.2" +} diff --git a/node_modules/cookie-signature/.npmignore b/node_modules/cookie-signature/.npmignore new file mode 100644 index 0000000..f1250e5 --- /dev/null +++ b/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/node_modules/cookie-signature/History.md b/node_modules/cookie-signature/History.md new file mode 100644 index 0000000..78513cc --- /dev/null +++ b/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/cookie-signature/Readme.md b/node_modules/cookie-signature/Readme.md new file mode 100644 index 0000000..2559e84 --- /dev/null +++ b/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/cookie-signature/index.js b/node_modules/cookie-signature/index.js new file mode 100644 index 0000000..b8c9463 --- /dev/null +++ b/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/node_modules/cookie-signature/package.json b/node_modules/cookie-signature/package.json new file mode 100644 index 0000000..d31d815 --- /dev/null +++ b/node_modules/cookie-signature/package.json @@ -0,0 +1,92 @@ +{ + "_args": [ + [ + { + "raw": "cookie-signature@1.0.6", + "scope": null, + "escapedName": "cookie-signature", + "name": "cookie-signature", + "rawSpec": "1.0.6", + "spec": "1.0.6", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "cookie-signature@1.0.6", + "_id": "cookie-signature@1.0.6", + "_inCache": true, + "_location": "/cookie-signature", + "_nodeVersion": "0.10.36", + "_npmUser": { + "name": "natevw", + "email": "natevw@yahoo.com" + }, + "_npmVersion": "2.3.0", + "_phantomChildren": {}, + "_requested": { + "raw": "cookie-signature@1.0.6", + "scope": null, + "escapedName": "cookie-signature", + "name": "cookie-signature", + "rawSpec": "1.0.6", + "spec": "1.0.6", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "_shasum": "e303a882b342cc3ee8ca513a79999734dab3ae2c", + "_shrinkwrap": null, + "_spec": "cookie-signature@1.0.6", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@learnboost.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/node-cookie-signature/issues" + }, + "dependencies": {}, + "description": "Sign and unsign cookies", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "directories": {}, + "dist": { + "shasum": "e303a882b342cc3ee8ca513a79999734dab3ae2c", + "tarball": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz" + }, + "gitHead": "391b56cf44d88c493491b7e3fc53208cfb976d2a", + "homepage": "https://github.com/visionmedia/node-cookie-signature", + "keywords": [ + "cookie", + "sign", + "unsign" + ], + "license": "MIT", + "main": "index", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "natevw", + "email": "natevw@yahoo.com" + } + ], + "name": "cookie-signature", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/node-cookie-signature.git" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "version": "1.0.6" +} diff --git a/node_modules/cookie/HISTORY.md b/node_modules/cookie/HISTORY.md new file mode 100644 index 0000000..5bd6485 --- /dev/null +++ b/node_modules/cookie/HISTORY.md @@ -0,0 +1,118 @@ +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/node_modules/cookie/LICENSE b/node_modules/cookie/LICENSE new file mode 100644 index 0000000..058b6b4 --- /dev/null +++ b/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/cookie/README.md b/node_modules/cookie/README.md new file mode 100644 index 0000000..db0d078 --- /dev/null +++ b/node_modules/cookie/README.md @@ -0,0 +1,220 @@ +# cookie + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6266-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `ecodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6266-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6266-5.3] states that if both `expires` and +`magAge` are set, then `maxAge` takes precedence, but it is possiblke not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6266-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6266-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6266-5.3] states that if both `expires` and +`magAge` are set, then `maxAge` takes precedence, but it is possiblke not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6266-5.2.4]. By default, the path +is considered the ["default path"][rfc-6266-5.1.4]. By default, no maximum age is set, and most +clients will consider this a "non-persistent cookie" and will delete it on a condition like exiting +a web browser application. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][draft-west-first-party-cookies-07]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in the specification +https://tools.ietf.org/html/draft-west-first-party-cookies-07#section-4.1.1 + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6266-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('

Welcome back, ' + escapeHtml(name) + '!

'); + } else { + res.write('

Hello, new visitor!

'); + } + + res.write('
'); + res.write(' '); + res.end(' values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var pairs = str.split(pairSplitRegExp); + var dec = opt.decode || decode; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + var eq_idx = pair.indexOf('='); + + // skip things that don't look like key=value + if (eq_idx < 0) { + continue; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + obj[key] = tryDecode(val, dec); + } + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + if (isNaN(maxAge)) throw new Error('maxAge should be a Number'); + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + if (typeof opt.expires.toUTCString !== 'function') { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + opt.expires.toUTCString(); + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/node_modules/cookie/package.json b/node_modules/cookie/package.json new file mode 100644 index 0000000..17f0126 --- /dev/null +++ b/node_modules/cookie/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + { + "raw": "cookie@0.3.1", + "scope": null, + "escapedName": "cookie", + "name": "cookie", + "rawSpec": "0.3.1", + "spec": "0.3.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "cookie@0.3.1", + "_id": "cookie@0.3.1", + "_inCache": true, + "_location": "/cookie", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/cookie-0.3.1.tgz_1464323556714_0.6435900838114321" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "cookie@0.3.1", + "scope": null, + "escapedName": "cookie", + "name": "cookie", + "rawSpec": "0.3.1", + "spec": "0.3.1", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz", + "_shasum": "e7e0a1f9ef43b4c8ba925c5c5a96e806d16873bb", + "_shrinkwrap": null, + "_spec": "cookie@0.3.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Roman Shtylman", + "email": "shtylman@gmail.com" + }, + "bugs": { + "url": "https://github.com/jshttp/cookie/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "HTTP server cookie parsing and serialization", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "e7e0a1f9ef43b4c8ba925c5c5a96e806d16873bb", + "tarball": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "gitHead": "e3c77d497d66c8b8d4b677b8954c1b192a09f0b3", + "homepage": "https://github.com/jshttp/cookie", + "keywords": [ + "cookie", + "cookies" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "cookie", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/cookie.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "0.3.1" +} diff --git a/node_modules/debug/.jshintrc b/node_modules/debug/.jshintrc new file mode 100644 index 0000000..299877f --- /dev/null +++ b/node_modules/debug/.jshintrc @@ -0,0 +1,3 @@ +{ + "laxbreak": true +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..7e6163d --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,6 @@ +support +test +examples +example +*.sock +dist diff --git a/node_modules/debug/History.md b/node_modules/debug/History.md new file mode 100644 index 0000000..854c971 --- /dev/null +++ b/node_modules/debug/History.md @@ -0,0 +1,195 @@ + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..5cf4a59 --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,36 @@ + +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# applications +NODE ?= $(shell which node) +NPM ?= $(NODE) $(shell which npm) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +all: dist/debug.js + +install: node_modules + +clean: + @rm -rf dist + +dist: + @mkdir -p $@ + +dist/debug.js: node_modules browser.js debug.js dist + @$(BROWSERIFY) \ + --standalone debug \ + . > $@ + +distclean: clean + @rm -rf node_modules + +node_modules: package.json + @NODE_ENV= $(NPM) install + @touch node_modules + +.PHONY: all install clean distclean diff --git a/node_modules/debug/Readme.md b/node_modules/debug/Readme.md new file mode 100644 index 0000000..b4f45e3 --- /dev/null +++ b/node_modules/debug/Readme.md @@ -0,0 +1,188 @@ +# debug + + tiny node.js debugging utility modelled after node core's debugging technique. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + + With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Browser support + + Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include: + +```js +window.myDebug = require("debug"); +``` + + ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console: + +```js +myDebug.enable("worker:*") +``` + + Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + +### stderr vs stdout + +You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +### Save debug output to a file + +You can save all debug statements to a file by piping them. + +Example: + +```bash +$ DEBUG_FD=3 node your-app.js 3> whatever.log +``` + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + +## License + +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/bower.json b/node_modules/debug/bower.json new file mode 100644 index 0000000..6af573f --- /dev/null +++ b/node_modules/debug/bower.json @@ -0,0 +1,28 @@ +{ + "name": "visionmedia-debug", + "main": "dist/debug.js", + "version": "2.2.0", + "homepage": "https://github.com/visionmedia/debug", + "authors": [ + "TJ Holowaychuk " + ], + "description": "visionmedia-debug", + "moduleType": [ + "amd", + "es6", + "globals", + "node" + ], + "keywords": [ + "visionmedia", + "debug" + ], + "license": "MIT", + "ignore": [ + "**/.*", + "node_modules", + "bower_components", + "test", + "tests" + ] +} diff --git a/node_modules/debug/browser.js b/node_modules/debug/browser.js new file mode 100644 index 0000000..7c76452 --- /dev/null +++ b/node_modules/debug/browser.js @@ -0,0 +1,168 @@ + +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // is webkit? http://stackoverflow.com/a/16459606/376773 + return ('WebkitAppearance' in document.documentElement.style) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (window.console && (console.firebug || (console.exception && console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + return JSON.stringify(v); +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs() { + var args = arguments; + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return args; + + var c = 'color: ' + this.color; + args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1)); + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); + return args; +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage(){ + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json new file mode 100644 index 0000000..ca10637 --- /dev/null +++ b/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.2.0", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "browser.js", + "scripts": [ + "browser.js", + "debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/node_modules/debug/debug.js b/node_modules/debug/debug.js new file mode 100644 index 0000000..7571a86 --- /dev/null +++ b/node_modules/debug/debug.js @@ -0,0 +1,197 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = debug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lowercased letter, i.e. "n". + */ + +exports.formatters = {}; + +/** + * Previously assigned color. + */ + +var prevColor = 0; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * + * @return {Number} + * @api private + */ + +function selectColor() { + return exports.colors[prevColor++ % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function debug(namespace) { + + // define the `disabled` version + function disabled() { + } + disabled.enabled = false; + + // define the `enabled` version + function enabled() { + + var self = enabled; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // add the `color` if not set + if (null == self.useColors) self.useColors = exports.useColors(); + if (null == self.color && self.useColors) self.color = selectColor(); + + var args = Array.prototype.slice.call(arguments); + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %o + args = ['%o'].concat(args); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + if ('function' === typeof exports.formatArgs) { + args = exports.formatArgs.apply(self, args); + } + var logFn = enabled.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + enabled.enabled = true; + + var fn = exports.enabled(namespace) ? enabled : disabled; + + fn.namespace = namespace; + + return fn; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + var split = (namespaces || '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..1d392a8 --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1,209 @@ + +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase(); + if (0 === debugColors.length) { + return tty.isatty(fd); + } else { + return '0' !== debugColors + && 'no' !== debugColors + && 'false' !== debugColors + && 'disabled' !== debugColors; + } +} + +/** + * Map %o to `util.inspect()`, since Node doesn't do that out of the box. + */ + +var inspect = (4 === util.inspect.length ? + // node <= 0.8.x + function (v, colors) { + return util.inspect(v, void 0, void 0, colors); + } : + // node > 0.8.x + function (v, colors) { + return util.inspect(v, { colors: colors }); + } +); + +exports.formatters.o = function(v) { + return inspect(v, this.useColors) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs() { + var args = arguments; + var useColors = this.useColors; + var name = this.namespace; + + if (useColors) { + var c = this.color; + + args[0] = ' \u001b[3' + c + ';1m' + name + ' ' + + '\u001b[0m' + + args[0] + '\u001b[3' + c + 'm' + + ' +' + exports.humanize(this.diff) + '\u001b[0m'; + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } + return args; +} + +/** + * Invokes `console.error()` with the specified arguments. + */ + +function log() { + return stream.write(util.format.apply(this, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..1287fdf --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,108 @@ +{ + "_args": [ + [ + { + "raw": "debug@~2.2.0", + "scope": null, + "escapedName": "debug", + "name": "debug", + "rawSpec": "~2.2.0", + "spec": ">=2.2.0 <2.3.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "debug@>=2.2.0 <2.3.0", + "_id": "debug@2.2.0", + "_inCache": true, + "_location": "/debug", + "_nodeVersion": "0.12.2", + "_npmUser": { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + }, + "_npmVersion": "2.7.4", + "_phantomChildren": {}, + "_requested": { + "raw": "debug@~2.2.0", + "scope": null, + "escapedName": "debug", + "name": "debug", + "rawSpec": "~2.2.0", + "spec": ">=2.2.0 <2.3.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz", + "_shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "_shrinkwrap": null, + "_spec": "debug@~2.2.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + } + ], + "dependencies": { + "ms": "0.7.1" + }, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "mocha": "*" + }, + "directories": {}, + "dist": { + "shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "tarball": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz" + }, + "gitHead": "b38458422b5aa8aa6d286b10dfe427e8a67e2b35", + "homepage": "https://github.com/visionmedia/debug", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./node.js", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + } + ], + "name": "debug", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "scripts": {}, + "version": "2.2.0" +} diff --git a/node_modules/depd/History.md b/node_modules/depd/History.md new file mode 100644 index 0000000..ace1171 --- /dev/null +++ b/node_modules/depd/History.md @@ -0,0 +1,84 @@ +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/node_modules/depd/LICENSE b/node_modules/depd/LICENSE new file mode 100644 index 0000000..142ede3 --- /dev/null +++ b/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/depd/Readme.md b/node_modules/depd/Readme.md new file mode 100644 index 0000000..09bb979 --- /dev/null +++ b/node_modules/depd/Readme.md @@ -0,0 +1,281 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] +[![Gratipay][gratipay-image]][gratipay-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction() { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[npm-version-image]: https://img.shields.io/npm/v/depd.svg +[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg +[npm-url]: https://npmjs.org/package/depd +[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://img.shields.io/node/v/depd.svg +[node-url]: http://nodejs.org/download/ +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url]: https://www.gratipay.com/dougwilson/ diff --git a/node_modules/depd/index.js b/node_modules/depd/index.js new file mode 100644 index 0000000..fddcae8 --- /dev/null +++ b/node_modules/depd/index.js @@ -0,0 +1,521 @@ +/*! + * depd + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var callSiteToString = require('./lib/compat').callSiteToString +var eventListenerCount = require('./lib/compat').eventListenerCount +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace(str, namespace) { + var val = str.split(/[ ,]+/) + + namespace = String(namespace).toLowerCase() + + for (var i = 0 ; i < val.length; i++) { + if (!(str = val[i])) continue; + + // namespace contained + if (str === '*' || str.toLowerCase() === namespace) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor(obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter() { return value } + + if (descriptor.writable) { + descriptor.set = function setter(val) { return value = val } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString(arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString(stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + callSiteToString(stack[i]) + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd(namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate(message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if namespace is ignored. + */ + +function isignored(namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced(namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log(message, site) { + var haslisteners = eventListenerCount(process, 'deprecation') !== 0 + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + callSite = callSiteLocation(stack[1]) + callSite.name = site.name + file = callSite[0] + } else { + // get call site + i = 2 + site = callSiteLocation(stack[i]) + callSite = site + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? site.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + if (!message) { + message = callSite === site || !callSite.name + ? defaultMessage(site) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, message, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var msg = format.call(this, message, caller, stack.slice(i)) + process.stderr.write(msg + '\n', 'utf8') + + return +} + +/** + * Get call site location as array. + */ + +function callSiteLocation(callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage(site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain(msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + callSiteToString(stack[i]) + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor(msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' // bold cyan + + ' \x1b[33;1mdeprecated\x1b[22;39m' // bold yellow + + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation(callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack() { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace(obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction(fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + var deprecatedfn = eval('(function (' + args + ') {\n' + + '"use strict"\n' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '})') + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty(obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter() { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter() { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError(namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return stackString = createStackString.call(this, stack) + }, + set: function setter(val) { + stackString = val + } + }) + + return error +} diff --git a/node_modules/depd/lib/browser/index.js b/node_modules/depd/lib/browser/index.js new file mode 100644 index 0000000..f464e05 --- /dev/null +++ b/node_modules/depd/lib/browser/index.js @@ -0,0 +1,79 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd(namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate(message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction(fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty(obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + return +} diff --git a/node_modules/depd/lib/compat/buffer-concat.js b/node_modules/depd/lib/compat/buffer-concat.js new file mode 100644 index 0000000..4b73381 --- /dev/null +++ b/node_modules/depd/lib/compat/buffer-concat.js @@ -0,0 +1,35 @@ +/*! + * depd + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = bufferConcat + +/** + * Concatenate an array of Buffers. + */ + +function bufferConcat(bufs) { + var length = 0 + + for (var i = 0, len = bufs.length; i < len; i++) { + length += bufs[i].length + } + + var buf = new Buffer(length) + var pos = 0 + + for (var i = 0, len = bufs.length; i < len; i++) { + bufs[i].copy(buf, pos) + pos += bufs[i].length + } + + return buf +} diff --git a/node_modules/depd/lib/compat/callsite-tostring.js b/node_modules/depd/lib/compat/callsite-tostring.js new file mode 100644 index 0000000..9ecef34 --- /dev/null +++ b/node_modules/depd/lib/compat/callsite-tostring.js @@ -0,0 +1,103 @@ +/*! + * depd + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = callSiteToString + +/** + * Format a CallSite file location to a string. + */ + +function callSiteFileLocation(callSite) { + var fileName + var fileLocation = '' + + if (callSite.isNative()) { + fileLocation = 'native' + } else if (callSite.isEval()) { + fileName = callSite.getScriptNameOrSourceURL() + if (!fileName) { + fileLocation = callSite.getEvalOrigin() + } + } else { + fileName = callSite.getFileName() + } + + if (fileName) { + fileLocation += fileName + + var lineNumber = callSite.getLineNumber() + if (lineNumber != null) { + fileLocation += ':' + lineNumber + + var columnNumber = callSite.getColumnNumber() + if (columnNumber) { + fileLocation += ':' + columnNumber + } + } + } + + return fileLocation || 'unknown source' +} + +/** + * Format a CallSite to a string. + */ + +function callSiteToString(callSite) { + var addSuffix = true + var fileLocation = callSiteFileLocation(callSite) + var functionName = callSite.getFunctionName() + var isConstructor = callSite.isConstructor() + var isMethodCall = !(callSite.isToplevel() || isConstructor) + var line = '' + + if (isMethodCall) { + var methodName = callSite.getMethodName() + var typeName = getConstructorName(callSite) + + if (functionName) { + if (typeName && functionName.indexOf(typeName) !== 0) { + line += typeName + '.' + } + + line += functionName + + if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) { + line += ' [as ' + methodName + ']' + } + } else { + line += typeName + '.' + (methodName || '') + } + } else if (isConstructor) { + line += 'new ' + (functionName || '') + } else if (functionName) { + line += functionName + } else { + addSuffix = false + line += fileLocation + } + + if (addSuffix) { + line += ' (' + fileLocation + ')' + } + + return line +} + +/** + * Get constructor name of reviver. + */ + +function getConstructorName(obj) { + var receiver = obj.receiver + return (receiver.constructor && receiver.constructor.name) || null +} diff --git a/node_modules/depd/lib/compat/event-listener-count.js b/node_modules/depd/lib/compat/event-listener-count.js new file mode 100644 index 0000000..a05fceb --- /dev/null +++ b/node_modules/depd/lib/compat/event-listener-count.js @@ -0,0 +1,22 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = eventListenerCount + +/** + * Get the count of listeners on an event emitter of a specific type. + */ + +function eventListenerCount(emitter, type) { + return emitter.listeners(type).length +} diff --git a/node_modules/depd/lib/compat/index.js b/node_modules/depd/lib/compat/index.js new file mode 100644 index 0000000..aa3c1de --- /dev/null +++ b/node_modules/depd/lib/compat/index.js @@ -0,0 +1,84 @@ +/*! + * depd + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Buffer = require('buffer') +var EventEmitter = require('events').EventEmitter + +/** + * Module exports. + * @public + */ + +lazyProperty(module.exports, 'bufferConcat', function bufferConcat() { + return Buffer.concat || require('./buffer-concat') +}) + +lazyProperty(module.exports, 'callSiteToString', function callSiteToString() { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + function prepareObjectStackTrace(obj, stack) { + return stack + } + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = 2 + + // capture the stack + Error.captureStackTrace(obj) + + // slice the stack + var stack = obj.stack.slice() + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack[0].toString ? toString : require('./callsite-tostring') +}) + +lazyProperty(module.exports, 'eventListenerCount', function eventListenerCount() { + return EventEmitter.listenerCount || require('./event-listener-count') +}) + +/** + * Define a lazy property. + */ + +function lazyProperty(obj, prop, getter) { + function get() { + var val = getter() + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + value: val + }) + + return val + } + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + get: get + }) +} + +/** + * Call toString() on the obj + */ + +function toString(obj) { + return obj.toString() +} diff --git a/node_modules/depd/package.json b/node_modules/depd/package.json new file mode 100644 index 0000000..577ba31 --- /dev/null +++ b/node_modules/depd/package.json @@ -0,0 +1,102 @@ +{ + "_args": [ + [ + { + "raw": "depd@~1.1.0", + "scope": null, + "escapedName": "depd", + "name": "depd", + "rawSpec": "~1.1.0", + "spec": ">=1.1.0 <1.2.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "depd@>=1.1.0 <1.2.0", + "_id": "depd@1.1.0", + "_inCache": true, + "_location": "/depd", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "depd@~1.1.0", + "scope": null, + "escapedName": "depd", + "name": "depd", + "rawSpec": "~1.1.0", + "spec": ">=1.1.0 <1.2.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/depd/-/depd-1.1.0.tgz", + "_shasum": "e1bd82c6aab6ced965b97b88b17ed3e528ca18c3", + "_shrinkwrap": null, + "_spec": "depd@~1.1.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "browser": "lib/browser/index.js", + "bugs": { + "url": "https://github.com/dougwilson/nodejs-depd/issues" + }, + "dependencies": {}, + "description": "Deprecate all the things", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "1.0.0", + "istanbul": "0.3.5", + "mocha": "~1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "e1bd82c6aab6ced965b97b88b17ed3e528ca18c3", + "tarball": "https://registry.npmjs.org/depd/-/depd-1.1.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "gitHead": "78c659de20283e3a6bee92bda455e6daff01686a", + "homepage": "https://github.com/dougwilson/nodejs-depd", + "keywords": [ + "deprecate", + "deprecated" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "depd", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/dougwilson/nodejs-depd.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/" + }, + "version": "1.1.0" +} diff --git a/node_modules/destroy/LICENSE b/node_modules/destroy/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/destroy/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/destroy/README.md b/node_modules/destroy/README.md new file mode 100644 index 0000000..6474bc3 --- /dev/null +++ b/node_modules/destroy/README.md @@ -0,0 +1,60 @@ +# Destroy + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream) + +Destroy the given stream. In most cases, this is identical to a simple +`stream.destroy()` call. The rules are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is not an instance of `Stream`, then nothing happens. + 3. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[travis-image]: https://img.shields.io/travis/stream-utils/destroy.svg?style=flat-square +[travis-url]: https://travis-ci.org/stream-utils/destroy +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/destroy/index.js b/node_modules/destroy/index.js new file mode 100644 index 0000000..6da2d26 --- /dev/null +++ b/node_modules/destroy/index.js @@ -0,0 +1,75 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var ReadStream = require('fs').ReadStream +var Stream = require('stream') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy a stream. + * + * @param {object} stream + * @public + */ + +function destroy(stream) { + if (stream instanceof ReadStream) { + return destroyReadStream(stream) + } + + if (!(stream instanceof Stream)) { + return stream + } + + if (typeof stream.destroy === 'function') { + stream.destroy() + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream(stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } + + return stream +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose() { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/node_modules/destroy/package.json b/node_modules/destroy/package.json new file mode 100644 index 0000000..32099d7 --- /dev/null +++ b/node_modules/destroy/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + { + "raw": "destroy@~1.0.4", + "scope": null, + "escapedName": "destroy", + "name": "destroy", + "rawSpec": "~1.0.4", + "spec": ">=1.0.4 <1.1.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/send" + ] + ], + "_from": "destroy@>=1.0.4 <1.1.0", + "_id": "destroy@1.0.4", + "_inCache": true, + "_location": "/destroy", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "destroy@~1.0.4", + "scope": null, + "escapedName": "destroy", + "name": "destroy", + "rawSpec": "~1.0.4", + "spec": ">=1.0.4 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "_shasum": "978857442c44749e4206613e37946205826abd80", + "_shrinkwrap": null, + "_spec": "destroy@~1.0.4", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/send", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/destroy/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "destroy a stream if possible", + "devDependencies": { + "istanbul": "0.4.2", + "mocha": "2.3.4" + }, + "directories": {}, + "dist": { + "shasum": "978857442c44749e4206613e37946205826abd80", + "tarball": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz" + }, + "files": [ + "index.js", + "LICENSE" + ], + "gitHead": "86edea01456f5fa1027f6a47250c34c713cbcc3b", + "homepage": "https://github.com/stream-utils/destroy", + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ], + "license": "MIT", + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "destroy", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/destroy.git" + }, + "scripts": { + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.0.4" +} diff --git a/node_modules/ee-first/LICENSE b/node_modules/ee-first/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/ee-first/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/ee-first/README.md b/node_modules/ee-first/README.md new file mode 100644 index 0000000..cbd2478 --- /dev/null +++ b/node_modules/ee-first/README.md @@ -0,0 +1,80 @@ +# EE First + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Get the first event in a set of event emitters and event pairs, +then clean up after itself. + +## Install + +```sh +$ npm install ee-first +``` + +## API + +```js +var first = require('ee-first') +``` + +### first(arr, listener) + +Invoke `listener` on the first event from the list specified in `arr`. `arr` is +an array of arrays, with each array in the format `[ee, ...event]`. `listener` +will be called only once, the first time any of the given events are emitted. If +`error` is one of the listened events, then if that fires first, the `listener` +will be given the `err` argument. + +The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the +first argument emitted from an `error` event, if applicable; `ee` is the event +emitter that fired; `event` is the string event name that fired; and `args` is an +array of the arguments that were emitted on the event. + +```js +var ee1 = new EventEmitter() +var ee2 = new EventEmitter() + +first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) +``` + +#### .cancel() + +The group of listeners can be cancelled before being invoked and have all the event +listeners removed from the underlying event emitters. + +```js +var thunk = first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) + +// cancel and clean up +thunk.cancel() +``` + +[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square +[npm-url]: https://npmjs.org/package/ee-first +[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square +[github-url]: https://github.com/jonathanong/ee-first/tags +[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square +[travis-url]: https://travis-ci.org/jonathanong/ee-first +[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master +[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/ee-first +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/ee-first/index.js b/node_modules/ee-first/index.js new file mode 100644 index 0000000..501287c --- /dev/null +++ b/node_modules/ee-first/index.js @@ -0,0 +1,95 @@ +/*! + * ee-first + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = first + +/** + * Get the first event in a set of event emitters and event pairs. + * + * @param {array} stuff + * @param {function} done + * @public + */ + +function first(stuff, done) { + if (!Array.isArray(stuff)) + throw new TypeError('arg must be an array of [ee, events...] arrays') + + var cleanups = [] + + for (var i = 0; i < stuff.length; i++) { + var arr = stuff[i] + + if (!Array.isArray(arr) || arr.length < 2) + throw new TypeError('each array member must be [ee, events...]') + + var ee = arr[0] + + for (var j = 1; j < arr.length; j++) { + var event = arr[j] + var fn = listener(event, callback) + + // listen to the event + ee.on(event, fn) + // push this listener to the list of cleanups + cleanups.push({ + ee: ee, + event: event, + fn: fn, + }) + } + } + + function callback() { + cleanup() + done.apply(null, arguments) + } + + function cleanup() { + var x + for (var i = 0; i < cleanups.length; i++) { + x = cleanups[i] + x.ee.removeListener(x.event, x.fn) + } + } + + function thunk(fn) { + done = fn + } + + thunk.cancel = cleanup + + return thunk +} + +/** + * Create the event listener. + * @private + */ + +function listener(event, done) { + return function onevent(arg1) { + var args = new Array(arguments.length) + var ee = this + var err = event === 'error' + ? arg1 + : null + + // copy args to prevent arguments escaping scope + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + done(err, ee, event, args) + } +} diff --git a/node_modules/ee-first/package.json b/node_modules/ee-first/package.json new file mode 100644 index 0000000..902c5b5 --- /dev/null +++ b/node_modules/ee-first/package.json @@ -0,0 +1,98 @@ +{ + "_args": [ + [ + { + "raw": "ee-first@1.1.1", + "scope": null, + "escapedName": "ee-first", + "name": "ee-first", + "rawSpec": "1.1.1", + "spec": "1.1.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/on-finished" + ] + ], + "_from": "ee-first@1.1.1", + "_id": "ee-first@1.1.1", + "_inCache": true, + "_location": "/ee-first", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "ee-first@1.1.1", + "scope": null, + "escapedName": "ee-first", + "name": "ee-first", + "rawSpec": "1.1.1", + "spec": "1.1.1", + "type": "version" + }, + "_requiredBy": [ + "/on-finished" + ], + "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "_shasum": "590c61156b0ae2f4f0255732a158b266bc56b21d", + "_shrinkwrap": null, + "_spec": "ee-first@1.1.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/on-finished", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/jonathanong/ee-first/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "return the first event in a set of ee/event pairs", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "directories": {}, + "dist": { + "shasum": "590c61156b0ae2f4f0255732a158b266bc56b21d", + "tarball": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz" + }, + "files": [ + "index.js", + "LICENSE" + ], + "gitHead": "512e0ce4cc3643f603708f965a97b61b1a9c0441", + "homepage": "https://github.com/jonathanong/ee-first", + "license": "MIT", + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "ee-first", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jonathanong/ee-first.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.1" +} diff --git a/node_modules/encodeurl/HISTORY.md b/node_modules/encodeurl/HISTORY.md new file mode 100644 index 0000000..06d34a5 --- /dev/null +++ b/node_modules/encodeurl/HISTORY.md @@ -0,0 +1,9 @@ +1.0.1 / 2016-06-09 +================== + + * Fix encoding unpaired surrogates at start/end of string + +1.0.0 / 2016-06-08 +================== + + * Initial release diff --git a/node_modules/encodeurl/LICENSE b/node_modules/encodeurl/LICENSE new file mode 100644 index 0000000..8812229 --- /dev/null +++ b/node_modules/encodeurl/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/encodeurl/README.md b/node_modules/encodeurl/README.md new file mode 100644 index 0000000..b086133 --- /dev/null +++ b/node_modules/encodeurl/README.md @@ -0,0 +1,124 @@ +# encodeurl + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Encode a URL to a percent-encoded form, excluding already-encoded sequences + +## Installation + +```sh +$ npm install encodeurl +``` + +## API + +```js +var encodeUrl = require('encodeurl') +``` + +### encodeUrl(url) + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +This function will take an already-encoded URL and encode all the non-URL +code points (as UTF-8 byte sequences). This function will not encode the +"%" character unless it is not part of a valid sequence (`%20` will be +left as-is, but `%foo` will be encoded as `%25foo`). + +This encode is meant to be "safe" and does not throw errors. It will try as +hard as it can to properly encode the given URL, including replacing any raw, +unpaired surrogate pairs with the Unicode replacement character prior to +encoding. + +This function is _similar_ to the intrinsic function `encodeURI`, except it +will not encode the `%` character if that is part of a valid sequence, will +not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired +surrogate pairs with the Unicode replacement character (instead of throwing). + +## Examples + +### Encode a URL containing user-controled data + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') + +http.createServer(function onRequest (req, res) { + // get encoded form of inbound url + var url = encodeUrl(req.url) + + // create html message + var body = '

Location ' + escapeHtml(url) + ' not found

' + + // send a 404 + res.statusCode = 404 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.end(body, 'utf-8') +}) +``` + +### Encode a URL for use in a header field + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var url = require('url') + +http.createServer(function onRequest (req, res) { + // parse inbound url + var href = url.parse(req) + + // set new host for redirect + href.host = 'localhost' + href.protocol = 'https:' + href.slashes = true + + // create location header + var location = encodeUrl(url.format(href)) + + // create html message + var body = '

Redirecting to new site: ' + escapeHtml(location) + '

' + + // send a 301 + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.setHeader('Location', location) + res.end(body, 'utf-8') +}) +``` + +## Testing + +```sh +$ npm test +$ npm run lint +``` + +## References + +- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986] +- [WHATWG URL Living Standard][whatwg-url] + +[rfc-3986]: https://tools.ietf.org/html/rfc3986 +[whatwg-url]: https://url.spec.whatwg.org/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/encodeurl.svg +[npm-url]: https://npmjs.org/package/encodeurl +[node-version-image]: https://img.shields.io/node/v/encodeurl.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg +[travis-url]: https://travis-ci.org/pillarjs/encodeurl +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master +[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg +[downloads-url]: https://npmjs.org/package/encodeurl diff --git a/node_modules/encodeurl/index.js b/node_modules/encodeurl/index.js new file mode 100644 index 0000000..ae77cc9 --- /dev/null +++ b/node_modules/encodeurl/index.js @@ -0,0 +1,60 @@ +/*! + * encodeurl + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = encodeUrl + +/** + * RegExp to match non-URL code points, *after* encoding (i.e. not including "%") + * and including invalid escape sequences. + * @private + */ + +var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]))+/g + +/** + * RegExp to match unmatched surrogate pair. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g + +/** + * String to replace unmatched surrogate pair with. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2' + +/** + * Encode a URL to a percent-encoded form, excluding already-encoded sequences. + * + * This function will take an already-encoded URL and encode all the non-URL + * code points. This function will not encode the "%" character unless it is + * not part of a valid sequence (`%20` will be left as-is, but `%foo` will + * be encoded as `%25foo`). + * + * This encode is meant to be "safe" and does not throw errors. It will try as + * hard as it can to properly encode the given URL, including replacing any raw, + * unpaired surrogate pairs with the Unicode replacement character prior to + * encoding. + * + * @param {string} url + * @return {string} + * @public + */ + +function encodeUrl (url) { + return String(url) + .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE) + .replace(ENCODE_CHARS_REGEXP, encodeURI) +} diff --git a/node_modules/encodeurl/package.json b/node_modules/encodeurl/package.json new file mode 100644 index 0000000..f8c2700 --- /dev/null +++ b/node_modules/encodeurl/package.json @@ -0,0 +1,111 @@ +{ + "_args": [ + [ + { + "raw": "encodeurl@~1.0.1", + "scope": null, + "escapedName": "encodeurl", + "name": "encodeurl", + "rawSpec": "~1.0.1", + "spec": ">=1.0.1 <1.1.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "encodeurl@>=1.0.1 <1.1.0", + "_id": "encodeurl@1.0.1", + "_inCache": true, + "_location": "/encodeurl", + "_nodeVersion": "4.4.3", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/encodeurl-1.0.1.tgz_1465519736251_0.09314409433864057" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.1", + "_phantomChildren": {}, + "_requested": { + "raw": "encodeurl@~1.0.1", + "scope": null, + "escapedName": "encodeurl", + "name": "encodeurl", + "rawSpec": "~1.0.1", + "spec": ">=1.0.1 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/send", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.1.tgz", + "_shasum": "79e3d58655346909fe6f0f45a5de68103b294d20", + "_shrinkwrap": null, + "_spec": "encodeurl@~1.0.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/pillarjs/encodeurl/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences", + "devDependencies": { + "eslint": "2.11.1", + "eslint-config-standard": "5.3.1", + "eslint-plugin-promise": "1.3.2", + "eslint-plugin-standard": "1.3.2", + "istanbul": "0.4.3", + "mocha": "2.5.3" + }, + "directories": {}, + "dist": { + "shasum": "79e3d58655346909fe6f0f45a5de68103b294d20", + "tarball": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.1.tgz" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "39ed0c235fed4cea7d012038fd6bb0480561d226", + "homepage": "https://github.com/pillarjs/encodeurl#readme", + "keywords": [ + "encode", + "encodeurl", + "url" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "encodeurl", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/encodeurl.git" + }, + "scripts": { + "lint": "eslint **/*.js", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.1" +} diff --git a/node_modules/escape-html/LICENSE b/node_modules/escape-html/LICENSE new file mode 100644 index 0000000..2e70de9 --- /dev/null +++ b/node_modules/escape-html/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2013 TJ Holowaychuk +Copyright (c) 2015 Andreas Lubbe +Copyright (c) 2015 Tiancheng "Timothy" Gu + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/escape-html/Readme.md b/node_modules/escape-html/Readme.md new file mode 100644 index 0000000..653d9ea --- /dev/null +++ b/node_modules/escape-html/Readme.md @@ -0,0 +1,43 @@ + +# escape-html + + Escape string for use in HTML + +## Example + +```js +var escape = require('escape-html'); +var html = escape('foo & bar'); +// -> foo & bar +``` + +## Benchmark + +``` +$ npm run-script bench + +> escape-html@1.0.3 bench nodejs-escape-html +> node benchmark/index.js + + + http_parser@1.0 + node@0.10.33 + v8@3.14.5.9 + ares@1.9.0-DEV + uv@0.10.29 + zlib@1.2.3 + modules@11 + openssl@1.0.1j + + 1 test completed. + 2 tests completed. + 3 tests completed. + + no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled) + single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled) + many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled) +``` + +## License + + MIT \ No newline at end of file diff --git a/node_modules/escape-html/index.js b/node_modules/escape-html/index.js new file mode 100644 index 0000000..bf9e226 --- /dev/null +++ b/node_modules/escape-html/index.js @@ -0,0 +1,78 @@ +/*! + * escape-html + * Copyright(c) 2012-2013 TJ Holowaychuk + * Copyright(c) 2015 Andreas Lubbe + * Copyright(c) 2015 Tiancheng "Timothy" Gu + * MIT Licensed + */ + +'use strict'; + +/** + * Module variables. + * @private + */ + +var matchHtmlRegExp = /["'&<>]/; + +/** + * Module exports. + * @public + */ + +module.exports = escapeHtml; + +/** + * Escape special characters in the given string of html. + * + * @param {string} string The string to escape for inserting into HTML + * @return {string} + * @public + */ + +function escapeHtml(string) { + var str = '' + string; + var match = matchHtmlRegExp.exec(str); + + if (!match) { + return str; + } + + var escape; + var html = ''; + var index = 0; + var lastIndex = 0; + + for (index = match.index; index < str.length; index++) { + switch (str.charCodeAt(index)) { + case 34: // " + escape = '"'; + break; + case 38: // & + escape = '&'; + break; + case 39: // ' + escape = '''; + break; + case 60: // < + escape = '<'; + break; + case 62: // > + escape = '>'; + break; + default: + continue; + } + + if (lastIndex !== index) { + html += str.substring(lastIndex, index); + } + + lastIndex = index + 1; + html += escape; + } + + return lastIndex !== index + ? html + str.substring(lastIndex, index) + : html; +} diff --git a/node_modules/escape-html/package.json b/node_modules/escape-html/package.json new file mode 100644 index 0000000..fe911cd --- /dev/null +++ b/node_modules/escape-html/package.json @@ -0,0 +1,94 @@ +{ + "_args": [ + [ + { + "raw": "escape-html@~1.0.3", + "scope": null, + "escapedName": "escape-html", + "name": "escape-html", + "rawSpec": "~1.0.3", + "spec": ">=1.0.3 <1.1.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "escape-html@>=1.0.3 <1.1.0", + "_id": "escape-html@1.0.3", + "_inCache": true, + "_location": "/escape-html", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "escape-html@~1.0.3", + "scope": null, + "escapedName": "escape-html", + "name": "escape-html", + "rawSpec": "~1.0.3", + "spec": ">=1.0.3 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "_shasum": "0258eae4d3d0c0974de1c169188ef0051d1d1988", + "_shrinkwrap": null, + "_spec": "escape-html@~1.0.3", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/component/escape-html/issues" + }, + "dependencies": {}, + "description": "Escape string for use in HTML", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "1.0.0" + }, + "directories": {}, + "dist": { + "shasum": "0258eae4d3d0c0974de1c169188ef0051d1d1988", + "tarball": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz" + }, + "files": [ + "LICENSE", + "Readme.md", + "index.js" + ], + "gitHead": "7ac2ea3977fcac3d4c5be8d2a037812820c65f28", + "homepage": "https://github.com/component/escape-html", + "keywords": [ + "escape", + "html", + "utility" + ], + "license": "MIT", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "escape-html", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/component/escape-html.git" + }, + "scripts": { + "bench": "node benchmark/index.js" + }, + "version": "1.0.3" +} diff --git a/node_modules/etag/HISTORY.md b/node_modules/etag/HISTORY.md new file mode 100644 index 0000000..bd0f26d --- /dev/null +++ b/node_modules/etag/HISTORY.md @@ -0,0 +1,71 @@ +1.7.0 / 2015-06-08 +================== + + * Always include entity length in ETags for hash length extensions + * Generate non-Stats ETags using MD5 only (no longer CRC32) + * Improve stat performance by removing hashing + * Remove base64 padding in ETags to shorten + * Use MD5 instead of MD4 in weak ETags over 1KB + +1.6.0 / 2015-05-10 +================== + + * Improve support for JXcore + * Remove requirement of `atime` in the stats object + * Support "fake" stats objects in environments without `fs` + +1.5.1 / 2014-11-19 +================== + + * deps: crc@3.2.1 + - Minor fixes + +1.5.0 / 2014-10-14 +================== + + * Improve string performance + * Slightly improve speed for weak ETags over 1KB + +1.4.0 / 2014-09-21 +================== + + * Support "fake" stats objects + * Support Node.js 0.6 + +1.3.1 / 2014-09-14 +================== + + * Use the (new and improved) `crc` for crc32 + +1.3.0 / 2014-08-29 +================== + + * Default strings to strong ETags + * Improve speed for weak ETags over 1KB + +1.2.1 / 2014-08-29 +================== + + * Use the (much faster) `buffer-crc32` for crc32 + +1.2.0 / 2014-08-24 +================== + + * Add support for file stat objects + +1.1.0 / 2014-08-24 +================== + + * Add fast-path for empty entity + * Add weak ETag generation + * Shrink size of generated ETags + +1.0.1 / 2014-08-24 +================== + + * Fix behavior of string containing Unicode + +1.0.0 / 2014-05-18 +================== + + * Initial release diff --git a/node_modules/etag/LICENSE b/node_modules/etag/LICENSE new file mode 100644 index 0000000..142ede3 --- /dev/null +++ b/node_modules/etag/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/etag/README.md b/node_modules/etag/README.md new file mode 100644 index 0000000..8da9e05 --- /dev/null +++ b/node_modules/etag/README.md @@ -0,0 +1,165 @@ +# etag + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create simple ETags + +## Installation + +```sh +$ npm install etag +``` + +## API + +```js +var etag = require('etag') +``` + +### etag(entity, [options]) + +Generate a strong ETag for the given entity. This should be the complete +body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By +default, a strong ETag is generated except for `fs.Stats`, which will +generate a weak ETag (this can be overwritten by `options.weak`). + +```js +res.setHeader('ETag', etag(body)) +``` + +#### Options + +`etag` accepts these properties in the options object. + +##### weak + +Specifies if the generated ETag will include the weak validator mark (that +is, the leading `W/`). The actual entity tag is the same. The default value +is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`. + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +```bash +$ npm run-script bench + +> etag@1.6.0 bench nodejs-etag +> node benchmark/index.js + + http_parser@1.0 + node@0.10.33 + v8@3.14.5.9 + ares@1.9.0-DEV + uv@0.10.29 + zlib@1.2.3 + modules@11 + openssl@1.0.1j + +> node benchmark/body0-100b.js + + 100B body + + 1 test completed. + 2 tests completed. + 3 tests completed. + 4 tests completed. + +* buffer - strong x 289,198 ops/sec ±1.09% (190 runs sampled) +* buffer - weak x 287,838 ops/sec ±0.91% (189 runs sampled) +* string - strong x 284,586 ops/sec ±1.05% (192 runs sampled) +* string - weak x 287,439 ops/sec ±0.82% (192 runs sampled) + +> node benchmark/body1-1kb.js + + 1KB body + + 1 test completed. + 2 tests completed. + 3 tests completed. + 4 tests completed. + +* buffer - strong x 212,423 ops/sec ±0.75% (193 runs sampled) +* buffer - weak x 211,871 ops/sec ±0.74% (194 runs sampled) + string - strong x 205,291 ops/sec ±0.86% (194 runs sampled) + string - weak x 208,463 ops/sec ±0.79% (192 runs sampled) + +> node benchmark/body2-5kb.js + + 5KB body + + 1 test completed. + 2 tests completed. + 3 tests completed. + 4 tests completed. + +* buffer - strong x 92,901 ops/sec ±0.58% (195 runs sampled) +* buffer - weak x 93,045 ops/sec ±0.65% (192 runs sampled) + string - strong x 89,621 ops/sec ±0.68% (194 runs sampled) + string - weak x 90,070 ops/sec ±0.70% (196 runs sampled) + +> node benchmark/body3-10kb.js + + 10KB body + + 1 test completed. + 2 tests completed. + 3 tests completed. + 4 tests completed. + +* buffer - strong x 54,220 ops/sec ±0.85% (192 runs sampled) +* buffer - weak x 54,069 ops/sec ±0.83% (191 runs sampled) + string - strong x 53,078 ops/sec ±0.53% (194 runs sampled) + string - weak x 53,849 ops/sec ±0.47% (197 runs sampled) + +> node benchmark/body4-100kb.js + + 100KB body + + 1 test completed. + 2 tests completed. + 3 tests completed. + 4 tests completed. + +* buffer - strong x 6,673 ops/sec ±0.15% (197 runs sampled) +* buffer - weak x 6,716 ops/sec ±0.12% (198 runs sampled) + string - strong x 6,357 ops/sec ±0.14% (197 runs sampled) + string - weak x 6,344 ops/sec ±0.21% (197 runs sampled) + +> node benchmark/stats.js + + stats + + 1 test completed. + 2 tests completed. + 3 tests completed. + 4 tests completed. + +* real - strong x 1,671,989 ops/sec ±0.13% (197 runs sampled) +* real - weak x 1,681,297 ops/sec ±0.12% (198 runs sampled) + fake - strong x 927,063 ops/sec ±0.14% (198 runs sampled) + fake - weak x 914,461 ops/sec ±0.41% (191 runs sampled) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/etag.svg +[npm-url]: https://npmjs.org/package/etag +[node-version-image]: https://img.shields.io/node/v/etag.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg +[travis-url]: https://travis-ci.org/jshttp/etag +[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master +[downloads-image]: https://img.shields.io/npm/dm/etag.svg +[downloads-url]: https://npmjs.org/package/etag diff --git a/node_modules/etag/index.js b/node_modules/etag/index.js new file mode 100644 index 0000000..b582c84 --- /dev/null +++ b/node_modules/etag/index.js @@ -0,0 +1,132 @@ +/*! + * etag + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = etag + +/** + * Module dependencies. + * @private + */ + +var crypto = require('crypto') +var Stats = require('fs').Stats + +/** + * Module variables. + * @private + */ + +var base64PadCharRegExp = /=+$/ +var toString = Object.prototype.toString + +/** + * Generate an entity tag. + * + * @param {Buffer|string} entity + * @return {string} + * @private + */ + +function entitytag(entity) { + if (entity.length === 0) { + // fast-path empty + return '"0-1B2M2Y8AsgTpgAmY7PhCfg"' + } + + // compute hash of entity + var hash = crypto + .createHash('md5') + .update(entity, 'utf8') + .digest('base64') + .replace(base64PadCharRegExp, '') + + // compute length of entity + var len = typeof entity === 'string' + ? Buffer.byteLength(entity, 'utf8') + : entity.length + + return '"' + len.toString(16) + '-' + hash + '"' +} + +/** + * Create a simple ETag. + * + * @param {string|Buffer|Stats} entity + * @param {object} [options] + * @param {boolean} [options.weak] + * @return {String} + * @public + */ + +function etag(entity, options) { + if (entity == null) { + throw new TypeError('argument entity is required') + } + + // support fs.Stats object + var isStats = isstats(entity) + var weak = options && typeof options.weak === 'boolean' + ? options.weak + : isStats + + // validate argument + if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) { + throw new TypeError('argument entity must be string, Buffer, or fs.Stats') + } + + // generate entity tag + var tag = isStats + ? stattag(entity) + : entitytag(entity) + + return weak + ? 'W/' + tag + : tag +} + +/** + * Determine if object is a Stats object. + * + * @param {object} obj + * @return {boolean} + * @api private + */ + +function isstats(obj) { + // genuine fs.Stats + if (typeof Stats === 'function' && obj instanceof Stats) { + return true + } + + // quack quack + return obj && typeof obj === 'object' + && 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' + && 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' + && 'ino' in obj && typeof obj.ino === 'number' + && 'size' in obj && typeof obj.size === 'number' +} + +/** + * Generate a tag for a stat. + * + * @param {object} stat + * @return {string} + * @private + */ + +function stattag(stat) { + var mtime = stat.mtime.getTime().toString(16) + var size = stat.size.toString(16) + + return '"' + size + '-' + mtime + '"' +} diff --git a/node_modules/etag/package.json b/node_modules/etag/package.json new file mode 100644 index 0000000..73d5e32 --- /dev/null +++ b/node_modules/etag/package.json @@ -0,0 +1,108 @@ +{ + "_args": [ + [ + { + "raw": "etag@~1.7.0", + "scope": null, + "escapedName": "etag", + "name": "etag", + "rawSpec": "~1.7.0", + "spec": ">=1.7.0 <1.8.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "etag@>=1.7.0 <1.8.0", + "_id": "etag@1.7.0", + "_inCache": true, + "_location": "/etag", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "etag@~1.7.0", + "scope": null, + "escapedName": "etag", + "name": "etag", + "rawSpec": "~1.7.0", + "spec": ">=1.7.0 <1.8.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/etag/-/etag-1.7.0.tgz", + "_shasum": "03d30b5f67dd6e632d2945d30d6652731a34d5d8", + "_shrinkwrap": null, + "_spec": "etag@~1.7.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/etag/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "David Björklund", + "email": "david.bjorklund@gmail.com" + } + ], + "dependencies": {}, + "description": "Create simple ETags", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "1.0.0", + "istanbul": "0.3.14", + "mocha": "~1.21.4", + "seedrandom": "2.3.11" + }, + "directories": {}, + "dist": { + "shasum": "03d30b5f67dd6e632d2945d30d6652731a34d5d8", + "tarball": "https://registry.npmjs.org/etag/-/etag-1.7.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "a511f5c8c930fd9546dbd88acb080f96bc788cfc", + "homepage": "https://github.com/jshttp/etag", + "keywords": [ + "etag", + "http", + "res" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "etag", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/etag.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.7.0" +} diff --git a/node_modules/express/History.md b/node_modules/express/History.md new file mode 100644 index 0000000..4a706a4 --- /dev/null +++ b/node_modules/express/History.md @@ -0,0 +1,3162 @@ +4.14.1 / 2017-01-28 +=================== + + * deps: content-disposition@0.5.2 + * deps: finalhandler@0.5.1 + - Fix exception when `err.headers` is not an object + - deps: statuses@~1.3.1 + - perf: hoist regular expressions + - perf: remove duplicate validation path + * deps: proxy-addr@~1.1.3 + - deps: ipaddr.js@1.2.0 + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + * deps: serve-static@~1.11.2 + - deps: send@0.14.2 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +4.14.0 / 2016-06-16 +=================== + + * Add `acceptRanges` option to `res.sendFile`/`res.sendfile` + * Add `cacheControl` option to `res.sendFile`/`res.sendfile` + * Add `options` argument to `req.range` + - Includes the `combine` option + * Encode URL in `res.location`/`res.redirect` if not already encoded + * Fix some redirect handling in `res.sendFile`/`res.sendfile` + * Fix Windows absolute path check using forward slashes + * Improve error with invalid arguments to `req.get()` + * Improve performance for `res.json`/`res.jsonp` in most cases + * Improve `Range` header handling in `res.sendFile`/`res.sendfile` + * deps: accepts@~1.3.3 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Many performance improvments + - deps: mime-types@~2.1.11 + - deps: negotiator@0.6.1 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: cookie@0.3.1 + - Add `sameSite` option + - Fix cookie `Max-Age` to never be a floating point number + - Improve error message when `encode` is not a function + - Improve error message when `expires` is not a `Date` + - Throw better error for invalid argument to parse + - Throw on invalid values provided to `serialize` + - perf: enable strict mode + - perf: hoist regular expression + - perf: use for loop in parse + - perf: use string concatination for serialization + * deps: finalhandler@0.5.0 + - Change invalid or non-numeric status code to 500 + - Overwrite status message to match set status code + - Prefer `err.statusCode` if `err.status` is invalid + - Set response headers from `err.headers` object + - Use `statuses` instead of `http` module for status messages + * deps: proxy-addr@~1.1.2 + - Fix accepting various invalid netmasks + - Fix IPv6-mapped IPv4 validation edge cases + - IPv4 netmasks must be contingous + - IPv6 addresses cannot be used as a netmask + - deps: ipaddr.js@1.1.1 + * deps: qs@6.2.0 + - Add `decoder` option in `parse` function + * deps: range-parser@~1.2.0 + - Add `combine` option to combine overlapping ranges + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: send@0.14.1 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Fix redirect error when `path` contains raw non-URL characters + - Fix redirect when `path` starts with multiple forward slashes + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + * deps: serve-static@~1.11.1 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Fix redirect error when `req.url` contains raw non-URL characters + - Ignore non-byte `Range` headers + - Use status code 301 for redirects + - deps: send@0.14.1 + * deps: type-is@~1.6.13 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.11 + * deps: vary@~1.1.0 + - Only accept valid field names in the `field` argument + * perf: use strict equality when possible + +4.13.4 / 2016-01-21 +=================== + + * deps: content-disposition@0.5.1 + - perf: enable strict mode + * deps: cookie@0.1.5 + - Throw on invalid values provided to `serialize` + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: finalhandler@0.4.1 + - deps: escape-html@~1.0.3 + * deps: merge-descriptors@1.0.1 + - perf: enable strict mode + * deps: methods@~1.1.2 + - perf: enable strict mode + * deps: parseurl@~1.3.1 + - perf: enable strict mode + * deps: proxy-addr@~1.0.10 + - deps: ipaddr.js@1.0.5 + - perf: enable strict mode + * deps: range-parser@~1.0.3 + - perf: enable strict mode + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + * deps: serve-static@~1.10.2 + - deps: escape-html@~1.0.3 + - deps: parseurl@~1.3.0 + - deps: send@0.13.1 + +4.13.3 / 2015-08-02 +=================== + + * Fix infinite loop condition using `mergeParams: true` + * Fix inner numeric indices incorrectly altering parent `req.params` + +4.13.2 / 2015-07-31 +=================== + + * deps: accepts@~1.2.12 + - deps: mime-types@~2.1.4 + * deps: array-flatten@1.1.1 + - perf: enable strict mode + * deps: path-to-regexp@0.1.7 + - Fix regression with escaped round brackets and matching groups + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +4.13.1 / 2015-07-05 +=================== + + * deps: accepts@~1.2.10 + - deps: mime-types@~2.1.2 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +4.13.0 / 2015-06-20 +=================== + + * Add settings to debug output + * Fix `res.format` error when only `default` provided + * Fix issue where `next('route')` in `app.param` would incorrectly skip values + * Fix hiding platform issues with `decodeURIComponent` + - Only `URIError`s are a 400 + * Fix using `*` before params in routes + * Fix using capture groups before params in routes + * Simplify `res.cookie` to call `res.append` + * Use `array-flatten` module for flattening arrays + * deps: accepts@~1.2.9 + - deps: mime-types@~2.1.1 + - perf: avoid argument reassignment & argument slice + - perf: avoid negotiator recursive construction + - perf: enable strict mode + - perf: remove unnecessary bitwise operator + * deps: cookie@0.1.3 + - perf: deduce the scope of try-catch deopt + - perf: remove argument reassignments + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Always include entity length in ETags for hash length extensions + - Generate non-Stats ETags using MD5 only (no longer CRC32) + - Improve stat performance by removing hashing + - Improve support for JXcore + - Remove base64 padding in ETags to shorten + - Support "fake" stats objects in environments without fs + - Use MD5 instead of MD4 in weak ETags over 1KB + * deps: finalhandler@0.4.0 + - Fix a false-positive when unpiping in Node.js 0.8 + - Support `statusCode` property on `Error` objects + - Use `unpipe` module for unpiping requests + - deps: escape-html@1.0.2 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: path-to-regexp@0.1.6 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * deps: serve-static@~1.10.0 + - Add `fallthrough` option + - Fix reading options from options prototype + - Improve the default redirect response headers + - Malformed URLs now `next()` instead of 400 + - deps: escape-html@1.0.2 + - deps: send@0.13.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: isolate `app.render` try block + * perf: remove argument reassignments in application + * perf: remove argument reassignments in request prototype + * perf: remove argument reassignments in response prototype + * perf: remove argument reassignments in routing + * perf: remove argument reassignments in `View` + * perf: skip attempting to decode zero length string + * perf: use saved reference to `http.STATUS_CODES` + +4.12.4 / 2015-05-17 +=================== + + * deps: accepts@~1.2.7 + - deps: mime-types@~2.0.11 + - deps: negotiator@0.5.3 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: finalhandler@0.3.6 + - deps: debug@~2.2.0 + - deps: on-finished@~2.2.1 + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + * deps: proxy-addr@~1.0.8 + - deps: ipaddr.js@1.0.1 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + * deps: serve-static@~1.9.3 + - deps: send@0.12.3 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +4.12.3 / 2015-03-17 +=================== + + * deps: accepts@~1.2.5 + - deps: mime-types@~2.0.10 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: finalhandler@0.3.4 + - deps: debug@~2.1.3 + * deps: proxy-addr@~1.0.7 + - deps: ipaddr.js@0.1.9 + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + * deps: serve-static@~1.9.2 + - deps: send@0.12.2 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +4.12.2 / 2015-03-02 +=================== + + * Fix regression where `"Request aborted"` is logged using `res.sendFile` + +4.12.1 / 2015-03-01 +=================== + + * Fix constructing application with non-configurable prototype properties + * Fix `ECONNRESET` errors from `res.sendFile` usage + * Fix `req.host` when using "trust proxy" hops count + * Fix `req.protocol`/`req.secure` when using "trust proxy" hops count + * Fix wrong `code` on aborted connections from `res.sendFile` + * deps: merge-descriptors@1.0.0 + +4.12.0 / 2015-02-23 +=================== + + * Fix `"trust proxy"` setting to inherit when app is mounted + * Generate `ETag`s for all request responses + - No longer restricted to only responses for `GET` and `HEAD` requests + * Use `content-type` to parse `Content-Type` headers + * deps: accepts@~1.2.4 + - Fix preference sorting to be stable for long acceptable lists + - deps: mime-types@~2.0.9 + - deps: negotiator@0.5.1 + * deps: cookie-signature@1.0.6 + * deps: send@0.12.1 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + * deps: serve-static@~1.9.1 + - deps: send@0.12.1 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +4.11.2 / 2015-02-01 +=================== + + * Fix `res.redirect` double-calling `res.end` for `HEAD` requests + * deps: accepts@~1.2.3 + - deps: mime-types@~2.0.8 + * deps: proxy-addr@~1.0.6 + - deps: ipaddr.js@0.1.8 + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +4.11.1 / 2015-01-20 +=================== + + * deps: send@0.11.1 + - Fix root path disclosure + * deps: serve-static@~1.8.1 + - Fix redirect loop in Node.js 0.11.14 + - Fix root path disclosure + - deps: send@0.11.1 + +4.11.0 / 2015-01-13 +=================== + + * Add `res.append(field, val)` to append headers + * Deprecate leading `:` in `name` for `app.param(name, fn)` + * Deprecate `req.param()` -- use `req.params`, `req.body`, or `req.query` instead + * Deprecate `app.param(fn)` + * Fix `OPTIONS` responses to include the `HEAD` method properly + * Fix `res.sendFile` not always detecting aborted connection + * Match routes iteratively to prevent stack overflows + * deps: accepts@~1.2.2 + - deps: mime-types@~2.0.7 + - deps: negotiator@0.5.0 + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + * deps: serve-static@~1.8.0 + - deps: send@0.11.0 + +4.10.8 / 2015-01-13 +=================== + + * Fix crash from error within `OPTIONS` response handler + * deps: proxy-addr@~1.0.5 + - deps: ipaddr.js@0.1.6 + +4.10.7 / 2015-01-04 +=================== + + * Fix `Allow` header for `OPTIONS` to not contain duplicate methods + * Fix incorrect "Request aborted" for `res.sendFile` when `HEAD` or 304 + * deps: debug@~2.1.1 + * deps: finalhandler@0.3.3 + - deps: debug@~2.1.1 + - deps: on-finished@~2.2.0 + * deps: methods@~1.1.1 + * deps: on-finished@~2.2.0 + * deps: serve-static@~1.7.2 + - Fix potential open redirect when mounted at root + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +4.10.6 / 2014-12-12 +=================== + + * Fix exception in `req.fresh`/`req.stale` without response headers + +4.10.5 / 2014-12-10 +=================== + + * Fix `res.send` double-calling `res.end` for `HEAD` requests + * deps: accepts@~1.1.4 + - deps: mime-types@~2.0.4 + * deps: type-is@~1.5.4 + - deps: mime-types@~2.0.4 + +4.10.4 / 2014-11-24 +=================== + + * Fix `res.sendfile` logging standard write errors + +4.10.3 / 2014-11-23 +=================== + + * Fix `res.sendFile` logging standard write errors + * deps: etag@~1.5.1 + * deps: proxy-addr@~1.0.4 + - deps: ipaddr.js@0.1.5 + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + +4.10.2 / 2014-11-09 +=================== + + * Correctly invoke async router callback asynchronously + * deps: accepts@~1.1.3 + - deps: mime-types@~2.0.3 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +4.10.1 / 2014-10-28 +=================== + + * Fix handling of URLs containing `://` in the path + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +4.10.0 / 2014-10-23 +=================== + + * Add support for `app.set('views', array)` + - Views are looked up in sequence in array of directories + * Fix `res.send(status)` to mention `res.sendStatus(status)` + * Fix handling of invalid empty URLs + * Use `content-disposition` module for `res.attachment`/`res.download` + - Sends standards-compliant `Content-Disposition` header + - Full Unicode support + * Use `path.resolve` in view lookup + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + * deps: finalhandler@0.3.2 + - Terminate in progress response only on error + - Use `on-finished` to determine request status + - deps: debug@~2.1.0 + - deps: on-finished@~2.1.1 + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: send@0.10.1 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + - deps: on-finished@~2.1.1 + * deps: serve-static@~1.7.1 + - deps: send@0.10.1 + +4.9.8 / 2014-10-17 +================== + + * Fix `res.redirect` body when redirect status specified + * deps: accepts@~1.1.2 + - Fix error when media type has invalid parameter + - deps: negotiator@0.4.9 + +4.9.7 / 2014-10-10 +================== + + * Fix using same param name in array of paths + +4.9.6 / 2014-10-08 +================== + + * deps: accepts@~1.1.1 + - deps: mime-types@~2.0.2 + - deps: negotiator@0.4.8 + * deps: serve-static@~1.6.4 + - Fix redirect loop when index file serving disabled + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +4.9.5 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + * deps: proxy-addr@~1.0.3 + - Use `forwarded` npm module + * deps: send@0.9.3 + - deps: etag@~1.4.0 + * deps: serve-static@~1.6.3 + - deps: send@0.9.3 + +4.9.4 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +4.9.3 / 2014-09-18 +================== + + * deps: proxy-addr@~1.0.2 + - Fix a global leak when multiple subnets are trusted + - deps: ipaddr.js@0.1.3 + +4.9.2 / 2014-09-17 +================== + + * Fix regression for empty string `path` in `app.use` + * Fix `router.use` to accept array of middleware without path + * Improve error message for bad `app.use` arguments + +4.9.1 / 2014-09-16 +================== + + * Fix `app.use` to accept array of middleware without path + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + * deps: serve-static@~1.6.2 + - deps: send@0.9.2 + +4.9.0 / 2014-09-08 +================== + + * Add `res.sendStatus` + * Invoke callback for sendfile when client aborts + - Applies to `res.sendFile`, `res.sendfile`, and `res.download` + - `err` will be populated with request aborted error + * Support IP address host in `req.subdomains` + * Use `etag` to generate `ETag` headers + * deps: accepts@~1.1.0 + - update `mime-types` + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + * deps: finalhandler@0.2.0 + - Set `X-Content-Type-Options: nosniff` header + - deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: range-parser@~1.0.2 + * deps: send@0.9.1 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + - deps: fresh@0.2.4 + * deps: serve-static@~1.6.1 + - Add `lastModified` option + - deps: send@0.9.1 + * deps: type-is@~1.5.1 + - fix `hasbody` to be true for `content-length: 0` + - deps: media-typer@0.3.0 + - deps: mime-types@~2.0.1 + * deps: vary@~1.0.0 + - Accept valid `Vary` header string as `field` + +4.8.8 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + * deps: serve-static@~1.5.4 + - deps: send@0.8.5 + +4.8.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +4.8.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +4.8.5 / 2014-08-18 +================== + + * deps: send@0.8.3 + - deps: destroy@1.0.3 + - deps: on-finished@2.1.0 + * deps: serve-static@~1.5.3 + - deps: send@0.8.3 + +4.8.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: serve-static@~1.5.2 + - deps: send@0.8.2 + +4.8.3 / 2014-08-10 +================== + + * deps: parseurl@~1.3.0 + * deps: qs@1.2.1 + * deps: serve-static@~1.5.1 + - Fix parsing of weird `req.originalUrl` values + - deps: parseurl@~1.3.0 + - deps: utils-merge@1.0.0 + +4.8.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +4.8.1 / 2014-08-06 +================== + + * fix incorrect deprecation warnings on `res.download` + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +4.8.0 / 2014-08-05 +================== + + * add `res.sendFile` + - accepts a file system path instead of a URL + - requires an absolute path or `root` option specified + * deprecate `res.sendfile` -- use `res.sendFile` instead + * support mounted app as any argument to `app.use()` + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + * deps: send@0.8.1 + - Add `extensions` option + * deps: serve-static@~1.5.0 + - Add `extensions` option + - deps: send@0.8.1 + +4.7.4 / 2014-08-04 +================== + + * fix `res.sendfile` regression for serving directory index files + * deps: send@0.7.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - Fix serving index files without root dir + * deps: serve-static@~1.4.4 + - deps: send@0.7.4 + +4.7.3 / 2014-08-04 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + * deps: serve-static@~1.4.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + - deps: send@0.7.3 + +4.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: send@0.7.2 + - deps: depd@0.4.4 + * deps: serve-static@~1.4.2 + +4.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: send@0.7.1 + - deps: depd@0.4.3 + * deps: serve-static@~1.4.1 + +4.7.0 / 2014-07-25 +================== + + * fix `req.protocol` for proxy-direct connections + * configurable query parser with `app.set('query parser', parser)` + - `app.set('query parser', 'extended')` parse with "qs" module + - `app.set('query parser', 'simple')` parse with "querystring" core module + - `app.set('query parser', false)` disable query string parsing + - `app.set('query parser', true)` enable simple parsing + * deprecate `res.json(status, obj)` -- use `res.status(status).json(obj)` instead + * deprecate `res.jsonp(status, obj)` -- use `res.status(status).jsonp(obj)` instead + * deprecate `res.send(status, body)` -- use `res.status(status).send(body)` instead + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: finalhandler@0.1.0 + - Respond after request fully read + - deps: debug@1.0.4 + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - Cap `maxAge` value to 1 year + - deps: debug@1.0.4 + - deps: depd@0.4.2 + * deps: serve-static@~1.4.0 + - deps: parseurl@~1.2.0 + - deps: send@0.7.0 + * perf: prevent multiple `Buffer` creation in `res.send` + +4.6.1 / 2014-07-12 +================== + + * fix `subapp.mountpath` regression for `app.use(subapp)` + +4.6.0 / 2014-07-11 +================== + + * accept multiple callbacks to `app.use()` + * add explicit "Rosetta Flash JSONP abuse" protection + - previous versions are not vulnerable; this is just explicit protection + * catch errors in multiple `req.param(name, fn)` handlers + * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead + * fix `res.send(status, num)` to send `num` as json (not error) + * remove unnecessary escaping when `res.jsonp` returns JSON response + * support non-string `path` in `app.use(path, fn)` + - supports array of paths + - supports `RegExp` + * router: fix optimization on router exit + * router: refactor location of `try` blocks + * router: speed up standard `app.use(fn)` + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: finalhandler@0.0.3 + - deps: debug@1.0.3 + * deps: methods@1.1.0 + - add `CONNECT` + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + * deps: path-to-regexp@0.1.3 + * deps: send@0.6.0 + - deps: debug@1.0.3 + * deps: serve-static@~1.3.2 + - deps: parseurl@~1.1.3 + - deps: send@0.6.0 + * perf: fix arguments reassign deopt in some `res` methods + +4.5.1 / 2014-07-06 +================== + + * fix routing regression when altering `req.method` + +4.5.0 / 2014-07-04 +================== + + * add deprecation message to non-plural `req.accepts*` + * add deprecation message to `res.send(body, status)` + * add deprecation message to `res.vary()` + * add `headers` option to `res.sendfile` + - use to set headers on successful file transfer + * add `mergeParams` option to `Router` + - merges `req.params` from parent routes + * add `req.hostname` -- correct name for what `req.host` returns + * deprecate things with `depd` module + * deprecate `req.host` -- use `req.hostname` instead + * fix behavior when handling request without routes + * fix handling when `route.all` is only route + * invoke `router.param()` only when route matches + * restore `req.params` after invoking router + * use `finalhandler` for final response handling + * use `media-typer` to alter content-type charset + * deps: accepts@~1.0.7 + * deps: send@0.5.0 + - Accept string for `maxage` (converted by `ms`) + - Include link in default redirect response + * deps: serve-static@~1.3.0 + - Accept string for `maxAge` (converted by `ms`) + - Add `setHeaders` option + - Include HTML link in redirect response + - deps: send@0.5.0 + * deps: type-is@~1.3.2 + +4.4.5 / 2014-06-26 +================== + + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +4.4.4 / 2014-06-20 +================== + + * fix `res.attachment` Unicode filenames in Safari + * fix "trim prefix" debug message in `express:router` + * deps: accepts@~1.0.5 + * deps: buffer-crc32@0.2.3 + +4.4.3 / 2014-06-11 +================== + + * fix persistence of modified `req.params[name]` from `app.param()` + * deps: accepts@1.0.3 + - deps: negotiator@0.4.6 + * deps: debug@1.0.2 + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + * deps: serve-static@1.2.3 + - Do not throw un-catchable error on file open race condition + - deps: send@0.4.3 + +4.4.2 / 2014-06-09 +================== + + * fix catching errors from top-level handlers + * use `vary` module for `res.vary` + * deps: debug@1.0.1 + * deps: proxy-addr@1.0.1 + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + * deps: serve-static@1.2.2 + - fix "event emitter leak" warnings + - deps: send@0.4.2 + * deps: type-is@1.2.1 + +4.4.1 / 2014-06-02 +================== + + * deps: methods@1.0.1 + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + * deps: serve-static@1.2.1 + - use `escape-html` for escaping + - deps: send@0.4.1 + +4.4.0 / 2014-05-30 +================== + + * custom etag control with `app.set('etag', val)` + - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation + - `app.set('etag', 'weak')` weak tag + - `app.set('etag', 'strong')` strong etag + - `app.set('etag', false)` turn off + - `app.set('etag', true)` standard etag + * mark `res.send` ETag as weak and reduce collisions + * update accepts to 1.0.2 + - Fix interpretation when header not in request + * update send to 0.4.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: debug@0.8.1 + * update serve-static to 1.2.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: send@0.4.0 + +4.3.2 / 2014-05-28 +================== + + * fix handling of errors from `router.param()` callbacks + +4.3.1 / 2014-05-23 +================== + + * revert "fix behavior of multiple `app.VERB` for the same path" + - this caused a regression in the order of route execution + +4.3.0 / 2014-05-21 +================== + + * add `req.baseUrl` to access the path stripped from `req.url` in routes + * fix behavior of multiple `app.VERB` for the same path + * fix issue routing requests among sub routers + * invoke `router.param()` only when necessary instead of every match + * proper proxy trust with `app.set('trust proxy', trust)` + - `app.set('trust proxy', 1)` trust first hop + - `app.set('trust proxy', 'loopback')` trust loopback addresses + - `app.set('trust proxy', '10.0.0.1')` trust single IP + - `app.set('trust proxy', '10.0.0.1/16')` trust subnet + - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list + - `app.set('trust proxy', false)` turn off + - `app.set('trust proxy', true)` trust everything + * set proper `charset` in `Content-Type` for `res.send` + * update type-is to 1.2.0 + - support suffix matching + +4.2.0 / 2014-05-11 +================== + + * deprecate `app.del()` -- use `app.delete()` instead + * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead + - the edge-case `res.json(status, num)` requires `res.status(status).json(num)` + * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead + - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)` + * fix `req.next` when inside router instance + * include `ETag` header in `HEAD` requests + * keep previous `Content-Type` for `res.jsonp` + * support PURGE method + - add `app.purge` + - add `router.purge` + - include PURGE in `app.all` + * update debug to 0.8.0 + - add `enable()` method + - change from stderr to stdout + * update methods to 1.0.0 + - add PURGE + +4.1.2 / 2014-05-08 +================== + + * fix `req.host` for IPv6 literals + * fix `res.jsonp` error if callback param is object + +4.1.1 / 2014-04-27 +================== + + * fix package.json to reflect supported node version + +4.1.0 / 2014-04-24 +================== + + * pass options from `res.sendfile` to `send` + * preserve casing of headers in `res.header` and `res.set` + * support unicode file names in `res.attachment` and `res.download` + * update accepts to 1.0.1 + - deps: negotiator@0.4.0 + * update cookie to 0.1.2 + - Fix for maxAge == 0 + - made compat with expires field + * update send to 0.3.0 + - Accept API options in options object + - Coerce option types + - Control whether to generate etags + - Default directory access to 403 when index disabled + - Fix sending files with dots without root set + - Include file path in etag + - Make "Can't set headers after they are sent." catchable + - Send full entity-body for multi range requests + - Set etags to "weak" + - Support "If-Range" header + - Support multiple index paths + - deps: mime@1.2.11 + * update serve-static to 1.1.0 + - Accept options directly to `send` module + - Resolve relative paths at middleware setup + - Use parseurl to parse the URL from request + - deps: send@0.3.0 + * update type-is to 1.1.0 + - add non-array values support + - add `multipart` as a shorthand + +4.0.0 / 2014-04-09 +================== + + * remove: + - node 0.8 support + - connect and connect's patches except for charset handling + - express(1) - moved to [express-generator](https://github.com/expressjs/generator) + - `express.createServer()` - it has been deprecated for a long time. Use `express()` + - `app.configure` - use logic in your own app code + - `app.router` - is removed + - `req.auth` - use `basic-auth` instead + - `req.accepted*` - use `req.accepts*()` instead + - `res.location` - relative URL resolution is removed + - `res.charset` - include the charset in the content type when using `res.set()` + - all bundled middleware except `static` + * change: + - `app.route` -> `app.mountpath` when mounting an express app in another express app + - `json spaces` no longer enabled by default in development + - `req.accepts*` -> `req.accepts*s` - i.e. `req.acceptsEncoding` -> `req.acceptsEncodings` + - `req.params` is now an object instead of an array + - `res.locals` is no longer a function. It is a plain js object. Treat it as such. + - `res.headerSent` -> `res.headersSent` to match node.js ServerResponse object + * refactor: + - `req.accepts*` with [accepts](https://github.com/expressjs/accepts) + - `req.is` with [type-is](https://github.com/expressjs/type-is) + - [path-to-regexp](https://github.com/component/path-to-regexp) + * add: + - `app.router()` - returns the app Router instance + - `app.route()` - Proxy to the app's `Router#route()` method to create a new route + - Router & Route - public API + +3.21.2 / 2015-07-31 +=================== + + * deps: connect@2.30.2 + - deps: body-parser@~1.13.3 + - deps: compression@~1.5.2 + - deps: errorhandler@~1.4.2 + - deps: method-override@~2.3.5 + - deps: serve-index@~1.7.2 + - deps: type-is@~1.6.6 + - deps: vhost@~3.0.1 + * deps: vary@~1.0.1 + - Fix setting empty header from empty `field` + - perf: enable strict mode + - perf: remove argument reassignments + +3.21.1 / 2015-07-05 +=================== + + * deps: basic-auth@~1.0.3 + * deps: connect@2.30.1 + - deps: body-parser@~1.13.2 + - deps: compression@~1.5.1 + - deps: errorhandler@~1.4.1 + - deps: morgan@~1.6.1 + - deps: pause@0.1.0 + - deps: qs@4.0.0 + - deps: serve-index@~1.7.1 + - deps: type-is@~1.6.4 + +3.21.0 / 2015-06-18 +=================== + + * deps: basic-auth@1.0.2 + - perf: enable strict mode + - perf: hoist regular expression + - perf: parse with regular expressions + - perf: remove argument reassignment + * deps: connect@2.30.0 + - deps: body-parser@~1.13.1 + - deps: bytes@2.1.0 + - deps: compression@~1.5.0 + - deps: cookie@0.1.3 + - deps: cookie-parser@~1.3.5 + - deps: csurf@~1.8.3 + - deps: errorhandler@~1.4.0 + - deps: express-session@~1.11.3 + - deps: finalhandler@0.4.0 + - deps: fresh@0.3.0 + - deps: morgan@~1.6.0 + - deps: serve-favicon@~2.3.0 + - deps: serve-index@~1.7.0 + - deps: serve-static@~1.10.0 + - deps: type-is@~1.6.3 + * deps: cookie@0.1.3 + - perf: deduce the scope of try-catch deopt + - perf: remove argument reassignments + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Always include entity length in ETags for hash length extensions + - Generate non-Stats ETags using MD5 only (no longer CRC32) + - Improve stat performance by removing hashing + - Improve support for JXcore + - Remove base64 padding in ETags to shorten + - Support "fake" stats objects in environments without fs + - Use MD5 instead of MD4 in weak ETags over 1KB + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: mkdirp@0.5.1 + - Work in global strict mode + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + +3.20.3 / 2015-05-17 +=================== + + * deps: connect@2.29.2 + - deps: body-parser@~1.12.4 + - deps: compression@~1.4.4 + - deps: connect-timeout@~1.6.2 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: errorhandler@~1.3.6 + - deps: finalhandler@0.3.6 + - deps: method-override@~2.3.3 + - deps: morgan@~1.5.3 + - deps: qs@2.4.2 + - deps: response-time@~2.3.1 + - deps: serve-favicon@~2.2.1 + - deps: serve-index@~1.6.4 + - deps: serve-static@~1.9.3 + - deps: type-is@~1.6.2 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: proxy-addr@~1.0.8 + - deps: ipaddr.js@1.0.1 + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +3.20.2 / 2015-03-16 +=================== + + * deps: connect@2.29.1 + - deps: body-parser@~1.12.2 + - deps: compression@~1.4.3 + - deps: connect-timeout@~1.6.1 + - deps: debug@~2.1.3 + - deps: errorhandler@~1.3.5 + - deps: express-session@~1.10.4 + - deps: finalhandler@0.3.4 + - deps: method-override@~2.3.2 + - deps: morgan@~1.5.2 + - deps: qs@2.4.1 + - deps: serve-index@~1.6.3 + - deps: serve-static@~1.9.2 + - deps: type-is@~1.6.1 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: merge-descriptors@1.0.0 + * deps: proxy-addr@~1.0.7 + - deps: ipaddr.js@0.1.9 + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +3.20.1 / 2015-02-28 +=================== + + * Fix `req.host` when using "trust proxy" hops count + * Fix `req.protocol`/`req.secure` when using "trust proxy" hops count + +3.20.0 / 2015-02-18 +=================== + + * Fix `"trust proxy"` setting to inherit when app is mounted + * Generate `ETag`s for all request responses + - No longer restricted to only responses for `GET` and `HEAD` requests + * Use `content-type` to parse `Content-Type` headers + * deps: connect@2.29.0 + - Use `content-type` to parse `Content-Type` headers + - deps: body-parser@~1.12.0 + - deps: compression@~1.4.1 + - deps: connect-timeout@~1.6.0 + - deps: cookie-parser@~1.3.4 + - deps: cookie-signature@1.0.6 + - deps: csurf@~1.7.0 + - deps: errorhandler@~1.3.4 + - deps: express-session@~1.10.3 + - deps: http-errors@~1.3.1 + - deps: response-time@~2.3.0 + - deps: serve-index@~1.6.2 + - deps: serve-static@~1.9.1 + - deps: type-is@~1.6.0 + * deps: cookie-signature@1.0.6 + * deps: send@0.12.1 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +3.19.2 / 2015-02-01 +=================== + + * deps: connect@2.28.3 + - deps: compression@~1.3.1 + - deps: csurf@~1.6.6 + - deps: errorhandler@~1.3.3 + - deps: express-session@~1.10.2 + - deps: serve-index@~1.6.1 + - deps: type-is@~1.5.6 + * deps: proxy-addr@~1.0.6 + - deps: ipaddr.js@0.1.8 + +3.19.1 / 2015-01-20 +=================== + + * deps: connect@2.28.2 + - deps: body-parser@~1.10.2 + - deps: serve-static@~1.8.1 + * deps: send@0.11.1 + - Fix root path disclosure + +3.19.0 / 2015-01-09 +=================== + + * Fix `OPTIONS` responses to include the `HEAD` method property + * Use `readline` for prompt in `express(1)` + * deps: commander@2.6.0 + * deps: connect@2.28.1 + - deps: body-parser@~1.10.1 + - deps: compression@~1.3.0 + - deps: connect-timeout@~1.5.0 + - deps: csurf@~1.6.4 + - deps: debug@~2.1.1 + - deps: errorhandler@~1.3.2 + - deps: express-session@~1.10.1 + - deps: finalhandler@0.3.3 + - deps: method-override@~2.3.1 + - deps: morgan@~1.5.1 + - deps: serve-favicon@~2.2.0 + - deps: serve-index@~1.6.0 + - deps: serve-static@~1.8.0 + - deps: type-is@~1.5.5 + * deps: debug@~2.1.1 + * deps: methods@~1.1.1 + * deps: proxy-addr@~1.0.5 + - deps: ipaddr.js@0.1.6 + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +3.18.6 / 2014-12-12 +=================== + + * Fix exception in `req.fresh`/`req.stale` without response headers + +3.18.5 / 2014-12-11 +=================== + + * deps: connect@2.27.6 + - deps: compression@~1.2.2 + - deps: express-session@~1.9.3 + - deps: http-errors@~1.2.8 + - deps: serve-index@~1.5.3 + - deps: type-is@~1.5.4 + +3.18.4 / 2014-11-23 +=================== + + * deps: connect@2.27.4 + - deps: body-parser@~1.9.3 + - deps: compression@~1.2.1 + - deps: errorhandler@~1.2.3 + - deps: express-session@~1.9.2 + - deps: qs@2.3.3 + - deps: serve-favicon@~2.1.7 + - deps: serve-static@~1.5.1 + - deps: type-is@~1.5.3 + * deps: etag@~1.5.1 + * deps: proxy-addr@~1.0.4 + - deps: ipaddr.js@0.1.5 + +3.18.3 / 2014-11-09 +=================== + + * deps: connect@2.27.3 + - Correctly invoke async callback asynchronously + - deps: csurf@~1.6.3 + +3.18.2 / 2014-10-28 +=================== + + * deps: connect@2.27.2 + - Fix handling of URLs containing `://` in the path + - deps: body-parser@~1.9.2 + - deps: qs@2.3.2 + +3.18.1 / 2014-10-22 +=================== + + * Fix internal `utils.merge` deprecation warnings + * deps: connect@2.27.1 + - deps: body-parser@~1.9.1 + - deps: express-session@~1.9.1 + - deps: finalhandler@0.3.2 + - deps: morgan@~1.4.1 + - deps: qs@2.3.0 + - deps: serve-static@~1.7.1 + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +3.18.0 / 2014-10-17 +=================== + + * Use `content-disposition` module for `res.attachment`/`res.download` + - Sends standards-compliant `Content-Disposition` header + - Full Unicode support + * Use `etag` module to generate `ETag` headers + * deps: connect@2.27.0 + - Use `http-errors` module for creating errors + - Use `utils-merge` module for merging objects + - deps: body-parser@~1.9.0 + - deps: compression@~1.2.0 + - deps: connect-timeout@~1.4.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: express-session@~1.9.0 + - deps: finalhandler@0.3.1 + - deps: method-override@~2.3.0 + - deps: morgan@~1.4.0 + - deps: response-time@~2.2.0 + - deps: serve-favicon@~2.1.6 + - deps: serve-index@~1.5.0 + - deps: serve-static@~1.7.0 + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +3.17.8 / 2014-10-15 +=================== + + * deps: connect@2.26.6 + - deps: compression@~1.1.2 + - deps: csurf@~1.6.2 + - deps: errorhandler@~1.2.2 + +3.17.7 / 2014-10-08 +=================== + + * deps: connect@2.26.5 + - Fix accepting non-object arguments to `logger` + - deps: serve-static@~1.6.4 + +3.17.6 / 2014-10-02 +=================== + + * deps: connect@2.26.4 + - deps: morgan@~1.3.2 + - deps: type-is@~1.5.2 + +3.17.5 / 2014-09-24 +=================== + + * deps: connect@2.26.3 + - deps: body-parser@~1.8.4 + - deps: serve-favicon@~2.1.5 + - deps: serve-static@~1.6.3 + * deps: proxy-addr@~1.0.3 + - Use `forwarded` npm module + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +3.17.4 / 2014-09-19 +=================== + + * deps: connect@2.26.2 + - deps: body-parser@~1.8.3 + - deps: qs@2.2.4 + +3.17.3 / 2014-09-18 +=================== + + * deps: proxy-addr@~1.0.2 + - Fix a global leak when multiple subnets are trusted + - deps: ipaddr.js@0.1.3 + +3.17.2 / 2014-09-15 +=================== + + * Use `crc` instead of `buffer-crc32` for speed + * deps: connect@2.26.1 + - deps: body-parser@~1.8.2 + - deps: depd@0.4.5 + - deps: express-session@~1.8.2 + - deps: morgan@~1.3.1 + - deps: serve-favicon@~2.1.3 + - deps: serve-static@~1.6.2 + * deps: depd@0.4.5 + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +3.17.1 / 2014-09-08 +=================== + + * Fix error in `req.subdomains` on empty host + +3.17.0 / 2014-09-08 +=================== + + * Support `X-Forwarded-Host` in `req.subdomains` + * Support IP address host in `req.subdomains` + * deps: connect@2.26.0 + - deps: body-parser@~1.8.1 + - deps: compression@~1.1.0 + - deps: connect-timeout@~1.3.0 + - deps: cookie-parser@~1.3.3 + - deps: cookie-signature@1.0.5 + - deps: csurf@~1.6.1 + - deps: debug@~2.0.0 + - deps: errorhandler@~1.2.0 + - deps: express-session@~1.8.1 + - deps: finalhandler@0.2.0 + - deps: fresh@0.2.4 + - deps: media-typer@0.3.0 + - deps: method-override@~2.2.0 + - deps: morgan@~1.3.0 + - deps: qs@2.2.3 + - deps: serve-favicon@~2.1.3 + - deps: serve-index@~1.2.1 + - deps: serve-static@~1.6.1 + - deps: type-is@~1.5.1 + - deps: vhost@~3.0.0 + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: range-parser@~1.0.2 + * deps: send@0.9.1 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + - deps: fresh@0.2.4 + * deps: vary@~1.0.0 + - Accept valid `Vary` header string as `field` + +3.16.10 / 2014-09-04 +==================== + + * deps: connect@2.25.10 + - deps: serve-static@~1.5.4 + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +3.16.9 / 2014-08-29 +=================== + + * deps: connect@2.25.9 + - deps: body-parser@~1.6.7 + - deps: qs@2.2.2 + +3.16.8 / 2014-08-27 +=================== + + * deps: connect@2.25.8 + - deps: body-parser@~1.6.6 + - deps: csurf@~1.4.1 + - deps: qs@2.2.0 + +3.16.7 / 2014-08-18 +=================== + + * deps: connect@2.25.7 + - deps: body-parser@~1.6.5 + - deps: express-session@~1.7.6 + - deps: morgan@~1.2.3 + - deps: serve-static@~1.5.3 + * deps: send@0.8.3 + - deps: destroy@1.0.3 + - deps: on-finished@2.1.0 + +3.16.6 / 2014-08-14 +=================== + + * deps: connect@2.25.6 + - deps: body-parser@~1.6.4 + - deps: qs@1.2.2 + - deps: serve-static@~1.5.2 + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +3.16.5 / 2014-08-11 +=================== + + * deps: connect@2.25.5 + - Fix backwards compatibility in `logger` + +3.16.4 / 2014-08-10 +=================== + + * Fix original URL parsing in `res.location` + * deps: connect@2.25.4 + - Fix `query` middleware breaking with argument + - deps: body-parser@~1.6.3 + - deps: compression@~1.0.11 + - deps: connect-timeout@~1.2.2 + - deps: express-session@~1.7.5 + - deps: method-override@~2.1.3 + - deps: on-headers@~1.0.0 + - deps: parseurl@~1.3.0 + - deps: qs@1.2.1 + - deps: response-time@~2.0.1 + - deps: serve-index@~1.1.6 + - deps: serve-static@~1.5.1 + * deps: parseurl@~1.3.0 + +3.16.3 / 2014-08-07 +=================== + + * deps: connect@2.25.3 + - deps: multiparty@3.3.2 + +3.16.2 / 2014-08-07 +=================== + + * deps: connect@2.25.2 + - deps: body-parser@~1.6.2 + - deps: qs@1.2.0 + +3.16.1 / 2014-08-06 +=================== + + * deps: connect@2.25.1 + - deps: body-parser@~1.6.1 + - deps: qs@1.1.0 + +3.16.0 / 2014-08-05 +=================== + + * deps: connect@2.25.0 + - deps: body-parser@~1.6.0 + - deps: compression@~1.0.10 + - deps: csurf@~1.4.0 + - deps: express-session@~1.7.4 + - deps: qs@1.0.2 + - deps: serve-static@~1.5.0 + * deps: send@0.8.1 + - Add `extensions` option + +3.15.3 / 2014-08-04 +=================== + + * fix `res.sendfile` regression for serving directory index files + * deps: connect@2.24.3 + - deps: serve-index@~1.1.5 + - deps: serve-static@~1.4.4 + * deps: send@0.7.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - Fix serving index files without root dir + +3.15.2 / 2014-07-27 +=================== + + * deps: connect@2.24.2 + - deps: body-parser@~1.5.2 + - deps: depd@0.4.4 + - deps: express-session@~1.7.2 + - deps: morgan@~1.2.2 + - deps: serve-static@~1.4.2 + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: send@0.7.2 + - deps: depd@0.4.4 + +3.15.1 / 2014-07-26 +=================== + + * deps: connect@2.24.1 + - deps: body-parser@~1.5.1 + - deps: depd@0.4.3 + - deps: express-session@~1.7.1 + - deps: morgan@~1.2.1 + - deps: serve-index@~1.1.4 + - deps: serve-static@~1.4.1 + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: send@0.7.1 + - deps: depd@0.4.3 + +3.15.0 / 2014-07-22 +=================== + + * Fix `req.protocol` for proxy-direct connections + * Pass options from `res.sendfile` to `send` + * deps: connect@2.24.0 + - deps: body-parser@~1.5.0 + - deps: compression@~1.0.9 + - deps: connect-timeout@~1.2.1 + - deps: debug@1.0.4 + - deps: depd@0.4.2 + - deps: express-session@~1.7.0 + - deps: finalhandler@0.1.0 + - deps: method-override@~2.1.2 + - deps: morgan@~1.2.0 + - deps: multiparty@3.3.1 + - deps: parseurl@~1.2.0 + - deps: serve-static@~1.4.0 + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - Cap `maxAge` value to 1 year + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +3.14.0 / 2014-07-11 +=================== + + * add explicit "Rosetta Flash JSONP abuse" protection + - previous versions are not vulnerable; this is just explicit protection + * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead + * fix `res.send(status, num)` to send `num` as json (not error) + * remove unnecessary escaping when `res.jsonp` returns JSON response + * deps: basic-auth@1.0.0 + - support empty password + - support empty username + * deps: connect@2.23.0 + - deps: debug@1.0.3 + - deps: express-session@~1.6.4 + - deps: method-override@~2.1.0 + - deps: parseurl@~1.1.3 + - deps: serve-static@~1.3.1 + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: methods@1.1.0 + - add `CONNECT` + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +3.13.0 / 2014-07-03 +=================== + + * add deprecation message to `app.configure` + * add deprecation message to `req.auth` + * use `basic-auth` to parse `Authorization` header + * deps: connect@2.22.0 + - deps: csurf@~1.3.0 + - deps: express-session@~1.6.1 + - deps: multiparty@3.3.0 + - deps: serve-static@~1.3.0 + * deps: send@0.5.0 + - Accept string for `maxage` (converted by `ms`) + - Include link in default redirect response + +3.12.1 / 2014-06-26 +=================== + + * deps: connect@2.21.1 + - deps: cookie-parser@1.3.2 + - deps: cookie-signature@1.0.4 + - deps: express-session@~1.5.2 + - deps: type-is@~1.3.2 + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +3.12.0 / 2014-06-21 +=================== + + * use `media-typer` to alter content-type charset + * deps: connect@2.21.0 + - deprecate `connect(middleware)` -- use `app.use(middleware)` instead + - deprecate `connect.createServer()` -- use `connect()` instead + - fix `res.setHeader()` patch to work with with get -> append -> set pattern + - deps: compression@~1.0.8 + - deps: errorhandler@~1.1.1 + - deps: express-session@~1.5.0 + - deps: serve-index@~1.1.3 + +3.11.0 / 2014-06-19 +=================== + + * deprecate things with `depd` module + * deps: buffer-crc32@0.2.3 + * deps: connect@2.20.2 + - deprecate `verify` option to `json` -- use `body-parser` npm module instead + - deprecate `verify` option to `urlencoded` -- use `body-parser` npm module instead + - deprecate things with `depd` module + - use `finalhandler` for final response handling + - use `media-typer` to parse `content-type` for charset + - deps: body-parser@1.4.3 + - deps: connect-timeout@1.1.1 + - deps: cookie-parser@1.3.1 + - deps: csurf@1.2.2 + - deps: errorhandler@1.1.0 + - deps: express-session@1.4.0 + - deps: multiparty@3.2.9 + - deps: serve-index@1.1.2 + - deps: type-is@1.3.1 + - deps: vhost@2.0.0 + +3.10.5 / 2014-06-11 +=================== + + * deps: connect@2.19.6 + - deps: body-parser@1.3.1 + - deps: compression@1.0.7 + - deps: debug@1.0.2 + - deps: serve-index@1.1.1 + - deps: serve-static@1.2.3 + * deps: debug@1.0.2 + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +3.10.4 / 2014-06-09 +=================== + + * deps: connect@2.19.5 + - fix "event emitter leak" warnings + - deps: csurf@1.2.1 + - deps: debug@1.0.1 + - deps: serve-static@1.2.2 + - deps: type-is@1.2.1 + * deps: debug@1.0.1 + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: finished@1.2.1 + - deps: debug@1.0.1 + +3.10.3 / 2014-06-05 +=================== + + * use `vary` module for `res.vary` + * deps: connect@2.19.4 + - deps: errorhandler@1.0.2 + - deps: method-override@2.0.2 + - deps: serve-favicon@2.0.1 + * deps: debug@1.0.0 + +3.10.2 / 2014-06-03 +=================== + + * deps: connect@2.19.3 + - deps: compression@1.0.6 + +3.10.1 / 2014-06-03 +=================== + + * deps: connect@2.19.2 + - deps: compression@1.0.4 + * deps: proxy-addr@1.0.1 + +3.10.0 / 2014-06-02 +=================== + + * deps: connect@2.19.1 + - deprecate `methodOverride()` -- use `method-override` npm module instead + - deps: body-parser@1.3.0 + - deps: method-override@2.0.1 + - deps: multiparty@3.2.8 + - deps: response-time@2.0.0 + - deps: serve-static@1.2.1 + * deps: methods@1.0.1 + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +3.9.0 / 2014-05-30 +================== + + * custom etag control with `app.set('etag', val)` + - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation + - `app.set('etag', 'weak')` weak tag + - `app.set('etag', 'strong')` strong etag + - `app.set('etag', false)` turn off + - `app.set('etag', true)` standard etag + * Include ETag in HEAD requests + * mark `res.send` ETag as weak and reduce collisions + * update connect to 2.18.0 + - deps: compression@1.0.3 + - deps: serve-index@1.1.0 + - deps: serve-static@1.2.0 + * update send to 0.4.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: debug@0.8.1 + +3.8.1 / 2014-05-27 +================== + + * update connect to 2.17.3 + - deps: body-parser@1.2.2 + - deps: express-session@1.2.1 + - deps: method-override@1.0.2 + +3.8.0 / 2014-05-21 +================== + + * keep previous `Content-Type` for `res.jsonp` + * set proper `charset` in `Content-Type` for `res.send` + * update connect to 2.17.1 + - fix `res.charset` appending charset when `content-type` has one + - deps: express-session@1.2.0 + - deps: morgan@1.1.1 + - deps: serve-index@1.0.3 + +3.7.0 / 2014-05-18 +================== + + * proper proxy trust with `app.set('trust proxy', trust)` + - `app.set('trust proxy', 1)` trust first hop + - `app.set('trust proxy', 'loopback')` trust loopback addresses + - `app.set('trust proxy', '10.0.0.1')` trust single IP + - `app.set('trust proxy', '10.0.0.1/16')` trust subnet + - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list + - `app.set('trust proxy', false)` turn off + - `app.set('trust proxy', true)` trust everything + * update connect to 2.16.2 + - deprecate `res.headerSent` -- use `res.headersSent` + - deprecate `res.on("header")` -- use on-headers module instead + - fix edge-case in `res.appendHeader` that would append in wrong order + - json: use body-parser + - urlencoded: use body-parser + - dep: bytes@1.0.0 + - dep: cookie-parser@1.1.0 + - dep: csurf@1.2.0 + - dep: express-session@1.1.0 + - dep: method-override@1.0.1 + +3.6.0 / 2014-05-09 +================== + + * deprecate `app.del()` -- use `app.delete()` instead + * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead + - the edge-case `res.json(status, num)` requires `res.status(status).json(num)` + * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead + - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)` + * support PURGE method + - add `app.purge` + - add `router.purge` + - include PURGE in `app.all` + * update connect to 2.15.0 + * Add `res.appendHeader` + * Call error stack even when response has been sent + * Patch `res.headerSent` to return Boolean + * Patch `res.headersSent` for node.js 0.8 + * Prevent default 404 handler after response sent + * dep: compression@1.0.2 + * dep: connect-timeout@1.1.0 + * dep: debug@^0.8.0 + * dep: errorhandler@1.0.1 + * dep: express-session@1.0.4 + * dep: morgan@1.0.1 + * dep: serve-favicon@2.0.0 + * dep: serve-index@1.0.2 + * update debug to 0.8.0 + * add `enable()` method + * change from stderr to stdout + * update methods to 1.0.0 + - add PURGE + * update mkdirp to 0.5.0 + +3.5.3 / 2014-05-08 +================== + + * fix `req.host` for IPv6 literals + * fix `res.jsonp` error if callback param is object + +3.5.2 / 2014-04-24 +================== + + * update connect to 2.14.5 + * update cookie to 0.1.2 + * update mkdirp to 0.4.0 + * update send to 0.3.0 + +3.5.1 / 2014-03-25 +================== + + * pin less-middleware in generated app + +3.5.0 / 2014-03-06 +================== + + * bump deps + +3.4.8 / 2014-01-13 +================== + + * prevent incorrect automatic OPTIONS responses #1868 @dpatti + * update binary and examples for jade 1.0 #1876 @yossi, #1877 @reqshark, #1892 @matheusazzi + * throw 400 in case of malformed paths @rlidwka + +3.4.7 / 2013-12-10 +================== + + * update connect + +3.4.6 / 2013-12-01 +================== + + * update connect (raw-body) + +3.4.5 / 2013-11-27 +================== + + * update connect + * res.location: remove leading ./ #1802 @kapouer + * res.redirect: fix `res.redirect('toString') #1829 @michaelficarra + * res.send: always send ETag when content-length > 0 + * router: add Router.all() method + +3.4.4 / 2013-10-29 +================== + + * update connect + * update supertest + * update methods + * express(1): replace bodyParser() with urlencoded() and json() #1795 @chirag04 + +3.4.3 / 2013-10-23 +================== + + * update connect + +3.4.2 / 2013-10-18 +================== + + * update connect + * downgrade commander + +3.4.1 / 2013-10-15 +================== + + * update connect + * update commander + * jsonp: check if callback is a function + * router: wrap encodeURIComponent in a try/catch #1735 (@lxe) + * res.format: now includes charset @1747 (@sorribas) + * res.links: allow multiple calls @1746 (@sorribas) + +3.4.0 / 2013-09-07 +================== + + * add res.vary(). Closes #1682 + * update connect + +3.3.8 / 2013-09-02 +================== + + * update connect + +3.3.7 / 2013-08-28 +================== + + * update connect + +3.3.6 / 2013-08-27 +================== + + * Revert "remove charset from json responses. Closes #1631" (causes issues in some clients) + * add: req.accepts take an argument list + +3.3.4 / 2013-07-08 +================== + + * update send and connect + +3.3.3 / 2013-07-04 +================== + + * update connect + +3.3.2 / 2013-07-03 +================== + + * update connect + * update send + * remove .version export + +3.3.1 / 2013-06-27 +================== + + * update connect + +3.3.0 / 2013-06-26 +================== + + * update connect + * add support for multiple X-Forwarded-Proto values. Closes #1646 + * change: remove charset from json responses. Closes #1631 + * change: return actual booleans from req.accept* functions + * fix jsonp callback array throw + +3.2.6 / 2013-06-02 +================== + + * update connect + +3.2.5 / 2013-05-21 +================== + + * update connect + * update node-cookie + * add: throw a meaningful error when there is no default engine + * change generation of ETags with res.send() to GET requests only. Closes #1619 + +3.2.4 / 2013-05-09 +================== + + * fix `req.subdomains` when no Host is present + * fix `req.host` when no Host is present, return undefined + +3.2.3 / 2013-05-07 +================== + + * update connect / qs + +3.2.2 / 2013-05-03 +================== + + * update qs + +3.2.1 / 2013-04-29 +================== + + * add app.VERB() paths array deprecation warning + * update connect + * update qs and remove all ~ semver crap + * fix: accept number as value of Signed Cookie + +3.2.0 / 2013-04-15 +================== + + * add "view" constructor setting to override view behaviour + * add req.acceptsEncoding(name) + * add req.acceptedEncodings + * revert cookie signature change causing session race conditions + * fix sorting of Accept values of the same quality + +3.1.2 / 2013-04-12 +================== + + * add support for custom Accept parameters + * update cookie-signature + +3.1.1 / 2013-04-01 +================== + + * add X-Forwarded-Host support to `req.host` + * fix relative redirects + * update mkdirp + * update buffer-crc32 + * remove legacy app.configure() method from app template. + +3.1.0 / 2013-01-25 +================== + + * add support for leading "." in "view engine" setting + * add array support to `res.set()` + * add node 0.8.x to travis.yml + * add "subdomain offset" setting for tweaking `req.subdomains` + * add `res.location(url)` implementing `res.redirect()`-like setting of Location + * use app.get() for x-powered-by setting for inheritance + * fix colons in passwords for `req.auth` + +3.0.6 / 2013-01-04 +================== + + * add http verb methods to Router + * update connect + * fix mangling of the `res.cookie()` options object + * fix jsonp whitespace escape. Closes #1132 + +3.0.5 / 2012-12-19 +================== + + * add throwing when a non-function is passed to a route + * fix: explicitly remove Transfer-Encoding header from 204 and 304 responses + * revert "add 'etag' option" + +3.0.4 / 2012-12-05 +================== + + * add 'etag' option to disable `res.send()` Etags + * add escaping of urls in text/plain in `res.redirect()` + for old browsers interpreting as html + * change crc32 module for a more liberal license + * update connect + +3.0.3 / 2012-11-13 +================== + + * update connect + * update cookie module + * fix cookie max-age + +3.0.2 / 2012-11-08 +================== + + * add OPTIONS to cors example. Closes #1398 + * fix route chaining regression. Closes #1397 + +3.0.1 / 2012-11-01 +================== + + * update connect + +3.0.0 / 2012-10-23 +================== + + * add `make clean` + * add "Basic" check to req.auth + * add `req.auth` test coverage + * add cb && cb(payload) to `res.jsonp()`. Closes #1374 + * add backwards compat for `res.redirect()` status. Closes #1336 + * add support for `res.json()` to retain previously defined Content-Types. Closes #1349 + * update connect + * change `res.redirect()` to utilize a pathname-relative Location again. Closes #1382 + * remove non-primitive string support for `res.send()` + * fix view-locals example. Closes #1370 + * fix route-separation example + +3.0.0rc5 / 2012-09-18 +================== + + * update connect + * add redis search example + * add static-files example + * add "x-powered-by" setting (`app.disable('x-powered-by')`) + * add "application/octet-stream" redirect Accept test case. Closes #1317 + +3.0.0rc4 / 2012-08-30 +================== + + * add `res.jsonp()`. Closes #1307 + * add "verbose errors" option to error-pages example + * add another route example to express(1) so people are not so confused + * add redis online user activity tracking example + * update connect dep + * fix etag quoting. Closes #1310 + * fix error-pages 404 status + * fix jsonp callback char restrictions + * remove old OPTIONS default response + +3.0.0rc3 / 2012-08-13 +================== + + * update connect dep + * fix signed cookies to work with `connect.cookieParser()` ("s:" prefix was missing) [tnydwrds] + * fix `res.render()` clobbering of "locals" + +3.0.0rc2 / 2012-08-03 +================== + + * add CORS example + * update connect dep + * deprecate `.createServer()` & remove old stale examples + * fix: escape `res.redirect()` link + * fix vhost example + +3.0.0rc1 / 2012-07-24 +================== + + * add more examples to view-locals + * add scheme-relative redirects (`res.redirect("//foo.com")`) support + * update cookie dep + * update connect dep + * update send dep + * fix `express(1)` -h flag, use -H for hogan. Closes #1245 + * fix `res.sendfile()` socket error handling regression + +3.0.0beta7 / 2012-07-16 +================== + + * update connect dep for `send()` root normalization regression + +3.0.0beta6 / 2012-07-13 +================== + + * add `err.view` property for view errors. Closes #1226 + * add "jsonp callback name" setting + * add support for "/foo/:bar*" non-greedy matches + * change `res.sendfile()` to use `send()` module + * change `res.send` to use "response-send" module + * remove `app.locals.use` and `res.locals.use`, use regular middleware + +3.0.0beta5 / 2012-07-03 +================== + + * add "make check" support + * add route-map example + * add `res.json(obj, status)` support back for BC + * add "methods" dep, remove internal methods module + * update connect dep + * update auth example to utilize cores pbkdf2 + * updated tests to use "supertest" + +3.0.0beta4 / 2012-06-25 +================== + + * Added `req.auth` + * Added `req.range(size)` + * Added `res.links(obj)` + * Added `res.send(body, status)` support back for backwards compat + * Added `.default()` support to `res.format()` + * Added 2xx / 304 check to `req.fresh` + * Revert "Added + support to the router" + * Fixed `res.send()` freshness check, respect res.statusCode + +3.0.0beta3 / 2012-06-15 +================== + + * Added hogan `--hjs` to express(1) [nullfirm] + * Added another example to content-negotiation + * Added `fresh` dep + * Changed: `res.send()` always checks freshness + * Fixed: expose connects mime module. Closes #1165 + +3.0.0beta2 / 2012-06-06 +================== + + * Added `+` support to the router + * Added `req.host` + * Changed `req.param()` to check route first + * Update connect dep + +3.0.0beta1 / 2012-06-01 +================== + + * Added `res.format()` callback to override default 406 behaviour + * Fixed `res.redirect()` 406. Closes #1154 + +3.0.0alpha5 / 2012-05-30 +================== + + * Added `req.ip` + * Added `{ signed: true }` option to `res.cookie()` + * Removed `res.signedCookie()` + * Changed: dont reverse `req.ips` + * Fixed "trust proxy" setting check for `req.ips` + +3.0.0alpha4 / 2012-05-09 +================== + + * Added: allow `[]` in jsonp callback. Closes #1128 + * Added `PORT` env var support in generated template. Closes #1118 [benatkin] + * Updated: connect 2.2.2 + +3.0.0alpha3 / 2012-05-04 +================== + + * Added public `app.routes`. Closes #887 + * Added _view-locals_ example + * Added _mvc_ example + * Added `res.locals.use()`. Closes #1120 + * Added conditional-GET support to `res.send()` + * Added: coerce `res.set()` values to strings + * Changed: moved `static()` in generated apps below router + * Changed: `res.send()` only set ETag when not previously set + * Changed connect 2.2.1 dep + * Changed: `make test` now runs unit / acceptance tests + * Fixed req/res proto inheritance + +3.0.0alpha2 / 2012-04-26 +================== + + * Added `make benchmark` back + * Added `res.send()` support for `String` objects + * Added client-side data exposing example + * Added `res.header()` and `req.header()` aliases for BC + * Added `express.createServer()` for BC + * Perf: memoize parsed urls + * Perf: connect 2.2.0 dep + * Changed: make `expressInit()` middleware self-aware + * Fixed: use app.get() for all core settings + * Fixed redis session example + * Fixed session example. Closes #1105 + * Fixed generated express dep. Closes #1078 + +3.0.0alpha1 / 2012-04-15 +================== + + * Added `app.locals.use(callback)` + * Added `app.locals` object + * Added `app.locals(obj)` + * Added `res.locals` object + * Added `res.locals(obj)` + * Added `res.format()` for content-negotiation + * Added `app.engine()` + * Added `res.cookie()` JSON cookie support + * Added "trust proxy" setting + * Added `req.subdomains` + * Added `req.protocol` + * Added `req.secure` + * Added `req.path` + * Added `req.ips` + * Added `req.fresh` + * Added `req.stale` + * Added comma-delimited / array support for `req.accepts()` + * Added debug instrumentation + * Added `res.set(obj)` + * Added `res.set(field, value)` + * Added `res.get(field)` + * Added `app.get(setting)`. Closes #842 + * Added `req.acceptsLanguage()` + * Added `req.acceptsCharset()` + * Added `req.accepted` + * Added `req.acceptedLanguages` + * Added `req.acceptedCharsets` + * Added "json replacer" setting + * Added "json spaces" setting + * Added X-Forwarded-Proto support to `res.redirect()`. Closes #92 + * Added `--less` support to express(1) + * Added `express.response` prototype + * Added `express.request` prototype + * Added `express.application` prototype + * Added `app.path()` + * Added `app.render()` + * Added `res.type()` to replace `res.contentType()` + * Changed: `res.redirect()` to add relative support + * Changed: enable "jsonp callback" by default + * Changed: renamed "case sensitive routes" to "case sensitive routing" + * Rewrite of all tests with mocha + * Removed "root" setting + * Removed `res.redirect('home')` support + * Removed `req.notify()` + * Removed `app.register()` + * Removed `app.redirect()` + * Removed `app.is()` + * Removed `app.helpers()` + * Removed `app.dynamicHelpers()` + * Fixed `res.sendfile()` with non-GET. Closes #723 + * Fixed express(1) public dir for windows. Closes #866 + +2.5.9/ 2012-04-02 +================== + + * Added support for PURGE request method [pbuyle] + * Fixed `express(1)` generated app `app.address()` before `listening` [mmalecki] + +2.5.8 / 2012-02-08 +================== + + * Update mkdirp dep. Closes #991 + +2.5.7 / 2012-02-06 +================== + + * Fixed `app.all` duplicate DELETE requests [mscdex] + +2.5.6 / 2012-01-13 +================== + + * Updated hamljs dev dep. Closes #953 + +2.5.5 / 2012-01-08 +================== + + * Fixed: set `filename` on cached templates [matthewleon] + +2.5.4 / 2012-01-02 +================== + + * Fixed `express(1)` eol on 0.4.x. Closes #947 + +2.5.3 / 2011-12-30 +================== + + * Fixed `req.is()` when a charset is present + +2.5.2 / 2011-12-10 +================== + + * Fixed: express(1) LF -> CRLF for windows + +2.5.1 / 2011-11-17 +================== + + * Changed: updated connect to 1.8.x + * Removed sass.js support from express(1) + +2.5.0 / 2011-10-24 +================== + + * Added ./routes dir for generated app by default + * Added npm install reminder to express(1) app gen + * Added 0.5.x support + * Removed `make test-cov` since it wont work with node 0.5.x + * Fixed express(1) public dir for windows. Closes #866 + +2.4.7 / 2011-10-05 +================== + + * Added mkdirp to express(1). Closes #795 + * Added simple _json-config_ example + * Added shorthand for the parsed request's pathname via `req.path` + * Changed connect dep to 1.7.x to fix npm issue... + * Fixed `res.redirect()` __HEAD__ support. [reported by xerox] + * Fixed `req.flash()`, only escape args + * Fixed absolute path checking on windows. Closes #829 [reported by andrewpmckenzie] + +2.4.6 / 2011-08-22 +================== + + * Fixed multiple param callback regression. Closes #824 [reported by TroyGoode] + +2.4.5 / 2011-08-19 +================== + + * Added support for routes to handle errors. Closes #809 + * Added `app.routes.all()`. Closes #803 + * Added "basepath" setting to work in conjunction with reverse proxies etc. + * Refactored `Route` to use a single array of callbacks + * Added support for multiple callbacks for `app.param()`. Closes #801 +Closes #805 + * Changed: removed .call(self) for route callbacks + * Dependency: `qs >= 0.3.1` + * Fixed `res.redirect()` on windows due to `join()` usage. Closes #808 + +2.4.4 / 2011-08-05 +================== + + * Fixed `res.header()` intention of a set, even when `undefined` + * Fixed `*`, value no longer required + * Fixed `res.send(204)` support. Closes #771 + +2.4.3 / 2011-07-14 +================== + + * Added docs for `status` option special-case. Closes #739 + * Fixed `options.filename`, exposing the view path to template engines + +2.4.2. / 2011-07-06 +================== + + * Revert "removed jsonp stripping" for XSS + +2.4.1 / 2011-07-06 +================== + + * Added `res.json()` JSONP support. Closes #737 + * Added _extending-templates_ example. Closes #730 + * Added "strict routing" setting for trailing slashes + * Added support for multiple envs in `app.configure()` calls. Closes #735 + * Changed: `res.send()` using `res.json()` + * Changed: when cookie `path === null` don't default it + * Changed; default cookie path to "home" setting. Closes #731 + * Removed _pids/logs_ creation from express(1) + +2.4.0 / 2011-06-28 +================== + + * Added chainable `res.status(code)` + * Added `res.json()`, an explicit version of `res.send(obj)` + * Added simple web-service example + +2.3.12 / 2011-06-22 +================== + + * \#express is now on freenode! come join! + * Added `req.get(field, param)` + * Added links to Japanese documentation, thanks @hideyukisaito! + * Added; the `express(1)` generated app outputs the env + * Added `content-negotiation` example + * Dependency: connect >= 1.5.1 < 2.0.0 + * Fixed view layout bug. Closes #720 + * Fixed; ignore body on 304. Closes #701 + +2.3.11 / 2011-06-04 +================== + + * Added `npm test` + * Removed generation of dummy test file from `express(1)` + * Fixed; `express(1)` adds express as a dep + * Fixed; prune on `prepublish` + +2.3.10 / 2011-05-27 +================== + + * Added `req.route`, exposing the current route + * Added _package.json_ generation support to `express(1)` + * Fixed call to `app.param()` function for optional params. Closes #682 + +2.3.9 / 2011-05-25 +================== + + * Fixed bug-ish with `../' in `res.partial()` calls + +2.3.8 / 2011-05-24 +================== + + * Fixed `app.options()` + +2.3.7 / 2011-05-23 +================== + + * Added route `Collection`, ex: `app.get('/user/:id').remove();` + * Added support for `app.param(fn)` to define param logic + * Removed `app.param()` support for callback with return value + * Removed module.parent check from express(1) generated app. Closes #670 + * Refactored router. Closes #639 + +2.3.6 / 2011-05-20 +================== + + * Changed; using devDependencies instead of git submodules + * Fixed redis session example + * Fixed markdown example + * Fixed view caching, should not be enabled in development + +2.3.5 / 2011-05-20 +================== + + * Added export `.view` as alias for `.View` + +2.3.4 / 2011-05-08 +================== + + * Added `./examples/say` + * Fixed `res.sendfile()` bug preventing the transfer of files with spaces + +2.3.3 / 2011-05-03 +================== + + * Added "case sensitive routes" option. + * Changed; split methods supported per rfc [slaskis] + * Fixed route-specific middleware when using the same callback function several times + +2.3.2 / 2011-04-27 +================== + + * Fixed view hints + +2.3.1 / 2011-04-26 +================== + + * Added `app.match()` as `app.match.all()` + * Added `app.lookup()` as `app.lookup.all()` + * Added `app.remove()` for `app.remove.all()` + * Added `app.remove.VERB()` + * Fixed template caching collision issue. Closes #644 + * Moved router over from connect and started refactor + +2.3.0 / 2011-04-25 +================== + + * Added options support to `res.clearCookie()` + * Added `res.helpers()` as alias of `res.locals()` + * Added; json defaults to UTF-8 with `res.send()`. Closes #632. [Daniel * Dependency `connect >= 1.4.0` + * Changed; auto set Content-Type in res.attachement [Aaron Heckmann] + * Renamed "cache views" to "view cache". Closes #628 + * Fixed caching of views when using several apps. Closes #637 + * Fixed gotcha invoking `app.param()` callbacks once per route middleware. +Closes #638 + * Fixed partial lookup precedence. Closes #631 +Shaw] + +2.2.2 / 2011-04-12 +================== + + * Added second callback support for `res.download()` connection errors + * Fixed `filename` option passing to template engine + +2.2.1 / 2011-04-04 +================== + + * Added `layout(path)` helper to change the layout within a view. Closes #610 + * Fixed `partial()` collection object support. + Previously only anything with `.length` would work. + When `.length` is present one must still be aware of holes, + however now `{ collection: {foo: 'bar'}}` is valid, exposes + `keyInCollection` and `keysInCollection`. + + * Performance improved with better view caching + * Removed `request` and `response` locals + * Changed; errorHandler page title is now `Express` instead of `Connect` + +2.2.0 / 2011-03-30 +================== + + * Added `app.lookup.VERB()`, ex `app.lookup.put('/user/:id')`. Closes #606 + * Added `app.match.VERB()`, ex `app.match.put('/user/12')`. Closes #606 + * Added `app.VERB(path)` as alias of `app.lookup.VERB()`. + * Dependency `connect >= 1.2.0` + +2.1.1 / 2011-03-29 +================== + + * Added; expose `err.view` object when failing to locate a view + * Fixed `res.partial()` call `next(err)` when no callback is given [reported by aheckmann] + * Fixed; `res.send(undefined)` responds with 204 [aheckmann] + +2.1.0 / 2011-03-24 +================== + + * Added `/_?` partial lookup support. Closes #447 + * Added `request`, `response`, and `app` local variables + * Added `settings` local variable, containing the app's settings + * Added `req.flash()` exception if `req.session` is not available + * Added `res.send(bool)` support (json response) + * Fixed stylus example for latest version + * Fixed; wrap try/catch around `res.render()` + +2.0.0 / 2011-03-17 +================== + + * Fixed up index view path alternative. + * Changed; `res.locals()` without object returns the locals + +2.0.0rc3 / 2011-03-17 +================== + + * Added `res.locals(obj)` to compliment `res.local(key, val)` + * Added `res.partial()` callback support + * Fixed recursive error reporting issue in `res.render()` + +2.0.0rc2 / 2011-03-17 +================== + + * Changed; `partial()` "locals" are now optional + * Fixed `SlowBuffer` support. Closes #584 [reported by tyrda01] + * Fixed .filename view engine option [reported by drudge] + * Fixed blog example + * Fixed `{req,res}.app` reference when mounting [Ben Weaver] + +2.0.0rc / 2011-03-14 +================== + + * Fixed; expose `HTTPSServer` constructor + * Fixed express(1) default test charset. Closes #579 [reported by secoif] + * Fixed; default charset to utf-8 instead of utf8 for lame IE [reported by NickP] + +2.0.0beta3 / 2011-03-09 +================== + + * Added support for `res.contentType()` literal + The original `res.contentType('.json')`, + `res.contentType('application/json')`, and `res.contentType('json')` + will work now. + * Added `res.render()` status option support back + * Added charset option for `res.render()` + * Added `.charset` support (via connect 1.0.4) + * Added view resolution hints when in development and a lookup fails + * Added layout lookup support relative to the page view. + For example while rendering `./views/user/index.jade` if you create + `./views/user/layout.jade` it will be used in favour of the root layout. + * Fixed `res.redirect()`. RFC states absolute url [reported by unlink] + * Fixed; default `res.send()` string charset to utf8 + * Removed `Partial` constructor (not currently used) + +2.0.0beta2 / 2011-03-07 +================== + + * Added res.render() `.locals` support back to aid in migration process + * Fixed flash example + +2.0.0beta / 2011-03-03 +================== + + * Added HTTPS support + * Added `res.cookie()` maxAge support + * Added `req.header()` _Referrer_ / _Referer_ special-case, either works + * Added mount support for `res.redirect()`, now respects the mount-point + * Added `union()` util, taking place of `merge(clone())` combo + * Added stylus support to express(1) generated app + * Added secret to session middleware used in examples and generated app + * Added `res.local(name, val)` for progressive view locals + * Added default param support to `req.param(name, default)` + * Added `app.disabled()` and `app.enabled()` + * Added `app.register()` support for omitting leading ".", either works + * Added `res.partial()`, using the same interface as `partial()` within a view. Closes #539 + * Added `app.param()` to map route params to async/sync logic + * Added; aliased `app.helpers()` as `app.locals()`. Closes #481 + * Added extname with no leading "." support to `res.contentType()` + * Added `cache views` setting, defaulting to enabled in "production" env + * Added index file partial resolution, eg: partial('user') may try _views/user/index.jade_. + * Added `req.accepts()` support for extensions + * Changed; `res.download()` and `res.sendfile()` now utilize Connect's + static file server `connect.static.send()`. + * Changed; replaced `connect.utils.mime()` with npm _mime_ module + * Changed; allow `req.query` to be pre-defined (via middleware or other parent + * Changed view partial resolution, now relative to parent view + * Changed view engine signature. no longer `engine.render(str, options, callback)`, now `engine.compile(str, options) -> Function`, the returned function accepts `fn(locals)`. + * Fixed `req.param()` bug returning Array.prototype methods. Closes #552 + * Fixed; using `Stream#pipe()` instead of `sys.pump()` in `res.sendfile()` + * Fixed; using _qs_ module instead of _querystring_ + * Fixed; strip unsafe chars from jsonp callbacks + * Removed "stream threshold" setting + +1.0.8 / 2011-03-01 +================== + + * Allow `req.query` to be pre-defined (via middleware or other parent app) + * "connect": ">= 0.5.0 < 1.0.0". Closes #547 + * Removed the long deprecated __EXPRESS_ENV__ support + +1.0.7 / 2011-02-07 +================== + + * Fixed `render()` setting inheritance. + Mounted apps would not inherit "view engine" + +1.0.6 / 2011-02-07 +================== + + * Fixed `view engine` setting bug when period is in dirname + +1.0.5 / 2011-02-05 +================== + + * Added secret to generated app `session()` call + +1.0.4 / 2011-02-05 +================== + + * Added `qs` dependency to _package.json_ + * Fixed namespaced `require()`s for latest connect support + +1.0.3 / 2011-01-13 +================== + + * Remove unsafe characters from JSONP callback names [Ryan Grove] + +1.0.2 / 2011-01-10 +================== + + * Removed nested require, using `connect.router` + +1.0.1 / 2010-12-29 +================== + + * Fixed for middleware stacked via `createServer()` + previously the `foo` middleware passed to `createServer(foo)` + would not have access to Express methods such as `res.send()` + or props like `req.query` etc. + +1.0.0 / 2010-11-16 +================== + + * Added; deduce partial object names from the last segment. + For example by default `partial('forum/post', postObject)` will + give you the _post_ object, providing a meaningful default. + * Added http status code string representation to `res.redirect()` body + * Added; `res.redirect()` supporting _text/plain_ and _text/html_ via __Accept__. + * Added `req.is()` to aid in content negotiation + * Added partial local inheritance [suggested by masylum]. Closes #102 + providing access to parent template locals. + * Added _-s, --session[s]_ flag to express(1) to add session related middleware + * Added _--template_ flag to express(1) to specify the + template engine to use. + * Added _--css_ flag to express(1) to specify the + stylesheet engine to use (or just plain css by default). + * Added `app.all()` support [thanks aheckmann] + * Added partial direct object support. + You may now `partial('user', user)` providing the "user" local, + vs previously `partial('user', { object: user })`. + * Added _route-separation_ example since many people question ways + to do this with CommonJS modules. Also view the _blog_ example for + an alternative. + * Performance; caching view path derived partial object names + * Fixed partial local inheritance precedence. [reported by Nick Poulden] Closes #454 + * Fixed jsonp support; _text/javascript_ as per mailinglist discussion + +1.0.0rc4 / 2010-10-14 +================== + + * Added _NODE_ENV_ support, _EXPRESS_ENV_ is deprecated and will be removed in 1.0.0 + * Added route-middleware support (very helpful, see the [docs](http://expressjs.com/guide.html#Route-Middleware)) + * Added _jsonp callback_ setting to enable/disable jsonp autowrapping [Dav Glass] + * Added callback query check on response.send to autowrap JSON objects for simple webservice implementations [Dav Glass] + * Added `partial()` support for array-like collections. Closes #434 + * Added support for swappable querystring parsers + * Added session usage docs. Closes #443 + * Added dynamic helper caching. Closes #439 [suggested by maritz] + * Added authentication example + * Added basic Range support to `res.sendfile()` (and `res.download()` etc) + * Changed; `express(1)` generated app using 2 spaces instead of 4 + * Default env to "development" again [aheckmann] + * Removed _context_ option is no more, use "scope" + * Fixed; exposing _./support_ libs to examples so they can run without installs + * Fixed mvc example + +1.0.0rc3 / 2010-09-20 +================== + + * Added confirmation for `express(1)` app generation. Closes #391 + * Added extending of flash formatters via `app.flashFormatters` + * Added flash formatter support. Closes #411 + * Added streaming support to `res.sendfile()` using `sys.pump()` when >= "stream threshold" + * Added _stream threshold_ setting for `res.sendfile()` + * Added `res.send()` __HEAD__ support + * Added `res.clearCookie()` + * Added `res.cookie()` + * Added `res.render()` headers option + * Added `res.redirect()` response bodies + * Added `res.render()` status option support. Closes #425 [thanks aheckmann] + * Fixed `res.sendfile()` responding with 403 on malicious path + * Fixed `res.download()` bug; when an error occurs remove _Content-Disposition_ + * Fixed; mounted apps settings now inherit from parent app [aheckmann] + * Fixed; stripping Content-Length / Content-Type when 204 + * Fixed `res.send()` 204. Closes #419 + * Fixed multiple _Set-Cookie_ headers via `res.header()`. Closes #402 + * Fixed bug messing with error handlers when `listenFD()` is called instead of `listen()`. [thanks guillermo] + + +1.0.0rc2 / 2010-08-17 +================== + + * Added `app.register()` for template engine mapping. Closes #390 + * Added `res.render()` callback support as second argument (no options) + * Added callback support to `res.download()` + * Added callback support for `res.sendfile()` + * Added support for middleware access via `express.middlewareName()` vs `connect.middlewareName()` + * Added "partials" setting to docs + * Added default expresso tests to `express(1)` generated app. Closes #384 + * Fixed `res.sendfile()` error handling, defer via `next()` + * Fixed `res.render()` callback when a layout is used [thanks guillermo] + * Fixed; `make install` creating ~/.node_libraries when not present + * Fixed issue preventing error handlers from being defined anywhere. Closes #387 + +1.0.0rc / 2010-07-28 +================== + + * Added mounted hook. Closes #369 + * Added connect dependency to _package.json_ + + * Removed "reload views" setting and support code + development env never caches, production always caches. + + * Removed _param_ in route callbacks, signature is now + simply (req, res, next), previously (req, res, params, next). + Use _req.params_ for path captures, _req.query_ for GET params. + + * Fixed "home" setting + * Fixed middleware/router precedence issue. Closes #366 + * Fixed; _configure()_ callbacks called immediately. Closes #368 + +1.0.0beta2 / 2010-07-23 +================== + + * Added more examples + * Added; exporting `Server` constructor + * Added `Server#helpers()` for view locals + * Added `Server#dynamicHelpers()` for dynamic view locals. Closes #349 + * Added support for absolute view paths + * Added; _home_ setting defaults to `Server#route` for mounted apps. Closes #363 + * Added Guillermo Rauch to the contributor list + * Added support for "as" for non-collection partials. Closes #341 + * Fixed _install.sh_, ensuring _~/.node_libraries_ exists. Closes #362 [thanks jf] + * Fixed `res.render()` exceptions, now passed to `next()` when no callback is given [thanks guillermo] + * Fixed instanceof `Array` checks, now `Array.isArray()` + * Fixed express(1) expansion of public dirs. Closes #348 + * Fixed middleware precedence. Closes #345 + * Fixed view watcher, now async [thanks aheckmann] + +1.0.0beta / 2010-07-15 +================== + + * Re-write + - much faster + - much lighter + - Check [ExpressJS.com](http://expressjs.com) for migration guide and updated docs + +0.14.0 / 2010-06-15 +================== + + * Utilize relative requires + * Added Static bufferSize option [aheckmann] + * Fixed caching of view and partial subdirectories [aheckmann] + * Fixed mime.type() comments now that ".ext" is not supported + * Updated haml submodule + * Updated class submodule + * Removed bin/express + +0.13.0 / 2010-06-01 +================== + + * Added node v0.1.97 compatibility + * Added support for deleting cookies via Request#cookie('key', null) + * Updated haml submodule + * Fixed not-found page, now using using charset utf-8 + * Fixed show-exceptions page, now using using charset utf-8 + * Fixed view support due to fs.readFile Buffers + * Changed; mime.type() no longer accepts ".type" due to node extname() changes + +0.12.0 / 2010-05-22 +================== + + * Added node v0.1.96 compatibility + * Added view `helpers` export which act as additional local variables + * Updated haml submodule + * Changed ETag; removed inode, modified time only + * Fixed LF to CRLF for setting multiple cookies + * Fixed cookie complation; values are now urlencoded + * Fixed cookies parsing; accepts quoted values and url escaped cookies + +0.11.0 / 2010-05-06 +================== + + * Added support for layouts using different engines + - this.render('page.html.haml', { layout: 'super-cool-layout.html.ejs' }) + - this.render('page.html.haml', { layout: 'foo' }) // assumes 'foo.html.haml' + - this.render('page.html.haml', { layout: false }) // no layout + * Updated ext submodule + * Updated haml submodule + * Fixed EJS partial support by passing along the context. Issue #307 + +0.10.1 / 2010-05-03 +================== + + * Fixed binary uploads. + +0.10.0 / 2010-04-30 +================== + + * Added charset support via Request#charset (automatically assigned to 'UTF-8' when respond()'s + encoding is set to 'utf8' or 'utf-8'. + * Added "encoding" option to Request#render(). Closes #299 + * Added "dump exceptions" setting, which is enabled by default. + * Added simple ejs template engine support + * Added error response support for text/plain, application/json. Closes #297 + * Added callback function param to Request#error() + * Added Request#sendHead() + * Added Request#stream() + * Added support for Request#respond(304, null) for empty response bodies + * Added ETag support to Request#sendfile() + * Added options to Request#sendfile(), passed to fs.createReadStream() + * Added filename arg to Request#download() + * Performance enhanced due to pre-reversing plugins so that plugins.reverse() is not called on each request + * Performance enhanced by preventing several calls to toLowerCase() in Router#match() + * Changed; Request#sendfile() now streams + * Changed; Renamed Request#halt() to Request#respond(). Closes #289 + * Changed; Using sys.inspect() instead of JSON.encode() for error output + * Changed; run() returns the http.Server instance. Closes #298 + * Changed; Defaulting Server#host to null (INADDR_ANY) + * Changed; Logger "common" format scale of 0.4f + * Removed Logger "request" format + * Fixed; Catching ENOENT in view caching, preventing error when "views/partials" is not found + * Fixed several issues with http client + * Fixed Logger Content-Length output + * Fixed bug preventing Opera from retaining the generated session id. Closes #292 + +0.9.0 / 2010-04-14 +================== + + * Added DSL level error() route support + * Added DSL level notFound() route support + * Added Request#error() + * Added Request#notFound() + * Added Request#render() callback function. Closes #258 + * Added "max upload size" setting + * Added "magic" variables to collection partials (\_\_index\_\_, \_\_length\_\_, \_\_isFirst\_\_, \_\_isLast\_\_). Closes #254 + * Added [haml.js](http://github.com/visionmedia/haml.js) submodule; removed haml-js + * Added callback function support to Request#halt() as 3rd/4th arg + * Added preprocessing of route param wildcards using param(). Closes #251 + * Added view partial support (with collections etc) + * Fixed bug preventing falsey params (such as ?page=0). Closes #286 + * Fixed setting of multiple cookies. Closes #199 + * Changed; view naming convention is now NAME.TYPE.ENGINE (for example page.html.haml) + * Changed; session cookie is now httpOnly + * Changed; Request is no longer global + * Changed; Event is no longer global + * Changed; "sys" module is no longer global + * Changed; moved Request#download to Static plugin where it belongs + * Changed; Request instance created before body parsing. Closes #262 + * Changed; Pre-caching views in memory when "cache view contents" is enabled. Closes #253 + * Changed; Pre-caching view partials in memory when "cache view partials" is enabled + * Updated support to node --version 0.1.90 + * Updated dependencies + * Removed set("session cookie") in favour of use(Session, { cookie: { ... }}) + * Removed utils.mixin(); use Object#mergeDeep() + +0.8.0 / 2010-03-19 +================== + + * Added coffeescript example app. Closes #242 + * Changed; cache api now async friendly. Closes #240 + * Removed deprecated 'express/static' support. Use 'express/plugins/static' + +0.7.6 / 2010-03-19 +================== + + * Added Request#isXHR. Closes #229 + * Added `make install` (for the executable) + * Added `express` executable for setting up simple app templates + * Added "GET /public/*" to Static plugin, defaulting to /public + * Added Static plugin + * Fixed; Request#render() only calls cache.get() once + * Fixed; Namespacing View caches with "view:" + * Fixed; Namespacing Static caches with "static:" + * Fixed; Both example apps now use the Static plugin + * Fixed set("views"). Closes #239 + * Fixed missing space for combined log format + * Deprecated Request#sendfile() and 'express/static' + * Removed Server#running + +0.7.5 / 2010-03-16 +================== + + * Added Request#flash() support without args, now returns all flashes + * Updated ext submodule + +0.7.4 / 2010-03-16 +================== + + * Fixed session reaper + * Changed; class.js replacing js-oo Class implementation (quite a bit faster, no browser cruft) + +0.7.3 / 2010-03-16 +================== + + * Added package.json + * Fixed requiring of haml / sass due to kiwi removal + +0.7.2 / 2010-03-16 +================== + + * Fixed GIT submodules (HAH!) + +0.7.1 / 2010-03-16 +================== + + * Changed; Express now using submodules again until a PM is adopted + * Changed; chat example using millisecond conversions from ext + +0.7.0 / 2010-03-15 +================== + + * Added Request#pass() support (finds the next matching route, or the given path) + * Added Logger plugin (default "common" format replaces CommonLogger) + * Removed Profiler plugin + * Removed CommonLogger plugin + +0.6.0 / 2010-03-11 +================== + + * Added seed.yml for kiwi package management support + * Added HTTP client query string support when method is GET. Closes #205 + + * Added support for arbitrary view engines. + For example "foo.engine.html" will now require('engine'), + the exports from this module are cached after the first require(). + + * Added async plugin support + + * Removed usage of RESTful route funcs as http client + get() etc, use http.get() and friends + + * Removed custom exceptions + +0.5.0 / 2010-03-10 +================== + + * Added ext dependency (library of js extensions) + * Removed extname() / basename() utils. Use path module + * Removed toArray() util. Use arguments.values + * Removed escapeRegexp() util. Use RegExp.escape() + * Removed process.mixin() dependency. Use utils.mixin() + * Removed Collection + * Removed ElementCollection + * Shameless self promotion of ebook "Advanced JavaScript" (http://dev-mag.com) ;) + +0.4.0 / 2010-02-11 +================== + + * Added flash() example to sample upload app + * Added high level restful http client module (express/http) + * Changed; RESTful route functions double as HTTP clients. Closes #69 + * Changed; throwing error when routes are added at runtime + * Changed; defaulting render() context to the current Request. Closes #197 + * Updated haml submodule + +0.3.0 / 2010-02-11 +================== + + * Updated haml / sass submodules. Closes #200 + * Added flash message support. Closes #64 + * Added accepts() now allows multiple args. fixes #117 + * Added support for plugins to halt. Closes #189 + * Added alternate layout support. Closes #119 + * Removed Route#run(). Closes #188 + * Fixed broken specs due to use(Cookie) missing + +0.2.1 / 2010-02-05 +================== + + * Added "plot" format option for Profiler (for gnuplot processing) + * Added request number to Profiler plugin + * Fixed binary encoding for multi-part file uploads, was previously defaulting to UTF8 + * Fixed issue with routes not firing when not files are present. Closes #184 + * Fixed process.Promise -> events.Promise + +0.2.0 / 2010-02-03 +================== + + * Added parseParam() support for name[] etc. (allows for file inputs with "multiple" attr) Closes #180 + * Added Both Cache and Session option "reapInterval" may be "reapEvery". Closes #174 + * Added expiration support to cache api with reaper. Closes #133 + * Added cache Store.Memory#reap() + * Added Cache; cache api now uses first class Cache instances + * Added abstract session Store. Closes #172 + * Changed; cache Memory.Store#get() utilizing Collection + * Renamed MemoryStore -> Store.Memory + * Fixed use() of the same plugin several time will always use latest options. Closes #176 + +0.1.0 / 2010-02-03 +================== + + * Changed; Hooks (before / after) pass request as arg as well as evaluated in their context + * Updated node support to 0.1.27 Closes #169 + * Updated dirname(__filename) -> __dirname + * Updated libxmljs support to v0.2.0 + * Added session support with memory store / reaping + * Added quick uid() helper + * Added multi-part upload support + * Added Sass.js support / submodule + * Added production env caching view contents and static files + * Added static file caching. Closes #136 + * Added cache plugin with memory stores + * Added support to StaticFile so that it works with non-textual files. + * Removed dirname() helper + * Removed several globals (now their modules must be required) + +0.0.2 / 2010-01-10 +================== + + * Added view benchmarks; currently haml vs ejs + * Added Request#attachment() specs. Closes #116 + * Added use of node's parseQuery() util. Closes #123 + * Added `make init` for submodules + * Updated Haml + * Updated sample chat app to show messages on load + * Updated libxmljs parseString -> parseHtmlString + * Fixed `make init` to work with older versions of git + * Fixed specs can now run independent specs for those who cant build deps. Closes #127 + * Fixed issues introduced by the node url module changes. Closes 126. + * Fixed two assertions failing due to Collection#keys() returning strings + * Fixed faulty Collection#toArray() spec due to keys() returning strings + * Fixed `make test` now builds libxmljs.node before testing + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/express/LICENSE b/node_modules/express/LICENSE new file mode 100644 index 0000000..aa927e4 --- /dev/null +++ b/node_modules/express/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2009-2014 TJ Holowaychuk +Copyright (c) 2013-2014 Roman Shtylman +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/express/Readme.md b/node_modules/express/Readme.md new file mode 100644 index 0000000..e9bfaeb --- /dev/null +++ b/node_modules/express/Readme.md @@ -0,0 +1,142 @@ +[![Express Logo](https://i.cloudup.com/zfY6lL7eFa-3000x3000.png)](http://expressjs.com/) + + Fast, unopinionated, minimalist web framework for [node](http://nodejs.org). + + [![NPM Version][npm-image]][npm-url] + [![NPM Downloads][downloads-image]][downloads-url] + [![Linux Build][travis-image]][travis-url] + [![Windows Build][appveyor-image]][appveyor-url] + [![Test Coverage][coveralls-image]][coveralls-url] + +```js +var express = require('express') +var app = express() + +app.get('/', function (req, res) { + res.send('Hello World') +}) + +app.listen(3000) +``` + +## Installation + +```bash +$ npm install express +``` + +## Features + + * Robust routing + * Focus on high performance + * Super-high test coverage + * HTTP helpers (redirection, caching, etc) + * View system supporting 14+ template engines + * Content negotiation + * Executable for generating applications quickly + +## Docs & Community + + * [Website and Documentation](http://expressjs.com/) - [[website repo](https://github.com/strongloop/expressjs.com)] + * [#express](https://webchat.freenode.net/?channels=express) on freenode IRC + * [Github Organization](https://github.com/expressjs) for Official Middleware & Modules + * Visit the [Wiki](https://github.com/expressjs/express/wiki) + * [Google Group](https://groups.google.com/group/express-js) for discussion + * [Gitter](https://gitter.im/expressjs/express) for support and discussion + * [Русскоязычная документация](http://jsman.ru/express/) + +**PROTIP** Be sure to read [Migrating from 3.x to 4.x](https://github.com/expressjs/express/wiki/Migrating-from-3.x-to-4.x) as well as [New features in 4.x](https://github.com/expressjs/express/wiki/New-features-in-4.x). + +###Security Issues + +If you discover a security vulnerability in Express, please see [Security Policies and Procedures](Security.md). + +## Quick Start + + The quickest way to get started with express is to utilize the executable [`express(1)`](https://github.com/expressjs/generator) to generate an application as shown below: + + Install the executable. The executable's major version will match Express's: + +```bash +$ npm install -g express-generator@4 +``` + + Create the app: + +```bash +$ express /tmp/foo && cd /tmp/foo +``` + + Install dependencies: + +```bash +$ npm install +``` + + Start the server: + +```bash +$ npm start +``` + +## Philosophy + + The Express philosophy is to provide small, robust tooling for HTTP servers, making + it a great solution for single page applications, web sites, hybrids, or public + HTTP APIs. + + Express does not force you to use any specific ORM or template engine. With support for over + 14 template engines via [Consolidate.js](https://github.com/tj/consolidate.js), + you can quickly craft your perfect framework. + +## Examples + + To view the examples, clone the Express repo and install the dependencies: + +```bash +$ git clone git://github.com/expressjs/express.git --depth 1 +$ cd express +$ npm install +``` + + Then run whichever example you want: + +```bash +$ node examples/content-negotiation +``` + +## Tests + + To run the test suite, first install the dependencies, then run `npm test`: + +```bash +$ npm install +$ npm test +``` + +## People + +The original author of Express is [TJ Holowaychuk](https://github.com/tj) [![TJ's Gratipay][gratipay-image-visionmedia]][gratipay-url-visionmedia] + +The current lead maintainer is [Douglas Christopher Wilson](https://github.com/dougwilson) [![Doug's Gratipay][gratipay-image-dougwilson]][gratipay-url-dougwilson] + +[List of all contributors](https://github.com/expressjs/express/graphs/contributors) + +## License + + [MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/express.svg +[npm-url]: https://npmjs.org/package/express +[downloads-image]: https://img.shields.io/npm/dm/express.svg +[downloads-url]: https://npmjs.org/package/express +[travis-image]: https://img.shields.io/travis/expressjs/express/master.svg?label=linux +[travis-url]: https://travis-ci.org/expressjs/express +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/express/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/express +[coveralls-image]: https://img.shields.io/coveralls/expressjs/express/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/express?branch=master +[gratipay-image-visionmedia]: https://img.shields.io/gratipay/visionmedia.svg +[gratipay-url-visionmedia]: https://gratipay.com/visionmedia/ +[gratipay-image-dougwilson]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url-dougwilson]: https://gratipay.com/dougwilson/ diff --git a/node_modules/express/index.js b/node_modules/express/index.js new file mode 100644 index 0000000..d219b0c --- /dev/null +++ b/node_modules/express/index.js @@ -0,0 +1,11 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +module.exports = require('./lib/express'); diff --git a/node_modules/express/lib/application.js b/node_modules/express/lib/application.js new file mode 100644 index 0000000..0ee4def --- /dev/null +++ b/node_modules/express/lib/application.js @@ -0,0 +1,643 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var finalhandler = require('finalhandler'); +var Router = require('./router'); +var methods = require('methods'); +var middleware = require('./middleware/init'); +var query = require('./middleware/query'); +var debug = require('debug')('express:application'); +var View = require('./view'); +var http = require('http'); +var compileETag = require('./utils').compileETag; +var compileQueryParser = require('./utils').compileQueryParser; +var compileTrust = require('./utils').compileTrust; +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var merge = require('utils-merge'); +var resolve = require('path').resolve; +var slice = Array.prototype.slice; + +/** + * Application prototype. + */ + +var app = exports = module.exports = {}; + +/** + * Variable for trust proxy inheritance back-compat + * @private + */ + +var trustProxyDefaultSymbol = '@@symbol:trust_proxy_default'; + +/** + * Initialize the server. + * + * - setup default configuration + * - setup default middleware + * - setup route reflection methods + * + * @private + */ + +app.init = function init() { + this.cache = {}; + this.engines = {}; + this.settings = {}; + + this.defaultConfiguration(); +}; + +/** + * Initialize application configuration. + * @private + */ + +app.defaultConfiguration = function defaultConfiguration() { + var env = process.env.NODE_ENV || 'development'; + + // default settings + this.enable('x-powered-by'); + this.set('etag', 'weak'); + this.set('env', env); + this.set('query parser', 'extended'); + this.set('subdomain offset', 2); + this.set('trust proxy', false); + + // trust proxy inherit back-compat + Object.defineProperty(this.settings, trustProxyDefaultSymbol, { + configurable: true, + value: true + }); + + debug('booting in %s mode', env); + + this.on('mount', function onmount(parent) { + // inherit trust proxy + if (this.settings[trustProxyDefaultSymbol] === true + && typeof parent.settings['trust proxy fn'] === 'function') { + delete this.settings['trust proxy']; + delete this.settings['trust proxy fn']; + } + + // inherit protos + this.request.__proto__ = parent.request; + this.response.__proto__ = parent.response; + this.engines.__proto__ = parent.engines; + this.settings.__proto__ = parent.settings; + }); + + // setup locals + this.locals = Object.create(null); + + // top-most app is mounted at / + this.mountpath = '/'; + + // default locals + this.locals.settings = this.settings; + + // default configuration + this.set('view', View); + this.set('views', resolve('views')); + this.set('jsonp callback name', 'callback'); + + if (env === 'production') { + this.enable('view cache'); + } + + Object.defineProperty(this, 'router', { + get: function() { + throw new Error('\'app.router\' is deprecated!\nPlease see the 3.x to 4.x migration guide for details on how to update your app.'); + } + }); +}; + +/** + * lazily adds the base router if it has not yet been added. + * + * We cannot add the base router in the defaultConfiguration because + * it reads app settings which might be set after that has run. + * + * @private + */ +app.lazyrouter = function lazyrouter() { + if (!this._router) { + this._router = new Router({ + caseSensitive: this.enabled('case sensitive routing'), + strict: this.enabled('strict routing') + }); + + this._router.use(query(this.get('query parser fn'))); + this._router.use(middleware.init(this)); + } +}; + +/** + * Dispatch a req, res pair into the application. Starts pipeline processing. + * + * If no callback is provided, then default error handlers will respond + * in the event of an error bubbling through the stack. + * + * @private + */ + +app.handle = function handle(req, res, callback) { + var router = this._router; + + // final handler + var done = callback || finalhandler(req, res, { + env: this.get('env'), + onerror: logerror.bind(this) + }); + + // no routes + if (!router) { + debug('no routes defined on app'); + done(); + return; + } + + router.handle(req, res, done); +}; + +/** + * Proxy `Router#use()` to add middleware to the app router. + * See Router#use() documentation for details. + * + * If the _fn_ parameter is an express app, then it will be + * mounted at the _route_ specified. + * + * @public + */ + +app.use = function use(fn) { + var offset = 0; + var path = '/'; + + // default path to '/' + // disambiguate app.use([fn]) + if (typeof fn !== 'function') { + var arg = fn; + + while (Array.isArray(arg) && arg.length !== 0) { + arg = arg[0]; + } + + // first arg is the path + if (typeof arg !== 'function') { + offset = 1; + path = fn; + } + } + + var fns = flatten(slice.call(arguments, offset)); + + if (fns.length === 0) { + throw new TypeError('app.use() requires middleware functions'); + } + + // setup router + this.lazyrouter(); + var router = this._router; + + fns.forEach(function (fn) { + // non-express app + if (!fn || !fn.handle || !fn.set) { + return router.use(path, fn); + } + + debug('.use app under %s', path); + fn.mountpath = path; + fn.parent = this; + + // restore .app property on req and res + router.use(path, function mounted_app(req, res, next) { + var orig = req.app; + fn.handle(req, res, function (err) { + req.__proto__ = orig.request; + res.__proto__ = orig.response; + next(err); + }); + }); + + // mounted an app + fn.emit('mount', this); + }, this); + + return this; +}; + +/** + * Proxy to the app `Router#route()` + * Returns a new `Route` instance for the _path_. + * + * Routes are isolated middleware stacks for specific paths. + * See the Route api docs for details. + * + * @public + */ + +app.route = function route(path) { + this.lazyrouter(); + return this._router.route(path); +}; + +/** + * Register the given template engine callback `fn` + * as `ext`. + * + * By default will `require()` the engine based on the + * file extension. For example if you try to render + * a "foo.jade" file Express will invoke the following internally: + * + * app.engine('jade', require('jade').__express); + * + * For engines that do not provide `.__express` out of the box, + * or if you wish to "map" a different extension to the template engine + * you may use this method. For example mapping the EJS template engine to + * ".html" files: + * + * app.engine('html', require('ejs').renderFile); + * + * In this case EJS provides a `.renderFile()` method with + * the same signature that Express expects: `(path, options, callback)`, + * though note that it aliases this method as `ejs.__express` internally + * so if you're using ".ejs" extensions you dont need to do anything. + * + * Some template engines do not follow this convention, the + * [Consolidate.js](https://github.com/tj/consolidate.js) + * library was created to map all of node's popular template + * engines to follow this convention, thus allowing them to + * work seamlessly within Express. + * + * @param {String} ext + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +app.engine = function engine(ext, fn) { + if (typeof fn !== 'function') { + throw new Error('callback function required'); + } + + // get file extension + var extension = ext[0] !== '.' + ? '.' + ext + : ext; + + // store engine + this.engines[extension] = fn; + + return this; +}; + +/** + * Proxy to `Router#param()` with one added api feature. The _name_ parameter + * can be an array of names. + * + * See the Router#param() docs for more details. + * + * @param {String|Array} name + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +app.param = function param(name, fn) { + this.lazyrouter(); + + if (Array.isArray(name)) { + for (var i = 0; i < name.length; i++) { + this.param(name[i], fn); + } + + return this; + } + + this._router.param(name, fn); + + return this; +}; + +/** + * Assign `setting` to `val`, or return `setting`'s value. + * + * app.set('foo', 'bar'); + * app.get('foo'); + * // => "bar" + * + * Mounted servers inherit their parent server's settings. + * + * @param {String} setting + * @param {*} [val] + * @return {Server} for chaining + * @public + */ + +app.set = function set(setting, val) { + if (arguments.length === 1) { + // app.get(setting) + return this.settings[setting]; + } + + debug('set "%s" to %o', setting, val); + + // set value + this.settings[setting] = val; + + // trigger matched settings + switch (setting) { + case 'etag': + this.set('etag fn', compileETag(val)); + break; + case 'query parser': + this.set('query parser fn', compileQueryParser(val)); + break; + case 'trust proxy': + this.set('trust proxy fn', compileTrust(val)); + + // trust proxy inherit back-compat + Object.defineProperty(this.settings, trustProxyDefaultSymbol, { + configurable: true, + value: false + }); + + break; + } + + return this; +}; + +/** + * Return the app's absolute pathname + * based on the parent(s) that have + * mounted it. + * + * For example if the application was + * mounted as "/admin", which itself + * was mounted as "/blog" then the + * return value would be "/blog/admin". + * + * @return {String} + * @private + */ + +app.path = function path() { + return this.parent + ? this.parent.path() + this.mountpath + : ''; +}; + +/** + * Check if `setting` is enabled (truthy). + * + * app.enabled('foo') + * // => false + * + * app.enable('foo') + * app.enabled('foo') + * // => true + * + * @param {String} setting + * @return {Boolean} + * @public + */ + +app.enabled = function enabled(setting) { + return Boolean(this.set(setting)); +}; + +/** + * Check if `setting` is disabled. + * + * app.disabled('foo') + * // => true + * + * app.enable('foo') + * app.disabled('foo') + * // => false + * + * @param {String} setting + * @return {Boolean} + * @public + */ + +app.disabled = function disabled(setting) { + return !this.set(setting); +}; + +/** + * Enable `setting`. + * + * @param {String} setting + * @return {app} for chaining + * @public + */ + +app.enable = function enable(setting) { + return this.set(setting, true); +}; + +/** + * Disable `setting`. + * + * @param {String} setting + * @return {app} for chaining + * @public + */ + +app.disable = function disable(setting) { + return this.set(setting, false); +}; + +/** + * Delegate `.VERB(...)` calls to `router.VERB(...)`. + */ + +methods.forEach(function(method){ + app[method] = function(path){ + if (method === 'get' && arguments.length === 1) { + // app.get(setting) + return this.set(path); + } + + this.lazyrouter(); + + var route = this._router.route(path); + route[method].apply(route, slice.call(arguments, 1)); + return this; + }; +}); + +/** + * Special-cased "all" method, applying the given route `path`, + * middleware, and callback to _every_ HTTP method. + * + * @param {String} path + * @param {Function} ... + * @return {app} for chaining + * @public + */ + +app.all = function all(path) { + this.lazyrouter(); + + var route = this._router.route(path); + var args = slice.call(arguments, 1); + + for (var i = 0; i < methods.length; i++) { + route[methods[i]].apply(route, args); + } + + return this; +}; + +// del -> delete alias + +app.del = deprecate.function(app.delete, 'app.del: Use app.delete instead'); + +/** + * Render the given view `name` name with `options` + * and a callback accepting an error and the + * rendered template string. + * + * Example: + * + * app.render('email', { name: 'Tobi' }, function(err, html){ + * // ... + * }) + * + * @param {String} name + * @param {Object|Function} options or fn + * @param {Function} callback + * @public + */ + +app.render = function render(name, options, callback) { + var cache = this.cache; + var done = callback; + var engines = this.engines; + var opts = options; + var renderOptions = {}; + var view; + + // support callback function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // merge app.locals + merge(renderOptions, this.locals); + + // merge options._locals + if (opts._locals) { + merge(renderOptions, opts._locals); + } + + // merge options + merge(renderOptions, opts); + + // set .cache unless explicitly provided + if (renderOptions.cache == null) { + renderOptions.cache = this.enabled('view cache'); + } + + // primed cache + if (renderOptions.cache) { + view = cache[name]; + } + + // view + if (!view) { + var View = this.get('view'); + + view = new View(name, { + defaultEngine: this.get('view engine'), + root: this.get('views'), + engines: engines + }); + + if (!view.path) { + var dirs = Array.isArray(view.root) && view.root.length > 1 + ? 'directories "' + view.root.slice(0, -1).join('", "') + '" or "' + view.root[view.root.length - 1] + '"' + : 'directory "' + view.root + '"' + var err = new Error('Failed to lookup view "' + name + '" in views ' + dirs); + err.view = view; + return done(err); + } + + // prime the cache + if (renderOptions.cache) { + cache[name] = view; + } + } + + // render + tryRender(view, renderOptions, done); +}; + +/** + * Listen for connections. + * + * A node `http.Server` is returned, with this + * application (which is a `Function`) as its + * callback. If you wish to create both an HTTP + * and HTTPS server you may do so with the "http" + * and "https" modules as shown here: + * + * var http = require('http') + * , https = require('https') + * , express = require('express') + * , app = express(); + * + * http.createServer(app).listen(80); + * https.createServer({ ... }, app).listen(443); + * + * @return {http.Server} + * @public + */ + +app.listen = function listen() { + var server = http.createServer(this); + return server.listen.apply(server, arguments); +}; + +/** + * Log error using console.error. + * + * @param {Error} err + * @private + */ + +function logerror(err) { + /* istanbul ignore next */ + if (this.get('env') !== 'test') console.error(err.stack || err.toString()); +} + +/** + * Try rendering a view. + * @private + */ + +function tryRender(view, options, callback) { + try { + view.render(options, callback); + } catch (err) { + callback(err); + } +} diff --git a/node_modules/express/lib/express.js b/node_modules/express/lib/express.js new file mode 100644 index 0000000..540c8be --- /dev/null +++ b/node_modules/express/lib/express.js @@ -0,0 +1,103 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var EventEmitter = require('events').EventEmitter; +var mixin = require('merge-descriptors'); +var proto = require('./application'); +var Route = require('./router/route'); +var Router = require('./router'); +var req = require('./request'); +var res = require('./response'); + +/** + * Expose `createApplication()`. + */ + +exports = module.exports = createApplication; + +/** + * Create an express application. + * + * @return {Function} + * @api public + */ + +function createApplication() { + var app = function(req, res, next) { + app.handle(req, res, next); + }; + + mixin(app, EventEmitter.prototype, false); + mixin(app, proto, false); + + app.request = { __proto__: req, app: app }; + app.response = { __proto__: res, app: app }; + app.init(); + return app; +} + +/** + * Expose the prototypes. + */ + +exports.application = proto; +exports.request = req; +exports.response = res; + +/** + * Expose constructors. + */ + +exports.Route = Route; +exports.Router = Router; + +/** + * Expose middleware + */ + +exports.query = require('./middleware/query'); +exports.static = require('serve-static'); + +/** + * Replace removed middleware with an appropriate error message. + */ + +[ + 'json', + 'urlencoded', + 'bodyParser', + 'compress', + 'cookieSession', + 'session', + 'logger', + 'cookieParser', + 'favicon', + 'responseTime', + 'errorHandler', + 'timeout', + 'methodOverride', + 'vhost', + 'csrf', + 'directory', + 'limit', + 'multipart', + 'staticCache', +].forEach(function (name) { + Object.defineProperty(exports, name, { + get: function () { + throw new Error('Most middleware (like ' + name + ') is no longer bundled with Express and must be installed separately. Please see https://github.com/senchalabs/connect#middleware.'); + }, + configurable: true + }); +}); diff --git a/node_modules/express/lib/middleware/init.js b/node_modules/express/lib/middleware/init.js new file mode 100644 index 0000000..f3119ed --- /dev/null +++ b/node_modules/express/lib/middleware/init.js @@ -0,0 +1,36 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Initialization middleware, exposing the + * request and response to each other, as well + * as defaulting the X-Powered-By header field. + * + * @param {Function} app + * @return {Function} + * @api private + */ + +exports.init = function(app){ + return function expressInit(req, res, next){ + if (app.enabled('x-powered-by')) res.setHeader('X-Powered-By', 'Express'); + req.res = res; + res.req = req; + req.next = next; + + req.__proto__ = app.request; + res.__proto__ = app.response; + + res.locals = res.locals || Object.create(null); + + next(); + }; +}; + diff --git a/node_modules/express/lib/middleware/query.js b/node_modules/express/lib/middleware/query.js new file mode 100644 index 0000000..5f76f84 --- /dev/null +++ b/node_modules/express/lib/middleware/query.js @@ -0,0 +1,46 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var parseUrl = require('parseurl'); +var qs = require('qs'); + +/** + * @param {Object} options + * @return {Function} + * @api public + */ + +module.exports = function query(options) { + var opts = Object.create(options || null); + var queryparse = qs.parse; + + if (typeof options === 'function') { + queryparse = options; + opts = undefined; + } + + if (opts !== undefined && opts.allowPrototypes === undefined) { + // back-compat for qs module + opts.allowPrototypes = true; + } + + return function query(req, res, next){ + if (!req.query) { + var val = parseUrl(req).query; + req.query = queryparse(val, opts); + } + + next(); + }; +}; diff --git a/node_modules/express/lib/request.js b/node_modules/express/lib/request.js new file mode 100644 index 0000000..557d050 --- /dev/null +++ b/node_modules/express/lib/request.js @@ -0,0 +1,502 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var accepts = require('accepts'); +var deprecate = require('depd')('express'); +var isIP = require('net').isIP; +var typeis = require('type-is'); +var http = require('http'); +var fresh = require('fresh'); +var parseRange = require('range-parser'); +var parse = require('parseurl'); +var proxyaddr = require('proxy-addr'); + +/** + * Request prototype. + */ + +var req = exports = module.exports = { + __proto__: http.IncomingMessage.prototype +}; + +/** + * Return request header. + * + * The `Referrer` header field is special-cased, + * both `Referrer` and `Referer` are interchangeable. + * + * Examples: + * + * req.get('Content-Type'); + * // => "text/plain" + * + * req.get('content-type'); + * // => "text/plain" + * + * req.get('Something'); + * // => undefined + * + * Aliased as `req.header()`. + * + * @param {String} name + * @return {String} + * @public + */ + +req.get = +req.header = function header(name) { + if (!name) { + throw new TypeError('name argument is required to req.get'); + } + + if (typeof name !== 'string') { + throw new TypeError('name must be a string to req.get'); + } + + var lc = name.toLowerCase(); + + switch (lc) { + case 'referer': + case 'referrer': + return this.headers.referrer + || this.headers.referer; + default: + return this.headers[lc]; + } +}; + +/** + * To do: update docs. + * + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single MIME type string + * such as "application/json", an extension name + * such as "json", a comma-delimited list such as "json, html, text/plain", + * an argument list such as `"json", "html", "text/plain"`, + * or an array `["json", "html", "text/plain"]`. When a list + * or array is given, the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * req.accepts('html'); + * // => "html" + * + * // Accept: text/*, application/json + * req.accepts('html'); + * // => "html" + * req.accepts('text/html'); + * // => "text/html" + * req.accepts('json, text'); + * // => "json" + * req.accepts('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * req.accepts('image/png'); + * req.accepts('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * req.accepts(['html', 'json']); + * req.accepts('html', 'json'); + * req.accepts('html, json'); + * // => "json" + * + * @param {String|Array} type(s) + * @return {String|Array|Boolean} + * @public + */ + +req.accepts = function(){ + var accept = accepts(this); + return accept.types.apply(accept, arguments); +}; + +/** + * Check if the given `encoding`s are accepted. + * + * @param {String} ...encoding + * @return {String|Array} + * @public + */ + +req.acceptsEncodings = function(){ + var accept = accepts(this); + return accept.encodings.apply(accept, arguments); +}; + +req.acceptsEncoding = deprecate.function(req.acceptsEncodings, + 'req.acceptsEncoding: Use acceptsEncodings instead'); + +/** + * Check if the given `charset`s are acceptable, + * otherwise you should respond with 406 "Not Acceptable". + * + * @param {String} ...charset + * @return {String|Array} + * @public + */ + +req.acceptsCharsets = function(){ + var accept = accepts(this); + return accept.charsets.apply(accept, arguments); +}; + +req.acceptsCharset = deprecate.function(req.acceptsCharsets, + 'req.acceptsCharset: Use acceptsCharsets instead'); + +/** + * Check if the given `lang`s are acceptable, + * otherwise you should respond with 406 "Not Acceptable". + * + * @param {String} ...lang + * @return {String|Array} + * @public + */ + +req.acceptsLanguages = function(){ + var accept = accepts(this); + return accept.languages.apply(accept, arguments); +}; + +req.acceptsLanguage = deprecate.function(req.acceptsLanguages, + 'req.acceptsLanguage: Use acceptsLanguages instead'); + +/** + * Parse Range header field, capping to the given `size`. + * + * Unspecified ranges such as "0-" require knowledge of your resource length. In + * the case of a byte range this is of course the total number of bytes. If the + * Range header field is not given `undefined` is returned, `-1` when unsatisfiable, + * and `-2` when syntactically invalid. + * + * When ranges are returned, the array has a "type" property which is the type of + * range that is required (most commonly, "bytes"). Each array element is an object + * with a "start" and "end" property for the portion of the range. + * + * The "combine" option can be set to `true` and overlapping & adjacent ranges + * will be combined into a single range. + * + * NOTE: remember that ranges are inclusive, so for example "Range: users=0-3" + * should respond with 4 users when available, not 3. + * + * @param {number} size + * @param {object} [options] + * @param {boolean} [options.combine=false] + * @return {number|array} + * @public + */ + +req.range = function range(size, options) { + var range = this.get('Range'); + if (!range) return; + return parseRange(size, range, options); +}; + +/** + * Return the value of param `name` when present or `defaultValue`. + * + * - Checks route placeholders, ex: _/user/:id_ + * - Checks body params, ex: id=12, {"id":12} + * - Checks query string params, ex: ?id=12 + * + * To utilize request bodies, `req.body` + * should be an object. This can be done by using + * the `bodyParser()` middleware. + * + * @param {String} name + * @param {Mixed} [defaultValue] + * @return {String} + * @public + */ + +req.param = function param(name, defaultValue) { + var params = this.params || {}; + var body = this.body || {}; + var query = this.query || {}; + + var args = arguments.length === 1 + ? 'name' + : 'name, default'; + deprecate('req.param(' + args + '): Use req.params, req.body, or req.query instead'); + + if (null != params[name] && params.hasOwnProperty(name)) return params[name]; + if (null != body[name]) return body[name]; + if (null != query[name]) return query[name]; + + return defaultValue; +}; + +/** + * Check if the incoming request contains the "Content-Type" + * header field, and it contains the give mime `type`. + * + * Examples: + * + * // With Content-Type: text/html; charset=utf-8 + * req.is('html'); + * req.is('text/html'); + * req.is('text/*'); + * // => true + * + * // When Content-Type is application/json + * req.is('json'); + * req.is('application/json'); + * req.is('application/*'); + * // => true + * + * req.is('html'); + * // => false + * + * @param {String|Array} types... + * @return {String|false|null} + * @public + */ + +req.is = function is(types) { + var arr = types; + + // support flattened arguments + if (!Array.isArray(types)) { + arr = new Array(arguments.length); + for (var i = 0; i < arr.length; i++) { + arr[i] = arguments[i]; + } + } + + return typeis(this, arr); +}; + +/** + * Return the protocol string "http" or "https" + * when requested with TLS. When the "trust proxy" + * setting trusts the socket address, the + * "X-Forwarded-Proto" header field will be trusted + * and used if present. + * + * If you're running behind a reverse proxy that + * supplies https for you this may be enabled. + * + * @return {String} + * @public + */ + +defineGetter(req, 'protocol', function protocol(){ + var proto = this.connection.encrypted + ? 'https' + : 'http'; + var trust = this.app.get('trust proxy fn'); + + if (!trust(this.connection.remoteAddress, 0)) { + return proto; + } + + // Note: X-Forwarded-Proto is normally only ever a + // single value, but this is to be safe. + proto = this.get('X-Forwarded-Proto') || proto; + return proto.split(/\s*,\s*/)[0]; +}); + +/** + * Short-hand for: + * + * req.protocol === 'https' + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'secure', function secure(){ + return this.protocol === 'https'; +}); + +/** + * Return the remote address from the trusted proxy. + * + * The is the remote address on the socket unless + * "trust proxy" is set. + * + * @return {String} + * @public + */ + +defineGetter(req, 'ip', function ip(){ + var trust = this.app.get('trust proxy fn'); + return proxyaddr(this, trust); +}); + +/** + * When "trust proxy" is set, trusted proxy addresses + client. + * + * For example if the value were "client, proxy1, proxy2" + * you would receive the array `["client", "proxy1", "proxy2"]` + * where "proxy2" is the furthest down-stream and "proxy1" and + * "proxy2" were trusted. + * + * @return {Array} + * @public + */ + +defineGetter(req, 'ips', function ips() { + var trust = this.app.get('trust proxy fn'); + var addrs = proxyaddr.all(this, trust); + return addrs.slice(1).reverse(); +}); + +/** + * Return subdomains as an array. + * + * Subdomains are the dot-separated parts of the host before the main domain of + * the app. By default, the domain of the app is assumed to be the last two + * parts of the host. This can be changed by setting "subdomain offset". + * + * For example, if the domain is "tobi.ferrets.example.com": + * If "subdomain offset" is not set, req.subdomains is `["ferrets", "tobi"]`. + * If "subdomain offset" is 3, req.subdomains is `["tobi"]`. + * + * @return {Array} + * @public + */ + +defineGetter(req, 'subdomains', function subdomains() { + var hostname = this.hostname; + + if (!hostname) return []; + + var offset = this.app.get('subdomain offset'); + var subdomains = !isIP(hostname) + ? hostname.split('.').reverse() + : [hostname]; + + return subdomains.slice(offset); +}); + +/** + * Short-hand for `url.parse(req.url).pathname`. + * + * @return {String} + * @public + */ + +defineGetter(req, 'path', function path() { + return parse(this).pathname; +}); + +/** + * Parse the "Host" header field to a hostname. + * + * When the "trust proxy" setting trusts the socket + * address, the "X-Forwarded-Host" header field will + * be trusted. + * + * @return {String} + * @public + */ + +defineGetter(req, 'hostname', function hostname(){ + var trust = this.app.get('trust proxy fn'); + var host = this.get('X-Forwarded-Host'); + + if (!host || !trust(this.connection.remoteAddress, 0)) { + host = this.get('Host'); + } + + if (!host) return; + + // IPv6 literal support + var offset = host[0] === '[' + ? host.indexOf(']') + 1 + : 0; + var index = host.indexOf(':', offset); + + return index !== -1 + ? host.substring(0, index) + : host; +}); + +// TODO: change req.host to return host in next major + +defineGetter(req, 'host', deprecate.function(function host(){ + return this.hostname; +}, 'req.host: Use req.hostname instead')); + +/** + * Check if the request is fresh, aka + * Last-Modified and/or the ETag + * still match. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'fresh', function(){ + var method = this.method; + var s = this.res.statusCode; + + // GET or HEAD for weak freshness validation only + if ('GET' !== method && 'HEAD' !== method) return false; + + // 2xx or 304 as per rfc2616 14.26 + if ((s >= 200 && s < 300) || 304 === s) { + return fresh(this.headers, (this.res._headers || {})); + } + + return false; +}); + +/** + * Check if the request is stale, aka + * "Last-Modified" and / or the "ETag" for the + * resource has changed. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'stale', function stale(){ + return !this.fresh; +}); + +/** + * Check if the request was an _XMLHttpRequest_. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'xhr', function xhr(){ + var val = this.get('X-Requested-With') || ''; + return val.toLowerCase() === 'xmlhttprequest'; +}); + +/** + * Helper function for creating a getter on an object. + * + * @param {Object} obj + * @param {String} name + * @param {Function} getter + * @private + */ +function defineGetter(obj, name, getter) { + Object.defineProperty(obj, name, { + configurable: true, + enumerable: true, + get: getter + }); +}; diff --git a/node_modules/express/lib/response.js b/node_modules/express/lib/response.js new file mode 100644 index 0000000..6128f45 --- /dev/null +++ b/node_modules/express/lib/response.js @@ -0,0 +1,1065 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var contentDisposition = require('content-disposition'); +var deprecate = require('depd')('express'); +var encodeUrl = require('encodeurl'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var isAbsolute = require('./utils').isAbsolute; +var onFinished = require('on-finished'); +var path = require('path'); +var merge = require('utils-merge'); +var sign = require('cookie-signature').sign; +var normalizeType = require('./utils').normalizeType; +var normalizeTypes = require('./utils').normalizeTypes; +var setCharset = require('./utils').setCharset; +var statusCodes = http.STATUS_CODES; +var cookie = require('cookie'); +var send = require('send'); +var extname = path.extname; +var mime = send.mime; +var resolve = path.resolve; +var vary = require('vary'); + +/** + * Response prototype. + */ + +var res = module.exports = { + __proto__: http.ServerResponse.prototype +}; + +/** + * Module variables. + * @private + */ + +var charsetRegExp = /;\s*charset\s*=/; + +/** + * Set status `code`. + * + * @param {Number} code + * @return {ServerResponse} + * @public + */ + +res.status = function status(code) { + this.statusCode = code; + return this; +}; + +/** + * Set Link header field with the given `links`. + * + * Examples: + * + * res.links({ + * next: 'http://api.example.com/users?page=2', + * last: 'http://api.example.com/users?page=5' + * }); + * + * @param {Object} links + * @return {ServerResponse} + * @public + */ + +res.links = function(links){ + var link = this.get('Link') || ''; + if (link) link += ', '; + return this.set('Link', link + Object.keys(links).map(function(rel){ + return '<' + links[rel] + '>; rel="' + rel + '"'; + }).join(', ')); +}; + +/** + * Send a response. + * + * Examples: + * + * res.send(new Buffer('wahoo')); + * res.send({ some: 'json' }); + * res.send('

some html

'); + * + * @param {string|number|boolean|object|Buffer} body + * @public + */ + +res.send = function send(body) { + var chunk = body; + var encoding; + var len; + var req = this.req; + var type; + + // settings + var app = this.app; + + // allow status / body + if (arguments.length === 2) { + // res.send(body, status) backwards compat + if (typeof arguments[0] !== 'number' && typeof arguments[1] === 'number') { + deprecate('res.send(body, status): Use res.status(status).send(body) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.send(status, body): Use res.status(status).send(body) instead'); + this.statusCode = arguments[0]; + chunk = arguments[1]; + } + } + + // disambiguate res.send(status) and res.send(status, num) + if (typeof chunk === 'number' && arguments.length === 1) { + // res.send(status) will set status message as text string + if (!this.get('Content-Type')) { + this.type('txt'); + } + + deprecate('res.send(status): Use res.sendStatus(status) instead'); + this.statusCode = chunk; + chunk = statusCodes[chunk]; + } + + switch (typeof chunk) { + // string defaulting to html + case 'string': + if (!this.get('Content-Type')) { + this.type('html'); + } + break; + case 'boolean': + case 'number': + case 'object': + if (chunk === null) { + chunk = ''; + } else if (Buffer.isBuffer(chunk)) { + if (!this.get('Content-Type')) { + this.type('bin'); + } + } else { + return this.json(chunk); + } + break; + } + + // write strings in utf-8 + if (typeof chunk === 'string') { + encoding = 'utf8'; + type = this.get('Content-Type'); + + // reflect this in content-type + if (typeof type === 'string') { + this.set('Content-Type', setCharset(type, 'utf-8')); + } + } + + // populate Content-Length + if (chunk !== undefined) { + if (!Buffer.isBuffer(chunk)) { + // convert chunk to Buffer; saves later double conversions + chunk = new Buffer(chunk, encoding); + encoding = undefined; + } + + len = chunk.length; + this.set('Content-Length', len); + } + + // populate ETag + var etag; + var generateETag = len !== undefined && app.get('etag fn'); + if (typeof generateETag === 'function' && !this.get('ETag')) { + if ((etag = generateETag(chunk, encoding))) { + this.set('ETag', etag); + } + } + + // freshness + if (req.fresh) this.statusCode = 304; + + // strip irrelevant headers + if (204 === this.statusCode || 304 === this.statusCode) { + this.removeHeader('Content-Type'); + this.removeHeader('Content-Length'); + this.removeHeader('Transfer-Encoding'); + chunk = ''; + } + + if (req.method === 'HEAD') { + // skip body for HEAD + this.end(); + } else { + // respond + this.end(chunk, encoding); + } + + return this; +}; + +/** + * Send JSON response. + * + * Examples: + * + * res.json(null); + * res.json({ user: 'tj' }); + * + * @param {string|number|boolean|object} obj + * @public + */ + +res.json = function json(obj) { + var val = obj; + + // allow status / body + if (arguments.length === 2) { + // res.json(body, status) backwards compat + if (typeof arguments[1] === 'number') { + deprecate('res.json(obj, status): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.json(status, obj): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[0]; + val = arguments[1]; + } + } + + // settings + var app = this.app; + var replacer = app.get('json replacer'); + var spaces = app.get('json spaces'); + var body = stringify(val, replacer, spaces); + + // content-type + if (!this.get('Content-Type')) { + this.set('Content-Type', 'application/json'); + } + + return this.send(body); +}; + +/** + * Send JSON response with JSONP callback support. + * + * Examples: + * + * res.jsonp(null); + * res.jsonp({ user: 'tj' }); + * + * @param {string|number|boolean|object} obj + * @public + */ + +res.jsonp = function jsonp(obj) { + var val = obj; + + // allow status / body + if (arguments.length === 2) { + // res.json(body, status) backwards compat + if (typeof arguments[1] === 'number') { + deprecate('res.jsonp(obj, status): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.jsonp(status, obj): Use res.status(status).jsonp(obj) instead'); + this.statusCode = arguments[0]; + val = arguments[1]; + } + } + + // settings + var app = this.app; + var replacer = app.get('json replacer'); + var spaces = app.get('json spaces'); + var body = stringify(val, replacer, spaces); + var callback = this.req.query[app.get('jsonp callback name')]; + + // content-type + if (!this.get('Content-Type')) { + this.set('X-Content-Type-Options', 'nosniff'); + this.set('Content-Type', 'application/json'); + } + + // fixup callback + if (Array.isArray(callback)) { + callback = callback[0]; + } + + // jsonp + if (typeof callback === 'string' && callback.length !== 0) { + this.charset = 'utf-8'; + this.set('X-Content-Type-Options', 'nosniff'); + this.set('Content-Type', 'text/javascript'); + + // restrict callback charset + callback = callback.replace(/[^\[\]\w$.]/g, ''); + + // replace chars not allowed in JavaScript that are in JSON + body = body + .replace(/\u2028/g, '\\u2028') + .replace(/\u2029/g, '\\u2029'); + + // the /**/ is a specific security mitigation for "Rosetta Flash JSONP abuse" + // the typeof check is just to reduce client error noise + body = '/**/ typeof ' + callback + ' === \'function\' && ' + callback + '(' + body + ');'; + } + + return this.send(body); +}; + +/** + * Send given HTTP status code. + * + * Sets the response status to `statusCode` and the body of the + * response to the standard description from node's http.STATUS_CODES + * or the statusCode number if no description. + * + * Examples: + * + * res.sendStatus(200); + * + * @param {number} statusCode + * @public + */ + +res.sendStatus = function sendStatus(statusCode) { + var body = statusCodes[statusCode] || String(statusCode); + + this.statusCode = statusCode; + this.type('txt'); + + return this.send(body); +}; + +/** + * Transfer the file at the given `path`. + * + * Automatically sets the _Content-Type_ response header field. + * The callback `callback(err)` is invoked when the transfer is complete + * or when an error occurs. Be sure to check `res.sentHeader` + * if you wish to attempt responding, as the header and some data + * may have already been transferred. + * + * Options: + * + * - `maxAge` defaulting to 0 (can be string converted by `ms`) + * - `root` root directory for relative filenames + * - `headers` object of headers to serve with file + * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them + * + * Other options are passed along to `send`. + * + * Examples: + * + * The following example illustrates how `res.sendFile()` may + * be used as an alternative for the `static()` middleware for + * dynamic situations. The code backing `res.sendFile()` is actually + * the same code, so HTTP cache support etc is identical. + * + * app.get('/user/:uid/photos/:file', function(req, res){ + * var uid = req.params.uid + * , file = req.params.file; + * + * req.user.mayViewFilesFrom(uid, function(yes){ + * if (yes) { + * res.sendFile('/uploads/' + uid + '/' + file); + * } else { + * res.send(403, 'Sorry! you cant see that.'); + * } + * }); + * }); + * + * @public + */ + +res.sendFile = function sendFile(path, options, callback) { + var done = callback; + var req = this.req; + var res = this; + var next = req.next; + var opts = options || {}; + + if (!path) { + throw new TypeError('path argument is required to res.sendFile'); + } + + // support function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + if (!opts.root && !isAbsolute(path)) { + throw new TypeError('path must be absolute or specify root to res.sendFile'); + } + + // create file stream + var pathname = encodeURI(path); + var file = send(req, pathname, opts); + + // transfer + sendfile(res, file, opts, function (err) { + if (done) return done(err); + if (err && err.code === 'EISDIR') return next(); + + // next() all but write errors + if (err && err.code !== 'ECONNABORTED' && err.syscall !== 'write') { + next(err); + } + }); +}; + +/** + * Transfer the file at the given `path`. + * + * Automatically sets the _Content-Type_ response header field. + * The callback `callback(err)` is invoked when the transfer is complete + * or when an error occurs. Be sure to check `res.sentHeader` + * if you wish to attempt responding, as the header and some data + * may have already been transferred. + * + * Options: + * + * - `maxAge` defaulting to 0 (can be string converted by `ms`) + * - `root` root directory for relative filenames + * - `headers` object of headers to serve with file + * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them + * + * Other options are passed along to `send`. + * + * Examples: + * + * The following example illustrates how `res.sendfile()` may + * be used as an alternative for the `static()` middleware for + * dynamic situations. The code backing `res.sendfile()` is actually + * the same code, so HTTP cache support etc is identical. + * + * app.get('/user/:uid/photos/:file', function(req, res){ + * var uid = req.params.uid + * , file = req.params.file; + * + * req.user.mayViewFilesFrom(uid, function(yes){ + * if (yes) { + * res.sendfile('/uploads/' + uid + '/' + file); + * } else { + * res.send(403, 'Sorry! you cant see that.'); + * } + * }); + * }); + * + * @public + */ + +res.sendfile = function (path, options, callback) { + var done = callback; + var req = this.req; + var res = this; + var next = req.next; + var opts = options || {}; + + // support function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // create file stream + var file = send(req, path, opts); + + // transfer + sendfile(res, file, opts, function (err) { + if (done) return done(err); + if (err && err.code === 'EISDIR') return next(); + + // next() all but write errors + if (err && err.code !== 'ECONNABORT' && err.syscall !== 'write') { + next(err); + } + }); +}; + +res.sendfile = deprecate.function(res.sendfile, + 'res.sendfile: Use res.sendFile instead'); + +/** + * Transfer the file at the given `path` as an attachment. + * + * Optionally providing an alternate attachment `filename`, + * and optional callback `callback(err)`. The callback is invoked + * when the data transfer is complete, or when an error has + * ocurred. Be sure to check `res.headersSent` if you plan to respond. + * + * This method uses `res.sendfile()`. + * + * @public + */ + +res.download = function download(path, filename, callback) { + var done = callback; + var name = filename; + + // support function as second arg + if (typeof filename === 'function') { + done = filename; + name = null; + } + + // set Content-Disposition when file is sent + var headers = { + 'Content-Disposition': contentDisposition(name || path) + }; + + // Resolve the full path for sendFile + var fullPath = resolve(path); + + return this.sendFile(fullPath, { headers: headers }, done); +}; + +/** + * Set _Content-Type_ response header with `type` through `mime.lookup()` + * when it does not contain "/", or set the Content-Type to `type` otherwise. + * + * Examples: + * + * res.type('.html'); + * res.type('html'); + * res.type('json'); + * res.type('application/json'); + * res.type('png'); + * + * @param {String} type + * @return {ServerResponse} for chaining + * @public + */ + +res.contentType = +res.type = function contentType(type) { + var ct = type.indexOf('/') === -1 + ? mime.lookup(type) + : type; + + return this.set('Content-Type', ct); +}; + +/** + * Respond to the Acceptable formats using an `obj` + * of mime-type callbacks. + * + * This method uses `req.accepted`, an array of + * acceptable types ordered by their quality values. + * When "Accept" is not present the _first_ callback + * is invoked, otherwise the first match is used. When + * no match is performed the server responds with + * 406 "Not Acceptable". + * + * Content-Type is set for you, however if you choose + * you may alter this within the callback using `res.type()` + * or `res.set('Content-Type', ...)`. + * + * res.format({ + * 'text/plain': function(){ + * res.send('hey'); + * }, + * + * 'text/html': function(){ + * res.send('

hey

'); + * }, + * + * 'appliation/json': function(){ + * res.send({ message: 'hey' }); + * } + * }); + * + * In addition to canonicalized MIME types you may + * also use extnames mapped to these types: + * + * res.format({ + * text: function(){ + * res.send('hey'); + * }, + * + * html: function(){ + * res.send('

hey

'); + * }, + * + * json: function(){ + * res.send({ message: 'hey' }); + * } + * }); + * + * By default Express passes an `Error` + * with a `.status` of 406 to `next(err)` + * if a match is not made. If you provide + * a `.default` callback it will be invoked + * instead. + * + * @param {Object} obj + * @return {ServerResponse} for chaining + * @public + */ + +res.format = function(obj){ + var req = this.req; + var next = req.next; + + var fn = obj.default; + if (fn) delete obj.default; + var keys = Object.keys(obj); + + var key = keys.length > 0 + ? req.accepts(keys) + : false; + + this.vary("Accept"); + + if (key) { + this.set('Content-Type', normalizeType(key).value); + obj[key](req, this, next); + } else if (fn) { + fn(); + } else { + var err = new Error('Not Acceptable'); + err.status = err.statusCode = 406; + err.types = normalizeTypes(keys).map(function(o){ return o.value }); + next(err); + } + + return this; +}; + +/** + * Set _Content-Disposition_ header to _attachment_ with optional `filename`. + * + * @param {String} filename + * @return {ServerResponse} + * @public + */ + +res.attachment = function attachment(filename) { + if (filename) { + this.type(extname(filename)); + } + + this.set('Content-Disposition', contentDisposition(filename)); + + return this; +}; + +/** + * Append additional header `field` with value `val`. + * + * Example: + * + * res.append('Link', ['', '']); + * res.append('Set-Cookie', 'foo=bar; Path=/; HttpOnly'); + * res.append('Warning', '199 Miscellaneous warning'); + * + * @param {String} field + * @param {String|Array} val + * @return {ServerResponse} for chaining + * @public + */ + +res.append = function append(field, val) { + var prev = this.get(field); + var value = val; + + if (prev) { + // concat the new and prev vals + value = Array.isArray(prev) ? prev.concat(val) + : Array.isArray(val) ? [prev].concat(val) + : [prev, val]; + } + + return this.set(field, value); +}; + +/** + * Set header `field` to `val`, or pass + * an object of header fields. + * + * Examples: + * + * res.set('Foo', ['bar', 'baz']); + * res.set('Accept', 'application/json'); + * res.set({ Accept: 'text/plain', 'X-API-Key': 'tobi' }); + * + * Aliased as `res.header()`. + * + * @param {String|Object} field + * @param {String|Array} val + * @return {ServerResponse} for chaining + * @public + */ + +res.set = +res.header = function header(field, val) { + if (arguments.length === 2) { + var value = Array.isArray(val) + ? val.map(String) + : String(val); + + // add charset to content-type + if (field.toLowerCase() === 'content-type' && !charsetRegExp.test(value)) { + var charset = mime.charsets.lookup(value.split(';')[0]); + if (charset) value += '; charset=' + charset.toLowerCase(); + } + + this.setHeader(field, value); + } else { + for (var key in field) { + this.set(key, field[key]); + } + } + return this; +}; + +/** + * Get value for header `field`. + * + * @param {String} field + * @return {String} + * @public + */ + +res.get = function(field){ + return this.getHeader(field); +}; + +/** + * Clear cookie `name`. + * + * @param {String} name + * @param {Object} [options] + * @return {ServerResponse} for chaining + * @public + */ + +res.clearCookie = function clearCookie(name, options) { + var opts = merge({ expires: new Date(1), path: '/' }, options); + + return this.cookie(name, '', opts); +}; + +/** + * Set cookie `name` to `value`, with the given `options`. + * + * Options: + * + * - `maxAge` max-age in milliseconds, converted to `expires` + * - `signed` sign the cookie + * - `path` defaults to "/" + * + * Examples: + * + * // "Remember Me" for 15 minutes + * res.cookie('rememberme', '1', { expires: new Date(Date.now() + 900000), httpOnly: true }); + * + * // save as above + * res.cookie('rememberme', '1', { maxAge: 900000, httpOnly: true }) + * + * @param {String} name + * @param {String|Object} value + * @param {Options} options + * @return {ServerResponse} for chaining + * @public + */ + +res.cookie = function (name, value, options) { + var opts = merge({}, options); + var secret = this.req.secret; + var signed = opts.signed; + + if (signed && !secret) { + throw new Error('cookieParser("secret") required for signed cookies'); + } + + var val = typeof value === 'object' + ? 'j:' + JSON.stringify(value) + : String(value); + + if (signed) { + val = 's:' + sign(val, secret); + } + + if ('maxAge' in opts) { + opts.expires = new Date(Date.now() + opts.maxAge); + opts.maxAge /= 1000; + } + + if (opts.path == null) { + opts.path = '/'; + } + + this.append('Set-Cookie', cookie.serialize(name, String(val), opts)); + + return this; +}; + +/** + * Set the location header to `url`. + * + * The given `url` can also be "back", which redirects + * to the _Referrer_ or _Referer_ headers or "/". + * + * Examples: + * + * res.location('/foo/bar').; + * res.location('http://example.com'); + * res.location('../login'); + * + * @param {String} url + * @return {ServerResponse} for chaining + * @public + */ + +res.location = function location(url) { + var loc = url; + + // "back" is an alias for the referrer + if (url === 'back') { + loc = this.req.get('Referrer') || '/'; + } + + // set location + return this.set('Location', encodeUrl(loc)); +}; + +/** + * Redirect to the given `url` with optional response `status` + * defaulting to 302. + * + * The resulting `url` is determined by `res.location()`, so + * it will play nicely with mounted apps, relative paths, + * `"back"` etc. + * + * Examples: + * + * res.redirect('/foo/bar'); + * res.redirect('http://example.com'); + * res.redirect(301, 'http://example.com'); + * res.redirect('../login'); // /blog/post/1 -> /blog/login + * + * @public + */ + +res.redirect = function redirect(url) { + var address = url; + var body; + var status = 302; + + // allow status / url + if (arguments.length === 2) { + if (typeof arguments[0] === 'number') { + status = arguments[0]; + address = arguments[1]; + } else { + deprecate('res.redirect(url, status): Use res.redirect(status, url) instead'); + status = arguments[1]; + } + } + + // Set location header + address = this.location(address).get('Location'); + + // Support text/{plain,html} by default + this.format({ + text: function(){ + body = statusCodes[status] + '. Redirecting to ' + address; + }, + + html: function(){ + var u = escapeHtml(address); + body = '

' + statusCodes[status] + '. Redirecting to ' + u + '

'; + }, + + default: function(){ + body = ''; + } + }); + + // Respond + this.statusCode = status; + this.set('Content-Length', Buffer.byteLength(body)); + + if (this.req.method === 'HEAD') { + this.end(); + } else { + this.end(body); + } +}; + +/** + * Add `field` to Vary. If already present in the Vary set, then + * this call is simply ignored. + * + * @param {Array|String} field + * @return {ServerResponse} for chaining + * @public + */ + +res.vary = function(field){ + // checks for back-compat + if (!field || (Array.isArray(field) && !field.length)) { + deprecate('res.vary(): Provide a field name'); + return this; + } + + vary(this, field); + + return this; +}; + +/** + * Render `view` with the given `options` and optional callback `fn`. + * When a callback function is given a response will _not_ be made + * automatically, otherwise a response of _200_ and _text/html_ is given. + * + * Options: + * + * - `cache` boolean hinting to the engine it should cache + * - `filename` filename of the view being rendered + * + * @public + */ + +res.render = function render(view, options, callback) { + var app = this.req.app; + var done = callback; + var opts = options || {}; + var req = this.req; + var self = this; + + // support callback function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // merge res.locals + opts._locals = self.locals; + + // default callback to respond + done = done || function (err, str) { + if (err) return req.next(err); + self.send(str); + }; + + // render + app.render(view, opts, done); +}; + +// pipe the send file stream +function sendfile(res, file, options, callback) { + var done = false; + var streaming; + + // request aborted + function onaborted() { + if (done) return; + done = true; + + var err = new Error('Request aborted'); + err.code = 'ECONNABORTED'; + callback(err); + } + + // directory + function ondirectory() { + if (done) return; + done = true; + + var err = new Error('EISDIR, read'); + err.code = 'EISDIR'; + callback(err); + } + + // errors + function onerror(err) { + if (done) return; + done = true; + callback(err); + } + + // ended + function onend() { + if (done) return; + done = true; + callback(); + } + + // file + function onfile() { + streaming = false; + } + + // finished + function onfinish(err) { + if (err && err.code === 'ECONNRESET') return onaborted(); + if (err) return onerror(err); + if (done) return; + + setImmediate(function () { + if (streaming !== false && !done) { + onaborted(); + return; + } + + if (done) return; + done = true; + callback(); + }); + } + + // streaming + function onstream() { + streaming = true; + } + + file.on('directory', ondirectory); + file.on('end', onend); + file.on('error', onerror); + file.on('file', onfile); + file.on('stream', onstream); + onFinished(res, onfinish); + + if (options.headers) { + // set headers on successful transfer + file.on('headers', function headers(res) { + var obj = options.headers; + var keys = Object.keys(obj); + + for (var i = 0; i < keys.length; i++) { + var k = keys[i]; + res.setHeader(k, obj[k]); + } + }); + } + + // pipe + file.pipe(res); +} + +/** + * Stringify JSON, like JSON.stringify, but v8 optimized. + * @private + */ + +function stringify(value, replacer, spaces) { + // v8 checks arguments.length for optimizing simple call + // https://bugs.chromium.org/p/v8/issues/detail?id=4730 + return replacer || spaces + ? JSON.stringify(value, replacer, spaces) + : JSON.stringify(value); +} diff --git a/node_modules/express/lib/router/index.js b/node_modules/express/lib/router/index.js new file mode 100644 index 0000000..dac2514 --- /dev/null +++ b/node_modules/express/lib/router/index.js @@ -0,0 +1,645 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Route = require('./route'); +var Layer = require('./layer'); +var methods = require('methods'); +var mixin = require('utils-merge'); +var debug = require('debug')('express:router'); +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var parseUrl = require('parseurl'); + +/** + * Module variables. + * @private + */ + +var objectRegExp = /^\[object (\S+)\]$/; +var slice = Array.prototype.slice; +var toString = Object.prototype.toString; + +/** + * Initialize a new `Router` with the given `options`. + * + * @param {Object} options + * @return {Router} which is an callable function + * @public + */ + +var proto = module.exports = function(options) { + var opts = options || {}; + + function router(req, res, next) { + router.handle(req, res, next); + } + + // mixin Router class functions + router.__proto__ = proto; + + router.params = {}; + router._params = []; + router.caseSensitive = opts.caseSensitive; + router.mergeParams = opts.mergeParams; + router.strict = opts.strict; + router.stack = []; + + return router; +}; + +/** + * Map the given param placeholder `name`(s) to the given callback. + * + * Parameter mapping is used to provide pre-conditions to routes + * which use normalized placeholders. For example a _:user_id_ parameter + * could automatically load a user's information from the database without + * any additional code, + * + * The callback uses the same signature as middleware, the only difference + * being that the value of the placeholder is passed, in this case the _id_ + * of the user. Once the `next()` function is invoked, just like middleware + * it will continue on to execute the route, or subsequent parameter functions. + * + * Just like in middleware, you must either respond to the request or call next + * to avoid stalling the request. + * + * app.param('user_id', function(req, res, next, id){ + * User.find(id, function(err, user){ + * if (err) { + * return next(err); + * } else if (!user) { + * return next(new Error('failed to load user')); + * } + * req.user = user; + * next(); + * }); + * }); + * + * @param {String} name + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +proto.param = function param(name, fn) { + // param logic + if (typeof name === 'function') { + deprecate('router.param(fn): Refactor to use path params'); + this._params.push(name); + return; + } + + // apply param functions + var params = this._params; + var len = params.length; + var ret; + + if (name[0] === ':') { + deprecate('router.param(' + JSON.stringify(name) + ', fn): Use router.param(' + JSON.stringify(name.substr(1)) + ', fn) instead'); + name = name.substr(1); + } + + for (var i = 0; i < len; ++i) { + if (ret = params[i](name, fn)) { + fn = ret; + } + } + + // ensure we end up with a + // middleware function + if ('function' !== typeof fn) { + throw new Error('invalid param() call for ' + name + ', got ' + fn); + } + + (this.params[name] = this.params[name] || []).push(fn); + return this; +}; + +/** + * Dispatch a req, res into the router. + * @private + */ + +proto.handle = function handle(req, res, out) { + var self = this; + + debug('dispatching %s %s', req.method, req.url); + + var search = 1 + req.url.indexOf('?'); + var pathlength = search ? search - 1 : req.url.length; + var fqdn = req.url[0] !== '/' && 1 + req.url.substr(0, pathlength).indexOf('://'); + var protohost = fqdn ? req.url.substr(0, req.url.indexOf('/', 2 + fqdn)) : ''; + var idx = 0; + var removed = ''; + var slashAdded = false; + var paramcalled = {}; + + // store options for OPTIONS request + // only used if OPTIONS request + var options = []; + + // middleware and routes + var stack = self.stack; + + // manage inter-router variables + var parentParams = req.params; + var parentUrl = req.baseUrl || ''; + var done = restore(out, req, 'baseUrl', 'next', 'params'); + + // setup next layer + req.next = next; + + // for options requests, respond with a default if nothing else responds + if (req.method === 'OPTIONS') { + done = wrap(done, function(old, err) { + if (err || options.length === 0) return old(err); + sendOptionsResponse(res, options, old); + }); + } + + // setup basic req values + req.baseUrl = parentUrl; + req.originalUrl = req.originalUrl || req.url; + + next(); + + function next(err) { + var layerError = err === 'route' + ? null + : err; + + // remove added slash + if (slashAdded) { + req.url = req.url.substr(1); + slashAdded = false; + } + + // restore altered req.url + if (removed.length !== 0) { + req.baseUrl = parentUrl; + req.url = protohost + removed + req.url.substr(protohost.length); + removed = ''; + } + + // no more matching layers + if (idx >= stack.length) { + setImmediate(done, layerError); + return; + } + + // get pathname of request + var path = getPathname(req); + + if (path == null) { + return done(layerError); + } + + // find next matching layer + var layer; + var match; + var route; + + while (match !== true && idx < stack.length) { + layer = stack[idx++]; + match = matchLayer(layer, path); + route = layer.route; + + if (typeof match !== 'boolean') { + // hold on to layerError + layerError = layerError || match; + } + + if (match !== true) { + continue; + } + + if (!route) { + // process non-route handlers normally + continue; + } + + if (layerError) { + // routes do not match with a pending error + match = false; + continue; + } + + var method = req.method; + var has_method = route._handles_method(method); + + // build up automatic options response + if (!has_method && method === 'OPTIONS') { + appendMethods(options, route._options()); + } + + // don't even bother matching route + if (!has_method && method !== 'HEAD') { + match = false; + continue; + } + } + + // no match + if (match !== true) { + return done(layerError); + } + + // store route for dispatch on change + if (route) { + req.route = route; + } + + // Capture one-time layer values + req.params = self.mergeParams + ? mergeParams(layer.params, parentParams) + : layer.params; + var layerPath = layer.path; + + // this should be done for the layer + self.process_params(layer, paramcalled, req, res, function (err) { + if (err) { + return next(layerError || err); + } + + if (route) { + return layer.handle_request(req, res, next); + } + + trim_prefix(layer, layerError, layerPath, path); + }); + } + + function trim_prefix(layer, layerError, layerPath, path) { + var c = path[layerPath.length]; + if (c && '/' !== c && '.' !== c) return next(layerError); + + // Trim off the part of the url that matches the route + // middleware (.use stuff) needs to have the path stripped + if (layerPath.length !== 0) { + debug('trim prefix (%s) from url %s', layerPath, req.url); + removed = layerPath; + req.url = protohost + req.url.substr(protohost.length + removed.length); + + // Ensure leading slash + if (!fqdn && req.url[0] !== '/') { + req.url = '/' + req.url; + slashAdded = true; + } + + // Setup base URL (no trailing slash) + req.baseUrl = parentUrl + (removed[removed.length - 1] === '/' + ? removed.substring(0, removed.length - 1) + : removed); + } + + debug('%s %s : %s', layer.name, layerPath, req.originalUrl); + + if (layerError) { + layer.handle_error(layerError, req, res, next); + } else { + layer.handle_request(req, res, next); + } + } +}; + +/** + * Process any parameters for the layer. + * @private + */ + +proto.process_params = function process_params(layer, called, req, res, done) { + var params = this.params; + + // captured parameters from the layer, keys and values + var keys = layer.keys; + + // fast track + if (!keys || keys.length === 0) { + return done(); + } + + var i = 0; + var name; + var paramIndex = 0; + var key; + var paramVal; + var paramCallbacks; + var paramCalled; + + // process params in order + // param callbacks can be async + function param(err) { + if (err) { + return done(err); + } + + if (i >= keys.length ) { + return done(); + } + + paramIndex = 0; + key = keys[i++]; + + if (!key) { + return done(); + } + + name = key.name; + paramVal = req.params[name]; + paramCallbacks = params[name]; + paramCalled = called[name]; + + if (paramVal === undefined || !paramCallbacks) { + return param(); + } + + // param previously called with same value or error occurred + if (paramCalled && (paramCalled.match === paramVal + || (paramCalled.error && paramCalled.error !== 'route'))) { + // restore value + req.params[name] = paramCalled.value; + + // next param + return param(paramCalled.error); + } + + called[name] = paramCalled = { + error: null, + match: paramVal, + value: paramVal + }; + + paramCallback(); + } + + // single param callbacks + function paramCallback(err) { + var fn = paramCallbacks[paramIndex++]; + + // store updated value + paramCalled.value = req.params[key.name]; + + if (err) { + // store error + paramCalled.error = err; + param(err); + return; + } + + if (!fn) return param(); + + try { + fn(req, res, paramCallback, paramVal, key.name); + } catch (e) { + paramCallback(e); + } + } + + param(); +}; + +/** + * Use the given middleware function, with optional path, defaulting to "/". + * + * Use (like `.all`) will run for any http METHOD, but it will not add + * handlers for those methods so OPTIONS requests will not consider `.use` + * functions even if they could respond. + * + * The other difference is that _route_ path is stripped and not visible + * to the handler function. The main effect of this feature is that mounted + * handlers can operate without any code changes regardless of the "prefix" + * pathname. + * + * @public + */ + +proto.use = function use(fn) { + var offset = 0; + var path = '/'; + + // default path to '/' + // disambiguate router.use([fn]) + if (typeof fn !== 'function') { + var arg = fn; + + while (Array.isArray(arg) && arg.length !== 0) { + arg = arg[0]; + } + + // first arg is the path + if (typeof arg !== 'function') { + offset = 1; + path = fn; + } + } + + var callbacks = flatten(slice.call(arguments, offset)); + + if (callbacks.length === 0) { + throw new TypeError('Router.use() requires middleware functions'); + } + + for (var i = 0; i < callbacks.length; i++) { + var fn = callbacks[i]; + + if (typeof fn !== 'function') { + throw new TypeError('Router.use() requires middleware function but got a ' + gettype(fn)); + } + + // add the middleware + debug('use %s %s', path, fn.name || ''); + + var layer = new Layer(path, { + sensitive: this.caseSensitive, + strict: false, + end: false + }, fn); + + layer.route = undefined; + + this.stack.push(layer); + } + + return this; +}; + +/** + * Create a new Route for the given path. + * + * Each route contains a separate middleware stack and VERB handlers. + * + * See the Route api documentation for details on adding handlers + * and middleware to routes. + * + * @param {String} path + * @return {Route} + * @public + */ + +proto.route = function route(path) { + var route = new Route(path); + + var layer = new Layer(path, { + sensitive: this.caseSensitive, + strict: this.strict, + end: true + }, route.dispatch.bind(route)); + + layer.route = route; + + this.stack.push(layer); + return route; +}; + +// create Router#VERB functions +methods.concat('all').forEach(function(method){ + proto[method] = function(path){ + var route = this.route(path) + route[method].apply(route, slice.call(arguments, 1)); + return this; + }; +}); + +// append methods to a list of methods +function appendMethods(list, addition) { + for (var i = 0; i < addition.length; i++) { + var method = addition[i]; + if (list.indexOf(method) === -1) { + list.push(method); + } + } +} + +// get pathname of request +function getPathname(req) { + try { + return parseUrl(req).pathname; + } catch (err) { + return undefined; + } +} + +// get type for error message +function gettype(obj) { + var type = typeof obj; + + if (type !== 'object') { + return type; + } + + // inspect [[Class]] for objects + return toString.call(obj) + .replace(objectRegExp, '$1'); +} + +/** + * Match path to a layer. + * + * @param {Layer} layer + * @param {string} path + * @private + */ + +function matchLayer(layer, path) { + try { + return layer.match(path); + } catch (err) { + return err; + } +} + +// merge params with parent params +function mergeParams(params, parent) { + if (typeof parent !== 'object' || !parent) { + return params; + } + + // make copy of parent for base + var obj = mixin({}, parent); + + // simple non-numeric merging + if (!(0 in params) || !(0 in parent)) { + return mixin(obj, params); + } + + var i = 0; + var o = 0; + + // determine numeric gaps + while (i in params) { + i++; + } + + while (o in parent) { + o++; + } + + // offset numeric indices in params before merge + for (i--; i >= 0; i--) { + params[i + o] = params[i]; + + // create holes for the merge when necessary + if (i < o) { + delete params[i]; + } + } + + return mixin(obj, params); +} + +// restore obj props after function +function restore(fn, obj) { + var props = new Array(arguments.length - 2); + var vals = new Array(arguments.length - 2); + + for (var i = 0; i < props.length; i++) { + props[i] = arguments[i + 2]; + vals[i] = obj[props[i]]; + } + + return function(err){ + // restore vals + for (var i = 0; i < props.length; i++) { + obj[props[i]] = vals[i]; + } + + return fn.apply(this, arguments); + }; +} + +// send an OPTIONS response +function sendOptionsResponse(res, options, next) { + try { + var body = options.join(','); + res.set('Allow', body); + res.send(body); + } catch (err) { + next(err); + } +} + +// wrap a function +function wrap(old, fn) { + return function proxy() { + var args = new Array(arguments.length + 1); + + args[0] = old; + for (var i = 0, len = arguments.length; i < len; i++) { + args[i + 1] = arguments[i]; + } + + fn.apply(this, args); + }; +} diff --git a/node_modules/express/lib/router/layer.js b/node_modules/express/lib/router/layer.js new file mode 100644 index 0000000..fe9210c --- /dev/null +++ b/node_modules/express/lib/router/layer.js @@ -0,0 +1,176 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var pathRegexp = require('path-to-regexp'); +var debug = require('debug')('express:router:layer'); + +/** + * Module variables. + * @private + */ + +var hasOwnProperty = Object.prototype.hasOwnProperty; + +/** + * Module exports. + * @public + */ + +module.exports = Layer; + +function Layer(path, options, fn) { + if (!(this instanceof Layer)) { + return new Layer(path, options, fn); + } + + debug('new %s', path); + var opts = options || {}; + + this.handle = fn; + this.name = fn.name || ''; + this.params = undefined; + this.path = undefined; + this.regexp = pathRegexp(path, this.keys = [], opts); + + if (path === '/' && opts.end === false) { + this.regexp.fast_slash = true; + } +} + +/** + * Handle the error for the layer. + * + * @param {Error} error + * @param {Request} req + * @param {Response} res + * @param {function} next + * @api private + */ + +Layer.prototype.handle_error = function handle_error(error, req, res, next) { + var fn = this.handle; + + if (fn.length !== 4) { + // not a standard error handler + return next(error); + } + + try { + fn(error, req, res, next); + } catch (err) { + next(err); + } +}; + +/** + * Handle the request for the layer. + * + * @param {Request} req + * @param {Response} res + * @param {function} next + * @api private + */ + +Layer.prototype.handle_request = function handle(req, res, next) { + var fn = this.handle; + + if (fn.length > 3) { + // not a standard request handler + return next(); + } + + try { + fn(req, res, next); + } catch (err) { + next(err); + } +}; + +/** + * Check if this route matches `path`, if so + * populate `.params`. + * + * @param {String} path + * @return {Boolean} + * @api private + */ + +Layer.prototype.match = function match(path) { + if (path == null) { + // no path, nothing matches + this.params = undefined; + this.path = undefined; + return false; + } + + if (this.regexp.fast_slash) { + // fast path non-ending match for / (everything matches) + this.params = {}; + this.path = ''; + return true; + } + + var m = this.regexp.exec(path); + + if (!m) { + this.params = undefined; + this.path = undefined; + return false; + } + + // store values + this.params = {}; + this.path = m[0]; + + var keys = this.keys; + var params = this.params; + + for (var i = 1; i < m.length; i++) { + var key = keys[i - 1]; + var prop = key.name; + var val = decode_param(m[i]); + + if (val !== undefined || !(hasOwnProperty.call(params, prop))) { + params[prop] = val; + } + } + + return true; +}; + +/** + * Decode param value. + * + * @param {string} val + * @return {string} + * @private + */ + +function decode_param(val) { + if (typeof val !== 'string' || val.length === 0) { + return val; + } + + try { + return decodeURIComponent(val); + } catch (err) { + if (err instanceof URIError) { + err.message = 'Failed to decode param \'' + val + '\''; + err.status = err.statusCode = 400; + } + + throw err; + } +} diff --git a/node_modules/express/lib/router/route.js b/node_modules/express/lib/router/route.js new file mode 100644 index 0000000..2788d7b --- /dev/null +++ b/node_modules/express/lib/router/route.js @@ -0,0 +1,210 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('express:router:route'); +var flatten = require('array-flatten'); +var Layer = require('./layer'); +var methods = require('methods'); + +/** + * Module variables. + * @private + */ + +var slice = Array.prototype.slice; +var toString = Object.prototype.toString; + +/** + * Module exports. + * @public + */ + +module.exports = Route; + +/** + * Initialize `Route` with the given `path`, + * + * @param {String} path + * @public + */ + +function Route(path) { + this.path = path; + this.stack = []; + + debug('new %s', path); + + // route handlers for various http methods + this.methods = {}; +} + +/** + * Determine if the route handles a given method. + * @private + */ + +Route.prototype._handles_method = function _handles_method(method) { + if (this.methods._all) { + return true; + } + + var name = method.toLowerCase(); + + if (name === 'head' && !this.methods['head']) { + name = 'get'; + } + + return Boolean(this.methods[name]); +}; + +/** + * @return {Array} supported HTTP methods + * @private + */ + +Route.prototype._options = function _options() { + var methods = Object.keys(this.methods); + + // append automatic head + if (this.methods.get && !this.methods.head) { + methods.push('head'); + } + + for (var i = 0; i < methods.length; i++) { + // make upper case + methods[i] = methods[i].toUpperCase(); + } + + return methods; +}; + +/** + * dispatch req, res into this route + * @private + */ + +Route.prototype.dispatch = function dispatch(req, res, done) { + var idx = 0; + var stack = this.stack; + if (stack.length === 0) { + return done(); + } + + var method = req.method.toLowerCase(); + if (method === 'head' && !this.methods['head']) { + method = 'get'; + } + + req.route = this; + + next(); + + function next(err) { + if (err && err === 'route') { + return done(); + } + + var layer = stack[idx++]; + if (!layer) { + return done(err); + } + + if (layer.method && layer.method !== method) { + return next(err); + } + + if (err) { + layer.handle_error(err, req, res, next); + } else { + layer.handle_request(req, res, next); + } + } +}; + +/** + * Add a handler for all HTTP verbs to this route. + * + * Behaves just like middleware and can respond or call `next` + * to continue processing. + * + * You can use multiple `.all` call to add multiple handlers. + * + * function check_something(req, res, next){ + * next(); + * }; + * + * function validate_user(req, res, next){ + * next(); + * }; + * + * route + * .all(validate_user) + * .all(check_something) + * .get(function(req, res, next){ + * res.send('hello world'); + * }); + * + * @param {function} handler + * @return {Route} for chaining + * @api public + */ + +Route.prototype.all = function all() { + var handles = flatten(slice.call(arguments)); + + for (var i = 0; i < handles.length; i++) { + var handle = handles[i]; + + if (typeof handle !== 'function') { + var type = toString.call(handle); + var msg = 'Route.all() requires callback functions but got a ' + type; + throw new TypeError(msg); + } + + var layer = Layer('/', {}, handle); + layer.method = undefined; + + this.methods._all = true; + this.stack.push(layer); + } + + return this; +}; + +methods.forEach(function(method){ + Route.prototype[method] = function(){ + var handles = flatten(slice.call(arguments)); + + for (var i = 0; i < handles.length; i++) { + var handle = handles[i]; + + if (typeof handle !== 'function') { + var type = toString.call(handle); + var msg = 'Route.' + method + '() requires callback functions but got a ' + type; + throw new Error(msg); + } + + debug('%s %s', method, this.path); + + var layer = Layer('/', {}, handle); + layer.method = method; + + this.methods[method] = true; + this.stack.push(layer); + } + + return this; + }; +}); diff --git a/node_modules/express/lib/utils.js b/node_modules/express/lib/utils.js new file mode 100644 index 0000000..f418c58 --- /dev/null +++ b/node_modules/express/lib/utils.js @@ -0,0 +1,299 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @api private + */ + +var contentDisposition = require('content-disposition'); +var contentType = require('content-type'); +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var mime = require('send').mime; +var basename = require('path').basename; +var etag = require('etag'); +var proxyaddr = require('proxy-addr'); +var qs = require('qs'); +var querystring = require('querystring'); + +/** + * Return strong ETag for `body`. + * + * @param {String|Buffer} body + * @param {String} [encoding] + * @return {String} + * @api private + */ + +exports.etag = function (body, encoding) { + var buf = !Buffer.isBuffer(body) + ? new Buffer(body, encoding) + : body; + + return etag(buf, {weak: false}); +}; + +/** + * Return weak ETag for `body`. + * + * @param {String|Buffer} body + * @param {String} [encoding] + * @return {String} + * @api private + */ + +exports.wetag = function wetag(body, encoding){ + var buf = !Buffer.isBuffer(body) + ? new Buffer(body, encoding) + : body; + + return etag(buf, {weak: true}); +}; + +/** + * Check if `path` looks absolute. + * + * @param {String} path + * @return {Boolean} + * @api private + */ + +exports.isAbsolute = function(path){ + if ('/' === path[0]) return true; + if (':' === path[1] && ('\\' === path[2] || '/' === path[2])) return true; // Windows device path + if ('\\\\' === path.substring(0, 2)) return true; // Microsoft Azure absolute path +}; + +/** + * Flatten the given `arr`. + * + * @param {Array} arr + * @return {Array} + * @api private + */ + +exports.flatten = deprecate.function(flatten, + 'utils.flatten: use array-flatten npm module instead'); + +/** + * Normalize the given `type`, for example "html" becomes "text/html". + * + * @param {String} type + * @return {Object} + * @api private + */ + +exports.normalizeType = function(type){ + return ~type.indexOf('/') + ? acceptParams(type) + : { value: mime.lookup(type), params: {} }; +}; + +/** + * Normalize `types`, for example "html" becomes "text/html". + * + * @param {Array} types + * @return {Array} + * @api private + */ + +exports.normalizeTypes = function(types){ + var ret = []; + + for (var i = 0; i < types.length; ++i) { + ret.push(exports.normalizeType(types[i])); + } + + return ret; +}; + +/** + * Generate Content-Disposition header appropriate for the filename. + * non-ascii filenames are urlencoded and a filename* parameter is added + * + * @param {String} filename + * @return {String} + * @api private + */ + +exports.contentDisposition = deprecate.function(contentDisposition, + 'utils.contentDisposition: use content-disposition npm module instead'); + +/** + * Parse accept params `str` returning an + * object with `.value`, `.quality` and `.params`. + * also includes `.originalIndex` for stable sorting + * + * @param {String} str + * @return {Object} + * @api private + */ + +function acceptParams(str, index) { + var parts = str.split(/ *; */); + var ret = { value: parts[0], quality: 1, params: {}, originalIndex: index }; + + for (var i = 1; i < parts.length; ++i) { + var pms = parts[i].split(/ *= */); + if ('q' === pms[0]) { + ret.quality = parseFloat(pms[1]); + } else { + ret.params[pms[0]] = pms[1]; + } + } + + return ret; +} + +/** + * Compile "etag" value to function. + * + * @param {Boolean|String|Function} val + * @return {Function} + * @api private + */ + +exports.compileETag = function(val) { + var fn; + + if (typeof val === 'function') { + return val; + } + + switch (val) { + case true: + fn = exports.wetag; + break; + case false: + break; + case 'strong': + fn = exports.etag; + break; + case 'weak': + fn = exports.wetag; + break; + default: + throw new TypeError('unknown value for etag function: ' + val); + } + + return fn; +} + +/** + * Compile "query parser" value to function. + * + * @param {String|Function} val + * @return {Function} + * @api private + */ + +exports.compileQueryParser = function compileQueryParser(val) { + var fn; + + if (typeof val === 'function') { + return val; + } + + switch (val) { + case true: + fn = querystring.parse; + break; + case false: + fn = newObject; + break; + case 'extended': + fn = parseExtendedQueryString; + break; + case 'simple': + fn = querystring.parse; + break; + default: + throw new TypeError('unknown value for query parser function: ' + val); + } + + return fn; +} + +/** + * Compile "proxy trust" value to function. + * + * @param {Boolean|String|Number|Array|Function} val + * @return {Function} + * @api private + */ + +exports.compileTrust = function(val) { + if (typeof val === 'function') return val; + + if (val === true) { + // Support plain true/false + return function(){ return true }; + } + + if (typeof val === 'number') { + // Support trusting hop count + return function(a, i){ return i < val }; + } + + if (typeof val === 'string') { + // Support comma-separated values + val = val.split(/ *, */); + } + + return proxyaddr.compile(val || []); +} + +/** + * Set the charset in a given Content-Type string. + * + * @param {String} type + * @param {String} charset + * @return {String} + * @api private + */ + +exports.setCharset = function setCharset(type, charset) { + if (!type || !charset) { + return type; + } + + // parse type + var parsed = contentType.parse(type); + + // set charset + parsed.parameters.charset = charset; + + // format type + return contentType.format(parsed); +}; + +/** + * Parse an extended query string with qs. + * + * @return {Object} + * @private + */ + +function parseExtendedQueryString(str) { + return qs.parse(str, { + allowPrototypes: true + }); +} + +/** + * Return new empty object. + * + * @return {Object} + * @api private + */ + +function newObject() { + return {}; +} diff --git a/node_modules/express/lib/view.js b/node_modules/express/lib/view.js new file mode 100644 index 0000000..52415d4 --- /dev/null +++ b/node_modules/express/lib/view.js @@ -0,0 +1,173 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('express:view'); +var path = require('path'); +var fs = require('fs'); +var utils = require('./utils'); + +/** + * Module variables. + * @private + */ + +var dirname = path.dirname; +var basename = path.basename; +var extname = path.extname; +var join = path.join; +var resolve = path.resolve; + +/** + * Module exports. + * @public + */ + +module.exports = View; + +/** + * Initialize a new `View` with the given `name`. + * + * Options: + * + * - `defaultEngine` the default template engine name + * - `engines` template engine require() cache + * - `root` root path for view lookup + * + * @param {string} name + * @param {object} options + * @public + */ + +function View(name, options) { + var opts = options || {}; + + this.defaultEngine = opts.defaultEngine; + this.ext = extname(name); + this.name = name; + this.root = opts.root; + + if (!this.ext && !this.defaultEngine) { + throw new Error('No default engine was specified and no extension was provided.'); + } + + var fileName = name; + + if (!this.ext) { + // get extension from default engine name + this.ext = this.defaultEngine[0] !== '.' + ? '.' + this.defaultEngine + : this.defaultEngine; + + fileName += this.ext; + } + + if (!opts.engines[this.ext]) { + // load engine + opts.engines[this.ext] = require(this.ext.substr(1)).__express; + } + + // store loaded engine + this.engine = opts.engines[this.ext]; + + // lookup path + this.path = this.lookup(fileName); +} + +/** + * Lookup view by the given `name` + * + * @param {string} name + * @private + */ + +View.prototype.lookup = function lookup(name) { + var path; + var roots = [].concat(this.root); + + debug('lookup "%s"', name); + + for (var i = 0; i < roots.length && !path; i++) { + var root = roots[i]; + + // resolve the path + var loc = resolve(root, name); + var dir = dirname(loc); + var file = basename(loc); + + // resolve the file + path = this.resolve(dir, file); + } + + return path; +}; + +/** + * Render with the given options. + * + * @param {object} options + * @param {function} callback + * @private + */ + +View.prototype.render = function render(options, callback) { + debug('render "%s"', this.path); + this.engine(this.path, options, callback); +}; + +/** + * Resolve the file within the given directory. + * + * @param {string} dir + * @param {string} file + * @private + */ + +View.prototype.resolve = function resolve(dir, file) { + var ext = this.ext; + + // . + var path = join(dir, file); + var stat = tryStat(path); + + if (stat && stat.isFile()) { + return path; + } + + // /index. + path = join(dir, basename(file, ext), 'index' + ext); + stat = tryStat(path); + + if (stat && stat.isFile()) { + return path; + } +}; + +/** + * Return a stat, maybe. + * + * @param {string} path + * @return {fs.Stats} + * @private + */ + +function tryStat(path) { + debug('stat "%s"', path); + + try { + return fs.statSync(path); + } catch (e) { + return undefined; + } +} diff --git a/node_modules/express/package.json b/node_modules/express/package.json new file mode 100644 index 0000000..741241e --- /dev/null +++ b/node_modules/express/package.json @@ -0,0 +1,194 @@ +{ + "_args": [ + [ + { + "raw": "express", + "scope": null, + "escapedName": "express", + "name": "express", + "rawSpec": "", + "spec": "latest", + "type": "tag" + }, + "/home/sangwan/Documents/summonAPI" + ] + ], + "_from": "express@latest", + "_id": "express@4.14.1", + "_inCache": true, + "_location": "/express", + "_nodeVersion": "4.6.1", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/express-4.14.1.tgz_1485642795215_0.5481494057457894" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "express", + "scope": null, + "escapedName": "express", + "name": "express", + "rawSpec": "", + "spec": "latest", + "type": "tag" + }, + "_requiredBy": [ + "#USER" + ], + "_resolved": "https://registry.npmjs.org/express/-/express-4.14.1.tgz", + "_shasum": "646c237f766f148c2120aff073817b9e4d7e0d33", + "_shrinkwrap": null, + "_spec": "express", + "_where": "/home/sangwan/Documents/summonAPI", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/expressjs/express/issues" + }, + "contributors": [ + { + "name": "Aaron Heckmann", + "email": "aaron.heckmann+github@gmail.com" + }, + { + "name": "Ciaran Jessup", + "email": "ciaranj@gmail.com" + }, + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Guillermo Rauch", + "email": "rauchg@gmail.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com" + }, + { + "name": "Roman Shtylman", + "email": "shtylman+expressjs@gmail.com" + }, + { + "name": "Young Jae Sim", + "email": "hanul@hanul.me" + } + ], + "dependencies": { + "accepts": "~1.3.3", + "array-flatten": "1.1.1", + "content-disposition": "0.5.2", + "content-type": "~1.0.2", + "cookie": "0.3.1", + "cookie-signature": "1.0.6", + "debug": "~2.2.0", + "depd": "~1.1.0", + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "etag": "~1.7.0", + "finalhandler": "0.5.1", + "fresh": "0.3.0", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.1", + "path-to-regexp": "0.1.7", + "proxy-addr": "~1.1.3", + "qs": "6.2.0", + "range-parser": "~1.2.0", + "send": "0.14.2", + "serve-static": "~1.11.2", + "type-is": "~1.6.14", + "utils-merge": "1.0.0", + "vary": "~1.1.0" + }, + "description": "Fast, unopinionated, minimalist web framework", + "devDependencies": { + "after": "0.8.2", + "body-parser": "1.16.0", + "connect-redis": "~2.4.1", + "cookie-parser": "~1.4.3", + "cookie-session": "~1.2.0", + "ejs": "2.5.5", + "express-session": "1.15.0", + "istanbul": "0.4.5", + "jade": "~1.11.0", + "marked": "0.3.6", + "method-override": "~2.3.6", + "mocha": "3.2.0", + "morgan": "~1.7.0", + "multiparty": "4.1.3", + "should": "11.2.0", + "supertest": "1.2.0", + "vhost": "~3.0.2" + }, + "directories": {}, + "dist": { + "shasum": "646c237f766f148c2120aff073817b9e4d7e0d33", + "tarball": "https://registry.npmjs.org/express/-/express-4.14.1.tgz" + }, + "engines": { + "node": ">= 0.10.0" + }, + "files": [ + "LICENSE", + "History.md", + "Readme.md", + "index.js", + "lib/" + ], + "gitHead": "0437c513f2dbc8d1dfc5a3e35fe35182bd3a671e", + "homepage": "http://expressjs.com/", + "keywords": [ + "express", + "framework", + "sinatra", + "web", + "rest", + "restful", + "router", + "app", + "api" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "hacksparrow", + "email": "captain@hacksparrow.com" + }, + { + "name": "jasnell", + "email": "jasnell@gmail.com" + }, + { + "name": "mikeal", + "email": "mikeal.rogers@gmail.com" + } + ], + "name": "express", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/express.git" + }, + "scripts": { + "test": "mocha --require test/support/env --reporter spec --bail --check-leaks test/ test/acceptance/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/ test/acceptance/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/ test/acceptance/", + "test-tap": "mocha --require test/support/env --reporter tap --check-leaks test/ test/acceptance/" + }, + "version": "4.14.1" +} diff --git a/node_modules/finalhandler/HISTORY.md b/node_modules/finalhandler/HISTORY.md new file mode 100644 index 0000000..5070d22 --- /dev/null +++ b/node_modules/finalhandler/HISTORY.md @@ -0,0 +1,116 @@ +0.5.1 / 2016-11-12 +================== + + * Fix exception when `err.headers` is not an object + * deps: statuses@~1.3.1 + * perf: hoist regular expressions + * perf: remove duplicate validation path + +0.5.0 / 2016-06-15 +================== + + * Change invalid or non-numeric status code to 500 + * Overwrite status message to match set status code + * Prefer `err.statusCode` if `err.status` is invalid + * Set response headers from `err.headers` object + * Use `statuses` instead of `http` module for status messages + - Includes all defined status messages + +0.4.1 / 2015-12-02 +================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + +0.4.0 / 2015-06-14 +================== + + * Fix a false-positive when unpiping in Node.js 0.8 + * Support `statusCode` property on `Error` objects + * Use `unpipe` module for unpiping requests + * deps: escape-html@1.0.2 + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove argument reassignment + +0.3.6 / 2015-05-11 +================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + +0.3.5 / 2015-04-22 +================== + + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + +0.3.4 / 2015-03-15 +================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.3.3 / 2015-01-01 +================== + + * deps: debug@~2.1.1 + * deps: on-finished@~2.2.0 + +0.3.2 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.3.1 / 2014-10-16 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + +0.3.0 / 2014-09-17 +================== + + * Terminate in progress response only on error + * Use `on-finished` to determine request status + +0.2.0 / 2014-09-03 +================== + + * Set `X-Content-Type-Options: nosniff` header + * deps: debug@~2.0.0 + +0.1.0 / 2014-07-16 +================== + + * Respond after request fully read + - prevents hung responses and socket hang ups + * deps: debug@1.0.4 + +0.0.3 / 2014-07-11 +================== + + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.0.2 / 2014-06-19 +================== + + * Handle invalid status codes + +0.0.1 / 2014-06-05 +================== + + * deps: debug@1.0.2 + +0.0.0 / 2014-06-05 +================== + + * Extracted from connect/express diff --git a/node_modules/finalhandler/LICENSE b/node_modules/finalhandler/LICENSE new file mode 100644 index 0000000..0fa162e --- /dev/null +++ b/node_modules/finalhandler/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/finalhandler/README.md b/node_modules/finalhandler/README.md new file mode 100644 index 0000000..84c3d2a --- /dev/null +++ b/node_modules/finalhandler/README.md @@ -0,0 +1,146 @@ +# finalhandler + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js function to invoke as the final step to respond to HTTP request. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install finalhandler +``` + +## API + +``` +var finalhandler = require('finalhandler') +``` + +### finalhandler(req, res, [options]) + +Returns function to be invoked as the final step for the given `req` and `res`. +This function is to be invoked as `fn(err)`. If `err` is falsy, the handler will +write out a 404 response to the `res`. If it is truthy, an error response will +be written out to the `res`. + +When an error is written, the following information is added to the response: + + * The `res.statusCode` is set from `err.status` (or `err.statusCode`). If + this value is outside the 4xx or 5xx range, it will be set to 500. + * The `res.statusMessage` is set according to the status code. + * The body will be the HTML of the status code message if `env` is + `'production'`, otherwise will be `err.stack`. + * Any headers specified in an `err.headers` object. + +The final handler will also unpipe anything from `req` when it is invoked. + +#### options.env + +By default, the environment is determined by `NODE_ENV` variable, but it can be +overridden by this option. + +#### options.onerror + +Provide a function to be called with the `err` when it exists. Can be used for +writing errors to a central location without excessive function generation. Called +as `onerror(err, req, res)`. + +## Examples + +### always 404 + +```js +var finalhandler = require('finalhandler') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + done() +}) + +server.listen(3000) +``` + +### perform simple action + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) +``` + +### use with middleware-style functions + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +var serve = serveStatic('public') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + serve(req, res, done) +}) + +server.listen(3000) +``` + +### keep log of all errors + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res, {onerror: logerror}) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) + +function logerror (err) { + console.error(err.stack || err.toString()) +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/finalhandler.svg +[npm-url]: https://npmjs.org/package/finalhandler +[node-image]: https://img.shields.io/node/v/finalhandler.svg +[node-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/finalhandler.svg +[travis-url]: https://travis-ci.org/pillarjs/finalhandler +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/finalhandler.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/finalhandler?branch=master +[downloads-image]: https://img.shields.io/npm/dm/finalhandler.svg +[downloads-url]: https://npmjs.org/package/finalhandler diff --git a/node_modules/finalhandler/index.js b/node_modules/finalhandler/index.js new file mode 100644 index 0000000..e0719c5 --- /dev/null +++ b/node_modules/finalhandler/index.js @@ -0,0 +1,247 @@ +/*! + * finalhandler + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('finalhandler') +var escapeHtml = require('escape-html') +var onFinished = require('on-finished') +var statuses = require('statuses') +var unpipe = require('unpipe') + +/** + * Module variables. + * @private + */ + +var DOUBLE_SPACE_REGEXP = /\x20{2}/g +var NEWLINE_REGEXP = /\n/g + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function (fn) { process.nextTick(fn.bind.apply(fn, arguments)) } +var isFinished = onFinished.isFinished + +/** + * Module exports. + * @public + */ + +module.exports = finalhandler + +/** + * Create a function to handle the final response. + * + * @param {Request} req + * @param {Response} res + * @param {Object} [options] + * @return {Function} + * @public + */ + +function finalhandler (req, res, options) { + var opts = options || {} + + // get environment + var env = opts.env || process.env.NODE_ENV || 'development' + + // get error callback + var onerror = opts.onerror + + return function (err) { + var headers + var status + + // ignore 404 on in-flight response + if (!err && res._header) { + debug('cannot 404 after headers sent') + return + } + + // unhandled error + if (err) { + // respect status code from error + status = getErrorStatusCode(err) + + // respect headers from error + if (status !== undefined) { + headers = getErrorHeaders(err) + } + + // fallback to status code on response + if (status === undefined) { + status = getResponseStatusCode(res) + } + + // production gets a basic error message + var msg = env === 'production' + ? statuses[status] + : err.stack || err.toString() + msg = escapeHtml(msg) + .replace(NEWLINE_REGEXP, '
') + .replace(DOUBLE_SPACE_REGEXP, '  ') + '\n' + } else { + status = 404 + msg = 'Cannot ' + escapeHtml(req.method) + ' ' + escapeHtml(req.originalUrl || req.url) + '\n' + } + + debug('default %s', status) + + // schedule onerror callback + if (err && onerror) { + defer(onerror, err, req, res) + } + + // cannot actually respond + if (res._header) { + debug('cannot %d after headers sent', status) + req.socket.destroy() + return + } + + // send response + send(req, res, status, headers, msg) + } +} + +/** + * Get headers from Error object. + * + * @param {Error} err + * @return {object} + * @private + */ + +function getErrorHeaders (err) { + if (!err.headers || typeof err.headers !== 'object') { + return undefined + } + + var headers = Object.create(null) + var keys = Object.keys(err.headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + headers[key] = err.headers[key] + } + + return headers +} + +/** + * Get status code from Error object. + * + * @param {Error} err + * @return {number} + * @private + */ + +function getErrorStatusCode (err) { + // check err.status + if (typeof err.status === 'number' && err.status >= 400 && err.status < 600) { + return err.status + } + + // check err.statusCode + if (typeof err.statusCode === 'number' && err.statusCode >= 400 && err.statusCode < 600) { + return err.statusCode + } + + return undefined +} + +/** + * Get status code from response. + * + * @param {OutgoingMessage} res + * @return {number} + * @private + */ + +function getResponseStatusCode (res) { + var status = res.statusCode + + // default status code to 500 if outside valid range + if (typeof status !== 'number' || status < 400 || status > 599) { + status = 500 + } + + return status +} + +/** + * Send response. + * + * @param {IncomingMessage} req + * @param {OutgoingMessage} res + * @param {number} status + * @param {object} headers + * @param {string} body + * @private + */ + +function send (req, res, status, headers, body) { + function write () { + // response status + res.statusCode = status + res.statusMessage = statuses[status] + + // response headers + setHeaders(res, headers) + + // security header for content sniffing + res.setHeader('X-Content-Type-Options', 'nosniff') + + // standard headers + res.setHeader('Content-Type', 'text/html; charset=utf-8') + res.setHeader('Content-Length', Buffer.byteLength(body, 'utf8')) + + if (req.method === 'HEAD') { + res.end() + return + } + + res.end(body, 'utf8') + } + + if (isFinished(req)) { + write() + return + } + + // unpipe everything from the request + unpipe(req) + + // flush the request + onFinished(req, write) + req.resume() +} + +/** + * Set response headers from an object. + * + * @param {OutgoingMessage} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + if (!headers) { + return + } + + var keys = Object.keys(headers) + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/node_modules/finalhandler/package.json b/node_modules/finalhandler/package.json new file mode 100644 index 0000000..bdf8e99 --- /dev/null +++ b/node_modules/finalhandler/package.json @@ -0,0 +1,109 @@ +{ + "_args": [ + [ + { + "raw": "finalhandler@0.5.1", + "scope": null, + "escapedName": "finalhandler", + "name": "finalhandler", + "rawSpec": "0.5.1", + "spec": "0.5.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "finalhandler@0.5.1", + "_id": "finalhandler@0.5.1", + "_inCache": true, + "_location": "/finalhandler", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/finalhandler-0.5.1.tgz_1479018213560_0.8304649770725518" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "finalhandler@0.5.1", + "scope": null, + "escapedName": "finalhandler", + "name": "finalhandler", + "rawSpec": "0.5.1", + "spec": "0.5.1", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-0.5.1.tgz", + "_shasum": "2c400d8d4530935bc232549c5fa385ec07de6fcd", + "_shrinkwrap": null, + "_spec": "finalhandler@0.5.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/pillarjs/finalhandler/issues" + }, + "dependencies": { + "debug": "~2.2.0", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "statuses": "~1.3.1", + "unpipe": "~1.0.0" + }, + "description": "Node.js final http responder", + "devDependencies": { + "eslint": "3.10.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-markdown": "1.0.0-beta.3", + "eslint-plugin-promise": "3.3.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "readable-stream": "2.1.2", + "supertest": "1.1.0" + }, + "directories": {}, + "dist": { + "shasum": "2c400d8d4530935bc232549c5fa385ec07de6fcd", + "tarball": "https://registry.npmjs.org/finalhandler/-/finalhandler-0.5.1.tgz" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "gitHead": "ae6137a81049eecb2d57341b1a9c4efed46a25da", + "homepage": "https://github.com/pillarjs/finalhandler", + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "finalhandler", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/finalhandler.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "0.5.1" +} diff --git a/node_modules/forwarded/HISTORY.md b/node_modules/forwarded/HISTORY.md new file mode 100644 index 0000000..97fa1d1 --- /dev/null +++ b/node_modules/forwarded/HISTORY.md @@ -0,0 +1,4 @@ +0.1.0 / 2014-09-21 +================== + + * Initial release diff --git a/node_modules/forwarded/LICENSE b/node_modules/forwarded/LICENSE new file mode 100644 index 0000000..b7dce6c --- /dev/null +++ b/node_modules/forwarded/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/forwarded/README.md b/node_modules/forwarded/README.md new file mode 100644 index 0000000..2b4988f --- /dev/null +++ b/node_modules/forwarded/README.md @@ -0,0 +1,53 @@ +# forwarded + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse HTTP X-Forwarded-For header + +## Installation + +```sh +$ npm install forwarded +``` + +## API + +```js +var forwarded = require('forwarded') +``` + +### forwarded(req) + +```js +var addresses = forwarded(req) +``` + +Parse the `X-Forwarded-For` header from the request. Returns an array +of the addresses, including the socket address for the `req`. In reverse +order (i.e. index `0` is the socket address and the last index is the +furthest address, typically the end-user). + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/forwarded.svg?style=flat +[npm-url]: https://npmjs.org/package/forwarded +[node-version-image]: https://img.shields.io/node/v/forwarded.svg?style=flat +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/forwarded.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/forwarded +[coveralls-image]: https://img.shields.io/coveralls/jshttp/forwarded.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/forwarded?branch=master +[downloads-image]: https://img.shields.io/npm/dm/forwarded.svg?style=flat +[downloads-url]: https://npmjs.org/package/forwarded diff --git a/node_modules/forwarded/index.js b/node_modules/forwarded/index.js new file mode 100644 index 0000000..2f5c340 --- /dev/null +++ b/node_modules/forwarded/index.js @@ -0,0 +1,35 @@ +/*! + * forwarded + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = forwarded + +/** + * Get all addresses in the request, using the `X-Forwarded-For` header. + * + * @param {Object} req + * @api public + */ + +function forwarded(req) { + if (!req) { + throw new TypeError('argument req is required') + } + + // simple header parsing + var proxyAddrs = (req.headers['x-forwarded-for'] || '') + .split(/ *, */) + .filter(Boolean) + .reverse() + var socketAddr = req.connection.remoteAddress + var addrs = [socketAddr].concat(proxyAddrs) + + // return all addresses + return addrs +} diff --git a/node_modules/forwarded/package.json b/node_modules/forwarded/package.json new file mode 100644 index 0000000..02aa303 --- /dev/null +++ b/node_modules/forwarded/package.json @@ -0,0 +1,99 @@ +{ + "_args": [ + [ + { + "raw": "forwarded@~0.1.0", + "scope": null, + "escapedName": "forwarded", + "name": "forwarded", + "rawSpec": "~0.1.0", + "spec": ">=0.1.0 <0.2.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/proxy-addr" + ] + ], + "_from": "forwarded@>=0.1.0 <0.2.0", + "_id": "forwarded@0.1.0", + "_inCache": true, + "_location": "/forwarded", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.21", + "_phantomChildren": {}, + "_requested": { + "raw": "forwarded@~0.1.0", + "scope": null, + "escapedName": "forwarded", + "name": "forwarded", + "rawSpec": "~0.1.0", + "spec": ">=0.1.0 <0.2.0", + "type": "range" + }, + "_requiredBy": [ + "/proxy-addr" + ], + "_resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz", + "_shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363", + "_shrinkwrap": null, + "_spec": "forwarded@~0.1.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/proxy-addr", + "bugs": { + "url": "https://github.com/jshttp/forwarded/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "Parse HTTP X-Forwarded-For header", + "devDependencies": { + "istanbul": "0.3.2", + "mocha": "~1.21.4" + }, + "directories": {}, + "dist": { + "shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363", + "tarball": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "e9a9faeb3cfaadf40eb57d144fff26bca9b818e8", + "homepage": "https://github.com/jshttp/forwarded", + "keywords": [ + "x-forwarded-for", + "http", + "req" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "forwarded", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/forwarded.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.1.0" +} diff --git a/node_modules/fresh/HISTORY.md b/node_modules/fresh/HISTORY.md new file mode 100644 index 0000000..3c95fbb --- /dev/null +++ b/node_modules/fresh/HISTORY.md @@ -0,0 +1,38 @@ +0.3.0 / 2015-05-12 +================== + + * Add weak `ETag` matching support + +0.2.4 / 2014-09-07 +================== + + * Support Node.js 0.6 + +0.2.3 / 2014-09-07 +================== + + * Move repository to jshttp + +0.2.2 / 2014-02-19 +================== + + * Revert "Fix for blank page on Safari reload" + +0.2.1 / 2014-01-29 +================== + + * Fix for blank page on Safari reload + +0.2.0 / 2013-08-11 +================== + + * Return stale for `Cache-Control: no-cache` + +0.1.0 / 2012-06-15 +================== + * Add `If-None-Match: *` support + +0.0.1 / 2012-06-10 +================== + + * Initial release diff --git a/node_modules/fresh/LICENSE b/node_modules/fresh/LICENSE new file mode 100644 index 0000000..f527394 --- /dev/null +++ b/node_modules/fresh/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/fresh/README.md b/node_modules/fresh/README.md new file mode 100644 index 0000000..0813e30 --- /dev/null +++ b/node_modules/fresh/README.md @@ -0,0 +1,58 @@ +# fresh + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP response freshness testing + +## Installation + +``` +$ npm install fresh +``` + +## API + +```js +var fresh = require('fresh') +``` + +### fresh(req, res) + + Check freshness of `req` and `res` headers. + + When the cache is "fresh" __true__ is returned, + otherwise __false__ is returned to indicate that + the cache is now stale. + +## Example + +```js +var req = { 'if-none-match': 'tobi' }; +var res = { 'etag': 'luna' }; +fresh(req, res); +// => false + +var req = { 'if-none-match': 'tobi' }; +var res = { 'etag': 'tobi' }; +fresh(req, res); +// => true +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/fresh.svg +[npm-url]: https://npmjs.org/package/fresh +[node-version-image]: https://img.shields.io/node/v/fresh.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/fresh/master.svg +[travis-url]: https://travis-ci.org/jshttp/fresh +[coveralls-image]: https://img.shields.io/coveralls/jshttp/fresh/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/fresh?branch=master +[downloads-image]: https://img.shields.io/npm/dm/fresh.svg +[downloads-url]: https://npmjs.org/package/fresh diff --git a/node_modules/fresh/index.js b/node_modules/fresh/index.js new file mode 100644 index 0000000..a900873 --- /dev/null +++ b/node_modules/fresh/index.js @@ -0,0 +1,57 @@ + +/** + * Expose `fresh()`. + */ + +module.exports = fresh; + +/** + * Check freshness of `req` and `res` headers. + * + * When the cache is "fresh" __true__ is returned, + * otherwise __false__ is returned to indicate that + * the cache is now stale. + * + * @param {Object} req + * @param {Object} res + * @return {Boolean} + * @api public + */ + +function fresh(req, res) { + // defaults + var etagMatches = true; + var notModified = true; + + // fields + var modifiedSince = req['if-modified-since']; + var noneMatch = req['if-none-match']; + var lastModified = res['last-modified']; + var etag = res['etag']; + var cc = req['cache-control']; + + // unconditional request + if (!modifiedSince && !noneMatch) return false; + + // check for no-cache cache request directive + if (cc && cc.indexOf('no-cache') !== -1) return false; + + // parse if-none-match + if (noneMatch) noneMatch = noneMatch.split(/ *, */); + + // if-none-match + if (noneMatch) { + etagMatches = noneMatch.some(function (match) { + return match === '*' || match === etag || match === 'W/' + etag; + }); + } + + // if-modified-since + if (modifiedSince) { + modifiedSince = new Date(modifiedSince); + lastModified = new Date(lastModified); + notModified = lastModified <= modifiedSince; + } + + return !! (etagMatches && notModified); +} diff --git a/node_modules/fresh/package.json b/node_modules/fresh/package.json new file mode 100644 index 0000000..91e114d --- /dev/null +++ b/node_modules/fresh/package.json @@ -0,0 +1,122 @@ +{ + "_args": [ + [ + { + "raw": "fresh@0.3.0", + "scope": null, + "escapedName": "fresh", + "name": "fresh", + "rawSpec": "0.3.0", + "spec": "0.3.0", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "fresh@0.3.0", + "_id": "fresh@0.3.0", + "_inCache": true, + "_location": "/fresh", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "fresh@0.3.0", + "scope": null, + "escapedName": "fresh", + "name": "fresh", + "rawSpec": "0.3.0", + "spec": "0.3.0", + "type": "version" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/fresh/-/fresh-0.3.0.tgz", + "_shasum": "651f838e22424e7566de161d8358caa199f83d4f", + "_shrinkwrap": null, + "_spec": "fresh@0.3.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/jshttp/fresh/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": {}, + "description": "HTTP response freshness testing", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "651f838e22424e7566de161d8358caa199f83d4f", + "tarball": "https://registry.npmjs.org/fresh/-/fresh-0.3.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "gitHead": "14616c9748368ca08cd6a955dd88ab659b778634", + "homepage": "https://github.com/jshttp/fresh", + "keywords": [ + "fresh", + "http", + "conditional", + "cache" + ], + "license": "MIT", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "jonathanong", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "fresh", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/fresh.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.3.0" +} diff --git a/node_modules/http-errors/HISTORY.md b/node_modules/http-errors/HISTORY.md new file mode 100644 index 0000000..a7f080f --- /dev/null +++ b/node_modules/http-errors/HISTORY.md @@ -0,0 +1,103 @@ +2016-11-16 / 1.5.1 +================== + + * deps: inherits@2.0.3 + - Fix issue loading in browser + * deps: setprototypeof@1.0.2 + * deps: statuses@'>= 1.3.1 < 2' + +2016-05-18 / 1.5.0 +================== + + * Support new code `421 Misdirected Request` + * Use `setprototypeof` module to replace `__proto__` setting + * deps: statuses@'>= 1.3.0 < 2' + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: enable strict mode + +2016-01-28 / 1.4.0 +================== + + * Add `HttpError` export, for `err instanceof createError.HttpError` + * deps: inherits@2.0.1 + * deps: statuses@'>= 1.2.1 < 2' + - Fix message for status 451 + - Remove incorrect nginx status code + +2015-02-02 / 1.3.1 +================== + + * Fix regression where status can be overwritten in `createError` `props` + +2015-02-01 / 1.3.0 +================== + + * Construct errors using defined constructors from `createError` + * Fix error names that are not identifiers + - `createError["I'mateapot"]` is now `createError.ImATeapot` + * Set a meaningful `name` property on constructed errors + +2014-12-09 / 1.2.8 +================== + + * Fix stack trace from exported function + * Remove `arguments.callee` usage + +2014-10-14 / 1.2.7 +================== + + * Remove duplicate line + +2014-10-02 / 1.2.6 +================== + + * Fix `expose` to be `true` for `ClientError` constructor + +2014-09-28 / 1.2.5 +================== + + * deps: statuses@1 + +2014-09-21 / 1.2.4 +================== + + * Fix dependency version to work with old `npm`s + +2014-09-21 / 1.2.3 +================== + + * deps: statuses@~1.1.0 + +2014-09-21 / 1.2.2 +================== + + * Fix publish error + +2014-09-21 / 1.2.1 +================== + + * Support Node.js 0.6 + * Use `inherits` instead of `util` + +2014-09-09 / 1.2.0 +================== + + * Fix the way inheriting functions + * Support `expose` being provided in properties argument + +2014-09-08 / 1.1.0 +================== + + * Default status to 500 + * Support provided `error` to extend + +2014-09-08 / 1.0.1 +================== + + * Fix accepting string message + +2014-09-08 / 1.0.0 +================== + + * Initial release diff --git a/node_modules/http-errors/LICENSE b/node_modules/http-errors/LICENSE new file mode 100644 index 0000000..82af4df --- /dev/null +++ b/node_modules/http-errors/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2016 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/http-errors/README.md b/node_modules/http-errors/README.md new file mode 100644 index 0000000..4143977 --- /dev/null +++ b/node_modules/http-errors/README.md @@ -0,0 +1,132 @@ +# http-errors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create HTTP errors for Express, Koa, Connect, etc. with ease. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install http-errors +``` + +## Example + +```js +var createError = require('http-errors') +var express = require('express') +var app = express() + +app.use(function (req, res, next) { + if (!req.user) return next(createError(401, 'Please login to view this page.')) + next() +}) +``` + +## API + +This is the current API, currently extracted from Koa and subject to change. + +All errors inherit from JavaScript `Error` and the exported `createError.HttpError`. + +### Error Properties + +- `expose` - can be used to signal if `message` should be sent to the client, + defaulting to `false` when `status` >= 500 +- `headers` - can be an object of header names to values to be sent to the + client, defaulting to `undefined`. When defined, the key names should all + be lower-cased +- `message` +- `status` and `statusCode` - the status code of the error, defaulting to `500` + +### createError([status], [message], [properties]) + + + +```js +var err = createError(404, 'This video does not exist!') +``` + +- `status: 500` - the status code as a number +- `message` - the message of the error, defaulting to node's text for that status code. +- `properties` - custom properties to attach to the object + +### new createError\[code || name\](\[msg]\)) + + + +```js +var err = new createError.NotFound() +``` + +- `code` - the status code as a number +- `name` - the name of the error as a "bumpy case", i.e. `NotFound` or `InternalServerError`. + +#### List of all constructors + +|Status Code|Constructor Name | +|-----------|-----------------------------| +|400 |BadRequest | +|401 |Unauthorized | +|402 |PaymentRequired | +|403 |Forbidden | +|404 |NotFound | +|405 |MethodNotAllowed | +|406 |NotAcceptable | +|407 |ProxyAuthenticationRequired | +|408 |RequestTimeout | +|409 |Conflict | +|410 |Gone | +|411 |LengthRequired | +|412 |PreconditionFailed | +|413 |PayloadTooLarge | +|414 |URITooLong | +|415 |UnsupportedMediaType | +|416 |RangeNotSatisfiable | +|417 |ExpectationFailed | +|418 |ImATeapot | +|421 |MisdirectedRequest | +|422 |UnprocessableEntity | +|423 |Locked | +|424 |FailedDependency | +|425 |UnorderedCollection | +|426 |UpgradeRequired | +|428 |PreconditionRequired | +|429 |TooManyRequests | +|431 |RequestHeaderFieldsTooLarge | +|451 |UnavailableForLegalReasons | +|500 |InternalServerError | +|501 |NotImplemented | +|502 |BadGateway | +|503 |ServiceUnavailable | +|504 |GatewayTimeout | +|505 |HTTPVersionNotSupported | +|506 |VariantAlsoNegotiates | +|507 |InsufficientStorage | +|508 |LoopDetected | +|509 |BandwidthLimitExceeded | +|510 |NotExtended | +|511 |NetworkAuthenticationRequired| + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/http-errors.svg +[npm-url]: https://npmjs.org/package/http-errors +[node-version-image]: https://img.shields.io/node/v/http-errors.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/http-errors.svg +[travis-url]: https://travis-ci.org/jshttp/http-errors +[coveralls-image]: https://img.shields.io/coveralls/jshttp/http-errors.svg +[coveralls-url]: https://coveralls.io/r/jshttp/http-errors +[downloads-image]: https://img.shields.io/npm/dm/http-errors.svg +[downloads-url]: https://npmjs.org/package/http-errors diff --git a/node_modules/http-errors/index.js b/node_modules/http-errors/index.js new file mode 100644 index 0000000..6130db8 --- /dev/null +++ b/node_modules/http-errors/index.js @@ -0,0 +1,223 @@ +/*! + * http-errors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var setPrototypeOf = require('setprototypeof') +var statuses = require('statuses') +var inherits = require('inherits') + +/** + * Module exports. + * @public + */ + +module.exports = createError +module.exports.HttpError = createHttpErrorConstructor() + +// Populate exports for all constructors +populateConstructorExports(module.exports, statuses.codes, module.exports.HttpError) + +/** + * Create a new HTTP Error. + * + * @returns {Error} + * @public + */ + +function createError () { + // so much arity going on ~_~ + var err + var msg + var status = 500 + var props = {} + for (var i = 0; i < arguments.length; i++) { + var arg = arguments[i] + if (arg instanceof Error) { + err = arg + status = err.status || err.statusCode || status + continue + } + switch (typeof arg) { + case 'string': + msg = arg + break + case 'number': + status = arg + break + case 'object': + props = arg + break + } + } + + if (typeof status !== 'number' || !statuses[status]) { + status = 500 + } + + // constructor + var HttpError = createError[status] + + if (!err) { + // create error + err = HttpError + ? new HttpError(msg) + : new Error(msg || statuses[status]) + Error.captureStackTrace(err, createError) + } + + if (!HttpError || !(err instanceof HttpError)) { + // add properties to generic error + err.expose = status < 500 + err.status = err.statusCode = status + } + + for (var key in props) { + if (key !== 'status' && key !== 'statusCode') { + err[key] = props[key] + } + } + + return err +} + +/** + * Create HTTP error abstract base class. + * @private + */ + +function createHttpErrorConstructor () { + function HttpError () { + throw new TypeError('cannot construct abstract class') + } + + inherits(HttpError, Error) + + return HttpError +} + +/** + * Create a constructor for a client error. + * @private + */ + +function createClientErrorConstructor (HttpError, name, code) { + var className = name.match(/Error$/) ? name : name + 'Error' + + function ClientError (message) { + // create the error object + var err = new Error(message != null ? message : statuses[code]) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ClientError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ClientError.prototype) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ClientError, HttpError) + + ClientError.prototype.status = code + ClientError.prototype.statusCode = code + ClientError.prototype.expose = true + + return ClientError +} + +/** + * Create a constructor for a server error. + * @private + */ + +function createServerErrorConstructor (HttpError, name, code) { + var className = name.match(/Error$/) ? name : name + 'Error' + + function ServerError (message) { + // create the error object + var err = new Error(message != null ? message : statuses[code]) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ServerError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ServerError.prototype) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ServerError, HttpError) + + ServerError.prototype.status = code + ServerError.prototype.statusCode = code + ServerError.prototype.expose = false + + return ServerError +} + +/** + * Populate the exports object with constructors for every error class. + * @private + */ + +function populateConstructorExports (exports, codes, HttpError) { + codes.forEach(function forEachCode (code) { + var CodeError + var name = toIdentifier(statuses[code]) + + switch (String(code).charAt(0)) { + case '4': + CodeError = createClientErrorConstructor(HttpError, name, code) + break + case '5': + CodeError = createServerErrorConstructor(HttpError, name, code) + break + } + + if (CodeError) { + // export the constructor + exports[code] = CodeError + exports[name] = CodeError + } + }) + + // backwards-compatibility + exports["I'mateapot"] = exports.ImATeapot +} + +/** + * Convert a string of words to a JavaScript identifier. + * @private + */ + +function toIdentifier (str) { + return str.split(' ').map(function (token) { + return token.slice(0, 1).toUpperCase() + token.slice(1) + }).join('').replace(/[^ _0-9a-z]/gi, '') +} diff --git a/node_modules/http-errors/package.json b/node_modules/http-errors/package.json new file mode 100644 index 0000000..2736d8c --- /dev/null +++ b/node_modules/http-errors/package.json @@ -0,0 +1,129 @@ +{ + "_args": [ + [ + { + "raw": "http-errors@~1.5.1", + "scope": null, + "escapedName": "http-errors", + "name": "http-errors", + "rawSpec": "~1.5.1", + "spec": ">=1.5.1 <1.6.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/send" + ] + ], + "_from": "http-errors@>=1.5.1 <1.6.0", + "_id": "http-errors@1.5.1", + "_inCache": true, + "_location": "/http-errors", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/http-errors-1.5.1.tgz_1479361411507_0.47469806275330484" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "http-errors@~1.5.1", + "scope": null, + "escapedName": "http-errors", + "name": "http-errors", + "rawSpec": "~1.5.1", + "spec": ">=1.5.1 <1.6.0", + "type": "range" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.5.1.tgz", + "_shasum": "788c0d2c1de2c81b9e6e8c01843b6b97eb920750", + "_shrinkwrap": null, + "_spec": "http-errors@~1.5.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/send", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/jshttp/http-errors/issues" + }, + "contributors": [ + { + "name": "Alan Plum", + "email": "me@pluma.io" + }, + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": { + "inherits": "2.0.3", + "setprototypeof": "1.0.2", + "statuses": ">= 1.3.1 < 2" + }, + "description": "Create HTTP error objects", + "devDependencies": { + "eslint": "3.10.2", + "eslint-config-standard": "6.2.1", + "eslint-plugin-markdown": "1.0.0-beta.3", + "eslint-plugin-promise": "3.3.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "788c0d2c1de2c81b9e6e8c01843b6b97eb920750", + "tarball": "https://registry.npmjs.org/http-errors/-/http-errors-1.5.1.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "index.js", + "HISTORY.md", + "LICENSE", + "README.md" + ], + "gitHead": "a55db90c7a2c0bafedb4bfa35a85eee5f53a37e9", + "homepage": "https://github.com/jshttp/http-errors", + "keywords": [ + "http", + "error" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "egeste", + "email": "npm@egeste.net" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "http-errors", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/http-errors.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.5.1" +} diff --git a/node_modules/inherits/LICENSE b/node_modules/inherits/LICENSE new file mode 100644 index 0000000..dea3013 --- /dev/null +++ b/node_modules/inherits/LICENSE @@ -0,0 +1,16 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. + diff --git a/node_modules/inherits/README.md b/node_modules/inherits/README.md new file mode 100644 index 0000000..b1c5665 --- /dev/null +++ b/node_modules/inherits/README.md @@ -0,0 +1,42 @@ +Browser-friendly inheritance fully compatible with standard node.js +[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). + +This package exports standard `inherits` from node.js `util` module in +node environment, but also provides alternative browser-friendly +implementation through [browser +field](https://gist.github.com/shtylman/4339901). Alternative +implementation is a literal copy of standard one located in standalone +module to avoid requiring of `util`. It also has a shim for old +browsers with no `Object.create` support. + +While keeping you sure you are using standard `inherits` +implementation in node.js environment, it allows bundlers such as +[browserify](https://github.com/substack/node-browserify) to not +include full `util` package to your client code if all you need is +just `inherits` function. It worth, because browser shim for `util` +package is large and `inherits` is often the single function you need +from it. + +It's recommended to use this package instead of +`require('util').inherits` for any code that has chances to be used +not only in node.js but in browser too. + +## usage + +```js +var inherits = require('inherits'); +// then use exactly as the standard one +``` + +## note on version ~1.0 + +Version ~1.0 had completely different motivation and is not compatible +neither with 2.0 nor with standard node.js `inherits`. + +If you are using version ~1.0 and planning to switch to ~2.0, be +careful: + +* new version uses `super_` instead of `super` for referencing + superclass +* new version overwrites current prototype while old one preserves any + existing fields on it diff --git a/node_modules/inherits/inherits.js b/node_modules/inherits/inherits.js new file mode 100644 index 0000000..3b94763 --- /dev/null +++ b/node_modules/inherits/inherits.js @@ -0,0 +1,7 @@ +try { + var util = require('util'); + if (typeof util.inherits !== 'function') throw ''; + module.exports = util.inherits; +} catch (e) { + module.exports = require('./inherits_browser.js'); +} diff --git a/node_modules/inherits/inherits_browser.js b/node_modules/inherits/inherits_browser.js new file mode 100644 index 0000000..c1e78a7 --- /dev/null +++ b/node_modules/inherits/inherits_browser.js @@ -0,0 +1,23 @@ +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } +} diff --git a/node_modules/inherits/package.json b/node_modules/inherits/package.json new file mode 100644 index 0000000..c3c78ef --- /dev/null +++ b/node_modules/inherits/package.json @@ -0,0 +1,97 @@ +{ + "_args": [ + [ + { + "raw": "inherits@2.0.3", + "scope": null, + "escapedName": "inherits", + "name": "inherits", + "rawSpec": "2.0.3", + "spec": "2.0.3", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/http-errors" + ] + ], + "_from": "inherits@2.0.3", + "_id": "inherits@2.0.3", + "_inCache": true, + "_location": "/inherits", + "_nodeVersion": "6.5.0", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/inherits-2.0.3.tgz_1473295776489_0.08142363070510328" + }, + "_npmUser": { + "name": "isaacs", + "email": "i@izs.me" + }, + "_npmVersion": "3.10.7", + "_phantomChildren": {}, + "_requested": { + "raw": "inherits@2.0.3", + "scope": null, + "escapedName": "inherits", + "name": "inherits", + "rawSpec": "2.0.3", + "spec": "2.0.3", + "type": "version" + }, + "_requiredBy": [ + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "_shasum": "633c2c83e3da42a502f52466022480f4208261de", + "_shrinkwrap": null, + "_spec": "inherits@2.0.3", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/http-errors", + "browser": "./inherits_browser.js", + "bugs": { + "url": "https://github.com/isaacs/inherits/issues" + }, + "dependencies": {}, + "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", + "devDependencies": { + "tap": "^7.1.0" + }, + "directories": {}, + "dist": { + "shasum": "633c2c83e3da42a502f52466022480f4208261de", + "tarball": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz" + }, + "files": [ + "inherits.js", + "inherits_browser.js" + ], + "gitHead": "e05d0fb27c61a3ec687214f0476386b765364d5f", + "homepage": "https://github.com/isaacs/inherits#readme", + "keywords": [ + "inheritance", + "class", + "klass", + "oop", + "object-oriented", + "inherits", + "browser", + "browserify" + ], + "license": "ISC", + "main": "./inherits.js", + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "name": "inherits", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/inherits.git" + }, + "scripts": { + "test": "node test" + }, + "version": "2.0.3" +} diff --git a/node_modules/ipaddr.js/.npmignore b/node_modules/ipaddr.js/.npmignore new file mode 100644 index 0000000..7a1537b --- /dev/null +++ b/node_modules/ipaddr.js/.npmignore @@ -0,0 +1,2 @@ +.idea +node_modules diff --git a/node_modules/ipaddr.js/.travis.yml b/node_modules/ipaddr.js/.travis.yml new file mode 100644 index 0000000..aa3d14a --- /dev/null +++ b/node_modules/ipaddr.js/.travis.yml @@ -0,0 +1,10 @@ +language: node_js + +node_js: + - "0.10" + - "0.11" + - "0.12" + - "4.0" + - "4.1" + - "4.2" + - "5" diff --git a/node_modules/ipaddr.js/Cakefile b/node_modules/ipaddr.js/Cakefile new file mode 100644 index 0000000..7fd355a --- /dev/null +++ b/node_modules/ipaddr.js/Cakefile @@ -0,0 +1,18 @@ +fs = require 'fs' +CoffeeScript = require 'coffee-script' +nodeunit = require 'nodeunit' +UglifyJS = require 'uglify-js' + +task 'build', 'build the JavaScript files from CoffeeScript source', build = (cb) -> + source = fs.readFileSync 'src/ipaddr.coffee' + fs.writeFileSync 'lib/ipaddr.js', CoffeeScript.compile source.toString() + + invoke 'test' + invoke 'compress' + +task 'test', 'run the bundled tests', (cb) -> + nodeunit.reporters.default.run ['test'] + +task 'compress', 'uglify the resulting javascript', (cb) -> + result = UglifyJS.minify('lib/ipaddr.js') + fs.writeFileSync('ipaddr.min.js', result.code) diff --git a/node_modules/ipaddr.js/LICENSE b/node_modules/ipaddr.js/LICENSE new file mode 100644 index 0000000..3493f0d --- /dev/null +++ b/node_modules/ipaddr.js/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2011 Peter Zotov + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/ipaddr.js/README.md b/node_modules/ipaddr.js/README.md new file mode 100644 index 0000000..1d2b42d --- /dev/null +++ b/node_modules/ipaddr.js/README.md @@ -0,0 +1,211 @@ +# ipaddr.js — an IPv6 and IPv4 address manipulation library [![Build Status](https://travis-ci.org/whitequark/ipaddr.js.svg)](https://travis-ci.org/whitequark/ipaddr.js) + +ipaddr.js is a small (1.9K minified and gzipped) library for manipulating +IP addresses in JavaScript environments. It runs on both CommonJS runtimes +(e.g. [nodejs]) and in a web browser. + +ipaddr.js allows you to verify and parse string representation of an IP +address, match it against a CIDR range or range list, determine if it falls +into some reserved ranges (examples include loopback and private ranges), +and convert between IPv4 and IPv4-mapped IPv6 addresses. + +[nodejs]: http://nodejs.org + +## Installation + +`npm install ipaddr.js` + +or + +`bower install ipaddr.js` + +## API + +ipaddr.js defines one object in the global scope: `ipaddr`. In CommonJS, +it is exported from the module: + +```js +var ipaddr = require('ipaddr.js'); +``` + +The API consists of several global methods and two classes: ipaddr.IPv6 and ipaddr.IPv4. + +### Global methods + +There are three global methods defined: `ipaddr.isValid`, `ipaddr.parse` and +`ipaddr.process`. All of them receive a string as a single parameter. + +The `ipaddr.isValid` method returns `true` if the address is a valid IPv4 or +IPv6 address, and `false` otherwise. It does not throw any exceptions. + +The `ipaddr.parse` method returns an object representing the IP address, +or throws an `Error` if the passed string is not a valid representation of an +IP address. + +The `ipaddr.process` method works just like the `ipaddr.parse` one, but it +automatically converts IPv4-mapped IPv6 addresses to their IPv4 couterparts +before returning. It is useful when you have a Node.js instance listening +on an IPv6 socket, and the `net.ivp6.bindv6only` sysctl parameter (or its +equivalent on non-Linux OS) is set to 0. In this case, you can accept IPv4 +connections on your IPv6-only socket, but the remote address will be mangled. +Use `ipaddr.process` method to automatically demangle it. + +### Object representation + +Parsing methods return an object which descends from `ipaddr.IPv6` or +`ipaddr.IPv4`. These objects share some properties, but most of them differ. + +#### Shared properties + +One can determine the type of address by calling `addr.kind()`. It will return +either `"ipv6"` or `"ipv4"`. + +An address can be converted back to its string representation with `addr.toString()`. +Note that this method: + * does not return the original string used to create the object (in fact, there is + no way of getting that string) + * returns a compact representation (when it is applicable) + +A `match(range, bits)` method can be used to check if the address falls into a +certain CIDR range. +Note that an address can be (obviously) matched only against an address of the same type. + +For example: + +```js +var addr = ipaddr.parse("2001:db8:1234::1"); +var range = ipaddr.parse("2001:db8::"); + +addr.match(range, 32); // => true +``` + +Alternatively, `match` can also be called as `match([range, bits])`. In this way, +it can be used together with the `parseCIDR(string)` method, which parses an IP +address together with a CIDR range. + +For example: + +```js +var addr = ipaddr.parse("2001:db8:1234::1"); + +addr.match(ipaddr.parseCIDR("2001:db8::/32")); // => true +``` + +A `range()` method returns one of predefined names for several special ranges defined +by IP protocols. The exact names (and their respective CIDR ranges) can be looked up +in the source: [IPv6 ranges] and [IPv4 ranges]. Some common ones include `"unicast"` +(the default one) and `"reserved"`. + +You can match against your own range list by using +`ipaddr.subnetMatch(address, rangeList, defaultName)` method. It can work with both +IPv6 and IPv4 addresses, and accepts a name-to-subnet map as the range list. For example: + +```js +var rangeList = { + documentationOnly: [ ipaddr.parse('2001:db8::'), 32 ], + tunnelProviders: [ + [ ipaddr.parse('2001:470::'), 32 ], // he.net + [ ipaddr.parse('2001:5c0::'), 32 ] // freenet6 + ] +}; +ipaddr.subnetMatch(ipaddr.parse('2001:470:8:66::1'), rangeList, 'unknown'); // => "he.net" +``` + +The addresses can be converted to their byte representation with `toByteArray()`. +(Actually, JavaScript mostly does not know about byte buffers. They are emulated with +arrays of numbers, each in range of 0..255.) + +```js +var bytes = ipaddr.parse('2a00:1450:8007::68').toByteArray(); // ipv6.google.com +bytes // => [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, , 0x00, 0x68 ] +``` + +The `ipaddr.IPv4` and `ipaddr.IPv6` objects have some methods defined, too. All of them +have the same interface for both protocols, and are similar to global methods. + +`ipaddr.IPvX.isValid(string)` can be used to check if the string is a valid address +for particular protocol, and `ipaddr.IPvX.parse(string)` is the error-throwing parser. + +`ipaddr.IPvX.isValid(string)` uses the same format for parsing as the POSIX `inet_ntoa` function, which accepts unusual formats like `0xc0.168.1.1` or `0x10000000`. The function `ipaddr.IPv4.isValidFourPartDecimal(string)` validates the IPv4 address and also ensures that it is written in four-part decimal format. + +[IPv6 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L186 +[IPv4 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L71 + +#### IPv6 properties + +Sometimes you will want to convert IPv6 not to a compact string representation (with +the `::` substitution); the `toNormalizedString()` method will return an address where +all zeroes are explicit. + +For example: + +```js +var addr = ipaddr.parse("2001:0db8::0001"); +addr.toString(); // => "2001:db8::1" +addr.toNormalizedString(); // => "2001:db8:0:0:0:0:0:1" +``` + +The `isIPv4MappedAddress()` method will return `true` if this address is an IPv4-mapped +one, and `toIPv4Address()` will return an IPv4 object address. + +To access the underlying binary representation of the address, use `addr.parts`. + +```js +var addr = ipaddr.parse("2001:db8:10::1234:DEAD"); +addr.parts // => [0x2001, 0xdb8, 0x10, 0, 0, 0, 0x1234, 0xdead] +``` + +#### IPv4 properties + +`toIPv4MappedAddress()` will return a corresponding IPv4-mapped IPv6 address. + +To access the underlying representation of the address, use `addr.octets`. + +```js +var addr = ipaddr.parse("192.168.1.1"); +addr.octets // => [192, 168, 1, 1] +``` + +`prefixLengthFromSubnetMask()` will return a CIDR prefix length for a valid IPv4 netmask or +false if the netmask is not valid. + +```js +ipaddr.IPv4.parse('255.255.255.240').prefixLengthFromSubnetMask() == 28 +ipaddr.IPv4.parse('255.192.164.0').prefixLengthFromSubnetMask() == null +``` + +#### Conversion + +IPv4 and IPv6 can be converted bidirectionally to and from network byte order (MSB) byte arrays. + +The `fromByteArray()` method will take an array and create an appropriate IPv4 or IPv6 object +if the input satisfies the requirements. For IPv4 it has to be an array of four 8-bit values, +while for IPv6 it has to be an array of sixteen 8-bit values. + +For example: +```js +var addr = ipaddr.fromByteArray([0x7f, 0, 0, 1]); +addr.toString(); // => "127.0.0.1" +``` + +or + +```js +var addr = ipaddr.fromByteArray([0x20, 1, 0xd, 0xb8, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) +addr.toString(); // => "2001:db8::1" +``` + +Both objects also offer a `toByteArray()` method, which returns an array in network byte order (MSB). + +For example: +```js +var addr = ipaddr.parse("127.0.0.1"); +addr.toByteArray(); // => [0x7f, 0, 0, 1] +``` + +or + +```js +var addr = ipaddr.parse("2001:db8::1"); +addr.toByteArray(); // => [0x20, 1, 0xd, 0xb8, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1] +``` diff --git a/node_modules/ipaddr.js/bower.json b/node_modules/ipaddr.js/bower.json new file mode 100644 index 0000000..e7c681f --- /dev/null +++ b/node_modules/ipaddr.js/bower.json @@ -0,0 +1,29 @@ +{ + "name": "ipaddr.js", + "version": "1.2.0", + "homepage": "https://github.com/whitequark/ipaddr.js", + "authors": [ + "whitequark " + ], + "description": "IP address manipulation library in JavaScript (CoffeeScript, actually)", + "main": "lib/ipaddr.js", + "moduleType": [ + "globals", + "node" + ], + "keywords": [ + "javscript", + "ip", + "address", + "ipv4", + "ipv6" + ], + "license": "MIT", + "ignore": [ + "**/.*", + "node_modules", + "bower_components", + "test", + "tests" + ] +} diff --git a/node_modules/ipaddr.js/ipaddr.min.js b/node_modules/ipaddr.js/ipaddr.min.js new file mode 100644 index 0000000..803ff95 --- /dev/null +++ b/node_modules/ipaddr.js/ipaddr.min.js @@ -0,0 +1 @@ +(function(){var r,t,n,e,i,o,a,s;t={},s=this,"undefined"!=typeof module&&null!==module&&module.exports?module.exports=t:s.ipaddr=t,a=function(r,t,n,e){var i,o;if(r.length!==t.length)throw new Error("ipaddr: cannot match CIDR for objects with different lengths");for(i=0;e>0;){if(o=n-e,o<0&&(o=0),r[i]>>o!==t[i]>>o)return!1;e-=n,i+=1}return!0},t.subnetMatch=function(r,t,n){var e,i,o,a,s;null==n&&(n="unicast");for(e in t)for(i=t[e],!i[0]||i[0]instanceof Array||(i=[i]),a=0,s=i.length;a=0;t=a+=-1){if(n=this.octets[t],!(n in o))return null;if(i=o[n],e&&0!==i)return null;8!==i&&(e=!0),r+=i}return 32-r},r}(),n="(0?\\d+|0x[a-f0-9]+)",e={fourOctet:new RegExp("^"+n+"\\."+n+"\\."+n+"\\."+n+"$","i"),longValue:new RegExp("^"+n+"$","i")},t.IPv4.parser=function(r){var t,n,i,o,a;if(n=function(r){return"0"===r[0]&&"x"!==r[1]?parseInt(r,8):parseInt(r)},t=r.match(e.fourOctet))return function(){var r,e,o,a;for(o=t.slice(1,6),a=[],r=0,e=o.length;r4294967295||a<0)throw new Error("ipaddr: address outside defined range");return function(){var r,t;for(t=[],o=r=0;r<=24;o=r+=8)t.push(a>>o&255);return t}().reverse()}return null},t.IPv6=function(){function r(r){var t,n,e,i,o,a;if(16===r.length)for(this.parts=[],t=e=0;e<=14;t=e+=2)this.parts.push(r[t]<<8|r[t+1]);else{if(8!==r.length)throw new Error("ipaddr: ipv6 part count should be 8 or 16");this.parts=r}for(a=this.parts,i=0,o=a.length;i>8),r.push(255&t);return r},r.prototype.toNormalizedString=function(){var r;return function(){var t,n,e,i;for(e=this.parts,i=[],t=0,n=e.length;t>8,255&r,n>>8,255&n])},r}(),i="(?:[0-9a-f]+::?)+",o={native:new RegExp("^(::)?("+i+")?([0-9a-f]+)?(::)?$","i"),transitional:new RegExp("^((?:"+i+")|(?:::)(?:"+i+")?)"+(""+n+"\\."+n+"\\."+n+"\\."+n+"$"),"i")},r=function(r,t){var n,e,i,o,a;if(r.indexOf("::")!==r.lastIndexOf("::"))return null;for(n=0,e=-1;(e=r.indexOf(":",e+1))>=0;)n++;if("::"===r.substr(0,2)&&n--,"::"===r.substr(-2,2)&&n--,n>t)return null;for(a=t-n,o=":";a--;)o+="0:";return r=r.replace("::",o),":"===r[0]&&(r=r.slice(1)),":"===r[r.length-1]&&(r=r.slice(0,-1)),function(){var t,n,e,o;for(e=r.split(":"),o=[],t=0,n=e.length;t=0&&t<=32))return[this.parse(n[1]),t];throw new Error("ipaddr: string is not formatted like an IPv4 CIDR range")},t.IPv6.parseCIDR=function(r){var t,n;if((n=r.match(/^(.+)\/(\d+)$/))&&(t=parseInt(n[2]),t>=0&&t<=128))return[this.parse(n[1]),t];throw new Error("ipaddr: string is not formatted like an IPv6 CIDR range")},t.isValid=function(r){return t.IPv6.isValid(r)||t.IPv4.isValid(r)},t.parse=function(r){if(t.IPv6.isValid(r))return t.IPv6.parse(r);if(t.IPv4.isValid(r))return t.IPv4.parse(r);throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format")},t.parseCIDR=function(r){var n;try{return t.IPv6.parseCIDR(r)}catch(e){n=e;try{return t.IPv4.parseCIDR(r)}catch(r){throw n=r,new Error("ipaddr: the address has neither IPv6 nor IPv4 CIDR format")}}},t.fromByteArray=function(r){var n;if(n=r.length,4===n)return new t.IPv4(r);if(16===n)return new t.IPv6(r);throw new Error("ipaddr: the binary input is neither an IPv6 nor IPv4 address")},t.process=function(r){var t;return t=this.parse(r),"ipv6"===t.kind()&&t.isIPv4MappedAddress()?t.toIPv4Address():t}}).call(this); \ No newline at end of file diff --git a/node_modules/ipaddr.js/lib/ipaddr.js b/node_modules/ipaddr.js/lib/ipaddr.js new file mode 100644 index 0000000..0b3e7b3 --- /dev/null +++ b/node_modules/ipaddr.js/lib/ipaddr.js @@ -0,0 +1,534 @@ +(function() { + var expandIPv6, ipaddr, ipv4Part, ipv4Regexes, ipv6Part, ipv6Regexes, matchCIDR, root; + + ipaddr = {}; + + root = this; + + if ((typeof module !== "undefined" && module !== null) && module.exports) { + module.exports = ipaddr; + } else { + root['ipaddr'] = ipaddr; + } + + matchCIDR = function(first, second, partSize, cidrBits) { + var part, shift; + if (first.length !== second.length) { + throw new Error("ipaddr: cannot match CIDR for objects with different lengths"); + } + part = 0; + while (cidrBits > 0) { + shift = partSize - cidrBits; + if (shift < 0) { + shift = 0; + } + if (first[part] >> shift !== second[part] >> shift) { + return false; + } + cidrBits -= partSize; + part += 1; + } + return true; + }; + + ipaddr.subnetMatch = function(address, rangeList, defaultName) { + var rangeName, rangeSubnets, subnet, _i, _len; + if (defaultName == null) { + defaultName = 'unicast'; + } + for (rangeName in rangeList) { + rangeSubnets = rangeList[rangeName]; + if (rangeSubnets[0] && !(rangeSubnets[0] instanceof Array)) { + rangeSubnets = [rangeSubnets]; + } + for (_i = 0, _len = rangeSubnets.length; _i < _len; _i++) { + subnet = rangeSubnets[_i]; + if (address.match.apply(address, subnet)) { + return rangeName; + } + } + } + return defaultName; + }; + + ipaddr.IPv4 = (function() { + function IPv4(octets) { + var octet, _i, _len; + if (octets.length !== 4) { + throw new Error("ipaddr: ipv4 octet count should be 4"); + } + for (_i = 0, _len = octets.length; _i < _len; _i++) { + octet = octets[_i]; + if (!((0 <= octet && octet <= 255))) { + throw new Error("ipaddr: ipv4 octet should fit in 8 bits"); + } + } + this.octets = octets; + } + + IPv4.prototype.kind = function() { + return 'ipv4'; + }; + + IPv4.prototype.toString = function() { + return this.octets.join("."); + }; + + IPv4.prototype.toByteArray = function() { + return this.octets.slice(0); + }; + + IPv4.prototype.match = function(other, cidrRange) { + var _ref; + if (cidrRange === void 0) { + _ref = other, other = _ref[0], cidrRange = _ref[1]; + } + if (other.kind() !== 'ipv4') { + throw new Error("ipaddr: cannot match ipv4 address with non-ipv4 one"); + } + return matchCIDR(this.octets, other.octets, 8, cidrRange); + }; + + IPv4.prototype.SpecialRanges = { + unspecified: [[new IPv4([0, 0, 0, 0]), 8]], + broadcast: [[new IPv4([255, 255, 255, 255]), 32]], + multicast: [[new IPv4([224, 0, 0, 0]), 4]], + linkLocal: [[new IPv4([169, 254, 0, 0]), 16]], + loopback: [[new IPv4([127, 0, 0, 0]), 8]], + "private": [[new IPv4([10, 0, 0, 0]), 8], [new IPv4([172, 16, 0, 0]), 12], [new IPv4([192, 168, 0, 0]), 16]], + reserved: [[new IPv4([192, 0, 0, 0]), 24], [new IPv4([192, 0, 2, 0]), 24], [new IPv4([192, 88, 99, 0]), 24], [new IPv4([198, 51, 100, 0]), 24], [new IPv4([203, 0, 113, 0]), 24], [new IPv4([240, 0, 0, 0]), 4]] + }; + + IPv4.prototype.range = function() { + return ipaddr.subnetMatch(this, this.SpecialRanges); + }; + + IPv4.prototype.toIPv4MappedAddress = function() { + return ipaddr.IPv6.parse("::ffff:" + (this.toString())); + }; + + IPv4.prototype.prefixLengthFromSubnetMask = function() { + var cidr, i, octet, stop, zeros, zerotable, _i; + zerotable = { + 0: 8, + 128: 7, + 192: 6, + 224: 5, + 240: 4, + 248: 3, + 252: 2, + 254: 1, + 255: 0 + }; + cidr = 0; + stop = false; + for (i = _i = 3; _i >= 0; i = _i += -1) { + octet = this.octets[i]; + if (octet in zerotable) { + zeros = zerotable[octet]; + if (stop && zeros !== 0) { + return null; + } + if (zeros !== 8) { + stop = true; + } + cidr += zeros; + } else { + return null; + } + } + return 32 - cidr; + }; + + return IPv4; + + })(); + + ipv4Part = "(0?\\d+|0x[a-f0-9]+)"; + + ipv4Regexes = { + fourOctet: new RegExp("^" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$", 'i'), + longValue: new RegExp("^" + ipv4Part + "$", 'i') + }; + + ipaddr.IPv4.parser = function(string) { + var match, parseIntAuto, part, shift, value; + parseIntAuto = function(string) { + if (string[0] === "0" && string[1] !== "x") { + return parseInt(string, 8); + } else { + return parseInt(string); + } + }; + if (match = string.match(ipv4Regexes.fourOctet)) { + return (function() { + var _i, _len, _ref, _results; + _ref = match.slice(1, 6); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(parseIntAuto(part)); + } + return _results; + })(); + } else if (match = string.match(ipv4Regexes.longValue)) { + value = parseIntAuto(match[1]); + if (value > 0xffffffff || value < 0) { + throw new Error("ipaddr: address outside defined range"); + } + return ((function() { + var _i, _results; + _results = []; + for (shift = _i = 0; _i <= 24; shift = _i += 8) { + _results.push((value >> shift) & 0xff); + } + return _results; + })()).reverse(); + } else { + return null; + } + }; + + ipaddr.IPv6 = (function() { + function IPv6(parts) { + var i, part, _i, _j, _len, _ref; + if (parts.length === 16) { + this.parts = []; + for (i = _i = 0; _i <= 14; i = _i += 2) { + this.parts.push((parts[i] << 8) | parts[i + 1]); + } + } else if (parts.length === 8) { + this.parts = parts; + } else { + throw new Error("ipaddr: ipv6 part count should be 8 or 16"); + } + _ref = this.parts; + for (_j = 0, _len = _ref.length; _j < _len; _j++) { + part = _ref[_j]; + if (!((0 <= part && part <= 0xffff))) { + throw new Error("ipaddr: ipv6 part should fit in 16 bits"); + } + } + } + + IPv6.prototype.kind = function() { + return 'ipv6'; + }; + + IPv6.prototype.toString = function() { + var compactStringParts, part, pushPart, state, stringParts, _i, _len; + stringParts = (function() { + var _i, _len, _ref, _results; + _ref = this.parts; + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(part.toString(16)); + } + return _results; + }).call(this); + compactStringParts = []; + pushPart = function(part) { + return compactStringParts.push(part); + }; + state = 0; + for (_i = 0, _len = stringParts.length; _i < _len; _i++) { + part = stringParts[_i]; + switch (state) { + case 0: + if (part === '0') { + pushPart(''); + } else { + pushPart(part); + } + state = 1; + break; + case 1: + if (part === '0') { + state = 2; + } else { + pushPart(part); + } + break; + case 2: + if (part !== '0') { + pushPart(''); + pushPart(part); + state = 3; + } + break; + case 3: + pushPart(part); + } + } + if (state === 2) { + pushPart(''); + pushPart(''); + } + return compactStringParts.join(":"); + }; + + IPv6.prototype.toByteArray = function() { + var bytes, part, _i, _len, _ref; + bytes = []; + _ref = this.parts; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + bytes.push(part >> 8); + bytes.push(part & 0xff); + } + return bytes; + }; + + IPv6.prototype.toNormalizedString = function() { + var part; + return ((function() { + var _i, _len, _ref, _results; + _ref = this.parts; + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(part.toString(16)); + } + return _results; + }).call(this)).join(":"); + }; + + IPv6.prototype.match = function(other, cidrRange) { + var _ref; + if (cidrRange === void 0) { + _ref = other, other = _ref[0], cidrRange = _ref[1]; + } + if (other.kind() !== 'ipv6') { + throw new Error("ipaddr: cannot match ipv6 address with non-ipv6 one"); + } + return matchCIDR(this.parts, other.parts, 16, cidrRange); + }; + + IPv6.prototype.SpecialRanges = { + unspecified: [new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128], + linkLocal: [new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10], + multicast: [new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8], + loopback: [new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128], + uniqueLocal: [new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7], + ipv4Mapped: [new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96], + rfc6145: [new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96], + rfc6052: [new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96], + '6to4': [new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16], + teredo: [new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32], + reserved: [[new IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32]] + }; + + IPv6.prototype.range = function() { + return ipaddr.subnetMatch(this, this.SpecialRanges); + }; + + IPv6.prototype.isIPv4MappedAddress = function() { + return this.range() === 'ipv4Mapped'; + }; + + IPv6.prototype.toIPv4Address = function() { + var high, low, _ref; + if (!this.isIPv4MappedAddress()) { + throw new Error("ipaddr: trying to convert a generic ipv6 address to ipv4"); + } + _ref = this.parts.slice(-2), high = _ref[0], low = _ref[1]; + return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff]); + }; + + return IPv6; + + })(); + + ipv6Part = "(?:[0-9a-f]+::?)+"; + + ipv6Regexes = { + "native": new RegExp("^(::)?(" + ipv6Part + ")?([0-9a-f]+)?(::)?$", 'i'), + transitional: new RegExp(("^((?:" + ipv6Part + ")|(?:::)(?:" + ipv6Part + ")?)") + ("" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$"), 'i') + }; + + expandIPv6 = function(string, parts) { + var colonCount, lastColon, part, replacement, replacementCount; + if (string.indexOf('::') !== string.lastIndexOf('::')) { + return null; + } + colonCount = 0; + lastColon = -1; + while ((lastColon = string.indexOf(':', lastColon + 1)) >= 0) { + colonCount++; + } + if (string.substr(0, 2) === '::') { + colonCount--; + } + if (string.substr(-2, 2) === '::') { + colonCount--; + } + if (colonCount > parts) { + return null; + } + replacementCount = parts - colonCount; + replacement = ':'; + while (replacementCount--) { + replacement += '0:'; + } + string = string.replace('::', replacement); + if (string[0] === ':') { + string = string.slice(1); + } + if (string[string.length - 1] === ':') { + string = string.slice(0, -1); + } + return (function() { + var _i, _len, _ref, _results; + _ref = string.split(":"); + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + part = _ref[_i]; + _results.push(parseInt(part, 16)); + } + return _results; + })(); + }; + + ipaddr.IPv6.parser = function(string) { + var match, octet, octets, parts, _i, _len; + if (string.match(ipv6Regexes['native'])) { + return expandIPv6(string, 8); + } else if (match = string.match(ipv6Regexes['transitional'])) { + parts = expandIPv6(match[1].slice(0, -1), 6); + if (parts) { + octets = [parseInt(match[2]), parseInt(match[3]), parseInt(match[4]), parseInt(match[5])]; + for (_i = 0, _len = octets.length; _i < _len; _i++) { + octet = octets[_i]; + if (!((0 <= octet && octet <= 255))) { + return null; + } + } + parts.push(octets[0] << 8 | octets[1]); + parts.push(octets[2] << 8 | octets[3]); + return parts; + } + } + return null; + }; + + ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = function(string) { + return this.parser(string) !== null; + }; + + ipaddr.IPv4.isValid = function(string) { + var e; + try { + new this(this.parser(string)); + return true; + } catch (_error) { + e = _error; + return false; + } + }; + + ipaddr.IPv4.isValidFourPartDecimal = function(string) { + if (ipaddr.IPv4.isValid(string) && string.match(/^\d+(\.\d+){3}$/)) { + return true; + } else { + return false; + } + }; + + ipaddr.IPv6.isValid = function(string) { + var e; + if (typeof string === "string" && string.indexOf(":") === -1) { + return false; + } + try { + new this(this.parser(string)); + return true; + } catch (_error) { + e = _error; + return false; + } + }; + + ipaddr.IPv4.parse = ipaddr.IPv6.parse = function(string) { + var parts; + parts = this.parser(string); + if (parts === null) { + throw new Error("ipaddr: string is not formatted like ip address"); + } + return new this(parts); + }; + + ipaddr.IPv4.parseCIDR = function(string) { + var maskLength, match; + if (match = string.match(/^(.+)\/(\d+)$/)) { + maskLength = parseInt(match[2]); + if (maskLength >= 0 && maskLength <= 32) { + return [this.parse(match[1]), maskLength]; + } + } + throw new Error("ipaddr: string is not formatted like an IPv4 CIDR range"); + }; + + ipaddr.IPv6.parseCIDR = function(string) { + var maskLength, match; + if (match = string.match(/^(.+)\/(\d+)$/)) { + maskLength = parseInt(match[2]); + if (maskLength >= 0 && maskLength <= 128) { + return [this.parse(match[1]), maskLength]; + } + } + throw new Error("ipaddr: string is not formatted like an IPv6 CIDR range"); + }; + + ipaddr.isValid = function(string) { + return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string); + }; + + ipaddr.parse = function(string) { + if (ipaddr.IPv6.isValid(string)) { + return ipaddr.IPv6.parse(string); + } else if (ipaddr.IPv4.isValid(string)) { + return ipaddr.IPv4.parse(string); + } else { + throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format"); + } + }; + + ipaddr.parseCIDR = function(string) { + var e; + try { + return ipaddr.IPv6.parseCIDR(string); + } catch (_error) { + e = _error; + try { + return ipaddr.IPv4.parseCIDR(string); + } catch (_error) { + e = _error; + throw new Error("ipaddr: the address has neither IPv6 nor IPv4 CIDR format"); + } + } + }; + + ipaddr.fromByteArray = function(bytes) { + var length; + length = bytes.length; + if (length === 4) { + return new ipaddr.IPv4(bytes); + } else if (length === 16) { + return new ipaddr.IPv6(bytes); + } else { + throw new Error("ipaddr: the binary input is neither an IPv6 nor IPv4 address"); + } + }; + + ipaddr.process = function(string) { + var addr; + addr = this.parse(string); + if (addr.kind() === 'ipv6' && addr.isIPv4MappedAddress()) { + return addr.toIPv4Address(); + } else { + return addr; + } + }; + +}).call(this); diff --git a/node_modules/ipaddr.js/package.json b/node_modules/ipaddr.js/package.json new file mode 100644 index 0000000..68bd029 --- /dev/null +++ b/node_modules/ipaddr.js/package.json @@ -0,0 +1,97 @@ +{ + "_args": [ + [ + { + "raw": "ipaddr.js@1.2.0", + "scope": null, + "escapedName": "ipaddr.js", + "name": "ipaddr.js", + "rawSpec": "1.2.0", + "spec": "1.2.0", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/proxy-addr" + ] + ], + "_from": "ipaddr.js@1.2.0", + "_id": "ipaddr.js@1.2.0", + "_inCache": true, + "_location": "/ipaddr.js", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/ipaddr.js-1.2.0.tgz_1467971539814_0.6815996605437249" + }, + "_npmUser": { + "name": "whitequark", + "email": "whitequark@whitequark.org" + }, + "_npmVersion": "1.4.21", + "_phantomChildren": {}, + "_requested": { + "raw": "ipaddr.js@1.2.0", + "scope": null, + "escapedName": "ipaddr.js", + "name": "ipaddr.js", + "rawSpec": "1.2.0", + "spec": "1.2.0", + "type": "version" + }, + "_requiredBy": [ + "/proxy-addr" + ], + "_resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.2.0.tgz", + "_shasum": "8aba49c9192799585bdd643e0ccb50e8ae777ba4", + "_shrinkwrap": null, + "_spec": "ipaddr.js@1.2.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/proxy-addr", + "author": { + "name": "whitequark", + "email": "whitequark@whitequark.org" + }, + "bugs": { + "url": "https://github.com/whitequark/ipaddr.js/issues" + }, + "dependencies": {}, + "description": "A library for manipulating IPv4 and IPv6 addresses in JavaScript.", + "devDependencies": { + "coffee-script": "~1.6", + "nodeunit": ">=0.8.2 <0.8.7", + "uglify-js": "latest" + }, + "directories": { + "lib": "./lib" + }, + "dist": { + "shasum": "8aba49c9192799585bdd643e0ccb50e8ae777ba4", + "tarball": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.2.0.tgz" + }, + "engines": { + "node": ">= 0.10" + }, + "gitHead": "87bcb487f1a6739101231e71b111da2823540398", + "homepage": "https://github.com/whitequark/ipaddr.js#readme", + "keywords": [ + "ip", + "ipv4", + "ipv6" + ], + "license": "MIT", + "main": "./lib/ipaddr", + "maintainers": [ + { + "name": "whitequark", + "email": "whitequark@whitequark.org" + } + ], + "name": "ipaddr.js", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/whitequark/ipaddr.js.git" + }, + "scripts": { + "test": "cake build test" + }, + "version": "1.2.0" +} diff --git a/node_modules/ipaddr.js/src/ipaddr.coffee b/node_modules/ipaddr.js/src/ipaddr.coffee new file mode 100644 index 0000000..45ffc34 --- /dev/null +++ b/node_modules/ipaddr.js/src/ipaddr.coffee @@ -0,0 +1,456 @@ +# Define the main object +ipaddr = {} + +root = this + +# Export for both the CommonJS and browser-like environment +if module? && module.exports + module.exports = ipaddr +else + root['ipaddr'] = ipaddr + +# A generic CIDR (Classless Inter-Domain Routing) RFC1518 range matcher. +matchCIDR = (first, second, partSize, cidrBits) -> + if first.length != second.length + throw new Error "ipaddr: cannot match CIDR for objects with different lengths" + + part = 0 + while cidrBits > 0 + shift = partSize - cidrBits + shift = 0 if shift < 0 + + if first[part] >> shift != second[part] >> shift + return false + + cidrBits -= partSize + part += 1 + + return true + +# An utility function to ease named range matching. See examples below. +ipaddr.subnetMatch = (address, rangeList, defaultName='unicast') -> + for rangeName, rangeSubnets of rangeList + # ECMA5 Array.isArray isn't available everywhere + if rangeSubnets[0] && !(rangeSubnets[0] instanceof Array) + rangeSubnets = [ rangeSubnets ] + + for subnet in rangeSubnets + return rangeName if address.match.apply(address, subnet) + + return defaultName + +# An IPv4 address (RFC791). +class ipaddr.IPv4 + # Constructs a new IPv4 address from an array of four octets + # in network order (MSB first) + # Verifies the input. + constructor: (octets) -> + if octets.length != 4 + throw new Error "ipaddr: ipv4 octet count should be 4" + + for octet in octets + if !(0 <= octet <= 255) + throw new Error "ipaddr: ipv4 octet should fit in 8 bits" + + @octets = octets + + # The 'kind' method exists on both IPv4 and IPv6 classes. + kind: -> + return 'ipv4' + + # Returns the address in convenient, decimal-dotted format. + toString: -> + return @octets.join "." + + # Returns an array of byte-sized values in network order (MSB first) + toByteArray: -> + return @octets.slice(0) # octets.clone + + # Checks if this address matches other one within given CIDR range. + match: (other, cidrRange) -> + if cidrRange == undefined + [other, cidrRange] = other + + if other.kind() != 'ipv4' + throw new Error "ipaddr: cannot match ipv4 address with non-ipv4 one" + + return matchCIDR(this.octets, other.octets, 8, cidrRange) + + # Special IPv4 address ranges. + SpecialRanges: + unspecified: [ + [ new IPv4([0, 0, 0, 0]), 8 ] + ] + broadcast: [ + [ new IPv4([255, 255, 255, 255]), 32 ] + ] + multicast: [ # RFC3171 + [ new IPv4([224, 0, 0, 0]), 4 ] + ] + linkLocal: [ # RFC3927 + [ new IPv4([169, 254, 0, 0]), 16 ] + ] + loopback: [ # RFC5735 + [ new IPv4([127, 0, 0, 0]), 8 ] + ] + private: [ # RFC1918 + [ new IPv4([10, 0, 0, 0]), 8 ] + [ new IPv4([172, 16, 0, 0]), 12 ] + [ new IPv4([192, 168, 0, 0]), 16 ] + ] + reserved: [ # Reserved and testing-only ranges; RFCs 5735, 5737, 2544, 1700 + [ new IPv4([192, 0, 0, 0]), 24 ] + [ new IPv4([192, 0, 2, 0]), 24 ] + [ new IPv4([192, 88, 99, 0]), 24 ] + [ new IPv4([198, 51, 100, 0]), 24 ] + [ new IPv4([203, 0, 113, 0]), 24 ] + [ new IPv4([240, 0, 0, 0]), 4 ] + ] + + # Checks if the address corresponds to one of the special ranges. + range: -> + return ipaddr.subnetMatch(this, @SpecialRanges) + + # Convrets this IPv4 address to an IPv4-mapped IPv6 address. + toIPv4MappedAddress: -> + return ipaddr.IPv6.parse "::ffff:#{@toString()}" + + # returns a number of leading ones in IPv4 address, making sure that + # the rest is a solid sequence of 0's (valid netmask) + # returns either the CIDR length or null if mask is not valid + prefixLengthFromSubnetMask: -> + # number of zeroes in octet + zerotable = + 0: 8 + 128: 7 + 192: 6 + 224: 5 + 240: 4 + 248: 3 + 252: 2 + 254: 1 + 255: 0 + + cidr = 0 + # non-zero encountered stop scanning for zeroes + stop = false + for i in [3..0] by -1 + octet = @octets[i] + if octet of zerotable + zeros = zerotable[octet] + if stop and zeros != 0 + return null + unless zeros == 8 + stop = true + cidr += zeros + else + return null + return 32 - cidr + +# A list of regular expressions that match arbitrary IPv4 addresses, +# for which a number of weird notations exist. +# Note that an address like 0010.0xa5.1.1 is considered legal. +ipv4Part = "(0?\\d+|0x[a-f0-9]+)" +ipv4Regexes = + fourOctet: new RegExp "^#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}$", 'i' + longValue: new RegExp "^#{ipv4Part}$", 'i' + +# Classful variants (like a.b, where a is an octet, and b is a 24-bit +# value representing last three octets; this corresponds to a class C +# address) are omitted due to classless nature of modern Internet. +ipaddr.IPv4.parser = (string) -> + parseIntAuto = (string) -> + if string[0] == "0" && string[1] != "x" + parseInt(string, 8) + else + parseInt(string) + + # parseInt recognizes all that octal & hexadecimal weirdness for us + if match = string.match(ipv4Regexes.fourOctet) + return (parseIntAuto(part) for part in match[1..5]) + else if match = string.match(ipv4Regexes.longValue) + value = parseIntAuto(match[1]) + if value > 0xffffffff || value < 0 + throw new Error "ipaddr: address outside defined range" + return ((value >> shift) & 0xff for shift in [0..24] by 8).reverse() + else + return null + +# An IPv6 address (RFC2460) +class ipaddr.IPv6 + # Constructs an IPv6 address from an array of eight 16-bit parts + # or sixteen 8-bit parts in network order (MSB first). + # Throws an error if the input is invalid. + constructor: (parts) -> + if parts.length == 16 + @parts = [] + for i in [0..14] by 2 + @parts.push((parts[i] << 8) | parts[i + 1]) + else if parts.length == 8 + @parts = parts + else + throw new Error "ipaddr: ipv6 part count should be 8 or 16" + + for part in @parts + if !(0 <= part <= 0xffff) + throw new Error "ipaddr: ipv6 part should fit in 16 bits" + + # The 'kind' method exists on both IPv4 and IPv6 classes. + kind: -> + return 'ipv6' + + # Returns the address in compact, human-readable format like + # 2001:db8:8:66::1 + toString: -> + stringParts = (part.toString(16) for part in @parts) + + compactStringParts = [] + pushPart = (part) -> compactStringParts.push part + + state = 0 + for part in stringParts + switch state + when 0 + if part == '0' + pushPart('') + else + pushPart(part) + + state = 1 + when 1 + if part == '0' + state = 2 + else + pushPart(part) + when 2 + unless part == '0' + pushPart('') + pushPart(part) + state = 3 + when 3 + pushPart(part) + + if state == 2 + pushPart('') + pushPart('') + + return compactStringParts.join ":" + + # Returns an array of byte-sized values in network order (MSB first) + toByteArray: -> + bytes = [] + for part in @parts + bytes.push(part >> 8) + bytes.push(part & 0xff) + + return bytes + + # Returns the address in expanded format with all zeroes included, like + # 2001:db8:8:66:0:0:0:1 + toNormalizedString: -> + return (part.toString(16) for part in @parts).join ":" + + # Checks if this address matches other one within given CIDR range. + match: (other, cidrRange) -> + if cidrRange == undefined + [other, cidrRange] = other + + if other.kind() != 'ipv6' + throw new Error "ipaddr: cannot match ipv6 address with non-ipv6 one" + + return matchCIDR(this.parts, other.parts, 16, cidrRange) + + # Special IPv6 ranges + SpecialRanges: + unspecified: [ new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128 ] # RFC4291, here and after + linkLocal: [ new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10 ] + multicast: [ new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8 ] + loopback: [ new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128 ] + uniqueLocal: [ new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7 ] + ipv4Mapped: [ new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96 ] + rfc6145: [ new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96 ] # RFC6145 + rfc6052: [ new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96 ] # RFC6052 + '6to4': [ new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16 ] # RFC3056 + teredo: [ new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32 ] # RFC6052, RFC6146 + reserved: [ + [ new IPv6([ 0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32 ] # RFC4291 + ] + + # Checks if the address corresponds to one of the special ranges. + range: -> + return ipaddr.subnetMatch(this, @SpecialRanges) + + # Checks if this address is an IPv4-mapped IPv6 address. + isIPv4MappedAddress: -> + return @range() == 'ipv4Mapped' + + # Converts this address to IPv4 address if it is an IPv4-mapped IPv6 address. + # Throws an error otherwise. + toIPv4Address: -> + unless @isIPv4MappedAddress() + throw new Error "ipaddr: trying to convert a generic ipv6 address to ipv4" + + [high, low] = @parts[-2..-1] + + return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff]) + +# IPv6-matching regular expressions. +# For IPv6, the task is simpler: it is enough to match the colon-delimited +# hexadecimal IPv6 and a transitional variant with dotted-decimal IPv4 at +# the end. +ipv6Part = "(?:[0-9a-f]+::?)+" +ipv6Regexes = + native: new RegExp "^(::)?(#{ipv6Part})?([0-9a-f]+)?(::)?$", 'i' + transitional: new RegExp "^((?:#{ipv6Part})|(?:::)(?:#{ipv6Part})?)" + + "#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}$", 'i' + +# Expand :: in an IPv6 address or address part consisting of `parts` groups. +expandIPv6 = (string, parts) -> + # More than one '::' means invalid adddress + if string.indexOf('::') != string.lastIndexOf('::') + return null + + # How many parts do we already have? + colonCount = 0 + lastColon = -1 + while (lastColon = string.indexOf(':', lastColon + 1)) >= 0 + colonCount++ + + # 0::0 is two parts more than :: + colonCount-- if string.substr(0, 2) == '::' + colonCount-- if string.substr(-2, 2) == '::' + + # The following loop would hang if colonCount > parts + if colonCount > parts + return null + + # replacement = ':' + '0:' * (parts - colonCount) + replacementCount = parts - colonCount + replacement = ':' + while replacementCount-- + replacement += '0:' + + # Insert the missing zeroes + string = string.replace('::', replacement) + + # Trim any garbage which may be hanging around if :: was at the edge in + # the source string + string = string[1..-1] if string[0] == ':' + string = string[0..-2] if string[string.length-1] == ':' + + return (parseInt(part, 16) for part in string.split(":")) + +# Parse an IPv6 address. +ipaddr.IPv6.parser = (string) -> + if string.match(ipv6Regexes['native']) + return expandIPv6(string, 8) + + else if match = string.match(ipv6Regexes['transitional']) + parts = expandIPv6(match[1][0..-2], 6) + if parts + octets = [parseInt(match[2]), parseInt(match[3]), + parseInt(match[4]), parseInt(match[5])] + for octet in octets + if !(0 <= octet <= 255) + return null + + parts.push(octets[0] << 8 | octets[1]) + parts.push(octets[2] << 8 | octets[3]) + return parts + + return null + +# Checks if a given string is formatted like IPv4/IPv6 address. +ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = (string) -> + return @parser(string) != null + +# Checks if a given string is a valid IPv4/IPv6 address. +ipaddr.IPv4.isValid = (string) -> + try + new this(@parser(string)) + return true + catch e + return false + +ipaddr.IPv4.isValidFourPartDecimal = (string) -> + if ipaddr.IPv4.isValid(string) and string.match(/^\d+(\.\d+){3}$/) + return true + else + return false + +ipaddr.IPv6.isValid = (string) -> + # Since IPv6.isValid is always called first, this shortcut + # provides a substantial performance gain. + if typeof string == "string" and string.indexOf(":") == -1 + return false + + try + new this(@parser(string)) + return true + catch e + return false + +# Tries to parse and validate a string with IPv4/IPv6 address. +# Throws an error if it fails. +ipaddr.IPv4.parse = ipaddr.IPv6.parse = (string) -> + parts = @parser(string) + if parts == null + throw new Error "ipaddr: string is not formatted like ip address" + + return new this(parts) + +ipaddr.IPv4.parseCIDR = (string) -> + if match = string.match(/^(.+)\/(\d+)$/) + maskLength = parseInt(match[2]) + if maskLength >= 0 and maskLength <= 32 + return [@parse(match[1]), maskLength] + + throw new Error "ipaddr: string is not formatted like an IPv4 CIDR range" + +ipaddr.IPv6.parseCIDR = (string) -> + if match = string.match(/^(.+)\/(\d+)$/) + maskLength = parseInt(match[2]) + if maskLength >= 0 and maskLength <= 128 + return [@parse(match[1]), maskLength] + + throw new Error "ipaddr: string is not formatted like an IPv6 CIDR range" + +# Checks if the address is valid IP address +ipaddr.isValid = (string) -> + return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string) + +# Try to parse an address and throw an error if it is impossible +ipaddr.parse = (string) -> + if ipaddr.IPv6.isValid(string) + return ipaddr.IPv6.parse(string) + else if ipaddr.IPv4.isValid(string) + return ipaddr.IPv4.parse(string) + else + throw new Error "ipaddr: the address has neither IPv6 nor IPv4 format" + +ipaddr.parseCIDR = (string) -> + try + return ipaddr.IPv6.parseCIDR(string) + catch e + try + return ipaddr.IPv4.parseCIDR(string) + catch e + throw new Error "ipaddr: the address has neither IPv6 nor IPv4 CIDR format" + +# Try to parse an array in network order (MSB first) for IPv4 and IPv6 +ipaddr.fromByteArray = (bytes) -> + length = bytes.length + if length == 4 + return new ipaddr.IPv4(bytes) + else if length == 16 + return new ipaddr.IPv6(bytes) + else + throw new Error "ipaddr: the binary input is neither an IPv6 nor IPv4 address" + +# Parse an address and return plain IPv4 address if it is an IPv4-mapped address +ipaddr.process = (string) -> + addr = @parse(string) + if addr.kind() == 'ipv6' && addr.isIPv4MappedAddress() + return addr.toIPv4Address() + else + return addr diff --git a/node_modules/ipaddr.js/test/ipaddr.test.coffee b/node_modules/ipaddr.js/test/ipaddr.test.coffee new file mode 100644 index 0000000..b8ef0b9 --- /dev/null +++ b/node_modules/ipaddr.js/test/ipaddr.test.coffee @@ -0,0 +1,344 @@ +ipaddr = require '../lib/ipaddr' + +module.exports = + 'should define main classes': (test) -> + test.ok(ipaddr.IPv4?, 'defines IPv4 class') + test.ok(ipaddr.IPv6?, 'defines IPv6 class') + test.done() + + 'can construct IPv4 from octets': (test) -> + test.doesNotThrow -> + new ipaddr.IPv4([192, 168, 1, 2]) + test.done() + + 'refuses to construct invalid IPv4': (test) -> + test.throws -> + new ipaddr.IPv4([300, 1, 2, 3]) + test.throws -> + new ipaddr.IPv4([8, 8, 8]) + test.done() + + 'converts IPv4 to string correctly': (test) -> + addr = new ipaddr.IPv4([192, 168, 1, 1]) + test.equal(addr.toString(), '192.168.1.1') + test.done() + + 'returns correct kind for IPv4': (test) -> + addr = new ipaddr.IPv4([1, 2, 3, 4]) + test.equal(addr.kind(), 'ipv4') + test.done() + + 'allows to access IPv4 octets': (test) -> + addr = new ipaddr.IPv4([42, 0, 0, 0]) + test.equal(addr.octets[0], 42) + test.done() + + 'checks IPv4 address format': (test) -> + test.equal(ipaddr.IPv4.isIPv4('192.168.007.0xa'), true) + test.equal(ipaddr.IPv4.isIPv4('1024.0.0.1'), true) + test.equal(ipaddr.IPv4.isIPv4('8.0xa.wtf.6'), false) + test.done() + + 'validates IPv4 addresses': (test) -> + test.equal(ipaddr.IPv4.isValid('192.168.007.0xa'), true) + test.equal(ipaddr.IPv4.isValid('1024.0.0.1'), false) + test.equal(ipaddr.IPv4.isValid('8.0xa.wtf.6'), false) + test.done() + + 'parses IPv4 in several weird formats': (test) -> + test.deepEqual(ipaddr.IPv4.parse('192.168.1.1').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('0xc0.168.1.1').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('192.0250.1.1').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('0xc0a80101').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('030052000401').octets, [192, 168, 1, 1]) + test.deepEqual(ipaddr.IPv4.parse('3232235777').octets, [192, 168, 1, 1]) + test.done() + + 'barfs at invalid IPv4': (test) -> + test.throws -> + ipaddr.IPv4.parse('10.0.0.wtf') + test.done() + + 'matches IPv4 CIDR correctly': (test) -> + addr = new ipaddr.IPv4([10, 5, 0, 1]) + test.equal(addr.match(ipaddr.IPv4.parse('0.0.0.0'), 0), true) + test.equal(addr.match(ipaddr.IPv4.parse('11.0.0.0'), 8), false) + test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.0'), 8), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.1'), 8), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.10'), 8), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.5.5.0'), 16), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.4.5.0'), 16), false) + test.equal(addr.match(ipaddr.IPv4.parse('10.4.5.0'), 15), true) + test.equal(addr.match(ipaddr.IPv4.parse('10.5.0.2'), 32), false) + test.equal(addr.match(addr, 32), true) + test.done() + + 'parses IPv4 CIDR correctly': (test) -> + addr = new ipaddr.IPv4([10, 5, 0, 1]) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('0.0.0.0/0')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('11.0.0.0/8')), false) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.0.0.0/8')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.0.0.1/8')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.0.0.10/8')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.5.5.0/16')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.4.5.0/16')), false) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.4.5.0/15')), true) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.5.0.2/32')), false) + test.equal(addr.match(ipaddr.IPv4.parseCIDR('10.5.0.1/32')), true) + test.throws -> + ipaddr.IPv4.parseCIDR('10.5.0.1') + test.throws -> + ipaddr.IPv4.parseCIDR('0.0.0.0/-1') + test.throws -> + ipaddr.IPv4.parseCIDR('0.0.0.0/33') + test.done() + + 'detects reserved IPv4 networks': (test) -> + test.equal(ipaddr.IPv4.parse('0.0.0.0').range(), 'unspecified') + test.equal(ipaddr.IPv4.parse('0.1.0.0').range(), 'unspecified') + test.equal(ipaddr.IPv4.parse('10.1.0.1').range(), 'private') + test.equal(ipaddr.IPv4.parse('192.168.2.1').range(), 'private') + test.equal(ipaddr.IPv4.parse('224.100.0.1').range(), 'multicast') + test.equal(ipaddr.IPv4.parse('169.254.15.0').range(), 'linkLocal') + test.equal(ipaddr.IPv4.parse('127.1.1.1').range(), 'loopback') + test.equal(ipaddr.IPv4.parse('255.255.255.255').range(), 'broadcast') + test.equal(ipaddr.IPv4.parse('240.1.2.3').range(), 'reserved') + test.equal(ipaddr.IPv4.parse('8.8.8.8').range(), 'unicast') + test.done() + + 'checks the conventional IPv4 address format': (test) -> + test.equal(ipaddr.IPv4.isValidFourPartDecimal('192.168.1.1'), true) + test.equal(ipaddr.IPv4.isValidFourPartDecimal('0xc0.168.1.1'), false) + test.done() + + 'can construct IPv6 from 16bit parts': (test) -> + test.doesNotThrow -> + new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.done() + + 'can construct IPv6 from 8bit parts': (test) -> + test.doesNotThrow -> + new ipaddr.IPv6([0x20, 0x01, 0xd, 0xb8, 0xf5, 0x3a, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) + test.deepEqual(new ipaddr.IPv6([0x20, 0x01, 0xd, 0xb8, 0xf5, 0x3a, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]), + new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1])) + test.done() + + 'refuses to construct invalid IPv6': (test) -> + test.throws -> + new ipaddr.IPv6([0xfffff, 0, 0, 0, 0, 0, 0, 1]) + test.throws -> + new ipaddr.IPv6([0xfffff, 0, 0, 0, 0, 0, 1]) + test.throws -> + new ipaddr.IPv6([0xffff, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) + test.done() + + 'converts IPv6 to string correctly': (test) -> + addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.equal(addr.toNormalizedString(), '2001:db8:f53a:0:0:0:0:1') + test.equal(addr.toString(), '2001:db8:f53a::1') + test.equal(new ipaddr.IPv6([0, 0, 0, 0, 0, 0, 0, 1]).toString(), '::1') + test.equal(new ipaddr.IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]).toString(), '2001:db8::') + test.done() + + 'returns correct kind for IPv6': (test) -> + addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.equal(addr.kind(), 'ipv6') + test.done() + + 'allows to access IPv6 address parts': (test) -> + addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 42, 0, 1]) + test.equal(addr.parts[5], 42) + test.done() + + 'checks IPv6 address format': (test) -> + test.equal(ipaddr.IPv6.isIPv6('2001:db8:F53A::1'), true) + test.equal(ipaddr.IPv6.isIPv6('200001::1'), true) + test.equal(ipaddr.IPv6.isIPv6('::ffff:192.168.1.1'), true) + test.equal(ipaddr.IPv6.isIPv6('::ffff:300.168.1.1'), false) + test.equal(ipaddr.IPv6.isIPv6('::ffff:300.168.1.1:0'), false) + test.equal(ipaddr.IPv6.isIPv6('fe80::wtf'), false) + test.done() + + 'validates IPv6 addresses': (test) -> + test.equal(ipaddr.IPv6.isValid('2001:db8:F53A::1'), true) + test.equal(ipaddr.IPv6.isValid('200001::1'), false) + test.equal(ipaddr.IPv6.isValid('::ffff:192.168.1.1'), true) + test.equal(ipaddr.IPv6.isValid('::ffff:300.168.1.1'), false) + test.equal(ipaddr.IPv6.isValid('::ffff:300.168.1.1:0'), false) + test.equal(ipaddr.IPv6.isValid('::ffff:222.1.41.9000'), false) + test.equal(ipaddr.IPv6.isValid('2001:db8::F53A::1'), false) + test.equal(ipaddr.IPv6.isValid('fe80::wtf'), false) + test.equal(ipaddr.IPv6.isValid('2002::2:'), false) + test.equal(ipaddr.IPv6.isValid(undefined), false) + test.done() + + 'parses IPv6 in different formats': (test) -> + test.deepEqual(ipaddr.IPv6.parse('2001:db8:F53A:0:0:0:0:1').parts, [0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1]) + test.deepEqual(ipaddr.IPv6.parse('fe80::10').parts, [0xfe80, 0, 0, 0, 0, 0, 0, 0x10]) + test.deepEqual(ipaddr.IPv6.parse('2001:db8:F53A::').parts, [0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 0]) + test.deepEqual(ipaddr.IPv6.parse('::1').parts, [0, 0, 0, 0, 0, 0, 0, 1]) + test.deepEqual(ipaddr.IPv6.parse('::').parts, [0, 0, 0, 0, 0, 0, 0, 0]) + test.done() + + 'barfs at invalid IPv6': (test) -> + test.throws -> + ipaddr.IPv6.parse('fe80::0::1') + test.done() + + 'matches IPv6 CIDR correctly': (test) -> + addr = ipaddr.IPv6.parse('2001:db8:f53a::1') + test.equal(addr.match(ipaddr.IPv6.parse('::'), 0), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f53a::1:1'), 64), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f53b::1:1'), 48), false) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f531::1:1'), 44), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f500::1'), 40), true) + test.equal(addr.match(ipaddr.IPv6.parse('2001:db9:f500::1'), 40), false) + test.equal(addr.match(addr, 128), true) + test.done() + + 'parses IPv6 CIDR correctly': (test) -> + addr = ipaddr.IPv6.parse('2001:db8:f53a::1') + test.equal(addr.match(ipaddr.IPv6.parseCIDR('::/0')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f53a::1:1/64')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f53b::1:1/48')), false) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f531::1:1/44')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f500::1/40')), true) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db9:f500::1/40')), false) + test.equal(addr.match(ipaddr.IPv6.parseCIDR('2001:db8:f53a::1/128')), true) + test.throws -> + ipaddr.IPv6.parseCIDR('2001:db8:f53a::1') + test.throws -> + ipaddr.IPv6.parseCIDR('2001:db8:f53a::1/-1') + test.throws -> + ipaddr.IPv6.parseCIDR('2001:db8:f53a::1/129') + test.done() + + 'converts between IPv4-mapped IPv6 addresses and IPv4 addresses': (test) -> + addr = ipaddr.IPv4.parse('77.88.21.11') + mapped = addr.toIPv4MappedAddress() + test.deepEqual(mapped.parts, [0, 0, 0, 0, 0, 0xffff, 0x4d58, 0x150b]) + test.deepEqual(mapped.toIPv4Address().octets, addr.octets) + test.done() + + 'refuses to convert non-IPv4-mapped IPv6 address to IPv4 address': (test) -> + test.throws -> + ipaddr.IPv6.parse('2001:db8::1').toIPv4Address() + test.done() + + 'detects reserved IPv6 networks': (test) -> + test.equal(ipaddr.IPv6.parse('::').range(), 'unspecified') + test.equal(ipaddr.IPv6.parse('fe80::1234:5678:abcd:0123').range(), 'linkLocal') + test.equal(ipaddr.IPv6.parse('ff00::1234').range(), 'multicast') + test.equal(ipaddr.IPv6.parse('::1').range(), 'loopback') + test.equal(ipaddr.IPv6.parse('fc00::').range(), 'uniqueLocal') + test.equal(ipaddr.IPv6.parse('::ffff:192.168.1.10').range(), 'ipv4Mapped') + test.equal(ipaddr.IPv6.parse('::ffff:0:192.168.1.10').range(), 'rfc6145') + test.equal(ipaddr.IPv6.parse('64:ff9b::1234').range(), 'rfc6052') + test.equal(ipaddr.IPv6.parse('2002:1f63:45e8::1').range(), '6to4') + test.equal(ipaddr.IPv6.parse('2001::4242').range(), 'teredo') + test.equal(ipaddr.IPv6.parse('2001:db8::3210').range(), 'reserved') + test.equal(ipaddr.IPv6.parse('2001:470:8:66::1').range(), 'unicast') + test.done() + + 'is able to determine IP address type': (test) -> + test.equal(ipaddr.parse('8.8.8.8').kind(), 'ipv4') + test.equal(ipaddr.parse('2001:db8:3312::1').kind(), 'ipv6') + test.done() + + 'throws an error if tried to parse an invalid address': (test) -> + test.throws -> + ipaddr.parse('::some.nonsense') + test.done() + + 'correctly processes IPv4-mapped addresses': (test) -> + test.equal(ipaddr.process('8.8.8.8').kind(), 'ipv4') + test.equal(ipaddr.process('2001:db8:3312::1').kind(), 'ipv6') + test.equal(ipaddr.process('::ffff:192.168.1.1').kind(), 'ipv4') + test.done() + + 'correctly converts IPv6 and IPv4 addresses to byte arrays': (test) -> + test.deepEqual(ipaddr.parse('1.2.3.4').toByteArray(), + [0x1, 0x2, 0x3, 0x4]); + # Fuck yeah. The first byte of Google's IPv6 address is 42. 42! + test.deepEqual(ipaddr.parse('2a00:1450:8007::68').toByteArray(), + [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x68 ]) + test.done() + + 'correctly parses 1 as an IPv4 address': (test) -> + test.equal(ipaddr.IPv6.isValid('1'), false) + test.equal(ipaddr.IPv4.isValid('1'), true) + test.deepEqual(new ipaddr.IPv4([0, 0, 0, 1]), ipaddr.parse('1')) + test.done() + + 'correctly detects IPv4 and IPv6 CIDR addresses': (test) -> + test.deepEqual([ipaddr.IPv6.parse('fc00::'), 64], + ipaddr.parseCIDR('fc00::/64')) + test.deepEqual([ipaddr.IPv4.parse('1.2.3.4'), 5], + ipaddr.parseCIDR('1.2.3.4/5')) + test.done() + + 'does not consider a very large or very small number a valid IP address': (test) -> + test.equal(ipaddr.isValid('4999999999'), false) + test.equal(ipaddr.isValid('-1'), false) + test.done() + + 'does not hang on ::8:8:8:8:8:8:8:8:8': (test) -> + test.equal(ipaddr.IPv6.isValid('::8:8:8:8:8:8:8:8:8'), false) + test.done() + + 'subnetMatch does not fail on empty range': (test) -> + ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {}, false) + ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {subnet: []}, false) + test.done() + + 'subnetMatch returns default subnet on empty range': (test) -> + test.equal(ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {}, false), false) + test.equal(ipaddr.subnetMatch(new ipaddr.IPv4([1,2,3,4]), {subnet: []}, false), false) + test.done() + + 'is able to determine IP address type from byte array input': (test) -> + test.equal(ipaddr.fromByteArray([0x7f, 0, 0, 1]).kind(), 'ipv4') + test.equal(ipaddr.fromByteArray([0x20, 0x01, 0xd, 0xb8, 0xf5, 0x3a, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]).kind(), 'ipv6') + test.throws -> + ipaddr.fromByteArray([1]) + test.done() + + 'prefixLengthFromSubnetMask returns proper CIDR notation for standard IPv4 masks': (test) -> + test.equal(ipaddr.IPv4.parse('255.255.255.255').prefixLengthFromSubnetMask(), 32) + test.equal(ipaddr.IPv4.parse('255.255.255.254').prefixLengthFromSubnetMask(), 31) + test.equal(ipaddr.IPv4.parse('255.255.255.252').prefixLengthFromSubnetMask(), 30) + test.equal(ipaddr.IPv4.parse('255.255.255.248').prefixLengthFromSubnetMask(), 29) + test.equal(ipaddr.IPv4.parse('255.255.255.240').prefixLengthFromSubnetMask(), 28) + test.equal(ipaddr.IPv4.parse('255.255.255.224').prefixLengthFromSubnetMask(), 27) + test.equal(ipaddr.IPv4.parse('255.255.255.192').prefixLengthFromSubnetMask(), 26) + test.equal(ipaddr.IPv4.parse('255.255.255.128').prefixLengthFromSubnetMask(), 25) + test.equal(ipaddr.IPv4.parse('255.255.255.0').prefixLengthFromSubnetMask(), 24) + test.equal(ipaddr.IPv4.parse('255.255.254.0').prefixLengthFromSubnetMask(), 23) + test.equal(ipaddr.IPv4.parse('255.255.252.0').prefixLengthFromSubnetMask(), 22) + test.equal(ipaddr.IPv4.parse('255.255.248.0').prefixLengthFromSubnetMask(), 21) + test.equal(ipaddr.IPv4.parse('255.255.240.0').prefixLengthFromSubnetMask(), 20) + test.equal(ipaddr.IPv4.parse('255.255.224.0').prefixLengthFromSubnetMask(), 19) + test.equal(ipaddr.IPv4.parse('255.255.192.0').prefixLengthFromSubnetMask(), 18) + test.equal(ipaddr.IPv4.parse('255.255.128.0').prefixLengthFromSubnetMask(), 17) + test.equal(ipaddr.IPv4.parse('255.255.0.0').prefixLengthFromSubnetMask(), 16) + test.equal(ipaddr.IPv4.parse('255.254.0.0').prefixLengthFromSubnetMask(), 15) + test.equal(ipaddr.IPv4.parse('255.252.0.0').prefixLengthFromSubnetMask(), 14) + test.equal(ipaddr.IPv4.parse('255.248.0.0').prefixLengthFromSubnetMask(), 13) + test.equal(ipaddr.IPv4.parse('255.240.0.0').prefixLengthFromSubnetMask(), 12) + test.equal(ipaddr.IPv4.parse('255.224.0.0').prefixLengthFromSubnetMask(), 11) + test.equal(ipaddr.IPv4.parse('255.192.0.0').prefixLengthFromSubnetMask(), 10) + test.equal(ipaddr.IPv4.parse('255.128.0.0').prefixLengthFromSubnetMask(), 9) + test.equal(ipaddr.IPv4.parse('255.0.0.0').prefixLengthFromSubnetMask(), 8) + test.equal(ipaddr.IPv4.parse('254.0.0.0').prefixLengthFromSubnetMask(), 7) + test.equal(ipaddr.IPv4.parse('252.0.0.0').prefixLengthFromSubnetMask(), 6) + test.equal(ipaddr.IPv4.parse('248.0.0.0').prefixLengthFromSubnetMask(), 5) + test.equal(ipaddr.IPv4.parse('240.0.0.0').prefixLengthFromSubnetMask(), 4) + test.equal(ipaddr.IPv4.parse('224.0.0.0').prefixLengthFromSubnetMask(), 3) + test.equal(ipaddr.IPv4.parse('192.0.0.0').prefixLengthFromSubnetMask(), 2) + test.equal(ipaddr.IPv4.parse('128.0.0.0').prefixLengthFromSubnetMask(), 1) + test.equal(ipaddr.IPv4.parse('0.0.0.0').prefixLengthFromSubnetMask(), 0) + # negative cases + test.equal(ipaddr.IPv4.parse('192.168.255.0').prefixLengthFromSubnetMask(), null) + test.equal(ipaddr.IPv4.parse('255.0.255.0').prefixLengthFromSubnetMask(), null) + test.done() + diff --git a/node_modules/media-typer/HISTORY.md b/node_modules/media-typer/HISTORY.md new file mode 100644 index 0000000..62c2003 --- /dev/null +++ b/node_modules/media-typer/HISTORY.md @@ -0,0 +1,22 @@ +0.3.0 / 2014-09-07 +================== + + * Support Node.js 0.6 + * Throw error when parameter format invalid on parse + +0.2.0 / 2014-06-18 +================== + + * Add `typer.format()` to format media types + +0.1.0 / 2014-06-17 +================== + + * Accept `req` as argument to `parse` + * Accept `res` as argument to `parse` + * Parse media type with extra LWS between type and first parameter + +0.0.0 / 2014-06-13 +================== + + * Initial implementation diff --git a/node_modules/media-typer/LICENSE b/node_modules/media-typer/LICENSE new file mode 100644 index 0000000..b7dce6c --- /dev/null +++ b/node_modules/media-typer/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/media-typer/README.md b/node_modules/media-typer/README.md new file mode 100644 index 0000000..d8df623 --- /dev/null +++ b/node_modules/media-typer/README.md @@ -0,0 +1,81 @@ +# media-typer + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Simple RFC 6838 media type parser + +## Installation + +```sh +$ npm install media-typer +``` + +## API + +```js +var typer = require('media-typer') +``` + +### typer.parse(string) + +```js +var obj = typer.parse('image/svg+xml; charset=utf-8') +``` + +Parse a media type string. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The type of the media type (always lower case). Example: `'image'` + + - `subtype`: The subtype of the media type (always lower case). Example: `'svg'` + + - `suffix`: The suffix of the media type (always lower case). Example: `'xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter always lower case). Example: `{charset: 'utf-8'}` + +### typer.parse(req) + +```js +var obj = typer.parse(req) +``` + +Parse the `content-type` header from the given `req`. Short-cut for +`typer.parse(req.headers['content-type'])`. + +### typer.parse(res) + +```js +var obj = typer.parse(res) +``` + +Parse the `content-type` header set on the given `res`. Short-cut for +`typer.parse(res.getHeader('content-type'))`. + +### typer.format(obj) + +```js +var obj = typer.format({type: 'image', subtype: 'svg', suffix: 'xml'}) +``` + +Format an object into a media type string. This will return a string of the +mime type for the given object. For the properties of the object, see the +documentation for `typer.parse(string)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/media-typer.svg?style=flat +[npm-url]: https://npmjs.org/package/media-typer +[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/media-typer.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/media-typer +[coveralls-image]: https://img.shields.io/coveralls/jshttp/media-typer.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/media-typer +[downloads-image]: https://img.shields.io/npm/dm/media-typer.svg?style=flat +[downloads-url]: https://npmjs.org/package/media-typer diff --git a/node_modules/media-typer/index.js b/node_modules/media-typer/index.js new file mode 100644 index 0000000..07f7295 --- /dev/null +++ b/node_modules/media-typer/index.js @@ -0,0 +1,270 @@ +/*! + * media-typer + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * RegExp to match *( ";" parameter ) in RFC 2616 sec 3.7 + * + * parameter = token "=" ( token | quoted-string ) + * token = 1* + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = > + * quoted-pair = "\" CHAR + * CHAR = + * TEXT = + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = + * LF = + * SP = + * SHT = + * CTL = + * OCTET = + */ +var paramRegExp = /; *([!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) *= *("(?:[ !\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u0020-\u007e])*"|[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) */g; +var textRegExp = /^[\u0020-\u007e\u0080-\u00ff]+$/ +var tokenRegExp = /^[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+$/ + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = + */ +var qescRegExp = /\\([\u0000-\u007f])/g; + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + */ +var quoteRegExp = /([\\"])/g; + +/** + * RegExp to match type in RFC 6838 + * + * type-name = restricted-name + * subtype-name = restricted-name + * restricted-name = restricted-name-first *126restricted-name-chars + * restricted-name-first = ALPHA / DIGIT + * restricted-name-chars = ALPHA / DIGIT / "!" / "#" / + * "$" / "&" / "-" / "^" / "_" + * restricted-name-chars =/ "." ; Characters before first dot always + * ; specify a facet name + * restricted-name-chars =/ "+" ; Characters after last plus always + * ; specify a structured syntax suffix + * ALPHA = %x41-5A / %x61-7A ; A-Z / a-z + * DIGIT = %x30-39 ; 0-9 + */ +var subtypeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_.-]{0,126}$/ +var typeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126}$/ +var typeRegExp = /^ *([A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126})\/([A-Za-z0-9][A-Za-z0-9!#$&^_.+-]{0,126}) *$/; + +/** + * Module exports. + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @api public + */ + +function format(obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var subtype = obj.subtype + var suffix = obj.suffix + var type = obj.type + + if (!type || !typeNameRegExp.test(type)) { + throw new TypeError('invalid type') + } + + if (!subtype || !subtypeNameRegExp.test(subtype)) { + throw new TypeError('invalid subtype') + } + + // format as type/subtype + var string = type + '/' + subtype + + // append +suffix + if (suffix) { + if (!typeNameRegExp.test(suffix)) { + throw new TypeError('invalid suffix') + } + + string += '+' + suffix + } + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!tokenRegExp.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @api public + */ + +function parse(string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + if (typeof string === 'object') { + string = getcontenttype(string) + } + + if (typeof string !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = string.indexOf(';') + var type = index !== -1 + ? string.substr(0, index) + : string + + var key + var match + var obj = splitType(type) + var params = {} + var value + + paramRegExp.lastIndex = index + + while (match = paramRegExp.exec(string)) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(qescRegExp, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + obj.parameters = params + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @api private + */ + +function getcontenttype(obj) { + if (typeof obj.getHeader === 'function') { + // res-like + return obj.getHeader('content-type') + } + + if (typeof obj.headers === 'object') { + // req-like + return obj.headers && obj.headers['content-type'] + } +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @api private + */ + +function qstring(val) { + var str = String(val) + + // no need to quote tokens + if (tokenRegExp.test(str)) { + return str + } + + if (str.length > 0 && !textRegExp.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(quoteRegExp, '\\$1') + '"' +} + +/** + * Simply "type/subtype+siffx" into parts. + * + * @param {string} string + * @return {Object} + * @api private + */ + +function splitType(string) { + var match = typeRegExp.exec(string.toLowerCase()) + + if (!match) { + throw new TypeError('invalid media type') + } + + var type = match[1] + var subtype = match[2] + var suffix + + // suffix after last + + var index = subtype.lastIndexOf('+') + if (index !== -1) { + suffix = subtype.substr(index + 1) + subtype = subtype.substr(0, index) + } + + var obj = { + type: type, + subtype: subtype, + suffix: suffix + } + + return obj +} diff --git a/node_modules/media-typer/package.json b/node_modules/media-typer/package.json new file mode 100644 index 0000000..1972590 --- /dev/null +++ b/node_modules/media-typer/package.json @@ -0,0 +1,92 @@ +{ + "_args": [ + [ + { + "raw": "media-typer@0.3.0", + "scope": null, + "escapedName": "media-typer", + "name": "media-typer", + "rawSpec": "0.3.0", + "spec": "0.3.0", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/type-is" + ] + ], + "_from": "media-typer@0.3.0", + "_id": "media-typer@0.3.0", + "_inCache": true, + "_location": "/media-typer", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.21", + "_phantomChildren": {}, + "_requested": { + "raw": "media-typer@0.3.0", + "scope": null, + "escapedName": "media-typer", + "name": "media-typer", + "rawSpec": "0.3.0", + "spec": "0.3.0", + "type": "version" + }, + "_requiredBy": [ + "/type-is" + ], + "_resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "_shasum": "8710d7af0aa626f8fffa1ce00168545263255748", + "_shrinkwrap": null, + "_spec": "media-typer@0.3.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/type-is", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/media-typer/issues" + }, + "dependencies": {}, + "description": "Simple RFC 6838 media type parser and formatter", + "devDependencies": { + "istanbul": "0.3.2", + "mocha": "~1.21.4", + "should": "~4.0.4" + }, + "directories": {}, + "dist": { + "shasum": "8710d7af0aa626f8fffa1ce00168545263255748", + "tarball": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "gitHead": "d49d41ffd0bb5a0655fa44a59df2ec0bfc835b16", + "homepage": "https://github.com/jshttp/media-typer", + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "media-typer", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/media-typer.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.3.0" +} diff --git a/node_modules/merge-descriptors/HISTORY.md b/node_modules/merge-descriptors/HISTORY.md new file mode 100644 index 0000000..486771f --- /dev/null +++ b/node_modules/merge-descriptors/HISTORY.md @@ -0,0 +1,21 @@ +1.0.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.0.0 / 2015-03-01 +================== + + * Add option to only add new descriptors + * Add simple argument validation + * Add jsdoc to source file + +0.0.2 / 2013-12-14 +================== + + * Move repository to `component` organization + +0.0.1 / 2013-10-29 +================== + + * Initial release diff --git a/node_modules/merge-descriptors/LICENSE b/node_modules/merge-descriptors/LICENSE new file mode 100644 index 0000000..274bfd8 --- /dev/null +++ b/node_modules/merge-descriptors/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/merge-descriptors/README.md b/node_modules/merge-descriptors/README.md new file mode 100644 index 0000000..d593c0e --- /dev/null +++ b/node_modules/merge-descriptors/README.md @@ -0,0 +1,48 @@ +# Merge Descriptors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Merge objects using descriptors. + +```js +var thing = { + get name() { + return 'jon' + } +} + +var animal = { + +} + +merge(animal, thing) + +animal.name === 'jon' +``` + +## API + +### merge(destination, source) + +Redefines `destination`'s descriptors with `source`'s. + +### merge(destination, source, false) + +Defines `source`'s descriptors on `destination` if `destination` does not have +a descriptor by the same name. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/merge-descriptors.svg +[npm-url]: https://npmjs.org/package/merge-descriptors +[travis-image]: https://img.shields.io/travis/component/merge-descriptors/master.svg +[travis-url]: https://travis-ci.org/component/merge-descriptors +[coveralls-image]: https://img.shields.io/coveralls/component/merge-descriptors/master.svg +[coveralls-url]: https://coveralls.io/r/component/merge-descriptors?branch=master +[downloads-image]: https://img.shields.io/npm/dm/merge-descriptors.svg +[downloads-url]: https://npmjs.org/package/merge-descriptors diff --git a/node_modules/merge-descriptors/index.js b/node_modules/merge-descriptors/index.js new file mode 100644 index 0000000..573b132 --- /dev/null +++ b/node_modules/merge-descriptors/index.js @@ -0,0 +1,60 @@ +/*! + * merge-descriptors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = merge + +/** + * Module variables. + * @private + */ + +var hasOwnProperty = Object.prototype.hasOwnProperty + +/** + * Merge the property descriptors of `src` into `dest` + * + * @param {object} dest Object to add descriptors to + * @param {object} src Object to clone descriptors from + * @param {boolean} [redefine=true] Redefine `dest` properties with `src` properties + * @returns {object} Reference to dest + * @public + */ + +function merge(dest, src, redefine) { + if (!dest) { + throw new TypeError('argument dest is required') + } + + if (!src) { + throw new TypeError('argument src is required') + } + + if (redefine === undefined) { + // Default to true + redefine = true + } + + Object.getOwnPropertyNames(src).forEach(function forEachOwnPropertyName(name) { + if (!redefine && hasOwnProperty.call(dest, name)) { + // Skip desriptor + return + } + + // Copy descriptor + var descriptor = Object.getOwnPropertyDescriptor(src, name) + Object.defineProperty(dest, name, descriptor) + }) + + return dest +} diff --git a/node_modules/merge-descriptors/package.json b/node_modules/merge-descriptors/package.json new file mode 100644 index 0000000..d784b10 --- /dev/null +++ b/node_modules/merge-descriptors/package.json @@ -0,0 +1,172 @@ +{ + "_args": [ + [ + { + "raw": "merge-descriptors@1.0.1", + "scope": null, + "escapedName": "merge-descriptors", + "name": "merge-descriptors", + "rawSpec": "1.0.1", + "spec": "1.0.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "merge-descriptors@1.0.1", + "_id": "merge-descriptors@1.0.1", + "_inCache": true, + "_location": "/merge-descriptors", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "merge-descriptors@1.0.1", + "scope": null, + "escapedName": "merge-descriptors", + "name": "merge-descriptors", + "rawSpec": "1.0.1", + "spec": "1.0.1", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "_shasum": "b00aaa556dd8b44568150ec9d1b953f3f90cbb61", + "_shrinkwrap": null, + "_spec": "merge-descriptors@1.0.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/component/merge-descriptors/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Mike Grabowski", + "email": "grabbou@gmail.com" + } + ], + "dependencies": {}, + "description": "Merge objects using descriptors", + "devDependencies": { + "istanbul": "0.4.1", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "b00aaa556dd8b44568150ec9d1b953f3f90cbb61", + "tarball": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "gitHead": "f26c49c3b423b0b2ac31f6e32a84e1632f2d7ac2", + "homepage": "https://github.com/component/merge-descriptors", + "license": "MIT", + "maintainers": [ + { + "name": "anthonyshort", + "email": "antshort@gmail.com" + }, + { + "name": "clintwood", + "email": "clint@anotherway.co.za" + }, + { + "name": "dfcreative", + "email": "df.creative@gmail.com" + }, + { + "name": "dominicbarnes", + "email": "dominic@dbarnes.info" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "ianstormtaylor", + "email": "ian@ianstormtaylor.com" + }, + { + "name": "jonathanong", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + }, + { + "name": "mattmueller", + "email": "mattmuelle@gmail.com" + }, + { + "name": "queckezz", + "email": "fabian.eichenberger@gmail.com" + }, + { + "name": "stephenmathieson", + "email": "me@stephenmathieson.com" + }, + { + "name": "thehydroimpulse", + "email": "dnfagnan@gmail.com" + }, + { + "name": "timaschew", + "email": "timaschew@gmail.com" + }, + { + "name": "timoxley", + "email": "secoif@gmail.com" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + }, + { + "name": "trevorgerhardt", + "email": "trevorgerhardt@gmail.com" + }, + { + "name": "yields", + "email": "yields@icloud.com" + } + ], + "name": "merge-descriptors", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/component/merge-descriptors.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.1" +} diff --git a/node_modules/methods/HISTORY.md b/node_modules/methods/HISTORY.md new file mode 100644 index 0000000..c0ecf07 --- /dev/null +++ b/node_modules/methods/HISTORY.md @@ -0,0 +1,29 @@ +1.1.2 / 2016-01-17 +================== + + * perf: enable strict mode + +1.1.1 / 2014-12-30 +================== + + * Improve `browserify` support + +1.1.0 / 2014-07-05 +================== + + * Add `CONNECT` method + +1.0.1 / 2014-06-02 +================== + + * Fix module to work with harmony transform + +1.0.0 / 2014-05-08 +================== + + * Add `PURGE` method + +0.1.0 / 2013-10-28 +================== + + * Add `http.METHODS` support diff --git a/node_modules/methods/LICENSE b/node_modules/methods/LICENSE new file mode 100644 index 0000000..220dc1a --- /dev/null +++ b/node_modules/methods/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2013-2014 TJ Holowaychuk +Copyright (c) 2015-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/methods/README.md b/node_modules/methods/README.md new file mode 100644 index 0000000..672a32b --- /dev/null +++ b/node_modules/methods/README.md @@ -0,0 +1,51 @@ +# Methods + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP verbs that Node.js core's HTTP parser supports. + +This module provides an export that is just like `http.METHODS` from Node.js core, +with the following differences: + + * All method names are lower-cased. + * Contains a fallback list of methods for Node.js versions that do not have a + `http.METHODS` export (0.10 and lower). + * Provides the fallback list when using tools like `browserify` without pulling + in the `http` shim module. + +## Install + +```bash +$ npm install methods +``` + +## API + +```js +var methods = require('methods') +``` + +### methods + +This is an array of lower-cased method names that Node.js supports. If Node.js +provides the `http.METHODS` export, then this is the same array lower-cased, +otherwise it is a snapshot of the verbs from Node.js 0.10. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/methods.svg?style=flat +[npm-url]: https://npmjs.org/package/methods +[node-version-image]: https://img.shields.io/node/v/methods.svg?style=flat +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/methods.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/methods +[coveralls-image]: https://img.shields.io/coveralls/jshttp/methods.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/methods?branch=master +[downloads-image]: https://img.shields.io/npm/dm/methods.svg?style=flat +[downloads-url]: https://npmjs.org/package/methods diff --git a/node_modules/methods/index.js b/node_modules/methods/index.js new file mode 100644 index 0000000..667a50b --- /dev/null +++ b/node_modules/methods/index.js @@ -0,0 +1,69 @@ +/*! + * methods + * Copyright(c) 2013-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var http = require('http'); + +/** + * Module exports. + * @public + */ + +module.exports = getCurrentNodeMethods() || getBasicNodeMethods(); + +/** + * Get the current Node.js methods. + * @private + */ + +function getCurrentNodeMethods() { + return http.METHODS && http.METHODS.map(function lowerCaseMethod(method) { + return method.toLowerCase(); + }); +} + +/** + * Get the "basic" Node.js methods, a snapshot from Node.js 0.10. + * @private + */ + +function getBasicNodeMethods() { + return [ + 'get', + 'post', + 'put', + 'head', + 'delete', + 'options', + 'trace', + 'copy', + 'lock', + 'mkcol', + 'move', + 'purge', + 'propfind', + 'proppatch', + 'unlock', + 'report', + 'mkactivity', + 'checkout', + 'merge', + 'm-search', + 'notify', + 'subscribe', + 'unsubscribe', + 'patch', + 'search', + 'connect' + ]; +} diff --git a/node_modules/methods/package.json b/node_modules/methods/package.json new file mode 100644 index 0000000..ba32834 --- /dev/null +++ b/node_modules/methods/package.json @@ -0,0 +1,122 @@ +{ + "_args": [ + [ + { + "raw": "methods@~1.1.2", + "scope": null, + "escapedName": "methods", + "name": "methods", + "rawSpec": "~1.1.2", + "spec": ">=1.1.2 <1.2.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "methods@>=1.1.2 <1.2.0", + "_id": "methods@1.1.2", + "_inCache": true, + "_location": "/methods", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "methods@~1.1.2", + "scope": null, + "escapedName": "methods", + "name": "methods", + "rawSpec": "~1.1.2", + "spec": ">=1.1.2 <1.2.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "_shasum": "5529a4d67654134edcc5266656835b0f851afcee", + "_shrinkwrap": null, + "_spec": "methods@~1.1.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "browser": { + "http": false + }, + "bugs": { + "url": "https://github.com/jshttp/methods/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + } + ], + "dependencies": {}, + "description": "HTTP methods that node supports", + "devDependencies": { + "istanbul": "0.4.1", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "5529a4d67654134edcc5266656835b0f851afcee", + "tarball": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "index.js", + "HISTORY.md", + "LICENSE" + ], + "gitHead": "25d257d913f1b94bd2d73581521ff72c81469140", + "homepage": "https://github.com/jshttp/methods", + "keywords": [ + "http", + "methods" + ], + "license": "MIT", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "jonathanong", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "methods", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/methods.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.2" +} diff --git a/node_modules/mime-db/HISTORY.md b/node_modules/mime-db/HISTORY.md new file mode 100644 index 0000000..27b2a11 --- /dev/null +++ b/node_modules/mime-db/HISTORY.md @@ -0,0 +1,391 @@ +1.26.0 / 2017-01-14 +=================== + + * Add `application/coap-payload` + * Add `application/cose` + * Add `application/cose-key` + * Add `application/cose-key-set` + * Add `application/mud+json` + * Add `application/trig` + * Add `application/vnd.dataresource+json` + * Add `application/vnd.hc+json` + * Add `application/vnd.tableschema+json` + * Add `application/yang-patch+json` + * Add `application/yang-patch+xml` + * Add extension `.geojson` to `application/geo+json` + +1.25.0 / 2016-11-11 +=================== + + * Add `application/dicom+json` + * Add `application/dicom+xml` + * Add `application/vnd.openstreetmap.data+xml` + * Add `application/vnd.tri.onesource` + * Add `application/yang-data+json` + * Add `application/yang-data+xml` + +1.24.0 / 2016-09-18 +=================== + + * Add `application/clue_info+xml` + * Add `application/geo+json` + * Add `application/lgr+xml` + * Add `application/vnd.amazon.mobi8-ebook` + * Add `application/vnd.chess-pgn` + * Add `application/vnd.comicbook+zip` + * Add `application/vnd.d2l.coursepackage1p0+zip` + * Add `application/vnd.espass-espass+zip` + * Add `application/vnd.nearst.inv+json` + * Add `application/vnd.oma.lwm2m+json` + * Add `application/vnd.oma.lwm2m+tlv` + * Add `application/vnd.quarantainenet` + * Add `application/vnd.rar` + * Add `audio/mp3` + * Add `image/dicom-rle` + * Add `image/emf` + * Add `image/jls` + * Add `image/wmf` + * Add `model/gltf+json` + * Add `text/vnd.ascii-art` + +1.23.0 / 2016-05-01 +=================== + + * Add `application/efi` + * Add `application/vnd.3gpp.sms+xml` + * Add `application/vnd.3lightssoftware.imagescal` + * Add `application/vnd.coreos.ignition+json` + * Add `application/vnd.desmume.movie` + * Add `application/vnd.onepager` + * Add `application/vnd.vel+json` + * Add `text/prs.prop.logic` + * Add `video/encaprtp` + * Add `video/h265` + * Add `video/iso.segment` + * Add `video/raptorfec` + * Add `video/rtploopback` + * Add `video/vnd.radgamettools.bink` + * Add `video/vnd.radgamettools.smacker` + * Add `video/vp8` + * Add extension `.3gpp` to `audio/3gpp` + +1.22.0 / 2016-02-15 +=================== + + * Add `application/ppsp-tracker+json` + * Add `application/problem+json` + * Add `application/problem+xml` + * Add `application/vnd.hdt` + * Add `application/vnd.ms-printschematicket+xml` + * Add `model/vnd.rosette.annotated-data-model` + * Add `text/slim` + * Add extension `.rng` to `application/xml` + * Fix extension of `application/dash+xml` to be `.mpd` + * Update primary extension to `.m4a` for `audio/mp4` + +1.21.0 / 2016-01-06 +=================== + + * Add `application/emergencycalldata.comment+xml` + * Add `application/emergencycalldata.deviceinfo+xml` + * Add `application/emergencycalldata.providerinfo+xml` + * Add `application/emergencycalldata.serviceinfo+xml` + * Add `application/emergencycalldata.subscriberinfo+xml` + * Add `application/vnd.filmit.zfc` + * Add `application/vnd.google-apps.document` + * Add `application/vnd.google-apps.presentation` + * Add `application/vnd.google-apps.spreadsheet` + * Add `application/vnd.mapbox-vector-tile` + * Add `application/vnd.ms-printdevicecapabilities+xml` + * Add `application/vnd.ms-windows.devicepairing` + * Add `application/vnd.ms-windows.nwprinting.oob` + * Add `application/vnd.tml` + * Add `audio/evs` + +1.20.0 / 2015-11-10 +=================== + + * Add `application/cdni` + * Add `application/csvm+json` + * Add `application/rfc+xml` + * Add `application/vnd.3gpp.access-transfer-events+xml` + * Add `application/vnd.3gpp.srvcc-ext+xml` + * Add `application/vnd.ms-windows.wsd.oob` + * Add `application/vnd.oxli.countgraph` + * Add `application/vnd.pagerduty+json` + * Add `text/x-suse-ymp` + +1.19.0 / 2015-09-17 +=================== + + * Add `application/vnd.3gpp-prose-pc3ch+xml` + * Add `application/vnd.3gpp.srvcc-info+xml` + * Add `application/vnd.apple.pkpass` + * Add `application/vnd.drive+json` + +1.18.0 / 2015-09-03 +=================== + + * Add `application/pkcs12` + * Add `application/vnd.3gpp-prose+xml` + * Add `application/vnd.3gpp.mid-call+xml` + * Add `application/vnd.3gpp.state-and-event-info+xml` + * Add `application/vnd.anki` + * Add `application/vnd.firemonkeys.cloudcell` + * Add `application/vnd.openblox.game+xml` + * Add `application/vnd.openblox.game-binary` + +1.17.0 / 2015-08-13 +=================== + + * Add `application/x-msdos-program` + * Add `audio/g711-0` + * Add `image/vnd.mozilla.apng` + * Add extension `.exe` to `application/x-msdos-program` + +1.16.0 / 2015-07-29 +=================== + + * Add `application/vnd.uri-map` + +1.15.0 / 2015-07-13 +=================== + + * Add `application/x-httpd-php` + +1.14.0 / 2015-06-25 +=================== + + * Add `application/scim+json` + * Add `application/vnd.3gpp.ussd+xml` + * Add `application/vnd.biopax.rdf+xml` + * Add `text/x-processing` + +1.13.0 / 2015-06-07 +=================== + + * Add nginx as a source + * Add `application/x-cocoa` + * Add `application/x-java-archive-diff` + * Add `application/x-makeself` + * Add `application/x-perl` + * Add `application/x-pilot` + * Add `application/x-redhat-package-manager` + * Add `application/x-sea` + * Add `audio/x-m4a` + * Add `audio/x-realaudio` + * Add `image/x-jng` + * Add `text/mathml` + +1.12.0 / 2015-06-05 +=================== + + * Add `application/bdoc` + * Add `application/vnd.hyperdrive+json` + * Add `application/x-bdoc` + * Add extension `.rtf` to `text/rtf` + +1.11.0 / 2015-05-31 +=================== + + * Add `audio/wav` + * Add `audio/wave` + * Add extension `.litcoffee` to `text/coffeescript` + * Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data` + * Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install` + +1.10.0 / 2015-05-19 +=================== + + * Add `application/vnd.balsamiq.bmpr` + * Add `application/vnd.microsoft.portable-executable` + * Add `application/x-ns-proxy-autoconfig` + +1.9.1 / 2015-04-19 +================== + + * Remove `.json` extension from `application/manifest+json` + - This is causing bugs downstream + +1.9.0 / 2015-04-19 +================== + + * Add `application/manifest+json` + * Add `application/vnd.micro+json` + * Add `image/vnd.zbrush.pcx` + * Add `image/x-ms-bmp` + +1.8.0 / 2015-03-13 +================== + + * Add `application/vnd.citationstyles.style+xml` + * Add `application/vnd.fastcopy-disk-image` + * Add `application/vnd.gov.sk.xmldatacontainer+xml` + * Add extension `.jsonld` to `application/ld+json` + +1.7.0 / 2015-02-08 +================== + + * Add `application/vnd.gerber` + * Add `application/vnd.msa-disk-image` + +1.6.1 / 2015-02-05 +================== + + * Community extensions ownership transferred from `node-mime` + +1.6.0 / 2015-01-29 +================== + + * Add `application/jose` + * Add `application/jose+json` + * Add `application/json-seq` + * Add `application/jwk+json` + * Add `application/jwk-set+json` + * Add `application/jwt` + * Add `application/rdap+json` + * Add `application/vnd.gov.sk.e-form+xml` + * Add `application/vnd.ims.imsccv1p3` + +1.5.0 / 2014-12-30 +================== + + * Add `application/vnd.oracle.resource+json` + * Fix various invalid MIME type entries + - `application/mbox+xml` + - `application/oscp-response` + - `application/vwg-multiplexed` + - `audio/g721` + +1.4.0 / 2014-12-21 +================== + + * Add `application/vnd.ims.imsccv1p2` + * Fix various invalid MIME type entries + - `application/vnd-acucobol` + - `application/vnd-curl` + - `application/vnd-dart` + - `application/vnd-dxr` + - `application/vnd-fdf` + - `application/vnd-mif` + - `application/vnd-sema` + - `application/vnd-wap-wmlc` + - `application/vnd.adobe.flash-movie` + - `application/vnd.dece-zip` + - `application/vnd.dvb_service` + - `application/vnd.micrografx-igx` + - `application/vnd.sealed-doc` + - `application/vnd.sealed-eml` + - `application/vnd.sealed-mht` + - `application/vnd.sealed-ppt` + - `application/vnd.sealed-tiff` + - `application/vnd.sealed-xls` + - `application/vnd.sealedmedia.softseal-html` + - `application/vnd.sealedmedia.softseal-pdf` + - `application/vnd.wap-slc` + - `application/vnd.wap-wbxml` + - `audio/vnd.sealedmedia.softseal-mpeg` + - `image/vnd-djvu` + - `image/vnd-svf` + - `image/vnd-wap-wbmp` + - `image/vnd.sealed-png` + - `image/vnd.sealedmedia.softseal-gif` + - `image/vnd.sealedmedia.softseal-jpg` + - `model/vnd-dwf` + - `model/vnd.parasolid.transmit-binary` + - `model/vnd.parasolid.transmit-text` + - `text/vnd-a` + - `text/vnd-curl` + - `text/vnd.wap-wml` + * Remove example template MIME types + - `application/example` + - `audio/example` + - `image/example` + - `message/example` + - `model/example` + - `multipart/example` + - `text/example` + - `video/example` + +1.3.1 / 2014-12-16 +================== + + * Fix missing extensions + - `application/json5` + - `text/hjson` + +1.3.0 / 2014-12-07 +================== + + * Add `application/a2l` + * Add `application/aml` + * Add `application/atfx` + * Add `application/atxml` + * Add `application/cdfx+xml` + * Add `application/dii` + * Add `application/json5` + * Add `application/lxf` + * Add `application/mf4` + * Add `application/vnd.apache.thrift.compact` + * Add `application/vnd.apache.thrift.json` + * Add `application/vnd.coffeescript` + * Add `application/vnd.enphase.envoy` + * Add `application/vnd.ims.imsccv1p1` + * Add `text/csv-schema` + * Add `text/hjson` + * Add `text/markdown` + * Add `text/yaml` + +1.2.0 / 2014-11-09 +================== + + * Add `application/cea` + * Add `application/dit` + * Add `application/vnd.gov.sk.e-form+zip` + * Add `application/vnd.tmd.mediaflex.api+xml` + * Type `application/epub+zip` is now IANA-registered + +1.1.2 / 2014-10-23 +================== + + * Rebuild database for `application/x-www-form-urlencoded` change + +1.1.1 / 2014-10-20 +================== + + * Mark `application/x-www-form-urlencoded` as compressible. + +1.1.0 / 2014-09-28 +================== + + * Add `application/font-woff2` + +1.0.3 / 2014-09-25 +================== + + * Fix engine requirement in package + +1.0.2 / 2014-09-25 +================== + + * Add `application/coap-group+json` + * Add `application/dcd` + * Add `application/vnd.apache.thrift.binary` + * Add `image/vnd.tencent.tap` + * Mark all JSON-derived types as compressible + * Update `text/vtt` data + +1.0.1 / 2014-08-30 +================== + + * Fix extension ordering + +1.0.0 / 2014-08-30 +================== + + * Add `application/atf` + * Add `application/merge-patch+json` + * Add `multipart/x-mixed-replace` + * Add `source: 'apache'` metadata + * Add `source: 'iana'` metadata + * Remove badly-assumed charset data diff --git a/node_modules/mime-db/LICENSE b/node_modules/mime-db/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/mime-db/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mime-db/README.md b/node_modules/mime-db/README.md new file mode 100644 index 0000000..7662440 --- /dev/null +++ b/node_modules/mime-db/README.md @@ -0,0 +1,82 @@ +# mime-db + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +This is a database of all mime types. +It consists of a single, public JSON file and does not include any logic, +allowing it to remain as un-opinionated as possible with an API. +It aggregates data from the following sources: + +- http://www.iana.org/assignments/media-types/media-types.xhtml +- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types +- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types + +## Installation + +```bash +npm install mime-db +``` + +### Database Download + +If you're crazy enough to use this in the browser, you can just grab the +JSON file using [RawGit](https://rawgit.com/). It is recommended to replace +`master` with [a release tag](https://github.com/jshttp/mime-db/tags) as the +JSON format may change in the future. + +``` +https://cdn.rawgit.com/jshttp/mime-db/master/db.json +``` + +## Usage + +```js +var db = require('mime-db'); + +// grab data on .js files +var data = db['application/javascript']; +``` + +## Data Structure + +The JSON file is a map lookup for lowercased mime types. +Each mime type has the following properties: + +- `.source` - where the mime type is defined. + If not set, it's probably a custom media type. + - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) + - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml) + - `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types) +- `.extensions[]` - known extensions associated with this mime type. +- `.compressible` - whether a file of this type can be gzipped. +- `.charset` - the default charset associated with this type, if any. + +If unknown, every property could be `undefined`. + +## Contributing + +To edit the database, only make PRs against `src/custom.json` or +`src/custom-suffix.json`. + +To update the build, run `npm run build`. + +## Adding Custom Media Types + +The best way to get new media types included in this library is to register +them with the IANA. The community registration procedure is outlined in +[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types +registered with the IANA are automatically pulled into this library. + +[npm-version-image]: https://img.shields.io/npm/v/mime-db.svg +[npm-downloads-image]: https://img.shields.io/npm/dm/mime-db.svg +[npm-url]: https://npmjs.org/package/mime-db +[travis-image]: https://img.shields.io/travis/jshttp/mime-db/master.svg +[travis-url]: https://travis-ci.org/jshttp/mime-db +[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-db/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master +[node-image]: https://img.shields.io/node/v/mime-db.svg +[node-url]: http://nodejs.org/download/ diff --git a/node_modules/mime-db/db.json b/node_modules/mime-db/db.json new file mode 100644 index 0000000..400b9e1 --- /dev/null +++ b/node_modules/mime-db/db.json @@ -0,0 +1,6751 @@ +{ + "application/1d-interleaved-parityfec": { + "source": "iana" + }, + "application/3gpdash-qoe-report+xml": { + "source": "iana" + }, + "application/3gpp-ims+xml": { + "source": "iana" + }, + "application/a2l": { + "source": "iana" + }, + "application/activemessage": { + "source": "iana" + }, + "application/alto-costmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-directory+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcost+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcostparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointprop+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointpropparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-error+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/aml": { + "source": "iana" + }, + "application/andrew-inset": { + "source": "iana", + "extensions": ["ez"] + }, + "application/applefile": { + "source": "iana" + }, + "application/applixware": { + "source": "apache", + "extensions": ["aw"] + }, + "application/atf": { + "source": "iana" + }, + "application/atfx": { + "source": "iana" + }, + "application/atom+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atom"] + }, + "application/atomcat+xml": { + "source": "iana", + "extensions": ["atomcat"] + }, + "application/atomdeleted+xml": { + "source": "iana" + }, + "application/atomicmail": { + "source": "iana" + }, + "application/atomsvc+xml": { + "source": "iana", + "extensions": ["atomsvc"] + }, + "application/atxml": { + "source": "iana" + }, + "application/auth-policy+xml": { + "source": "iana" + }, + "application/bacnet-xdd+zip": { + "source": "iana" + }, + "application/batch-smtp": { + "source": "iana" + }, + "application/bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/beep+xml": { + "source": "iana" + }, + "application/calendar+json": { + "source": "iana", + "compressible": true + }, + "application/calendar+xml": { + "source": "iana" + }, + "application/call-completion": { + "source": "iana" + }, + "application/cals-1840": { + "source": "iana" + }, + "application/cbor": { + "source": "iana" + }, + "application/ccmp+xml": { + "source": "iana" + }, + "application/ccxml+xml": { + "source": "iana", + "extensions": ["ccxml"] + }, + "application/cdfx+xml": { + "source": "iana" + }, + "application/cdmi-capability": { + "source": "iana", + "extensions": ["cdmia"] + }, + "application/cdmi-container": { + "source": "iana", + "extensions": ["cdmic"] + }, + "application/cdmi-domain": { + "source": "iana", + "extensions": ["cdmid"] + }, + "application/cdmi-object": { + "source": "iana", + "extensions": ["cdmio"] + }, + "application/cdmi-queue": { + "source": "iana", + "extensions": ["cdmiq"] + }, + "application/cdni": { + "source": "iana" + }, + "application/cea": { + "source": "iana" + }, + "application/cea-2018+xml": { + "source": "iana" + }, + "application/cellml+xml": { + "source": "iana" + }, + "application/cfw": { + "source": "iana" + }, + "application/clue_info+xml": { + "source": "iana" + }, + "application/cms": { + "source": "iana" + }, + "application/cnrp+xml": { + "source": "iana" + }, + "application/coap-group+json": { + "source": "iana", + "compressible": true + }, + "application/coap-payload": { + "source": "iana" + }, + "application/commonground": { + "source": "iana" + }, + "application/conference-info+xml": { + "source": "iana" + }, + "application/cose": { + "source": "iana" + }, + "application/cose-key": { + "source": "iana" + }, + "application/cose-key-set": { + "source": "iana" + }, + "application/cpl+xml": { + "source": "iana" + }, + "application/csrattrs": { + "source": "iana" + }, + "application/csta+xml": { + "source": "iana" + }, + "application/cstadata+xml": { + "source": "iana" + }, + "application/csvm+json": { + "source": "iana", + "compressible": true + }, + "application/cu-seeme": { + "source": "apache", + "extensions": ["cu"] + }, + "application/cybercash": { + "source": "iana" + }, + "application/dart": { + "compressible": true + }, + "application/dash+xml": { + "source": "iana", + "extensions": ["mpd"] + }, + "application/dashdelta": { + "source": "iana" + }, + "application/davmount+xml": { + "source": "iana", + "extensions": ["davmount"] + }, + "application/dca-rft": { + "source": "iana" + }, + "application/dcd": { + "source": "iana" + }, + "application/dec-dx": { + "source": "iana" + }, + "application/dialog-info+xml": { + "source": "iana" + }, + "application/dicom": { + "source": "iana" + }, + "application/dicom+json": { + "source": "iana", + "compressible": true + }, + "application/dicom+xml": { + "source": "iana" + }, + "application/dii": { + "source": "iana" + }, + "application/dit": { + "source": "iana" + }, + "application/dns": { + "source": "iana" + }, + "application/docbook+xml": { + "source": "apache", + "extensions": ["dbk"] + }, + "application/dskpp+xml": { + "source": "iana" + }, + "application/dssc+der": { + "source": "iana", + "extensions": ["dssc"] + }, + "application/dssc+xml": { + "source": "iana", + "extensions": ["xdssc"] + }, + "application/dvcs": { + "source": "iana" + }, + "application/ecmascript": { + "source": "iana", + "compressible": true, + "extensions": ["ecma"] + }, + "application/edi-consent": { + "source": "iana" + }, + "application/edi-x12": { + "source": "iana", + "compressible": false + }, + "application/edifact": { + "source": "iana", + "compressible": false + }, + "application/efi": { + "source": "iana" + }, + "application/emergencycalldata.comment+xml": { + "source": "iana" + }, + "application/emergencycalldata.deviceinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.providerinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.serviceinfo+xml": { + "source": "iana" + }, + "application/emergencycalldata.subscriberinfo+xml": { + "source": "iana" + }, + "application/emma+xml": { + "source": "iana", + "extensions": ["emma"] + }, + "application/emotionml+xml": { + "source": "iana" + }, + "application/encaprtp": { + "source": "iana" + }, + "application/epp+xml": { + "source": "iana" + }, + "application/epub+zip": { + "source": "iana", + "extensions": ["epub"] + }, + "application/eshop": { + "source": "iana" + }, + "application/exi": { + "source": "iana", + "extensions": ["exi"] + }, + "application/fastinfoset": { + "source": "iana" + }, + "application/fastsoap": { + "source": "iana" + }, + "application/fdt+xml": { + "source": "iana" + }, + "application/fits": { + "source": "iana" + }, + "application/font-sfnt": { + "source": "iana" + }, + "application/font-tdpfr": { + "source": "iana", + "extensions": ["pfr"] + }, + "application/font-woff": { + "source": "iana", + "compressible": false, + "extensions": ["woff"] + }, + "application/font-woff2": { + "compressible": false, + "extensions": ["woff2"] + }, + "application/framework-attributes+xml": { + "source": "iana" + }, + "application/geo+json": { + "source": "iana", + "compressible": true, + "extensions": ["geojson"] + }, + "application/gml+xml": { + "source": "iana", + "extensions": ["gml"] + }, + "application/gpx+xml": { + "source": "apache", + "extensions": ["gpx"] + }, + "application/gxf": { + "source": "apache", + "extensions": ["gxf"] + }, + "application/gzip": { + "source": "iana", + "compressible": false + }, + "application/h224": { + "source": "iana" + }, + "application/held+xml": { + "source": "iana" + }, + "application/http": { + "source": "iana" + }, + "application/hyperstudio": { + "source": "iana", + "extensions": ["stk"] + }, + "application/ibe-key-request+xml": { + "source": "iana" + }, + "application/ibe-pkg-reply+xml": { + "source": "iana" + }, + "application/ibe-pp-data": { + "source": "iana" + }, + "application/iges": { + "source": "iana" + }, + "application/im-iscomposing+xml": { + "source": "iana" + }, + "application/index": { + "source": "iana" + }, + "application/index.cmd": { + "source": "iana" + }, + "application/index.obj": { + "source": "iana" + }, + "application/index.response": { + "source": "iana" + }, + "application/index.vnd": { + "source": "iana" + }, + "application/inkml+xml": { + "source": "iana", + "extensions": ["ink","inkml"] + }, + "application/iotp": { + "source": "iana" + }, + "application/ipfix": { + "source": "iana", + "extensions": ["ipfix"] + }, + "application/ipp": { + "source": "iana" + }, + "application/isup": { + "source": "iana" + }, + "application/its+xml": { + "source": "iana" + }, + "application/java-archive": { + "source": "apache", + "compressible": false, + "extensions": ["jar","war","ear"] + }, + "application/java-serialized-object": { + "source": "apache", + "compressible": false, + "extensions": ["ser"] + }, + "application/java-vm": { + "source": "apache", + "compressible": false, + "extensions": ["class"] + }, + "application/javascript": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js"] + }, + "application/jose": { + "source": "iana" + }, + "application/jose+json": { + "source": "iana", + "compressible": true + }, + "application/jrd+json": { + "source": "iana", + "compressible": true + }, + "application/json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["json","map"] + }, + "application/json-patch+json": { + "source": "iana", + "compressible": true + }, + "application/json-seq": { + "source": "iana" + }, + "application/json5": { + "extensions": ["json5"] + }, + "application/jsonml+json": { + "source": "apache", + "compressible": true, + "extensions": ["jsonml"] + }, + "application/jwk+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+json": { + "source": "iana", + "compressible": true + }, + "application/jwt": { + "source": "iana" + }, + "application/kpml-request+xml": { + "source": "iana" + }, + "application/kpml-response+xml": { + "source": "iana" + }, + "application/ld+json": { + "source": "iana", + "compressible": true, + "extensions": ["jsonld"] + }, + "application/lgr+xml": { + "source": "iana" + }, + "application/link-format": { + "source": "iana" + }, + "application/load-control+xml": { + "source": "iana" + }, + "application/lost+xml": { + "source": "iana", + "extensions": ["lostxml"] + }, + "application/lostsync+xml": { + "source": "iana" + }, + "application/lxf": { + "source": "iana" + }, + "application/mac-binhex40": { + "source": "iana", + "extensions": ["hqx"] + }, + "application/mac-compactpro": { + "source": "apache", + "extensions": ["cpt"] + }, + "application/macwriteii": { + "source": "iana" + }, + "application/mads+xml": { + "source": "iana", + "extensions": ["mads"] + }, + "application/manifest+json": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["webmanifest"] + }, + "application/marc": { + "source": "iana", + "extensions": ["mrc"] + }, + "application/marcxml+xml": { + "source": "iana", + "extensions": ["mrcx"] + }, + "application/mathematica": { + "source": "iana", + "extensions": ["ma","nb","mb"] + }, + "application/mathml+xml": { + "source": "iana", + "extensions": ["mathml"] + }, + "application/mathml-content+xml": { + "source": "iana" + }, + "application/mathml-presentation+xml": { + "source": "iana" + }, + "application/mbms-associated-procedure-description+xml": { + "source": "iana" + }, + "application/mbms-deregister+xml": { + "source": "iana" + }, + "application/mbms-envelope+xml": { + "source": "iana" + }, + "application/mbms-msk+xml": { + "source": "iana" + }, + "application/mbms-msk-response+xml": { + "source": "iana" + }, + "application/mbms-protection-description+xml": { + "source": "iana" + }, + "application/mbms-reception-report+xml": { + "source": "iana" + }, + "application/mbms-register+xml": { + "source": "iana" + }, + "application/mbms-register-response+xml": { + "source": "iana" + }, + "application/mbms-schedule+xml": { + "source": "iana" + }, + "application/mbms-user-service-description+xml": { + "source": "iana" + }, + "application/mbox": { + "source": "iana", + "extensions": ["mbox"] + }, + "application/media-policy-dataset+xml": { + "source": "iana" + }, + "application/media_control+xml": { + "source": "iana" + }, + "application/mediaservercontrol+xml": { + "source": "iana", + "extensions": ["mscml"] + }, + "application/merge-patch+json": { + "source": "iana", + "compressible": true + }, + "application/metalink+xml": { + "source": "apache", + "extensions": ["metalink"] + }, + "application/metalink4+xml": { + "source": "iana", + "extensions": ["meta4"] + }, + "application/mets+xml": { + "source": "iana", + "extensions": ["mets"] + }, + "application/mf4": { + "source": "iana" + }, + "application/mikey": { + "source": "iana" + }, + "application/mods+xml": { + "source": "iana", + "extensions": ["mods"] + }, + "application/moss-keys": { + "source": "iana" + }, + "application/moss-signature": { + "source": "iana" + }, + "application/mosskey-data": { + "source": "iana" + }, + "application/mosskey-request": { + "source": "iana" + }, + "application/mp21": { + "source": "iana", + "extensions": ["m21","mp21"] + }, + "application/mp4": { + "source": "iana", + "extensions": ["mp4s","m4p"] + }, + "application/mpeg4-generic": { + "source": "iana" + }, + "application/mpeg4-iod": { + "source": "iana" + }, + "application/mpeg4-iod-xmt": { + "source": "iana" + }, + "application/mrb-consumer+xml": { + "source": "iana" + }, + "application/mrb-publish+xml": { + "source": "iana" + }, + "application/msc-ivr+xml": { + "source": "iana" + }, + "application/msc-mixer+xml": { + "source": "iana" + }, + "application/msword": { + "source": "iana", + "compressible": false, + "extensions": ["doc","dot"] + }, + "application/mud+json": { + "source": "iana", + "compressible": true + }, + "application/mxf": { + "source": "iana", + "extensions": ["mxf"] + }, + "application/nasdata": { + "source": "iana" + }, + "application/news-checkgroups": { + "source": "iana" + }, + "application/news-groupinfo": { + "source": "iana" + }, + "application/news-transmission": { + "source": "iana" + }, + "application/nlsml+xml": { + "source": "iana" + }, + "application/nss": { + "source": "iana" + }, + "application/ocsp-request": { + "source": "iana" + }, + "application/ocsp-response": { + "source": "iana" + }, + "application/octet-stream": { + "source": "iana", + "compressible": false, + "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"] + }, + "application/oda": { + "source": "iana", + "extensions": ["oda"] + }, + "application/odx": { + "source": "iana" + }, + "application/oebps-package+xml": { + "source": "iana", + "extensions": ["opf"] + }, + "application/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogx"] + }, + "application/omdoc+xml": { + "source": "apache", + "extensions": ["omdoc"] + }, + "application/onenote": { + "source": "apache", + "extensions": ["onetoc","onetoc2","onetmp","onepkg"] + }, + "application/oxps": { + "source": "iana", + "extensions": ["oxps"] + }, + "application/p2p-overlay+xml": { + "source": "iana" + }, + "application/parityfec": { + "source": "iana" + }, + "application/patch-ops-error+xml": { + "source": "iana", + "extensions": ["xer"] + }, + "application/pdf": { + "source": "iana", + "compressible": false, + "extensions": ["pdf"] + }, + "application/pdx": { + "source": "iana" + }, + "application/pgp-encrypted": { + "source": "iana", + "compressible": false, + "extensions": ["pgp"] + }, + "application/pgp-keys": { + "source": "iana" + }, + "application/pgp-signature": { + "source": "iana", + "extensions": ["asc","sig"] + }, + "application/pics-rules": { + "source": "apache", + "extensions": ["prf"] + }, + "application/pidf+xml": { + "source": "iana" + }, + "application/pidf-diff+xml": { + "source": "iana" + }, + "application/pkcs10": { + "source": "iana", + "extensions": ["p10"] + }, + "application/pkcs12": { + "source": "iana" + }, + "application/pkcs7-mime": { + "source": "iana", + "extensions": ["p7m","p7c"] + }, + "application/pkcs7-signature": { + "source": "iana", + "extensions": ["p7s"] + }, + "application/pkcs8": { + "source": "iana", + "extensions": ["p8"] + }, + "application/pkix-attr-cert": { + "source": "iana", + "extensions": ["ac"] + }, + "application/pkix-cert": { + "source": "iana", + "extensions": ["cer"] + }, + "application/pkix-crl": { + "source": "iana", + "extensions": ["crl"] + }, + "application/pkix-pkipath": { + "source": "iana", + "extensions": ["pkipath"] + }, + "application/pkixcmp": { + "source": "iana", + "extensions": ["pki"] + }, + "application/pls+xml": { + "source": "iana", + "extensions": ["pls"] + }, + "application/poc-settings+xml": { + "source": "iana" + }, + "application/postscript": { + "source": "iana", + "compressible": true, + "extensions": ["ai","eps","ps"] + }, + "application/ppsp-tracker+json": { + "source": "iana", + "compressible": true + }, + "application/problem+json": { + "source": "iana", + "compressible": true + }, + "application/problem+xml": { + "source": "iana" + }, + "application/provenance+xml": { + "source": "iana" + }, + "application/prs.alvestrand.titrax-sheet": { + "source": "iana" + }, + "application/prs.cww": { + "source": "iana", + "extensions": ["cww"] + }, + "application/prs.hpub+zip": { + "source": "iana" + }, + "application/prs.nprend": { + "source": "iana" + }, + "application/prs.plucker": { + "source": "iana" + }, + "application/prs.rdf-xml-crypt": { + "source": "iana" + }, + "application/prs.xsf+xml": { + "source": "iana" + }, + "application/pskc+xml": { + "source": "iana", + "extensions": ["pskcxml"] + }, + "application/qsig": { + "source": "iana" + }, + "application/raptorfec": { + "source": "iana" + }, + "application/rdap+json": { + "source": "iana", + "compressible": true + }, + "application/rdf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rdf"] + }, + "application/reginfo+xml": { + "source": "iana", + "extensions": ["rif"] + }, + "application/relax-ng-compact-syntax": { + "source": "iana", + "extensions": ["rnc"] + }, + "application/remote-printing": { + "source": "iana" + }, + "application/reputon+json": { + "source": "iana", + "compressible": true + }, + "application/resource-lists+xml": { + "source": "iana", + "extensions": ["rl"] + }, + "application/resource-lists-diff+xml": { + "source": "iana", + "extensions": ["rld"] + }, + "application/rfc+xml": { + "source": "iana" + }, + "application/riscos": { + "source": "iana" + }, + "application/rlmi+xml": { + "source": "iana" + }, + "application/rls-services+xml": { + "source": "iana", + "extensions": ["rs"] + }, + "application/rpki-ghostbusters": { + "source": "iana", + "extensions": ["gbr"] + }, + "application/rpki-manifest": { + "source": "iana", + "extensions": ["mft"] + }, + "application/rpki-roa": { + "source": "iana", + "extensions": ["roa"] + }, + "application/rpki-updown": { + "source": "iana" + }, + "application/rsd+xml": { + "source": "apache", + "extensions": ["rsd"] + }, + "application/rss+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rss"] + }, + "application/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "application/rtploopback": { + "source": "iana" + }, + "application/rtx": { + "source": "iana" + }, + "application/samlassertion+xml": { + "source": "iana" + }, + "application/samlmetadata+xml": { + "source": "iana" + }, + "application/sbml+xml": { + "source": "iana", + "extensions": ["sbml"] + }, + "application/scaip+xml": { + "source": "iana" + }, + "application/scim+json": { + "source": "iana", + "compressible": true + }, + "application/scvp-cv-request": { + "source": "iana", + "extensions": ["scq"] + }, + "application/scvp-cv-response": { + "source": "iana", + "extensions": ["scs"] + }, + "application/scvp-vp-request": { + "source": "iana", + "extensions": ["spq"] + }, + "application/scvp-vp-response": { + "source": "iana", + "extensions": ["spp"] + }, + "application/sdp": { + "source": "iana", + "extensions": ["sdp"] + }, + "application/sep+xml": { + "source": "iana" + }, + "application/sep-exi": { + "source": "iana" + }, + "application/session-info": { + "source": "iana" + }, + "application/set-payment": { + "source": "iana" + }, + "application/set-payment-initiation": { + "source": "iana", + "extensions": ["setpay"] + }, + "application/set-registration": { + "source": "iana" + }, + "application/set-registration-initiation": { + "source": "iana", + "extensions": ["setreg"] + }, + "application/sgml": { + "source": "iana" + }, + "application/sgml-open-catalog": { + "source": "iana" + }, + "application/shf+xml": { + "source": "iana", + "extensions": ["shf"] + }, + "application/sieve": { + "source": "iana" + }, + "application/simple-filter+xml": { + "source": "iana" + }, + "application/simple-message-summary": { + "source": "iana" + }, + "application/simplesymbolcontainer": { + "source": "iana" + }, + "application/slate": { + "source": "iana" + }, + "application/smil": { + "source": "iana" + }, + "application/smil+xml": { + "source": "iana", + "extensions": ["smi","smil"] + }, + "application/smpte336m": { + "source": "iana" + }, + "application/soap+fastinfoset": { + "source": "iana" + }, + "application/soap+xml": { + "source": "iana", + "compressible": true + }, + "application/sparql-query": { + "source": "iana", + "extensions": ["rq"] + }, + "application/sparql-results+xml": { + "source": "iana", + "extensions": ["srx"] + }, + "application/spirits-event+xml": { + "source": "iana" + }, + "application/sql": { + "source": "iana" + }, + "application/srgs": { + "source": "iana", + "extensions": ["gram"] + }, + "application/srgs+xml": { + "source": "iana", + "extensions": ["grxml"] + }, + "application/sru+xml": { + "source": "iana", + "extensions": ["sru"] + }, + "application/ssdl+xml": { + "source": "apache", + "extensions": ["ssdl"] + }, + "application/ssml+xml": { + "source": "iana", + "extensions": ["ssml"] + }, + "application/tamp-apex-update": { + "source": "iana" + }, + "application/tamp-apex-update-confirm": { + "source": "iana" + }, + "application/tamp-community-update": { + "source": "iana" + }, + "application/tamp-community-update-confirm": { + "source": "iana" + }, + "application/tamp-error": { + "source": "iana" + }, + "application/tamp-sequence-adjust": { + "source": "iana" + }, + "application/tamp-sequence-adjust-confirm": { + "source": "iana" + }, + "application/tamp-status-query": { + "source": "iana" + }, + "application/tamp-status-response": { + "source": "iana" + }, + "application/tamp-update": { + "source": "iana" + }, + "application/tamp-update-confirm": { + "source": "iana" + }, + "application/tar": { + "compressible": true + }, + "application/tei+xml": { + "source": "iana", + "extensions": ["tei","teicorpus"] + }, + "application/thraud+xml": { + "source": "iana", + "extensions": ["tfi"] + }, + "application/timestamp-query": { + "source": "iana" + }, + "application/timestamp-reply": { + "source": "iana" + }, + "application/timestamped-data": { + "source": "iana", + "extensions": ["tsd"] + }, + "application/trig": { + "source": "iana" + }, + "application/ttml+xml": { + "source": "iana" + }, + "application/tve-trigger": { + "source": "iana" + }, + "application/ulpfec": { + "source": "iana" + }, + "application/urc-grpsheet+xml": { + "source": "iana" + }, + "application/urc-ressheet+xml": { + "source": "iana" + }, + "application/urc-targetdesc+xml": { + "source": "iana" + }, + "application/urc-uisocketdesc+xml": { + "source": "iana" + }, + "application/vcard+json": { + "source": "iana", + "compressible": true + }, + "application/vcard+xml": { + "source": "iana" + }, + "application/vemmi": { + "source": "iana" + }, + "application/vividence.scriptfile": { + "source": "apache" + }, + "application/vnd.3gpp-prose+xml": { + "source": "iana" + }, + "application/vnd.3gpp-prose-pc3ch+xml": { + "source": "iana" + }, + "application/vnd.3gpp.access-transfer-events+xml": { + "source": "iana" + }, + "application/vnd.3gpp.bsf+xml": { + "source": "iana" + }, + "application/vnd.3gpp.mid-call+xml": { + "source": "iana" + }, + "application/vnd.3gpp.pic-bw-large": { + "source": "iana", + "extensions": ["plb"] + }, + "application/vnd.3gpp.pic-bw-small": { + "source": "iana", + "extensions": ["psb"] + }, + "application/vnd.3gpp.pic-bw-var": { + "source": "iana", + "extensions": ["pvb"] + }, + "application/vnd.3gpp.sms": { + "source": "iana" + }, + "application/vnd.3gpp.sms+xml": { + "source": "iana" + }, + "application/vnd.3gpp.srvcc-ext+xml": { + "source": "iana" + }, + "application/vnd.3gpp.srvcc-info+xml": { + "source": "iana" + }, + "application/vnd.3gpp.state-and-event-info+xml": { + "source": "iana" + }, + "application/vnd.3gpp.ussd+xml": { + "source": "iana" + }, + "application/vnd.3gpp2.bcmcsinfo+xml": { + "source": "iana" + }, + "application/vnd.3gpp2.sms": { + "source": "iana" + }, + "application/vnd.3gpp2.tcap": { + "source": "iana", + "extensions": ["tcap"] + }, + "application/vnd.3lightssoftware.imagescal": { + "source": "iana" + }, + "application/vnd.3m.post-it-notes": { + "source": "iana", + "extensions": ["pwn"] + }, + "application/vnd.accpac.simply.aso": { + "source": "iana", + "extensions": ["aso"] + }, + "application/vnd.accpac.simply.imp": { + "source": "iana", + "extensions": ["imp"] + }, + "application/vnd.acucobol": { + "source": "iana", + "extensions": ["acu"] + }, + "application/vnd.acucorp": { + "source": "iana", + "extensions": ["atc","acutc"] + }, + "application/vnd.adobe.air-application-installer-package+zip": { + "source": "apache", + "extensions": ["air"] + }, + "application/vnd.adobe.flash.movie": { + "source": "iana" + }, + "application/vnd.adobe.formscentral.fcdt": { + "source": "iana", + "extensions": ["fcdt"] + }, + "application/vnd.adobe.fxp": { + "source": "iana", + "extensions": ["fxp","fxpl"] + }, + "application/vnd.adobe.partial-upload": { + "source": "iana" + }, + "application/vnd.adobe.xdp+xml": { + "source": "iana", + "extensions": ["xdp"] + }, + "application/vnd.adobe.xfdf": { + "source": "iana", + "extensions": ["xfdf"] + }, + "application/vnd.aether.imp": { + "source": "iana" + }, + "application/vnd.ah-barcode": { + "source": "iana" + }, + "application/vnd.ahead.space": { + "source": "iana", + "extensions": ["ahead"] + }, + "application/vnd.airzip.filesecure.azf": { + "source": "iana", + "extensions": ["azf"] + }, + "application/vnd.airzip.filesecure.azs": { + "source": "iana", + "extensions": ["azs"] + }, + "application/vnd.amazon.ebook": { + "source": "apache", + "extensions": ["azw"] + }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, + "application/vnd.americandynamics.acc": { + "source": "iana", + "extensions": ["acc"] + }, + "application/vnd.amiga.ami": { + "source": "iana", + "extensions": ["ami"] + }, + "application/vnd.amundsen.maze+xml": { + "source": "iana" + }, + "application/vnd.android.package-archive": { + "source": "apache", + "compressible": false, + "extensions": ["apk"] + }, + "application/vnd.anki": { + "source": "iana" + }, + "application/vnd.anser-web-certificate-issue-initiation": { + "source": "iana", + "extensions": ["cii"] + }, + "application/vnd.anser-web-funds-transfer-initiation": { + "source": "apache", + "extensions": ["fti"] + }, + "application/vnd.antix.game-component": { + "source": "iana", + "extensions": ["atx"] + }, + "application/vnd.apache.thrift.binary": { + "source": "iana" + }, + "application/vnd.apache.thrift.compact": { + "source": "iana" + }, + "application/vnd.apache.thrift.json": { + "source": "iana" + }, + "application/vnd.api+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apple.installer+xml": { + "source": "iana", + "extensions": ["mpkg"] + }, + "application/vnd.apple.mpegurl": { + "source": "iana", + "extensions": ["m3u8"] + }, + "application/vnd.apple.pkpass": { + "compressible": false, + "extensions": ["pkpass"] + }, + "application/vnd.arastra.swi": { + "source": "iana" + }, + "application/vnd.aristanetworks.swi": { + "source": "iana", + "extensions": ["swi"] + }, + "application/vnd.artsquare": { + "source": "iana" + }, + "application/vnd.astraea-software.iota": { + "source": "iana", + "extensions": ["iota"] + }, + "application/vnd.audiograph": { + "source": "iana", + "extensions": ["aep"] + }, + "application/vnd.autopackage": { + "source": "iana" + }, + "application/vnd.avistar+xml": { + "source": "iana" + }, + "application/vnd.balsamiq.bmml+xml": { + "source": "iana" + }, + "application/vnd.balsamiq.bmpr": { + "source": "iana" + }, + "application/vnd.bekitzur-stech+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.biopax.rdf+xml": { + "source": "iana" + }, + "application/vnd.blueice.multipass": { + "source": "iana", + "extensions": ["mpm"] + }, + "application/vnd.bluetooth.ep.oob": { + "source": "iana" + }, + "application/vnd.bluetooth.le.oob": { + "source": "iana" + }, + "application/vnd.bmi": { + "source": "iana", + "extensions": ["bmi"] + }, + "application/vnd.businessobjects": { + "source": "iana", + "extensions": ["rep"] + }, + "application/vnd.cab-jscript": { + "source": "iana" + }, + "application/vnd.canon-cpdl": { + "source": "iana" + }, + "application/vnd.canon-lips": { + "source": "iana" + }, + "application/vnd.cendio.thinlinc.clientconf": { + "source": "iana" + }, + "application/vnd.century-systems.tcp_stream": { + "source": "iana" + }, + "application/vnd.chemdraw+xml": { + "source": "iana", + "extensions": ["cdxml"] + }, + "application/vnd.chess-pgn": { + "source": "iana" + }, + "application/vnd.chipnuts.karaoke-mmd": { + "source": "iana", + "extensions": ["mmd"] + }, + "application/vnd.cinderella": { + "source": "iana", + "extensions": ["cdy"] + }, + "application/vnd.cirpack.isdn-ext": { + "source": "iana" + }, + "application/vnd.citationstyles.style+xml": { + "source": "iana" + }, + "application/vnd.claymore": { + "source": "iana", + "extensions": ["cla"] + }, + "application/vnd.cloanto.rp9": { + "source": "iana", + "extensions": ["rp9"] + }, + "application/vnd.clonk.c4group": { + "source": "iana", + "extensions": ["c4g","c4d","c4f","c4p","c4u"] + }, + "application/vnd.cluetrust.cartomobile-config": { + "source": "iana", + "extensions": ["c11amc"] + }, + "application/vnd.cluetrust.cartomobile-config-pkg": { + "source": "iana", + "extensions": ["c11amz"] + }, + "application/vnd.coffeescript": { + "source": "iana" + }, + "application/vnd.collection+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.doc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.next+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.comicbook+zip": { + "source": "iana" + }, + "application/vnd.commerce-battelle": { + "source": "iana" + }, + "application/vnd.commonspace": { + "source": "iana", + "extensions": ["csp"] + }, + "application/vnd.contact.cmsg": { + "source": "iana", + "extensions": ["cdbcmsg"] + }, + "application/vnd.coreos.ignition+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cosmocaller": { + "source": "iana", + "extensions": ["cmc"] + }, + "application/vnd.crick.clicker": { + "source": "iana", + "extensions": ["clkx"] + }, + "application/vnd.crick.clicker.keyboard": { + "source": "iana", + "extensions": ["clkk"] + }, + "application/vnd.crick.clicker.palette": { + "source": "iana", + "extensions": ["clkp"] + }, + "application/vnd.crick.clicker.template": { + "source": "iana", + "extensions": ["clkt"] + }, + "application/vnd.crick.clicker.wordbank": { + "source": "iana", + "extensions": ["clkw"] + }, + "application/vnd.criticaltools.wbs+xml": { + "source": "iana", + "extensions": ["wbs"] + }, + "application/vnd.ctc-posml": { + "source": "iana", + "extensions": ["pml"] + }, + "application/vnd.ctct.ws+xml": { + "source": "iana" + }, + "application/vnd.cups-pdf": { + "source": "iana" + }, + "application/vnd.cups-postscript": { + "source": "iana" + }, + "application/vnd.cups-ppd": { + "source": "iana", + "extensions": ["ppd"] + }, + "application/vnd.cups-raster": { + "source": "iana" + }, + "application/vnd.cups-raw": { + "source": "iana" + }, + "application/vnd.curl": { + "source": "iana" + }, + "application/vnd.curl.car": { + "source": "apache", + "extensions": ["car"] + }, + "application/vnd.curl.pcurl": { + "source": "apache", + "extensions": ["pcurl"] + }, + "application/vnd.cyan.dean.root+xml": { + "source": "iana" + }, + "application/vnd.cybank": { + "source": "iana" + }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana" + }, + "application/vnd.dart": { + "source": "iana", + "compressible": true, + "extensions": ["dart"] + }, + "application/vnd.data-vision.rdz": { + "source": "iana", + "extensions": ["rdz"] + }, + "application/vnd.dataresource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.debian.binary-package": { + "source": "iana" + }, + "application/vnd.dece.data": { + "source": "iana", + "extensions": ["uvf","uvvf","uvd","uvvd"] + }, + "application/vnd.dece.ttml+xml": { + "source": "iana", + "extensions": ["uvt","uvvt"] + }, + "application/vnd.dece.unspecified": { + "source": "iana", + "extensions": ["uvx","uvvx"] + }, + "application/vnd.dece.zip": { + "source": "iana", + "extensions": ["uvz","uvvz"] + }, + "application/vnd.denovo.fcselayout-link": { + "source": "iana", + "extensions": ["fe_launch"] + }, + "application/vnd.desmume-movie": { + "source": "iana" + }, + "application/vnd.desmume.movie": { + "source": "apache" + }, + "application/vnd.dir-bi.plate-dl-nosuffix": { + "source": "iana" + }, + "application/vnd.dm.delegation+xml": { + "source": "iana" + }, + "application/vnd.dna": { + "source": "iana", + "extensions": ["dna"] + }, + "application/vnd.document+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dolby.mlp": { + "source": "apache", + "extensions": ["mlp"] + }, + "application/vnd.dolby.mobile.1": { + "source": "iana" + }, + "application/vnd.dolby.mobile.2": { + "source": "iana" + }, + "application/vnd.doremir.scorecloud-binary-document": { + "source": "iana" + }, + "application/vnd.dpgraph": { + "source": "iana", + "extensions": ["dpg"] + }, + "application/vnd.dreamfactory": { + "source": "iana", + "extensions": ["dfac"] + }, + "application/vnd.drive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ds-keypoint": { + "source": "apache", + "extensions": ["kpxx"] + }, + "application/vnd.dtg.local": { + "source": "iana" + }, + "application/vnd.dtg.local.flash": { + "source": "iana" + }, + "application/vnd.dtg.local.html": { + "source": "iana" + }, + "application/vnd.dvb.ait": { + "source": "iana", + "extensions": ["ait"] + }, + "application/vnd.dvb.dvbj": { + "source": "iana" + }, + "application/vnd.dvb.esgcontainer": { + "source": "iana" + }, + "application/vnd.dvb.ipdcdftnotifaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess2": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgpdd": { + "source": "iana" + }, + "application/vnd.dvb.ipdcroaming": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-base": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-enhancement": { + "source": "iana" + }, + "application/vnd.dvb.notif-aggregate-root+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-container+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-generic+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-ia-msglist+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-ia-registration-request+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-ia-registration-response+xml": { + "source": "iana" + }, + "application/vnd.dvb.notif-init+xml": { + "source": "iana" + }, + "application/vnd.dvb.pfr": { + "source": "iana" + }, + "application/vnd.dvb.service": { + "source": "iana", + "extensions": ["svc"] + }, + "application/vnd.dxr": { + "source": "iana" + }, + "application/vnd.dynageo": { + "source": "iana", + "extensions": ["geo"] + }, + "application/vnd.dzr": { + "source": "iana" + }, + "application/vnd.easykaraoke.cdgdownload": { + "source": "iana" + }, + "application/vnd.ecdis-update": { + "source": "iana" + }, + "application/vnd.ecowin.chart": { + "source": "iana", + "extensions": ["mag"] + }, + "application/vnd.ecowin.filerequest": { + "source": "iana" + }, + "application/vnd.ecowin.fileupdate": { + "source": "iana" + }, + "application/vnd.ecowin.series": { + "source": "iana" + }, + "application/vnd.ecowin.seriesrequest": { + "source": "iana" + }, + "application/vnd.ecowin.seriesupdate": { + "source": "iana" + }, + "application/vnd.emclient.accessrequest+xml": { + "source": "iana" + }, + "application/vnd.enliven": { + "source": "iana", + "extensions": ["nml"] + }, + "application/vnd.enphase.envoy": { + "source": "iana" + }, + "application/vnd.eprints.data+xml": { + "source": "iana" + }, + "application/vnd.epson.esf": { + "source": "iana", + "extensions": ["esf"] + }, + "application/vnd.epson.msf": { + "source": "iana", + "extensions": ["msf"] + }, + "application/vnd.epson.quickanime": { + "source": "iana", + "extensions": ["qam"] + }, + "application/vnd.epson.salt": { + "source": "iana", + "extensions": ["slt"] + }, + "application/vnd.epson.ssf": { + "source": "iana", + "extensions": ["ssf"] + }, + "application/vnd.ericsson.quickcall": { + "source": "iana" + }, + "application/vnd.espass-espass+zip": { + "source": "iana" + }, + "application/vnd.eszigno3+xml": { + "source": "iana", + "extensions": ["es3","et3"] + }, + "application/vnd.etsi.aoc+xml": { + "source": "iana" + }, + "application/vnd.etsi.asic-e+zip": { + "source": "iana" + }, + "application/vnd.etsi.asic-s+zip": { + "source": "iana" + }, + "application/vnd.etsi.cug+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvcommand+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvdiscovery+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvprofile+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsad-bc+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsad-cod+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsad-npvr+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvservice+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvsync+xml": { + "source": "iana" + }, + "application/vnd.etsi.iptvueprofile+xml": { + "source": "iana" + }, + "application/vnd.etsi.mcid+xml": { + "source": "iana" + }, + "application/vnd.etsi.mheg5": { + "source": "iana" + }, + "application/vnd.etsi.overload-control-policy-dataset+xml": { + "source": "iana" + }, + "application/vnd.etsi.pstn+xml": { + "source": "iana" + }, + "application/vnd.etsi.sci+xml": { + "source": "iana" + }, + "application/vnd.etsi.simservs+xml": { + "source": "iana" + }, + "application/vnd.etsi.timestamp-token": { + "source": "iana" + }, + "application/vnd.etsi.tsl+xml": { + "source": "iana" + }, + "application/vnd.etsi.tsl.der": { + "source": "iana" + }, + "application/vnd.eudora.data": { + "source": "iana" + }, + "application/vnd.ezpix-album": { + "source": "iana", + "extensions": ["ez2"] + }, + "application/vnd.ezpix-package": { + "source": "iana", + "extensions": ["ez3"] + }, + "application/vnd.f-secure.mobile": { + "source": "iana" + }, + "application/vnd.fastcopy-disk-image": { + "source": "iana" + }, + "application/vnd.fdf": { + "source": "iana", + "extensions": ["fdf"] + }, + "application/vnd.fdsn.mseed": { + "source": "iana", + "extensions": ["mseed"] + }, + "application/vnd.fdsn.seed": { + "source": "iana", + "extensions": ["seed","dataless"] + }, + "application/vnd.ffsns": { + "source": "iana" + }, + "application/vnd.filmit.zfc": { + "source": "iana" + }, + "application/vnd.fints": { + "source": "iana" + }, + "application/vnd.firemonkeys.cloudcell": { + "source": "iana" + }, + "application/vnd.flographit": { + "source": "iana", + "extensions": ["gph"] + }, + "application/vnd.fluxtime.clip": { + "source": "iana", + "extensions": ["ftc"] + }, + "application/vnd.font-fontforge-sfd": { + "source": "iana" + }, + "application/vnd.framemaker": { + "source": "iana", + "extensions": ["fm","frame","maker","book"] + }, + "application/vnd.frogans.fnc": { + "source": "iana", + "extensions": ["fnc"] + }, + "application/vnd.frogans.ltf": { + "source": "iana", + "extensions": ["ltf"] + }, + "application/vnd.fsc.weblaunch": { + "source": "iana", + "extensions": ["fsc"] + }, + "application/vnd.fujitsu.oasys": { + "source": "iana", + "extensions": ["oas"] + }, + "application/vnd.fujitsu.oasys2": { + "source": "iana", + "extensions": ["oa2"] + }, + "application/vnd.fujitsu.oasys3": { + "source": "iana", + "extensions": ["oa3"] + }, + "application/vnd.fujitsu.oasysgp": { + "source": "iana", + "extensions": ["fg5"] + }, + "application/vnd.fujitsu.oasysprs": { + "source": "iana", + "extensions": ["bh2"] + }, + "application/vnd.fujixerox.art-ex": { + "source": "iana" + }, + "application/vnd.fujixerox.art4": { + "source": "iana" + }, + "application/vnd.fujixerox.ddd": { + "source": "iana", + "extensions": ["ddd"] + }, + "application/vnd.fujixerox.docuworks": { + "source": "iana", + "extensions": ["xdw"] + }, + "application/vnd.fujixerox.docuworks.binder": { + "source": "iana", + "extensions": ["xbd"] + }, + "application/vnd.fujixerox.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujixerox.hbpl": { + "source": "iana" + }, + "application/vnd.fut-misnet": { + "source": "iana" + }, + "application/vnd.fuzzysheet": { + "source": "iana", + "extensions": ["fzs"] + }, + "application/vnd.genomatix.tuxedo": { + "source": "iana", + "extensions": ["txd"] + }, + "application/vnd.geo+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.geocube+xml": { + "source": "iana" + }, + "application/vnd.geogebra.file": { + "source": "iana", + "extensions": ["ggb"] + }, + "application/vnd.geogebra.tool": { + "source": "iana", + "extensions": ["ggt"] + }, + "application/vnd.geometry-explorer": { + "source": "iana", + "extensions": ["gex","gre"] + }, + "application/vnd.geonext": { + "source": "iana", + "extensions": ["gxt"] + }, + "application/vnd.geoplan": { + "source": "iana", + "extensions": ["g2w"] + }, + "application/vnd.geospace": { + "source": "iana", + "extensions": ["g3w"] + }, + "application/vnd.gerber": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt-response": { + "source": "iana" + }, + "application/vnd.gmx": { + "source": "iana", + "extensions": ["gmx"] + }, + "application/vnd.google-apps.document": { + "compressible": false, + "extensions": ["gdoc"] + }, + "application/vnd.google-apps.presentation": { + "compressible": false, + "extensions": ["gslides"] + }, + "application/vnd.google-apps.spreadsheet": { + "compressible": false, + "extensions": ["gsheet"] + }, + "application/vnd.google-earth.kml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["kml"] + }, + "application/vnd.google-earth.kmz": { + "source": "iana", + "compressible": false, + "extensions": ["kmz"] + }, + "application/vnd.gov.sk.e-form+xml": { + "source": "iana" + }, + "application/vnd.gov.sk.e-form+zip": { + "source": "iana" + }, + "application/vnd.gov.sk.xmldatacontainer+xml": { + "source": "iana" + }, + "application/vnd.grafeq": { + "source": "iana", + "extensions": ["gqf","gqs"] + }, + "application/vnd.gridmp": { + "source": "iana" + }, + "application/vnd.groove-account": { + "source": "iana", + "extensions": ["gac"] + }, + "application/vnd.groove-help": { + "source": "iana", + "extensions": ["ghf"] + }, + "application/vnd.groove-identity-message": { + "source": "iana", + "extensions": ["gim"] + }, + "application/vnd.groove-injector": { + "source": "iana", + "extensions": ["grv"] + }, + "application/vnd.groove-tool-message": { + "source": "iana", + "extensions": ["gtm"] + }, + "application/vnd.groove-tool-template": { + "source": "iana", + "extensions": ["tpl"] + }, + "application/vnd.groove-vcard": { + "source": "iana", + "extensions": ["vcg"] + }, + "application/vnd.hal+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hal+xml": { + "source": "iana", + "extensions": ["hal"] + }, + "application/vnd.handheld-entertainment+xml": { + "source": "iana", + "extensions": ["zmm"] + }, + "application/vnd.hbci": { + "source": "iana", + "extensions": ["hbci"] + }, + "application/vnd.hc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hcl-bireports": { + "source": "iana" + }, + "application/vnd.hdt": { + "source": "iana" + }, + "application/vnd.heroku+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hhe.lesson-player": { + "source": "iana", + "extensions": ["les"] + }, + "application/vnd.hp-hpgl": { + "source": "iana", + "extensions": ["hpgl"] + }, + "application/vnd.hp-hpid": { + "source": "iana", + "extensions": ["hpid"] + }, + "application/vnd.hp-hps": { + "source": "iana", + "extensions": ["hps"] + }, + "application/vnd.hp-jlyt": { + "source": "iana", + "extensions": ["jlt"] + }, + "application/vnd.hp-pcl": { + "source": "iana", + "extensions": ["pcl"] + }, + "application/vnd.hp-pclxl": { + "source": "iana", + "extensions": ["pclxl"] + }, + "application/vnd.httphone": { + "source": "iana" + }, + "application/vnd.hydrostatix.sof-data": { + "source": "iana", + "extensions": ["sfd-hdstx"] + }, + "application/vnd.hyperdrive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hzn-3d-crossword": { + "source": "iana" + }, + "application/vnd.ibm.afplinedata": { + "source": "iana" + }, + "application/vnd.ibm.electronic-media": { + "source": "iana" + }, + "application/vnd.ibm.minipay": { + "source": "iana", + "extensions": ["mpy"] + }, + "application/vnd.ibm.modcap": { + "source": "iana", + "extensions": ["afp","listafp","list3820"] + }, + "application/vnd.ibm.rights-management": { + "source": "iana", + "extensions": ["irm"] + }, + "application/vnd.ibm.secure-container": { + "source": "iana", + "extensions": ["sc"] + }, + "application/vnd.iccprofile": { + "source": "iana", + "extensions": ["icc","icm"] + }, + "application/vnd.ieee.1905": { + "source": "iana" + }, + "application/vnd.igloader": { + "source": "iana", + "extensions": ["igl"] + }, + "application/vnd.immervision-ivp": { + "source": "iana", + "extensions": ["ivp"] + }, + "application/vnd.immervision-ivu": { + "source": "iana", + "extensions": ["ivu"] + }, + "application/vnd.ims.imsccv1p1": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p2": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p3": { + "source": "iana" + }, + "application/vnd.ims.lis.v2.result+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolconsumerprofile+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy.id+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings.simple+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.informedcontrol.rms+xml": { + "source": "iana" + }, + "application/vnd.informix-visionary": { + "source": "iana" + }, + "application/vnd.infotech.project": { + "source": "iana" + }, + "application/vnd.infotech.project+xml": { + "source": "iana" + }, + "application/vnd.innopath.wamp.notification": { + "source": "iana" + }, + "application/vnd.insors.igm": { + "source": "iana", + "extensions": ["igm"] + }, + "application/vnd.intercon.formnet": { + "source": "iana", + "extensions": ["xpw","xpx"] + }, + "application/vnd.intergeo": { + "source": "iana", + "extensions": ["i2g"] + }, + "application/vnd.intertrust.digibox": { + "source": "iana" + }, + "application/vnd.intertrust.nncp": { + "source": "iana" + }, + "application/vnd.intu.qbo": { + "source": "iana", + "extensions": ["qbo"] + }, + "application/vnd.intu.qfx": { + "source": "iana", + "extensions": ["qfx"] + }, + "application/vnd.iptc.g2.catalogitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.conceptitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.knowledgeitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.newsitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.newsmessage+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.packageitem+xml": { + "source": "iana" + }, + "application/vnd.iptc.g2.planningitem+xml": { + "source": "iana" + }, + "application/vnd.ipunplugged.rcprofile": { + "source": "iana", + "extensions": ["rcprofile"] + }, + "application/vnd.irepository.package+xml": { + "source": "iana", + "extensions": ["irp"] + }, + "application/vnd.is-xpr": { + "source": "iana", + "extensions": ["xpr"] + }, + "application/vnd.isac.fcs": { + "source": "iana", + "extensions": ["fcs"] + }, + "application/vnd.jam": { + "source": "iana", + "extensions": ["jam"] + }, + "application/vnd.japannet-directory-service": { + "source": "iana" + }, + "application/vnd.japannet-jpnstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-payment-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-registration": { + "source": "iana" + }, + "application/vnd.japannet-registration-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-setstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-verification": { + "source": "iana" + }, + "application/vnd.japannet-verification-wakeup": { + "source": "iana" + }, + "application/vnd.jcp.javame.midlet-rms": { + "source": "iana", + "extensions": ["rms"] + }, + "application/vnd.jisp": { + "source": "iana", + "extensions": ["jisp"] + }, + "application/vnd.joost.joda-archive": { + "source": "iana", + "extensions": ["joda"] + }, + "application/vnd.jsk.isdn-ngn": { + "source": "iana" + }, + "application/vnd.kahootz": { + "source": "iana", + "extensions": ["ktz","ktr"] + }, + "application/vnd.kde.karbon": { + "source": "iana", + "extensions": ["karbon"] + }, + "application/vnd.kde.kchart": { + "source": "iana", + "extensions": ["chrt"] + }, + "application/vnd.kde.kformula": { + "source": "iana", + "extensions": ["kfo"] + }, + "application/vnd.kde.kivio": { + "source": "iana", + "extensions": ["flw"] + }, + "application/vnd.kde.kontour": { + "source": "iana", + "extensions": ["kon"] + }, + "application/vnd.kde.kpresenter": { + "source": "iana", + "extensions": ["kpr","kpt"] + }, + "application/vnd.kde.kspread": { + "source": "iana", + "extensions": ["ksp"] + }, + "application/vnd.kde.kword": { + "source": "iana", + "extensions": ["kwd","kwt"] + }, + "application/vnd.kenameaapp": { + "source": "iana", + "extensions": ["htke"] + }, + "application/vnd.kidspiration": { + "source": "iana", + "extensions": ["kia"] + }, + "application/vnd.kinar": { + "source": "iana", + "extensions": ["kne","knp"] + }, + "application/vnd.koan": { + "source": "iana", + "extensions": ["skp","skd","skt","skm"] + }, + "application/vnd.kodak-descriptor": { + "source": "iana", + "extensions": ["sse"] + }, + "application/vnd.las.las+xml": { + "source": "iana", + "extensions": ["lasxml"] + }, + "application/vnd.liberty-request+xml": { + "source": "iana" + }, + "application/vnd.llamagraphics.life-balance.desktop": { + "source": "iana", + "extensions": ["lbd"] + }, + "application/vnd.llamagraphics.life-balance.exchange+xml": { + "source": "iana", + "extensions": ["lbe"] + }, + "application/vnd.lotus-1-2-3": { + "source": "iana", + "extensions": ["123"] + }, + "application/vnd.lotus-approach": { + "source": "iana", + "extensions": ["apr"] + }, + "application/vnd.lotus-freelance": { + "source": "iana", + "extensions": ["pre"] + }, + "application/vnd.lotus-notes": { + "source": "iana", + "extensions": ["nsf"] + }, + "application/vnd.lotus-organizer": { + "source": "iana", + "extensions": ["org"] + }, + "application/vnd.lotus-screencam": { + "source": "iana", + "extensions": ["scm"] + }, + "application/vnd.lotus-wordpro": { + "source": "iana", + "extensions": ["lwp"] + }, + "application/vnd.macports.portpkg": { + "source": "iana", + "extensions": ["portpkg"] + }, + "application/vnd.mapbox-vector-tile": { + "source": "iana" + }, + "application/vnd.marlin.drm.actiontoken+xml": { + "source": "iana" + }, + "application/vnd.marlin.drm.conftoken+xml": { + "source": "iana" + }, + "application/vnd.marlin.drm.license+xml": { + "source": "iana" + }, + "application/vnd.marlin.drm.mdcf": { + "source": "iana" + }, + "application/vnd.mason+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.maxmind.maxmind-db": { + "source": "iana" + }, + "application/vnd.mcd": { + "source": "iana", + "extensions": ["mcd"] + }, + "application/vnd.medcalcdata": { + "source": "iana", + "extensions": ["mc1"] + }, + "application/vnd.mediastation.cdkey": { + "source": "iana", + "extensions": ["cdkey"] + }, + "application/vnd.meridian-slingshot": { + "source": "iana" + }, + "application/vnd.mfer": { + "source": "iana", + "extensions": ["mwf"] + }, + "application/vnd.mfmp": { + "source": "iana", + "extensions": ["mfm"] + }, + "application/vnd.micro+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.micrografx.flo": { + "source": "iana", + "extensions": ["flo"] + }, + "application/vnd.micrografx.igx": { + "source": "iana", + "extensions": ["igx"] + }, + "application/vnd.microsoft.portable-executable": { + "source": "iana" + }, + "application/vnd.miele+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.mif": { + "source": "iana", + "extensions": ["mif"] + }, + "application/vnd.minisoft-hp3000-save": { + "source": "iana" + }, + "application/vnd.mitsubishi.misty-guard.trustweb": { + "source": "iana" + }, + "application/vnd.mobius.daf": { + "source": "iana", + "extensions": ["daf"] + }, + "application/vnd.mobius.dis": { + "source": "iana", + "extensions": ["dis"] + }, + "application/vnd.mobius.mbk": { + "source": "iana", + "extensions": ["mbk"] + }, + "application/vnd.mobius.mqy": { + "source": "iana", + "extensions": ["mqy"] + }, + "application/vnd.mobius.msl": { + "source": "iana", + "extensions": ["msl"] + }, + "application/vnd.mobius.plc": { + "source": "iana", + "extensions": ["plc"] + }, + "application/vnd.mobius.txf": { + "source": "iana", + "extensions": ["txf"] + }, + "application/vnd.mophun.application": { + "source": "iana", + "extensions": ["mpn"] + }, + "application/vnd.mophun.certificate": { + "source": "iana", + "extensions": ["mpc"] + }, + "application/vnd.motorola.flexsuite": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.adsi": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.fis": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.gotap": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.kmr": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.ttc": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.wem": { + "source": "iana" + }, + "application/vnd.motorola.iprm": { + "source": "iana" + }, + "application/vnd.mozilla.xul+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xul"] + }, + "application/vnd.ms-3mfdocument": { + "source": "iana" + }, + "application/vnd.ms-artgalry": { + "source": "iana", + "extensions": ["cil"] + }, + "application/vnd.ms-asf": { + "source": "iana" + }, + "application/vnd.ms-cab-compressed": { + "source": "iana", + "extensions": ["cab"] + }, + "application/vnd.ms-color.iccprofile": { + "source": "apache" + }, + "application/vnd.ms-excel": { + "source": "iana", + "compressible": false, + "extensions": ["xls","xlm","xla","xlc","xlt","xlw"] + }, + "application/vnd.ms-excel.addin.macroenabled.12": { + "source": "iana", + "extensions": ["xlam"] + }, + "application/vnd.ms-excel.sheet.binary.macroenabled.12": { + "source": "iana", + "extensions": ["xlsb"] + }, + "application/vnd.ms-excel.sheet.macroenabled.12": { + "source": "iana", + "extensions": ["xlsm"] + }, + "application/vnd.ms-excel.template.macroenabled.12": { + "source": "iana", + "extensions": ["xltm"] + }, + "application/vnd.ms-fontobject": { + "source": "iana", + "compressible": true, + "extensions": ["eot"] + }, + "application/vnd.ms-htmlhelp": { + "source": "iana", + "extensions": ["chm"] + }, + "application/vnd.ms-ims": { + "source": "iana", + "extensions": ["ims"] + }, + "application/vnd.ms-lrm": { + "source": "iana", + "extensions": ["lrm"] + }, + "application/vnd.ms-office.activex+xml": { + "source": "iana" + }, + "application/vnd.ms-officetheme": { + "source": "iana", + "extensions": ["thmx"] + }, + "application/vnd.ms-opentype": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-package.obfuscated-opentype": { + "source": "apache" + }, + "application/vnd.ms-pki.seccat": { + "source": "apache", + "extensions": ["cat"] + }, + "application/vnd.ms-pki.stl": { + "source": "apache", + "extensions": ["stl"] + }, + "application/vnd.ms-playready.initiator+xml": { + "source": "iana" + }, + "application/vnd.ms-powerpoint": { + "source": "iana", + "compressible": false, + "extensions": ["ppt","pps","pot"] + }, + "application/vnd.ms-powerpoint.addin.macroenabled.12": { + "source": "iana", + "extensions": ["ppam"] + }, + "application/vnd.ms-powerpoint.presentation.macroenabled.12": { + "source": "iana", + "extensions": ["pptm"] + }, + "application/vnd.ms-powerpoint.slide.macroenabled.12": { + "source": "iana", + "extensions": ["sldm"] + }, + "application/vnd.ms-powerpoint.slideshow.macroenabled.12": { + "source": "iana", + "extensions": ["ppsm"] + }, + "application/vnd.ms-powerpoint.template.macroenabled.12": { + "source": "iana", + "extensions": ["potm"] + }, + "application/vnd.ms-printdevicecapabilities+xml": { + "source": "iana" + }, + "application/vnd.ms-printing.printticket+xml": { + "source": "apache" + }, + "application/vnd.ms-printschematicket+xml": { + "source": "iana" + }, + "application/vnd.ms-project": { + "source": "iana", + "extensions": ["mpp","mpt"] + }, + "application/vnd.ms-tnef": { + "source": "iana" + }, + "application/vnd.ms-windows.devicepairing": { + "source": "iana" + }, + "application/vnd.ms-windows.nwprinting.oob": { + "source": "iana" + }, + "application/vnd.ms-windows.printerpairing": { + "source": "iana" + }, + "application/vnd.ms-windows.wsd.oob": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-resp": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-resp": { + "source": "iana" + }, + "application/vnd.ms-word.document.macroenabled.12": { + "source": "iana", + "extensions": ["docm"] + }, + "application/vnd.ms-word.template.macroenabled.12": { + "source": "iana", + "extensions": ["dotm"] + }, + "application/vnd.ms-works": { + "source": "iana", + "extensions": ["wps","wks","wcm","wdb"] + }, + "application/vnd.ms-wpl": { + "source": "iana", + "extensions": ["wpl"] + }, + "application/vnd.ms-xpsdocument": { + "source": "iana", + "compressible": false, + "extensions": ["xps"] + }, + "application/vnd.msa-disk-image": { + "source": "iana" + }, + "application/vnd.mseq": { + "source": "iana", + "extensions": ["mseq"] + }, + "application/vnd.msign": { + "source": "iana" + }, + "application/vnd.multiad.creator": { + "source": "iana" + }, + "application/vnd.multiad.creator.cif": { + "source": "iana" + }, + "application/vnd.music-niff": { + "source": "iana" + }, + "application/vnd.musician": { + "source": "iana", + "extensions": ["mus"] + }, + "application/vnd.muvee.style": { + "source": "iana", + "extensions": ["msty"] + }, + "application/vnd.mynfc": { + "source": "iana", + "extensions": ["taglet"] + }, + "application/vnd.ncd.control": { + "source": "iana" + }, + "application/vnd.ncd.reference": { + "source": "iana" + }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nervana": { + "source": "iana" + }, + "application/vnd.netfpx": { + "source": "iana" + }, + "application/vnd.neurolanguage.nlu": { + "source": "iana", + "extensions": ["nlu"] + }, + "application/vnd.nintendo.nitro.rom": { + "source": "iana" + }, + "application/vnd.nintendo.snes.rom": { + "source": "iana" + }, + "application/vnd.nitf": { + "source": "iana", + "extensions": ["ntf","nitf"] + }, + "application/vnd.noblenet-directory": { + "source": "iana", + "extensions": ["nnd"] + }, + "application/vnd.noblenet-sealer": { + "source": "iana", + "extensions": ["nns"] + }, + "application/vnd.noblenet-web": { + "source": "iana", + "extensions": ["nnw"] + }, + "application/vnd.nokia.catalogs": { + "source": "iana" + }, + "application/vnd.nokia.conml+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.conml+xml": { + "source": "iana" + }, + "application/vnd.nokia.iptv.config+xml": { + "source": "iana" + }, + "application/vnd.nokia.isds-radio-presets": { + "source": "iana" + }, + "application/vnd.nokia.landmark+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.landmark+xml": { + "source": "iana" + }, + "application/vnd.nokia.landmarkcollection+xml": { + "source": "iana" + }, + "application/vnd.nokia.n-gage.ac+xml": { + "source": "iana" + }, + "application/vnd.nokia.n-gage.data": { + "source": "iana", + "extensions": ["ngdat"] + }, + "application/vnd.nokia.n-gage.symbian.install": { + "source": "iana", + "extensions": ["n-gage"] + }, + "application/vnd.nokia.ncd": { + "source": "iana" + }, + "application/vnd.nokia.pcd+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.pcd+xml": { + "source": "iana" + }, + "application/vnd.nokia.radio-preset": { + "source": "iana", + "extensions": ["rpst"] + }, + "application/vnd.nokia.radio-presets": { + "source": "iana", + "extensions": ["rpss"] + }, + "application/vnd.novadigm.edm": { + "source": "iana", + "extensions": ["edm"] + }, + "application/vnd.novadigm.edx": { + "source": "iana", + "extensions": ["edx"] + }, + "application/vnd.novadigm.ext": { + "source": "iana", + "extensions": ["ext"] + }, + "application/vnd.ntt-local.content-share": { + "source": "iana" + }, + "application/vnd.ntt-local.file-transfer": { + "source": "iana" + }, + "application/vnd.ntt-local.ogw_remote-access": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_remote": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_tcp_stream": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.chart": { + "source": "iana", + "extensions": ["odc"] + }, + "application/vnd.oasis.opendocument.chart-template": { + "source": "iana", + "extensions": ["otc"] + }, + "application/vnd.oasis.opendocument.database": { + "source": "iana", + "extensions": ["odb"] + }, + "application/vnd.oasis.opendocument.formula": { + "source": "iana", + "extensions": ["odf"] + }, + "application/vnd.oasis.opendocument.formula-template": { + "source": "iana", + "extensions": ["odft"] + }, + "application/vnd.oasis.opendocument.graphics": { + "source": "iana", + "compressible": false, + "extensions": ["odg"] + }, + "application/vnd.oasis.opendocument.graphics-template": { + "source": "iana", + "extensions": ["otg"] + }, + "application/vnd.oasis.opendocument.image": { + "source": "iana", + "extensions": ["odi"] + }, + "application/vnd.oasis.opendocument.image-template": { + "source": "iana", + "extensions": ["oti"] + }, + "application/vnd.oasis.opendocument.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["odp"] + }, + "application/vnd.oasis.opendocument.presentation-template": { + "source": "iana", + "extensions": ["otp"] + }, + "application/vnd.oasis.opendocument.spreadsheet": { + "source": "iana", + "compressible": false, + "extensions": ["ods"] + }, + "application/vnd.oasis.opendocument.spreadsheet-template": { + "source": "iana", + "extensions": ["ots"] + }, + "application/vnd.oasis.opendocument.text": { + "source": "iana", + "compressible": false, + "extensions": ["odt"] + }, + "application/vnd.oasis.opendocument.text-master": { + "source": "iana", + "extensions": ["odm"] + }, + "application/vnd.oasis.opendocument.text-template": { + "source": "iana", + "extensions": ["ott"] + }, + "application/vnd.oasis.opendocument.text-web": { + "source": "iana", + "extensions": ["oth"] + }, + "application/vnd.obn": { + "source": "iana" + }, + "application/vnd.oftn.l10n+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessdownload+xml": { + "source": "iana" + }, + "application/vnd.oipf.contentaccessstreaming+xml": { + "source": "iana" + }, + "application/vnd.oipf.cspg-hexbinary": { + "source": "iana" + }, + "application/vnd.oipf.dae.svg+xml": { + "source": "iana" + }, + "application/vnd.oipf.dae.xhtml+xml": { + "source": "iana" + }, + "application/vnd.oipf.mippvcontrolmessage+xml": { + "source": "iana" + }, + "application/vnd.oipf.pae.gem": { + "source": "iana" + }, + "application/vnd.oipf.spdiscovery+xml": { + "source": "iana" + }, + "application/vnd.oipf.spdlist+xml": { + "source": "iana" + }, + "application/vnd.oipf.ueprofile+xml": { + "source": "iana" + }, + "application/vnd.oipf.userprofile+xml": { + "source": "iana" + }, + "application/vnd.olpc-sugar": { + "source": "iana", + "extensions": ["xo"] + }, + "application/vnd.oma-scws-config": { + "source": "iana" + }, + "application/vnd.oma-scws-http-request": { + "source": "iana" + }, + "application/vnd.oma-scws-http-response": { + "source": "iana" + }, + "application/vnd.oma.bcast.associated-procedure-parameter+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.drm-trigger+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.imd+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.ltkm": { + "source": "iana" + }, + "application/vnd.oma.bcast.notification+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.provisioningtrigger": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgboot": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdd+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdu": { + "source": "iana" + }, + "application/vnd.oma.bcast.simple-symbol-container": { + "source": "iana" + }, + "application/vnd.oma.bcast.smartcard-trigger+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.sprov+xml": { + "source": "iana" + }, + "application/vnd.oma.bcast.stkm": { + "source": "iana" + }, + "application/vnd.oma.cab-address-book+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-feature-handler+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-pcc+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-subs-invite+xml": { + "source": "iana" + }, + "application/vnd.oma.cab-user-prefs+xml": { + "source": "iana" + }, + "application/vnd.oma.dcd": { + "source": "iana" + }, + "application/vnd.oma.dcdc": { + "source": "iana" + }, + "application/vnd.oma.dd2+xml": { + "source": "iana", + "extensions": ["dd2"] + }, + "application/vnd.oma.drm.risd+xml": { + "source": "iana" + }, + "application/vnd.oma.group-usage-list+xml": { + "source": "iana" + }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, + "application/vnd.oma.pal+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.detailed-progress-report+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.final-report+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.groups+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.invocation-descriptor+xml": { + "source": "iana" + }, + "application/vnd.oma.poc.optimized-progress-report+xml": { + "source": "iana" + }, + "application/vnd.oma.push": { + "source": "iana" + }, + "application/vnd.oma.scidm.messages+xml": { + "source": "iana" + }, + "application/vnd.oma.xcap-directory+xml": { + "source": "iana" + }, + "application/vnd.omads-email+xml": { + "source": "iana" + }, + "application/vnd.omads-file+xml": { + "source": "iana" + }, + "application/vnd.omads-folder+xml": { + "source": "iana" + }, + "application/vnd.omaloc-supl-init": { + "source": "iana" + }, + "application/vnd.onepager": { + "source": "iana" + }, + "application/vnd.openblox.game+xml": { + "source": "iana" + }, + "application/vnd.openblox.game-binary": { + "source": "iana" + }, + "application/vnd.openeye.oeb": { + "source": "iana" + }, + "application/vnd.openofficeorg.extension": { + "source": "apache", + "extensions": ["oxt"] + }, + "application/vnd.openstreetmap.data+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.custom-properties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawing+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.extended-properties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml-template": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["pptx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide": { + "source": "iana", + "extensions": ["sldx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow": { + "source": "iana", + "extensions": ["ppsx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.template": { + "source": "apache", + "extensions": ["potx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml-template": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": { + "source": "iana", + "compressible": false, + "extensions": ["xlsx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template": { + "source": "apache", + "extensions": ["xltx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.theme+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.themeoverride+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.vmldrawing": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml-template": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document": { + "source": "iana", + "compressible": false, + "extensions": ["docx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template": { + "source": "apache", + "extensions": ["dotx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-package.core-properties+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": { + "source": "iana" + }, + "application/vnd.openxmlformats-package.relationships+xml": { + "source": "iana" + }, + "application/vnd.oracle.resource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.orange.indata": { + "source": "iana" + }, + "application/vnd.osa.netdeploy": { + "source": "iana" + }, + "application/vnd.osgeo.mapguide.package": { + "source": "iana", + "extensions": ["mgp"] + }, + "application/vnd.osgi.bundle": { + "source": "iana" + }, + "application/vnd.osgi.dp": { + "source": "iana", + "extensions": ["dp"] + }, + "application/vnd.osgi.subsystem": { + "source": "iana", + "extensions": ["esa"] + }, + "application/vnd.otps.ct-kip+xml": { + "source": "iana" + }, + "application/vnd.oxli.countgraph": { + "source": "iana" + }, + "application/vnd.pagerduty+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.palm": { + "source": "iana", + "extensions": ["pdb","pqa","oprc"] + }, + "application/vnd.panoply": { + "source": "iana" + }, + "application/vnd.paos+xml": { + "source": "iana" + }, + "application/vnd.paos.xml": { + "source": "apache" + }, + "application/vnd.pawaafile": { + "source": "iana", + "extensions": ["paw"] + }, + "application/vnd.pcos": { + "source": "iana" + }, + "application/vnd.pg.format": { + "source": "iana", + "extensions": ["str"] + }, + "application/vnd.pg.osasli": { + "source": "iana", + "extensions": ["ei6"] + }, + "application/vnd.piaccess.application-licence": { + "source": "iana" + }, + "application/vnd.picsel": { + "source": "iana", + "extensions": ["efif"] + }, + "application/vnd.pmi.widget": { + "source": "iana", + "extensions": ["wg"] + }, + "application/vnd.poc.group-advertisement+xml": { + "source": "iana" + }, + "application/vnd.pocketlearn": { + "source": "iana", + "extensions": ["plf"] + }, + "application/vnd.powerbuilder6": { + "source": "iana", + "extensions": ["pbd"] + }, + "application/vnd.powerbuilder6-s": { + "source": "iana" + }, + "application/vnd.powerbuilder7": { + "source": "iana" + }, + "application/vnd.powerbuilder7-s": { + "source": "iana" + }, + "application/vnd.powerbuilder75": { + "source": "iana" + }, + "application/vnd.powerbuilder75-s": { + "source": "iana" + }, + "application/vnd.preminet": { + "source": "iana" + }, + "application/vnd.previewsystems.box": { + "source": "iana", + "extensions": ["box"] + }, + "application/vnd.proteus.magazine": { + "source": "iana", + "extensions": ["mgz"] + }, + "application/vnd.publishare-delta-tree": { + "source": "iana", + "extensions": ["qps"] + }, + "application/vnd.pvi.ptid1": { + "source": "iana", + "extensions": ["ptid"] + }, + "application/vnd.pwg-multiplexed": { + "source": "iana" + }, + "application/vnd.pwg-xhtml-print+xml": { + "source": "iana" + }, + "application/vnd.qualcomm.brew-app-res": { + "source": "iana" + }, + "application/vnd.quarantainenet": { + "source": "iana" + }, + "application/vnd.quark.quarkxpress": { + "source": "iana", + "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] + }, + "application/vnd.quobject-quoxdocument": { + "source": "iana" + }, + "application/vnd.radisys.moml+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-conf+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-conn+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-dialog+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-audit-stream+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-conf+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-base+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-fax-detect+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-group+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-speech+xml": { + "source": "iana" + }, + "application/vnd.radisys.msml-dialog-transform+xml": { + "source": "iana" + }, + "application/vnd.rainstor.data": { + "source": "iana" + }, + "application/vnd.rapid": { + "source": "iana" + }, + "application/vnd.rar": { + "source": "iana" + }, + "application/vnd.realvnc.bed": { + "source": "iana", + "extensions": ["bed"] + }, + "application/vnd.recordare.musicxml": { + "source": "iana", + "extensions": ["mxl"] + }, + "application/vnd.recordare.musicxml+xml": { + "source": "iana", + "extensions": ["musicxml"] + }, + "application/vnd.renlearn.rlprint": { + "source": "iana" + }, + "application/vnd.rig.cryptonote": { + "source": "iana", + "extensions": ["cryptonote"] + }, + "application/vnd.rim.cod": { + "source": "apache", + "extensions": ["cod"] + }, + "application/vnd.rn-realmedia": { + "source": "apache", + "extensions": ["rm"] + }, + "application/vnd.rn-realmedia-vbr": { + "source": "apache", + "extensions": ["rmvb"] + }, + "application/vnd.route66.link66+xml": { + "source": "iana", + "extensions": ["link66"] + }, + "application/vnd.rs-274x": { + "source": "iana" + }, + "application/vnd.ruckus.download": { + "source": "iana" + }, + "application/vnd.s3sms": { + "source": "iana" + }, + "application/vnd.sailingtracker.track": { + "source": "iana", + "extensions": ["st"] + }, + "application/vnd.sbm.cid": { + "source": "iana" + }, + "application/vnd.sbm.mid2": { + "source": "iana" + }, + "application/vnd.scribus": { + "source": "iana" + }, + "application/vnd.sealed.3df": { + "source": "iana" + }, + "application/vnd.sealed.csf": { + "source": "iana" + }, + "application/vnd.sealed.doc": { + "source": "iana" + }, + "application/vnd.sealed.eml": { + "source": "iana" + }, + "application/vnd.sealed.mht": { + "source": "iana" + }, + "application/vnd.sealed.net": { + "source": "iana" + }, + "application/vnd.sealed.ppt": { + "source": "iana" + }, + "application/vnd.sealed.tiff": { + "source": "iana" + }, + "application/vnd.sealed.xls": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.html": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.pdf": { + "source": "iana" + }, + "application/vnd.seemail": { + "source": "iana", + "extensions": ["see"] + }, + "application/vnd.sema": { + "source": "iana", + "extensions": ["sema"] + }, + "application/vnd.semd": { + "source": "iana", + "extensions": ["semd"] + }, + "application/vnd.semf": { + "source": "iana", + "extensions": ["semf"] + }, + "application/vnd.shana.informed.formdata": { + "source": "iana", + "extensions": ["ifm"] + }, + "application/vnd.shana.informed.formtemplate": { + "source": "iana", + "extensions": ["itp"] + }, + "application/vnd.shana.informed.interchange": { + "source": "iana", + "extensions": ["iif"] + }, + "application/vnd.shana.informed.package": { + "source": "iana", + "extensions": ["ipk"] + }, + "application/vnd.simtech-mindmapper": { + "source": "iana", + "extensions": ["twd","twds"] + }, + "application/vnd.siren+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.smaf": { + "source": "iana", + "extensions": ["mmf"] + }, + "application/vnd.smart.notebook": { + "source": "iana" + }, + "application/vnd.smart.teacher": { + "source": "iana", + "extensions": ["teacher"] + }, + "application/vnd.software602.filler.form+xml": { + "source": "iana" + }, + "application/vnd.software602.filler.form-xml-zip": { + "source": "iana" + }, + "application/vnd.solent.sdkm+xml": { + "source": "iana", + "extensions": ["sdkm","sdkd"] + }, + "application/vnd.spotfire.dxp": { + "source": "iana", + "extensions": ["dxp"] + }, + "application/vnd.spotfire.sfs": { + "source": "iana", + "extensions": ["sfs"] + }, + "application/vnd.sss-cod": { + "source": "iana" + }, + "application/vnd.sss-dtf": { + "source": "iana" + }, + "application/vnd.sss-ntf": { + "source": "iana" + }, + "application/vnd.stardivision.calc": { + "source": "apache", + "extensions": ["sdc"] + }, + "application/vnd.stardivision.draw": { + "source": "apache", + "extensions": ["sda"] + }, + "application/vnd.stardivision.impress": { + "source": "apache", + "extensions": ["sdd"] + }, + "application/vnd.stardivision.math": { + "source": "apache", + "extensions": ["smf"] + }, + "application/vnd.stardivision.writer": { + "source": "apache", + "extensions": ["sdw","vor"] + }, + "application/vnd.stardivision.writer-global": { + "source": "apache", + "extensions": ["sgl"] + }, + "application/vnd.stepmania.package": { + "source": "iana", + "extensions": ["smzip"] + }, + "application/vnd.stepmania.stepchart": { + "source": "iana", + "extensions": ["sm"] + }, + "application/vnd.street-stream": { + "source": "iana" + }, + "application/vnd.sun.wadl+xml": { + "source": "iana" + }, + "application/vnd.sun.xml.calc": { + "source": "apache", + "extensions": ["sxc"] + }, + "application/vnd.sun.xml.calc.template": { + "source": "apache", + "extensions": ["stc"] + }, + "application/vnd.sun.xml.draw": { + "source": "apache", + "extensions": ["sxd"] + }, + "application/vnd.sun.xml.draw.template": { + "source": "apache", + "extensions": ["std"] + }, + "application/vnd.sun.xml.impress": { + "source": "apache", + "extensions": ["sxi"] + }, + "application/vnd.sun.xml.impress.template": { + "source": "apache", + "extensions": ["sti"] + }, + "application/vnd.sun.xml.math": { + "source": "apache", + "extensions": ["sxm"] + }, + "application/vnd.sun.xml.writer": { + "source": "apache", + "extensions": ["sxw"] + }, + "application/vnd.sun.xml.writer.global": { + "source": "apache", + "extensions": ["sxg"] + }, + "application/vnd.sun.xml.writer.template": { + "source": "apache", + "extensions": ["stw"] + }, + "application/vnd.sus-calendar": { + "source": "iana", + "extensions": ["sus","susp"] + }, + "application/vnd.svd": { + "source": "iana", + "extensions": ["svd"] + }, + "application/vnd.swiftview-ics": { + "source": "iana" + }, + "application/vnd.symbian.install": { + "source": "apache", + "extensions": ["sis","sisx"] + }, + "application/vnd.syncml+xml": { + "source": "iana", + "extensions": ["xsm"] + }, + "application/vnd.syncml.dm+wbxml": { + "source": "iana", + "extensions": ["bdm"] + }, + "application/vnd.syncml.dm+xml": { + "source": "iana", + "extensions": ["xdm"] + }, + "application/vnd.syncml.dm.notification": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+xml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+xml": { + "source": "iana" + }, + "application/vnd.syncml.ds.notification": { + "source": "iana" + }, + "application/vnd.tableschema+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tao.intent-module-archive": { + "source": "iana", + "extensions": ["tao"] + }, + "application/vnd.tcpdump.pcap": { + "source": "iana", + "extensions": ["pcap","cap","dmp"] + }, + "application/vnd.tmd.mediaflex.api+xml": { + "source": "iana" + }, + "application/vnd.tml": { + "source": "iana" + }, + "application/vnd.tmobile-livetv": { + "source": "iana", + "extensions": ["tmo"] + }, + "application/vnd.tri.onesource": { + "source": "iana" + }, + "application/vnd.trid.tpt": { + "source": "iana", + "extensions": ["tpt"] + }, + "application/vnd.triscape.mxs": { + "source": "iana", + "extensions": ["mxs"] + }, + "application/vnd.trueapp": { + "source": "iana", + "extensions": ["tra"] + }, + "application/vnd.truedoc": { + "source": "iana" + }, + "application/vnd.ubisoft.webplayer": { + "source": "iana" + }, + "application/vnd.ufdl": { + "source": "iana", + "extensions": ["ufd","ufdl"] + }, + "application/vnd.uiq.theme": { + "source": "iana", + "extensions": ["utz"] + }, + "application/vnd.umajin": { + "source": "iana", + "extensions": ["umj"] + }, + "application/vnd.unity": { + "source": "iana", + "extensions": ["unityweb"] + }, + "application/vnd.uoml+xml": { + "source": "iana", + "extensions": ["uoml"] + }, + "application/vnd.uplanet.alert": { + "source": "iana" + }, + "application/vnd.uplanet.alert-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.channel": { + "source": "iana" + }, + "application/vnd.uplanet.channel-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.list": { + "source": "iana" + }, + "application/vnd.uplanet.list-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.signal": { + "source": "iana" + }, + "application/vnd.uri-map": { + "source": "iana" + }, + "application/vnd.valve.source.material": { + "source": "iana" + }, + "application/vnd.vcx": { + "source": "iana", + "extensions": ["vcx"] + }, + "application/vnd.vd-study": { + "source": "iana" + }, + "application/vnd.vectorworks": { + "source": "iana" + }, + "application/vnd.vel+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.verimatrix.vcas": { + "source": "iana" + }, + "application/vnd.vidsoft.vidconference": { + "source": "iana" + }, + "application/vnd.visio": { + "source": "iana", + "extensions": ["vsd","vst","vss","vsw"] + }, + "application/vnd.visionary": { + "source": "iana", + "extensions": ["vis"] + }, + "application/vnd.vividence.scriptfile": { + "source": "iana" + }, + "application/vnd.vsf": { + "source": "iana", + "extensions": ["vsf"] + }, + "application/vnd.wap.sic": { + "source": "iana" + }, + "application/vnd.wap.slc": { + "source": "iana" + }, + "application/vnd.wap.wbxml": { + "source": "iana", + "extensions": ["wbxml"] + }, + "application/vnd.wap.wmlc": { + "source": "iana", + "extensions": ["wmlc"] + }, + "application/vnd.wap.wmlscriptc": { + "source": "iana", + "extensions": ["wmlsc"] + }, + "application/vnd.webturbo": { + "source": "iana", + "extensions": ["wtb"] + }, + "application/vnd.wfa.p2p": { + "source": "iana" + }, + "application/vnd.wfa.wsc": { + "source": "iana" + }, + "application/vnd.windows.devicepairing": { + "source": "iana" + }, + "application/vnd.wmc": { + "source": "iana" + }, + "application/vnd.wmf.bootstrap": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica.package": { + "source": "iana" + }, + "application/vnd.wolfram.player": { + "source": "iana", + "extensions": ["nbp"] + }, + "application/vnd.wordperfect": { + "source": "iana", + "extensions": ["wpd"] + }, + "application/vnd.wqd": { + "source": "iana", + "extensions": ["wqd"] + }, + "application/vnd.wrq-hp3000-labelled": { + "source": "iana" + }, + "application/vnd.wt.stf": { + "source": "iana", + "extensions": ["stf"] + }, + "application/vnd.wv.csp+wbxml": { + "source": "iana" + }, + "application/vnd.wv.csp+xml": { + "source": "iana" + }, + "application/vnd.wv.ssp+xml": { + "source": "iana" + }, + "application/vnd.xacml+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.xara": { + "source": "iana", + "extensions": ["xar"] + }, + "application/vnd.xfdl": { + "source": "iana", + "extensions": ["xfdl"] + }, + "application/vnd.xfdl.webform": { + "source": "iana" + }, + "application/vnd.xmi+xml": { + "source": "iana" + }, + "application/vnd.xmpie.cpkg": { + "source": "iana" + }, + "application/vnd.xmpie.dpkg": { + "source": "iana" + }, + "application/vnd.xmpie.plan": { + "source": "iana" + }, + "application/vnd.xmpie.ppkg": { + "source": "iana" + }, + "application/vnd.xmpie.xlim": { + "source": "iana" + }, + "application/vnd.yamaha.hv-dic": { + "source": "iana", + "extensions": ["hvd"] + }, + "application/vnd.yamaha.hv-script": { + "source": "iana", + "extensions": ["hvs"] + }, + "application/vnd.yamaha.hv-voice": { + "source": "iana", + "extensions": ["hvp"] + }, + "application/vnd.yamaha.openscoreformat": { + "source": "iana", + "extensions": ["osf"] + }, + "application/vnd.yamaha.openscoreformat.osfpvg+xml": { + "source": "iana", + "extensions": ["osfpvg"] + }, + "application/vnd.yamaha.remote-setup": { + "source": "iana" + }, + "application/vnd.yamaha.smaf-audio": { + "source": "iana", + "extensions": ["saf"] + }, + "application/vnd.yamaha.smaf-phrase": { + "source": "iana", + "extensions": ["spf"] + }, + "application/vnd.yamaha.through-ngn": { + "source": "iana" + }, + "application/vnd.yamaha.tunnel-udpencap": { + "source": "iana" + }, + "application/vnd.yaoweme": { + "source": "iana" + }, + "application/vnd.yellowriver-custom-menu": { + "source": "iana", + "extensions": ["cmp"] + }, + "application/vnd.zul": { + "source": "iana", + "extensions": ["zir","zirz"] + }, + "application/vnd.zzazz.deck+xml": { + "source": "iana", + "extensions": ["zaz"] + }, + "application/voicexml+xml": { + "source": "iana", + "extensions": ["vxml"] + }, + "application/vq-rtcpxr": { + "source": "iana" + }, + "application/watcherinfo+xml": { + "source": "iana" + }, + "application/whoispp-query": { + "source": "iana" + }, + "application/whoispp-response": { + "source": "iana" + }, + "application/widget": { + "source": "iana", + "extensions": ["wgt"] + }, + "application/winhlp": { + "source": "apache", + "extensions": ["hlp"] + }, + "application/wita": { + "source": "iana" + }, + "application/wordperfect5.1": { + "source": "iana" + }, + "application/wsdl+xml": { + "source": "iana", + "extensions": ["wsdl"] + }, + "application/wspolicy+xml": { + "source": "iana", + "extensions": ["wspolicy"] + }, + "application/x-7z-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["7z"] + }, + "application/x-abiword": { + "source": "apache", + "extensions": ["abw"] + }, + "application/x-ace-compressed": { + "source": "apache", + "extensions": ["ace"] + }, + "application/x-amf": { + "source": "apache" + }, + "application/x-apple-diskimage": { + "source": "apache", + "extensions": ["dmg"] + }, + "application/x-authorware-bin": { + "source": "apache", + "extensions": ["aab","x32","u32","vox"] + }, + "application/x-authorware-map": { + "source": "apache", + "extensions": ["aam"] + }, + "application/x-authorware-seg": { + "source": "apache", + "extensions": ["aas"] + }, + "application/x-bcpio": { + "source": "apache", + "extensions": ["bcpio"] + }, + "application/x-bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/x-bittorrent": { + "source": "apache", + "extensions": ["torrent"] + }, + "application/x-blorb": { + "source": "apache", + "extensions": ["blb","blorb"] + }, + "application/x-bzip": { + "source": "apache", + "compressible": false, + "extensions": ["bz"] + }, + "application/x-bzip2": { + "source": "apache", + "compressible": false, + "extensions": ["bz2","boz"] + }, + "application/x-cbr": { + "source": "apache", + "extensions": ["cbr","cba","cbt","cbz","cb7"] + }, + "application/x-cdlink": { + "source": "apache", + "extensions": ["vcd"] + }, + "application/x-cfs-compressed": { + "source": "apache", + "extensions": ["cfs"] + }, + "application/x-chat": { + "source": "apache", + "extensions": ["chat"] + }, + "application/x-chess-pgn": { + "source": "apache", + "extensions": ["pgn"] + }, + "application/x-chrome-extension": { + "extensions": ["crx"] + }, + "application/x-cocoa": { + "source": "nginx", + "extensions": ["cco"] + }, + "application/x-compress": { + "source": "apache" + }, + "application/x-conference": { + "source": "apache", + "extensions": ["nsc"] + }, + "application/x-cpio": { + "source": "apache", + "extensions": ["cpio"] + }, + "application/x-csh": { + "source": "apache", + "extensions": ["csh"] + }, + "application/x-deb": { + "compressible": false + }, + "application/x-debian-package": { + "source": "apache", + "extensions": ["deb","udeb"] + }, + "application/x-dgc-compressed": { + "source": "apache", + "extensions": ["dgc"] + }, + "application/x-director": { + "source": "apache", + "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"] + }, + "application/x-doom": { + "source": "apache", + "extensions": ["wad"] + }, + "application/x-dtbncx+xml": { + "source": "apache", + "extensions": ["ncx"] + }, + "application/x-dtbook+xml": { + "source": "apache", + "extensions": ["dtb"] + }, + "application/x-dtbresource+xml": { + "source": "apache", + "extensions": ["res"] + }, + "application/x-dvi": { + "source": "apache", + "compressible": false, + "extensions": ["dvi"] + }, + "application/x-envoy": { + "source": "apache", + "extensions": ["evy"] + }, + "application/x-eva": { + "source": "apache", + "extensions": ["eva"] + }, + "application/x-font-bdf": { + "source": "apache", + "extensions": ["bdf"] + }, + "application/x-font-dos": { + "source": "apache" + }, + "application/x-font-framemaker": { + "source": "apache" + }, + "application/x-font-ghostscript": { + "source": "apache", + "extensions": ["gsf"] + }, + "application/x-font-libgrx": { + "source": "apache" + }, + "application/x-font-linux-psf": { + "source": "apache", + "extensions": ["psf"] + }, + "application/x-font-otf": { + "source": "apache", + "compressible": true, + "extensions": ["otf"] + }, + "application/x-font-pcf": { + "source": "apache", + "extensions": ["pcf"] + }, + "application/x-font-snf": { + "source": "apache", + "extensions": ["snf"] + }, + "application/x-font-speedo": { + "source": "apache" + }, + "application/x-font-sunos-news": { + "source": "apache" + }, + "application/x-font-ttf": { + "source": "apache", + "compressible": true, + "extensions": ["ttf","ttc"] + }, + "application/x-font-type1": { + "source": "apache", + "extensions": ["pfa","pfb","pfm","afm"] + }, + "application/x-font-vfont": { + "source": "apache" + }, + "application/x-freearc": { + "source": "apache", + "extensions": ["arc"] + }, + "application/x-futuresplash": { + "source": "apache", + "extensions": ["spl"] + }, + "application/x-gca-compressed": { + "source": "apache", + "extensions": ["gca"] + }, + "application/x-glulx": { + "source": "apache", + "extensions": ["ulx"] + }, + "application/x-gnumeric": { + "source": "apache", + "extensions": ["gnumeric"] + }, + "application/x-gramps-xml": { + "source": "apache", + "extensions": ["gramps"] + }, + "application/x-gtar": { + "source": "apache", + "extensions": ["gtar"] + }, + "application/x-gzip": { + "source": "apache" + }, + "application/x-hdf": { + "source": "apache", + "extensions": ["hdf"] + }, + "application/x-httpd-php": { + "compressible": true, + "extensions": ["php"] + }, + "application/x-install-instructions": { + "source": "apache", + "extensions": ["install"] + }, + "application/x-iso9660-image": { + "source": "apache", + "extensions": ["iso"] + }, + "application/x-java-archive-diff": { + "source": "nginx", + "extensions": ["jardiff"] + }, + "application/x-java-jnlp-file": { + "source": "apache", + "compressible": false, + "extensions": ["jnlp"] + }, + "application/x-javascript": { + "compressible": true + }, + "application/x-latex": { + "source": "apache", + "compressible": false, + "extensions": ["latex"] + }, + "application/x-lua-bytecode": { + "extensions": ["luac"] + }, + "application/x-lzh-compressed": { + "source": "apache", + "extensions": ["lzh","lha"] + }, + "application/x-makeself": { + "source": "nginx", + "extensions": ["run"] + }, + "application/x-mie": { + "source": "apache", + "extensions": ["mie"] + }, + "application/x-mobipocket-ebook": { + "source": "apache", + "extensions": ["prc","mobi"] + }, + "application/x-mpegurl": { + "compressible": false + }, + "application/x-ms-application": { + "source": "apache", + "extensions": ["application"] + }, + "application/x-ms-shortcut": { + "source": "apache", + "extensions": ["lnk"] + }, + "application/x-ms-wmd": { + "source": "apache", + "extensions": ["wmd"] + }, + "application/x-ms-wmz": { + "source": "apache", + "extensions": ["wmz"] + }, + "application/x-ms-xbap": { + "source": "apache", + "extensions": ["xbap"] + }, + "application/x-msaccess": { + "source": "apache", + "extensions": ["mdb"] + }, + "application/x-msbinder": { + "source": "apache", + "extensions": ["obd"] + }, + "application/x-mscardfile": { + "source": "apache", + "extensions": ["crd"] + }, + "application/x-msclip": { + "source": "apache", + "extensions": ["clp"] + }, + "application/x-msdos-program": { + "extensions": ["exe"] + }, + "application/x-msdownload": { + "source": "apache", + "extensions": ["exe","dll","com","bat","msi"] + }, + "application/x-msmediaview": { + "source": "apache", + "extensions": ["mvb","m13","m14"] + }, + "application/x-msmetafile": { + "source": "apache", + "extensions": ["wmf","wmz","emf","emz"] + }, + "application/x-msmoney": { + "source": "apache", + "extensions": ["mny"] + }, + "application/x-mspublisher": { + "source": "apache", + "extensions": ["pub"] + }, + "application/x-msschedule": { + "source": "apache", + "extensions": ["scd"] + }, + "application/x-msterminal": { + "source": "apache", + "extensions": ["trm"] + }, + "application/x-mswrite": { + "source": "apache", + "extensions": ["wri"] + }, + "application/x-netcdf": { + "source": "apache", + "extensions": ["nc","cdf"] + }, + "application/x-ns-proxy-autoconfig": { + "compressible": true, + "extensions": ["pac"] + }, + "application/x-nzb": { + "source": "apache", + "extensions": ["nzb"] + }, + "application/x-perl": { + "source": "nginx", + "extensions": ["pl","pm"] + }, + "application/x-pilot": { + "source": "nginx", + "extensions": ["prc","pdb"] + }, + "application/x-pkcs12": { + "source": "apache", + "compressible": false, + "extensions": ["p12","pfx"] + }, + "application/x-pkcs7-certificates": { + "source": "apache", + "extensions": ["p7b","spc"] + }, + "application/x-pkcs7-certreqresp": { + "source": "apache", + "extensions": ["p7r"] + }, + "application/x-rar-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["rar"] + }, + "application/x-redhat-package-manager": { + "source": "nginx", + "extensions": ["rpm"] + }, + "application/x-research-info-systems": { + "source": "apache", + "extensions": ["ris"] + }, + "application/x-sea": { + "source": "nginx", + "extensions": ["sea"] + }, + "application/x-sh": { + "source": "apache", + "compressible": true, + "extensions": ["sh"] + }, + "application/x-shar": { + "source": "apache", + "extensions": ["shar"] + }, + "application/x-shockwave-flash": { + "source": "apache", + "compressible": false, + "extensions": ["swf"] + }, + "application/x-silverlight-app": { + "source": "apache", + "extensions": ["xap"] + }, + "application/x-sql": { + "source": "apache", + "extensions": ["sql"] + }, + "application/x-stuffit": { + "source": "apache", + "compressible": false, + "extensions": ["sit"] + }, + "application/x-stuffitx": { + "source": "apache", + "extensions": ["sitx"] + }, + "application/x-subrip": { + "source": "apache", + "extensions": ["srt"] + }, + "application/x-sv4cpio": { + "source": "apache", + "extensions": ["sv4cpio"] + }, + "application/x-sv4crc": { + "source": "apache", + "extensions": ["sv4crc"] + }, + "application/x-t3vm-image": { + "source": "apache", + "extensions": ["t3"] + }, + "application/x-tads": { + "source": "apache", + "extensions": ["gam"] + }, + "application/x-tar": { + "source": "apache", + "compressible": true, + "extensions": ["tar"] + }, + "application/x-tcl": { + "source": "apache", + "extensions": ["tcl","tk"] + }, + "application/x-tex": { + "source": "apache", + "extensions": ["tex"] + }, + "application/x-tex-tfm": { + "source": "apache", + "extensions": ["tfm"] + }, + "application/x-texinfo": { + "source": "apache", + "extensions": ["texinfo","texi"] + }, + "application/x-tgif": { + "source": "apache", + "extensions": ["obj"] + }, + "application/x-ustar": { + "source": "apache", + "extensions": ["ustar"] + }, + "application/x-wais-source": { + "source": "apache", + "extensions": ["src"] + }, + "application/x-web-app-manifest+json": { + "compressible": true, + "extensions": ["webapp"] + }, + "application/x-www-form-urlencoded": { + "source": "iana", + "compressible": true + }, + "application/x-x509-ca-cert": { + "source": "apache", + "extensions": ["der","crt","pem"] + }, + "application/x-xfig": { + "source": "apache", + "extensions": ["fig"] + }, + "application/x-xliff+xml": { + "source": "apache", + "extensions": ["xlf"] + }, + "application/x-xpinstall": { + "source": "apache", + "compressible": false, + "extensions": ["xpi"] + }, + "application/x-xz": { + "source": "apache", + "extensions": ["xz"] + }, + "application/x-zmachine": { + "source": "apache", + "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"] + }, + "application/x400-bp": { + "source": "iana" + }, + "application/xacml+xml": { + "source": "iana" + }, + "application/xaml+xml": { + "source": "apache", + "extensions": ["xaml"] + }, + "application/xcap-att+xml": { + "source": "iana" + }, + "application/xcap-caps+xml": { + "source": "iana" + }, + "application/xcap-diff+xml": { + "source": "iana", + "extensions": ["xdf"] + }, + "application/xcap-el+xml": { + "source": "iana" + }, + "application/xcap-error+xml": { + "source": "iana" + }, + "application/xcap-ns+xml": { + "source": "iana" + }, + "application/xcon-conference-info+xml": { + "source": "iana" + }, + "application/xcon-conference-info-diff+xml": { + "source": "iana" + }, + "application/xenc+xml": { + "source": "iana", + "extensions": ["xenc"] + }, + "application/xhtml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtml","xht"] + }, + "application/xhtml-voice+xml": { + "source": "apache" + }, + "application/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml","xsl","xsd","rng"] + }, + "application/xml-dtd": { + "source": "iana", + "compressible": true, + "extensions": ["dtd"] + }, + "application/xml-external-parsed-entity": { + "source": "iana" + }, + "application/xml-patch+xml": { + "source": "iana" + }, + "application/xmpp+xml": { + "source": "iana" + }, + "application/xop+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xop"] + }, + "application/xproc+xml": { + "source": "apache", + "extensions": ["xpl"] + }, + "application/xslt+xml": { + "source": "iana", + "extensions": ["xslt"] + }, + "application/xspf+xml": { + "source": "apache", + "extensions": ["xspf"] + }, + "application/xv+xml": { + "source": "iana", + "extensions": ["mxml","xhvml","xvml","xvm"] + }, + "application/yang": { + "source": "iana", + "extensions": ["yang"] + }, + "application/yang-data+json": { + "source": "iana", + "compressible": true + }, + "application/yang-data+xml": { + "source": "iana" + }, + "application/yang-patch+json": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+xml": { + "source": "iana" + }, + "application/yin+xml": { + "source": "iana", + "extensions": ["yin"] + }, + "application/zip": { + "source": "iana", + "compressible": false, + "extensions": ["zip"] + }, + "application/zlib": { + "source": "iana" + }, + "audio/1d-interleaved-parityfec": { + "source": "iana" + }, + "audio/32kadpcm": { + "source": "iana" + }, + "audio/3gpp": { + "source": "iana", + "compressible": false, + "extensions": ["3gpp"] + }, + "audio/3gpp2": { + "source": "iana" + }, + "audio/ac3": { + "source": "iana" + }, + "audio/adpcm": { + "source": "apache", + "extensions": ["adp"] + }, + "audio/amr": { + "source": "iana" + }, + "audio/amr-wb": { + "source": "iana" + }, + "audio/amr-wb+": { + "source": "iana" + }, + "audio/aptx": { + "source": "iana" + }, + "audio/asc": { + "source": "iana" + }, + "audio/atrac-advanced-lossless": { + "source": "iana" + }, + "audio/atrac-x": { + "source": "iana" + }, + "audio/atrac3": { + "source": "iana" + }, + "audio/basic": { + "source": "iana", + "compressible": false, + "extensions": ["au","snd"] + }, + "audio/bv16": { + "source": "iana" + }, + "audio/bv32": { + "source": "iana" + }, + "audio/clearmode": { + "source": "iana" + }, + "audio/cn": { + "source": "iana" + }, + "audio/dat12": { + "source": "iana" + }, + "audio/dls": { + "source": "iana" + }, + "audio/dsr-es201108": { + "source": "iana" + }, + "audio/dsr-es202050": { + "source": "iana" + }, + "audio/dsr-es202211": { + "source": "iana" + }, + "audio/dsr-es202212": { + "source": "iana" + }, + "audio/dv": { + "source": "iana" + }, + "audio/dvi4": { + "source": "iana" + }, + "audio/eac3": { + "source": "iana" + }, + "audio/encaprtp": { + "source": "iana" + }, + "audio/evrc": { + "source": "iana" + }, + "audio/evrc-qcp": { + "source": "iana" + }, + "audio/evrc0": { + "source": "iana" + }, + "audio/evrc1": { + "source": "iana" + }, + "audio/evrcb": { + "source": "iana" + }, + "audio/evrcb0": { + "source": "iana" + }, + "audio/evrcb1": { + "source": "iana" + }, + "audio/evrcnw": { + "source": "iana" + }, + "audio/evrcnw0": { + "source": "iana" + }, + "audio/evrcnw1": { + "source": "iana" + }, + "audio/evrcwb": { + "source": "iana" + }, + "audio/evrcwb0": { + "source": "iana" + }, + "audio/evrcwb1": { + "source": "iana" + }, + "audio/evs": { + "source": "iana" + }, + "audio/fwdred": { + "source": "iana" + }, + "audio/g711-0": { + "source": "iana" + }, + "audio/g719": { + "source": "iana" + }, + "audio/g722": { + "source": "iana" + }, + "audio/g7221": { + "source": "iana" + }, + "audio/g723": { + "source": "iana" + }, + "audio/g726-16": { + "source": "iana" + }, + "audio/g726-24": { + "source": "iana" + }, + "audio/g726-32": { + "source": "iana" + }, + "audio/g726-40": { + "source": "iana" + }, + "audio/g728": { + "source": "iana" + }, + "audio/g729": { + "source": "iana" + }, + "audio/g7291": { + "source": "iana" + }, + "audio/g729d": { + "source": "iana" + }, + "audio/g729e": { + "source": "iana" + }, + "audio/gsm": { + "source": "iana" + }, + "audio/gsm-efr": { + "source": "iana" + }, + "audio/gsm-hr-08": { + "source": "iana" + }, + "audio/ilbc": { + "source": "iana" + }, + "audio/ip-mr_v2.5": { + "source": "iana" + }, + "audio/isac": { + "source": "apache" + }, + "audio/l16": { + "source": "iana" + }, + "audio/l20": { + "source": "iana" + }, + "audio/l24": { + "source": "iana", + "compressible": false + }, + "audio/l8": { + "source": "iana" + }, + "audio/lpc": { + "source": "iana" + }, + "audio/midi": { + "source": "apache", + "extensions": ["mid","midi","kar","rmi"] + }, + "audio/mobile-xmf": { + "source": "iana" + }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, + "audio/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["m4a","mp4a"] + }, + "audio/mp4a-latm": { + "source": "iana" + }, + "audio/mpa": { + "source": "iana" + }, + "audio/mpa-robust": { + "source": "iana" + }, + "audio/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"] + }, + "audio/mpeg4-generic": { + "source": "iana" + }, + "audio/musepack": { + "source": "apache" + }, + "audio/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["oga","ogg","spx"] + }, + "audio/opus": { + "source": "iana" + }, + "audio/parityfec": { + "source": "iana" + }, + "audio/pcma": { + "source": "iana" + }, + "audio/pcma-wb": { + "source": "iana" + }, + "audio/pcmu": { + "source": "iana" + }, + "audio/pcmu-wb": { + "source": "iana" + }, + "audio/prs.sid": { + "source": "iana" + }, + "audio/qcelp": { + "source": "iana" + }, + "audio/raptorfec": { + "source": "iana" + }, + "audio/red": { + "source": "iana" + }, + "audio/rtp-enc-aescm128": { + "source": "iana" + }, + "audio/rtp-midi": { + "source": "iana" + }, + "audio/rtploopback": { + "source": "iana" + }, + "audio/rtx": { + "source": "iana" + }, + "audio/s3m": { + "source": "apache", + "extensions": ["s3m"] + }, + "audio/silk": { + "source": "apache", + "extensions": ["sil"] + }, + "audio/smv": { + "source": "iana" + }, + "audio/smv-qcp": { + "source": "iana" + }, + "audio/smv0": { + "source": "iana" + }, + "audio/sp-midi": { + "source": "iana" + }, + "audio/speex": { + "source": "iana" + }, + "audio/t140c": { + "source": "iana" + }, + "audio/t38": { + "source": "iana" + }, + "audio/telephone-event": { + "source": "iana" + }, + "audio/tone": { + "source": "iana" + }, + "audio/uemclip": { + "source": "iana" + }, + "audio/ulpfec": { + "source": "iana" + }, + "audio/vdvi": { + "source": "iana" + }, + "audio/vmr-wb": { + "source": "iana" + }, + "audio/vnd.3gpp.iufp": { + "source": "iana" + }, + "audio/vnd.4sb": { + "source": "iana" + }, + "audio/vnd.audiokoz": { + "source": "iana" + }, + "audio/vnd.celp": { + "source": "iana" + }, + "audio/vnd.cisco.nse": { + "source": "iana" + }, + "audio/vnd.cmles.radio-events": { + "source": "iana" + }, + "audio/vnd.cns.anp1": { + "source": "iana" + }, + "audio/vnd.cns.inf1": { + "source": "iana" + }, + "audio/vnd.dece.audio": { + "source": "iana", + "extensions": ["uva","uvva"] + }, + "audio/vnd.digital-winds": { + "source": "iana", + "extensions": ["eol"] + }, + "audio/vnd.dlna.adts": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.1": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.2": { + "source": "iana" + }, + "audio/vnd.dolby.mlp": { + "source": "iana" + }, + "audio/vnd.dolby.mps": { + "source": "iana" + }, + "audio/vnd.dolby.pl2": { + "source": "iana" + }, + "audio/vnd.dolby.pl2x": { + "source": "iana" + }, + "audio/vnd.dolby.pl2z": { + "source": "iana" + }, + "audio/vnd.dolby.pulse.1": { + "source": "iana" + }, + "audio/vnd.dra": { + "source": "iana", + "extensions": ["dra"] + }, + "audio/vnd.dts": { + "source": "iana", + "extensions": ["dts"] + }, + "audio/vnd.dts.hd": { + "source": "iana", + "extensions": ["dtshd"] + }, + "audio/vnd.dvb.file": { + "source": "iana" + }, + "audio/vnd.everad.plj": { + "source": "iana" + }, + "audio/vnd.hns.audio": { + "source": "iana" + }, + "audio/vnd.lucent.voice": { + "source": "iana", + "extensions": ["lvp"] + }, + "audio/vnd.ms-playready.media.pya": { + "source": "iana", + "extensions": ["pya"] + }, + "audio/vnd.nokia.mobile-xmf": { + "source": "iana" + }, + "audio/vnd.nortel.vbk": { + "source": "iana" + }, + "audio/vnd.nuera.ecelp4800": { + "source": "iana", + "extensions": ["ecelp4800"] + }, + "audio/vnd.nuera.ecelp7470": { + "source": "iana", + "extensions": ["ecelp7470"] + }, + "audio/vnd.nuera.ecelp9600": { + "source": "iana", + "extensions": ["ecelp9600"] + }, + "audio/vnd.octel.sbc": { + "source": "iana" + }, + "audio/vnd.qcelp": { + "source": "iana" + }, + "audio/vnd.rhetorex.32kadpcm": { + "source": "iana" + }, + "audio/vnd.rip": { + "source": "iana", + "extensions": ["rip"] + }, + "audio/vnd.rn-realaudio": { + "compressible": false + }, + "audio/vnd.sealedmedia.softseal.mpeg": { + "source": "iana" + }, + "audio/vnd.vmx.cvsd": { + "source": "iana" + }, + "audio/vnd.wave": { + "compressible": false + }, + "audio/vorbis": { + "source": "iana", + "compressible": false + }, + "audio/vorbis-config": { + "source": "iana" + }, + "audio/wav": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/wave": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/webm": { + "source": "apache", + "compressible": false, + "extensions": ["weba"] + }, + "audio/x-aac": { + "source": "apache", + "compressible": false, + "extensions": ["aac"] + }, + "audio/x-aiff": { + "source": "apache", + "extensions": ["aif","aiff","aifc"] + }, + "audio/x-caf": { + "source": "apache", + "compressible": false, + "extensions": ["caf"] + }, + "audio/x-flac": { + "source": "apache", + "extensions": ["flac"] + }, + "audio/x-m4a": { + "source": "nginx", + "extensions": ["m4a"] + }, + "audio/x-matroska": { + "source": "apache", + "extensions": ["mka"] + }, + "audio/x-mpegurl": { + "source": "apache", + "extensions": ["m3u"] + }, + "audio/x-ms-wax": { + "source": "apache", + "extensions": ["wax"] + }, + "audio/x-ms-wma": { + "source": "apache", + "extensions": ["wma"] + }, + "audio/x-pn-realaudio": { + "source": "apache", + "extensions": ["ram","ra"] + }, + "audio/x-pn-realaudio-plugin": { + "source": "apache", + "extensions": ["rmp"] + }, + "audio/x-realaudio": { + "source": "nginx", + "extensions": ["ra"] + }, + "audio/x-tta": { + "source": "apache" + }, + "audio/x-wav": { + "source": "apache", + "extensions": ["wav"] + }, + "audio/xm": { + "source": "apache", + "extensions": ["xm"] + }, + "chemical/x-cdx": { + "source": "apache", + "extensions": ["cdx"] + }, + "chemical/x-cif": { + "source": "apache", + "extensions": ["cif"] + }, + "chemical/x-cmdf": { + "source": "apache", + "extensions": ["cmdf"] + }, + "chemical/x-cml": { + "source": "apache", + "extensions": ["cml"] + }, + "chemical/x-csml": { + "source": "apache", + "extensions": ["csml"] + }, + "chemical/x-pdb": { + "source": "apache" + }, + "chemical/x-xyz": { + "source": "apache", + "extensions": ["xyz"] + }, + "font/opentype": { + "compressible": true, + "extensions": ["otf"] + }, + "image/bmp": { + "source": "iana", + "compressible": true, + "extensions": ["bmp"] + }, + "image/cgm": { + "source": "iana", + "extensions": ["cgm"] + }, + "image/dicom-rle": { + "source": "iana" + }, + "image/emf": { + "source": "iana" + }, + "image/fits": { + "source": "iana" + }, + "image/g3fax": { + "source": "iana", + "extensions": ["g3"] + }, + "image/gif": { + "source": "iana", + "compressible": false, + "extensions": ["gif"] + }, + "image/ief": { + "source": "iana", + "extensions": ["ief"] + }, + "image/jls": { + "source": "iana" + }, + "image/jp2": { + "source": "iana" + }, + "image/jpeg": { + "source": "iana", + "compressible": false, + "extensions": ["jpeg","jpg","jpe"] + }, + "image/jpm": { + "source": "iana" + }, + "image/jpx": { + "source": "iana" + }, + "image/ktx": { + "source": "iana", + "extensions": ["ktx"] + }, + "image/naplps": { + "source": "iana" + }, + "image/pjpeg": { + "compressible": false + }, + "image/png": { + "source": "iana", + "compressible": false, + "extensions": ["png"] + }, + "image/prs.btif": { + "source": "iana", + "extensions": ["btif"] + }, + "image/prs.pti": { + "source": "iana" + }, + "image/pwg-raster": { + "source": "iana" + }, + "image/sgi": { + "source": "apache", + "extensions": ["sgi"] + }, + "image/svg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["svg","svgz"] + }, + "image/t38": { + "source": "iana" + }, + "image/tiff": { + "source": "iana", + "compressible": false, + "extensions": ["tiff","tif"] + }, + "image/tiff-fx": { + "source": "iana" + }, + "image/vnd.adobe.photoshop": { + "source": "iana", + "compressible": true, + "extensions": ["psd"] + }, + "image/vnd.airzip.accelerator.azv": { + "source": "iana" + }, + "image/vnd.cns.inf2": { + "source": "iana" + }, + "image/vnd.dece.graphic": { + "source": "iana", + "extensions": ["uvi","uvvi","uvg","uvvg"] + }, + "image/vnd.djvu": { + "source": "iana", + "extensions": ["djvu","djv"] + }, + "image/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "image/vnd.dwg": { + "source": "iana", + "extensions": ["dwg"] + }, + "image/vnd.dxf": { + "source": "iana", + "extensions": ["dxf"] + }, + "image/vnd.fastbidsheet": { + "source": "iana", + "extensions": ["fbs"] + }, + "image/vnd.fpx": { + "source": "iana", + "extensions": ["fpx"] + }, + "image/vnd.fst": { + "source": "iana", + "extensions": ["fst"] + }, + "image/vnd.fujixerox.edmics-mmr": { + "source": "iana", + "extensions": ["mmr"] + }, + "image/vnd.fujixerox.edmics-rlc": { + "source": "iana", + "extensions": ["rlc"] + }, + "image/vnd.globalgraphics.pgb": { + "source": "iana" + }, + "image/vnd.microsoft.icon": { + "source": "iana" + }, + "image/vnd.mix": { + "source": "iana" + }, + "image/vnd.mozilla.apng": { + "source": "iana" + }, + "image/vnd.ms-modi": { + "source": "iana", + "extensions": ["mdi"] + }, + "image/vnd.ms-photo": { + "source": "apache", + "extensions": ["wdp"] + }, + "image/vnd.net-fpx": { + "source": "iana", + "extensions": ["npx"] + }, + "image/vnd.radiance": { + "source": "iana" + }, + "image/vnd.sealed.png": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.gif": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.jpg": { + "source": "iana" + }, + "image/vnd.svf": { + "source": "iana" + }, + "image/vnd.tencent.tap": { + "source": "iana" + }, + "image/vnd.valve.source.texture": { + "source": "iana" + }, + "image/vnd.wap.wbmp": { + "source": "iana", + "extensions": ["wbmp"] + }, + "image/vnd.xiff": { + "source": "iana", + "extensions": ["xif"] + }, + "image/vnd.zbrush.pcx": { + "source": "iana" + }, + "image/webp": { + "source": "apache", + "extensions": ["webp"] + }, + "image/wmf": { + "source": "iana" + }, + "image/x-3ds": { + "source": "apache", + "extensions": ["3ds"] + }, + "image/x-cmu-raster": { + "source": "apache", + "extensions": ["ras"] + }, + "image/x-cmx": { + "source": "apache", + "extensions": ["cmx"] + }, + "image/x-freehand": { + "source": "apache", + "extensions": ["fh","fhc","fh4","fh5","fh7"] + }, + "image/x-icon": { + "source": "apache", + "compressible": true, + "extensions": ["ico"] + }, + "image/x-jng": { + "source": "nginx", + "extensions": ["jng"] + }, + "image/x-mrsid-image": { + "source": "apache", + "extensions": ["sid"] + }, + "image/x-ms-bmp": { + "source": "nginx", + "compressible": true, + "extensions": ["bmp"] + }, + "image/x-pcx": { + "source": "apache", + "extensions": ["pcx"] + }, + "image/x-pict": { + "source": "apache", + "extensions": ["pic","pct"] + }, + "image/x-portable-anymap": { + "source": "apache", + "extensions": ["pnm"] + }, + "image/x-portable-bitmap": { + "source": "apache", + "extensions": ["pbm"] + }, + "image/x-portable-graymap": { + "source": "apache", + "extensions": ["pgm"] + }, + "image/x-portable-pixmap": { + "source": "apache", + "extensions": ["ppm"] + }, + "image/x-rgb": { + "source": "apache", + "extensions": ["rgb"] + }, + "image/x-tga": { + "source": "apache", + "extensions": ["tga"] + }, + "image/x-xbitmap": { + "source": "apache", + "extensions": ["xbm"] + }, + "image/x-xcf": { + "compressible": false + }, + "image/x-xpixmap": { + "source": "apache", + "extensions": ["xpm"] + }, + "image/x-xwindowdump": { + "source": "apache", + "extensions": ["xwd"] + }, + "message/cpim": { + "source": "iana" + }, + "message/delivery-status": { + "source": "iana" + }, + "message/disposition-notification": { + "source": "iana" + }, + "message/external-body": { + "source": "iana" + }, + "message/feedback-report": { + "source": "iana" + }, + "message/global": { + "source": "iana" + }, + "message/global-delivery-status": { + "source": "iana" + }, + "message/global-disposition-notification": { + "source": "iana" + }, + "message/global-headers": { + "source": "iana" + }, + "message/http": { + "source": "iana", + "compressible": false + }, + "message/imdn+xml": { + "source": "iana", + "compressible": true + }, + "message/news": { + "source": "iana" + }, + "message/partial": { + "source": "iana", + "compressible": false + }, + "message/rfc822": { + "source": "iana", + "compressible": true, + "extensions": ["eml","mime"] + }, + "message/s-http": { + "source": "iana" + }, + "message/sip": { + "source": "iana" + }, + "message/sipfrag": { + "source": "iana" + }, + "message/tracking-status": { + "source": "iana" + }, + "message/vnd.si.simp": { + "source": "iana" + }, + "message/vnd.wfa.wsc": { + "source": "iana" + }, + "model/gltf+json": { + "source": "iana", + "compressible": true + }, + "model/iges": { + "source": "iana", + "compressible": false, + "extensions": ["igs","iges"] + }, + "model/mesh": { + "source": "iana", + "compressible": false, + "extensions": ["msh","mesh","silo"] + }, + "model/vnd.collada+xml": { + "source": "iana", + "extensions": ["dae"] + }, + "model/vnd.dwf": { + "source": "iana", + "extensions": ["dwf"] + }, + "model/vnd.flatland.3dml": { + "source": "iana" + }, + "model/vnd.gdl": { + "source": "iana", + "extensions": ["gdl"] + }, + "model/vnd.gs-gdl": { + "source": "apache" + }, + "model/vnd.gs.gdl": { + "source": "iana" + }, + "model/vnd.gtw": { + "source": "iana", + "extensions": ["gtw"] + }, + "model/vnd.moml+xml": { + "source": "iana" + }, + "model/vnd.mts": { + "source": "iana", + "extensions": ["mts"] + }, + "model/vnd.opengex": { + "source": "iana" + }, + "model/vnd.parasolid.transmit.binary": { + "source": "iana" + }, + "model/vnd.parasolid.transmit.text": { + "source": "iana" + }, + "model/vnd.rosette.annotated-data-model": { + "source": "iana" + }, + "model/vnd.valve.source.compiled-map": { + "source": "iana" + }, + "model/vnd.vtu": { + "source": "iana", + "extensions": ["vtu"] + }, + "model/vrml": { + "source": "iana", + "compressible": false, + "extensions": ["wrl","vrml"] + }, + "model/x3d+binary": { + "source": "apache", + "compressible": false, + "extensions": ["x3db","x3dbz"] + }, + "model/x3d+fastinfoset": { + "source": "iana" + }, + "model/x3d+vrml": { + "source": "apache", + "compressible": false, + "extensions": ["x3dv","x3dvz"] + }, + "model/x3d+xml": { + "source": "iana", + "compressible": true, + "extensions": ["x3d","x3dz"] + }, + "model/x3d-vrml": { + "source": "iana" + }, + "multipart/alternative": { + "source": "iana", + "compressible": false + }, + "multipart/appledouble": { + "source": "iana" + }, + "multipart/byteranges": { + "source": "iana" + }, + "multipart/digest": { + "source": "iana" + }, + "multipart/encrypted": { + "source": "iana", + "compressible": false + }, + "multipart/form-data": { + "source": "iana", + "compressible": false + }, + "multipart/header-set": { + "source": "iana" + }, + "multipart/mixed": { + "source": "iana", + "compressible": false + }, + "multipart/parallel": { + "source": "iana" + }, + "multipart/related": { + "source": "iana", + "compressible": false + }, + "multipart/report": { + "source": "iana" + }, + "multipart/signed": { + "source": "iana", + "compressible": false + }, + "multipart/voice-message": { + "source": "iana" + }, + "multipart/x-mixed-replace": { + "source": "iana" + }, + "text/1d-interleaved-parityfec": { + "source": "iana" + }, + "text/cache-manifest": { + "source": "iana", + "compressible": true, + "extensions": ["appcache","manifest"] + }, + "text/calendar": { + "source": "iana", + "extensions": ["ics","ifb"] + }, + "text/calender": { + "compressible": true + }, + "text/cmd": { + "compressible": true + }, + "text/coffeescript": { + "extensions": ["coffee","litcoffee"] + }, + "text/css": { + "source": "iana", + "compressible": true, + "extensions": ["css"] + }, + "text/csv": { + "source": "iana", + "compressible": true, + "extensions": ["csv"] + }, + "text/csv-schema": { + "source": "iana" + }, + "text/directory": { + "source": "iana" + }, + "text/dns": { + "source": "iana" + }, + "text/ecmascript": { + "source": "iana" + }, + "text/encaprtp": { + "source": "iana" + }, + "text/enriched": { + "source": "iana" + }, + "text/fwdred": { + "source": "iana" + }, + "text/grammar-ref-list": { + "source": "iana" + }, + "text/hjson": { + "extensions": ["hjson"] + }, + "text/html": { + "source": "iana", + "compressible": true, + "extensions": ["html","htm","shtml"] + }, + "text/jade": { + "extensions": ["jade"] + }, + "text/javascript": { + "source": "iana", + "compressible": true + }, + "text/jcr-cnd": { + "source": "iana" + }, + "text/jsx": { + "compressible": true, + "extensions": ["jsx"] + }, + "text/less": { + "extensions": ["less"] + }, + "text/markdown": { + "source": "iana" + }, + "text/mathml": { + "source": "nginx", + "extensions": ["mml"] + }, + "text/mizar": { + "source": "iana" + }, + "text/n3": { + "source": "iana", + "compressible": true, + "extensions": ["n3"] + }, + "text/parameters": { + "source": "iana" + }, + "text/parityfec": { + "source": "iana" + }, + "text/plain": { + "source": "iana", + "compressible": true, + "extensions": ["txt","text","conf","def","list","log","in","ini"] + }, + "text/provenance-notation": { + "source": "iana" + }, + "text/prs.fallenstein.rst": { + "source": "iana" + }, + "text/prs.lines.tag": { + "source": "iana", + "extensions": ["dsc"] + }, + "text/prs.prop.logic": { + "source": "iana" + }, + "text/raptorfec": { + "source": "iana" + }, + "text/red": { + "source": "iana" + }, + "text/rfc822-headers": { + "source": "iana" + }, + "text/richtext": { + "source": "iana", + "compressible": true, + "extensions": ["rtx"] + }, + "text/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "text/rtp-enc-aescm128": { + "source": "iana" + }, + "text/rtploopback": { + "source": "iana" + }, + "text/rtx": { + "source": "iana" + }, + "text/sgml": { + "source": "iana", + "extensions": ["sgml","sgm"] + }, + "text/slim": { + "extensions": ["slim","slm"] + }, + "text/stylus": { + "extensions": ["stylus","styl"] + }, + "text/t140": { + "source": "iana" + }, + "text/tab-separated-values": { + "source": "iana", + "compressible": true, + "extensions": ["tsv"] + }, + "text/troff": { + "source": "iana", + "extensions": ["t","tr","roff","man","me","ms"] + }, + "text/turtle": { + "source": "iana", + "extensions": ["ttl"] + }, + "text/ulpfec": { + "source": "iana" + }, + "text/uri-list": { + "source": "iana", + "compressible": true, + "extensions": ["uri","uris","urls"] + }, + "text/vcard": { + "source": "iana", + "compressible": true, + "extensions": ["vcard"] + }, + "text/vnd.a": { + "source": "iana" + }, + "text/vnd.abc": { + "source": "iana" + }, + "text/vnd.ascii-art": { + "source": "iana" + }, + "text/vnd.curl": { + "source": "iana", + "extensions": ["curl"] + }, + "text/vnd.curl.dcurl": { + "source": "apache", + "extensions": ["dcurl"] + }, + "text/vnd.curl.mcurl": { + "source": "apache", + "extensions": ["mcurl"] + }, + "text/vnd.curl.scurl": { + "source": "apache", + "extensions": ["scurl"] + }, + "text/vnd.debian.copyright": { + "source": "iana" + }, + "text/vnd.dmclientscript": { + "source": "iana" + }, + "text/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "text/vnd.esmertec.theme-descriptor": { + "source": "iana" + }, + "text/vnd.fly": { + "source": "iana", + "extensions": ["fly"] + }, + "text/vnd.fmi.flexstor": { + "source": "iana", + "extensions": ["flx"] + }, + "text/vnd.graphviz": { + "source": "iana", + "extensions": ["gv"] + }, + "text/vnd.in3d.3dml": { + "source": "iana", + "extensions": ["3dml"] + }, + "text/vnd.in3d.spot": { + "source": "iana", + "extensions": ["spot"] + }, + "text/vnd.iptc.newsml": { + "source": "iana" + }, + "text/vnd.iptc.nitf": { + "source": "iana" + }, + "text/vnd.latex-z": { + "source": "iana" + }, + "text/vnd.motorola.reflex": { + "source": "iana" + }, + "text/vnd.ms-mediapackage": { + "source": "iana" + }, + "text/vnd.net2phone.commcenter.command": { + "source": "iana" + }, + "text/vnd.radisys.msml-basic-layout": { + "source": "iana" + }, + "text/vnd.si.uricatalogue": { + "source": "iana" + }, + "text/vnd.sun.j2me.app-descriptor": { + "source": "iana", + "extensions": ["jad"] + }, + "text/vnd.trolltech.linguist": { + "source": "iana" + }, + "text/vnd.wap.si": { + "source": "iana" + }, + "text/vnd.wap.sl": { + "source": "iana" + }, + "text/vnd.wap.wml": { + "source": "iana", + "extensions": ["wml"] + }, + "text/vnd.wap.wmlscript": { + "source": "iana", + "extensions": ["wmls"] + }, + "text/vtt": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["vtt"] + }, + "text/x-asm": { + "source": "apache", + "extensions": ["s","asm"] + }, + "text/x-c": { + "source": "apache", + "extensions": ["c","cc","cxx","cpp","h","hh","dic"] + }, + "text/x-component": { + "source": "nginx", + "extensions": ["htc"] + }, + "text/x-fortran": { + "source": "apache", + "extensions": ["f","for","f77","f90"] + }, + "text/x-gwt-rpc": { + "compressible": true + }, + "text/x-handlebars-template": { + "extensions": ["hbs"] + }, + "text/x-java-source": { + "source": "apache", + "extensions": ["java"] + }, + "text/x-jquery-tmpl": { + "compressible": true + }, + "text/x-lua": { + "extensions": ["lua"] + }, + "text/x-markdown": { + "compressible": true, + "extensions": ["markdown","md","mkd"] + }, + "text/x-nfo": { + "source": "apache", + "extensions": ["nfo"] + }, + "text/x-opml": { + "source": "apache", + "extensions": ["opml"] + }, + "text/x-pascal": { + "source": "apache", + "extensions": ["p","pas"] + }, + "text/x-processing": { + "compressible": true, + "extensions": ["pde"] + }, + "text/x-sass": { + "extensions": ["sass"] + }, + "text/x-scss": { + "extensions": ["scss"] + }, + "text/x-setext": { + "source": "apache", + "extensions": ["etx"] + }, + "text/x-sfv": { + "source": "apache", + "extensions": ["sfv"] + }, + "text/x-suse-ymp": { + "compressible": true, + "extensions": ["ymp"] + }, + "text/x-uuencode": { + "source": "apache", + "extensions": ["uu"] + }, + "text/x-vcalendar": { + "source": "apache", + "extensions": ["vcs"] + }, + "text/x-vcard": { + "source": "apache", + "extensions": ["vcf"] + }, + "text/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml"] + }, + "text/xml-external-parsed-entity": { + "source": "iana" + }, + "text/yaml": { + "extensions": ["yaml","yml"] + }, + "video/1d-interleaved-parityfec": { + "source": "apache" + }, + "video/3gpp": { + "source": "apache", + "extensions": ["3gp","3gpp"] + }, + "video/3gpp-tt": { + "source": "apache" + }, + "video/3gpp2": { + "source": "apache", + "extensions": ["3g2"] + }, + "video/bmpeg": { + "source": "apache" + }, + "video/bt656": { + "source": "apache" + }, + "video/celb": { + "source": "apache" + }, + "video/dv": { + "source": "apache" + }, + "video/encaprtp": { + "source": "apache" + }, + "video/h261": { + "source": "apache", + "extensions": ["h261"] + }, + "video/h263": { + "source": "apache", + "extensions": ["h263"] + }, + "video/h263-1998": { + "source": "apache" + }, + "video/h263-2000": { + "source": "apache" + }, + "video/h264": { + "source": "apache", + "extensions": ["h264"] + }, + "video/h264-rcdo": { + "source": "apache" + }, + "video/h264-svc": { + "source": "apache" + }, + "video/h265": { + "source": "apache" + }, + "video/iso.segment": { + "source": "apache" + }, + "video/jpeg": { + "source": "apache", + "extensions": ["jpgv"] + }, + "video/jpeg2000": { + "source": "apache" + }, + "video/jpm": { + "source": "apache", + "extensions": ["jpm","jpgm"] + }, + "video/mj2": { + "source": "apache", + "extensions": ["mj2","mjp2"] + }, + "video/mp1s": { + "source": "apache" + }, + "video/mp2p": { + "source": "apache" + }, + "video/mp2t": { + "source": "apache", + "extensions": ["ts"] + }, + "video/mp4": { + "source": "apache", + "compressible": false, + "extensions": ["mp4","mp4v","mpg4"] + }, + "video/mp4v-es": { + "source": "apache" + }, + "video/mpeg": { + "source": "apache", + "compressible": false, + "extensions": ["mpeg","mpg","mpe","m1v","m2v"] + }, + "video/mpeg4-generic": { + "source": "apache" + }, + "video/mpv": { + "source": "apache" + }, + "video/nv": { + "source": "apache" + }, + "video/ogg": { + "source": "apache", + "compressible": false, + "extensions": ["ogv"] + }, + "video/parityfec": { + "source": "apache" + }, + "video/pointer": { + "source": "apache" + }, + "video/quicktime": { + "source": "apache", + "compressible": false, + "extensions": ["qt","mov"] + }, + "video/raptorfec": { + "source": "apache" + }, + "video/raw": { + "source": "apache" + }, + "video/rtp-enc-aescm128": { + "source": "apache" + }, + "video/rtploopback": { + "source": "apache" + }, + "video/rtx": { + "source": "apache" + }, + "video/smpte292m": { + "source": "apache" + }, + "video/ulpfec": { + "source": "apache" + }, + "video/vc1": { + "source": "apache" + }, + "video/vnd.cctv": { + "source": "apache" + }, + "video/vnd.dece.hd": { + "source": "apache", + "extensions": ["uvh","uvvh"] + }, + "video/vnd.dece.mobile": { + "source": "apache", + "extensions": ["uvm","uvvm"] + }, + "video/vnd.dece.mp4": { + "source": "apache" + }, + "video/vnd.dece.pd": { + "source": "apache", + "extensions": ["uvp","uvvp"] + }, + "video/vnd.dece.sd": { + "source": "apache", + "extensions": ["uvs","uvvs"] + }, + "video/vnd.dece.video": { + "source": "apache", + "extensions": ["uvv","uvvv"] + }, + "video/vnd.directv.mpeg": { + "source": "apache" + }, + "video/vnd.directv.mpeg-tts": { + "source": "apache" + }, + "video/vnd.dlna.mpeg-tts": { + "source": "apache" + }, + "video/vnd.dvb.file": { + "source": "apache", + "extensions": ["dvb"] + }, + "video/vnd.fvt": { + "source": "apache", + "extensions": ["fvt"] + }, + "video/vnd.hns.video": { + "source": "apache" + }, + "video/vnd.iptvforum.1dparityfec-1010": { + "source": "apache" + }, + "video/vnd.iptvforum.1dparityfec-2005": { + "source": "apache" + }, + "video/vnd.iptvforum.2dparityfec-1010": { + "source": "apache" + }, + "video/vnd.iptvforum.2dparityfec-2005": { + "source": "apache" + }, + "video/vnd.iptvforum.ttsavc": { + "source": "apache" + }, + "video/vnd.iptvforum.ttsmpeg2": { + "source": "apache" + }, + "video/vnd.motorola.video": { + "source": "apache" + }, + "video/vnd.motorola.videop": { + "source": "apache" + }, + "video/vnd.mpegurl": { + "source": "apache", + "extensions": ["mxu","m4u"] + }, + "video/vnd.ms-playready.media.pyv": { + "source": "apache", + "extensions": ["pyv"] + }, + "video/vnd.nokia.interleaved-multimedia": { + "source": "apache" + }, + "video/vnd.nokia.videovoip": { + "source": "apache" + }, + "video/vnd.objectvideo": { + "source": "apache" + }, + "video/vnd.radgamettools.bink": { + "source": "apache" + }, + "video/vnd.radgamettools.smacker": { + "source": "apache" + }, + "video/vnd.sealed.mpeg1": { + "source": "apache" + }, + "video/vnd.sealed.mpeg4": { + "source": "apache" + }, + "video/vnd.sealed.swf": { + "source": "apache" + }, + "video/vnd.sealedmedia.softseal.mov": { + "source": "apache" + }, + "video/vnd.uvvu.mp4": { + "source": "apache", + "extensions": ["uvu","uvvu"] + }, + "video/vnd.vivo": { + "source": "apache", + "extensions": ["viv"] + }, + "video/vp8": { + "source": "apache" + }, + "video/webm": { + "source": "apache", + "compressible": false, + "extensions": ["webm"] + }, + "video/x-f4v": { + "source": "apache", + "extensions": ["f4v"] + }, + "video/x-fli": { + "source": "apache", + "extensions": ["fli"] + }, + "video/x-flv": { + "source": "apache", + "compressible": false, + "extensions": ["flv"] + }, + "video/x-m4v": { + "source": "apache", + "extensions": ["m4v"] + }, + "video/x-matroska": { + "source": "apache", + "compressible": false, + "extensions": ["mkv","mk3d","mks"] + }, + "video/x-mng": { + "source": "apache", + "extensions": ["mng"] + }, + "video/x-ms-asf": { + "source": "apache", + "extensions": ["asf","asx"] + }, + "video/x-ms-vob": { + "source": "apache", + "extensions": ["vob"] + }, + "video/x-ms-wm": { + "source": "apache", + "extensions": ["wm"] + }, + "video/x-ms-wmv": { + "source": "apache", + "compressible": false, + "extensions": ["wmv"] + }, + "video/x-ms-wmx": { + "source": "apache", + "extensions": ["wmx"] + }, + "video/x-ms-wvx": { + "source": "apache", + "extensions": ["wvx"] + }, + "video/x-msvideo": { + "source": "apache", + "extensions": ["avi"] + }, + "video/x-sgi-movie": { + "source": "apache", + "extensions": ["movie"] + }, + "video/x-smv": { + "source": "apache", + "extensions": ["smv"] + }, + "x-conference/x-cooltalk": { + "source": "apache", + "extensions": ["ice"] + }, + "x-shader/x-fragment": { + "compressible": true + }, + "x-shader/x-vertex": { + "compressible": true + } +} diff --git a/node_modules/mime-db/index.js b/node_modules/mime-db/index.js new file mode 100644 index 0000000..551031f --- /dev/null +++ b/node_modules/mime-db/index.js @@ -0,0 +1,11 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json') diff --git a/node_modules/mime-db/package.json b/node_modules/mime-db/package.json new file mode 100644 index 0000000..724a009 --- /dev/null +++ b/node_modules/mime-db/package.json @@ -0,0 +1,138 @@ +{ + "_args": [ + [ + { + "raw": "mime-db@~1.26.0", + "scope": null, + "escapedName": "mime-db", + "name": "mime-db", + "rawSpec": "~1.26.0", + "spec": ">=1.26.0 <1.27.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/mime-types" + ] + ], + "_from": "mime-db@>=1.26.0 <1.27.0", + "_id": "mime-db@1.26.0", + "_inCache": true, + "_location": "/mime-db", + "_nodeVersion": "4.6.1", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/mime-db-1.26.0.tgz_1484453096877_0.39498970191925764" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "mime-db@~1.26.0", + "scope": null, + "escapedName": "mime-db", + "name": "mime-db", + "rawSpec": "~1.26.0", + "spec": ">=1.26.0 <1.27.0", + "type": "range" + }, + "_requiredBy": [ + "/mime-types" + ], + "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.26.0.tgz", + "_shasum": "eaffcd0e4fc6935cf8134da246e2e6c35305adff", + "_shrinkwrap": null, + "_spec": "mime-db@~1.26.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/mime-types", + "bugs": { + "url": "https://github.com/jshttp/mime-db/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + } + ], + "dependencies": {}, + "description": "Media Type Database", + "devDependencies": { + "bluebird": "3.4.7", + "co": "4.6.0", + "cogent": "1.0.1", + "csv-parse": "1.1.9", + "eslint": "3.13.1", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.3.0", + "eslint-plugin-standard": "2.0.1", + "gnode": "0.1.2", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "raw-body": "2.2.0", + "stream-to-array": "2.3.0" + }, + "directories": {}, + "dist": { + "shasum": "eaffcd0e4fc6935cf8134da246e2e6c35305adff", + "tarball": "https://registry.npmjs.org/mime-db/-/mime-db-1.26.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "db.json", + "index.js" + ], + "gitHead": "1d9ff30e45b07a506a20f25df3a3c7106d219e24", + "homepage": "https://github.com/jshttp/mime-db#readme", + "keywords": [ + "mime", + "db", + "type", + "types", + "database", + "charset", + "charsets" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "mime-db", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-db.git" + }, + "scripts": { + "build": "node scripts/build", + "fetch": "gnode scripts/fetch-apache && gnode scripts/fetch-iana && gnode scripts/fetch-nginx", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "update": "npm run fetch && npm run build" + }, + "version": "1.26.0" +} diff --git a/node_modules/mime-types/HISTORY.md b/node_modules/mime-types/HISTORY.md new file mode 100644 index 0000000..85b59f0 --- /dev/null +++ b/node_modules/mime-types/HISTORY.md @@ -0,0 +1,216 @@ +2.1.14 / 2017-01-14 +=================== + + * deps: mime-db@~1.26.0 + - Add new mime types + +2.1.13 / 2016-11-18 +=================== + + * deps: mime-db@~1.25.0 + - Add new mime types + +2.1.12 / 2016-09-18 +=================== + + * deps: mime-db@~1.24.0 + - Add new mime types + - Add `audio/mp3` + +2.1.11 / 2016-05-01 +=================== + + * deps: mime-db@~1.23.0 + - Add new mime types + +2.1.10 / 2016-02-15 +=================== + + * deps: mime-db@~1.22.0 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +2.1.9 / 2016-01-06 +================== + + * deps: mime-db@~1.21.0 + - Add new mime types + +2.1.8 / 2015-11-30 +================== + + * deps: mime-db@~1.20.0 + - Add new mime types + +2.1.7 / 2015-09-20 +================== + + * deps: mime-db@~1.19.0 + - Add new mime types + +2.1.6 / 2015-09-03 +================== + + * deps: mime-db@~1.18.0 + - Add new mime types + +2.1.5 / 2015-08-20 +================== + + * deps: mime-db@~1.17.0 + - Add new mime types + +2.1.4 / 2015-07-30 +================== + + * deps: mime-db@~1.16.0 + - Add new mime types + +2.1.3 / 2015-07-13 +================== + + * deps: mime-db@~1.15.0 + - Add new mime types + +2.1.2 / 2015-06-25 +================== + + * deps: mime-db@~1.14.0 + - Add new mime types + +2.1.1 / 2015-06-08 +================== + + * perf: fix deopt during mapping + +2.1.0 / 2015-06-07 +================== + + * Fix incorrectly treating extension-less file name as extension + - i.e. `'path/to/json'` will no longer return `application/json` + * Fix `.charset(type)` to accept parameters + * Fix `.charset(type)` to match case-insensitive + * Improve generation of extension to MIME mapping + * Refactor internals for readability and no argument reassignment + * Prefer `application/*` MIME types from the same source + * Prefer any type over `application/octet-stream` + * deps: mime-db@~1.13.0 + - Add nginx as a source + - Add new mime types + +2.0.14 / 2015-06-06 +=================== + + * deps: mime-db@~1.12.0 + - Add new mime types + +2.0.13 / 2015-05-31 +=================== + + * deps: mime-db@~1.11.0 + - Add new mime types + +2.0.12 / 2015-05-19 +=================== + + * deps: mime-db@~1.10.0 + - Add new mime types + +2.0.11 / 2015-05-05 +=================== + + * deps: mime-db@~1.9.1 + - Add new mime types + +2.0.10 / 2015-03-13 +=================== + + * deps: mime-db@~1.8.0 + - Add new mime types + +2.0.9 / 2015-02-09 +================== + + * deps: mime-db@~1.7.0 + - Add new mime types + - Community extensions ownership transferred from `node-mime` + +2.0.8 / 2015-01-29 +================== + + * deps: mime-db@~1.6.0 + - Add new mime types + +2.0.7 / 2014-12-30 +================== + + * deps: mime-db@~1.5.0 + - Add new mime types + - Fix various invalid MIME type entries + +2.0.6 / 2014-12-30 +================== + + * deps: mime-db@~1.4.0 + - Add new mime types + - Fix various invalid MIME type entries + - Remove example template MIME types + +2.0.5 / 2014-12-29 +================== + + * deps: mime-db@~1.3.1 + - Fix missing extensions + +2.0.4 / 2014-12-10 +================== + + * deps: mime-db@~1.3.0 + - Add new mime types + +2.0.3 / 2014-11-09 +================== + + * deps: mime-db@~1.2.0 + - Add new mime types + +2.0.2 / 2014-09-28 +================== + + * deps: mime-db@~1.1.0 + - Add new mime types + - Add additional compressible + - Update charsets + +2.0.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + +2.0.0 / 2014-09-02 +================== + + * Use `mime-db` + * Remove `.define()` + +1.0.2 / 2014-08-04 +================== + + * Set charset=utf-8 for `text/javascript` + +1.0.1 / 2014-06-24 +================== + + * Add `text/jsx` type + +1.0.0 / 2014-05-12 +================== + + * Return `false` for unknown types + * Set charset=utf-8 for `application/json` + +0.1.0 / 2014-05-02 +================== + + * Initial release diff --git a/node_modules/mime-types/LICENSE b/node_modules/mime-types/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/mime-types/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mime-types/README.md b/node_modules/mime-types/README.md new file mode 100644 index 0000000..e77d615 --- /dev/null +++ b/node_modules/mime-types/README.md @@ -0,0 +1,103 @@ +# mime-types + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +The ultimate javascript content-type utility. + +Similar to [node-mime](https://github.com/broofa/node-mime), except: + +- __No fallbacks.__ Instead of naively returning the first available type, `mime-types` simply returns `false`, + so do `var type = mime.lookup('unrecognized') || 'application/octet-stream'`. +- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`. +- Additional mime types are added such as jade and stylus via [mime-db](https://github.com/jshttp/mime-db) +- No `.define()` functionality + +Otherwise, the API is compatible. + +## Install + +```sh +$ npm install mime-types +``` + +## Adding Types + +All mime types are based on [mime-db](https://github.com/jshttp/mime-db), +so open a PR there if you'd like to add mime types. + +## API + +```js +var mime = require('mime-types') +``` + +All functions return `false` if input is invalid or not found. + +### mime.lookup(path) + +Lookup the content-type associated with a file. + +```js +mime.lookup('json') // 'application/json' +mime.lookup('.md') // 'text/x-markdown' +mime.lookup('file.html') // 'text/html' +mime.lookup('folder/file.js') // 'application/javascript' +mime.lookup('folder/.htaccess') // false + +mime.lookup('cats') // false +``` + +### mime.contentType(type) + +Create a full content-type header given a content-type or extension. + +```js +mime.contentType('markdown') // 'text/x-markdown; charset=utf-8' +mime.contentType('file.json') // 'application/json; charset=utf-8' + +// from a full path +mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8' +``` + +### mime.extension(type) + +Get the default extension for a content-type. + +```js +mime.extension('application/octet-stream') // 'bin' +``` + +### mime.charset(type) + +Lookup the implied default charset of a content-type. + +```js +mime.charset('text/x-markdown') // 'UTF-8' +``` + +### var type = mime.types[extension] + +A map of content-types by extension. + +### [extensions...] = mime.extensions[type] + +A map of extensions by content-type. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/mime-types.svg +[npm-url]: https://npmjs.org/package/mime-types +[node-version-image]: https://img.shields.io/node/v/mime-types.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/mime-types/master.svg +[travis-url]: https://travis-ci.org/jshttp/mime-types +[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-types/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/mime-types +[downloads-image]: https://img.shields.io/npm/dm/mime-types.svg +[downloads-url]: https://npmjs.org/package/mime-types diff --git a/node_modules/mime-types/index.js b/node_modules/mime-types/index.js new file mode 100644 index 0000000..9226ca5 --- /dev/null +++ b/node_modules/mime-types/index.js @@ -0,0 +1,188 @@ +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var db = require('mime-db') +var extname = require('path').extname + +/** + * Module variables. + * @private + */ + +var extractTypeRegExp = /^\s*([^;\s]*)(?:;|\s|$)/ +var textTypeRegExp = /^text\//i + +/** + * Module exports. + * @public + */ + +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) + +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) + +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = extractTypeRegExp.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset + } + + // default text/* to utf-8 + if (match && textTypeRegExp.test(match[1])) { + return 'UTF-8' + } + + return false +} + +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false + } + + var mime = str.indexOf('/') === -1 + ? exports.lookup(str) + : str + + if (!mime) { + return false + } + + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } + + return mime +} + +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = extractTypeRegExp.exec(type) + + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] + + if (!exts || !exts.length) { + return false + } + + return exts[0] +} + +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ + +function lookup (path) { + if (!path || typeof path !== 'string') { + return false + } + + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .substr(1) + + if (!extension) { + return false + } + + return exports.types[extension] || false +} + +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + // source preference (least -> most) + var preference = ['nginx', 'apache', undefined, 'iana'] + + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return + } + + // mime -> extensions + extensions[type] = exts + + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] + + if (types[extension]) { + var from = preference.indexOf(db[types[extension]].source) + var to = preference.indexOf(mime.source) + + if (types[extension] !== 'application/octet-stream' && + from > to || (from === to && types[extension].substr(0, 12) === 'application/')) { + // skip the remapping + continue + } + } + + // set the extension -> mime + types[extension] = type + } + }) +} diff --git a/node_modules/mime-types/package.json b/node_modules/mime-types/package.json new file mode 100644 index 0000000..04dcf49 --- /dev/null +++ b/node_modules/mime-types/package.json @@ -0,0 +1,128 @@ +{ + "_args": [ + [ + { + "raw": "mime-types@~2.1.11", + "scope": null, + "escapedName": "mime-types", + "name": "mime-types", + "rawSpec": "~2.1.11", + "spec": ">=2.1.11 <2.2.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/accepts" + ] + ], + "_from": "mime-types@>=2.1.11 <2.2.0", + "_id": "mime-types@2.1.14", + "_inCache": true, + "_location": "/mime-types", + "_nodeVersion": "4.6.1", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/mime-types-2.1.14.tgz_1484458141358_0.7563668976072222" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "mime-types@~2.1.11", + "scope": null, + "escapedName": "mime-types", + "name": "mime-types", + "rawSpec": "~2.1.11", + "spec": ">=2.1.11 <2.2.0", + "type": "range" + }, + "_requiredBy": [ + "/accepts", + "/type-is" + ], + "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.14.tgz", + "_shasum": "f7ef7d97583fcaf3b7d282b6f8b5679dab1e94ee", + "_shrinkwrap": null, + "_spec": "mime-types@~2.1.11", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/mime-types/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jeremiah Senkpiel", + "email": "fishrock123@rocketmail.com", + "url": "https://searchbeam.jit.su" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-db": "~1.26.0" + }, + "description": "The ultimate javascript content-type utility.", + "devDependencies": { + "eslint": "3.13.1", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.4.0", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "f7ef7d97583fcaf3b7d282b6f8b5679dab1e94ee", + "tarball": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.14.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "gitHead": "d7d15e50fe6b3a2da79d855015d25efa50e9f157", + "homepage": "https://github.com/jshttp/mime-types#readme", + "keywords": [ + "mime", + "types" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "fishrock123", + "email": "fishrock123@rocketmail.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "mime-types", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-types.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec test/test.js", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/test.js", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot test/test.js" + }, + "version": "2.1.14" +} diff --git a/node_modules/mime/.npmignore b/node_modules/mime/.npmignore new file mode 100644 index 0000000..e69de29 diff --git a/node_modules/mime/LICENSE b/node_modules/mime/LICENSE new file mode 100644 index 0000000..451fc45 --- /dev/null +++ b/node_modules/mime/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2010 Benjamin Thomas, Robert Kieffer + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mime/README.md b/node_modules/mime/README.md new file mode 100644 index 0000000..506fbe5 --- /dev/null +++ b/node_modules/mime/README.md @@ -0,0 +1,90 @@ +# mime + +Comprehensive MIME type mapping API based on mime-db module. + +## Install + +Install with [npm](http://github.com/isaacs/npm): + + npm install mime + +## Contributing / Testing + + npm run test + +## Command Line + + mime [path_string] + +E.g. + + > mime scripts/jquery.js + application/javascript + +## API - Queries + +### mime.lookup(path) +Get the mime type associated with a file, if no mime type is found `application/octet-stream` is returned. Performs a case-insensitive lookup using the extension in `path` (the substring after the last '/' or '.'). E.g. + +```js +var mime = require('mime'); + +mime.lookup('/path/to/file.txt'); // => 'text/plain' +mime.lookup('file.txt'); // => 'text/plain' +mime.lookup('.TXT'); // => 'text/plain' +mime.lookup('htm'); // => 'text/html' +``` + +### mime.default_type +Sets the mime type returned when `mime.lookup` fails to find the extension searched for. (Default is `application/octet-stream`.) + +### mime.extension(type) +Get the default extension for `type` + +```js +mime.extension('text/html'); // => 'html' +mime.extension('application/octet-stream'); // => 'bin' +``` + +### mime.charsets.lookup() + +Map mime-type to charset + +```js +mime.charsets.lookup('text/plain'); // => 'UTF-8' +``` + +(The logic for charset lookups is pretty rudimentary. Feel free to suggest improvements.) + +## API - Defining Custom Types + +Custom type mappings can be added on a per-project basis via the following APIs. + +### mime.define() + +Add custom mime/extension mappings + +```js +mime.define({ + 'text/x-some-format': ['x-sf', 'x-sft', 'x-sfml'], + 'application/x-my-type': ['x-mt', 'x-mtt'], + // etc ... +}); + +mime.lookup('x-sft'); // => 'text/x-some-format' +``` + +The first entry in the extensions array is returned by `mime.extension()`. E.g. + +```js +mime.extension('text/x-some-format'); // => 'x-sf' +``` + +### mime.load(filepath) + +Load mappings from an Apache ".types" format file + +```js +mime.load('./my_project.types'); +``` +The .types file format is simple - See the `types` dir for examples. diff --git a/node_modules/mime/build/build.js b/node_modules/mime/build/build.js new file mode 100644 index 0000000..ed5313e --- /dev/null +++ b/node_modules/mime/build/build.js @@ -0,0 +1,11 @@ +var db = require('mime-db'); + +var mapByType = {}; +Object.keys(db).forEach(function(key) { + var extensions = db[key].extensions; + if (extensions) { + mapByType[key] = extensions; + } +}); + +console.log(JSON.stringify(mapByType)); diff --git a/node_modules/mime/build/test.js b/node_modules/mime/build/test.js new file mode 100644 index 0000000..58b9ba7 --- /dev/null +++ b/node_modules/mime/build/test.js @@ -0,0 +1,57 @@ +/** + * Usage: node test.js + */ + +var mime = require('../mime'); +var assert = require('assert'); +var path = require('path'); + +// +// Test mime lookups +// + +assert.equal('text/plain', mime.lookup('text.txt')); // normal file +assert.equal('text/plain', mime.lookup('TEXT.TXT')); // uppercase +assert.equal('text/plain', mime.lookup('dir/text.txt')); // dir + file +assert.equal('text/plain', mime.lookup('.text.txt')); // hidden file +assert.equal('text/plain', mime.lookup('.txt')); // nameless +assert.equal('text/plain', mime.lookup('txt')); // extension-only +assert.equal('text/plain', mime.lookup('/txt')); // extension-less () +assert.equal('text/plain', mime.lookup('\\txt')); // Windows, extension-less +assert.equal('application/octet-stream', mime.lookup('text.nope')); // unrecognized +assert.equal('fallback', mime.lookup('text.fallback', 'fallback')); // alternate default + +// +// Test extensions +// + +assert.equal('txt', mime.extension(mime.types.text)); +assert.equal('html', mime.extension(mime.types.htm)); +assert.equal('bin', mime.extension('application/octet-stream')); +assert.equal('bin', mime.extension('application/octet-stream ')); +assert.equal('html', mime.extension(' text/html; charset=UTF-8')); +assert.equal('html', mime.extension('text/html; charset=UTF-8 ')); +assert.equal('html', mime.extension('text/html; charset=UTF-8')); +assert.equal('html', mime.extension('text/html ; charset=UTF-8')); +assert.equal('html', mime.extension('text/html;charset=UTF-8')); +assert.equal('html', mime.extension('text/Html;charset=UTF-8')); +assert.equal(undefined, mime.extension('unrecognized')); + +// +// Test node.types lookups +// + +assert.equal('application/font-woff', mime.lookup('file.woff')); +assert.equal('application/octet-stream', mime.lookup('file.buffer')); +assert.equal('audio/mp4', mime.lookup('file.m4a')); +assert.equal('font/opentype', mime.lookup('file.otf')); + +// +// Test charsets +// + +assert.equal('UTF-8', mime.charsets.lookup('text/plain')); +assert.equal(undefined, mime.charsets.lookup(mime.types.js)); +assert.equal('fallback', mime.charsets.lookup('application/octet-stream', 'fallback')); + +console.log('\nAll tests passed'); diff --git a/node_modules/mime/cli.js b/node_modules/mime/cli.js new file mode 100755 index 0000000..20b1ffe --- /dev/null +++ b/node_modules/mime/cli.js @@ -0,0 +1,8 @@ +#!/usr/bin/env node + +var mime = require('./mime.js'); +var file = process.argv[2]; +var type = mime.lookup(file); + +process.stdout.write(type + '\n'); + diff --git a/node_modules/mime/mime.js b/node_modules/mime/mime.js new file mode 100644 index 0000000..341b6a5 --- /dev/null +++ b/node_modules/mime/mime.js @@ -0,0 +1,108 @@ +var path = require('path'); +var fs = require('fs'); + +function Mime() { + // Map of extension -> mime type + this.types = Object.create(null); + + // Map of mime type -> extension + this.extensions = Object.create(null); +} + +/** + * Define mimetype -> extension mappings. Each key is a mime-type that maps + * to an array of extensions associated with the type. The first extension is + * used as the default extension for the type. + * + * e.g. mime.define({'audio/ogg', ['oga', 'ogg', 'spx']}); + * + * @param map (Object) type definitions + */ +Mime.prototype.define = function (map) { + for (var type in map) { + var exts = map[type]; + for (var i = 0; i < exts.length; i++) { + if (process.env.DEBUG_MIME && this.types[exts]) { + console.warn(this._loading.replace(/.*\//, ''), 'changes "' + exts[i] + '" extension type from ' + + this.types[exts] + ' to ' + type); + } + + this.types[exts[i]] = type; + } + + // Default extension is the first one we encounter + if (!this.extensions[type]) { + this.extensions[type] = exts[0]; + } + } +}; + +/** + * Load an Apache2-style ".types" file + * + * This may be called multiple times (it's expected). Where files declare + * overlapping types/extensions, the last file wins. + * + * @param file (String) path of file to load. + */ +Mime.prototype.load = function(file) { + this._loading = file; + // Read file and split into lines + var map = {}, + content = fs.readFileSync(file, 'ascii'), + lines = content.split(/[\r\n]+/); + + lines.forEach(function(line) { + // Clean up whitespace/comments, and split into fields + var fields = line.replace(/\s*#.*|^\s*|\s*$/g, '').split(/\s+/); + map[fields.shift()] = fields; + }); + + this.define(map); + + this._loading = null; +}; + +/** + * Lookup a mime type based on extension + */ +Mime.prototype.lookup = function(path, fallback) { + var ext = path.replace(/.*[\.\/\\]/, '').toLowerCase(); + + return this.types[ext] || fallback || this.default_type; +}; + +/** + * Return file extension associated with a mime type + */ +Mime.prototype.extension = function(mimeType) { + var type = mimeType.match(/^\s*([^;\s]*)(?:;|\s|$)/)[1].toLowerCase(); + return this.extensions[type]; +}; + +// Default instance +var mime = new Mime(); + +// Define built-in types +mime.define(require('./types.json')); + +// Default type +mime.default_type = mime.lookup('bin'); + +// +// Additional API specific to the default instance +// + +mime.Mime = Mime; + +/** + * Lookup a charset based on mime type. + */ +mime.charsets = { + lookup: function(mimeType, fallback) { + // Assume text types are utf8 + return (/^text\//).test(mimeType) ? 'UTF-8' : fallback; + } +}; + +module.exports = mime; diff --git a/node_modules/mime/package.json b/node_modules/mime/package.json new file mode 100644 index 0000000..7210662 --- /dev/null +++ b/node_modules/mime/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + { + "raw": "mime@1.3.4", + "scope": null, + "escapedName": "mime", + "name": "mime", + "rawSpec": "1.3.4", + "spec": "1.3.4", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/send" + ] + ], + "_from": "mime@1.3.4", + "_id": "mime@1.3.4", + "_inCache": true, + "_location": "/mime", + "_npmUser": { + "name": "broofa", + "email": "robert@broofa.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "mime@1.3.4", + "scope": null, + "escapedName": "mime", + "name": "mime", + "rawSpec": "1.3.4", + "spec": "1.3.4", + "type": "version" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/mime/-/mime-1.3.4.tgz", + "_shasum": "115f9e3b6b3daf2959983cb38f149a2d40eb5d53", + "_shrinkwrap": null, + "_spec": "mime@1.3.4", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/send", + "author": { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + }, + "bin": { + "mime": "cli.js" + }, + "bugs": { + "url": "https://github.com/broofa/node-mime/issues" + }, + "contributors": [ + { + "name": "Benjamin Thomas", + "email": "benjamin@benjaminthomas.org", + "url": "http://github.com/bentomas" + } + ], + "dependencies": {}, + "description": "A comprehensive library for mime-type mapping", + "devDependencies": { + "mime-db": "^1.2.0" + }, + "directories": {}, + "dist": { + "shasum": "115f9e3b6b3daf2959983cb38f149a2d40eb5d53", + "tarball": "https://registry.npmjs.org/mime/-/mime-1.3.4.tgz" + }, + "gitHead": "1628f6e0187095009dcef4805c3a49706f137974", + "homepage": "https://github.com/broofa/node-mime", + "keywords": [ + "util", + "mime" + ], + "licenses": [ + { + "type": "MIT", + "url": "https://raw.github.com/broofa/node-mime/master/LICENSE" + } + ], + "main": "mime.js", + "maintainers": [ + { + "name": "broofa", + "email": "robert@broofa.com" + }, + { + "name": "bentomas", + "email": "benjamin@benjaminthomas.org" + } + ], + "name": "mime", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "url": "git+https://github.com/broofa/node-mime.git", + "type": "git" + }, + "scripts": { + "prepublish": "node build/build.js > types.json", + "test": "node build/test.js" + }, + "version": "1.3.4" +} diff --git a/node_modules/mime/types.json b/node_modules/mime/types.json new file mode 100644 index 0000000..c674b1c --- /dev/null +++ b/node_modules/mime/types.json @@ -0,0 +1 @@ +{"application/andrew-inset":["ez"],"application/applixware":["aw"],"application/atom+xml":["atom"],"application/atomcat+xml":["atomcat"],"application/atomsvc+xml":["atomsvc"],"application/ccxml+xml":["ccxml"],"application/cdmi-capability":["cdmia"],"application/cdmi-container":["cdmic"],"application/cdmi-domain":["cdmid"],"application/cdmi-object":["cdmio"],"application/cdmi-queue":["cdmiq"],"application/cu-seeme":["cu"],"application/dash+xml":["mdp"],"application/davmount+xml":["davmount"],"application/docbook+xml":["dbk"],"application/dssc+der":["dssc"],"application/dssc+xml":["xdssc"],"application/ecmascript":["ecma"],"application/emma+xml":["emma"],"application/epub+zip":["epub"],"application/exi":["exi"],"application/font-tdpfr":["pfr"],"application/font-woff":["woff"],"application/font-woff2":["woff2"],"application/gml+xml":["gml"],"application/gpx+xml":["gpx"],"application/gxf":["gxf"],"application/hyperstudio":["stk"],"application/inkml+xml":["ink","inkml"],"application/ipfix":["ipfix"],"application/java-archive":["jar"],"application/java-serialized-object":["ser"],"application/java-vm":["class"],"application/javascript":["js"],"application/json":["json","map"],"application/json5":["json5"],"application/jsonml+json":["jsonml"],"application/lost+xml":["lostxml"],"application/mac-binhex40":["hqx"],"application/mac-compactpro":["cpt"],"application/mads+xml":["mads"],"application/marc":["mrc"],"application/marcxml+xml":["mrcx"],"application/mathematica":["ma","nb","mb"],"application/mathml+xml":["mathml"],"application/mbox":["mbox"],"application/mediaservercontrol+xml":["mscml"],"application/metalink+xml":["metalink"],"application/metalink4+xml":["meta4"],"application/mets+xml":["mets"],"application/mods+xml":["mods"],"application/mp21":["m21","mp21"],"application/mp4":["mp4s","m4p"],"application/msword":["doc","dot"],"application/mxf":["mxf"],"application/octet-stream":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","buffer"],"application/oda":["oda"],"application/oebps-package+xml":["opf"],"application/ogg":["ogx"],"application/omdoc+xml":["omdoc"],"application/onenote":["onetoc","onetoc2","onetmp","onepkg"],"application/oxps":["oxps"],"application/patch-ops-error+xml":["xer"],"application/pdf":["pdf"],"application/pgp-encrypted":["pgp"],"application/pgp-signature":["asc","sig"],"application/pics-rules":["prf"],"application/pkcs10":["p10"],"application/pkcs7-mime":["p7m","p7c"],"application/pkcs7-signature":["p7s"],"application/pkcs8":["p8"],"application/pkix-attr-cert":["ac"],"application/pkix-cert":["cer"],"application/pkix-crl":["crl"],"application/pkix-pkipath":["pkipath"],"application/pkixcmp":["pki"],"application/pls+xml":["pls"],"application/postscript":["ai","eps","ps"],"application/prs.cww":["cww"],"application/pskc+xml":["pskcxml"],"application/rdf+xml":["rdf"],"application/reginfo+xml":["rif"],"application/relax-ng-compact-syntax":["rnc"],"application/resource-lists+xml":["rl"],"application/resource-lists-diff+xml":["rld"],"application/rls-services+xml":["rs"],"application/rpki-ghostbusters":["gbr"],"application/rpki-manifest":["mft"],"application/rpki-roa":["roa"],"application/rsd+xml":["rsd"],"application/rss+xml":["rss"],"application/rtf":["rtf"],"application/sbml+xml":["sbml"],"application/scvp-cv-request":["scq"],"application/scvp-cv-response":["scs"],"application/scvp-vp-request":["spq"],"application/scvp-vp-response":["spp"],"application/sdp":["sdp"],"application/set-payment-initiation":["setpay"],"application/set-registration-initiation":["setreg"],"application/shf+xml":["shf"],"application/smil+xml":["smi","smil"],"application/sparql-query":["rq"],"application/sparql-results+xml":["srx"],"application/srgs":["gram"],"application/srgs+xml":["grxml"],"application/sru+xml":["sru"],"application/ssdl+xml":["ssdl"],"application/ssml+xml":["ssml"],"application/tei+xml":["tei","teicorpus"],"application/thraud+xml":["tfi"],"application/timestamped-data":["tsd"],"application/vnd.3gpp.pic-bw-large":["plb"],"application/vnd.3gpp.pic-bw-small":["psb"],"application/vnd.3gpp.pic-bw-var":["pvb"],"application/vnd.3gpp2.tcap":["tcap"],"application/vnd.3m.post-it-notes":["pwn"],"application/vnd.accpac.simply.aso":["aso"],"application/vnd.accpac.simply.imp":["imp"],"application/vnd.acucobol":["acu"],"application/vnd.acucorp":["atc","acutc"],"application/vnd.adobe.air-application-installer-package+zip":["air"],"application/vnd.adobe.formscentral.fcdt":["fcdt"],"application/vnd.adobe.fxp":["fxp","fxpl"],"application/vnd.adobe.xdp+xml":["xdp"],"application/vnd.adobe.xfdf":["xfdf"],"application/vnd.ahead.space":["ahead"],"application/vnd.airzip.filesecure.azf":["azf"],"application/vnd.airzip.filesecure.azs":["azs"],"application/vnd.amazon.ebook":["azw"],"application/vnd.americandynamics.acc":["acc"],"application/vnd.amiga.ami":["ami"],"application/vnd.android.package-archive":["apk"],"application/vnd.anser-web-certificate-issue-initiation":["cii"],"application/vnd.anser-web-funds-transfer-initiation":["fti"],"application/vnd.antix.game-component":["atx"],"application/vnd.apple.installer+xml":["mpkg"],"application/vnd.apple.mpegurl":["m3u8"],"application/vnd.aristanetworks.swi":["swi"],"application/vnd.astraea-software.iota":["iota"],"application/vnd.audiograph":["aep"],"application/vnd.blueice.multipass":["mpm"],"application/vnd.bmi":["bmi"],"application/vnd.businessobjects":["rep"],"application/vnd.chemdraw+xml":["cdxml"],"application/vnd.chipnuts.karaoke-mmd":["mmd"],"application/vnd.cinderella":["cdy"],"application/vnd.claymore":["cla"],"application/vnd.cloanto.rp9":["rp9"],"application/vnd.clonk.c4group":["c4g","c4d","c4f","c4p","c4u"],"application/vnd.cluetrust.cartomobile-config":["c11amc"],"application/vnd.cluetrust.cartomobile-config-pkg":["c11amz"],"application/vnd.commonspace":["csp"],"application/vnd.contact.cmsg":["cdbcmsg"],"application/vnd.cosmocaller":["cmc"],"application/vnd.crick.clicker":["clkx"],"application/vnd.crick.clicker.keyboard":["clkk"],"application/vnd.crick.clicker.palette":["clkp"],"application/vnd.crick.clicker.template":["clkt"],"application/vnd.crick.clicker.wordbank":["clkw"],"application/vnd.criticaltools.wbs+xml":["wbs"],"application/vnd.ctc-posml":["pml"],"application/vnd.cups-ppd":["ppd"],"application/vnd.curl.car":["car"],"application/vnd.curl.pcurl":["pcurl"],"application/vnd.dart":["dart"],"application/vnd.data-vision.rdz":["rdz"],"application/vnd.dece.data":["uvf","uvvf","uvd","uvvd"],"application/vnd.dece.ttml+xml":["uvt","uvvt"],"application/vnd.dece.unspecified":["uvx","uvvx"],"application/vnd.dece.zip":["uvz","uvvz"],"application/vnd.denovo.fcselayout-link":["fe_launch"],"application/vnd.dna":["dna"],"application/vnd.dolby.mlp":["mlp"],"application/vnd.dpgraph":["dpg"],"application/vnd.dreamfactory":["dfac"],"application/vnd.ds-keypoint":["kpxx"],"application/vnd.dvb.ait":["ait"],"application/vnd.dvb.service":["svc"],"application/vnd.dynageo":["geo"],"application/vnd.ecowin.chart":["mag"],"application/vnd.enliven":["nml"],"application/vnd.epson.esf":["esf"],"application/vnd.epson.msf":["msf"],"application/vnd.epson.quickanime":["qam"],"application/vnd.epson.salt":["slt"],"application/vnd.epson.ssf":["ssf"],"application/vnd.eszigno3+xml":["es3","et3"],"application/vnd.ezpix-album":["ez2"],"application/vnd.ezpix-package":["ez3"],"application/vnd.fdf":["fdf"],"application/vnd.fdsn.mseed":["mseed"],"application/vnd.fdsn.seed":["seed","dataless"],"application/vnd.flographit":["gph"],"application/vnd.fluxtime.clip":["ftc"],"application/vnd.framemaker":["fm","frame","maker","book"],"application/vnd.frogans.fnc":["fnc"],"application/vnd.frogans.ltf":["ltf"],"application/vnd.fsc.weblaunch":["fsc"],"application/vnd.fujitsu.oasys":["oas"],"application/vnd.fujitsu.oasys2":["oa2"],"application/vnd.fujitsu.oasys3":["oa3"],"application/vnd.fujitsu.oasysgp":["fg5"],"application/vnd.fujitsu.oasysprs":["bh2"],"application/vnd.fujixerox.ddd":["ddd"],"application/vnd.fujixerox.docuworks":["xdw"],"application/vnd.fujixerox.docuworks.binder":["xbd"],"application/vnd.fuzzysheet":["fzs"],"application/vnd.genomatix.tuxedo":["txd"],"application/vnd.geogebra.file":["ggb"],"application/vnd.geogebra.tool":["ggt"],"application/vnd.geometry-explorer":["gex","gre"],"application/vnd.geonext":["gxt"],"application/vnd.geoplan":["g2w"],"application/vnd.geospace":["g3w"],"application/vnd.gmx":["gmx"],"application/vnd.google-earth.kml+xml":["kml"],"application/vnd.google-earth.kmz":["kmz"],"application/vnd.grafeq":["gqf","gqs"],"application/vnd.groove-account":["gac"],"application/vnd.groove-help":["ghf"],"application/vnd.groove-identity-message":["gim"],"application/vnd.groove-injector":["grv"],"application/vnd.groove-tool-message":["gtm"],"application/vnd.groove-tool-template":["tpl"],"application/vnd.groove-vcard":["vcg"],"application/vnd.hal+xml":["hal"],"application/vnd.handheld-entertainment+xml":["zmm"],"application/vnd.hbci":["hbci"],"application/vnd.hhe.lesson-player":["les"],"application/vnd.hp-hpgl":["hpgl"],"application/vnd.hp-hpid":["hpid"],"application/vnd.hp-hps":["hps"],"application/vnd.hp-jlyt":["jlt"],"application/vnd.hp-pcl":["pcl"],"application/vnd.hp-pclxl":["pclxl"],"application/vnd.ibm.minipay":["mpy"],"application/vnd.ibm.modcap":["afp","listafp","list3820"],"application/vnd.ibm.rights-management":["irm"],"application/vnd.ibm.secure-container":["sc"],"application/vnd.iccprofile":["icc","icm"],"application/vnd.igloader":["igl"],"application/vnd.immervision-ivp":["ivp"],"application/vnd.immervision-ivu":["ivu"],"application/vnd.insors.igm":["igm"],"application/vnd.intercon.formnet":["xpw","xpx"],"application/vnd.intergeo":["i2g"],"application/vnd.intu.qbo":["qbo"],"application/vnd.intu.qfx":["qfx"],"application/vnd.ipunplugged.rcprofile":["rcprofile"],"application/vnd.irepository.package+xml":["irp"],"application/vnd.is-xpr":["xpr"],"application/vnd.isac.fcs":["fcs"],"application/vnd.jam":["jam"],"application/vnd.jcp.javame.midlet-rms":["rms"],"application/vnd.jisp":["jisp"],"application/vnd.joost.joda-archive":["joda"],"application/vnd.kahootz":["ktz","ktr"],"application/vnd.kde.karbon":["karbon"],"application/vnd.kde.kchart":["chrt"],"application/vnd.kde.kformula":["kfo"],"application/vnd.kde.kivio":["flw"],"application/vnd.kde.kontour":["kon"],"application/vnd.kde.kpresenter":["kpr","kpt"],"application/vnd.kde.kspread":["ksp"],"application/vnd.kde.kword":["kwd","kwt"],"application/vnd.kenameaapp":["htke"],"application/vnd.kidspiration":["kia"],"application/vnd.kinar":["kne","knp"],"application/vnd.koan":["skp","skd","skt","skm"],"application/vnd.kodak-descriptor":["sse"],"application/vnd.las.las+xml":["lasxml"],"application/vnd.llamagraphics.life-balance.desktop":["lbd"],"application/vnd.llamagraphics.life-balance.exchange+xml":["lbe"],"application/vnd.lotus-1-2-3":["123"],"application/vnd.lotus-approach":["apr"],"application/vnd.lotus-freelance":["pre"],"application/vnd.lotus-notes":["nsf"],"application/vnd.lotus-organizer":["org"],"application/vnd.lotus-screencam":["scm"],"application/vnd.lotus-wordpro":["lwp"],"application/vnd.macports.portpkg":["portpkg"],"application/vnd.mcd":["mcd"],"application/vnd.medcalcdata":["mc1"],"application/vnd.mediastation.cdkey":["cdkey"],"application/vnd.mfer":["mwf"],"application/vnd.mfmp":["mfm"],"application/vnd.micrografx.flo":["flo"],"application/vnd.micrografx.igx":["igx"],"application/vnd.mif":["mif"],"application/vnd.mobius.daf":["daf"],"application/vnd.mobius.dis":["dis"],"application/vnd.mobius.mbk":["mbk"],"application/vnd.mobius.mqy":["mqy"],"application/vnd.mobius.msl":["msl"],"application/vnd.mobius.plc":["plc"],"application/vnd.mobius.txf":["txf"],"application/vnd.mophun.application":["mpn"],"application/vnd.mophun.certificate":["mpc"],"application/vnd.mozilla.xul+xml":["xul"],"application/vnd.ms-artgalry":["cil"],"application/vnd.ms-cab-compressed":["cab"],"application/vnd.ms-excel":["xls","xlm","xla","xlc","xlt","xlw"],"application/vnd.ms-excel.addin.macroenabled.12":["xlam"],"application/vnd.ms-excel.sheet.binary.macroenabled.12":["xlsb"],"application/vnd.ms-excel.sheet.macroenabled.12":["xlsm"],"application/vnd.ms-excel.template.macroenabled.12":["xltm"],"application/vnd.ms-fontobject":["eot"],"application/vnd.ms-htmlhelp":["chm"],"application/vnd.ms-ims":["ims"],"application/vnd.ms-lrm":["lrm"],"application/vnd.ms-officetheme":["thmx"],"application/vnd.ms-pki.seccat":["cat"],"application/vnd.ms-pki.stl":["stl"],"application/vnd.ms-powerpoint":["ppt","pps","pot"],"application/vnd.ms-powerpoint.addin.macroenabled.12":["ppam"],"application/vnd.ms-powerpoint.presentation.macroenabled.12":["pptm"],"application/vnd.ms-powerpoint.slide.macroenabled.12":["sldm"],"application/vnd.ms-powerpoint.slideshow.macroenabled.12":["ppsm"],"application/vnd.ms-powerpoint.template.macroenabled.12":["potm"],"application/vnd.ms-project":["mpp","mpt"],"application/vnd.ms-word.document.macroenabled.12":["docm"],"application/vnd.ms-word.template.macroenabled.12":["dotm"],"application/vnd.ms-works":["wps","wks","wcm","wdb"],"application/vnd.ms-wpl":["wpl"],"application/vnd.ms-xpsdocument":["xps"],"application/vnd.mseq":["mseq"],"application/vnd.musician":["mus"],"application/vnd.muvee.style":["msty"],"application/vnd.mynfc":["taglet"],"application/vnd.neurolanguage.nlu":["nlu"],"application/vnd.nitf":["ntf","nitf"],"application/vnd.noblenet-directory":["nnd"],"application/vnd.noblenet-sealer":["nns"],"application/vnd.noblenet-web":["nnw"],"application/vnd.nokia.n-gage.data":["ngdat"],"application/vnd.nokia.radio-preset":["rpst"],"application/vnd.nokia.radio-presets":["rpss"],"application/vnd.novadigm.edm":["edm"],"application/vnd.novadigm.edx":["edx"],"application/vnd.novadigm.ext":["ext"],"application/vnd.oasis.opendocument.chart":["odc"],"application/vnd.oasis.opendocument.chart-template":["otc"],"application/vnd.oasis.opendocument.database":["odb"],"application/vnd.oasis.opendocument.formula":["odf"],"application/vnd.oasis.opendocument.formula-template":["odft"],"application/vnd.oasis.opendocument.graphics":["odg"],"application/vnd.oasis.opendocument.graphics-template":["otg"],"application/vnd.oasis.opendocument.image":["odi"],"application/vnd.oasis.opendocument.image-template":["oti"],"application/vnd.oasis.opendocument.presentation":["odp"],"application/vnd.oasis.opendocument.presentation-template":["otp"],"application/vnd.oasis.opendocument.spreadsheet":["ods"],"application/vnd.oasis.opendocument.spreadsheet-template":["ots"],"application/vnd.oasis.opendocument.text":["odt"],"application/vnd.oasis.opendocument.text-master":["odm"],"application/vnd.oasis.opendocument.text-template":["ott"],"application/vnd.oasis.opendocument.text-web":["oth"],"application/vnd.olpc-sugar":["xo"],"application/vnd.oma.dd2+xml":["dd2"],"application/vnd.openofficeorg.extension":["oxt"],"application/vnd.openxmlformats-officedocument.presentationml.presentation":["pptx"],"application/vnd.openxmlformats-officedocument.presentationml.slide":["sldx"],"application/vnd.openxmlformats-officedocument.presentationml.slideshow":["ppsx"],"application/vnd.openxmlformats-officedocument.presentationml.template":["potx"],"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":["xlsx"],"application/vnd.openxmlformats-officedocument.spreadsheetml.template":["xltx"],"application/vnd.openxmlformats-officedocument.wordprocessingml.document":["docx"],"application/vnd.openxmlformats-officedocument.wordprocessingml.template":["dotx"],"application/vnd.osgeo.mapguide.package":["mgp"],"application/vnd.osgi.dp":["dp"],"application/vnd.osgi.subsystem":["esa"],"application/vnd.palm":["pdb","pqa","oprc"],"application/vnd.pawaafile":["paw"],"application/vnd.pg.format":["str"],"application/vnd.pg.osasli":["ei6"],"application/vnd.picsel":["efif"],"application/vnd.pmi.widget":["wg"],"application/vnd.pocketlearn":["plf"],"application/vnd.powerbuilder6":["pbd"],"application/vnd.previewsystems.box":["box"],"application/vnd.proteus.magazine":["mgz"],"application/vnd.publishare-delta-tree":["qps"],"application/vnd.pvi.ptid1":["ptid"],"application/vnd.quark.quarkxpress":["qxd","qxt","qwd","qwt","qxl","qxb"],"application/vnd.realvnc.bed":["bed"],"application/vnd.recordare.musicxml":["mxl"],"application/vnd.recordare.musicxml+xml":["musicxml"],"application/vnd.rig.cryptonote":["cryptonote"],"application/vnd.rim.cod":["cod"],"application/vnd.rn-realmedia":["rm"],"application/vnd.rn-realmedia-vbr":["rmvb"],"application/vnd.route66.link66+xml":["link66"],"application/vnd.sailingtracker.track":["st"],"application/vnd.seemail":["see"],"application/vnd.sema":["sema"],"application/vnd.semd":["semd"],"application/vnd.semf":["semf"],"application/vnd.shana.informed.formdata":["ifm"],"application/vnd.shana.informed.formtemplate":["itp"],"application/vnd.shana.informed.interchange":["iif"],"application/vnd.shana.informed.package":["ipk"],"application/vnd.simtech-mindmapper":["twd","twds"],"application/vnd.smaf":["mmf"],"application/vnd.smart.teacher":["teacher"],"application/vnd.solent.sdkm+xml":["sdkm","sdkd"],"application/vnd.spotfire.dxp":["dxp"],"application/vnd.spotfire.sfs":["sfs"],"application/vnd.stardivision.calc":["sdc"],"application/vnd.stardivision.draw":["sda"],"application/vnd.stardivision.impress":["sdd"],"application/vnd.stardivision.math":["smf"],"application/vnd.stardivision.writer":["sdw","vor"],"application/vnd.stardivision.writer-global":["sgl"],"application/vnd.stepmania.package":["smzip"],"application/vnd.stepmania.stepchart":["sm"],"application/vnd.sun.xml.calc":["sxc"],"application/vnd.sun.xml.calc.template":["stc"],"application/vnd.sun.xml.draw":["sxd"],"application/vnd.sun.xml.draw.template":["std"],"application/vnd.sun.xml.impress":["sxi"],"application/vnd.sun.xml.impress.template":["sti"],"application/vnd.sun.xml.math":["sxm"],"application/vnd.sun.xml.writer":["sxw"],"application/vnd.sun.xml.writer.global":["sxg"],"application/vnd.sun.xml.writer.template":["stw"],"application/vnd.sus-calendar":["sus","susp"],"application/vnd.svd":["svd"],"application/vnd.symbian.install":["sis","sisx"],"application/vnd.syncml+xml":["xsm"],"application/vnd.syncml.dm+wbxml":["bdm"],"application/vnd.syncml.dm+xml":["xdm"],"application/vnd.tao.intent-module-archive":["tao"],"application/vnd.tcpdump.pcap":["pcap","cap","dmp"],"application/vnd.tmobile-livetv":["tmo"],"application/vnd.trid.tpt":["tpt"],"application/vnd.triscape.mxs":["mxs"],"application/vnd.trueapp":["tra"],"application/vnd.ufdl":["ufd","ufdl"],"application/vnd.uiq.theme":["utz"],"application/vnd.umajin":["umj"],"application/vnd.unity":["unityweb"],"application/vnd.uoml+xml":["uoml"],"application/vnd.vcx":["vcx"],"application/vnd.visio":["vsd","vst","vss","vsw"],"application/vnd.visionary":["vis"],"application/vnd.vsf":["vsf"],"application/vnd.wap.wbxml":["wbxml"],"application/vnd.wap.wmlc":["wmlc"],"application/vnd.wap.wmlscriptc":["wmlsc"],"application/vnd.webturbo":["wtb"],"application/vnd.wolfram.player":["nbp"],"application/vnd.wordperfect":["wpd"],"application/vnd.wqd":["wqd"],"application/vnd.wt.stf":["stf"],"application/vnd.xara":["xar"],"application/vnd.xfdl":["xfdl"],"application/vnd.yamaha.hv-dic":["hvd"],"application/vnd.yamaha.hv-script":["hvs"],"application/vnd.yamaha.hv-voice":["hvp"],"application/vnd.yamaha.openscoreformat":["osf"],"application/vnd.yamaha.openscoreformat.osfpvg+xml":["osfpvg"],"application/vnd.yamaha.smaf-audio":["saf"],"application/vnd.yamaha.smaf-phrase":["spf"],"application/vnd.yellowriver-custom-menu":["cmp"],"application/vnd.zul":["zir","zirz"],"application/vnd.zzazz.deck+xml":["zaz"],"application/voicexml+xml":["vxml"],"application/widget":["wgt"],"application/winhlp":["hlp"],"application/wsdl+xml":["wsdl"],"application/wspolicy+xml":["wspolicy"],"application/x-7z-compressed":["7z"],"application/x-abiword":["abw"],"application/x-ace-compressed":["ace"],"application/x-apple-diskimage":["dmg"],"application/x-authorware-bin":["aab","x32","u32","vox"],"application/x-authorware-map":["aam"],"application/x-authorware-seg":["aas"],"application/x-bcpio":["bcpio"],"application/x-bittorrent":["torrent"],"application/x-blorb":["blb","blorb"],"application/x-bzip":["bz"],"application/x-bzip2":["bz2","boz"],"application/x-cbr":["cbr","cba","cbt","cbz","cb7"],"application/x-cdlink":["vcd"],"application/x-cfs-compressed":["cfs"],"application/x-chat":["chat"],"application/x-chess-pgn":["pgn"],"application/x-chrome-extension":["crx"],"application/x-conference":["nsc"],"application/x-cpio":["cpio"],"application/x-csh":["csh"],"application/x-debian-package":["deb","udeb"],"application/x-dgc-compressed":["dgc"],"application/x-director":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"],"application/x-doom":["wad"],"application/x-dtbncx+xml":["ncx"],"application/x-dtbook+xml":["dtb"],"application/x-dtbresource+xml":["res"],"application/x-dvi":["dvi"],"application/x-envoy":["evy"],"application/x-eva":["eva"],"application/x-font-bdf":["bdf"],"application/x-font-ghostscript":["gsf"],"application/x-font-linux-psf":["psf"],"application/x-font-otf":["otf"],"application/x-font-pcf":["pcf"],"application/x-font-snf":["snf"],"application/x-font-ttf":["ttf","ttc"],"application/x-font-type1":["pfa","pfb","pfm","afm"],"application/x-freearc":["arc"],"application/x-futuresplash":["spl"],"application/x-gca-compressed":["gca"],"application/x-glulx":["ulx"],"application/x-gnumeric":["gnumeric"],"application/x-gramps-xml":["gramps"],"application/x-gtar":["gtar"],"application/x-hdf":["hdf"],"application/x-install-instructions":["install"],"application/x-iso9660-image":["iso"],"application/x-java-jnlp-file":["jnlp"],"application/x-latex":["latex"],"application/x-lua-bytecode":["luac"],"application/x-lzh-compressed":["lzh","lha"],"application/x-mie":["mie"],"application/x-mobipocket-ebook":["prc","mobi"],"application/x-ms-application":["application"],"application/x-ms-shortcut":["lnk"],"application/x-ms-wmd":["wmd"],"application/x-ms-wmz":["wmz"],"application/x-ms-xbap":["xbap"],"application/x-msaccess":["mdb"],"application/x-msbinder":["obd"],"application/x-mscardfile":["crd"],"application/x-msclip":["clp"],"application/x-msdownload":["exe","dll","com","bat","msi"],"application/x-msmediaview":["mvb","m13","m14"],"application/x-msmetafile":["wmf","wmz","emf","emz"],"application/x-msmoney":["mny"],"application/x-mspublisher":["pub"],"application/x-msschedule":["scd"],"application/x-msterminal":["trm"],"application/x-mswrite":["wri"],"application/x-netcdf":["nc","cdf"],"application/x-nzb":["nzb"],"application/x-pkcs12":["p12","pfx"],"application/x-pkcs7-certificates":["p7b","spc"],"application/x-pkcs7-certreqresp":["p7r"],"application/x-rar-compressed":["rar"],"application/x-research-info-systems":["ris"],"application/x-sh":["sh"],"application/x-shar":["shar"],"application/x-shockwave-flash":["swf"],"application/x-silverlight-app":["xap"],"application/x-sql":["sql"],"application/x-stuffit":["sit"],"application/x-stuffitx":["sitx"],"application/x-subrip":["srt"],"application/x-sv4cpio":["sv4cpio"],"application/x-sv4crc":["sv4crc"],"application/x-t3vm-image":["t3"],"application/x-tads":["gam"],"application/x-tar":["tar"],"application/x-tcl":["tcl"],"application/x-tex":["tex"],"application/x-tex-tfm":["tfm"],"application/x-texinfo":["texinfo","texi"],"application/x-tgif":["obj"],"application/x-ustar":["ustar"],"application/x-wais-source":["src"],"application/x-web-app-manifest+json":["webapp"],"application/x-x509-ca-cert":["der","crt"],"application/x-xfig":["fig"],"application/x-xliff+xml":["xlf"],"application/x-xpinstall":["xpi"],"application/x-xz":["xz"],"application/x-zmachine":["z1","z2","z3","z4","z5","z6","z7","z8"],"application/xaml+xml":["xaml"],"application/xcap-diff+xml":["xdf"],"application/xenc+xml":["xenc"],"application/xhtml+xml":["xhtml","xht"],"application/xml":["xml","xsl","xsd"],"application/xml-dtd":["dtd"],"application/xop+xml":["xop"],"application/xproc+xml":["xpl"],"application/xslt+xml":["xslt"],"application/xspf+xml":["xspf"],"application/xv+xml":["mxml","xhvml","xvml","xvm"],"application/yang":["yang"],"application/yin+xml":["yin"],"application/zip":["zip"],"audio/adpcm":["adp"],"audio/basic":["au","snd"],"audio/midi":["mid","midi","kar","rmi"],"audio/mp4":["mp4a","m4a"],"audio/mpeg":["mpga","mp2","mp2a","mp3","m2a","m3a"],"audio/ogg":["oga","ogg","spx"],"audio/s3m":["s3m"],"audio/silk":["sil"],"audio/vnd.dece.audio":["uva","uvva"],"audio/vnd.digital-winds":["eol"],"audio/vnd.dra":["dra"],"audio/vnd.dts":["dts"],"audio/vnd.dts.hd":["dtshd"],"audio/vnd.lucent.voice":["lvp"],"audio/vnd.ms-playready.media.pya":["pya"],"audio/vnd.nuera.ecelp4800":["ecelp4800"],"audio/vnd.nuera.ecelp7470":["ecelp7470"],"audio/vnd.nuera.ecelp9600":["ecelp9600"],"audio/vnd.rip":["rip"],"audio/webm":["weba"],"audio/x-aac":["aac"],"audio/x-aiff":["aif","aiff","aifc"],"audio/x-caf":["caf"],"audio/x-flac":["flac"],"audio/x-matroska":["mka"],"audio/x-mpegurl":["m3u"],"audio/x-ms-wax":["wax"],"audio/x-ms-wma":["wma"],"audio/x-pn-realaudio":["ram","ra"],"audio/x-pn-realaudio-plugin":["rmp"],"audio/x-wav":["wav"],"audio/xm":["xm"],"chemical/x-cdx":["cdx"],"chemical/x-cif":["cif"],"chemical/x-cmdf":["cmdf"],"chemical/x-cml":["cml"],"chemical/x-csml":["csml"],"chemical/x-xyz":["xyz"],"font/opentype":["otf"],"image/bmp":["bmp"],"image/cgm":["cgm"],"image/g3fax":["g3"],"image/gif":["gif"],"image/ief":["ief"],"image/jpeg":["jpeg","jpg","jpe"],"image/ktx":["ktx"],"image/png":["png"],"image/prs.btif":["btif"],"image/sgi":["sgi"],"image/svg+xml":["svg","svgz"],"image/tiff":["tiff","tif"],"image/vnd.adobe.photoshop":["psd"],"image/vnd.dece.graphic":["uvi","uvvi","uvg","uvvg"],"image/vnd.djvu":["djvu","djv"],"image/vnd.dvb.subtitle":["sub"],"image/vnd.dwg":["dwg"],"image/vnd.dxf":["dxf"],"image/vnd.fastbidsheet":["fbs"],"image/vnd.fpx":["fpx"],"image/vnd.fst":["fst"],"image/vnd.fujixerox.edmics-mmr":["mmr"],"image/vnd.fujixerox.edmics-rlc":["rlc"],"image/vnd.ms-modi":["mdi"],"image/vnd.ms-photo":["wdp"],"image/vnd.net-fpx":["npx"],"image/vnd.wap.wbmp":["wbmp"],"image/vnd.xiff":["xif"],"image/webp":["webp"],"image/x-3ds":["3ds"],"image/x-cmu-raster":["ras"],"image/x-cmx":["cmx"],"image/x-freehand":["fh","fhc","fh4","fh5","fh7"],"image/x-icon":["ico"],"image/x-mrsid-image":["sid"],"image/x-pcx":["pcx"],"image/x-pict":["pic","pct"],"image/x-portable-anymap":["pnm"],"image/x-portable-bitmap":["pbm"],"image/x-portable-graymap":["pgm"],"image/x-portable-pixmap":["ppm"],"image/x-rgb":["rgb"],"image/x-tga":["tga"],"image/x-xbitmap":["xbm"],"image/x-xpixmap":["xpm"],"image/x-xwindowdump":["xwd"],"message/rfc822":["eml","mime"],"model/iges":["igs","iges"],"model/mesh":["msh","mesh","silo"],"model/vnd.collada+xml":["dae"],"model/vnd.dwf":["dwf"],"model/vnd.gdl":["gdl"],"model/vnd.gtw":["gtw"],"model/vnd.mts":["mts"],"model/vnd.vtu":["vtu"],"model/vrml":["wrl","vrml"],"model/x3d+binary":["x3db","x3dbz"],"model/x3d+vrml":["x3dv","x3dvz"],"model/x3d+xml":["x3d","x3dz"],"text/cache-manifest":["appcache","manifest"],"text/calendar":["ics","ifb"],"text/coffeescript":["coffee"],"text/css":["css"],"text/csv":["csv"],"text/hjson":["hjson"],"text/html":["html","htm"],"text/jade":["jade"],"text/jsx":["jsx"],"text/less":["less"],"text/n3":["n3"],"text/plain":["txt","text","conf","def","list","log","in","ini"],"text/prs.lines.tag":["dsc"],"text/richtext":["rtx"],"text/sgml":["sgml","sgm"],"text/stylus":["stylus","styl"],"text/tab-separated-values":["tsv"],"text/troff":["t","tr","roff","man","me","ms"],"text/turtle":["ttl"],"text/uri-list":["uri","uris","urls"],"text/vcard":["vcard"],"text/vnd.curl":["curl"],"text/vnd.curl.dcurl":["dcurl"],"text/vnd.curl.mcurl":["mcurl"],"text/vnd.curl.scurl":["scurl"],"text/vnd.dvb.subtitle":["sub"],"text/vnd.fly":["fly"],"text/vnd.fmi.flexstor":["flx"],"text/vnd.graphviz":["gv"],"text/vnd.in3d.3dml":["3dml"],"text/vnd.in3d.spot":["spot"],"text/vnd.sun.j2me.app-descriptor":["jad"],"text/vnd.wap.wml":["wml"],"text/vnd.wap.wmlscript":["wmls"],"text/vtt":["vtt"],"text/x-asm":["s","asm"],"text/x-c":["c","cc","cxx","cpp","h","hh","dic"],"text/x-component":["htc"],"text/x-fortran":["f","for","f77","f90"],"text/x-handlebars-template":["hbs"],"text/x-java-source":["java"],"text/x-lua":["lua"],"text/x-markdown":["markdown","md","mkd"],"text/x-nfo":["nfo"],"text/x-opml":["opml"],"text/x-pascal":["p","pas"],"text/x-sass":["sass"],"text/x-scss":["scss"],"text/x-setext":["etx"],"text/x-sfv":["sfv"],"text/x-uuencode":["uu"],"text/x-vcalendar":["vcs"],"text/x-vcard":["vcf"],"text/yaml":["yaml","yml"],"video/3gpp":["3gp"],"video/3gpp2":["3g2"],"video/h261":["h261"],"video/h263":["h263"],"video/h264":["h264"],"video/jpeg":["jpgv"],"video/jpm":["jpm","jpgm"],"video/mj2":["mj2","mjp2"],"video/mp2t":["ts"],"video/mp4":["mp4","mp4v","mpg4"],"video/mpeg":["mpeg","mpg","mpe","m1v","m2v"],"video/ogg":["ogv"],"video/quicktime":["qt","mov"],"video/vnd.dece.hd":["uvh","uvvh"],"video/vnd.dece.mobile":["uvm","uvvm"],"video/vnd.dece.pd":["uvp","uvvp"],"video/vnd.dece.sd":["uvs","uvvs"],"video/vnd.dece.video":["uvv","uvvv"],"video/vnd.dvb.file":["dvb"],"video/vnd.fvt":["fvt"],"video/vnd.mpegurl":["mxu","m4u"],"video/vnd.ms-playready.media.pyv":["pyv"],"video/vnd.uvvu.mp4":["uvu","uvvu"],"video/vnd.vivo":["viv"],"video/webm":["webm"],"video/x-f4v":["f4v"],"video/x-fli":["fli"],"video/x-flv":["flv"],"video/x-m4v":["m4v"],"video/x-matroska":["mkv","mk3d","mks"],"video/x-mng":["mng"],"video/x-ms-asf":["asf","asx"],"video/x-ms-vob":["vob"],"video/x-ms-wm":["wm"],"video/x-ms-wmv":["wmv"],"video/x-ms-wmx":["wmx"],"video/x-ms-wvx":["wvx"],"video/x-msvideo":["avi"],"video/x-sgi-movie":["movie"],"video/x-smv":["smv"],"x-conference/x-cooltalk":["ice"]} diff --git a/node_modules/ms/.npmignore b/node_modules/ms/.npmignore new file mode 100644 index 0000000..d1aa0ce --- /dev/null +++ b/node_modules/ms/.npmignore @@ -0,0 +1,5 @@ +node_modules +test +History.md +Makefile +component.json diff --git a/node_modules/ms/History.md b/node_modules/ms/History.md new file mode 100644 index 0000000..32fdfc1 --- /dev/null +++ b/node_modules/ms/History.md @@ -0,0 +1,66 @@ + +0.7.1 / 2015-04-20 +================== + + * prevent extraordinary long inputs (@evilpacket) + * Fixed broken readme link + +0.7.0 / 2014-11-24 +================== + + * add time abbreviations, updated tests and readme for the new units + * fix example in the readme. + * add LICENSE file + +0.6.2 / 2013-12-05 +================== + + * Adding repository section to package.json to suppress warning from NPM. + +0.6.1 / 2013-05-10 +================== + + * fix singularization [visionmedia] + +0.6.0 / 2013-03-15 +================== + + * fix minutes + +0.5.1 / 2013-02-24 +================== + + * add component namespace + +0.5.0 / 2012-11-09 +================== + + * add short formatting as default and .long option + * add .license property to component.json + * add version to component.json + +0.4.0 / 2012-10-22 +================== + + * add rounding to fix crazy decimals + +0.3.0 / 2012-09-07 +================== + + * fix `ms()` [visionmedia] + +0.2.0 / 2012-09-03 +================== + + * add component.json [visionmedia] + * add days support [visionmedia] + * add hours support [visionmedia] + * add minutes support [visionmedia] + * add seconds support [visionmedia] + * add ms string support [visionmedia] + * refactor tests to facilitate ms(number) [visionmedia] + +0.1.0 / 2012-03-07 +================== + + * Initial release diff --git a/node_modules/ms/LICENSE b/node_modules/ms/LICENSE new file mode 100644 index 0000000..6c07561 --- /dev/null +++ b/node_modules/ms/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014 Guillermo Rauch + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ms/README.md b/node_modules/ms/README.md new file mode 100644 index 0000000..9b4fd03 --- /dev/null +++ b/node_modules/ms/README.md @@ -0,0 +1,35 @@ +# ms.js: miliseconds conversion utility + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('100') // 100 +``` + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](http://nodejs.org/download). +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as +a number (e.g: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of +equivalent ms is returned. + +## License + +MIT diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js new file mode 100644 index 0000000..4f92771 --- /dev/null +++ b/node_modules/ms/index.js @@ -0,0 +1,125 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} options + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options){ + options = options || {}; + if ('string' == typeof val) return parse(val); + return options.long + ? long(val) + : short(val); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = '' + str; + if (str.length > 10000) return; + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str); + if (!match) return; + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function short(ms) { + if (ms >= d) return Math.round(ms / d) + 'd'; + if (ms >= h) return Math.round(ms / h) + 'h'; + if (ms >= m) return Math.round(ms / m) + 'm'; + if (ms >= s) return Math.round(ms / s) + 's'; + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function long(ms) { + return plural(ms, d, 'day') + || plural(ms, h, 'hour') + || plural(ms, m, 'minute') + || plural(ms, s, 'second') + || ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) return; + if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json new file mode 100644 index 0000000..5dfc6ca --- /dev/null +++ b/node_modules/ms/package.json @@ -0,0 +1,82 @@ +{ + "_args": [ + [ + { + "raw": "ms@0.7.1", + "scope": null, + "escapedName": "ms", + "name": "ms", + "rawSpec": "0.7.1", + "spec": "0.7.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/debug" + ] + ], + "_from": "ms@0.7.1", + "_id": "ms@0.7.1", + "_inCache": true, + "_location": "/ms", + "_nodeVersion": "0.12.2", + "_npmUser": { + "name": "rauchg", + "email": "rauchg@gmail.com" + }, + "_npmVersion": "2.7.5", + "_phantomChildren": {}, + "_requested": { + "raw": "ms@0.7.1", + "scope": null, + "escapedName": "ms", + "name": "ms", + "rawSpec": "0.7.1", + "spec": "0.7.1", + "type": "version" + }, + "_requiredBy": [ + "/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz", + "_shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "_shrinkwrap": null, + "_spec": "ms@0.7.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/debug", + "bugs": { + "url": "https://github.com/guille/ms.js/issues" + }, + "component": { + "scripts": { + "ms/index.js": "index.js" + } + }, + "dependencies": {}, + "description": "Tiny ms conversion utility", + "devDependencies": { + "expect.js": "*", + "mocha": "*", + "serve": "*" + }, + "directories": {}, + "dist": { + "shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "tarball": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz" + }, + "gitHead": "713dcf26d9e6fd9dbc95affe7eff9783b7f1b909", + "homepage": "https://github.com/guille/ms.js", + "main": "./index", + "maintainers": [ + { + "name": "rauchg", + "email": "rauchg@gmail.com" + } + ], + "name": "ms", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/guille/ms.js.git" + }, + "scripts": {}, + "version": "0.7.1" +} diff --git a/node_modules/negotiator/HISTORY.md b/node_modules/negotiator/HISTORY.md new file mode 100644 index 0000000..10b6917 --- /dev/null +++ b/node_modules/negotiator/HISTORY.md @@ -0,0 +1,98 @@ +0.6.1 / 2016-05-02 +================== + + * perf: improve `Accept` parsing speed + * perf: improve `Accept-Charset` parsing speed + * perf: improve `Accept-Encoding` parsing speed + * perf: improve `Accept-Language` parsing speed + +0.6.0 / 2015-09-29 +================== + + * Fix including type extensions in parameters in `Accept` parsing + * Fix parsing `Accept` parameters with quoted equals + * Fix parsing `Accept` parameters with quoted semicolons + * Lazy-load modules from main entry point + * perf: delay type concatenation until needed + * perf: enable strict mode + * perf: hoist regular expressions + * perf: remove closures getting spec properties + * perf: remove a closure from media type parsing + * perf: remove property delete from media type parsing + +0.5.3 / 2015-05-10 +================== + + * Fix media type parameter matching to be case-insensitive + +0.5.2 / 2015-05-06 +================== + + * Fix comparing media types with quoted values + * Fix splitting media types with quoted commas + +0.5.1 / 2015-02-14 +================== + + * Fix preference sorting to be stable for long acceptable lists + +0.5.0 / 2014-12-18 +================== + + * Fix list return order when large accepted list + * Fix missing identity encoding when q=0 exists + * Remove dynamic building of Negotiator class + +0.4.9 / 2014-10-14 +================== + + * Fix error when media type has invalid parameter + +0.4.8 / 2014-09-28 +================== + + * Fix all negotiations to be case-insensitive + * Stable sort preferences of same quality according to client order + * Support Node.js 0.6 + +0.4.7 / 2014-06-24 +================== + + * Handle invalid provided languages + * Handle invalid provided media types + +0.4.6 / 2014-06-11 +================== + + * Order by specificity when quality is the same + +0.4.5 / 2014-05-29 +================== + + * Fix regression in empty header handling + +0.4.4 / 2014-05-29 +================== + + * Fix behaviors when headers are not present + +0.4.3 / 2014-04-16 +================== + + * Handle slashes on media params correctly + +0.4.2 / 2014-02-28 +================== + + * Fix media type sorting + * Handle media types params strictly + +0.4.1 / 2014-01-16 +================== + + * Use most specific matches + +0.4.0 / 2014-01-09 +================== + + * Remove preferred prefix from methods diff --git a/node_modules/negotiator/LICENSE b/node_modules/negotiator/LICENSE new file mode 100644 index 0000000..ea6b9e2 --- /dev/null +++ b/node_modules/negotiator/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Federico Romero +Copyright (c) 2012-2014 Isaac Z. Schlueter +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/negotiator/README.md b/node_modules/negotiator/README.md new file mode 100644 index 0000000..04a67ff --- /dev/null +++ b/node_modules/negotiator/README.md @@ -0,0 +1,203 @@ +# negotiator + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +An HTTP content negotiator for Node.js + +## Installation + +```sh +$ npm install negotiator +``` + +## API + +```js +var Negotiator = require('negotiator') +``` + +### Accept Negotiation + +```js +availableMediaTypes = ['text/html', 'text/plain', 'application/json'] + +// The negotiator constructor receives a request object +negotiator = new Negotiator(request) + +// Let's say Accept header is 'text/html, application/*;q=0.2, image/jpeg;q=0.8' + +negotiator.mediaTypes() +// -> ['text/html', 'image/jpeg', 'application/*'] + +negotiator.mediaTypes(availableMediaTypes) +// -> ['text/html', 'application/json'] + +negotiator.mediaType(availableMediaTypes) +// -> 'text/html' +``` + +You can check a working example at `examples/accept.js`. + +#### Methods + +##### mediaType() + +Returns the most preferred media type from the client. + +##### mediaType(availableMediaType) + +Returns the most preferred media type from a list of available media types. + +##### mediaTypes() + +Returns an array of preferred media types ordered by the client preference. + +##### mediaTypes(availableMediaTypes) + +Returns an array of preferred media types ordered by priority from a list of +available media types. + +### Accept-Language Negotiation + +```js +negotiator = new Negotiator(request) + +availableLanguages = ['en', 'es', 'fr'] + +// Let's say Accept-Language header is 'en;q=0.8, es, pt' + +negotiator.languages() +// -> ['es', 'pt', 'en'] + +negotiator.languages(availableLanguages) +// -> ['es', 'en'] + +language = negotiator.language(availableLanguages) +// -> 'es' +``` + +You can check a working example at `examples/language.js`. + +#### Methods + +##### language() + +Returns the most preferred language from the client. + +##### language(availableLanguages) + +Returns the most preferred language from a list of available languages. + +##### languages() + +Returns an array of preferred languages ordered by the client preference. + +##### languages(availableLanguages) + +Returns an array of preferred languages ordered by priority from a list of +available languages. + +### Accept-Charset Negotiation + +```js +availableCharsets = ['utf-8', 'iso-8859-1', 'iso-8859-5'] + +negotiator = new Negotiator(request) + +// Let's say Accept-Charset header is 'utf-8, iso-8859-1;q=0.8, utf-7;q=0.2' + +negotiator.charsets() +// -> ['utf-8', 'iso-8859-1', 'utf-7'] + +negotiator.charsets(availableCharsets) +// -> ['utf-8', 'iso-8859-1'] + +negotiator.charset(availableCharsets) +// -> 'utf-8' +``` + +You can check a working example at `examples/charset.js`. + +#### Methods + +##### charset() + +Returns the most preferred charset from the client. + +##### charset(availableCharsets) + +Returns the most preferred charset from a list of available charsets. + +##### charsets() + +Returns an array of preferred charsets ordered by the client preference. + +##### charsets(availableCharsets) + +Returns an array of preferred charsets ordered by priority from a list of +available charsets. + +### Accept-Encoding Negotiation + +```js +availableEncodings = ['identity', 'gzip'] + +negotiator = new Negotiator(request) + +// Let's say Accept-Encoding header is 'gzip, compress;q=0.2, identity;q=0.5' + +negotiator.encodings() +// -> ['gzip', 'identity', 'compress'] + +negotiator.encodings(availableEncodings) +// -> ['gzip', 'identity'] + +negotiator.encoding(availableEncodings) +// -> 'gzip' +``` + +You can check a working example at `examples/encoding.js`. + +#### Methods + +##### encoding() + +Returns the most preferred encoding from the client. + +##### encoding(availableEncodings) + +Returns the most preferred encoding from a list of available encodings. + +##### encodings() + +Returns an array of preferred encodings ordered by the client preference. + +##### encodings(availableEncodings) + +Returns an array of preferred encodings ordered by priority from a list of +available encodings. + +## See Also + +The [accepts](https://npmjs.org/package/accepts#readme) module builds on +this module and provides an alternative interface, mime type validation, +and more. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/negotiator.svg +[npm-url]: https://npmjs.org/package/negotiator +[node-version-image]: https://img.shields.io/node/v/negotiator.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/negotiator/master.svg +[travis-url]: https://travis-ci.org/jshttp/negotiator +[coveralls-image]: https://img.shields.io/coveralls/jshttp/negotiator/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/negotiator?branch=master +[downloads-image]: https://img.shields.io/npm/dm/negotiator.svg +[downloads-url]: https://npmjs.org/package/negotiator diff --git a/node_modules/negotiator/index.js b/node_modules/negotiator/index.js new file mode 100644 index 0000000..8d4f6a2 --- /dev/null +++ b/node_modules/negotiator/index.js @@ -0,0 +1,124 @@ +/*! + * negotiator + * Copyright(c) 2012 Federico Romero + * Copyright(c) 2012-2014 Isaac Z. Schlueter + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Cached loaded submodules. + * @private + */ + +var modules = Object.create(null); + +/** + * Module exports. + * @public + */ + +module.exports = Negotiator; +module.exports.Negotiator = Negotiator; + +/** + * Create a Negotiator instance from a request. + * @param {object} request + * @public + */ + +function Negotiator(request) { + if (!(this instanceof Negotiator)) { + return new Negotiator(request); + } + + this.request = request; +} + +Negotiator.prototype.charset = function charset(available) { + var set = this.charsets(available); + return set && set[0]; +}; + +Negotiator.prototype.charsets = function charsets(available) { + var preferredCharsets = loadModule('charset').preferredCharsets; + return preferredCharsets(this.request.headers['accept-charset'], available); +}; + +Negotiator.prototype.encoding = function encoding(available) { + var set = this.encodings(available); + return set && set[0]; +}; + +Negotiator.prototype.encodings = function encodings(available) { + var preferredEncodings = loadModule('encoding').preferredEncodings; + return preferredEncodings(this.request.headers['accept-encoding'], available); +}; + +Negotiator.prototype.language = function language(available) { + var set = this.languages(available); + return set && set[0]; +}; + +Negotiator.prototype.languages = function languages(available) { + var preferredLanguages = loadModule('language').preferredLanguages; + return preferredLanguages(this.request.headers['accept-language'], available); +}; + +Negotiator.prototype.mediaType = function mediaType(available) { + var set = this.mediaTypes(available); + return set && set[0]; +}; + +Negotiator.prototype.mediaTypes = function mediaTypes(available) { + var preferredMediaTypes = loadModule('mediaType').preferredMediaTypes; + return preferredMediaTypes(this.request.headers.accept, available); +}; + +// Backwards compatibility +Negotiator.prototype.preferredCharset = Negotiator.prototype.charset; +Negotiator.prototype.preferredCharsets = Negotiator.prototype.charsets; +Negotiator.prototype.preferredEncoding = Negotiator.prototype.encoding; +Negotiator.prototype.preferredEncodings = Negotiator.prototype.encodings; +Negotiator.prototype.preferredLanguage = Negotiator.prototype.language; +Negotiator.prototype.preferredLanguages = Negotiator.prototype.languages; +Negotiator.prototype.preferredMediaType = Negotiator.prototype.mediaType; +Negotiator.prototype.preferredMediaTypes = Negotiator.prototype.mediaTypes; + +/** + * Load the given module. + * @private + */ + +function loadModule(moduleName) { + var module = modules[moduleName]; + + if (module !== undefined) { + return module; + } + + // This uses a switch for static require analysis + switch (moduleName) { + case 'charset': + module = require('./lib/charset'); + break; + case 'encoding': + module = require('./lib/encoding'); + break; + case 'language': + module = require('./lib/language'); + break; + case 'mediaType': + module = require('./lib/mediaType'); + break; + default: + throw new Error('Cannot find module \'' + moduleName + '\''); + } + + // Store to prevent invoking require() + modules[moduleName] = module; + + return module; +} diff --git a/node_modules/negotiator/lib/charset.js b/node_modules/negotiator/lib/charset.js new file mode 100644 index 0000000..ac4217b --- /dev/null +++ b/node_modules/negotiator/lib/charset.js @@ -0,0 +1,169 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredCharsets; +module.exports.preferredCharsets = preferredCharsets; + +/** + * Module variables. + * @private + */ + +var simpleCharsetRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Charset header. + * @private + */ + +function parseAcceptCharset(accept) { + var accepts = accept.split(','); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var charset = parseCharset(accepts[i].trim(), i); + + if (charset) { + accepts[j++] = charset; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a charset from the Accept-Charset header. + * @private + */ + +function parseCharset(str, i) { + var match = simpleCharsetRegExp.exec(str); + if (!match) return null; + + var charset = match[1]; + var q = 1; + if (match[2]) { + var params = match[2].split(';') + for (var i = 0; i < params.length; i ++) { + var p = params[i].trim().split('='); + if (p[0] === 'q') { + q = parseFloat(p[1]); + break; + } + } + } + + return { + charset: charset, + q: q, + i: i + }; +} + +/** + * Get the priority of a charset. + * @private + */ + +function getCharsetPriority(charset, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(charset, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the charset. + * @private + */ + +function specify(charset, spec, index) { + var s = 0; + if(spec.charset.toLowerCase() === charset.toLowerCase()){ + s |= 1; + } else if (spec.charset !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +} + +/** + * Get the preferred charsets from an Accept-Charset header. + * @public + */ + +function preferredCharsets(accept, provided) { + // RFC 2616 sec 14.2: no header = * + var accepts = parseAcceptCharset(accept === undefined ? '*' : accept || ''); + + if (!provided) { + // sorted list of all charsets + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullCharset); + } + + var priorities = provided.map(function getPriority(type, index) { + return getCharsetPriority(type, accepts, index); + }); + + // sorted list of accepted charsets + return priorities.filter(isQuality).sort(compareSpecs).map(function getCharset(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full charset string. + * @private + */ + +function getFullCharset(spec) { + return spec.charset; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/node_modules/negotiator/lib/encoding.js b/node_modules/negotiator/lib/encoding.js new file mode 100644 index 0000000..70ac3de --- /dev/null +++ b/node_modules/negotiator/lib/encoding.js @@ -0,0 +1,184 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredEncodings; +module.exports.preferredEncodings = preferredEncodings; + +/** + * Module variables. + * @private + */ + +var simpleEncodingRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Encoding header. + * @private + */ + +function parseAcceptEncoding(accept) { + var accepts = accept.split(','); + var hasIdentity = false; + var minQuality = 1; + + for (var i = 0, j = 0; i < accepts.length; i++) { + var encoding = parseEncoding(accepts[i].trim(), i); + + if (encoding) { + accepts[j++] = encoding; + hasIdentity = hasIdentity || specify('identity', encoding); + minQuality = Math.min(minQuality, encoding.q || 1); + } + } + + if (!hasIdentity) { + /* + * If identity doesn't explicitly appear in the accept-encoding header, + * it's added to the list of acceptable encoding with the lowest q + */ + accepts[j++] = { + encoding: 'identity', + q: minQuality, + i: i + }; + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse an encoding from the Accept-Encoding header. + * @private + */ + +function parseEncoding(str, i) { + var match = simpleEncodingRegExp.exec(str); + if (!match) return null; + + var encoding = match[1]; + var q = 1; + if (match[2]) { + var params = match[2].split(';'); + for (var i = 0; i < params.length; i ++) { + var p = params[i].trim().split('='); + if (p[0] === 'q') { + q = parseFloat(p[1]); + break; + } + } + } + + return { + encoding: encoding, + q: q, + i: i + }; +} + +/** + * Get the priority of an encoding. + * @private + */ + +function getEncodingPriority(encoding, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(encoding, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the encoding. + * @private + */ + +function specify(encoding, spec, index) { + var s = 0; + if(spec.encoding.toLowerCase() === encoding.toLowerCase()){ + s |= 1; + } else if (spec.encoding !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +}; + +/** + * Get the preferred encodings from an Accept-Encoding header. + * @public + */ + +function preferredEncodings(accept, provided) { + var accepts = parseAcceptEncoding(accept || ''); + + if (!provided) { + // sorted list of all encodings + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullEncoding); + } + + var priorities = provided.map(function getPriority(type, index) { + return getEncodingPriority(type, accepts, index); + }); + + // sorted list of accepted encodings + return priorities.filter(isQuality).sort(compareSpecs).map(function getEncoding(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full encoding string. + * @private + */ + +function getFullEncoding(spec) { + return spec.encoding; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/node_modules/negotiator/lib/language.js b/node_modules/negotiator/lib/language.js new file mode 100644 index 0000000..1bd2d0e --- /dev/null +++ b/node_modules/negotiator/lib/language.js @@ -0,0 +1,179 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredLanguages; +module.exports.preferredLanguages = preferredLanguages; + +/** + * Module variables. + * @private + */ + +var simpleLanguageRegExp = /^\s*([^\s\-;]+)(?:-([^\s;]+))?\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Language header. + * @private + */ + +function parseAcceptLanguage(accept) { + var accepts = accept.split(','); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var langauge = parseLanguage(accepts[i].trim(), i); + + if (langauge) { + accepts[j++] = langauge; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a language from the Accept-Language header. + * @private + */ + +function parseLanguage(str, i) { + var match = simpleLanguageRegExp.exec(str); + if (!match) return null; + + var prefix = match[1], + suffix = match[2], + full = prefix; + + if (suffix) full += "-" + suffix; + + var q = 1; + if (match[3]) { + var params = match[3].split(';') + for (var i = 0; i < params.length; i ++) { + var p = params[i].split('='); + if (p[0] === 'q') q = parseFloat(p[1]); + } + } + + return { + prefix: prefix, + suffix: suffix, + q: q, + i: i, + full: full + }; +} + +/** + * Get the priority of a language. + * @private + */ + +function getLanguagePriority(language, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(language, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the language. + * @private + */ + +function specify(language, spec, index) { + var p = parseLanguage(language) + if (!p) return null; + var s = 0; + if(spec.full.toLowerCase() === p.full.toLowerCase()){ + s |= 4; + } else if (spec.prefix.toLowerCase() === p.full.toLowerCase()) { + s |= 2; + } else if (spec.full.toLowerCase() === p.prefix.toLowerCase()) { + s |= 1; + } else if (spec.full !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +}; + +/** + * Get the preferred languages from an Accept-Language header. + * @public + */ + +function preferredLanguages(accept, provided) { + // RFC 2616 sec 14.4: no header = * + var accepts = parseAcceptLanguage(accept === undefined ? '*' : accept || ''); + + if (!provided) { + // sorted list of all languages + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullLanguage); + } + + var priorities = provided.map(function getPriority(type, index) { + return getLanguagePriority(type, accepts, index); + }); + + // sorted list of accepted languages + return priorities.filter(isQuality).sort(compareSpecs).map(function getLanguage(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full language string. + * @private + */ + +function getFullLanguage(spec) { + return spec.full; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/node_modules/negotiator/lib/mediaType.js b/node_modules/negotiator/lib/mediaType.js new file mode 100644 index 0000000..67309dd --- /dev/null +++ b/node_modules/negotiator/lib/mediaType.js @@ -0,0 +1,294 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredMediaTypes; +module.exports.preferredMediaTypes = preferredMediaTypes; + +/** + * Module variables. + * @private + */ + +var simpleMediaTypeRegExp = /^\s*([^\s\/;]+)\/([^;\s]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept header. + * @private + */ + +function parseAccept(accept) { + var accepts = splitMediaTypes(accept); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var mediaType = parseMediaType(accepts[i].trim(), i); + + if (mediaType) { + accepts[j++] = mediaType; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a media type from the Accept header. + * @private + */ + +function parseMediaType(str, i) { + var match = simpleMediaTypeRegExp.exec(str); + if (!match) return null; + + var params = Object.create(null); + var q = 1; + var subtype = match[2]; + var type = match[1]; + + if (match[3]) { + var kvps = splitParameters(match[3]).map(splitKeyValuePair); + + for (var j = 0; j < kvps.length; j++) { + var pair = kvps[j]; + var key = pair[0].toLowerCase(); + var val = pair[1]; + + // get the value, unwrapping quotes + var value = val && val[0] === '"' && val[val.length - 1] === '"' + ? val.substr(1, val.length - 2) + : val; + + if (key === 'q') { + q = parseFloat(value); + break; + } + + // store parameter + params[key] = value; + } + } + + return { + type: type, + subtype: subtype, + params: params, + q: q, + i: i + }; +} + +/** + * Get the priority of a media type. + * @private + */ + +function getMediaTypePriority(type, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(type, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the media type. + * @private + */ + +function specify(type, spec, index) { + var p = parseMediaType(type); + var s = 0; + + if (!p) { + return null; + } + + if(spec.type.toLowerCase() == p.type.toLowerCase()) { + s |= 4 + } else if(spec.type != '*') { + return null; + } + + if(spec.subtype.toLowerCase() == p.subtype.toLowerCase()) { + s |= 2 + } else if(spec.subtype != '*') { + return null; + } + + var keys = Object.keys(spec.params); + if (keys.length > 0) { + if (keys.every(function (k) { + return spec.params[k] == '*' || (spec.params[k] || '').toLowerCase() == (p.params[k] || '').toLowerCase(); + })) { + s |= 1 + } else { + return null + } + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s, + } +} + +/** + * Get the preferred media types from an Accept header. + * @public + */ + +function preferredMediaTypes(accept, provided) { + // RFC 2616 sec 14.2: no header = */* + var accepts = parseAccept(accept === undefined ? '*/*' : accept || ''); + + if (!provided) { + // sorted list of all types + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullType); + } + + var priorities = provided.map(function getPriority(type, index) { + return getMediaTypePriority(type, accepts, index); + }); + + // sorted list of accepted types + return priorities.filter(isQuality).sort(compareSpecs).map(function getType(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full type string. + * @private + */ + +function getFullType(spec) { + return spec.type + '/' + spec.subtype; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} + +/** + * Count the number of quotes in a string. + * @private + */ + +function quoteCount(string) { + var count = 0; + var index = 0; + + while ((index = string.indexOf('"', index)) !== -1) { + count++; + index++; + } + + return count; +} + +/** + * Split a key value pair. + * @private + */ + +function splitKeyValuePair(str) { + var index = str.indexOf('='); + var key; + var val; + + if (index === -1) { + key = str; + } else { + key = str.substr(0, index); + val = str.substr(index + 1); + } + + return [key, val]; +} + +/** + * Split an Accept header into media types. + * @private + */ + +function splitMediaTypes(accept) { + var accepts = accept.split(','); + + for (var i = 1, j = 0; i < accepts.length; i++) { + if (quoteCount(accepts[j]) % 2 == 0) { + accepts[++j] = accepts[i]; + } else { + accepts[j] += ',' + accepts[i]; + } + } + + // trim accepts + accepts.length = j + 1; + + return accepts; +} + +/** + * Split a string of parameters. + * @private + */ + +function splitParameters(str) { + var parameters = str.split(';'); + + for (var i = 1, j = 0; i < parameters.length; i++) { + if (quoteCount(parameters[j]) % 2 == 0) { + parameters[++j] = parameters[i]; + } else { + parameters[j] += ';' + parameters[i]; + } + } + + // trim parameters + parameters.length = j + 1; + + for (var i = 0; i < parameters.length; i++) { + parameters[i] = parameters[i].trim(); + } + + return parameters; +} diff --git a/node_modules/negotiator/package.json b/node_modules/negotiator/package.json new file mode 100644 index 0000000..408ecc9 --- /dev/null +++ b/node_modules/negotiator/package.json @@ -0,0 +1,125 @@ +{ + "_args": [ + [ + { + "raw": "negotiator@0.6.1", + "scope": null, + "escapedName": "negotiator", + "name": "negotiator", + "rawSpec": "0.6.1", + "spec": "0.6.1", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/accepts" + ] + ], + "_from": "negotiator@0.6.1", + "_id": "negotiator@0.6.1", + "_inCache": true, + "_location": "/negotiator", + "_nodeVersion": "4.4.3", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/negotiator-0.6.1.tgz_1462250848695_0.027451182017102838" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.1", + "_phantomChildren": {}, + "_requested": { + "raw": "negotiator@0.6.1", + "scope": null, + "escapedName": "negotiator", + "name": "negotiator", + "rawSpec": "0.6.1", + "spec": "0.6.1", + "type": "version" + }, + "_requiredBy": [ + "/accepts" + ], + "_resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz", + "_shasum": "2b327184e8992101177b28563fb5e7102acd0ca9", + "_shrinkwrap": null, + "_spec": "negotiator@0.6.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/negotiator/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Federico Romero", + "email": "federico.romero@outboxlabs.com" + }, + { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + } + ], + "dependencies": {}, + "description": "HTTP content negotiation", + "devDependencies": { + "istanbul": "0.4.3", + "mocha": "~1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "2b327184e8992101177b28563fb5e7102acd0ca9", + "tarball": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "HISTORY.md", + "LICENSE", + "index.js", + "README.md" + ], + "gitHead": "751c381c32707f238143cd65d78520e16f4ef9e5", + "homepage": "https://github.com/jshttp/negotiator#readme", + "keywords": [ + "http", + "content negotiation", + "accept", + "accept-language", + "accept-encoding", + "accept-charset" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "federomero", + "email": "federomero@gmail.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "negotiator", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/negotiator.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.6.1" +} diff --git a/node_modules/on-finished/HISTORY.md b/node_modules/on-finished/HISTORY.md new file mode 100644 index 0000000..98ff0e9 --- /dev/null +++ b/node_modules/on-finished/HISTORY.md @@ -0,0 +1,88 @@ +2.3.0 / 2015-05-26 +================== + + * Add defined behavior for HTTP `CONNECT` requests + * Add defined behavior for HTTP `Upgrade` requests + * deps: ee-first@1.1.1 + +2.2.1 / 2015-04-22 +================== + + * Fix `isFinished(req)` when data buffered + +2.2.0 / 2014-12-22 +================== + + * Add message object to callback arguments + +2.1.1 / 2014-10-22 +================== + + * Fix handling of pipelined requests + +2.1.0 / 2014-08-16 +================== + + * Check if `socket` is detached + * Return `undefined` for `isFinished` if state unknown + +2.0.0 / 2014-08-16 +================== + + * Add `isFinished` function + * Move to `jshttp` organization + * Remove support for plain socket argument + * Rename to `on-finished` + * Support both `req` and `res` as arguments + * deps: ee-first@1.0.5 + +1.2.2 / 2014-06-10 +================== + + * Reduce listeners added to emitters + - avoids "event emitter leak" warnings when used multiple times on same request + +1.2.1 / 2014-06-08 +================== + + * Fix returned value when already finished + +1.2.0 / 2014-06-05 +================== + + * Call callback when called on already-finished socket + +1.1.4 / 2014-05-27 +================== + + * Support node.js 0.8 + +1.1.3 / 2014-04-30 +================== + + * Make sure errors passed as instanceof `Error` + +1.1.2 / 2014-04-18 +================== + + * Default the `socket` to passed-in object + +1.1.1 / 2014-01-16 +================== + + * Rename module to `finished` + +1.1.0 / 2013-12-25 +================== + + * Call callback when called on already-errored socket + +1.0.1 / 2013-12-20 +================== + + * Actually pass the error to the callback + +1.0.0 / 2013-12-20 +================== + + * Initial release diff --git a/node_modules/on-finished/LICENSE b/node_modules/on-finished/LICENSE new file mode 100644 index 0000000..5931fd2 --- /dev/null +++ b/node_modules/on-finished/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/on-finished/README.md b/node_modules/on-finished/README.md new file mode 100644 index 0000000..a0e1157 --- /dev/null +++ b/node_modules/on-finished/README.md @@ -0,0 +1,154 @@ +# on-finished + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Execute a callback when a HTTP request closes, finishes, or errors. + +## Install + +```sh +$ npm install on-finished +``` + +## API + +```js +var onFinished = require('on-finished') +``` + +### onFinished(res, listener) + +Attach a listener to listen for the response to finish. The listener will +be invoked only once when the response finished. If the response finished +to an error, the first argument will contain the error. If the response +has already finished, the listener will be invoked. + +Listening to the end of a response would be used to close things associated +with the response, like open files. + +Listener is invoked as `listener(err, res)`. + +```js +onFinished(res, function (err, res) { + // clean up open fds, etc. + // err contains the error is request error'd +}) +``` + +### onFinished(req, listener) + +Attach a listener to listen for the request to finish. The listener will +be invoked only once when the request finished. If the request finished +to an error, the first argument will contain the error. If the request +has already finished, the listener will be invoked. + +Listening to the end of a request would be used to know when to continue +after reading the data. + +Listener is invoked as `listener(err, req)`. + +```js +var data = '' + +req.setEncoding('utf8') +res.on('data', function (str) { + data += str +}) + +onFinished(req, function (err, req) { + // data is read unless there is err +}) +``` + +### onFinished.isFinished(res) + +Determine if `res` is already finished. This would be useful to check and +not even start certain operations if the response has already finished. + +### onFinished.isFinished(req) + +Determine if `req` is already finished. This would be useful to check and +not even start certain operations if the request has already finished. + +## Special Node.js requests + +### HTTP CONNECT method + +The meaning of the `CONNECT` method from RFC 7231, section 4.3.6: + +> The CONNECT method requests that the recipient establish a tunnel to +> the destination origin server identified by the request-target and, +> if successful, thereafter restrict its behavior to blind forwarding +> of packets, in both directions, until the tunnel is closed. Tunnels +> are commonly used to create an end-to-end virtual connection, through +> one or more proxies, which can then be secured using TLS (Transport +> Layer Security, [RFC5246]). + +In Node.js, these request objects come from the `'connect'` event on +the HTTP server. + +When this module is used on a HTTP `CONNECT` request, the request is +considered "finished" immediately, **due to limitations in the Node.js +interface**. This means if the `CONNECT` request contains a request entity, +the request will be considered "finished" even before it has been read. + +There is no such thing as a response object to a `CONNECT` request in +Node.js, so there is no support for for one. + +### HTTP Upgrade request + +The meaning of the `Upgrade` header from RFC 7230, section 6.1: + +> The "Upgrade" header field is intended to provide a simple mechanism +> for transitioning from HTTP/1.1 to some other protocol on the same +> connection. + +In Node.js, these request objects come from the `'upgrade'` event on +the HTTP server. + +When this module is used on a HTTP request with an `Upgrade` header, the +request is considered "finished" immediately, **due to limitations in the +Node.js interface**. This means if the `Upgrade` request contains a request +entity, the request will be considered "finished" even before it has been +read. + +There is no such thing as a response object to a `Upgrade` request in +Node.js, so there is no support for for one. + +## Example + +The following code ensures that file descriptors are always closed +once the response finishes. + +```js +var destroy = require('destroy') +var http = require('http') +var onFinished = require('on-finished') + +http.createServer(function onRequest(req, res) { + var stream = fs.createReadStream('package.json') + stream.pipe(res) + onFinished(res, function (err) { + destroy(stream) + }) +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/on-finished.svg +[npm-url]: https://npmjs.org/package/on-finished +[node-version-image]: https://img.shields.io/node/v/on-finished.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/on-finished/master.svg +[travis-url]: https://travis-ci.org/jshttp/on-finished +[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-finished/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master +[downloads-image]: https://img.shields.io/npm/dm/on-finished.svg +[downloads-url]: https://npmjs.org/package/on-finished diff --git a/node_modules/on-finished/index.js b/node_modules/on-finished/index.js new file mode 100644 index 0000000..9abd98f --- /dev/null +++ b/node_modules/on-finished/index.js @@ -0,0 +1,196 @@ +/*! + * on-finished + * Copyright(c) 2013 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = onFinished +module.exports.isFinished = isFinished + +/** + * Module dependencies. + * @private + */ + +var first = require('ee-first') + +/** + * Variables. + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Invoke callback when the response has finished, useful for + * cleaning up resources afterwards. + * + * @param {object} msg + * @param {function} listener + * @return {object} + * @public + */ + +function onFinished(msg, listener) { + if (isFinished(msg) !== false) { + defer(listener, null, msg) + return msg + } + + // attach the listener to the message + attachListener(msg, listener) + + return msg +} + +/** + * Determine if message is already finished. + * + * @param {object} msg + * @return {boolean} + * @public + */ + +function isFinished(msg) { + var socket = msg.socket + + if (typeof msg.finished === 'boolean') { + // OutgoingMessage + return Boolean(msg.finished || (socket && !socket.writable)) + } + + if (typeof msg.complete === 'boolean') { + // IncomingMessage + return Boolean(msg.upgrade || !socket || !socket.readable || (msg.complete && !msg.readable)) + } + + // don't know + return undefined +} + +/** + * Attach a finished listener to the message. + * + * @param {object} msg + * @param {function} callback + * @private + */ + +function attachFinishedListener(msg, callback) { + var eeMsg + var eeSocket + var finished = false + + function onFinish(error) { + eeMsg.cancel() + eeSocket.cancel() + + finished = true + callback(error) + } + + // finished on first message event + eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish) + + function onSocket(socket) { + // remove listener + msg.removeListener('socket', onSocket) + + if (finished) return + if (eeMsg !== eeSocket) return + + // finished on first socket event + eeSocket = first([[socket, 'error', 'close']], onFinish) + } + + if (msg.socket) { + // socket already assigned + onSocket(msg.socket) + return + } + + // wait for socket to be assigned + msg.on('socket', onSocket) + + if (msg.socket === undefined) { + // node.js 0.8 patch + patchAssignSocket(msg, onSocket) + } +} + +/** + * Attach the listener to the message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function attachListener(msg, listener) { + var attached = msg.__onFinished + + // create a private single listener with queue + if (!attached || !attached.queue) { + attached = msg.__onFinished = createListener(msg) + attachFinishedListener(msg, attached) + } + + attached.queue.push(listener) +} + +/** + * Create listener on message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function createListener(msg) { + function listener(err) { + if (msg.__onFinished === listener) msg.__onFinished = null + if (!listener.queue) return + + var queue = listener.queue + listener.queue = null + + for (var i = 0; i < queue.length; i++) { + queue[i](err, msg) + } + } + + listener.queue = [] + + return listener +} + +/** + * Patch ServerResponse.prototype.assignSocket for node.js 0.8. + * + * @param {ServerResponse} res + * @param {function} callback + * @private + */ + +function patchAssignSocket(res, callback) { + var assignSocket = res.assignSocket + + if (typeof assignSocket !== 'function') return + + // res.on('socket', callback) is broken in 0.8 + res.assignSocket = function _assignSocket(socket) { + assignSocket.call(this, socket) + callback(socket) + } +} diff --git a/node_modules/on-finished/package.json b/node_modules/on-finished/package.json new file mode 100644 index 0000000..2a456be --- /dev/null +++ b/node_modules/on-finished/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + { + "raw": "on-finished@~2.3.0", + "scope": null, + "escapedName": "on-finished", + "name": "on-finished", + "rawSpec": "~2.3.0", + "spec": ">=2.3.0 <2.4.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "on-finished@>=2.3.0 <2.4.0", + "_id": "on-finished@2.3.0", + "_inCache": true, + "_location": "/on-finished", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "on-finished@~2.3.0", + "scope": null, + "escapedName": "on-finished", + "name": "on-finished", + "rawSpec": "~2.3.0", + "spec": ">=2.3.0 <2.4.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send" + ], + "_resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "_shasum": "20f1336481b083cd75337992a16971aa2d906947", + "_shrinkwrap": null, + "_spec": "on-finished@~2.3.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/on-finished/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "ee-first": "1.1.1" + }, + "description": "Execute a callback when a request closes, finishes, or errors", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "directories": {}, + "dist": { + "shasum": "20f1336481b083cd75337992a16971aa2d906947", + "tarball": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "gitHead": "34babcb58126a416fcf5205768204f2e12699dda", + "homepage": "https://github.com/jshttp/on-finished", + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "on-finished", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/on-finished.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "2.3.0" +} diff --git a/node_modules/parseurl/HISTORY.md b/node_modules/parseurl/HISTORY.md new file mode 100644 index 0000000..395041e --- /dev/null +++ b/node_modules/parseurl/HISTORY.md @@ -0,0 +1,47 @@ +1.3.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.3.0 / 2014-08-09 +================== + + * Add `parseurl.original` for parsing `req.originalUrl` with fallback + * Return `undefined` if `req.url` is `undefined` + +1.2.0 / 2014-07-21 +================== + + * Cache URLs based on original value + * Remove no-longer-needed URL mis-parse work-around + * Simplify the "fast-path" `RegExp` + +1.1.3 / 2014-07-08 +================== + + * Fix typo + +1.1.2 / 2014-07-08 +================== + + * Seriously fix Node.js 0.8 compatibility + +1.1.1 / 2014-07-08 +================== + + * Fix Node.js 0.8 compatibility + +1.1.0 / 2014-07-08 +================== + + * Incorporate URL href-only parse fast-path + +1.0.1 / 2014-03-08 +================== + + * Add missing `require` + +1.0.0 / 2014-03-08 +================== + + * Genesis from `connect` diff --git a/node_modules/parseurl/LICENSE b/node_modules/parseurl/LICENSE new file mode 100644 index 0000000..ec7dfe7 --- /dev/null +++ b/node_modules/parseurl/LICENSE @@ -0,0 +1,24 @@ + +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/parseurl/README.md b/node_modules/parseurl/README.md new file mode 100644 index 0000000..f4796eb --- /dev/null +++ b/node_modules/parseurl/README.md @@ -0,0 +1,120 @@ +# parseurl + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse a URL with memoization. + +## Install + +```bash +$ npm install parseurl +``` + +## API + +```js +var parseurl = require('parseurl') +``` + +### parseurl(req) + +Parse the URL of the given request object (looks at the `req.url` property) +and return the result. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.url` does +not change will return a cached parsed object, rather than parsing again. + +### parseurl.original(req) + +Parse the original URL of the given request object and return the result. +This works by trying to parse `req.originalUrl` if it is a string, otherwise +parses `req.url`. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.originalUrl` +does not change will return a cached parsed object, rather than parsing again. + +## Benchmark + +```bash +$ npm run-script bench + +> parseurl@1.3.1 bench nodejs-parseurl +> node benchmark/index.js + +> node benchmark/fullurl.js + + Parsing URL "http://localhost:8888/foo/bar?user=tj&pet=fluffy" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 1,290,780 ops/sec ±0.46% (195 runs sampled) + nativeurl x 56,401 ops/sec ±0.22% (196 runs sampled) + parseurl x 55,231 ops/sec ±0.22% (194 runs sampled) + +> node benchmark/pathquery.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 1,986,668 ops/sec ±0.27% (190 runs sampled) + nativeurl x 98,740 ops/sec ±0.21% (195 runs sampled) + parseurl x 2,628,171 ops/sec ±0.36% (195 runs sampled) + +> node benchmark/samerequest.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" on same request object + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 2,184,468 ops/sec ±0.40% (194 runs sampled) + nativeurl x 99,437 ops/sec ±0.71% (194 runs sampled) + parseurl x 10,498,005 ops/sec ±0.61% (186 runs sampled) + +> node benchmark/simplepath.js + + Parsing URL "/foo/bar" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 4,535,825 ops/sec ±0.27% (191 runs sampled) + nativeurl x 98,769 ops/sec ±0.54% (191 runs sampled) + parseurl x 4,164,865 ops/sec ±0.34% (192 runs sampled) + +> node benchmark/slash.js + + Parsing URL "/" + + 1 test completed. + 2 tests completed. + 3 tests completed. + + fasturl x 4,908,405 ops/sec ±0.42% (191 runs sampled) + nativeurl x 100,945 ops/sec ±0.59% (188 runs sampled) + parseurl x 4,333,208 ops/sec ±0.27% (194 runs sampled) +``` + +## License + + [MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/parseurl.svg +[npm-url]: https://npmjs.org/package/parseurl +[node-version-image]: https://img.shields.io/node/v/parseurl.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/pillarjs/parseurl/master.svg +[travis-url]: https://travis-ci.org/pillarjs/parseurl +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/parseurl/master.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/parseurl?branch=master +[downloads-image]: https://img.shields.io/npm/dm/parseurl.svg +[downloads-url]: https://npmjs.org/package/parseurl diff --git a/node_modules/parseurl/index.js b/node_modules/parseurl/index.js new file mode 100644 index 0000000..56cc6ec --- /dev/null +++ b/node_modules/parseurl/index.js @@ -0,0 +1,138 @@ +/*! + * parseurl + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var url = require('url') +var parse = url.parse +var Url = url.Url + +/** + * Pattern for a simple path case. + * See: https://github.com/joyent/node/pull/7878 + */ + +var simplePathRegExp = /^(\/\/?(?!\/)[^\?#\s]*)(\?[^#\s]*)?$/ + +/** + * Exports. + */ + +module.exports = parseurl +module.exports.original = originalurl + +/** + * Parse the `req` url with memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @api public + */ + +function parseurl(req) { + var url = req.url + + if (url === undefined) { + // URL is undefined + return undefined + } + + var parsed = req._parsedUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return req._parsedUrl = parsed +}; + +/** + * Parse the `req` original url with fallback and memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @api public + */ + +function originalurl(req) { + var url = req.originalUrl + + if (typeof url !== 'string') { + // Fallback + return parseurl(req) + } + + var parsed = req._parsedOriginalUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return req._parsedOriginalUrl = parsed +}; + +/** + * Parse the `str` url with fast-path short-cut. + * + * @param {string} str + * @return {Object} + * @api private + */ + +function fastparse(str) { + // Try fast path regexp + // See: https://github.com/joyent/node/pull/7878 + var simplePath = typeof str === 'string' && simplePathRegExp.exec(str) + + // Construct simple URL + if (simplePath) { + var pathname = simplePath[1] + var search = simplePath[2] || null + var url = Url !== undefined + ? new Url() + : {} + url.path = str + url.href = str + url.pathname = pathname + url.search = search + url.query = search && search.substr(1) + + return url + } + + return parse(str) +} + +/** + * Determine if parsed is still fresh for url. + * + * @param {string} url + * @param {object} parsedUrl + * @return {boolean} + * @api private + */ + +function fresh(url, parsedUrl) { + return typeof parsedUrl === 'object' + && parsedUrl !== null + && (Url === undefined || parsedUrl instanceof Url) + && parsedUrl._raw === url +} diff --git a/node_modules/parseurl/package.json b/node_modules/parseurl/package.json new file mode 100644 index 0000000..64ff9c6 --- /dev/null +++ b/node_modules/parseurl/package.json @@ -0,0 +1,124 @@ +{ + "_args": [ + [ + { + "raw": "parseurl@~1.3.1", + "scope": null, + "escapedName": "parseurl", + "name": "parseurl", + "rawSpec": "~1.3.1", + "spec": ">=1.3.1 <1.4.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "parseurl@>=1.3.1 <1.4.0", + "_id": "parseurl@1.3.1", + "_inCache": true, + "_location": "/parseurl", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "parseurl@~1.3.1", + "scope": null, + "escapedName": "parseurl", + "name": "parseurl", + "rawSpec": "~1.3.1", + "spec": ">=1.3.1 <1.4.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.1.tgz", + "_shasum": "c8ab8c9223ba34888aa64a297b28853bec18da56", + "_shrinkwrap": null, + "_spec": "parseurl@~1.3.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/pillarjs/parseurl/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": {}, + "description": "parse a url with memoization", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.0.0", + "fast-url-parser": "1.1.3", + "istanbul": "0.4.2", + "mocha": "~1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "c8ab8c9223ba34888aa64a297b28853bec18da56", + "tarball": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.1.tgz" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "6d22d376d75b927ab2b5347ce3a1d6735133dd43", + "homepage": "https://github.com/pillarjs/parseurl", + "license": "MIT", + "maintainers": [ + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "mscdex", + "email": "mscdex@mscdex.net" + }, + { + "name": "fishrock123", + "email": "fishrock123@rocketmail.com" + }, + { + "name": "defunctzombie", + "email": "shtylman@gmail.com" + } + ], + "name": "parseurl", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/parseurl.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --check-leaks --bail --reporter spec test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec test/" + }, + "version": "1.3.1" +} diff --git a/node_modules/path-to-regexp/History.md b/node_modules/path-to-regexp/History.md new file mode 100644 index 0000000..7f65878 --- /dev/null +++ b/node_modules/path-to-regexp/History.md @@ -0,0 +1,36 @@ +0.1.7 / 2015-07-28 +================== + + * Fixed regression with escaped round brackets and matching groups. + +0.1.6 / 2015-06-19 +================== + + * Replace `index` feature by outputting all parameters, unnamed and named. + +0.1.5 / 2015-05-08 +================== + + * Add an index property for position in match result. + +0.1.4 / 2015-03-05 +================== + + * Add license information + +0.1.3 / 2014-07-06 +================== + + * Better array support + * Improved support for trailing slash in non-ending mode + +0.1.0 / 2014-03-06 +================== + + * add options.end + +0.0.2 / 2013-02-10 +================== + + * Update to match current express + * add .license property to component.json diff --git a/node_modules/path-to-regexp/LICENSE b/node_modules/path-to-regexp/LICENSE new file mode 100644 index 0000000..983fbe8 --- /dev/null +++ b/node_modules/path-to-regexp/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/path-to-regexp/Readme.md b/node_modules/path-to-regexp/Readme.md new file mode 100644 index 0000000..95452a6 --- /dev/null +++ b/node_modules/path-to-regexp/Readme.md @@ -0,0 +1,35 @@ +# Path-to-RegExp + +Turn an Express-style path string such as `/user/:name` into a regular expression. + +**Note:** This is a legacy branch. You should upgrade to `1.x`. + +## Usage + +```javascript +var pathToRegexp = require('path-to-regexp'); +``` + +### pathToRegexp(path, keys, options) + + - **path** A string in the express format, an array of such strings, or a regular expression + - **keys** An array to be populated with the keys present in the url. Once the function completes, this will be an array of strings. + - **options** + - **options.sensitive** Defaults to false, set this to true to make routes case sensitive + - **options.strict** Defaults to false, set this to true to make the trailing slash matter. + - **options.end** Defaults to true, set this to false to only match the prefix of the URL. + +```javascript +var keys = []; +var exp = pathToRegexp('/foo/:bar', keys); +//keys = ['bar'] +//exp = /^\/foo\/(?:([^\/]+?))\/?$/i +``` + +## Live Demo + +You can see a live demo of this library in use at [express-route-tester](http://forbeslindesay.github.com/express-route-tester/). + +## License + + MIT diff --git a/node_modules/path-to-regexp/index.js b/node_modules/path-to-regexp/index.js new file mode 100644 index 0000000..500d1da --- /dev/null +++ b/node_modules/path-to-regexp/index.js @@ -0,0 +1,129 @@ +/** + * Expose `pathtoRegexp`. + */ + +module.exports = pathtoRegexp; + +/** + * Match matching groups in a regular expression. + */ +var MATCHING_GROUP_REGEXP = /\((?!\?)/g; + +/** + * Normalize the given path string, + * returning a regular expression. + * + * An empty array should be passed, + * which will contain the placeholder + * key names. For example "/user/:id" will + * then contain ["id"]. + * + * @param {String|RegExp|Array} path + * @param {Array} keys + * @param {Object} options + * @return {RegExp} + * @api private + */ + +function pathtoRegexp(path, keys, options) { + options = options || {}; + keys = keys || []; + var strict = options.strict; + var end = options.end !== false; + var flags = options.sensitive ? '' : 'i'; + var extraOffset = 0; + var keysOffset = keys.length; + var i = 0; + var name = 0; + var m; + + if (path instanceof RegExp) { + while (m = MATCHING_GROUP_REGEXP.exec(path.source)) { + keys.push({ + name: name++, + optional: false, + offset: m.index + }); + } + + return path; + } + + if (Array.isArray(path)) { + // Map array parts into regexps and return their source. We also pass + // the same keys and options instance into every generation to get + // consistent matching groups before we join the sources together. + path = path.map(function (value) { + return pathtoRegexp(value, keys, options).source; + }); + + return new RegExp('(?:' + path.join('|') + ')', flags); + } + + path = ('^' + path + (strict ? '' : path[path.length - 1] === '/' ? '?' : '/?')) + .replace(/\/\(/g, '/(?:') + .replace(/([\/\.])/g, '\\$1') + .replace(/(\\\/)?(\\\.)?:(\w+)(\(.*?\))?(\*)?(\?)?/g, function (match, slash, format, key, capture, star, optional, offset) { + slash = slash || ''; + format = format || ''; + capture = capture || '([^\\/' + format + ']+?)'; + optional = optional || ''; + + keys.push({ + name: key, + optional: !!optional, + offset: offset + extraOffset + }); + + var result = '' + + (optional ? '' : slash) + + '(?:' + + format + (optional ? slash : '') + capture + + (star ? '((?:[\\/' + format + '].+?)?)' : '') + + ')' + + optional; + + extraOffset += result.length - match.length; + + return result; + }) + .replace(/\*/g, function (star, index) { + var len = keys.length + + while (len-- > keysOffset && keys[len].offset > index) { + keys[len].offset += 3; // Replacement length minus asterisk length. + } + + return '(.*)'; + }); + + // This is a workaround for handling unnamed matching groups. + while (m = MATCHING_GROUP_REGEXP.exec(path)) { + var escapeCount = 0; + var index = m.index; + + while (path.charAt(--index) === '\\') { + escapeCount++; + } + + // It's possible to escape the bracket. + if (escapeCount % 2 === 1) { + continue; + } + + if (keysOffset + i === keys.length || keys[keysOffset + i].offset > m.index) { + keys.splice(keysOffset + i, 0, { + name: name++, // Unnamed matching groups must be consistently linear. + optional: false, + offset: m.index + }); + } + + i++; + } + + // If the path is non-ending, match until the end or a slash. + path += (end ? '$' : (path[path.length - 1] === '/' ? '' : '(?=\\/|$)')); + + return new RegExp(path, flags); +}; diff --git a/node_modules/path-to-regexp/package.json b/node_modules/path-to-regexp/package.json new file mode 100644 index 0000000..e63413b --- /dev/null +++ b/node_modules/path-to-regexp/package.json @@ -0,0 +1,219 @@ +{ + "_args": [ + [ + { + "raw": "path-to-regexp@0.1.7", + "scope": null, + "escapedName": "path-to-regexp", + "name": "path-to-regexp", + "rawSpec": "0.1.7", + "spec": "0.1.7", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "path-to-regexp@0.1.7", + "_id": "path-to-regexp@0.1.7", + "_inCache": true, + "_location": "/path-to-regexp", + "_nodeVersion": "2.3.3", + "_npmUser": { + "name": "blakeembrey", + "email": "hello@blakeembrey.com" + }, + "_npmVersion": "2.13.2", + "_phantomChildren": {}, + "_requested": { + "raw": "path-to-regexp@0.1.7", + "scope": null, + "escapedName": "path-to-regexp", + "name": "path-to-regexp", + "rawSpec": "0.1.7", + "spec": "0.1.7", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "_shasum": "df604178005f522f15eb4490e7247a1bfaa67f8c", + "_shrinkwrap": null, + "_spec": "path-to-regexp@0.1.7", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/component/path-to-regexp/issues" + }, + "component": { + "scripts": { + "path-to-regexp": "index.js" + } + }, + "dependencies": {}, + "description": "Express style path to RegExp utility", + "devDependencies": { + "istanbul": "^0.2.6", + "mocha": "^1.17.1" + }, + "directories": {}, + "dist": { + "shasum": "df604178005f522f15eb4490e7247a1bfaa67f8c", + "tarball": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz" + }, + "files": [ + "index.js", + "LICENSE" + ], + "gitHead": "039118d6c3c186d3f176c73935ca887a32a33d93", + "homepage": "https://github.com/component/path-to-regexp#readme", + "keywords": [ + "express", + "regexp" + ], + "license": "MIT", + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "hughsk", + "email": "hughskennedy@gmail.com" + }, + { + "name": "timaschew", + "email": "timaschew@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "dominicbarnes", + "email": "dominic@dbarnes.info" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + }, + { + "name": "rauchg", + "email": "rauchg@gmail.com" + }, + { + "name": "retrofox", + "email": "rdsuarez@gmail.com" + }, + { + "name": "coreh", + "email": "thecoreh@gmail.com" + }, + { + "name": "forbeslindesay", + "email": "forbes@lindesay.co.uk" + }, + { + "name": "kelonye", + "email": "kelonyemitchel@gmail.com" + }, + { + "name": "mattmueller", + "email": "mattmuelle@gmail.com" + }, + { + "name": "yields", + "email": "yields@icloud.com" + }, + { + "name": "anthonyshort", + "email": "antshort@gmail.com" + }, + { + "name": "ianstormtaylor", + "email": "ian@ianstormtaylor.com" + }, + { + "name": "cristiandouce", + "email": "cristian@gravityonmars.com" + }, + { + "name": "swatinem", + "email": "arpad.borsos@googlemail.com" + }, + { + "name": "stagas", + "email": "gstagas@gmail.com" + }, + { + "name": "amasad", + "email": "amjad.masad@gmail.com" + }, + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + }, + { + "name": "calvinfo", + "email": "calvin@calv.info" + }, + { + "name": "blakeembrey", + "email": "hello@blakeembrey.com" + }, + { + "name": "timoxley", + "email": "secoif@gmail.com" + }, + { + "name": "jonathanong", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "queckezz", + "email": "fabian.eichenberger@gmail.com" + }, + { + "name": "nami-doc", + "email": "vendethiel@hotmail.fr" + }, + { + "name": "clintwood", + "email": "clint@anotherway.co.za" + }, + { + "name": "thehydroimpulse", + "email": "dnfagnan@gmail.com" + }, + { + "name": "stephenmathieson", + "email": "me@stephenmathieson.com" + }, + { + "name": "trevorgerhardt", + "email": "trevorgerhardt@gmail.com" + }, + { + "name": "dfcreative", + "email": "df.creative@gmail.com" + }, + { + "name": "defunctzombie", + "email": "shtylman@gmail.com" + } + ], + "name": "path-to-regexp", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/component/path-to-regexp.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "0.1.7" +} diff --git a/node_modules/proxy-addr/HISTORY.md b/node_modules/proxy-addr/HISTORY.md new file mode 100644 index 0000000..ac845a0 --- /dev/null +++ b/node_modules/proxy-addr/HISTORY.md @@ -0,0 +1,104 @@ +1.1.3 / 2017-01-14 +================== + + * deps: ipaddr.js@1.2.0 + +1.1.2 / 2016-05-29 +================== + + * deps: ipaddr.js@1.1.1 + - Fix IPv6-mapped IPv4 validation edge cases + +1.1.1 / 2016-05-03 +================== + + * Fix regression matching mixed versions against multiple subnets + +1.1.0 / 2016-05-01 +================== + + * Fix accepting various invalid netmasks + - IPv4 netmasks must be contingous + - IPv6 addresses cannot be used as a netmask + * deps: ipaddr.js@1.1.0 + +1.0.10 / 2015-12-09 +=================== + + * deps: ipaddr.js@1.0.5 + - Fix regression in `isValid` with non-string arguments + +1.0.9 / 2015-12-01 +================== + + * deps: ipaddr.js@1.0.4 + - Fix accepting some invalid IPv6 addresses + - Reject CIDRs with negative or overlong masks + * perf: enable strict mode + +1.0.8 / 2015-05-10 +================== + + * deps: ipaddr.js@1.0.1 + +1.0.7 / 2015-03-16 +================== + + * deps: ipaddr.js@0.1.9 + - Fix OOM on certain inputs to `isValid` + +1.0.6 / 2015-02-01 +================== + + * deps: ipaddr.js@0.1.8 + +1.0.5 / 2015-01-08 +================== + + * deps: ipaddr.js@0.1.6 + +1.0.4 / 2014-11-23 +================== + + * deps: ipaddr.js@0.1.5 + - Fix edge cases with `isValid` + +1.0.3 / 2014-09-21 +================== + + * Use `forwarded` npm module + +1.0.2 / 2014-09-18 +================== + + * Fix a global leak when multiple subnets are trusted + * Support Node.js 0.6 + * deps: ipaddr.js@0.1.3 + +1.0.1 / 2014-06-03 +================== + + * Fix links in npm package + +1.0.0 / 2014-05-08 +================== + + * Add `trust` argument to determine proxy trust on + * Accepts custom function + * Accepts IPv4/IPv6 address(es) + * Accepts subnets + * Accepts pre-defined names + * Add optional `trust` argument to `proxyaddr.all` to + stop at first untrusted + * Add `proxyaddr.compile` to pre-compile `trust` function + to make subsequent calls faster + +0.0.1 / 2014-05-04 +================== + + * Fix bad npm publish + +0.0.0 / 2014-05-04 +================== + + * Initial release diff --git a/node_modules/proxy-addr/LICENSE b/node_modules/proxy-addr/LICENSE new file mode 100644 index 0000000..cab251c --- /dev/null +++ b/node_modules/proxy-addr/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/proxy-addr/README.md b/node_modules/proxy-addr/README.md new file mode 100644 index 0000000..1bffc76 --- /dev/null +++ b/node_modules/proxy-addr/README.md @@ -0,0 +1,136 @@ +# proxy-addr + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Determine address of proxied request + +## Install + +```sh +$ npm install proxy-addr +``` + +## API + +```js +var proxyaddr = require('proxy-addr') +``` + +### proxyaddr(req, trust) + +Return the address of the request, using the given `trust` parameter. + +The `trust` argument is a function that returns `true` if you trust +the address, `false` if you don't. The closest untrusted address is +returned. + +```js +proxyaddr(req, function(addr){ return addr === '127.0.0.1' }) +proxyaddr(req, function(addr, i){ return i < 1 }) +``` + +The `trust` arugment may also be a single IP address string or an +array of trusted addresses, as plain IP addresses, CIDR-formatted +strings, or IP/netmask strings. + +```js +proxyaddr(req, '127.0.0.1') +proxyaddr(req, ['127.0.0.0/8', '10.0.0.0/8']) +proxyaddr(req, ['127.0.0.0/255.0.0.0', '192.168.0.0/255.255.0.0']) +``` + +This module also supports IPv6. Your IPv6 addresses will be normalized +automatically (i.e. `fe80::00ed:1` equals `fe80:0:0:0:0:0:ed:1`). + +```js +proxyaddr(req, '::1') +proxyaddr(req, ['::1/128', 'fe80::/10']) +``` + +This module will automatically work with IPv4-mapped IPv6 addresses +as well to support node.js in IPv6-only mode. This means that you do +not have to specify both `::ffff:a00:1` and `10.0.0.1`. + +As a convenience, this module also takes certain pre-defined names +in addition to IP addresses, which expand into IP addresses: + +```js +proxyaddr(req, 'loopback') +proxyaddr(req, ['loopback', 'fc00:ac:1ab5:fff::1/64']) +``` + + * `loopback`: IPv4 and IPv6 loopback addresses (like `::1` and + `127.0.0.1`). + * `linklocal`: IPv4 and IPv6 link-local addresses (like + `fe80::1:1:1:1` and `169.254.0.1`). + * `uniquelocal`: IPv4 private addresses and IPv6 unique-local + addresses (like `fc00:ac:1ab5:fff::1` and `192.168.0.1`). + +When `trust` is specified as a function, it will be called for each +address to determine if it is a trusted address. The function is +given two arguments: `addr` and `i`, where `addr` is a string of +the address to check and `i` is a number that represents the distance +from the socket address. + +### proxyaddr.all(req, [trust]) + +Return all the addresses of the request, optionally stopping at the +first untrusted. This array is ordered from closest to furthest +(i.e. `arr[0] === req.connection.remoteAddress`). + +```js +proxyaddr.all(req) +``` + +The optional `trust` argument takes the same arguments as `trust` +does in `proxyaddr(req, trust)`. + +```js +proxyaddr.all(req, 'loopback') +``` + +### proxyaddr.compile(val) + +Compiles argument `val` into a `trust` function. This function takes +the same arguments as `trust` does in `proxyaddr(req, trust)` and +returns a function suitable for `proxyaddr(req, trust)`. + +```js +var trust = proxyaddr.compile('localhost') +var addr = proxyaddr(req, trust) +``` + +This function is meant to be optimized for use against every request. +It is recommend to compile a trust function up-front for the trusted +configuration and pass that to `proxyaddr(req, trust)` for each request. + +## Testing + +```sh +$ npm test +``` + +## Benchmarks + +```sh +$ npm run-script bench +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/proxy-addr.svg +[npm-url]: https://npmjs.org/package/proxy-addr +[node-version-image]: https://img.shields.io/node/v/proxy-addr.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/proxy-addr/master.svg +[travis-url]: https://travis-ci.org/jshttp/proxy-addr +[coveralls-image]: https://img.shields.io/coveralls/jshttp/proxy-addr/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/proxy-addr?branch=master +[downloads-image]: https://img.shields.io/npm/dm/proxy-addr.svg +[downloads-url]: https://npmjs.org/package/proxy-addr diff --git a/node_modules/proxy-addr/index.js b/node_modules/proxy-addr/index.js new file mode 100644 index 0000000..0b3cf0b --- /dev/null +++ b/node_modules/proxy-addr/index.js @@ -0,0 +1,321 @@ +/*! + * proxy-addr + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = proxyaddr; +module.exports.all = alladdrs; +module.exports.compile = compile; + +/** + * Module dependencies. + */ + +var forwarded = require('forwarded'); +var ipaddr = require('ipaddr.js'); + +/** + * Variables. + */ + +var digitre = /^[0-9]+$/; +var isip = ipaddr.isValid; +var parseip = ipaddr.parse; + +/** + * Pre-defined IP ranges. + */ + +var ipranges = { + linklocal: ['169.254.0.0/16', 'fe80::/10'], + loopback: ['127.0.0.1/8', '::1/128'], + uniquelocal: ['10.0.0.0/8', '172.16.0.0/12', '192.168.0.0/16', 'fc00::/7'] +}; + +/** + * Get all addresses in the request, optionally stopping + * at the first untrusted. + * + * @param {Object} request + * @param {Function|Array|String} [trust] + * @api public + */ + +function alladdrs(req, trust) { + // get addresses + var addrs = forwarded(req); + + if (!trust) { + // Return all addresses + return addrs; + } + + if (typeof trust !== 'function') { + trust = compile(trust); + } + + for (var i = 0; i < addrs.length - 1; i++) { + if (trust(addrs[i], i)) continue; + + addrs.length = i + 1; + } + + return addrs; +} + +/** + * Compile argument into trust function. + * + * @param {Array|String} val + * @api private + */ + +function compile(val) { + if (!val) { + throw new TypeError('argument is required'); + } + + var trust = typeof val === 'string' + ? [val] + : val; + + if (!Array.isArray(trust)) { + throw new TypeError('unsupported trust argument'); + } + + for (var i = 0; i < trust.length; i++) { + val = trust[i]; + + if (!ipranges.hasOwnProperty(val)) { + continue; + } + + // Splice in pre-defined range + val = ipranges[val]; + trust.splice.apply(trust, [i, 1].concat(val)); + i += val.length - 1; + } + + return compileTrust(compileRangeSubnets(trust)); +} + +/** + * Compile `arr` elements into range subnets. + * + * @param {Array} arr + * @api private + */ + +function compileRangeSubnets(arr) { + var rangeSubnets = new Array(arr.length); + + for (var i = 0; i < arr.length; i++) { + rangeSubnets[i] = parseipNotation(arr[i]); + } + + return rangeSubnets; +} + +/** + * Compile range subnet array into trust function. + * + * @param {Array} rangeSubnets + * @api private + */ + +function compileTrust(rangeSubnets) { + // Return optimized function based on length + var len = rangeSubnets.length; + return len === 0 + ? trustNone + : len === 1 + ? trustSingle(rangeSubnets[0]) + : trustMulti(rangeSubnets); +} + +/** + * Parse IP notation string into range subnet. + * + * @param {String} note + * @api private + */ + +function parseipNotation(note) { + var pos = note.lastIndexOf('/'); + var str = pos !== -1 + ? note.substring(0, pos) + : note; + + if (!isip(str)) { + throw new TypeError('invalid IP address: ' + str); + } + + var ip = parseip(str); + + if (pos === -1 && ip.kind() === 'ipv6' && ip.isIPv4MappedAddress()) { + // Store as IPv4 + ip = ip.toIPv4Address(); + } + + var max = ip.kind() === 'ipv6' + ? 128 + : 32; + + var range = pos !== -1 + ? note.substring(pos + 1, note.length) + : null; + + if (range === null) { + range = max; + } else if (digitre.test(range)) { + range = parseInt(range, 10); + } else if (ip.kind() === 'ipv4' && isip(range)) { + range = parseNetmask(range); + } else { + range = null; + } + + if (range <= 0 || range > max) { + throw new TypeError('invalid range on address: ' + note); + } + + return [ip, range]; +} + +/** + * Parse netmask string into CIDR range. + * + * @param {String} netmask + * @api private + */ + +function parseNetmask(netmask) { + var ip = parseip(netmask); + var kind = ip.kind(); + + return kind === 'ipv4' + ? ip.prefixLengthFromSubnetMask() + : null; +} + +/** + * Determine address of proxied request. + * + * @param {Object} request + * @param {Function|Array|String} trust + * @api public + */ + +function proxyaddr(req, trust) { + if (!req) { + throw new TypeError('req argument is required'); + } + + if (!trust) { + throw new TypeError('trust argument is required'); + } + + var addrs = alladdrs(req, trust); + var addr = addrs[addrs.length - 1]; + + return addr; +} + +/** + * Static trust function to trust nothing. + * + * @api private + */ + +function trustNone() { + return false; +} + +/** + * Compile trust function for multiple subnets. + * + * @param {Array} subnets + * @api private + */ + +function trustMulti(subnets) { + return function trust(addr) { + if (!isip(addr)) return false; + + var ip = parseip(addr); + var ipconv; + var kind = ip.kind(); + + for (var i = 0; i < subnets.length; i++) { + var subnet = subnets[i]; + var subnetip = subnet[0]; + var subnetkind = subnetip.kind(); + var subnetrange = subnet[1]; + var trusted = ip; + + if (kind !== subnetkind) { + if (subnetkind === 'ipv4' && !ip.isIPv4MappedAddress()) { + // Incompatible IP addresses + continue; + } + + if (!ipconv) { + // Convert IP to match subnet IP kind + ipconv = subnetkind === 'ipv4' + ? ip.toIPv4Address() + : ip.toIPv4MappedAddress(); + } + + trusted = ipconv; + } + + if (trusted.match(subnetip, subnetrange)) { + return true; + } + } + + return false; + }; +} + +/** + * Compile trust function for single subnet. + * + * @param {Object} subnet + * @api private + */ + +function trustSingle(subnet) { + var subnetip = subnet[0]; + var subnetkind = subnetip.kind(); + var subnetisipv4 = subnetkind === 'ipv4'; + var subnetrange = subnet[1]; + + return function trust(addr) { + if (!isip(addr)) return false; + + var ip = parseip(addr); + var kind = ip.kind(); + + if (kind !== subnetkind) { + if (subnetisipv4 && !ip.isIPv4MappedAddress()) { + // Incompatible IP addresses + return false; + } + + // Convert IP to match subnet IP kind + ip = subnetisipv4 + ? ip.toIPv4Address() + : ip.toIPv4MappedAddress(); + } + + return ip.match(subnetip, subnetrange); + }; +} diff --git a/node_modules/proxy-addr/package.json b/node_modules/proxy-addr/package.json new file mode 100644 index 0000000..32c3f00 --- /dev/null +++ b/node_modules/proxy-addr/package.json @@ -0,0 +1,108 @@ +{ + "_args": [ + [ + { + "raw": "proxy-addr@~1.1.3", + "scope": null, + "escapedName": "proxy-addr", + "name": "proxy-addr", + "rawSpec": "~1.1.3", + "spec": ">=1.1.3 <1.2.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "proxy-addr@>=1.1.3 <1.2.0", + "_id": "proxy-addr@1.1.3", + "_inCache": true, + "_location": "/proxy-addr", + "_nodeVersion": "4.6.1", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/proxy-addr-1.1.3.tgz_1484460061440_0.03347301739268005" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "proxy-addr@~1.1.3", + "scope": null, + "escapedName": "proxy-addr", + "name": "proxy-addr", + "rawSpec": "~1.1.3", + "spec": ">=1.1.3 <1.2.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.1.3.tgz", + "_shasum": "dc97502f5722e888467b3fa2297a7b1ff47df074", + "_shrinkwrap": null, + "_spec": "proxy-addr@~1.1.3", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/proxy-addr/issues" + }, + "dependencies": { + "forwarded": "~0.1.0", + "ipaddr.js": "1.2.0" + }, + "description": "Determine address of proxied request", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.3", + "istanbul": "0.4.5", + "mocha": "~1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "dc97502f5722e888467b3fa2297a7b1ff47df074", + "tarball": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.1.3.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "gitHead": "0724490937983255e7687812594c97c36ebca90b", + "homepage": "https://github.com/jshttp/proxy-addr#readme", + "keywords": [ + "ip", + "proxy", + "x-forwarded-for" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "proxy-addr", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/proxy-addr.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.3" +} diff --git a/node_modules/qs/.eslintignore b/node_modules/qs/.eslintignore new file mode 100644 index 0000000..1521c8b --- /dev/null +++ b/node_modules/qs/.eslintignore @@ -0,0 +1 @@ +dist diff --git a/node_modules/qs/.eslintrc b/node_modules/qs/.eslintrc new file mode 100644 index 0000000..1faac27 --- /dev/null +++ b/node_modules/qs/.eslintrc @@ -0,0 +1,19 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "complexity": [2, 22], + "consistent-return": [1], + "id-length": [2, { "min": 1, "max": 25, "properties": "never" }], + "indent": [2, 4], + "max-params": [2, 9], + "max-statements": [2, 36], + "no-extra-parens": [1], + "no-continue": [1], + "no-magic-numbers": 0, + "no-restricted-syntax": [2, "BreakStatement", "DebuggerStatement", "ForInStatement", "LabeledStatement", "WithStatement"], + "operator-linebreak": 1 + } +} diff --git a/node_modules/qs/.jscs.json b/node_modules/qs/.jscs.json new file mode 100644 index 0000000..3d099c4 --- /dev/null +++ b/node_modules/qs/.jscs.json @@ -0,0 +1,176 @@ +{ + "es3": true, + + "additionalRules": [], + + "requireSemicolons": true, + + "disallowMultipleSpaces": true, + + "disallowIdentifierNames": [], + + "requireCurlyBraces": { + "allExcept": [], + "keywords": ["if", "else", "for", "while", "do", "try", "catch"] + }, + + "requireSpaceAfterKeywords": ["if", "else", "for", "while", "do", "switch", "return", "try", "catch", "function"], + + "disallowSpaceAfterKeywords": [], + + "disallowSpaceBeforeComma": true, + "disallowSpaceAfterComma": false, + "disallowSpaceBeforeSemicolon": true, + + "disallowNodeTypes": [ + "DebuggerStatement", + "ForInStatement", + "LabeledStatement", + "SwitchCase", + "SwitchStatement", + "WithStatement" + ], + + "requireObjectKeysOnNewLine": { "allExcept": ["sameLine"] }, + + "requireSpacesInAnonymousFunctionExpression": { "beforeOpeningRoundBrace": true, "beforeOpeningCurlyBrace": true }, + "requireSpacesInNamedFunctionExpression": { "beforeOpeningCurlyBrace": true }, + "disallowSpacesInNamedFunctionExpression": { "beforeOpeningRoundBrace": true }, + "requireSpacesInFunctionDeclaration": { "beforeOpeningCurlyBrace": true }, + "disallowSpacesInFunctionDeclaration": { "beforeOpeningRoundBrace": true }, + + "requireSpaceBetweenArguments": true, + + "disallowSpacesInsideParentheses": true, + + "disallowSpacesInsideArrayBrackets": true, + + "disallowQuotedKeysInObjects": { "allExcept": ["reserved"] }, + + "disallowSpaceAfterObjectKeys": true, + + "requireCommaBeforeLineBreak": true, + + "disallowSpaceAfterPrefixUnaryOperators": ["++", "--", "+", "-", "~", "!"], + "requireSpaceAfterPrefixUnaryOperators": [], + + "disallowSpaceBeforePostfixUnaryOperators": ["++", "--"], + "requireSpaceBeforePostfixUnaryOperators": [], + + "disallowSpaceBeforeBinaryOperators": [], + "requireSpaceBeforeBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="], + + "requireSpaceAfterBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="], + "disallowSpaceAfterBinaryOperators": [], + + "disallowImplicitTypeConversion": ["binary", "string"], + + "disallowKeywords": ["with", "eval"], + + "requireKeywordsOnNewLine": [], + "disallowKeywordsOnNewLine": ["else"], + + "requireLineFeedAtFileEnd": true, + + "disallowTrailingWhitespace": true, + + "disallowTrailingComma": true, + + "excludeFiles": ["node_modules/**", "vendor/**"], + + "disallowMultipleLineStrings": true, + + "requireDotNotation": { "allExcept": ["keywords"] }, + + "requireParenthesesAroundIIFE": true, + + "validateLineBreaks": "LF", + + "validateQuoteMarks": { + "escape": true, + "mark": "'" + }, + + "disallowOperatorBeforeLineBreak": [], + + "requireSpaceBeforeKeywords": [ + "do", + "for", + "if", + "else", + "switch", + "case", + "try", + "catch", + "finally", + "while", + "with", + "return" + ], + + "validateAlignedFunctionParameters": { + "lineBreakAfterOpeningBraces": true, + "lineBreakBeforeClosingBraces": true + }, + + "requirePaddingNewLinesBeforeExport": true, + + "validateNewlineAfterArrayElements": { + "maximum": 1 + }, + + "requirePaddingNewLinesAfterUseStrict": true, + + "disallowArrowFunctions": true, + + "disallowMultiLineTernary": true, + + "validateOrderInObjectKeys": "asc-insensitive", + + "disallowIdenticalDestructuringNames": true, + + "disallowNestedTernaries": { "maxLevel": 1 }, + + "requireSpaceAfterComma": { "allExcept": ["trailing"] }, + "requireAlignedMultilineParams": false, + + "requireSpacesInGenerator": { + "afterStar": true + }, + + "disallowSpacesInGenerator": { + "beforeStar": true + }, + + "disallowVar": false, + + "requireArrayDestructuring": false, + + "requireEnhancedObjectLiterals": false, + + "requireObjectDestructuring": false, + + "requireEarlyReturn": false, + + "requireCapitalizedConstructorsNew": { + "allExcept": ["Function", "String", "Object", "Symbol", "Number", "Date", "RegExp", "Error", "Boolean", "Array"] + }, + + "requireImportAlphabetized": false, + + "requireSpaceBeforeObjectValues": true, + "requireSpaceBeforeDestructuredValues": true, + + "disallowSpacesInsideTemplateStringPlaceholders": true, + + "disallowArrayDestructuringReturn": false, + + "requireNewlineBeforeSingleStatementsInIf": false, + + "disallowUnusedVariables": true, + + "requireSpacesInsideImportedObjectBraces": true, + + "requireUseStrict": true +} + diff --git a/node_modules/qs/CHANGELOG.md b/node_modules/qs/CHANGELOG.md new file mode 100644 index 0000000..e318a05 --- /dev/null +++ b/node_modules/qs/CHANGELOG.md @@ -0,0 +1,120 @@ +## [**6.2.0**](https://github.com/ljharb/qs/issues?milestone=36&state=closed) +- [New] pass Buffers to the encoder/decoder directly (#161) +- [New] add "encoder" and "decoder" options, for custom param encoding/decoding (#160) +- [Fix] fix compacting of nested sparse arrays (#150) + +## [**6.1.0**](https://github.com/ljharb/qs/issues?milestone=35&state=closed) +- [New] allowDots option for `stringify` (#151) +- [Fix] "sort" option should work at a depth of 3 or more (#151) +- [Fix] Restore `dist` directory; will be removed in v7 (#148) + +## [**6.0.2**](https://github.com/ljharb/qs/issues?milestone=33&state=closed) +- Revert ES6 requirement and restore support for node down to v0.8. + +## [**6.0.1**](https://github.com/ljharb/qs/issues?milestone=32&state=closed) +- [**#127**](https://github.com/ljharb/qs/pull/127) Fix engines definition in package.json + +## [**6.0.0**](https://github.com/ljharb/qs/issues?milestone=31&state=closed) +- [**#124**](https://github.com/ljharb/qs/issues/124) Use ES6 and drop support for node < v4 + +## [**5.2.0**](https://github.com/ljharb/qs/issues?milestone=30&state=closed) +- [**#64**](https://github.com/ljharb/qs/issues/64) Add option to sort object keys in the query string + +## [**5.1.0**](https://github.com/ljharb/qs/issues?milestone=29&state=closed) +- [**#117**](https://github.com/ljharb/qs/issues/117) make URI encoding stringified results optional +- [**#106**](https://github.com/ljharb/qs/issues/106) Add flag `skipNulls` to optionally skip null values in stringify + +## [**5.0.0**](https://github.com/ljharb/qs/issues?milestone=28&state=closed) +- [**#114**](https://github.com/ljharb/qs/issues/114) default allowDots to false +- [**#100**](https://github.com/ljharb/qs/issues/100) include dist to npm + +## [**4.0.0**](https://github.com/ljharb/qs/issues?milestone=26&state=closed) +- [**#98**](https://github.com/ljharb/qs/issues/98) make returning plain objects and allowing prototype overwriting properties optional + +## [**3.1.0**](https://github.com/ljharb/qs/issues?milestone=24&state=closed) +- [**#89**](https://github.com/ljharb/qs/issues/89) Add option to disable "Transform dot notation to bracket notation" + +## [**3.0.0**](https://github.com/ljharb/qs/issues?milestone=23&state=closed) +- [**#80**](https://github.com/ljharb/qs/issues/80) qs.parse silently drops properties +- [**#77**](https://github.com/ljharb/qs/issues/77) Perf boost +- [**#60**](https://github.com/ljharb/qs/issues/60) Add explicit option to disable array parsing +- [**#74**](https://github.com/ljharb/qs/issues/74) Bad parse when turning array into object +- [**#81**](https://github.com/ljharb/qs/issues/81) Add a `filter` option +- [**#68**](https://github.com/ljharb/qs/issues/68) Fixed issue with recursion and passing strings into objects. +- [**#66**](https://github.com/ljharb/qs/issues/66) Add mixed array and object dot notation support Closes: #47 +- [**#76**](https://github.com/ljharb/qs/issues/76) RFC 3986 +- [**#85**](https://github.com/ljharb/qs/issues/85) No equal sign +- [**#84**](https://github.com/ljharb/qs/issues/84) update license attribute + +## [**2.4.1**](https://github.com/ljharb/qs/issues?milestone=20&state=closed) +- [**#73**](https://github.com/ljharb/qs/issues/73) Property 'hasOwnProperty' of object # is not a function + +## [**2.4.0**](https://github.com/ljharb/qs/issues?milestone=19&state=closed) +- [**#70**](https://github.com/ljharb/qs/issues/70) Add arrayFormat option + +## [**2.3.3**](https://github.com/ljharb/qs/issues?milestone=18&state=closed) +- [**#59**](https://github.com/ljharb/qs/issues/59) make sure array indexes are >= 0, closes #57 +- [**#58**](https://github.com/ljharb/qs/issues/58) make qs usable for browser loader + +## [**2.3.2**](https://github.com/ljharb/qs/issues?milestone=17&state=closed) +- [**#55**](https://github.com/ljharb/qs/issues/55) allow merging a string into an object + +## [**2.3.1**](https://github.com/ljharb/qs/issues?milestone=16&state=closed) +- [**#52**](https://github.com/ljharb/qs/issues/52) Return "undefined" and "false" instead of throwing "TypeError". + +## [**2.3.0**](https://github.com/ljharb/qs/issues?milestone=15&state=closed) +- [**#50**](https://github.com/ljharb/qs/issues/50) add option to omit array indices, closes #46 + +## [**2.2.5**](https://github.com/ljharb/qs/issues?milestone=14&state=closed) +- [**#39**](https://github.com/ljharb/qs/issues/39) Is there an alternative to Buffer.isBuffer? +- [**#49**](https://github.com/ljharb/qs/issues/49) refactor utils.merge, fixes #45 +- [**#41**](https://github.com/ljharb/qs/issues/41) avoid browserifying Buffer, for #39 + +## [**2.2.4**](https://github.com/ljharb/qs/issues?milestone=13&state=closed) +- [**#38**](https://github.com/ljharb/qs/issues/38) how to handle object keys beginning with a number + +## [**2.2.3**](https://github.com/ljharb/qs/issues?milestone=12&state=closed) +- [**#37**](https://github.com/ljharb/qs/issues/37) parser discards first empty value in array +- [**#36**](https://github.com/ljharb/qs/issues/36) Update to lab 4.x + +## [**2.2.2**](https://github.com/ljharb/qs/issues?milestone=11&state=closed) +- [**#33**](https://github.com/ljharb/qs/issues/33) Error when plain object in a value +- [**#34**](https://github.com/ljharb/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty +- [**#24**](https://github.com/ljharb/qs/issues/24) Changelog? Semver? + +## [**2.2.1**](https://github.com/ljharb/qs/issues?milestone=10&state=closed) +- [**#32**](https://github.com/ljharb/qs/issues/32) account for circular references properly, closes #31 +- [**#31**](https://github.com/ljharb/qs/issues/31) qs.parse stackoverflow on circular objects + +## [**2.2.0**](https://github.com/ljharb/qs/issues?milestone=9&state=closed) +- [**#26**](https://github.com/ljharb/qs/issues/26) Don't use Buffer global if it's not present +- [**#30**](https://github.com/ljharb/qs/issues/30) Bug when merging non-object values into arrays +- [**#29**](https://github.com/ljharb/qs/issues/29) Don't call Utils.clone at the top of Utils.merge +- [**#23**](https://github.com/ljharb/qs/issues/23) Ability to not limit parameters? + +## [**2.1.0**](https://github.com/ljharb/qs/issues?milestone=8&state=closed) +- [**#22**](https://github.com/ljharb/qs/issues/22) Enable using a RegExp as delimiter + +## [**2.0.0**](https://github.com/ljharb/qs/issues?milestone=7&state=closed) +- [**#18**](https://github.com/ljharb/qs/issues/18) Why is there arrayLimit? +- [**#20**](https://github.com/ljharb/qs/issues/20) Configurable parametersLimit +- [**#21**](https://github.com/ljharb/qs/issues/21) make all limits optional, for #18, for #20 + +## [**1.2.2**](https://github.com/ljharb/qs/issues?milestone=6&state=closed) +- [**#19**](https://github.com/ljharb/qs/issues/19) Don't overwrite null values + +## [**1.2.1**](https://github.com/ljharb/qs/issues?milestone=5&state=closed) +- [**#16**](https://github.com/ljharb/qs/issues/16) ignore non-string delimiters +- [**#15**](https://github.com/ljharb/qs/issues/15) Close code block + +## [**1.2.0**](https://github.com/ljharb/qs/issues?milestone=4&state=closed) +- [**#12**](https://github.com/ljharb/qs/issues/12) Add optional delim argument +- [**#13**](https://github.com/ljharb/qs/issues/13) fix #11: flattened keys in array are now correctly parsed + +## [**1.1.0**](https://github.com/ljharb/qs/issues?milestone=3&state=closed) +- [**#7**](https://github.com/ljharb/qs/issues/7) Empty values of a POST array disappear after being submitted +- [**#9**](https://github.com/ljharb/qs/issues/9) Should not omit equals signs (=) when value is null +- [**#6**](https://github.com/ljharb/qs/issues/6) Minor grammar fix in README + +## [**1.0.2**](https://github.com/ljharb/qs/issues?milestone=2&state=closed) +- [**#5**](https://github.com/ljharb/qs/issues/5) array holes incorrectly copied into object on large index diff --git a/node_modules/qs/CONTRIBUTING.md b/node_modules/qs/CONTRIBUTING.md new file mode 100644 index 0000000..8928361 --- /dev/null +++ b/node_modules/qs/CONTRIBUTING.md @@ -0,0 +1 @@ +Please view our [hapijs contributing guide](https://github.com/hapijs/hapi/blob/master/CONTRIBUTING.md). diff --git a/node_modules/qs/LICENSE b/node_modules/qs/LICENSE new file mode 100644 index 0000000..d456948 --- /dev/null +++ b/node_modules/qs/LICENSE @@ -0,0 +1,28 @@ +Copyright (c) 2014 Nathan LaFreniere and other contributors. +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + * The names of any contributors may not be used to endorse or promote + products derived from this software without specific prior written + permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDERS AND CONTRIBUTORS BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + * * * + +The complete list of contributors can be found at: https://github.com/hapijs/qs/graphs/contributors diff --git a/node_modules/qs/dist/qs.js b/node_modules/qs/dist/qs.js new file mode 100644 index 0000000..4cc6f30 --- /dev/null +++ b/node_modules/qs/dist/qs.js @@ -0,0 +1,487 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Qs = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o= 0 && + (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = parseObject(chain, val, options); + } else { + obj[cleanRoot] = parseObject(chain, val, options); + } + } + + return obj; +}; + +var parseKeys = function parseKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^\.\[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var parent = /^([^\[\]]*)/; + var child = /(\[[^\[\]]*\])/g; + + // Get the parent + + var segment = parent.exec(key); + + // Stash the parent if it exists + + var keys = []; + if (segment[1]) { + // If we aren't using plain objects, optionally prefix keys + // that would overwrite object prototype properties + if (!options.plainObjects && Object.prototype.hasOwnProperty(segment[1])) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(segment[1]); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && Object.prototype.hasOwnProperty(segment[1].replace(/\[|\]/g, ''))) { + if (!options.allowPrototypes) { + continue; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +module.exports = function (str, opts) { + var options = opts || {}; + + if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + options.delimiter = typeof options.delimiter === 'string' || Utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; + options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; + options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; + options.parseArrays = options.parseArrays !== false; + options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; + options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; + options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; + options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; + options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; + options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = Utils.merge(obj, newObj, options); + } + + return Utils.compact(obj); +}; + +},{"./utils":4}],3:[function(require,module,exports){ +'use strict'; + +var Utils = require('./utils'); + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { + return prefix + '[]'; + }, + indices: function indices(prefix, key) { + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { + return prefix; + } +}; + +var defaults = { + delimiter: '&', + strictNullHandling: false, + skipNulls: false, + encode: true, + encoder: Utils.encode +}; + +var stringify = function stringify(object, prefix, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = obj.toISOString(); + } else if (obj === null) { + if (strictNullHandling) { + return encoder ? encoder(prefix) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || Utils.isBuffer(obj)) { + if (encoder) { + return [encoder(prefix) + '=' + encoder(obj)]; + } + return [prefix + '=' + String(obj)]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (Array.isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (Array.isArray(obj)) { + values = values.concat(stringify(obj[key], generateArrayPrefix(prefix, key), generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots)); + } else { + values = values.concat(stringify(obj[key], prefix + (allowDots ? '.' + key : '[' + key + ']'), generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots)); + } + } + + return values; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = opts || {}; + var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; + var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; + var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; + var encoder = encode ? (typeof options.encoder === 'function' ? options.encoder : defaults.encoder) : null; + var sort = typeof options.sort === 'function' ? options.sort : null; + var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; + var objKeys; + var filter; + + if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (Array.isArray(options.filter)) { + objKeys = filter = options.filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (options.arrayFormat in arrayPrefixGenerators) { + arrayFormat = options.arrayFormat; + } else if ('indices' in options) { + arrayFormat = options.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (sort) { + objKeys.sort(sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + keys = keys.concat(stringify(obj[key], key, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots)); + } + + return keys.join(delimiter); +}; + +},{"./utils":4}],4:[function(require,module,exports){ +'use strict'; + +var hexTable = (function () { + var array = new Array(256); + for (var i = 0; i < 256; ++i) { + array[i] = '%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase(); + } + + return array; +}()); + +exports.arrayToObject = function (source, options) { + var obj = options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +exports.merge = function (target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (Array.isArray(target)) { + target.push(source); + } else if (typeof target === 'object') { + target[source] = true; + } else { + return [target, source]; + } + + return target; + } + + if (typeof target !== 'object') { + return [target].concat(source); + } + + var mergeTarget = target; + if (Array.isArray(target) && !Array.isArray(source)) { + mergeTarget = exports.arrayToObject(target, options); + } + + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; + + if (Object.prototype.hasOwnProperty.call(acc, key)) { + acc[key] = exports.merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; + +exports.decode = function (str) { + try { + return decodeURIComponent(str.replace(/\+/g, ' ')); + } catch (e) { + return str; + } +}; + +exports.encode = function (str) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } + + var string = typeof str === 'string' ? str : String(str); + + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); + + if ( + c === 0x2D || // - + c === 0x2E || // . + c === 0x5F || // _ + c === 0x7E || // ~ + (c >= 0x30 && c <= 0x39) || // 0-9 + (c >= 0x41 && c <= 0x5A) || // a-z + (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } + + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } + + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + hexTable[0x80 | ((c >> 12) & 0x3F)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]; + } + + return out; +}; + +exports.compact = function (obj, references) { + if (typeof obj !== 'object' || obj === null) { + return obj; + } + + var refs = references || []; + var lookup = refs.indexOf(obj); + if (lookup !== -1) { + return refs[lookup]; + } + + refs.push(obj); + + if (Array.isArray(obj)) { + var compacted = []; + + for (var i = 0; i < obj.length; ++i) { + if (obj[i] && typeof obj[i] === 'object') { + compacted.push(exports.compact(obj[i], refs)); + } else if (typeof obj[i] !== 'undefined') { + compacted.push(obj[i]); + } + } + + return compacted; + } + + var keys = Object.keys(obj); + for (var j = 0; j < keys.length; ++j) { + var key = keys[j]; + obj[key] = exports.compact(obj[key], refs); + } + + return obj; +}; + +exports.isRegExp = function (obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; + +exports.isBuffer = function (obj) { + if (obj === null || typeof obj === 'undefined') { + return false; + } + + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; + +},{}]},{},[1])(1) +}); \ No newline at end of file diff --git a/node_modules/qs/lib/index.js b/node_modules/qs/lib/index.js new file mode 100755 index 0000000..1901959 --- /dev/null +++ b/node_modules/qs/lib/index.js @@ -0,0 +1,9 @@ +'use strict'; + +var Stringify = require('./stringify'); +var Parse = require('./parse'); + +module.exports = { + stringify: Stringify, + parse: Parse +}; diff --git a/node_modules/qs/lib/parse.js b/node_modules/qs/lib/parse.js new file mode 100755 index 0000000..bf70fd8 --- /dev/null +++ b/node_modules/qs/lib/parse.js @@ -0,0 +1,167 @@ +'use strict'; + +var Utils = require('./utils'); + +var defaults = { + delimiter: '&', + depth: 5, + arrayLimit: 20, + parameterLimit: 1000, + strictNullHandling: false, + plainObjects: false, + allowPrototypes: false, + allowDots: false, + decoder: Utils.decode +}; + +var parseValues = function parseValues(str, options) { + var obj = {}; + var parts = str.split(options.delimiter, options.parameterLimit === Infinity ? undefined : options.parameterLimit); + + for (var i = 0; i < parts.length; ++i) { + var part = parts[i]; + var pos = part.indexOf(']=') === -1 ? part.indexOf('=') : part.indexOf(']=') + 1; + + if (pos === -1) { + obj[options.decoder(part)] = ''; + + if (options.strictNullHandling) { + obj[options.decoder(part)] = null; + } + } else { + var key = options.decoder(part.slice(0, pos)); + var val = options.decoder(part.slice(pos + 1)); + + if (Object.prototype.hasOwnProperty.call(obj, key)) { + obj[key] = [].concat(obj[key]).concat(val); + } else { + obj[key] = val; + } + } + } + + return obj; +}; + +var parseObject = function parseObject(chain, val, options) { + if (!chain.length) { + return val; + } + + var root = chain.shift(); + + var obj; + if (root === '[]') { + obj = []; + obj = obj.concat(parseObject(chain, val, options)); + } else { + obj = options.plainObjects ? Object.create(null) : {}; + var cleanRoot = root[0] === '[' && root[root.length - 1] === ']' ? root.slice(1, root.length - 1) : root; + var index = parseInt(cleanRoot, 10); + if ( + !isNaN(index) && + root !== cleanRoot && + String(index) === cleanRoot && + index >= 0 && + (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = parseObject(chain, val, options); + } else { + obj[cleanRoot] = parseObject(chain, val, options); + } + } + + return obj; +}; + +var parseKeys = function parseKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^\.\[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var parent = /^([^\[\]]*)/; + var child = /(\[[^\[\]]*\])/g; + + // Get the parent + + var segment = parent.exec(key); + + // Stash the parent if it exists + + var keys = []; + if (segment[1]) { + // If we aren't using plain objects, optionally prefix keys + // that would overwrite object prototype properties + if (!options.plainObjects && Object.prototype.hasOwnProperty(segment[1])) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(segment[1]); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && Object.prototype.hasOwnProperty(segment[1].replace(/\[|\]/g, ''))) { + if (!options.allowPrototypes) { + continue; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +module.exports = function (str, opts) { + var options = opts || {}; + + if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + options.delimiter = typeof options.delimiter === 'string' || Utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; + options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; + options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; + options.parseArrays = options.parseArrays !== false; + options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; + options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; + options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; + options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; + options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; + options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = Utils.merge(obj, newObj, options); + } + + return Utils.compact(obj); +}; diff --git a/node_modules/qs/lib/stringify.js b/node_modules/qs/lib/stringify.js new file mode 100755 index 0000000..6e1c9a2 --- /dev/null +++ b/node_modules/qs/lib/stringify.js @@ -0,0 +1,137 @@ +'use strict'; + +var Utils = require('./utils'); + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { + return prefix + '[]'; + }, + indices: function indices(prefix, key) { + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { + return prefix; + } +}; + +var defaults = { + delimiter: '&', + strictNullHandling: false, + skipNulls: false, + encode: true, + encoder: Utils.encode +}; + +var stringify = function stringify(object, prefix, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = obj.toISOString(); + } else if (obj === null) { + if (strictNullHandling) { + return encoder ? encoder(prefix) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || Utils.isBuffer(obj)) { + if (encoder) { + return [encoder(prefix) + '=' + encoder(obj)]; + } + return [prefix + '=' + String(obj)]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (Array.isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (Array.isArray(obj)) { + values = values.concat(stringify(obj[key], generateArrayPrefix(prefix, key), generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots)); + } else { + values = values.concat(stringify(obj[key], prefix + (allowDots ? '.' + key : '[' + key + ']'), generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots)); + } + } + + return values; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = opts || {}; + var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; + var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; + var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; + var encoder = encode ? (typeof options.encoder === 'function' ? options.encoder : defaults.encoder) : null; + var sort = typeof options.sort === 'function' ? options.sort : null; + var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; + var objKeys; + var filter; + + if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (Array.isArray(options.filter)) { + objKeys = filter = options.filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (options.arrayFormat in arrayPrefixGenerators) { + arrayFormat = options.arrayFormat; + } else if ('indices' in options) { + arrayFormat = options.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (sort) { + objKeys.sort(sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + keys = keys.concat(stringify(obj[key], key, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots)); + } + + return keys.join(delimiter); +}; diff --git a/node_modules/qs/lib/utils.js b/node_modules/qs/lib/utils.js new file mode 100755 index 0000000..2c5c8ee --- /dev/null +++ b/node_modules/qs/lib/utils.js @@ -0,0 +1,164 @@ +'use strict'; + +var hexTable = (function () { + var array = new Array(256); + for (var i = 0; i < 256; ++i) { + array[i] = '%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase(); + } + + return array; +}()); + +exports.arrayToObject = function (source, options) { + var obj = options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +exports.merge = function (target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (Array.isArray(target)) { + target.push(source); + } else if (typeof target === 'object') { + target[source] = true; + } else { + return [target, source]; + } + + return target; + } + + if (typeof target !== 'object') { + return [target].concat(source); + } + + var mergeTarget = target; + if (Array.isArray(target) && !Array.isArray(source)) { + mergeTarget = exports.arrayToObject(target, options); + } + + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; + + if (Object.prototype.hasOwnProperty.call(acc, key)) { + acc[key] = exports.merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; + +exports.decode = function (str) { + try { + return decodeURIComponent(str.replace(/\+/g, ' ')); + } catch (e) { + return str; + } +}; + +exports.encode = function (str) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } + + var string = typeof str === 'string' ? str : String(str); + + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); + + if ( + c === 0x2D || // - + c === 0x2E || // . + c === 0x5F || // _ + c === 0x7E || // ~ + (c >= 0x30 && c <= 0x39) || // 0-9 + (c >= 0x41 && c <= 0x5A) || // a-z + (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } + + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } + + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + hexTable[0x80 | ((c >> 12) & 0x3F)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]; + } + + return out; +}; + +exports.compact = function (obj, references) { + if (typeof obj !== 'object' || obj === null) { + return obj; + } + + var refs = references || []; + var lookup = refs.indexOf(obj); + if (lookup !== -1) { + return refs[lookup]; + } + + refs.push(obj); + + if (Array.isArray(obj)) { + var compacted = []; + + for (var i = 0; i < obj.length; ++i) { + if (obj[i] && typeof obj[i] === 'object') { + compacted.push(exports.compact(obj[i], refs)); + } else if (typeof obj[i] !== 'undefined') { + compacted.push(obj[i]); + } + } + + return compacted; + } + + var keys = Object.keys(obj); + for (var j = 0; j < keys.length; ++j) { + var key = keys[j]; + obj[key] = exports.compact(obj[key], refs); + } + + return obj; +}; + +exports.isRegExp = function (obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; + +exports.isBuffer = function (obj) { + if (obj === null || typeof obj === 'undefined') { + return false; + } + + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; diff --git a/node_modules/qs/package.json b/node_modules/qs/package.json new file mode 100644 index 0000000..c47f175 --- /dev/null +++ b/node_modules/qs/package.json @@ -0,0 +1,119 @@ +{ + "_args": [ + [ + { + "raw": "qs@6.2.0", + "scope": null, + "escapedName": "qs", + "name": "qs", + "rawSpec": "6.2.0", + "spec": "6.2.0", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "qs@6.2.0", + "_id": "qs@6.2.0", + "_inCache": true, + "_location": "/qs", + "_nodeVersion": "6.1.0", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/qs-6.2.0.tgz_1462749349998_0.03372702235355973" + }, + "_npmUser": { + "name": "ljharb", + "email": "ljharb@gmail.com" + }, + "_npmVersion": "3.8.6", + "_phantomChildren": {}, + "_requested": { + "raw": "qs@6.2.0", + "scope": null, + "escapedName": "qs", + "name": "qs", + "rawSpec": "6.2.0", + "spec": "6.2.0", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/qs/-/qs-6.2.0.tgz", + "_shasum": "3b7848c03c2dece69a9522b0fae8c4126d745f3b", + "_shrinkwrap": null, + "_spec": "qs@6.2.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/ljharb/qs/issues" + }, + "contributors": [ + { + "name": "Jordan Harband", + "email": "ljharb@gmail.com", + "url": "http://ljharb.codes" + } + ], + "dependencies": {}, + "description": "A querystring parser that supports nesting and arrays, with a depth limit", + "devDependencies": { + "@ljharb/eslint-config": "^4.0.0", + "browserify": "^13.0.1", + "covert": "^1.1.0", + "eslint": "^2.9.0", + "evalmd": "^0.0.17", + "iconv-lite": "^0.4.13", + "mkdirp": "^0.5.1", + "parallelshell": "^2.0.0", + "tape": "^4.5.1" + }, + "directories": {}, + "dist": { + "shasum": "3b7848c03c2dece69a9522b0fae8c4126d745f3b", + "tarball": "https://registry.npmjs.org/qs/-/qs-6.2.0.tgz" + }, + "engines": { + "node": ">=0.6" + }, + "gitHead": "d67d315b606c6bb809fedcbeebbbdb7f863852aa", + "homepage": "https://github.com/ljharb/qs", + "keywords": [ + "querystring", + "qs" + ], + "license": "BSD-3-Clause", + "main": "lib/index.js", + "maintainers": [ + { + "name": "hueniverse", + "email": "eran@hammer.io" + }, + { + "name": "ljharb", + "email": "ljharb@gmail.com" + }, + { + "name": "nlf", + "email": "quitlahok@gmail.com" + } + ], + "name": "qs", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/qs.git" + }, + "scripts": { + "coverage": "covert test", + "dist": "mkdirp dist && browserify --standalone Qs lib/index.js > dist/qs.js", + "lint": "eslint lib/*.js text/*.js", + "prepublish": "npm run dist", + "pretest": "parallelshell 'npm run --silent readme' 'npm run --silent lint'", + "readme": "evalmd README.md", + "test": "npm run --silent coverage", + "tests-only": "node test" + }, + "version": "6.2.0" +} diff --git a/node_modules/qs/test/index.js b/node_modules/qs/test/index.js new file mode 100644 index 0000000..b6a7d95 --- /dev/null +++ b/node_modules/qs/test/index.js @@ -0,0 +1,5 @@ +require('./parse'); + +require('./stringify'); + +require('./utils'); diff --git a/node_modules/qs/test/parse.js b/node_modules/qs/test/parse.js new file mode 100755 index 0000000..1b79daf --- /dev/null +++ b/node_modules/qs/test/parse.js @@ -0,0 +1,423 @@ +'use strict'; + +var test = require('tape'); +var qs = require('../'); +var iconv = require('iconv-lite'); + +test('parse()', function (t) { + t.test('parses a simple string', function (st) { + st.deepEqual(qs.parse('0=foo'), { '0': 'foo' }); + st.deepEqual(qs.parse('foo=c++'), { foo: 'c ' }); + st.deepEqual(qs.parse('a[>=]=23'), { a: { '>=': '23' } }); + st.deepEqual(qs.parse('a[<=>]==23'), { a: { '<=>': '=23' } }); + st.deepEqual(qs.parse('a[==]=23'), { a: { '==': '23' } }); + st.deepEqual(qs.parse('foo', { strictNullHandling: true }), { foo: null }); + st.deepEqual(qs.parse('foo'), { foo: '' }); + st.deepEqual(qs.parse('foo='), { foo: '' }); + st.deepEqual(qs.parse('foo=bar'), { foo: 'bar' }); + st.deepEqual(qs.parse(' foo = bar = baz '), { ' foo ': ' bar = baz ' }); + st.deepEqual(qs.parse('foo=bar=baz'), { foo: 'bar=baz' }); + st.deepEqual(qs.parse('foo=bar&bar=baz'), { foo: 'bar', bar: 'baz' }); + st.deepEqual(qs.parse('foo2=bar2&baz2='), { foo2: 'bar2', baz2: '' }); + st.deepEqual(qs.parse('foo=bar&baz', { strictNullHandling: true }), { foo: 'bar', baz: null }); + st.deepEqual(qs.parse('foo=bar&baz'), { foo: 'bar', baz: '' }); + st.deepEqual(qs.parse('cht=p3&chd=t:60,40&chs=250x100&chl=Hello|World'), { + cht: 'p3', + chd: 't:60,40', + chs: '250x100', + chl: 'Hello|World' + }); + st.end(); + }); + + t.test('allows enabling dot notation', function (st) { + st.deepEqual(qs.parse('a.b=c'), { 'a.b': 'c' }); + st.deepEqual(qs.parse('a.b=c', { allowDots: true }), { a: { b: 'c' } }); + st.end(); + }); + + t.deepEqual(qs.parse('a[b]=c'), { a: { b: 'c' } }, 'parses a single nested string'); + t.deepEqual(qs.parse('a[b][c]=d'), { a: { b: { c: 'd' } } }, 'parses a double nested string'); + t.deepEqual( + qs.parse('a[b][c][d][e][f][g][h]=i'), + { a: { b: { c: { d: { e: { f: { '[g][h]': 'i' } } } } } } }, + 'defaults to a depth of 5' + ); + + t.test('only parses one level when depth = 1', function (st) { + st.deepEqual(qs.parse('a[b][c]=d', { depth: 1 }), { a: { b: { '[c]': 'd' } } }); + st.deepEqual(qs.parse('a[b][c][d]=e', { depth: 1 }), { a: { b: { '[c][d]': 'e' } } }); + st.end(); + }); + + t.deepEqual(qs.parse('a=b&a=c'), { a: ['b', 'c'] }, 'parses a simple array'); + + t.test('parses an explicit array', function (st) { + st.deepEqual(qs.parse('a[]=b'), { a: ['b'] }); + st.deepEqual(qs.parse('a[]=b&a[]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a[]=c&a[]=d'), { a: ['b', 'c', 'd'] }); + st.end(); + }); + + t.test('parses a mix of simple and explicit arrays', function (st) { + st.deepEqual(qs.parse('a=b&a[]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[0]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[0]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[1]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[1]=c'), { a: ['b', 'c'] }); + st.end(); + }); + + t.test('parses a nested array', function (st) { + st.deepEqual(qs.parse('a[b][]=c&a[b][]=d'), { a: { b: ['c', 'd'] } }); + st.deepEqual(qs.parse('a[>=]=25'), { a: { '>=': '25' } }); + st.end(); + }); + + t.test('allows to specify array indices', function (st) { + st.deepEqual(qs.parse('a[1]=c&a[0]=b&a[2]=d'), { a: ['b', 'c', 'd'] }); + st.deepEqual(qs.parse('a[1]=c&a[0]=b'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[1]=c'), { a: ['c'] }); + st.end(); + }); + + t.test('limits specific array indices to 20', function (st) { + st.deepEqual(qs.parse('a[20]=a'), { a: ['a'] }); + st.deepEqual(qs.parse('a[21]=a'), { a: { '21': 'a' } }); + st.end(); + }); + + t.deepEqual(qs.parse('a[12b]=c'), { a: { '12b': 'c' } }, 'supports keys that begin with a number'); + + t.test('supports encoded = signs', function (st) { + st.deepEqual(qs.parse('he%3Dllo=th%3Dere'), { 'he=llo': 'th=ere' }); + st.end(); + }); + + t.test('is ok with url encoded strings', function (st) { + st.deepEqual(qs.parse('a[b%20c]=d'), { a: { 'b c': 'd' } }); + st.deepEqual(qs.parse('a[b]=c%20d'), { a: { b: 'c d' } }); + st.end(); + }); + + t.test('allows brackets in the value', function (st) { + st.deepEqual(qs.parse('pets=["tobi"]'), { pets: '["tobi"]' }); + st.deepEqual(qs.parse('operators=[">=", "<="]'), { operators: '[">=", "<="]' }); + st.end(); + }); + + t.test('allows empty values', function (st) { + st.deepEqual(qs.parse(''), {}); + st.deepEqual(qs.parse(null), {}); + st.deepEqual(qs.parse(undefined), {}); + st.end(); + }); + + t.test('transforms arrays to objects', function (st) { + st.deepEqual(qs.parse('foo[0]=bar&foo[bad]=baz'), { foo: { '0': 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[0]=bar'), { foo: { bad: 'baz', '0': 'bar' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[]=bar'), { foo: { bad: 'baz', '0': 'bar' } }); + st.deepEqual(qs.parse('foo[]=bar&foo[bad]=baz'), { foo: { '0': 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[]=bar&foo[]=foo'), { foo: { bad: 'baz', '0': 'bar', '1': 'foo' } }); + st.deepEqual(qs.parse('foo[0][a]=a&foo[0][b]=b&foo[1][a]=aa&foo[1][b]=bb'), { foo: [{ a: 'a', b: 'b' }, { a: 'aa', b: 'bb' }] }); + st.deepEqual(qs.parse('a[]=b&a[t]=u&a[hasOwnProperty]=c'), { a: { '0': 'b', t: 'u', c: true } }); + st.deepEqual(qs.parse('a[]=b&a[hasOwnProperty]=c&a[x]=y'), { a: { '0': 'b', '1': 'c', x: 'y' } }); + st.end(); + }); + + t.test('transforms arrays to objects (dot notation)', function (st) { + st.deepEqual(qs.parse('foo[0].baz=bar&fool.bad=baz', { allowDots: true }), { foo: [{ baz: 'bar' }], fool: { bad: 'baz' } }); + st.deepEqual(qs.parse('foo[0].baz=bar&fool.bad.boo=baz', { allowDots: true }), { foo: [{ baz: 'bar' }], fool: { bad: { boo: 'baz' } } }); + st.deepEqual(qs.parse('foo[0][0].baz=bar&fool.bad=baz', { allowDots: true }), { foo: [[{ baz: 'bar' }]], fool: { bad: 'baz' } }); + st.deepEqual(qs.parse('foo[0].baz[0]=15&foo[0].bar=2', { allowDots: true }), { foo: [{ baz: ['15'], bar: '2' }] }); + st.deepEqual(qs.parse('foo[0].baz[0]=15&foo[0].baz[1]=16&foo[0].bar=2', { allowDots: true }), { foo: [{ baz: ['15', '16'], bar: '2' }] }); + st.deepEqual(qs.parse('foo.bad=baz&foo[0]=bar', { allowDots: true }), { foo: { bad: 'baz', '0': 'bar' } }); + st.deepEqual(qs.parse('foo.bad=baz&foo[]=bar', { allowDots: true }), { foo: { bad: 'baz', '0': 'bar' } }); + st.deepEqual(qs.parse('foo[]=bar&foo.bad=baz', { allowDots: true }), { foo: { '0': 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo.bad=baz&foo[]=bar&foo[]=foo', { allowDots: true }), { foo: { bad: 'baz', '0': 'bar', '1': 'foo' } }); + st.deepEqual(qs.parse('foo[0].a=a&foo[0].b=b&foo[1].a=aa&foo[1].b=bb', { allowDots: true }), { foo: [{ a: 'a', b: 'b' }, { a: 'aa', b: 'bb' }] }); + st.end(); + }); + + t.deepEqual(qs.parse('a[b]=c&a=d'), { a: { b: 'c', d: true } }, 'can add keys to objects'); + + t.test('correctly prunes undefined values when converting an array to an object', function (st) { + st.deepEqual(qs.parse('a[2]=b&a[99999999]=c'), { a: { '2': 'b', '99999999': 'c' } }); + st.end(); + }); + + t.test('supports malformed uri characters', function (st) { + st.deepEqual(qs.parse('{%:%}', { strictNullHandling: true }), { '{%:%}': null }); + st.deepEqual(qs.parse('{%:%}='), { '{%:%}': '' }); + st.deepEqual(qs.parse('foo=%:%}'), { foo: '%:%}' }); + st.end(); + }); + + t.test('doesn\'t produce empty keys', function (st) { + st.deepEqual(qs.parse('_r=1&'), { '_r': '1' }); + st.end(); + }); + + t.test('cannot access Object prototype', function (st) { + qs.parse('constructor[prototype][bad]=bad'); + qs.parse('bad[constructor][prototype][bad]=bad'); + st.equal(typeof Object.prototype.bad, 'undefined'); + st.end(); + }); + + t.test('parses arrays of objects', function (st) { + st.deepEqual(qs.parse('a[][b]=c'), { a: [{ b: 'c' }] }); + st.deepEqual(qs.parse('a[0][b]=c'), { a: [{ b: 'c' }] }); + st.end(); + }); + + t.test('allows for empty strings in arrays', function (st) { + st.deepEqual(qs.parse('a[]=b&a[]=&a[]=c'), { a: ['b', '', 'c'] }); + st.deepEqual(qs.parse('a[0]=b&a[1]&a[2]=c&a[19]=', { strictNullHandling: true }), { a: ['b', null, 'c', ''] }); + st.deepEqual(qs.parse('a[0]=b&a[1]=&a[2]=c&a[19]', { strictNullHandling: true }), { a: ['b', '', 'c', null] }); + st.deepEqual(qs.parse('a[]=&a[]=b&a[]=c'), { a: ['', 'b', 'c'] }); + st.end(); + }); + + t.test('compacts sparse arrays', function (st) { + st.deepEqual(qs.parse('a[10]=1&a[2]=2'), { a: ['2', '1'] }); + st.deepEqual(qs.parse('a[1][b][2][c]=1'), { a: [{ b: [{ c: '1' }] }] }); + st.deepEqual(qs.parse('a[1][2][3][c]=1'), { a: [[[{ c: '1' }]]] }); + st.deepEqual(qs.parse('a[1][2][3][c][1]=1'), { a: [[[{ c: ['1'] }]]] }); + st.end(); + }); + + t.test('parses semi-parsed strings', function (st) { + st.deepEqual(qs.parse({ 'a[b]': 'c' }), { a: { b: 'c' } }); + st.deepEqual(qs.parse({ 'a[b]': 'c', 'a[d]': 'e' }), { a: { b: 'c', d: 'e' } }); + st.end(); + }); + + t.test('parses buffers correctly', function (st) { + var b = new Buffer('test'); + st.deepEqual(qs.parse({ a: b }), { a: b }); + st.end(); + }); + + t.test('continues parsing when no parent is found', function (st) { + st.deepEqual(qs.parse('[]=&a=b'), { '0': '', a: 'b' }); + st.deepEqual(qs.parse('[]&a=b', { strictNullHandling: true }), { '0': null, a: 'b' }); + st.deepEqual(qs.parse('[foo]=bar'), { foo: 'bar' }); + st.end(); + }); + + t.test('does not error when parsing a very long array', function (st) { + var str = 'a[]=a'; + while (Buffer.byteLength(str) < 128 * 1024) { + str = str + '&' + str; + } + + st.doesNotThrow(function () { qs.parse(str); }); + + st.end(); + }); + + t.test('should not throw when a native prototype has an enumerable property', { parallel: false }, function (st) { + Object.prototype.crash = ''; + Array.prototype.crash = ''; + st.doesNotThrow(qs.parse.bind(null, 'a=b')); + st.deepEqual(qs.parse('a=b'), { a: 'b' }); + st.doesNotThrow(qs.parse.bind(null, 'a[][b]=c')); + st.deepEqual(qs.parse('a[][b]=c'), { a: [{ b: 'c' }] }); + delete Object.prototype.crash; + delete Array.prototype.crash; + st.end(); + }); + + t.test('parses a string with an alternative string delimiter', function (st) { + st.deepEqual(qs.parse('a=b;c=d', { delimiter: ';' }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('parses a string with an alternative RegExp delimiter', function (st) { + st.deepEqual(qs.parse('a=b; c=d', { delimiter: /[;,] */ }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('does not use non-splittable objects as delimiters', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { delimiter: true }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('allows overriding parameter limit', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { parameterLimit: 1 }), { a: 'b' }); + st.end(); + }); + + t.test('allows setting the parameter limit to Infinity', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { parameterLimit: Infinity }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('allows overriding array limit', function (st) { + st.deepEqual(qs.parse('a[0]=b', { arrayLimit: -1 }), { a: { '0': 'b' } }); + st.deepEqual(qs.parse('a[-1]=b', { arrayLimit: -1 }), { a: { '-1': 'b' } }); + st.deepEqual(qs.parse('a[0]=b&a[1]=c', { arrayLimit: 0 }), { a: { '0': 'b', '1': 'c' } }); + st.end(); + }); + + t.test('allows disabling array parsing', function (st) { + st.deepEqual(qs.parse('a[0]=b&a[1]=c', { parseArrays: false }), { a: { '0': 'b', '1': 'c' } }); + st.end(); + }); + + t.test('parses an object', function (st) { + var input = { + 'user[name]': { 'pop[bob]': 3 }, + 'user[email]': null + }; + + var expected = { + user: { + name: { 'pop[bob]': 3 }, + email: null + } + }; + + var result = qs.parse(input); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('parses an object in dot notation', function (st) { + var input = { + 'user.name': { 'pop[bob]': 3 }, + 'user.email.': null + }; + + var expected = { + user: { + name: { 'pop[bob]': 3 }, + email: null + } + }; + + var result = qs.parse(input, { allowDots: true }); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('parses an object and not child values', function (st) { + var input = { + 'user[name]': { 'pop[bob]': { 'test': 3 } }, + 'user[email]': null + }; + + var expected = { + user: { + name: { 'pop[bob]': { 'test': 3 } }, + email: null + } + }; + + var result = qs.parse(input); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('does not blow up when Buffer global is missing', function (st) { + var tempBuffer = global.Buffer; + delete global.Buffer; + var result = qs.parse('a=b&c=d'); + global.Buffer = tempBuffer; + st.deepEqual(result, { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('does not crash when parsing circular references', function (st) { + var a = {}; + a.b = a; + + var parsed; + + st.doesNotThrow(function () { + parsed = qs.parse({ 'foo[bar]': 'baz', 'foo[baz]': a }); + }); + + st.equal('foo' in parsed, true, 'parsed has "foo" property'); + st.equal('bar' in parsed.foo, true); + st.equal('baz' in parsed.foo, true); + st.equal(parsed.foo.bar, 'baz'); + st.deepEqual(parsed.foo.baz, a); + st.end(); + }); + + t.test('parses plain objects correctly', function (st) { + var a = Object.create(null); + a.b = 'c'; + + st.deepEqual(qs.parse(a), { b: 'c' }); + var result = qs.parse({ a: a }); + st.equal('a' in result, true, 'result has "a" property'); + st.deepEqual(result.a, a); + st.end(); + }); + + t.test('parses dates correctly', function (st) { + var now = new Date(); + st.deepEqual(qs.parse({ a: now }), { a: now }); + st.end(); + }); + + t.test('parses regular expressions correctly', function (st) { + var re = /^test$/; + st.deepEqual(qs.parse({ a: re }), { a: re }); + st.end(); + }); + + t.test('can allow overwriting prototype properties', function (st) { + st.deepEqual(qs.parse('a[hasOwnProperty]=b', { allowPrototypes: true }), { a: { hasOwnProperty: 'b' } }, { prototype: false }); + st.deepEqual(qs.parse('hasOwnProperty=b', { allowPrototypes: true }), { hasOwnProperty: 'b' }, { prototype: false }); + st.end(); + }); + + t.test('can return plain objects', function (st) { + var expected = Object.create(null); + expected.a = Object.create(null); + expected.a.b = 'c'; + expected.a.hasOwnProperty = 'd'; + st.deepEqual(qs.parse('a[b]=c&a[hasOwnProperty]=d', { plainObjects: true }), expected); + st.deepEqual(qs.parse(null, { plainObjects: true }), Object.create(null)); + var expectedArray = Object.create(null); + expectedArray.a = Object.create(null); + expectedArray.a['0'] = 'b'; + expectedArray.a.c = 'd'; + st.deepEqual(qs.parse('a[]=b&a[c]=d', { plainObjects: true }), expectedArray); + st.end(); + }); + + t.test('can parse with custom encoding', function (st) { + st.deepEqual(qs.parse('%8c%a7=%91%e5%8d%e3%95%7b', { + decoder: function (str) { + var reg = /\%([0-9A-F]{2})/ig; + var result = []; + var parts; + var last = 0; + while (parts = reg.exec(str)) { + result.push(parseInt(parts[1], 16)); + last = parts.index + parts[0].length; + } + return iconv.decode(new Buffer(result), 'shift_jis').toString(); + } + }), { 県: '大阪府' }); + st.end(); + }); + + t.test('throws error with wrong decoder', function (st) { + st.throws(function () { + qs.parse({}, { + decoder: 'string' + }); + }, new TypeError('Decoder has to be a function.')); + st.end(); + }); +}); diff --git a/node_modules/qs/test/stringify.js b/node_modules/qs/test/stringify.js new file mode 100755 index 0000000..699397e --- /dev/null +++ b/node_modules/qs/test/stringify.js @@ -0,0 +1,305 @@ +'use strict'; + +var test = require('tape'); +var qs = require('../'); +var iconv = require('iconv-lite'); + +test('stringify()', function (t) { + t.test('stringifies a querystring object', function (st) { + st.equal(qs.stringify({ a: 'b' }), 'a=b'); + st.equal(qs.stringify({ a: 1 }), 'a=1'); + st.equal(qs.stringify({ a: 1, b: 2 }), 'a=1&b=2'); + st.equal(qs.stringify({ a: 'A_Z' }), 'a=A_Z'); + st.equal(qs.stringify({ a: '€' }), 'a=%E2%82%AC'); + st.equal(qs.stringify({ a: '' }), 'a=%EE%80%80'); + st.equal(qs.stringify({ a: 'א' }), 'a=%D7%90'); + st.equal(qs.stringify({ a: '𐐷' }), 'a=%F0%90%90%B7'); + st.end(); + }); + + t.test('stringifies a nested object', function (st) { + st.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); + st.equal(qs.stringify({ a: { b: { c: { d: 'e' } } } }), 'a%5Bb%5D%5Bc%5D%5Bd%5D=e'); + st.end(); + }); + + t.test('stringifies a nested object with dots notation', function (st) { + st.equal(qs.stringify({ a: { b: 'c' } }, { allowDots: true }), 'a.b=c'); + st.equal(qs.stringify({ a: { b: { c: { d: 'e' } } } }, { allowDots: true }), 'a.b.c.d=e'); + st.end(); + }); + + t.test('stringifies an array value', function (st) { + st.equal(qs.stringify({ a: ['b', 'c', 'd'] }), 'a%5B0%5D=b&a%5B1%5D=c&a%5B2%5D=d'); + st.end(); + }); + + t.test('omits nulls when asked', function (st) { + st.equal(qs.stringify({ a: 'b', c: null }, { skipNulls: true }), 'a=b'); + st.end(); + }); + + + t.test('omits nested nulls when asked', function (st) { + st.equal(qs.stringify({ a: { b: 'c', d: null } }, { skipNulls: true }), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('omits array indices when asked', function (st) { + st.equal(qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false }), 'a=b&a=c&a=d'); + st.end(); + }); + + t.test('stringifies a nested array value', function (st) { + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }), 'a%5Bb%5D%5B0%5D=c&a%5Bb%5D%5B1%5D=d'); + st.end(); + }); + + t.test('stringifies a nested array value with dots notation', function (st) { + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }, { allowDots: true, encode: false }), 'a.b[0]=c&a.b[1]=d'); + st.end(); + }); + + t.test('stringifies an object inside an array', function (st) { + st.equal(qs.stringify({ a: [{ b: 'c' }] }), 'a%5B0%5D%5Bb%5D=c'); + st.equal(qs.stringify({ a: [{ b: { c: [1] } }] }), 'a%5B0%5D%5Bb%5D%5Bc%5D%5B0%5D=1'); + st.end(); + }); + + t.test('stringifies an array with mixed objects and primitives', function (st) { + st.equal(qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false }), 'a[0][b]=1&a[1]=2&a[2]=3'); + st.end(); + }); + + t.test('stringifies an object inside an array with dots notation', function (st) { + st.equal(qs.stringify({ a: [{ b: 'c' }] }, { allowDots: true, encode: false }), 'a[0].b=c'); + st.equal(qs.stringify({ a: [{ b: { c: [1] } }] }, { allowDots: true, encode: false }), 'a[0].b.c[0]=1'); + st.end(); + }); + + t.test('does not omit object keys when indices = false', function (st) { + st.equal(qs.stringify({ a: [{ b: 'c' }] }, { indices: false }), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when indices=true', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { indices: true }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when no arrayFormat is specified', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when no arrayFormat=indices', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses repeat notation for arrays when no arrayFormat=repeat', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' }), 'a=b&a=c'); + st.end(); + }); + + t.test('uses brackets notation for arrays when no arrayFormat=brackets', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' }), 'a%5B%5D=b&a%5B%5D=c'); + st.end(); + }); + + t.test('stringifies a complicated object', function (st) { + st.equal(qs.stringify({ a: { b: 'c', d: 'e' } }), 'a%5Bb%5D=c&a%5Bd%5D=e'); + st.end(); + }); + + t.test('stringifies an empty value', function (st) { + st.equal(qs.stringify({ a: '' }), 'a='); + st.equal(qs.stringify({ a: null }, { strictNullHandling: true }), 'a'); + + st.equal(qs.stringify({ a: '', b: '' }), 'a=&b='); + st.equal(qs.stringify({ a: null, b: '' }, { strictNullHandling: true }), 'a&b='); + + st.equal(qs.stringify({ a: { b: '' } }), 'a%5Bb%5D='); + st.equal(qs.stringify({ a: { b: null } }, { strictNullHandling: true }), 'a%5Bb%5D'); + st.equal(qs.stringify({ a: { b: null } }, { strictNullHandling: false }), 'a%5Bb%5D='); + + st.end(); + }); + + t.test('stringifies an empty object', function (st) { + var obj = Object.create(null); + obj.a = 'b'; + st.equal(qs.stringify(obj), 'a=b'); + st.end(); + }); + + t.test('returns an empty string for invalid input', function (st) { + st.equal(qs.stringify(undefined), ''); + st.equal(qs.stringify(false), ''); + st.equal(qs.stringify(null), ''); + st.equal(qs.stringify(''), ''); + st.end(); + }); + + t.test('stringifies an object with an empty object as a child', function (st) { + var obj = { + a: Object.create(null) + }; + + obj.a.b = 'c'; + st.equal(qs.stringify(obj), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('drops keys with a value of undefined', function (st) { + st.equal(qs.stringify({ a: undefined }), ''); + + st.equal(qs.stringify({ a: { b: undefined, c: null } }, { strictNullHandling: true }), 'a%5Bc%5D'); + st.equal(qs.stringify({ a: { b: undefined, c: null } }, { strictNullHandling: false }), 'a%5Bc%5D='); + st.equal(qs.stringify({ a: { b: undefined, c: '' } }), 'a%5Bc%5D='); + st.end(); + }); + + t.test('url encodes values', function (st) { + st.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); + st.end(); + }); + + t.test('stringifies a date', function (st) { + var now = new Date(); + var str = 'a=' + encodeURIComponent(now.toISOString()); + st.equal(qs.stringify({ a: now }), str); + st.end(); + }); + + t.test('stringifies the weird object from qs', function (st) { + st.equal(qs.stringify({ 'my weird field': '~q1!2"\'w$5&7/z8)?' }), 'my%20weird%20field=~q1%212%22%27w%245%267%2Fz8%29%3F'); + st.end(); + }); + + t.test('skips properties that are part of the object prototype', function (st) { + Object.prototype.crash = 'test'; + st.equal(qs.stringify({ a: 'b' }), 'a=b'); + st.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); + delete Object.prototype.crash; + st.end(); + }); + + t.test('stringifies boolean values', function (st) { + st.equal(qs.stringify({ a: true }), 'a=true'); + st.equal(qs.stringify({ a: { b: true } }), 'a%5Bb%5D=true'); + st.equal(qs.stringify({ b: false }), 'b=false'); + st.equal(qs.stringify({ b: { c: false } }), 'b%5Bc%5D=false'); + st.end(); + }); + + t.test('stringifies buffer values', function (st) { + st.equal(qs.stringify({ a: new Buffer('test') }), 'a=test'); + st.equal(qs.stringify({ a: { b: new Buffer('test') } }), 'a%5Bb%5D=test'); + st.end(); + }); + + t.test('stringifies an object using an alternative delimiter', function (st) { + st.equal(qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' }), 'a=b;c=d'); + st.end(); + }); + + t.test('doesn\'t blow up when Buffer global is missing', function (st) { + var tempBuffer = global.Buffer; + delete global.Buffer; + var result = qs.stringify({ a: 'b', c: 'd' }); + global.Buffer = tempBuffer; + st.equal(result, 'a=b&c=d'); + st.end(); + }); + + t.test('selects properties when filter=array', function (st) { + st.equal(qs.stringify({ a: 'b' }, { filter: ['a'] }), 'a=b'); + st.equal(qs.stringify({ a: 1 }, { filter: [] }), ''); + st.equal(qs.stringify({ a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, { filter: ['a', 'b', 0, 2] }), 'a%5Bb%5D%5B0%5D=1&a%5Bb%5D%5B2%5D=3'); + st.end(); + }); + + t.test('supports custom representations when filter=function', function (st) { + var calls = 0; + var obj = { a: 'b', c: 'd', e: { f: new Date(1257894000000) } }; + var filterFunc = function (prefix, value) { + calls++; + if (calls === 1) { + st.equal(prefix, '', 'prefix is empty'); + st.equal(value, obj); + } else if (prefix === 'c') { + return; + } else if (value instanceof Date) { + st.equal(prefix, 'e[f]'); + return value.getTime(); + } + return value; + }; + + st.equal(qs.stringify(obj, { filter: filterFunc }), 'a=b&e%5Bf%5D=1257894000000'); + st.equal(calls, 5); + st.end(); + }); + + t.test('can disable uri encoding', function (st) { + st.equal(qs.stringify({ a: 'b' }, { encode: false }), 'a=b'); + st.equal(qs.stringify({ a: { b: 'c' } }, { encode: false }), 'a[b]=c'); + st.equal(qs.stringify({ a: 'b', c: null }, { strictNullHandling: true, encode: false }), 'a=b&c'); + st.end(); + }); + + t.test('can sort the keys', function (st) { + var sort = function (a, b) { return a.localeCompare(b); }; + st.equal(qs.stringify({ a: 'c', z: 'y', b: 'f' }, { sort: sort }), 'a=c&b=f&z=y'); + st.equal(qs.stringify({ a: 'c', z: { j: 'a', i: 'b' }, b: 'f' }, { sort: sort }), 'a=c&b=f&z%5Bi%5D=b&z%5Bj%5D=a'); + st.end(); + }); + + t.test('can sort the keys at depth 3 or more too', function (st) { + var sort = function (a, b) { return a.localeCompare(b); }; + st.equal(qs.stringify({ a: 'a', z: { zj: {zjb: 'zjb', zja: 'zja'}, zi: {zib: 'zib', zia: 'zia'} }, b: 'b' }, { sort: sort, encode: false }), 'a=a&b=b&z[zi][zia]=zia&z[zi][zib]=zib&z[zj][zja]=zja&z[zj][zjb]=zjb'); + st.equal(qs.stringify({ a: 'a', z: { zj: {zjb: 'zjb', zja: 'zja'}, zi: {zib: 'zib', zia: 'zia'} }, b: 'b' }, { sort: null, encode: false }), 'a=a&z[zj][zjb]=zjb&z[zj][zja]=zja&z[zi][zib]=zib&z[zi][zia]=zia&b=b'); + st.end(); + }); + + t.test('can stringify with custom encoding', function (st) { + st.equal(qs.stringify({ 県: '大阪府', '': ''}, { + encoder: function (str) { + if (str.length === 0) { + return ''; + } + var buf = iconv.encode(str, 'shiftjis'); + var result = []; + for (var i=0; i < buf.length; ++i) { + result.push(buf.readUInt8(i).toString(16)); + } + return '%' + result.join('%'); + } + }), '%8c%a7=%91%e5%8d%e3%95%7b&='); + st.end(); + }); + + t.test('throws error with wrong encoder', function (st) { + st.throws(function () { + qs.stringify({}, { + encoder: 'string' + }); + }, new TypeError('Encoder has to be a function.')); + st.end(); + }); + + t.test('can use custom encoder for a buffer object', { + skip: typeof Buffer === 'undefined' + }, function (st) { + st.equal(qs.stringify({ a: new Buffer([1]) }, { + encoder: function (buffer) { + if (typeof buffer === 'string') { + return buffer; + } + return String.fromCharCode(buffer.readUInt8(0) + 97); + } + }), 'a=b'); + st.end(); + }); +}); diff --git a/node_modules/qs/test/utils.js b/node_modules/qs/test/utils.js new file mode 100755 index 0000000..4a8d824 --- /dev/null +++ b/node_modules/qs/test/utils.js @@ -0,0 +1,9 @@ +'use strict'; + +var test = require('tape'); +var utils = require('../lib/utils'); + +test('merge()', function (t) { + t.deepEqual(utils.merge({ a: 'b' }, { a: 'c' }), { a: ['b', 'c'] }, 'merges two objects with the same key'); + t.end(); +}); diff --git a/node_modules/range-parser/HISTORY.md b/node_modules/range-parser/HISTORY.md new file mode 100644 index 0000000..5e01eef --- /dev/null +++ b/node_modules/range-parser/HISTORY.md @@ -0,0 +1,51 @@ +1.2.0 / 2016-06-01 +================== + + * Add `combine` option to combine overlapping ranges + +1.1.0 / 2016-05-13 +================== + + * Fix incorrectly returning -1 when there is at least one valid range + * perf: remove internal function + +1.0.3 / 2015-10-29 +================== + + * perf: enable strict mode + +1.0.2 / 2014-09-08 +================== + + * Support Node.js 0.6 + +1.0.1 / 2014-09-07 +================== + + * Move repository to jshttp + +1.0.0 / 2013-12-11 +================== + + * Add repository to package.json + * Add MIT license + +0.0.4 / 2012-06-17 +================== + + * Change ret -1 for unsatisfiable and -2 when invalid + +0.0.3 / 2012-06-17 +================== + + * Fix last-byte-pos default to len - 1 + +0.0.2 / 2012-06-14 +================== + + * Add `.type` + +0.0.1 / 2012-06-11 +================== + + * Initial release diff --git a/node_modules/range-parser/LICENSE b/node_modules/range-parser/LICENSE new file mode 100644 index 0000000..3599954 --- /dev/null +++ b/node_modules/range-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015-2016 Douglas Christopher Wilson [ +// { start: 0, end: 10 }, +// { start: 50, end: 60 } +// ] +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/range-parser.svg +[npm-url]: https://npmjs.org/package/range-parser +[node-version-image]: https://img.shields.io/node/v/range-parser.svg +[node-version-url]: https://nodejs.org/endownload +[travis-image]: https://img.shields.io/travis/jshttp/range-parser.svg +[travis-url]: https://travis-ci.org/jshttp/range-parser +[coveralls-image]: https://img.shields.io/coveralls/jshttp/range-parser.svg +[coveralls-url]: https://coveralls.io/r/jshttp/range-parser +[downloads-image]: https://img.shields.io/npm/dm/range-parser.svg +[downloads-url]: https://npmjs.org/package/range-parser diff --git a/node_modules/range-parser/index.js b/node_modules/range-parser/index.js new file mode 100644 index 0000000..83b2eb6 --- /dev/null +++ b/node_modules/range-parser/index.js @@ -0,0 +1,158 @@ +/*! + * range-parser + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = rangeParser + +/** + * Parse "Range" header `str` relative to the given file `size`. + * + * @param {Number} size + * @param {String} str + * @param {Object} [options] + * @return {Array} + * @public + */ + +function rangeParser (size, str, options) { + var index = str.indexOf('=') + + if (index === -1) { + return -2 + } + + // split the range string + var arr = str.slice(index + 1).split(',') + var ranges = [] + + // add ranges type + ranges.type = str.slice(0, index) + + // parse all ranges + for (var i = 0; i < arr.length; i++) { + var range = arr[i].split('-') + var start = parseInt(range[0], 10) + var end = parseInt(range[1], 10) + + // -nnn + if (isNaN(start)) { + start = size - end + end = size - 1 + // nnn- + } else if (isNaN(end)) { + end = size - 1 + } + + // limit last-byte-pos to current length + if (end > size - 1) { + end = size - 1 + } + + // invalid or unsatisifiable + if (isNaN(start) || isNaN(end) || start > end || start < 0) { + continue + } + + // add range + ranges.push({ + start: start, + end: end + }) + } + + if (ranges.length < 1) { + // unsatisifiable + return -1 + } + + return options && options.combine + ? combineRanges(ranges) + : ranges +} + +/** + * Combine overlapping & adjacent ranges. + * @private + */ + +function combineRanges (ranges) { + var ordered = ranges.map(mapWithIndex).sort(sortByRangeStart) + + for (var j = 0, i = 1; i < ordered.length; i++) { + var range = ordered[i] + var current = ordered[j] + + if (range.start > current.end + 1) { + // next range + ordered[++j] = range + } else if (range.end > current.end) { + // extend range + current.end = range.end + current.index = Math.min(current.index, range.index) + } + } + + // trim ordered array + ordered.length = j + 1 + + // generate combined range + var combined = ordered.sort(sortByRangeIndex).map(mapWithoutIndex) + + // copy ranges type + combined.type = ranges.type + + return combined +} + +/** + * Map function to add index value to ranges. + * @private + */ + +function mapWithIndex (range, index) { + return { + start: range.start, + end: range.end, + index: index + } +} + +/** + * Map function to remove index value from ranges. + * @private + */ + +function mapWithoutIndex (range) { + return { + start: range.start, + end: range.end + } +} + +/** + * Sort function to sort ranges by index. + * @private + */ + +function sortByRangeIndex (a, b) { + return a.index - b.index +} + +/** + * Sort function to sort ranges by start position. + * @private + */ + +function sortByRangeStart (a, b) { + return a.start - b.start +} diff --git a/node_modules/range-parser/package.json b/node_modules/range-parser/package.json new file mode 100644 index 0000000..4ddea01 --- /dev/null +++ b/node_modules/range-parser/package.json @@ -0,0 +1,134 @@ +{ + "_args": [ + [ + { + "raw": "range-parser@~1.2.0", + "scope": null, + "escapedName": "range-parser", + "name": "range-parser", + "rawSpec": "~1.2.0", + "spec": ">=1.2.0 <1.3.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "range-parser@>=1.2.0 <1.3.0", + "_id": "range-parser@1.2.0", + "_inCache": true, + "_location": "/range-parser", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/range-parser-1.2.0.tgz_1464803293097_0.6830497414339334" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "range-parser@~1.2.0", + "scope": null, + "escapedName": "range-parser", + "name": "range-parser", + "rawSpec": "~1.2.0", + "spec": ">=1.2.0 <1.3.0", + "type": "range" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz", + "_shasum": "f49be6b487894ddc40dcc94a322f611092e00d5e", + "_shrinkwrap": null, + "_spec": "range-parser@~1.2.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/jshttp/range-parser/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "James Wyatt Cready", + "email": "wyatt.cready@lanetix.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": {}, + "description": "Range header field string parser", + "devDependencies": { + "eslint": "2.11.1", + "eslint-config-standard": "5.3.1", + "eslint-plugin-promise": "1.1.0", + "eslint-plugin-standard": "1.3.2", + "istanbul": "0.4.3", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "f49be6b487894ddc40dcc94a322f611092e00d5e", + "tarball": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "gitHead": "0665aca31639d799dee1d35fb10970799559ec48", + "homepage": "https://github.com/jshttp/range-parser", + "keywords": [ + "range", + "parser", + "http" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jonathanong", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + } + ], + "name": "range-parser", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/range-parser.git" + }, + "scripts": { + "lint": "eslint **/*.js", + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.2.0" +} diff --git a/node_modules/send/HISTORY.md b/node_modules/send/HISTORY.md new file mode 100644 index 0000000..d8123cc --- /dev/null +++ b/node_modules/send/HISTORY.md @@ -0,0 +1,356 @@ +0.14.2 / 2017-01-23 +=================== + + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: ms@0.7.2 + * deps: statuses@~1.3.1 + +0.14.1 / 2016-06-09 +=================== + + * Fix redirect error when `path` contains raw non-URL characters + * Fix redirect when `path` starts with multiple forward slashes + +0.14.0 / 2016-06-06 +=================== + + * Add `acceptRanges` option + * Add `cacheControl` option + * Attempt to combine multiple ranges into single range + * Correctly inherit from `Stream` class + * Fix `Content-Range` header in 416 responses when using `start`/`end` options + * Fix `Content-Range` header missing from default 416 responses + * Ignore non-byte `Range` headers + * deps: http-errors@~1.5.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - Support new code `421 Misdirected Request` + - Use `setprototypeof` module to replace `__proto__` setting + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: range-parser@~1.2.0 + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: statuses@~1.3.0 + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: remove argument reassignment + +0.13.2 / 2016-03-05 +=================== + + * Fix invalid `Content-Type` header when `send.mime.default_type` unset + +0.13.1 / 2016-01-16 +=================== + + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: destroy@~1.0.4 + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: range-parser@~1.0.3 + - perf: enable strict mode + +0.13.0 / 2015-06-16 +=================== + + * Allow Node.js HTTP server to set `Date` response header + * Fix incorrectly removing `Content-Location` on 304 response + * Improve the default redirect response headers + * Send appropriate headers on default error response + * Use `http-errors` for standard emitted errors + * Use `statuses` instead of `http` module for status messages + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Improve stat performance by removing hashing + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove unnecessary array allocations + +0.12.3 / 2015-05-13 +=================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: ms@0.7.1 + - Prevent extraordinarily long inputs + * deps: on-finished@~2.2.1 + +0.12.2 / 2015-03-13 +=================== + + * Throw errors early for invalid `extensions` or `index` options + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.12.1 / 2015-02-17 +=================== + + * Fix regression sending zero-length files + +0.12.0 / 2015-02-16 +=================== + + * Always read the stat size from the file + * Fix mutating passed-in `options` + * deps: mime@1.3.4 + +0.11.1 / 2015-01-20 +=================== + + * Fix `root` path disclosure + +0.11.0 / 2015-01-05 +=================== + + * deps: debug@~2.1.1 + * deps: etag@~1.5.1 + - deps: crc@3.2.1 + * deps: ms@0.7.0 + - Add `milliseconds` + - Add `msecs` + - Add `secs` + - Add `mins` + - Add `hrs` + - Add `yrs` + * deps: on-finished@~2.2.0 + +0.10.1 / 2014-10-22 +=================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.10.0 / 2014-10-15 +=================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + +0.9.3 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + - Support "fake" stats objects + +0.9.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: range-parser@~1.0.2 + +0.9.1 / 2014-09-07 +================== + + * deps: fresh@0.2.4 + +0.9.0 / 2014-09-07 +================== + + * Add `lastModified` option + * Use `etag` to generate `ETag` header + * deps: debug@~2.0.0 + +0.8.5 / 2014-09-04 +================== + + * Fix malicious path detection for empty string path + +0.8.4 / 2014-09-04 +================== + + * Fix a path traversal issue when using `root` + +0.8.3 / 2014-08-16 +================== + + * deps: destroy@1.0.3 + - renamed from dethroy + * deps: on-finished@2.1.0 + +0.8.2 / 2014-08-14 +================== + + * Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: dethroy@1.0.2 + +0.8.1 / 2014-08-05 +================== + + * Fix `extensions` behavior when file already has extension + +0.8.0 / 2014-08-05 +================== + + * Add `extensions` option + +0.7.4 / 2014-08-04 +================== + + * Fix serving index files without root dir + +0.7.3 / 2014-07-29 +================== + + * Fix incorrect 403 on Windows and Node.js 0.11 + +0.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +0.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +0.7.0 / 2014-07-20 +================== + + * Deprecate `hidden` option; use `dotfiles` option + * Add `dotfiles` option + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + +0.6.0 / 2014-07-11 +================== + + * Deprecate `from` option; use `root` option + * Deprecate `send.etag()` -- use `etag` in `options` + * Deprecate `send.hidden()` -- use `hidden` in `options` + * Deprecate `send.index()` -- use `index` in `options` + * Deprecate `send.maxage()` -- use `maxAge` in `options` + * Deprecate `send.root()` -- use `root` in `options` + * Cap `maxAge` value to 1 year + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.5.0 / 2014-06-28 +================== + + * Accept string for `maxAge` (converted by `ms`) + * Add `headers` event + * Include link in default redirect response + * Use `EventEmitter.listenerCount` to count listeners + +0.4.3 / 2014-06-11 +================== + + * Do not throw un-catchable error on file open race condition + * Use `escape-html` for HTML escaping + * deps: debug@1.0.2 + - fix some debugging output colors on node.js 0.8 + * deps: finished@1.2.2 + * deps: fresh@0.2.2 + +0.4.2 / 2014-06-09 +================== + + * fix "event emitter leak" warnings + * deps: debug@1.0.1 + * deps: finished@1.2.1 + +0.4.1 / 2014-06-02 +================== + + * Send `max-age` in `Cache-Control` in correct format + +0.4.0 / 2014-05-27 +================== + + * Calculate ETag with md5 for reduced collisions + * Fix wrong behavior when index file matches directory + * Ignore stream errors after request ends + - Goodbye `EBADF, read` + * Skip directories in index file search + * deps: debug@0.8.1 + +0.3.0 / 2014-04-24 +================== + + * Fix sending files with dots without root set + * Coerce option types + * Accept API options in options object + * Set etags to "weak" + * Include file path in etag + * Make "Can't set headers after they are sent." catchable + * Send full entity-body for multi range requests + * Default directory access to 403 when index disabled + * Support multiple index paths + * Support "If-Range" header + * Control whether to generate etags + * deps: mime@1.2.11 + +0.2.0 / 2014-01-29 +================== + + * update range-parser and fresh + +0.1.4 / 2013-08-11 +================== + + * update fresh + +0.1.3 / 2013-07-08 +================== + + * Revert "Fix fd leak" + +0.1.2 / 2013-07-03 +================== + + * Fix fd leak + +0.1.0 / 2012-08-25 +================== + + * add options parameter to send() that is passed to fs.createReadStream() [kanongil] + +0.0.4 / 2012-08-16 +================== + + * allow custom "Accept-Ranges" definition + +0.0.3 / 2012-07-16 +================== + + * fix normalization of the root directory. Closes #3 + +0.0.2 / 2012-07-09 +================== + + * add passing of req explicitly for now (YUCK) + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/send/LICENSE b/node_modules/send/LICENSE new file mode 100644 index 0000000..4aa69e8 --- /dev/null +++ b/node_modules/send/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/send/README.md b/node_modules/send/README.md new file mode 100644 index 0000000..0453578 --- /dev/null +++ b/node_modules/send/README.md @@ -0,0 +1,251 @@ +# send + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![Gratipay][gratipay-image]][gratipay-url] + +Send is a library for streaming files from the file system as a http response +supporting partial responses (Ranges), conditional-GET negotiation, high test +coverage, and granular events which may be leveraged to take appropriate actions +in your application or framework. + +Looking to serve up entire folders mapped to URLs? Try [serve-static](https://www.npmjs.org/package/serve-static). + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install send +``` + +## API + +```js +var send = require('send') +``` + +### send(req, path, [options]) + +Create a new `SendStream` for the given path to send to a `res`. The `req` is +the Node.js HTTP request and the `path` is a urlencoded path to send (urlencoded, +not the actual file-system path). + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `maxAge` option. + +##### dotfiles + +Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Send a 403 for any request for a dotfile. + - `'ignore'` Pretend like the dotfile does not exist and 404. + +The default value is _similar_ to `'ignore'`, with the exception that +this default will not ignore the files within a directory that begins +with a dot, for backward-compatibility. + +##### end + +Byte offset at which the stream ends, defaults to the length of the file +minus 1. The end is inclusive in the stream, meaning `end: 3` will include +the 4th byte in the stream. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +If a given file doesn't exist, try appending one of the given extensions, +in the given order. By default, this is disabled (set to `false`). An +example value that will serve extension-less HTML files: `['html', 'htm']`. +This is skipped if the requested file already has an extension. + +##### index + +By default send supports "index.html" files, to disable this +set `false` or to supply a new index pass a string or an array +in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. +This can also be a string accepted by the +[ms](https://www.npmjs.org/package/ms#readme) module. + +##### root + +Serve files relative to `path`. + +##### start + +Byte offset at which the stream starts, defaults to 0. The start is inclusive, +meaning `start: 2` will include the 3rd byte in the stream. + +#### Events + +The `SendStream` is an event emitter and will emit the following events: + + - `error` an error occurred `(err)` + - `directory` a directory was requested + - `file` a file was requested `(path, stat)` + - `headers` the headers are about to be set on a file `(res, path, stat)` + - `stream` file streaming has started `(stream)` + - `end` streaming has completed + +#### .pipe + +The `pipe` method is used to pipe the response into the Node.js HTTP response +object, typically `send(req, path, options).pipe(res)`. + +### .mime + +The `mime` export is the global instance of of the +[`mime` npm module](https://www.npmjs.com/package/mime). + +This is used to configure the MIME types that are associated with file extensions +as well as other options for how to resolve the MIME type of a file (like the +default type to use for an unknown file extension). + +## Error-handling + +By default when no `error` listeners are present an automatic response will be +made, otherwise you have full control over the response, aka you may show a 5xx +page etc. + +## Caching + +It does _not_ perform internal caching, you should use a reverse proxy cache +such as Varnish for this, or those fancy things called CDNs. If your +application is small enough that it would benefit from single-node memory +caching, it's small enough that it does not need caching at all ;). + +## Debugging + +To enable `debug()` instrumentation output export __DEBUG__: + +``` +$ DEBUG=send node app +``` + +## Running tests + +``` +$ npm install +$ npm test +``` + +## Examples + +### Small example + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var app = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname).pipe(res) +}).listen(3000) +``` + +### Custom file types + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +// Default unknown types to text/plain +send.mime.default_type = 'text/plain' + +// Add a custom type +send.mime.define({ + 'application/x-my-type': ['x-mt', 'x-mtt'] +}) + +var app = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname).pipe(res) +}).listen(3000) +``` + +### Serving from a root directory with custom error-handling + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var app = http.createServer(function onRequest (req, res) { + // your custom error-handling logic: + function error (err) { + res.statusCode = err.status || 500 + res.end(err.message) + } + + // your custom headers + function headers (res, path, stat) { + // serve all files for download + res.setHeader('Content-Disposition', 'attachment') + } + + // your custom directory handling logic: + function redirect () { + res.statusCode = 301 + res.setHeader('Location', req.url + '/') + res.end('Redirecting to ' + req.url + '/') + } + + // transfer arbitrary files from within + // /www/example.com/public/* + send(req, parseUrl(req).pathname, {root: '/www/example.com/public'}) + .on('error', error) + .on('directory', redirect) + .on('headers', headers) + .pipe(res); +}).listen(3000) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/send.svg +[npm-url]: https://npmjs.org/package/send +[travis-image]: https://img.shields.io/travis/pillarjs/send/master.svg?label=linux +[travis-url]: https://travis-ci.org/pillarjs/send +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/send/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/send +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/send/master.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/send?branch=master +[downloads-image]: https://img.shields.io/npm/dm/send.svg +[downloads-url]: https://npmjs.org/package/send +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url]: https://www.gratipay.com/dougwilson/ diff --git a/node_modules/send/index.js b/node_modules/send/index.js new file mode 100644 index 0000000..81ec0b3 --- /dev/null +++ b/node_modules/send/index.js @@ -0,0 +1,948 @@ +/*! + * send + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var debug = require('debug')('send') +var deprecate = require('depd')('send') +var destroy = require('destroy') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var etag = require('etag') +var EventEmitter = require('events').EventEmitter +var fresh = require('fresh') +var fs = require('fs') +var mime = require('mime') +var ms = require('ms') +var onFinished = require('on-finished') +var parseRange = require('range-parser') +var path = require('path') +var statuses = require('statuses') +var Stream = require('stream') +var util = require('util') + +/** + * Path function references. + * @private + */ + +var extname = path.extname +var join = path.join +var normalize = path.normalize +var resolve = path.resolve +var sep = path.sep + +/** + * Regular expression for identifying a bytes Range header. + * @private + */ + +var BYTES_RANGE_REGEXP = /^ *bytes=/ + +/** + * Maximum value allowed for the max age. + * @private + */ + +var MAX_MAXAGE = 60 * 60 * 24 * 365 * 1000 // 1 year + +/** + * Regular expression to match a path with a directory up component. + * @private + */ + +var UP_PATH_REGEXP = /(?:^|[\\\/])\.\.(?:[\\\/]|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = send +module.exports.mime = mime + +/** + * Shim EventEmitter.listenerCount for node.js < 0.10 + */ + +/* istanbul ignore next */ +var listenerCount = EventEmitter.listenerCount || + function (emitter, type) { return emitter.listeners(type).length } + +/** + * Return a `SendStream` for `req` and `path`. + * + * @param {object} req + * @param {string} path + * @param {object} [options] + * @return {SendStream} + * @public + */ + +function send (req, path, options) { + return new SendStream(req, path, options) +} + +/** + * Initialize a `SendStream` with the given `path`. + * + * @param {Request} req + * @param {String} path + * @param {object} [options] + * @private + */ + +function SendStream (req, path, options) { + Stream.call(this) + + var opts = options || {} + + this.options = opts + this.path = path + this.req = req + + this._acceptRanges = opts.acceptRanges !== undefined + ? Boolean(opts.acceptRanges) + : true + + this._cacheControl = opts.cacheControl !== undefined + ? Boolean(opts.cacheControl) + : true + + this._etag = opts.etag !== undefined + ? Boolean(opts.etag) + : true + + this._dotfiles = opts.dotfiles !== undefined + ? opts.dotfiles + : 'ignore' + + if (this._dotfiles !== 'ignore' && this._dotfiles !== 'allow' && this._dotfiles !== 'deny') { + throw new TypeError('dotfiles option must be "allow", "deny", or "ignore"') + } + + this._hidden = Boolean(opts.hidden) + + if (opts.hidden !== undefined) { + deprecate('hidden: use dotfiles: \'' + (this._hidden ? 'allow' : 'ignore') + '\' instead') + } + + // legacy support + if (opts.dotfiles === undefined) { + this._dotfiles = undefined + } + + this._extensions = opts.extensions !== undefined + ? normalizeList(opts.extensions, 'extensions option') + : [] + + this._index = opts.index !== undefined + ? normalizeList(opts.index, 'index option') + : ['index.html'] + + this._lastModified = opts.lastModified !== undefined + ? Boolean(opts.lastModified) + : true + + this._maxage = opts.maxAge || opts.maxage + this._maxage = typeof this._maxage === 'string' + ? ms(this._maxage) + : Number(this._maxage) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + + this._root = opts.root + ? resolve(opts.root) + : null + + if (!this._root && opts.from) { + this.from(opts.from) + } +} + +/** + * Inherits from `Stream`. + */ + +util.inherits(SendStream, Stream) + +/** + * Enable or disable etag generation. + * + * @param {Boolean} val + * @return {SendStream} + * @api public + */ + +SendStream.prototype.etag = deprecate.function(function etag (val) { + this._etag = Boolean(val) + debug('etag %s', this._etag) + return this +}, 'send.etag: pass etag as option') + +/** + * Enable or disable "hidden" (dot) files. + * + * @param {Boolean} path + * @return {SendStream} + * @api public + */ + +SendStream.prototype.hidden = deprecate.function(function hidden (val) { + this._hidden = Boolean(val) + this._dotfiles = undefined + debug('hidden %s', this._hidden) + return this +}, 'send.hidden: use dotfiles option') + +/** + * Set index `paths`, set to a falsy + * value to disable index support. + * + * @param {String|Boolean|Array} paths + * @return {SendStream} + * @api public + */ + +SendStream.prototype.index = deprecate.function(function index (paths) { + var index = !paths ? [] : normalizeList(paths, 'paths argument') + debug('index %o', paths) + this._index = index + return this +}, 'send.index: pass index as option') + +/** + * Set root `path`. + * + * @param {String} path + * @return {SendStream} + * @api public + */ + +SendStream.prototype.root = function root (path) { + this._root = resolve(String(path)) + debug('root %s', this._root) + return this +} + +SendStream.prototype.from = deprecate.function(SendStream.prototype.root, + 'send.from: pass root as option') + +SendStream.prototype.root = deprecate.function(SendStream.prototype.root, + 'send.root: pass root as option') + +/** + * Set max-age to `maxAge`. + * + * @param {Number} maxAge + * @return {SendStream} + * @api public + */ + +SendStream.prototype.maxage = deprecate.function(function maxage (maxAge) { + this._maxage = typeof maxAge === 'string' + ? ms(maxAge) + : Number(maxAge) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + debug('max-age %d', this._maxage) + return this +}, 'send.maxage: pass maxAge as option') + +/** + * Emit error with `status`. + * + * @param {number} status + * @param {Error} [error] + * @private + */ + +SendStream.prototype.error = function error (status, error) { + // emit if listeners instead of responding + if (listenerCount(this, 'error') !== 0) { + return this.emit('error', createError(error, status, { + expose: false + })) + } + + var res = this.res + var msg = statuses[status] + + // clear existing headers + clearHeaders(res) + + // add error headers + if (error && error.headers) { + setHeaders(res, error.headers) + } + + // send basic response + res.statusCode = status + res.setHeader('Content-Type', 'text/plain; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(msg)) + res.setHeader('X-Content-Type-Options', 'nosniff') + res.end(msg) +} + +/** + * Check if the pathname ends with "/". + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.hasTrailingSlash = function hasTrailingSlash () { + return this.path[this.path.length - 1] === '/' +} + +/** + * Check if this is a conditional GET request. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isConditionalGET = function isConditionalGET () { + return this.req.headers['if-none-match'] || + this.req.headers['if-modified-since'] +} + +/** + * Strip content-* header fields. + * + * @private + */ + +SendStream.prototype.removeContentHeaderFields = function removeContentHeaderFields () { + var res = this.res + var headers = Object.keys(res._headers || {}) + + for (var i = 0; i < headers.length; i++) { + var header = headers[i] + if (header.substr(0, 8) === 'content-' && header !== 'content-location') { + res.removeHeader(header) + } + } +} + +/** + * Respond with 304 not modified. + * + * @api private + */ + +SendStream.prototype.notModified = function notModified () { + var res = this.res + debug('not modified') + this.removeContentHeaderFields() + res.statusCode = 304 + res.end() +} + +/** + * Raise error that headers already sent. + * + * @api private + */ + +SendStream.prototype.headersAlreadySent = function headersAlreadySent () { + var err = new Error('Can\'t set headers after they are sent.') + debug('headers already sent') + this.error(500, err) +} + +/** + * Check if the request is cacheable, aka + * responded with 2xx or 304 (see RFC 2616 section 14.2{5,6}). + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isCachable = function isCachable () { + var statusCode = this.res.statusCode + return (statusCode >= 200 && statusCode < 300) || + statusCode === 304 +} + +/** + * Handle stat() error. + * + * @param {Error} error + * @private + */ + +SendStream.prototype.onStatError = function onStatError (error) { + switch (error.code) { + case 'ENAMETOOLONG': + case 'ENOENT': + case 'ENOTDIR': + this.error(404, error) + break + default: + this.error(500, error) + break + } +} + +/** + * Check if the cache is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isFresh = function isFresh () { + return fresh(this.req.headers, this.res._headers) +} + +/** + * Check if the range is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isRangeFresh = function isRangeFresh () { + var ifRange = this.req.headers['if-range'] + + if (!ifRange) { + return true + } + + return ~ifRange.indexOf('"') + ? ~ifRange.indexOf(this.res._headers['etag']) + : Date.parse(this.res._headers['last-modified']) <= Date.parse(ifRange) +} + +/** + * Redirect to path. + * + * @param {string} path + * @private + */ + +SendStream.prototype.redirect = function redirect (path) { + if (listenerCount(this, 'directory') !== 0) { + this.emit('directory') + return + } + + if (this.hasTrailingSlash()) { + this.error(403) + return + } + + var loc = encodeUrl(collapseLeadingSlashes(path + '/')) + var msg = 'Redirecting to ' + escapeHtml(loc) + '\n' + var res = this.res + + // redirect + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(msg)) + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(msg) +} + +/** + * Pipe to `res. + * + * @param {Stream} res + * @return {Stream} res + * @api public + */ + +SendStream.prototype.pipe = function pipe (res) { + // root path + var root = this._root + + // references + this.res = res + + // decode the path + var path = decode(this.path) + if (path === -1) { + this.error(400) + return res + } + + // null byte(s) + if (~path.indexOf('\0')) { + this.error(400) + return res + } + + var parts + if (root !== null) { + // malicious path + if (UP_PATH_REGEXP.test(normalize('.' + sep + path))) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // join / normalize from optional root dir + path = normalize(join(root, path)) + root = normalize(root + sep) + + // explode path parts + parts = path.substr(root.length).split(sep) + } else { + // ".." is malicious without "root" + if (UP_PATH_REGEXP.test(path)) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // explode path parts + parts = normalize(path).split(sep) + + // resolve the path + path = resolve(path) + } + + // dotfile handling + if (containsDotFile(parts)) { + var access = this._dotfiles + + // legacy support + if (access === undefined) { + access = parts[parts.length - 1][0] === '.' + ? (this._hidden ? 'allow' : 'ignore') + : 'allow' + } + + debug('%s dotfile "%s"', access, path) + switch (access) { + case 'allow': + break + case 'deny': + this.error(403) + return res + case 'ignore': + default: + this.error(404) + return res + } + } + + // index file support + if (this._index.length && this.path[this.path.length - 1] === '/') { + this.sendIndex(path) + return res + } + + this.sendFile(path) + return res +} + +/** + * Transfer `path`. + * + * @param {String} path + * @api public + */ + +SendStream.prototype.send = function send (path, stat) { + var len = stat.size + var options = this.options + var opts = {} + var res = this.res + var req = this.req + var ranges = req.headers.range + var offset = options.start || 0 + + if (res._header) { + // impossible to send now + this.headersAlreadySent() + return + } + + debug('pipe "%s"', path) + + // set header fields + this.setHeader(path, stat) + + // set content-type + this.type(path) + + // conditional GET support + if (this.isConditionalGET() && this.isCachable() && this.isFresh()) { + this.notModified() + return + } + + // adjust len to start/end options + len = Math.max(0, len - offset) + if (options.end !== undefined) { + var bytes = options.end - offset + 1 + if (len > bytes) len = bytes + } + + // Range support + if (this._acceptRanges && BYTES_RANGE_REGEXP.test(ranges)) { + // parse + ranges = parseRange(len, ranges, { + combine: true + }) + + // If-Range support + if (!this.isRangeFresh()) { + debug('range stale') + ranges = -2 + } + + // unsatisfiable + if (ranges === -1) { + debug('range unsatisfiable') + + // Content-Range + res.setHeader('Content-Range', contentRange('bytes', len)) + + // 416 Requested Range Not Satisfiable + return this.error(416, { + headers: {'Content-Range': res.getHeader('Content-Range')} + }) + } + + // valid (syntactically invalid/multiple ranges are treated as a regular response) + if (ranges !== -2 && ranges.length === 1) { + debug('range %j', ranges) + + // Content-Range + res.statusCode = 206 + res.setHeader('Content-Range', contentRange('bytes', len, ranges[0])) + + // adjust for requested range + offset += ranges[0].start + len = ranges[0].end - ranges[0].start + 1 + } + } + + // clone options + for (var prop in options) { + opts[prop] = options[prop] + } + + // set read options + opts.start = offset + opts.end = Math.max(offset, offset + len - 1) + + // content-length + res.setHeader('Content-Length', len) + + // HEAD support + if (req.method === 'HEAD') { + res.end() + return + } + + this.stream(path, opts) +} + +/** + * Transfer file for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendFile = function sendFile (path) { + var i = 0 + var self = this + + debug('stat "%s"', path) + fs.stat(path, function onstat (err, stat) { + if (err && err.code === 'ENOENT' && !extname(path) && path[path.length - 1] !== sep) { + // not found, check extensions + return next(err) + } + if (err) return self.onStatError(err) + if (stat.isDirectory()) return self.redirect(self.path) + self.emit('file', path, stat) + self.send(path, stat) + }) + + function next (err) { + if (self._extensions.length <= i) { + return err + ? self.onStatError(err) + : self.error(404) + } + + var p = path + '.' + self._extensions[i++] + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } +} + +/** + * Transfer index for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendIndex = function sendIndex (path) { + var i = -1 + var self = this + + function next (err) { + if (++i >= self._index.length) { + if (err) return self.onStatError(err) + return self.error(404) + } + + var p = join(path, self._index[i]) + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } + + next() +} + +/** + * Stream `path` to the response. + * + * @param {String} path + * @param {Object} options + * @api private + */ + +SendStream.prototype.stream = function stream (path, options) { + // TODO: this is all lame, refactor meeee + var finished = false + var self = this + var res = this.res + + // pipe + var stream = fs.createReadStream(path, options) + this.emit('stream', stream) + stream.pipe(res) + + // response finished, done with the fd + onFinished(res, function onfinished () { + finished = true + destroy(stream) + }) + + // error handling code-smell + stream.on('error', function onerror (err) { + // request already finished + if (finished) return + + // clean up stream + finished = true + destroy(stream) + + // error + self.onStatError(err) + }) + + // end + stream.on('end', function onend () { + self.emit('end') + }) +} + +/** + * Set content-type based on `path` + * if it hasn't been explicitly set. + * + * @param {String} path + * @api private + */ + +SendStream.prototype.type = function type (path) { + var res = this.res + + if (res.getHeader('Content-Type')) return + + var type = mime.lookup(path) + + if (!type) { + debug('no content-type') + return + } + + var charset = mime.charsets.lookup(type) + + debug('content-type %s', type) + res.setHeader('Content-Type', type + (charset ? '; charset=' + charset : '')) +} + +/** + * Set response header fields, most + * fields may be pre-defined. + * + * @param {String} path + * @param {Object} stat + * @api private + */ + +SendStream.prototype.setHeader = function setHeader (path, stat) { + var res = this.res + + this.emit('headers', res, path, stat) + + if (this._acceptRanges && !res.getHeader('Accept-Ranges')) { + debug('accept ranges') + res.setHeader('Accept-Ranges', 'bytes') + } + + if (this._cacheControl && !res.getHeader('Cache-Control')) { + var cacheControl = 'public, max-age=' + Math.floor(this._maxage / 1000) + debug('cache-control %s', cacheControl) + res.setHeader('Cache-Control', cacheControl) + } + + if (this._lastModified && !res.getHeader('Last-Modified')) { + var modified = stat.mtime.toUTCString() + debug('modified %s', modified) + res.setHeader('Last-Modified', modified) + } + + if (this._etag && !res.getHeader('ETag')) { + var val = etag(stat) + debug('etag %s', val) + res.setHeader('ETag', val) + } +} + +/** + * Clear all headers from a response. + * + * @param {object} res + * @private + */ + +function clearHeaders (res) { + res._headers = {} + res._headerNames = {} +} + +/** + * Collapse all leading slashes into a single slash + * + * @param {string} str + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str[i] !== '/') { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Determine if path parts contain a dotfile. + * + * @api private + */ + +function containsDotFile (parts) { + for (var i = 0; i < parts.length; i++) { + if (parts[i][0] === '.') { + return true + } + } + + return false +} + +/** + * Create a Content-Range header. + * + * @param {string} type + * @param {number} size + * @param {array} [range] + */ + +function contentRange (type, size, range) { + return type + ' ' + (range ? range.start + '-' + range.end : '*') + '/' + size +} + +/** + * decodeURIComponent. + * + * Allows V8 to only deoptimize this fn instead of all + * of send(). + * + * @param {String} path + * @api private + */ + +function decode (path) { + try { + return decodeURIComponent(path) + } catch (err) { + return -1 + } +} + +/** + * Normalize the index option into an array. + * + * @param {boolean|string|array} val + * @param {string} name + * @private + */ + +function normalizeList (val, name) { + var list = [].concat(val || []) + + for (var i = 0; i < list.length; i++) { + if (typeof list[i] !== 'string') { + throw new TypeError(name + ' must be array of strings or false') + } + } + + return list +} + +/** + * Set an object of headers on a response. + * + * @param {object} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + var keys = Object.keys(headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/node_modules/send/node_modules/ms/LICENSE.md b/node_modules/send/node_modules/ms/LICENSE.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/node_modules/send/node_modules/ms/LICENSE.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/send/node_modules/ms/README.md b/node_modules/send/node_modules/ms/README.md new file mode 100644 index 0000000..5b47570 --- /dev/null +++ b/node_modules/send/node_modules/ms/README.md @@ -0,0 +1,52 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![XO code style](https://img.shields.io/badge/code_style-XO-5ed9c7.svg)](https://github.com/sindresorhus/xo) +[![Slack Channel](https://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/send/node_modules/ms/index.js b/node_modules/send/node_modules/ms/index.js new file mode 100644 index 0000000..824b37e --- /dev/null +++ b/node_modules/send/node_modules/ms/index.js @@ -0,0 +1,149 @@ +/** + * Helpers. + */ + +var s = 1000 +var m = s * 60 +var h = m * 60 +var d = h * 24 +var y = d * 365.25 + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} options + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function (val, options) { + options = options || {} + var type = typeof val + if (type === 'string' && val.length > 0) { + return parse(val) + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? + fmtLong(val) : + fmtShort(val) + } + throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val)) +} + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str) + if (str.length > 10000) { + return + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str) + if (!match) { + return + } + var n = parseFloat(match[1]) + var type = (match[2] || 'ms').toLowerCase() + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y + case 'days': + case 'day': + case 'd': + return n * d + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n + default: + return undefined + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd' + } + if (ms >= h) { + return Math.round(ms / h) + 'h' + } + if (ms >= m) { + return Math.round(ms / m) + 'm' + } + if (ms >= s) { + return Math.round(ms / s) + 's' + } + return ms + 'ms' +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms' +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name + } + return Math.ceil(ms / n) + ' ' + name + 's' +} diff --git a/node_modules/send/node_modules/ms/package.json b/node_modules/send/node_modules/ms/package.json new file mode 100644 index 0000000..8b0b0b4 --- /dev/null +++ b/node_modules/send/node_modules/ms/package.json @@ -0,0 +1,108 @@ +{ + "_args": [ + [ + { + "raw": "ms@0.7.2", + "scope": null, + "escapedName": "ms", + "name": "ms", + "rawSpec": "0.7.2", + "spec": "0.7.2", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/send" + ] + ], + "_from": "ms@0.7.2", + "_id": "ms@0.7.2", + "_inCache": true, + "_location": "/send/ms", + "_nodeVersion": "6.8.0", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/ms-0.7.2.tgz_1477383407940_0.4743474116548896" + }, + "_npmUser": { + "name": "leo", + "email": "leo@zeit.co" + }, + "_npmVersion": "3.10.8", + "_phantomChildren": {}, + "_requested": { + "raw": "ms@0.7.2", + "scope": null, + "escapedName": "ms", + "name": "ms", + "rawSpec": "0.7.2", + "spec": "0.7.2", + "type": "version" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz", + "_shasum": "ae25cf2512b3885a1d95d7f037868d8431124765", + "_shrinkwrap": null, + "_spec": "ms@0.7.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/send", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "component": { + "scripts": { + "ms/index.js": "index.js" + } + }, + "dependencies": {}, + "description": "Tiny milisecond conversion utility", + "devDependencies": { + "expect.js": "^0.3.1", + "mocha": "^3.0.2", + "serve": "^1.4.0", + "xo": "^0.17.0" + }, + "directories": {}, + "dist": { + "shasum": "ae25cf2512b3885a1d95d7f037868d8431124765", + "tarball": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz" + }, + "files": [ + "index.js" + ], + "gitHead": "ac92a7e0790ba2622a74d9d60690ca0d2c070a45", + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "main": "./index", + "maintainers": [ + { + "name": "leo", + "email": "leo@zeit.co" + }, + { + "name": "rauchg", + "email": "rauchg@gmail.com" + } + ], + "name": "ms", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "test": "xo && mocha test/index.js", + "test-browser": "serve ./test" + }, + "version": "0.7.2", + "xo": { + "space": true, + "semicolon": false, + "envs": [ + "mocha" + ], + "rules": { + "complexity": 0 + } + } +} diff --git a/node_modules/send/package.json b/node_modules/send/package.json new file mode 100644 index 0000000..ffa5906 --- /dev/null +++ b/node_modules/send/package.json @@ -0,0 +1,130 @@ +{ + "_args": [ + [ + { + "raw": "send@0.14.2", + "scope": null, + "escapedName": "send", + "name": "send", + "rawSpec": "0.14.2", + "spec": "0.14.2", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "send@0.14.2", + "_id": "send@0.14.2", + "_inCache": true, + "_location": "/send", + "_nodeVersion": "4.6.0", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/send-0.14.2.tgz_1485185381110_0.5022726391907781" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "send@0.14.2", + "scope": null, + "escapedName": "send", + "name": "send", + "rawSpec": "0.14.2", + "spec": "0.14.2", + "type": "version" + }, + "_requiredBy": [ + "/express", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/send/-/send-0.14.2.tgz", + "_shasum": "39b0438b3f510be5dc6f667a11f71689368cdeef", + "_shrinkwrap": null, + "_spec": "send@0.14.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/pillarjs/send/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": { + "debug": "~2.2.0", + "depd": "~1.1.0", + "destroy": "~1.0.4", + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "etag": "~1.7.0", + "fresh": "0.3.0", + "http-errors": "~1.5.1", + "mime": "1.3.4", + "ms": "0.7.2", + "on-finished": "~2.3.0", + "range-parser": "~1.2.0", + "statuses": "~1.3.1" + }, + "description": "Better streaming static file server with Range and conditional-GET support", + "devDependencies": { + "after": "0.8.2", + "eslint": "2.11.1", + "eslint-config-standard": "5.3.1", + "eslint-plugin-promise": "1.3.1", + "eslint-plugin-standard": "1.3.2", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "directories": {}, + "dist": { + "shasum": "39b0438b3f510be5dc6f667a11f71689368cdeef", + "tarball": "https://registry.npmjs.org/send/-/send-0.14.2.tgz" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "gitHead": "f3397bc0170fb9f2d84c45e81981dff6e58e102d", + "homepage": "https://github.com/pillarjs/send#readme", + "keywords": [ + "static", + "file", + "server" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "send", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/send.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec --bail", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot" + }, + "version": "0.14.2" +} diff --git a/node_modules/serve-static/HISTORY.md b/node_modules/serve-static/HISTORY.md new file mode 100644 index 0000000..b8201f3 --- /dev/null +++ b/node_modules/serve-static/HISTORY.md @@ -0,0 +1,340 @@ +1.11.2 / 2017-01-23 +=================== + + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + +1.11.1 / 2016-06-10 +=================== + + * Fix redirect error when `req.url` contains raw non-URL characters + * deps: send@0.14.1 + +1.11.0 / 2016-06-07 +=================== + + * Use status code 301 for redirects + * deps: send@0.14.0 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + +1.10.3 / 2016-05-30 +=================== + + * deps: send@0.13.2 + - Fix invalid `Content-Type` header when `send.mime.default_type` unset + +1.10.2 / 2016-01-19 +=================== + + * deps: parseurl@~1.3.1 + - perf: enable strict mode + +1.10.1 / 2016-01-16 +=================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + +1.10.0 / 2015-06-17 +=================== + + * Add `fallthrough` option + - Allows declaring this middleware is the final destination + - Provides better integration with Express patterns + * Fix reading options from options prototype + * Improve the default redirect response headers + * deps: escape-html@1.0.2 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * perf: enable strict mode + * perf: remove argument reassignment + +1.9.3 / 2015-05-14 +================== + + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +1.9.2 / 2015-03-14 +================== + + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +1.9.1 / 2015-02-17 +================== + + * deps: send@0.12.1 + - Fix regression sending zero-length files + +1.9.0 / 2015-02-16 +================== + + * deps: send@0.12.0 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +1.8.1 / 2015-01-20 +================== + + * Fix redirect loop in Node.js 0.11.14 + * deps: send@0.11.1 + - Fix root path disclosure + +1.8.0 / 2015-01-05 +================== + + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +1.7.2 / 2015-01-02 +================== + + * Fix potential open redirect when mounted at root + +1.7.1 / 2014-10-22 +================== + + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +1.7.0 / 2014-10-15 +================== + + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +1.6.5 / 2015-02-04 +================== + + * Fix potential open redirect when mounted at root + - Back-ported from v1.7.2 + +1.6.4 / 2014-10-08 +================== + + * Fix redirect loop when index file serving disabled + +1.6.3 / 2014-09-24 +================== + + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +1.6.2 / 2014-09-15 +================== + + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +1.6.1 / 2014-09-07 +================== + + * deps: send@0.9.1 + - deps: fresh@0.2.4 + +1.6.0 / 2014-09-07 +================== + + * deps: send@0.9.0 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + +1.5.4 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +1.5.3 / 2014-08-17 +================== + + * deps: send@0.8.3 + +1.5.2 / 2014-08-14 +================== + + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +1.5.1 / 2014-08-09 +================== + + * Fix parsing of weird `req.originalUrl` values + * deps: parseurl@~1.3.0 + * deps: utils-merge@1.0.0 + +1.5.0 / 2014-08-05 +================== + + * deps: send@0.8.1 + - Add `extensions` option + +1.4.4 / 2014-08-04 +================== + + * deps: send@0.7.4 + - Fix serving index files without root dir + +1.4.3 / 2014-07-29 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + +1.4.2 / 2014-07-27 +================== + + * deps: send@0.7.2 + - deps: depd@0.4.4 + +1.4.1 / 2014-07-26 +================== + + * deps: send@0.7.1 + - deps: depd@0.4.3 + +1.4.0 / 2014-07-21 +================== + + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +1.3.2 / 2014-07-11 +================== + + * deps: send@0.6.0 + - Cap `maxAge` value to 1 year + - deps: debug@1.0.3 + +1.3.1 / 2014-07-09 +================== + + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +1.3.0 / 2014-06-28 +================== + + * Add `setHeaders` option + * Include HTML link in redirect response + * deps: send@0.5.0 + - Accept string for `maxAge` (converted by `ms`) + +1.2.3 / 2014-06-11 +================== + + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +1.2.2 / 2014-06-09 +================== + + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + +1.2.1 / 2014-06-02 +================== + + * use `escape-html` for escaping + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +1.2.0 / 2014-05-29 +================== + + * deps: send@0.4.0 + - Calculate ETag with md5 for reduced collisions + - Fix wrong behavior when index file matches directory + - Ignore stream errors after request ends + - Skip directories in index file search + - deps: debug@0.8.1 + +1.1.0 / 2014-04-24 +================== + + * Accept options directly to `send` module + * deps: send@0.3.0 + +1.0.4 / 2014-04-07 +================== + + * Resolve relative paths at middleware setup + * Use parseurl to parse the URL from request + +1.0.3 / 2014-03-20 +================== + + * Do not rely on connect-like environments + +1.0.2 / 2014-03-06 +================== + + * deps: send@0.2.0 + +1.0.1 / 2014-03-05 +================== + + * Add mime export for back-compat + +1.0.0 / 2014-03-05 +================== + + * Genesis from `connect` diff --git a/node_modules/serve-static/LICENSE b/node_modules/serve-static/LICENSE new file mode 100644 index 0000000..cbe62e8 --- /dev/null +++ b/node_modules/serve-static/LICENSE @@ -0,0 +1,25 @@ +(The MIT License) + +Copyright (c) 2010 Sencha Inc. +Copyright (c) 2011 LearnBoost +Copyright (c) 2011 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/serve-static/README.md b/node_modules/serve-static/README.md new file mode 100644 index 0000000..6fef5d9 --- /dev/null +++ b/node_modules/serve-static/README.md @@ -0,0 +1,249 @@ +# serve-static + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![Gratipay][gratipay-image]][gratipay-url] + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install serve-static +``` + +## API + +```js +var serveStatic = require('serve-static') +``` + +### serveStatic(root, options) + +Create a new middleware function to serve files from within a given root +directory. The file to serve will be determined by combining `req.url` +with the provided root directory. When a file is not found, instead of +sending a 404 response, this module will instead call `next()` to move on +to the next middleware, allowing for stacking and fall-backs. + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `maxAge` option. + +##### dotfiles + + Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Deny a request for a dotfile and 403/`next()`. + - `'ignore'` Pretend like the dotfile does not exist and 404/`next()`. + +The default value is similar to `'ignore'`, with the exception that this +default will not ignore the files within a directory that begins with a dot. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +Set file extension fallbacks. When set, if a file is not found, the given +extensions will be added to the file name and search for. The first that +exists will be served. Example: `['html', 'htm']`. + +The default value is `false`. + +##### fallthrough + +Set the middleware to have client errors fall-through as just unhandled +requests, otherwise forward a client error. The difference is that client +errors like a bad request or a request to a non-existent file will cause +this middleware to simply `next()` to your next middleware when this value +is `true`. When this value is `false`, these errors (even 404s), will invoke +`next(err)`. + +Typically `true` is desired such that multiple physical directories can be +mapped to the same web address or for routes to fill in non-existent files. + +The value `false` can be used if this middleware is mounted at a path that +is designed to be strictly a single file system directory, which allows for +short-circuiting 404s for less overhead. This middleware will also reply to +all methods. + +The default value is `true`. + +##### index + +By default this module will send "index.html" files in response to a request +on a directory. To disable this set `false` or to supply a new index pass a +string or an array in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. This +can also be a string accepted by the [ms](https://www.npmjs.org/package/ms#readme) +module. + +##### redirect + +Redirect to trailing "/" when the pathname is a dir. Defaults to `true`. + +##### setHeaders + +Function to set custom headers on response. Alterations to the headers need to +occur synchronously. The function is called as `fn(res, path, stat)`, where +the arguments are: + + - `res` the response object + - `path` the file path that is being sent + - `stat` the stat object of the file that is being sent + +## Examples + +### Serve files with vanilla node.js http server + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', {'index': ['index.html', 'index.htm']}) + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serve all files as downloads + +```js +var contentDisposition = require('content-disposition') +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', { + 'index': false, + 'setHeaders': setHeaders +}) + +// Set header to force download +function setHeaders(res, path) { + res.setHeader('Content-Disposition', contentDisposition(path)) +} + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serving using express + +#### Simple + +This is a simple example of using Express. + +```js +var express = require('express') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic('public/ftp', {'index': ['default.html', 'default.htm']})) +app.listen(3000) +``` + +#### Multiple roots + +This example shows a simple way to search through multiple directories. +Files are look for in `public-optimized/` first, then `public/` second as +a fallback. + +```js +var express = require('express') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(__dirname + '/public-optimized')) +app.use(serveStatic(__dirname + '/public')) +app.listen(3000) +``` + +#### Different settings for paths + +This example shows how to set a different max age depending on the served +file type. In this example, HTML files are not cached, while everything else +is for 1 day. + +```js +var express = require('express') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(__dirname + '/public', { + maxAge: '1d', + setHeaders: setCustomCacheControl +})) + +app.listen(3000) + +function setCustomCacheControl (res, path) { + if (serveStatic.mime.lookup(path) === 'text/html') { + // Custom Cache-Control for HTML files + res.setHeader('Cache-Control', 'public, max-age=0') + } +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/serve-static.svg +[npm-url]: https://npmjs.org/package/serve-static +[travis-image]: https://img.shields.io/travis/expressjs/serve-static/master.svg?label=linux +[travis-url]: https://travis-ci.org/expressjs/serve-static +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/serve-static/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/serve-static +[coveralls-image]: https://img.shields.io/coveralls/expressjs/serve-static/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/serve-static +[downloads-image]: https://img.shields.io/npm/dm/serve-static.svg +[downloads-url]: https://npmjs.org/package/serve-static +[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg +[gratipay-url]: https://gratipay.com/dougwilson/ diff --git a/node_modules/serve-static/index.js b/node_modules/serve-static/index.js new file mode 100644 index 0000000..83c5e4f --- /dev/null +++ b/node_modules/serve-static/index.js @@ -0,0 +1,188 @@ +/*! + * serve-static + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var parseUrl = require('parseurl') +var resolve = require('path').resolve +var send = require('send') +var url = require('url') + +/** + * Module exports. + * @public + */ + +module.exports = serveStatic +module.exports.mime = send.mime + +/** + * @param {string} root + * @param {object} [options] + * @return {function} + * @public + */ + +function serveStatic (root, options) { + if (!root) { + throw new TypeError('root path required') + } + + if (typeof root !== 'string') { + throw new TypeError('root path must be a string') + } + + // copy options object + var opts = Object.create(options || null) + + // fall-though + var fallthrough = opts.fallthrough !== false + + // default redirect + var redirect = opts.redirect !== false + + // headers listener + var setHeaders = opts.setHeaders + + if (setHeaders && typeof setHeaders !== 'function') { + throw new TypeError('option setHeaders must be function') + } + + // setup options for send + opts.maxage = opts.maxage || opts.maxAge || 0 + opts.root = resolve(root) + + // construct directory listener + var onDirectory = redirect + ? createRedirectDirectoryListener() + : createNotFoundDirectoryListener() + + return function serveStatic (req, res, next) { + if (req.method !== 'GET' && req.method !== 'HEAD') { + if (fallthrough) { + return next() + } + + // method not allowed + res.statusCode = 405 + res.setHeader('Allow', 'GET, HEAD') + res.setHeader('Content-Length', '0') + res.end() + return + } + + var forwardError = !fallthrough + var originalUrl = parseUrl.original(req) + var path = parseUrl(req).pathname + + // make sure redirect occurs at mount + if (path === '/' && originalUrl.pathname.substr(-1) !== '/') { + path = '' + } + + // create send stream + var stream = send(req, path, opts) + + // add directory handler + stream.on('directory', onDirectory) + + // add headers listener + if (setHeaders) { + stream.on('headers', setHeaders) + } + + // add file listener for fallthrough + if (fallthrough) { + stream.on('file', function onFile () { + // once file is determined, always forward error + forwardError = true + }) + } + + // forward errors + stream.on('error', function error (err) { + if (forwardError || !(err.statusCode < 500)) { + next(err) + return + } + + next() + }) + + // pipe + stream.pipe(res) + } +} + +/** + * Collapse all leading slashes into a single slash + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str[i] !== '/') { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Create a directory listener that just 404s. + * @private + */ + +function createNotFoundDirectoryListener () { + return function notFound () { + this.error(404) + } +} + +/** + * Create a directory listener that performs a redirect. + * @private + */ + +function createRedirectDirectoryListener () { + return function redirect () { + if (this.hasTrailingSlash()) { + this.error(404) + return + } + + // get original URL + var originalUrl = parseUrl.original(this.req) + + // append trailing slash + originalUrl.path = null + originalUrl.pathname = collapseLeadingSlashes(originalUrl.pathname + '/') + + // reformat the URL + var loc = encodeUrl(url.format(originalUrl)) + var msg = 'Redirecting to ' + escapeHtml(loc) + '\n' + var res = this.res + + // send redirect response + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(msg)) + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(msg) + } +} diff --git a/node_modules/serve-static/package.json b/node_modules/serve-static/package.json new file mode 100644 index 0000000..e9e9ff6 --- /dev/null +++ b/node_modules/serve-static/package.json @@ -0,0 +1,107 @@ +{ + "_args": [ + [ + { + "raw": "serve-static@~1.11.2", + "scope": null, + "escapedName": "serve-static", + "name": "serve-static", + "rawSpec": "~1.11.2", + "spec": ">=1.11.2 <1.12.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "serve-static@>=1.11.2 <1.12.0", + "_id": "serve-static@1.11.2", + "_inCache": true, + "_location": "/serve-static", + "_nodeVersion": "4.6.0", + "_npmOperationalInternal": { + "host": "packages-18-east.internal.npmjs.com", + "tmp": "tmp/serve-static-1.11.2.tgz_1485190261958_0.8670230756979436" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "2.15.9", + "_phantomChildren": {}, + "_requested": { + "raw": "serve-static@~1.11.2", + "scope": null, + "escapedName": "serve-static", + "name": "serve-static", + "rawSpec": "~1.11.2", + "spec": ">=1.11.2 <1.12.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.11.2.tgz", + "_shasum": "2cf9889bd4435a320cc36895c9aa57bd662e6ac7", + "_shrinkwrap": null, + "_spec": "serve-static@~1.11.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/expressjs/serve-static/issues" + }, + "dependencies": { + "encodeurl": "~1.0.1", + "escape-html": "~1.0.3", + "parseurl": "~1.3.1", + "send": "0.14.2" + }, + "description": "Serve static files", + "devDependencies": { + "eslint": "3.14.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.4.0", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "directories": {}, + "dist": { + "shasum": "2cf9889bd4435a320cc36895c9aa57bd662e6ac7", + "tarball": "https://registry.npmjs.org/serve-static/-/serve-static-1.11.2.tgz" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "gitHead": "01f2a83d7456ef03a89e8c951c757dd79ae92522", + "homepage": "https://github.com/expressjs/serve-static#readme", + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "serve-static", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/serve-static.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.11.2" +} diff --git a/node_modules/setprototypeof/LICENSE b/node_modules/setprototypeof/LICENSE new file mode 100644 index 0000000..61afa2f --- /dev/null +++ b/node_modules/setprototypeof/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2015, Wes Todd + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION +OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN +CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/setprototypeof/README.md b/node_modules/setprototypeof/README.md new file mode 100644 index 0000000..01d7947 --- /dev/null +++ b/node_modules/setprototypeof/README.md @@ -0,0 +1,21 @@ +# Polyfill for `Object.setPrototypeOf` + +A simple cross platform implementation to set the prototype of an instianted object. Supports all modern browsers and at least back to IE8. + +## Usage: + +``` +$ npm install --save setprototypeof +``` + +```javascript +var setPrototypeOf = require('setprototypeof'); + +var obj = {}; +setPrototypeOf(obj, { + foo: function() { + return 'bar'; + } +}); +obj.foo(); // bar +``` diff --git a/node_modules/setprototypeof/index.js b/node_modules/setprototypeof/index.js new file mode 100644 index 0000000..b762a7c --- /dev/null +++ b/node_modules/setprototypeof/index.js @@ -0,0 +1,13 @@ +module.exports = Object.setPrototypeOf || ({__proto__:[]} instanceof Array ? setProtoOf : mixinProperties); + +function setProtoOf(obj, proto) { + obj.__proto__ = proto; + return obj; +} + +function mixinProperties(obj, proto) { + for (var prop in proto) { + obj[prop] = proto[prop]; + } + return obj; +} diff --git a/node_modules/setprototypeof/package.json b/node_modules/setprototypeof/package.json new file mode 100644 index 0000000..122c372 --- /dev/null +++ b/node_modules/setprototypeof/package.json @@ -0,0 +1,88 @@ +{ + "_args": [ + [ + { + "raw": "setprototypeof@1.0.2", + "scope": null, + "escapedName": "setprototypeof", + "name": "setprototypeof", + "rawSpec": "1.0.2", + "spec": "1.0.2", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/http-errors" + ] + ], + "_from": "setprototypeof@1.0.2", + "_id": "setprototypeof@1.0.2", + "_inCache": true, + "_location": "/setprototypeof", + "_nodeVersion": "7.0.0", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/setprototypeof-1.0.2.tgz_1479056139581_0.43114364007487893" + }, + "_npmUser": { + "name": "wesleytodd", + "email": "wes@wesleytodd.com" + }, + "_npmVersion": "3.10.8", + "_phantomChildren": {}, + "_requested": { + "raw": "setprototypeof@1.0.2", + "scope": null, + "escapedName": "setprototypeof", + "name": "setprototypeof", + "rawSpec": "1.0.2", + "spec": "1.0.2", + "type": "version" + }, + "_requiredBy": [ + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.2.tgz", + "_shasum": "81a552141ec104b88e89ce383103ad5c66564d08", + "_shrinkwrap": null, + "_spec": "setprototypeof@1.0.2", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/http-errors", + "author": { + "name": "Wes Todd" + }, + "bugs": { + "url": "https://github.com/wesleytodd/setprototypeof/issues" + }, + "dependencies": {}, + "description": "A small polyfill for Object.setprototypeof", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "81a552141ec104b88e89ce383103ad5c66564d08", + "tarball": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.2.tgz" + }, + "gitHead": "34da239ae7ab69b7b42791d5b928379ce51a0ff2", + "homepage": "https://github.com/wesleytodd/setprototypeof", + "keywords": [ + "polyfill", + "object", + "setprototypeof" + ], + "license": "ISC", + "main": "index.js", + "maintainers": [ + { + "name": "wesleytodd", + "email": "wes@wesleytodd.com" + } + ], + "name": "setprototypeof", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/wesleytodd/setprototypeof.git" + }, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "version": "1.0.2" +} diff --git a/node_modules/statuses/HISTORY.md b/node_modules/statuses/HISTORY.md new file mode 100644 index 0000000..3015a5f --- /dev/null +++ b/node_modules/statuses/HISTORY.md @@ -0,0 +1,55 @@ +1.3.1 / 2016-11-11 +================== + + * Fix return type in JSDoc + +1.3.0 / 2016-05-17 +================== + + * Add `421 Misdirected Request` + * perf: enable strict mode + +1.2.1 / 2015-02-01 +================== + + * Fix message for status 451 + - `451 Unavailable For Legal Reasons` + +1.2.0 / 2014-09-28 +================== + + * Add `208 Already Repored` + * Add `226 IM Used` + * Add `306 (Unused)` + * Add `415 Unable For Legal Reasons` + * Add `508 Loop Detected` + +1.1.1 / 2014-09-24 +================== + + * Add missing 308 to `codes.json` + +1.1.0 / 2014-09-21 +================== + + * Add `codes.json` for universal support + +1.0.4 / 2014-08-20 +================== + + * Package cleanup + +1.0.3 / 2014-06-08 +================== + + * Add 308 to `.redirect` category + +1.0.2 / 2014-03-13 +================== + + * Add `.retry` category + +1.0.1 / 2014-03-12 +================== + + * Initial release diff --git a/node_modules/statuses/LICENSE b/node_modules/statuses/LICENSE new file mode 100644 index 0000000..82af4df --- /dev/null +++ b/node_modules/statuses/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2016 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/statuses/README.md b/node_modules/statuses/README.md new file mode 100644 index 0000000..2bf0756 --- /dev/null +++ b/node_modules/statuses/README.md @@ -0,0 +1,103 @@ +# Statuses + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP status utility for node. + +## API + +```js +var status = require('statuses') +``` + +### var code = status(Integer || String) + +If `Integer` or `String` is a valid HTTP code or status message, then the appropriate `code` will be returned. Otherwise, an error will be thrown. + +```js +status(403) // => 403 +status('403') // => 403 +status('forbidden') // => 403 +status('Forbidden') // => 403 +status(306) // throws, as it's not supported by node.js +``` + +### status.codes + +Returns an array of all the status codes as `Integer`s. + +### var msg = status[code] + +Map of `code` to `status message`. `undefined` for invalid `code`s. + +```js +status[404] // => 'Not Found' +``` + +### var code = status[msg] + +Map of `status message` to `code`. `msg` can either be title-cased or lower-cased. `undefined` for invalid `status message`s. + +```js +status['not found'] // => 404 +status['Not Found'] // => 404 +``` + +### status.redirect[code] + +Returns `true` if a status code is a valid redirect status. + +```js +status.redirect[200] // => undefined +status.redirect[301] // => true +``` + +### status.empty[code] + +Returns `true` if a status code expects an empty body. + +```js +status.empty[200] // => undefined +status.empty[204] // => true +status.empty[304] // => true +``` + +### status.retry[code] + +Returns `true` if you should retry the rest. + +```js +status.retry[501] // => undefined +status.retry[503] // => true +``` + +## Adding Status Codes + +The status codes are primarily sourced from http://www.iana.org/assignments/http-status-codes/http-status-codes-1.csv. +Additionally, custom codes are added from http://en.wikipedia.org/wiki/List_of_HTTP_status_codes. +These are added manually in the `lib/*.json` files. +If you would like to add a status code, add it to the appropriate JSON file. + +To rebuild `codes.json`, run the following: + +```bash +# update src/iana.json +npm run fetch +# build codes.json +npm run build +``` + +[npm-image]: https://img.shields.io/npm/v/statuses.svg +[npm-url]: https://npmjs.org/package/statuses +[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/statuses.svg +[travis-url]: https://travis-ci.org/jshttp/statuses +[coveralls-image]: https://img.shields.io/coveralls/jshttp/statuses.svg +[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master +[downloads-image]: https://img.shields.io/npm/dm/statuses.svg +[downloads-url]: https://npmjs.org/package/statuses diff --git a/node_modules/statuses/codes.json b/node_modules/statuses/codes.json new file mode 100644 index 0000000..e765123 --- /dev/null +++ b/node_modules/statuses/codes.json @@ -0,0 +1,65 @@ +{ + "100": "Continue", + "101": "Switching Protocols", + "102": "Processing", + "200": "OK", + "201": "Created", + "202": "Accepted", + "203": "Non-Authoritative Information", + "204": "No Content", + "205": "Reset Content", + "206": "Partial Content", + "207": "Multi-Status", + "208": "Already Reported", + "226": "IM Used", + "300": "Multiple Choices", + "301": "Moved Permanently", + "302": "Found", + "303": "See Other", + "304": "Not Modified", + "305": "Use Proxy", + "306": "(Unused)", + "307": "Temporary Redirect", + "308": "Permanent Redirect", + "400": "Bad Request", + "401": "Unauthorized", + "402": "Payment Required", + "403": "Forbidden", + "404": "Not Found", + "405": "Method Not Allowed", + "406": "Not Acceptable", + "407": "Proxy Authentication Required", + "408": "Request Timeout", + "409": "Conflict", + "410": "Gone", + "411": "Length Required", + "412": "Precondition Failed", + "413": "Payload Too Large", + "414": "URI Too Long", + "415": "Unsupported Media Type", + "416": "Range Not Satisfiable", + "417": "Expectation Failed", + "418": "I'm a teapot", + "421": "Misdirected Request", + "422": "Unprocessable Entity", + "423": "Locked", + "424": "Failed Dependency", + "425": "Unordered Collection", + "426": "Upgrade Required", + "428": "Precondition Required", + "429": "Too Many Requests", + "431": "Request Header Fields Too Large", + "451": "Unavailable For Legal Reasons", + "500": "Internal Server Error", + "501": "Not Implemented", + "502": "Bad Gateway", + "503": "Service Unavailable", + "504": "Gateway Timeout", + "505": "HTTP Version Not Supported", + "506": "Variant Also Negotiates", + "507": "Insufficient Storage", + "508": "Loop Detected", + "509": "Bandwidth Limit Exceeded", + "510": "Not Extended", + "511": "Network Authentication Required" +} \ No newline at end of file diff --git a/node_modules/statuses/index.js b/node_modules/statuses/index.js new file mode 100644 index 0000000..9f955c6 --- /dev/null +++ b/node_modules/statuses/index.js @@ -0,0 +1,110 @@ +/*! + * statuses + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var codes = require('./codes.json') + +/** + * Module exports. + * @public + */ + +module.exports = status + +// array of status codes +status.codes = populateStatusesMap(status, codes) + +// status codes for redirects +status.redirect = { + 300: true, + 301: true, + 302: true, + 303: true, + 305: true, + 307: true, + 308: true +} + +// status codes for empty bodies +status.empty = { + 204: true, + 205: true, + 304: true +} + +// status codes for when you should retry the request +status.retry = { + 502: true, + 503: true, + 504: true +} + +/** + * Populate the statuses map for given codes. + * @private + */ + +function populateStatusesMap (statuses, codes) { + var arr = [] + + Object.keys(codes).forEach(function forEachCode (code) { + var message = codes[code] + var status = Number(code) + + // Populate properties + statuses[status] = message + statuses[message] = status + statuses[message.toLowerCase()] = status + + // Add to array + arr.push(status) + }) + + return arr +} + +/** + * Get the status code. + * + * Given a number, this will throw if it is not a known status + * code, otherwise the code will be returned. Given a string, + * the string will be parsed for a number and return the code + * if valid, otherwise will lookup the code assuming this is + * the status message. + * + * @param {string|number} code + * @returns {number} + * @public + */ + +function status (code) { + if (typeof code === 'number') { + if (!status[code]) throw new Error('invalid status code: ' + code) + return code + } + + if (typeof code !== 'string') { + throw new TypeError('code must be a number or string') + } + + // '403' + var n = parseInt(code, 10) + if (!isNaN(n)) { + if (!status[n]) throw new Error('invalid status code: ' + n) + return n + } + + n = status[code.toLowerCase()] + if (!n) throw new Error('invalid status message: "' + code + '"') + return n +} diff --git a/node_modules/statuses/package.json b/node_modules/statuses/package.json new file mode 100644 index 0000000..bd8c789 --- /dev/null +++ b/node_modules/statuses/package.json @@ -0,0 +1,140 @@ +{ + "_args": [ + [ + { + "raw": "statuses@~1.3.1", + "scope": null, + "escapedName": "statuses", + "name": "statuses", + "rawSpec": "~1.3.1", + "spec": ">=1.3.1 <1.4.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/finalhandler" + ] + ], + "_from": "statuses@>=1.3.1 <1.4.0", + "_id": "statuses@1.3.1", + "_inCache": true, + "_location": "/statuses", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/statuses-1.3.1.tgz_1478923281491_0.5574048184789717" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "statuses@~1.3.1", + "scope": null, + "escapedName": "statuses", + "name": "statuses", + "rawSpec": "~1.3.1", + "spec": ">=1.3.1 <1.4.0", + "type": "range" + }, + "_requiredBy": [ + "/finalhandler", + "/http-errors", + "/send" + ], + "_resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz", + "_shasum": "faf51b9eb74aaef3b3acf4ad5f61abf24cb7b93e", + "_shrinkwrap": null, + "_spec": "statuses@~1.3.1", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/finalhandler", + "bugs": { + "url": "https://github.com/jshttp/statuses/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": {}, + "description": "HTTP status utility", + "devDependencies": { + "csv-parse": "1.1.7", + "eslint": "3.10.0", + "eslint-config-standard": "6.2.1", + "eslint-plugin-promise": "3.3.2", + "eslint-plugin-standard": "2.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "stream-to-array": "2.3.0" + }, + "directories": {}, + "dist": { + "shasum": "faf51b9eb74aaef3b3acf4ad5f61abf24cb7b93e", + "tarball": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "index.js", + "codes.json", + "LICENSE" + ], + "gitHead": "28a619be77f5b4741e6578a5764c5b06ec6d4aea", + "homepage": "https://github.com/jshttp/statuses", + "keywords": [ + "http", + "status", + "code" + ], + "license": "MIT", + "maintainers": [ + { + "name": "defunctzombie", + "email": "shtylman@gmail.com" + }, + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "fishrock123", + "email": "fishrock123@rocketmail.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "mscdex", + "email": "mscdex@mscdex.net" + }, + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + } + ], + "name": "statuses", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/statuses.git" + }, + "scripts": { + "build": "node scripts/build.js", + "fetch": "node scripts/fetch.js", + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "update": "npm run fetch && npm run build" + }, + "version": "1.3.1" +} diff --git a/node_modules/type-is/HISTORY.md b/node_modules/type-is/HISTORY.md new file mode 100644 index 0000000..4f76fb4 --- /dev/null +++ b/node_modules/type-is/HISTORY.md @@ -0,0 +1,212 @@ +1.6.14 / 2016-11-18 +=================== + + * deps: mime-types@~2.1.13 + - Add new mime types + +1.6.13 / 2016-05-18 +=================== + + * deps: mime-types@~2.1.11 + - Add new mime types + +1.6.12 / 2016-02-28 +=================== + + * deps: mime-types@~2.1.10 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +1.6.11 / 2016-01-29 +=================== + + * deps: mime-types@~2.1.9 + - Add new mime types + +1.6.10 / 2015-12-01 +=================== + + * deps: mime-types@~2.1.8 + - Add new mime types + +1.6.9 / 2015-09-27 +================== + + * deps: mime-types@~2.1.7 + - Add new mime types + +1.6.8 / 2015-09-04 +================== + + * deps: mime-types@~2.1.6 + - Add new mime types + +1.6.7 / 2015-08-20 +================== + + * Fix type error when given invalid type to match against + * deps: mime-types@~2.1.5 + - Add new mime types + +1.6.6 / 2015-07-31 +================== + + * deps: mime-types@~2.1.4 + - Add new mime types + +1.6.5 / 2015-07-16 +================== + + * deps: mime-types@~2.1.3 + - Add new mime types + +1.6.4 / 2015-07-01 +================== + + * deps: mime-types@~2.1.2 + - Add new mime types + * perf: enable strict mode + * perf: remove argument reassignment + +1.6.3 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - Add new mime types + * perf: reduce try block size + * perf: remove bitwise operations + +1.6.2 / 2015-05-10 +================== + + * deps: mime-types@~2.0.11 + - Add new mime types + +1.6.1 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - Add new mime types + +1.6.0 / 2015-02-12 +================== + + * fix false-positives in `hasBody` `Transfer-Encoding` check + * support wildcard for both type and subtype (`*/*`) + +1.5.7 / 2015-02-09 +================== + + * fix argument reassignment + * deps: mime-types@~2.0.9 + - Add new mime types + +1.5.6 / 2015-01-29 +================== + + * deps: mime-types@~2.0.8 + - Add new mime types + +1.5.5 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - Add new mime types + - Fix missing extensions + - Fix various invalid MIME type entries + - Remove example template MIME types + - deps: mime-db@~1.5.0 + +1.5.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - Add new mime types + - deps: mime-db@~1.3.0 + +1.5.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - Add new mime types + - deps: mime-db@~1.2.0 + +1.5.2 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - Add new mime types + - deps: mime-db@~1.1.0 + +1.5.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + * deps: media-typer@0.3.0 + * deps: mime-types@~2.0.1 + - Support Node.js 0.6 + +1.5.0 / 2014-09-05 +================== + + * fix `hasbody` to be true for `content-length: 0` + +1.4.0 / 2014-09-02 +================== + + * update mime-types + +1.3.2 / 2014-06-24 +================== + + * use `~` range on mime-types + +1.3.1 / 2014-06-19 +================== + + * fix global variable leak + +1.3.0 / 2014-06-19 +================== + + * improve type parsing + + - invalid media type never matches + - media type not case-sensitive + - extra LWS does not affect results + +1.2.2 / 2014-06-19 +================== + + * fix behavior on unknown type argument + +1.2.1 / 2014-06-03 +================== + + * switch dependency from `mime` to `mime-types@1.0.0` + +1.2.0 / 2014-05-11 +================== + + * support suffix matching: + + - `+json` matches `application/vnd+json` + - `*/vnd+json` matches `application/vnd+json` + - `application/*+json` matches `application/vnd+json` + +1.1.0 / 2014-04-12 +================== + + * add non-array values support + * expose internal utilities: + + - `.is()` + - `.hasBody()` + - `.normalize()` + - `.match()` + +1.0.1 / 2014-03-30 +================== + + * add `multipart` as a shorthand diff --git a/node_modules/type-is/LICENSE b/node_modules/type-is/LICENSE new file mode 100644 index 0000000..386b7b6 --- /dev/null +++ b/node_modules/type-is/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/type-is/README.md b/node_modules/type-is/README.md new file mode 100644 index 0000000..008a7af --- /dev/null +++ b/node_modules/type-is/README.md @@ -0,0 +1,136 @@ +# type-is + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Infer the content-type of a request. + +### Install + +```sh +$ npm install type-is +``` + +## API + +```js +var http = require('http') +var is = require('type-is') + +http.createServer(function (req, res) { + var istext = is(req, ['text/*']) + res.end('you ' + (istext ? 'sent' : 'did not send') + ' me text') +}) +``` + +### type = is(request, types) + +`request` is the node HTTP request. `types` is an array of types. + +```js +// req.headers.content-type = 'application/json' + +is(req, ['json']) // 'json' +is(req, ['html', 'json']) // 'json' +is(req, ['application/*']) // 'application/json' +is(req, ['application/json']) // 'application/json' + +is(req, ['html']) // false +``` + +### is.hasBody(request) + +Returns a Boolean if the given `request` has a body, regardless of the +`Content-Type` header. + +Having a body has no relation to how large the body is (it may be 0 bytes). +This is similar to how file existence works. If a body does exist, then this +indicates that there is data to read from the Node.js request stream. + +```js +if (is.hasBody(req)) { + // read the body, since there is one + + req.on('data', function (chunk) { + // ... + }) +} +``` + +### type = is.is(mediaType, types) + +`mediaType` is the [media type](https://tools.ietf.org/html/rfc6838) string. `types` is an array of types. + +```js +var mediaType = 'application/json' + +is.is(mediaType, ['json']) // 'json' +is.is(mediaType, ['html', 'json']) // 'json' +is.is(mediaType, ['application/*']) // 'application/json' +is.is(mediaType, ['application/json']) // 'application/json' + +is.is(mediaType, ['html']) // false +``` + +### Each type can be: + +- An extension name such as `json`. This name will be returned if matched. +- A mime type such as `application/json`. +- A mime type with a wildcard such as `*/*` or `*/json` or `application/*`. The full mime type will be returned if matched. +- A suffix such as `+json`. This can be combined with a wildcard such as `*/vnd+json` or `application/*+json`. The full mime type will be returned if matched. + +`false` will be returned if no type matches or the content type is invalid. + +`null` will be returned if the request does not have a body. + +## Examples + +#### Example body parser + +```js +var is = require('type-is'); + +function bodyParser(req, res, next) { + if (!is.hasBody(req)) { + return next() + } + + switch (is(req, ['urlencoded', 'json', 'multipart'])) { + case 'urlencoded': + // parse urlencoded body + throw new Error('implement urlencoded body parsing') + break + case 'json': + // parse json body + throw new Error('implement json body parsing') + break + case 'multipart': + // parse multipart body + throw new Error('implement multipart body parsing') + break + default: + // 415 error code + res.statusCode = 415 + res.end() + return + } +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/type-is.svg +[npm-url]: https://npmjs.org/package/type-is +[node-version-image]: https://img.shields.io/node/v/type-is.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/type-is/master.svg +[travis-url]: https://travis-ci.org/jshttp/type-is +[coveralls-image]: https://img.shields.io/coveralls/jshttp/type-is/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/type-is?branch=master +[downloads-image]: https://img.shields.io/npm/dm/type-is.svg +[downloads-url]: https://npmjs.org/package/type-is diff --git a/node_modules/type-is/index.js b/node_modules/type-is/index.js new file mode 100644 index 0000000..4da7301 --- /dev/null +++ b/node_modules/type-is/index.js @@ -0,0 +1,262 @@ +/*! + * type-is + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var typer = require('media-typer') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = typeofrequest +module.exports.is = typeis +module.exports.hasBody = hasbody +module.exports.normalize = normalize +module.exports.match = mimeMatch + +/** + * Compare a `value` content-type with `types`. + * Each `type` can be an extension like `html`, + * a special shortcut like `multipart` or `urlencoded`, + * or a mime type. + * + * If no types match, `false` is returned. + * Otherwise, the first `type` that matches is returned. + * + * @param {String} value + * @param {Array} types + * @public + */ + +function typeis (value, types_) { + var i + var types = types_ + + // remove parameters and normalize + var val = tryNormalizeType(value) + + // no type or invalid + if (!val) { + return false + } + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length - 1) + for (i = 0; i < types.length; i++) { + types[i] = arguments[i + 1] + } + } + + // no types, return the content type + if (!types || !types.length) { + return val + } + + var type + for (i = 0; i < types.length; i++) { + if (mimeMatch(normalize(type = types[i]), val)) { + return type[0] === '+' || type.indexOf('*') !== -1 + ? val + : type + } + } + + // no matches + return false +} + +/** + * Check if a request has a request body. + * A request with a body __must__ either have `transfer-encoding` + * or `content-length` headers set. + * http://www.w3.org/Protocols/rfc2616/rfc2616-sec4.html#sec4.3 + * + * @param {Object} request + * @return {Boolean} + * @public + */ + +function hasbody (req) { + return req.headers['transfer-encoding'] !== undefined || + !isNaN(req.headers['content-length']) +} + +/** + * Check if the incoming request contains the "Content-Type" + * header field, and it contains any of the give mime `type`s. + * If there is no request body, `null` is returned. + * If there is no content type, `false` is returned. + * Otherwise, it returns the first `type` that matches. + * + * Examples: + * + * // With Content-Type: text/html; charset=utf-8 + * this.is('html'); // => 'html' + * this.is('text/html'); // => 'text/html' + * this.is('text/*', 'application/json'); // => 'text/html' + * + * // When Content-Type is application/json + * this.is('json', 'urlencoded'); // => 'json' + * this.is('application/json'); // => 'application/json' + * this.is('html', 'application/*'); // => 'application/json' + * + * this.is('html'); // => false + * + * @param {String|Array} types... + * @return {String|false|null} + * @public + */ + +function typeofrequest (req, types_) { + var types = types_ + + // no body + if (!hasbody(req)) { + return null + } + + // support flattened arguments + if (arguments.length > 2) { + types = new Array(arguments.length - 1) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i + 1] + } + } + + // request content type + var value = req.headers['content-type'] + + return typeis(value, types) +} + +/** + * Normalize a mime type. + * If it's a shorthand, expand it to a valid mime type. + * + * In general, you probably want: + * + * var type = is(req, ['urlencoded', 'json', 'multipart']); + * + * Then use the appropriate body parsers. + * These three are the most common request body types + * and are thus ensured to work. + * + * @param {String} type + * @private + */ + +function normalize (type) { + if (typeof type !== 'string') { + // invalid type + return false + } + + switch (type) { + case 'urlencoded': + return 'application/x-www-form-urlencoded' + case 'multipart': + return 'multipart/*' + } + + if (type[0] === '+') { + // "+json" -> "*/*+json" expando + return '*/*' + type + } + + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if `expected` mime type + * matches `actual` mime type with + * wildcard and +suffix support. + * + * @param {String} expected + * @param {String} actual + * @return {Boolean} + * @private + */ + +function mimeMatch (expected, actual) { + // invalid type + if (expected === false) { + return false + } + + // split types + var actualParts = actual.split('/') + var expectedParts = expected.split('/') + + // invalid format + if (actualParts.length !== 2 || expectedParts.length !== 2) { + return false + } + + // validate type + if (expectedParts[0] !== '*' && expectedParts[0] !== actualParts[0]) { + return false + } + + // validate suffix wildcard + if (expectedParts[1].substr(0, 2) === '*+') { + return expectedParts[1].length <= actualParts[1].length + 1 && + expectedParts[1].substr(1) === actualParts[1].substr(1 - expectedParts[1].length) + } + + // validate subtype + if (expectedParts[1] !== '*' && expectedParts[1] !== actualParts[1]) { + return false + } + + return true +} + +/** + * Normalize a type and remove parameters. + * + * @param {string} value + * @return {string} + * @private + */ + +function normalizeType (value) { + // parse the type + var type = typer.parse(value) + + // remove the parameters + type.parameters = undefined + + // reformat it + return typer.format(type) +} + +/** + * Try to normalize a type and remove parameters. + * + * @param {string} value + * @return {string} + * @private + */ + +function tryNormalizeType (value) { + try { + return normalizeType(value) + } catch (err) { + return null + } +} diff --git a/node_modules/type-is/package.json b/node_modules/type-is/package.json new file mode 100644 index 0000000..6bb01bb --- /dev/null +++ b/node_modules/type-is/package.json @@ -0,0 +1,119 @@ +{ + "_args": [ + [ + { + "raw": "type-is@~1.6.14", + "scope": null, + "escapedName": "type-is", + "name": "type-is", + "rawSpec": "~1.6.14", + "spec": ">=1.6.14 <1.7.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "type-is@>=1.6.14 <1.7.0", + "_id": "type-is@1.6.14", + "_inCache": true, + "_location": "/type-is", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/type-is-1.6.14.tgz_1479517858770_0.4908413903322071" + }, + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "type-is@~1.6.14", + "scope": null, + "escapedName": "type-is", + "name": "type-is", + "rawSpec": "~1.6.14", + "spec": ">=1.6.14 <1.7.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.14.tgz", + "_shasum": "e219639c17ded1ca0789092dd54a03826b817cb2", + "_shrinkwrap": null, + "_spec": "type-is@~1.6.14", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/type-is/issues" + }, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.13" + }, + "description": "Infer the content-type of a request.", + "devDependencies": { + "eslint": "2.10.2", + "eslint-config-standard": "5.3.1", + "eslint-plugin-promise": "1.1.0", + "eslint-plugin-standard": "1.3.2", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "directories": {}, + "dist": { + "shasum": "e219639c17ded1ca0789092dd54a03826b817cb2", + "tarball": "https://registry.npmjs.org/type-is/-/type-is-1.6.14.tgz" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "gitHead": "f88151e69d91c5ed42e29dea78f5566403a5a7ad", + "homepage": "https://github.com/jshttp/type-is", + "keywords": [ + "content", + "type", + "checking" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + } + ], + "name": "type-is", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/type-is.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.6.14" +} diff --git a/node_modules/unpipe/HISTORY.md b/node_modules/unpipe/HISTORY.md new file mode 100644 index 0000000..85e0f8d --- /dev/null +++ b/node_modules/unpipe/HISTORY.md @@ -0,0 +1,4 @@ +1.0.0 / 2015-06-14 +================== + + * Initial release diff --git a/node_modules/unpipe/LICENSE b/node_modules/unpipe/LICENSE new file mode 100644 index 0000000..aed0138 --- /dev/null +++ b/node_modules/unpipe/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/unpipe/README.md b/node_modules/unpipe/README.md new file mode 100644 index 0000000..e536ad2 --- /dev/null +++ b/node_modules/unpipe/README.md @@ -0,0 +1,43 @@ +# unpipe + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Unpipe a stream from all destinations. + +## Installation + +```sh +$ npm install unpipe +``` + +## API + +```js +var unpipe = require('unpipe') +``` + +### unpipe(stream) + +Unpipes all destinations from a given stream. With stream 2+, this is +equivalent to `stream.unpipe()`. When used with streams 1 style streams +(typically Node.js 0.8 and below), this module attempts to undo the +actions done in `stream.pipe(dest)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/unpipe.svg +[npm-url]: https://npmjs.org/package/unpipe +[node-image]: https://img.shields.io/node/v/unpipe.svg +[node-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/stream-utils/unpipe.svg +[travis-url]: https://travis-ci.org/stream-utils/unpipe +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/unpipe.svg +[coveralls-url]: https://coveralls.io/r/stream-utils/unpipe?branch=master +[downloads-image]: https://img.shields.io/npm/dm/unpipe.svg +[downloads-url]: https://npmjs.org/package/unpipe diff --git a/node_modules/unpipe/index.js b/node_modules/unpipe/index.js new file mode 100644 index 0000000..15c3d97 --- /dev/null +++ b/node_modules/unpipe/index.js @@ -0,0 +1,69 @@ +/*! + * unpipe + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = unpipe + +/** + * Determine if there are Node.js pipe-like data listeners. + * @private + */ + +function hasPipeDataListeners(stream) { + var listeners = stream.listeners('data') + + for (var i = 0; i < listeners.length; i++) { + if (listeners[i].name === 'ondata') { + return true + } + } + + return false +} + +/** + * Unpipe a stream from all destinations. + * + * @param {object} stream + * @public + */ + +function unpipe(stream) { + if (!stream) { + throw new TypeError('argument stream is required') + } + + if (typeof stream.unpipe === 'function') { + // new-style + stream.unpipe() + return + } + + // Node.js 0.8 hack + if (!hasPipeDataListeners(stream)) { + return + } + + var listener + var listeners = stream.listeners('close') + + for (var i = 0; i < listeners.length; i++) { + listener = listeners[i] + + if (listener.name !== 'cleanup' && listener.name !== 'onclose') { + continue + } + + // invoke the listener + listener.call(stream) + } +} diff --git a/node_modules/unpipe/package.json b/node_modules/unpipe/package.json new file mode 100644 index 0000000..c3b1fda --- /dev/null +++ b/node_modules/unpipe/package.json @@ -0,0 +1,93 @@ +{ + "_args": [ + [ + { + "raw": "unpipe@~1.0.0", + "scope": null, + "escapedName": "unpipe", + "name": "unpipe", + "rawSpec": "~1.0.0", + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/finalhandler" + ] + ], + "_from": "unpipe@>=1.0.0 <1.1.0", + "_id": "unpipe@1.0.0", + "_inCache": true, + "_location": "/unpipe", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "unpipe@~1.0.0", + "scope": null, + "escapedName": "unpipe", + "name": "unpipe", + "rawSpec": "~1.0.0", + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/finalhandler" + ], + "_resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "_shasum": "b2bf4ee8514aae6165b4817829d21b2ef49904ec", + "_shrinkwrap": null, + "_spec": "unpipe@~1.0.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/finalhandler", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/unpipe/issues" + }, + "dependencies": {}, + "description": "Unpipe a stream from all destinations", + "devDependencies": { + "istanbul": "0.3.15", + "mocha": "2.2.5", + "readable-stream": "1.1.13" + }, + "directories": {}, + "dist": { + "shasum": "b2bf4ee8514aae6165b4817829d21b2ef49904ec", + "tarball": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "gitHead": "d2df901c06487430e78dca62b6edb8bb2fc5e99d", + "homepage": "https://github.com/stream-utils/unpipe", + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + } + ], + "name": "unpipe", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/unpipe.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.0" +} diff --git a/node_modules/utils-merge/.travis.yml b/node_modules/utils-merge/.travis.yml new file mode 100644 index 0000000..af92b02 --- /dev/null +++ b/node_modules/utils-merge/.travis.yml @@ -0,0 +1,6 @@ +language: "node_js" +node_js: + - "0.4" + - "0.6" + - "0.8" + - "0.10" diff --git a/node_modules/utils-merge/LICENSE b/node_modules/utils-merge/LICENSE new file mode 100644 index 0000000..e33bd10 --- /dev/null +++ b/node_modules/utils-merge/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2013 Jared Hanson + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/utils-merge/README.md b/node_modules/utils-merge/README.md new file mode 100644 index 0000000..2f94e9b --- /dev/null +++ b/node_modules/utils-merge/README.md @@ -0,0 +1,34 @@ +# utils-merge + +Merges the properties from a source object into a destination object. + +## Install + + $ npm install utils-merge + +## Usage + +```javascript +var a = { foo: 'bar' } + , b = { bar: 'baz' }; + +merge(a, b); +// => { foo: 'bar', bar: 'baz' } +``` + +## Tests + + $ npm install + $ npm test + +[![Build Status](https://secure.travis-ci.org/jaredhanson/utils-merge.png)](http://travis-ci.org/jaredhanson/utils-merge) + +## Credits + + - [Jared Hanson](http://github.com/jaredhanson) + +## License + +[The MIT License](http://opensource.org/licenses/MIT) + +Copyright (c) 2013 Jared Hanson <[http://jaredhanson.net/](http://jaredhanson.net/)> diff --git a/node_modules/utils-merge/index.js b/node_modules/utils-merge/index.js new file mode 100644 index 0000000..4265c69 --- /dev/null +++ b/node_modules/utils-merge/index.js @@ -0,0 +1,23 @@ +/** + * Merge object b with object a. + * + * var a = { foo: 'bar' } + * , b = { bar: 'baz' }; + * + * merge(a, b); + * // => { foo: 'bar', bar: 'baz' } + * + * @param {Object} a + * @param {Object} b + * @return {Object} + * @api public + */ + +exports = module.exports = function(a, b){ + if (a && b) { + for (var key in b) { + a[key] = b[key]; + } + } + return a; +}; diff --git a/node_modules/utils-merge/package.json b/node_modules/utils-merge/package.json new file mode 100644 index 0000000..209f5b1 --- /dev/null +++ b/node_modules/utils-merge/package.json @@ -0,0 +1,93 @@ +{ + "_args": [ + [ + { + "raw": "utils-merge@1.0.0", + "scope": null, + "escapedName": "utils-merge", + "name": "utils-merge", + "rawSpec": "1.0.0", + "spec": "1.0.0", + "type": "version" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "utils-merge@1.0.0", + "_id": "utils-merge@1.0.0", + "_inCache": true, + "_location": "/utils-merge", + "_npmUser": { + "name": "jaredhanson", + "email": "jaredhanson@gmail.com" + }, + "_npmVersion": "1.2.25", + "_phantomChildren": {}, + "_requested": { + "raw": "utils-merge@1.0.0", + "scope": null, + "escapedName": "utils-merge", + "name": "utils-merge", + "rawSpec": "1.0.0", + "spec": "1.0.0", + "type": "version" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz", + "_shasum": "0294fb922bb9375153541c4f7096231f287c8af8", + "_shrinkwrap": null, + "_spec": "utils-merge@1.0.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Jared Hanson", + "email": "jaredhanson@gmail.com", + "url": "http://www.jaredhanson.net/" + }, + "bugs": { + "url": "http://github.com/jaredhanson/utils-merge/issues" + }, + "dependencies": {}, + "description": "merge() utility function", + "devDependencies": { + "chai": "1.x.x", + "mocha": "1.x.x" + }, + "directories": {}, + "dist": { + "shasum": "0294fb922bb9375153541c4f7096231f287c8af8", + "tarball": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz" + }, + "engines": { + "node": ">= 0.4.0" + }, + "homepage": "https://github.com/jaredhanson/utils-merge#readme", + "keywords": [ + "util" + ], + "licenses": [ + { + "type": "MIT", + "url": "http://www.opensource.org/licenses/MIT" + } + ], + "main": "./index", + "maintainers": [ + { + "name": "jaredhanson", + "email": "jaredhanson@gmail.com" + } + ], + "name": "utils-merge", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/jaredhanson/utils-merge.git" + }, + "scripts": { + "test": "node_modules/.bin/mocha --reporter spec --require test/bootstrap/node test/*.test.js" + }, + "version": "1.0.0" +} diff --git a/node_modules/vary/HISTORY.md b/node_modules/vary/HISTORY.md new file mode 100644 index 0000000..ed68118 --- /dev/null +++ b/node_modules/vary/HISTORY.md @@ -0,0 +1,29 @@ +1.1.0 / 2015-09-29 +================== + + * Only accept valid field names in the `field` argument + - Ensures the resulting string is a valid HTTP header value + +1.0.1 / 2015-07-08 +================== + + * Fix setting empty header from empty `field` + * perf: enable strict mode + * perf: remove argument reassignments + +1.0.0 / 2014-08-10 +================== + + * Accept valid `Vary` header string as `field` + * Add `vary.append` for low-level string manipulation + * Move to `jshttp` orgainzation + +0.1.0 / 2014-06-05 +================== + + * Support array of fields to set + +0.0.0 / 2014-06-04 +================== + + * Initial release diff --git a/node_modules/vary/LICENSE b/node_modules/vary/LICENSE new file mode 100644 index 0000000..142ede3 --- /dev/null +++ b/node_modules/vary/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/vary/README.md b/node_modules/vary/README.md new file mode 100644 index 0000000..5966542 --- /dev/null +++ b/node_modules/vary/README.md @@ -0,0 +1,91 @@ +# vary + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Manipulate the HTTP Vary header + +## Installation + +```sh +$ npm install vary +``` + +## API + +```js +var vary = require('vary') +``` + +### vary(res, field) + +Adds the given header `field` to the `Vary` response header of `res`. +This can be a string of a single field, a string of a valid `Vary` +header, or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. + +```js +// Append "Origin" to the Vary header of the response +vary(res, 'Origin') +``` + +### vary.append(header, field) + +Adds the given header `field` to the `Vary` response header string `header`. +This can be a string of a single field, a string of a valid `Vary` header, +or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. The new header string is returned. + +```js +// Get header string appending "Origin" to "Accept, User-Agent" +vary.append('Accept, User-Agent', 'Origin') +``` + +## Examples + +### Updating the Vary header when content is based on it + +```js +var http = require('http') +var vary = require('vary') + +http.createServer(function onRequest(req, res) { + // about to user-agent sniff + vary(res, 'User-Agent') + + var ua = req.headers['user-agent'] || '' + var isMobile = /mobi|android|touch|mini/i.test(ua) + + // serve site, depending on isMobile + res.setHeader('Content-Type', 'text/html') + res.end('You are (probably) ' + (isMobile ? '' : 'not ') + 'a mobile user') +}) +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/vary.svg +[npm-url]: https://npmjs.org/package/vary +[node-version-image]: https://img.shields.io/node/v/vary.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/vary/master.svg +[travis-url]: https://travis-ci.org/jshttp/vary +[coveralls-image]: https://img.shields.io/coveralls/jshttp/vary/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/vary +[downloads-image]: https://img.shields.io/npm/dm/vary.svg +[downloads-url]: https://npmjs.org/package/vary diff --git a/node_modules/vary/index.js b/node_modules/vary/index.js new file mode 100644 index 0000000..21dbaf1 --- /dev/null +++ b/node_modules/vary/index.js @@ -0,0 +1,124 @@ +/*! + * vary + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + */ + +module.exports = vary; +module.exports.append = append; + +/** + * RegExp to match field-name in RFC 7230 sec 3.2 + * + * field-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + */ + +var fieldNameRegExp = /^[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+$/ + +/** + * Append a field to a vary header. + * + * @param {String} header + * @param {String|Array} field + * @return {String} + * @api public + */ + +function append(header, field) { + if (typeof header !== 'string') { + throw new TypeError('header argument is required'); + } + + if (!field) { + throw new TypeError('field argument is required'); + } + + // get fields array + var fields = !Array.isArray(field) + ? parse(String(field)) + : field; + + // assert on invalid field names + for (var i = 0; i < fields.length; i++) { + if (!fieldNameRegExp.test(fields[i])) { + throw new TypeError('field argument contains an invalid header name'); + } + } + + // existing, unspecified vary + if (header === '*') { + return header; + } + + // enumerate current values + var val = header; + var vals = parse(header.toLowerCase()); + + // unspecified vary + if (fields.indexOf('*') !== -1 || vals.indexOf('*') !== -1) { + return '*'; + } + + for (var i = 0; i < fields.length; i++) { + var fld = fields[i].toLowerCase(); + + // append value (case-preserving) + if (vals.indexOf(fld) === -1) { + vals.push(fld); + val = val + ? val + ', ' + fields[i] + : fields[i]; + } + } + + return val; +} + +/** + * Parse a vary header into an array. + * + * @param {String} header + * @return {Array} + * @api private + */ + +function parse(header) { + return header.trim().split(/ *, */); +} + +/** + * Mark that a request is varied on a header field. + * + * @param {Object} res + * @param {String|Array} field + * @api public + */ + +function vary(res, field) { + if (!res || !res.getHeader || !res.setHeader) { + // quack quack + throw new TypeError('res argument is required'); + } + + // get existing header + var val = res.getHeader('Vary') || '' + var header = Array.isArray(val) + ? val.join(', ') + : String(val); + + // set new header + if ((val = append(header, field))) { + res.setHeader('Vary', val); + } +} diff --git a/node_modules/vary/package.json b/node_modules/vary/package.json new file mode 100644 index 0000000..46a0d94 --- /dev/null +++ b/node_modules/vary/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + { + "raw": "vary@~1.1.0", + "scope": null, + "escapedName": "vary", + "name": "vary", + "rawSpec": "~1.1.0", + "spec": ">=1.1.0 <1.2.0", + "type": "range" + }, + "/home/sangwan/Documents/summonAPI/node_modules/express" + ] + ], + "_from": "vary@>=1.1.0 <1.2.0", + "_id": "vary@1.1.0", + "_inCache": true, + "_location": "/vary", + "_npmUser": { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + "_npmVersion": "1.4.28", + "_phantomChildren": {}, + "_requested": { + "raw": "vary@~1.1.0", + "scope": null, + "escapedName": "vary", + "name": "vary", + "rawSpec": "~1.1.0", + "spec": ">=1.1.0 <1.2.0", + "type": "range" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/vary/-/vary-1.1.0.tgz", + "_shasum": "e1e5affbbd16ae768dd2674394b9ad3022653140", + "_shrinkwrap": null, + "_spec": "vary@~1.1.0", + "_where": "/home/sangwan/Documents/summonAPI/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/vary/issues" + }, + "dependencies": {}, + "description": "Manipulate the HTTP Vary header", + "devDependencies": { + "istanbul": "0.3.21", + "mocha": "2.3.3", + "supertest": "1.1.0" + }, + "directories": {}, + "dist": { + "shasum": "e1e5affbbd16ae768dd2674394b9ad3022653140", + "tarball": "https://registry.npmjs.org/vary/-/vary-1.1.0.tgz" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "gitHead": "13b03e9bf97da9d83bfeac84d84144137d84c257", + "homepage": "https://github.com/jshttp/vary", + "keywords": [ + "http", + "res", + "vary" + ], + "license": "MIT", + "maintainers": [ + { + "name": "dougwilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "jongleberry", + "email": "jonathanrichardong@gmail.com" + }, + { + "name": "fishrock123", + "email": "fishrock123@rocketmail.com" + } + ], + "name": "vary", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/vary.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.0" +}