diff --git a/.gitignore b/.gitignore index 3b9043a..bd3d1a7 100644 --- a/.gitignore +++ b/.gitignore @@ -2,4 +2,3 @@ node_modules/ api.key .history .idea/ -.vscode diff --git a/.prettierrc b/.prettierrc new file mode 100644 index 0000000..5da916d --- /dev/null +++ b/.prettierrc @@ -0,0 +1,4 @@ +{ + "singleQuote": true, + "bracketSpacing": true +} diff --git a/.vscode/extensions.json b/.vscode/extensions.json new file mode 100644 index 0000000..974188b --- /dev/null +++ b/.vscode/extensions.json @@ -0,0 +1,3 @@ +{ + "recommendations": ["esbenp.prettier-vscode"] +} diff --git a/.vscode/settings.json b/.vscode/settings.json new file mode 100644 index 0000000..6b73662 --- /dev/null +++ b/.vscode/settings.json @@ -0,0 +1,4 @@ +{ + "editor.formatOnSave": true, + "editor.defaultFormatter": "esbenp.prettier-vscode" +} diff --git a/README.md b/README.md index 4b0c619..dea9dcc 100644 --- a/README.md +++ b/README.md @@ -1,2 +1,3 @@ # wow-demos + Playground and demos of wow!Team diff --git a/animation-playground/index.html b/animation-playground/index.html index bf66a45..3475c06 100644 --- a/animation-playground/index.html +++ b/animation-playground/index.html @@ -1,66 +1,76 @@ - + + + + + + Document + - - - - - Document - + +
+
+

Animation Settings |

+

GSAP 2.1.3 [Reload with 3.2.6]

+
+ +
+ + + +
+
+ + + +
+
- -
-
-

Animation Settings |

-

GSAP 2.1.3 [Reload with 3.2.6]

- - -
- - - -
-
- - - -
-
+ + + + - - + + Out Info +

+                    In Info
+                    

                 
- - - - Out Info -

-                In Info
-                

-            
- -
-
-
- - - - - -
-
- ALL CAPS TITLE +
+
+ + + + + +
+
+ ALL CAPS TITLE +
-
- - - - - - + + + + + diff --git a/animation-playground/index3.html b/animation-playground/index3.html index 038c18c..9dcac38 100644 --- a/animation-playground/index3.html +++ b/animation-playground/index3.html @@ -1,66 +1,76 @@ - + + + + + + Document + - - - - - Document - + +
+
+

Animation Settings |

+

GSAP 3.2.6 [Reload with 2.1.3]

+
+ +
+ + + +
+
+ + + +
+
- -
-
-

Animation Settings |

-

GSAP 3.2.6 [Reload with 2.1.3]

- - -
- - - -
-
- - - -
-
+ + + + - - + + Out Info +

+                    In Info
+                    

                 
- - - - Out Info -

-                In Info
-                

-            
- -
-
-
- - - - - -
-
- ALL CAPS TITLE +
+
+ + + + + +
+
+ ALL CAPS TITLE +
-
- - - - - - + + + + + diff --git a/animation-playground/playground.js b/animation-playground/playground.js index 13eebe9..078173e 100644 --- a/animation-playground/playground.js +++ b/animation-playground/playground.js @@ -1,109 +1,113 @@ -'use strict' -let animations +'use strict'; +let animations; // Animation properties -const animationProperties = window['santa-animations'].animationProperties +const animationProperties = window['santa-animations'].animationProperties; // Selectors -const animationSelection = document.getElementById('animation-selection') -const animationSelectionForm = document.getElementById('animation-selection-form') -const animationViewModeName = document.getElementById('animation-viewmode-name') -const animationNameIn = document.getElementById('animation-name-in') -const animationNameOut = document.getElementById('animation-name-out') -const animationInfoIn = document.getElementById('animation-info-in') -const animationInfoOut = document.getElementById('animation-info-out') -const animationParamsIn = document.getElementById('animation-params-in') -const animationParamsOut = document.getElementById('animation-params-out') -const animationExecute = document.getElementById('animation-execute') +const animationSelection = document.getElementById('animation-selection'); +const animationSelectionForm = document.getElementById('animation-selection-form'); +const animationViewModeName = document.getElementById('animation-viewmode-name'); +const animationNameIn = document.getElementById('animation-name-in'); +const animationNameOut = document.getElementById('animation-name-out'); +const animationInfoIn = document.getElementById('animation-info-in'); +const animationInfoOut = document.getElementById('animation-info-out'); +const animationParamsIn = document.getElementById('animation-params-in'); +const animationParamsOut = document.getElementById('animation-params-out'); +const animationExecute = document.getElementById('animation-execute'); // Specials -const changeEvent = new Event('change') -const mobileQuery = window.matchMedia('(max-width: 768px)') -let isMobile = mobileQuery.matches +const changeEvent = new Event('change'); +const mobileQuery = window.matchMedia('(max-width: 768px)'); +let isMobile = mobileQuery.matches; // BaseClear props -const clearProps = - 'clip,clipPath,webkitClipPath,willChange,opacity,transform,transformOrigin' -const clearPropsNoOpacity = - 'clip,clipPath,webkitClipPath,willChange,transform,transformOrigin' +const clearProps = 'clip,clipPath,webkitClipPath,willChange,opacity,transform,transformOrigin'; +const clearPropsNoOpacity = 'clip,clipPath,webkitClipPath,willChange,transform,transformOrigin'; // Update form fields and info on select change -animationNameIn.addEventListener('change', event => { - const props = animations.getProperties(event.target.value) - animationInfoIn.textContent = JSON.stringify(props, null, 2) - populateAnimationParams(animationParamsIn, 'in', props.schema) -}) +animationNameIn.addEventListener('change', (event) => { + const props = animations.getProperties(event.target.value); + animationInfoIn.textContent = JSON.stringify(props, null, 2); + populateAnimationParams(animationParamsIn, 'in', props.schema); +}); // Update info on select change -animationNameOut.addEventListener('change', event => { - const props = animations.getProperties(event.target.value) - animationInfoOut.textContent = JSON.stringify(props, null, 2) - populateAnimationParams(animationParamsOut, 'out', props.schema) -}) +animationNameOut.addEventListener('change', (event) => { + const props = animations.getProperties(event.target.value); + animationInfoOut.textContent = JSON.stringify(props, null, 2); + populateAnimationParams(animationParamsOut, 'out', props.schema); +}); // On button click, Execute out animation and then in animation animationExecute.addEventListener('click', () => { // Get all in form elements values - const nameIn = animationNameIn.selectedOptions[0].label - const paramsInElements = animationParamsIn.querySelectorAll('input, select') - const {duration: durationIn, delay: delayIn, ...paramsIn} = Object.fromEntries( - Array.from(paramsInElements).map(el => [el.dataset.key, el.type === 'number' ? +el.value : el.value]) - ) + const nameIn = animationNameIn.selectedOptions[0].label; + const paramsInElements = animationParamsIn.querySelectorAll('input, select'); + const { + duration: durationIn, + delay: delayIn, + ...paramsIn + } = Object.fromEntries( + Array.from(paramsInElements).map((el) => [el.dataset.key, el.type === 'number' ? +el.value : el.value]), + ); // Get all out form elements values - const nameOut = animationNameOut.selectedOptions[0].label - const paramsOutElements = animationParamsOut.querySelectorAll('input, select') - const {duration: durationOut, delay: delayOut, ...paramsOut} = Object.fromEntries( - Array.from(paramsOutElements).map(el => [el.dataset.key, el.type === 'number' ? +el.value : el.value]) - ) - - const elements = document.getElementsByClassName('comp') + const nameOut = animationNameOut.selectedOptions[0].label; + const paramsOutElements = animationParamsOut.querySelectorAll('input, select'); + const { + duration: durationOut, + delay: delayOut, + ...paramsOut + } = Object.fromEntries( + Array.from(paramsOutElements).map((el) => [el.dataset.key, el.type === 'number' ? +el.value : el.value]), + ); + + const elements = document.getElementsByClassName('comp'); // In mobile view hide the panel if (isMobile) { - animationSelection.classList.add('hide-panel') + animationSelection.classList.add('hide-panel'); } // Run out animation, on complete clear transforms and run in animation - animations.animate('BaseClear', elements, 0, 0, {clearProps}) + animations.animate('BaseClear', elements, 0, 0, { clearProps }); animations.animate(nameOut, elements, durationOut, delayOut, { ...paramsOut, callbacks: { onComplete: () => { animations.animate('BaseClear', elements, 0, 0, { - clearProps: clearPropsNoOpacity - }) + clearProps: clearPropsNoOpacity, + }); animations.animate(nameIn, elements, durationIn, delayIn, { ...paramsIn, callbacks: { onComplete: () => { if (isMobile) { - animationSelection.classList.remove('hide-panel') + animationSelection.classList.remove('hide-panel'); } - } - } - }) - } - } - }) + }, + }, + }); + }, + }, + }); // Eventually save form values in session - Array.from(animationSelectionForm.elements).forEach(el => - sessionStorage.setItem(el.name, el.value) - ) -}) + Array.from(animationSelectionForm.elements).forEach((el) => sessionStorage.setItem(el.name, el.value)); +}); // Mobile Handling - reload animation definitions -mobileQuery.addListener(event => { +mobileQuery.addListener((event) => { if (isMobile !== event.matches) { - isMobile = event.matches - animations.updateViewMode(viewMode()) - animationViewModeName.textContent = viewMode() + isMobile = event.matches; + animations.updateViewMode(viewMode()); + animationViewModeName.textContent = viewMode(); - animationNameIn.dispatchEvent(changeEvent) - animationNameOut.dispatchEvent(changeEvent) + animationNameIn.dispatchEvent(changeEvent); + animationNameOut.dispatchEvent(changeEvent); } -}) +}); onLoad(() => { // Init animations with gsap2 or 3 @@ -111,136 +115,134 @@ onLoad(() => { animations = window['santa-animations'].create( window.tweenEngine2.create(window.TweenMax, window.TimelineMax), window, - viewMode() - ) + viewMode(), + ); } else { - animations = window['santa-animations'].create( - window.tweenEngine3.create(window.gsap), - window, - viewMode() - ) + animations = window['santa-animations'].create(window.tweenEngine3.create(window.gsap), window, viewMode()); } // Get all animation names - populateAnimationsSelect() - animationViewModeName.textContent = viewMode() + populateAnimationsSelect(); + animationViewModeName.textContent = viewMode(); // Default to FadeIn and FadeOut - animationNameIn.value = sessionStorage.getItem(animationNameIn.name) || 'FadeIn' - animationNameOut.value = sessionStorage.getItem(animationNameOut.name) || 'FadeOut' + animationNameIn.value = sessionStorage.getItem(animationNameIn.name) || 'FadeIn'; + animationNameOut.value = sessionStorage.getItem(animationNameOut.name) || 'FadeOut'; - animationNameIn.dispatchEvent(changeEvent) - animationNameOut.dispatchEvent(changeEvent) + animationNameIn.dispatchEvent(changeEvent); + animationNameOut.dispatchEvent(changeEvent); // Get values from sessionStorage if any - requestAnimationFrame(() => Array.from(animationSelectionForm.elements).forEach(element => { - const value = sessionStorage.getItem(element.name) - if (value) { - element.value = element.type === 'number' ? +value : value - } - })) -}) + requestAnimationFrame(() => + Array.from(animationSelectionForm.elements).forEach((element) => { + const value = sessionStorage.getItem(element.name); + if (value) { + element.value = element.type === 'number' ? +value : value; + } + }), + ); +}); // Fill Select fields // Filter by in and out but not modes animations function populateAnimationsSelect() { Object.entries(animationProperties).forEach(([name, props]) => { - const {groups = [], modeChange} = props + const { groups = [], modeChange } = props; if ((groups.includes('entrance') || groups.includes('exit')) && !modeChange) { - const option = document.createElement('option') - option.label = name - option.value = name + const option = document.createElement('option'); + option.label = name; + option.value = name; if (groups.includes('entrance')) { - animationNameIn.appendChild(option) + animationNameIn.appendChild(option); } else { - animationNameOut.appendChild(option) + animationNameOut.appendChild(option); } } - }) + }); } function populateAnimationParams(paramsArea, suffix, schema) { - paramsArea.innerHTML = '' + paramsArea.innerHTML = ''; Object.entries(schema).forEach(([key, def]) => { - const id = `${key}-${suffix}` - const label = document.createElement('label') - label.for = id - paramsArea.appendChild(label) - label.textContent = `${capitalize(key)}:` + const id = `${key}-${suffix}`; + const label = document.createElement('label'); + label.for = id; + paramsArea.appendChild(label); + label.textContent = `${capitalize(key)}:`; if (def.type === 'number') { // override duration 0 default if (key === 'duration') { - def.default = 1 + def.default = 1; } - paramsArea.appendChild(numberInput(def, id, key)) + paramsArea.appendChild(numberInput(def, id, key)); } else if (def.type === 'string' && def.enum) { - paramsArea.appendChild(enumInput(def, id, key)) + paramsArea.appendChild(enumInput(def, id, key)); } else if (def.type === 'boolean') { - paramsArea.appendChild(booleanInput(def, id, key)) + paramsArea.appendChild(booleanInput(def, id, key)); } else { - paramsArea.appendChild(missingInput(def, id, key)) + paramsArea.appendChild(missingInput(def, id, key)); } - }) + }); } // Controls function numberInput(schema, id, key) { - const input = document.createElement('input') - input.type = 'number' - input.id = id - input.name = id - input.dataset.key = key + const input = document.createElement('input'); + input.type = 'number'; + input.id = id; + input.name = id; + input.dataset.key = key; if (typeof schema.min !== 'undefined') { - input.min = schema.min + input.min = schema.min; } if (typeof schema.max !== 'undefined') { - input.max = schema.max + input.max = schema.max; } - input.step = schema.step || 0.1 - input.value = schema.default - return input + input.step = schema.step || 0.1; + input.value = schema.default; + return input; } function enumInput(schema, id, key) { - const select = document.createElement('select') - select.id = id - select.name = id - select.dataset.key = key + const select = document.createElement('select'); + select.id = id; + select.name = id; + select.dataset.key = key; for (const item of schema.enum) { - const option = document.createElement('option') - option.value = item - option.label = item + const option = document.createElement('option'); + option.value = item; + option.label = item; if (schema.default === item) { - option.selected = 'selected' + option.selected = 'selected'; } - select.appendChild(option) + select.appendChild(option); } - return select + return select; } function booleanInput(schema, id, key) { - const checkbox = document.createElement('input') - checkbox.id = id - checkbox.name = id - checkbox.dataset.key = key - checkbox.type = 'checkbox' + const checkbox = document.createElement('input'); + checkbox.id = id; + checkbox.name = id; + checkbox.dataset.key = key; + checkbox.type = 'checkbox'; if (schema.default) { - checkbox.checked = 'checked' + checkbox.checked = 'checked'; } - return checkbox + return checkbox; } function missingInput(schema, id) { - const textarea = document.createElement('textarea') - textarea.id = id - textarea.name = id - textarea.placeholder = `missing ${JSON.stringify(schema, null, 2)}` + const textarea = document.createElement('textarea'); + textarea.id = id; + textarea.name = id; + textarea.placeholder = `missing ${JSON.stringify(schema, null, 2)}`; - return textarea + return textarea; } // Helpers @@ -248,17 +250,17 @@ function missingInput(schema, id) { function onLoad(func) { if (document.readyState === 'loading') { // Loading hasn't finished yet - document.addEventListener('DOMContentLoaded', () => func()) + document.addEventListener('DOMContentLoaded', () => func()); } else { // `DOMContentLoaded` has already fired - func() + func(); } } function viewMode() { - return isMobile ? 'mobile' : 'desktop' + return isMobile ? 'mobile' : 'desktop'; } function capitalize(str) { - return str.replace(/^\w|\s\w/g, match => match.toUpperCase()) -} \ No newline at end of file + return str.replace(/^\w|\s\w/g, (match) => match.toUpperCase()); +} diff --git a/animation-playground/style.css b/animation-playground/style.css index 634d80c..727c910 100644 --- a/animation-playground/style.css +++ b/animation-playground/style.css @@ -2,22 +2,22 @@ html { height: 100%; } body { - padding:0; + padding: 0; margin: 0; height: 100%; min-height: 100%; - font-family: sans-serif + font-family: sans-serif; } h1 { font-size: 18px; padding: 0 10px; margin-bottom: 0; - text-align: center + text-align: center; } h2 { font-size: 14px; padding: 0 10px; - text-align: center + text-align: center; } .animation-viewmode-name { text-transform: capitalize; @@ -62,8 +62,8 @@ h2 { display: flex; justify-content: space-between; } -.animation-settings > div{ - width: 48% +.animation-settings > div { + width: 48%; } .animation-settings select { width: 100%; @@ -71,10 +71,10 @@ h2 { .animation-params { padding-bottom: 10px; } -.animation-params textarea{ +.animation-params textarea { width: 96%; } -.animation-params input{ +.animation-params input { width: 30%; } .animation-execute { @@ -91,10 +91,11 @@ h2 { width: 100%; grid-template-columns: 1fr; grid-template-rows: 1fr 1fr 1fr 1fr; - grid-template-areas: "a" - "b" - "c" - "d"; + grid-template-areas: + 'a' + 'b' + 'c' + 'd'; place-items: start center; } @@ -106,7 +107,7 @@ h2 { grid-area: c; } .error { - border-color: red + border-color: red; } .hide-panel { transition: all 200ms ease-out; diff --git a/gradients/dat.gui.js b/gradients/dat.gui.js index 78828b6..a08b93f 100644 --- a/gradients/dat.gui.js +++ b/gradients/dat.gui.js @@ -12,2527 +12,2726 @@ */ (function (global, factory) { - typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) : - typeof define === 'function' && define.amd ? define(['exports'], factory) : - (factory((global.dat = {}))); -}(this, (function (exports) { 'use strict'; + typeof exports === 'object' && typeof module !== 'undefined' + ? factory(exports) + : typeof define === 'function' && define.amd + ? define(['exports'], factory) + : factory((global.dat = {})); +})(this, function (exports) { + 'use strict'; + + function ___$insertStyle(css) { + if (!css) { + return; + } + if (typeof window === 'undefined') { + return; + } + + var style = document.createElement('style'); + + style.setAttribute('type', 'text/css'); + style.innerHTML = css; + document.head.appendChild(style); + + return css; + } + + function colorToString(color, forceCSSHex) { + var colorFormat = color.__state.conversionName.toString(); + var r = Math.round(color.r); + var g = Math.round(color.g); + var b = Math.round(color.b); + var a = color.a; + var h = Math.round(color.h); + var s = color.s.toFixed(1); + var v = color.v.toFixed(1); + if (forceCSSHex || colorFormat === 'THREE_CHAR_HEX' || colorFormat === 'SIX_CHAR_HEX') { + var str = color.hex.toString(16); + while (str.length < 6) { + str = '0' + str; + } + return '#' + str; + } else if (colorFormat === 'CSS_RGB') { + return 'rgb(' + r + ',' + g + ',' + b + ')'; + } else if (colorFormat === 'CSS_RGBA') { + return 'rgba(' + r + ',' + g + ',' + b + ',' + a + ')'; + } else if (colorFormat === 'HEX') { + return '0x' + color.hex.toString(16); + } else if (colorFormat === 'RGB_ARRAY') { + return '[' + r + ',' + g + ',' + b + ']'; + } else if (colorFormat === 'RGBA_ARRAY') { + return '[' + r + ',' + g + ',' + b + ',' + a + ']'; + } else if (colorFormat === 'RGB_OBJ') { + return '{r:' + r + ',g:' + g + ',b:' + b + '}'; + } else if (colorFormat === 'RGBA_OBJ') { + return '{r:' + r + ',g:' + g + ',b:' + b + ',a:' + a + '}'; + } else if (colorFormat === 'HSV_OBJ') { + return '{h:' + h + ',s:' + s + ',v:' + v + '}'; + } else if (colorFormat === 'HSVA_OBJ') { + return '{h:' + h + ',s:' + s + ',v:' + v + ',a:' + a + '}'; + } + return 'unknown format'; + } + + var ARR_EACH = Array.prototype.forEach; + var ARR_SLICE = Array.prototype.slice; + var Common = { + BREAK: {}, + extend: function extend(target) { + this.each( + ARR_SLICE.call(arguments, 1), + function (obj) { + var keys = this.isObject(obj) ? Object.keys(obj) : []; + keys.forEach( + function (key) { + if (!this.isUndefined(obj[key])) { + target[key] = obj[key]; + } + }.bind(this), + ); + }, + this, + ); + return target; + }, + defaults: function defaults(target) { + this.each( + ARR_SLICE.call(arguments, 1), + function (obj) { + var keys = this.isObject(obj) ? Object.keys(obj) : []; + keys.forEach( + function (key) { + if (this.isUndefined(target[key])) { + target[key] = obj[key]; + } + }.bind(this), + ); + }, + this, + ); + return target; + }, + compose: function compose() { + var toCall = ARR_SLICE.call(arguments); + return function () { + var args = ARR_SLICE.call(arguments); + for (var i = toCall.length - 1; i >= 0; i--) { + args = [toCall[i].apply(this, args)]; + } + return args[0]; + }; + }, + each: function each(obj, itr, scope) { + if (!obj) { + return; + } + if (ARR_EACH && obj.forEach && obj.forEach === ARR_EACH) { + obj.forEach(itr, scope); + } else if (obj.length === obj.length + 0) { + var key = void 0; + var l = void 0; + for (key = 0, l = obj.length; key < l; key++) { + if (key in obj && itr.call(scope, obj[key], key) === this.BREAK) { + return; + } + } + } else { + for (var _key in obj) { + if (itr.call(scope, obj[_key], _key) === this.BREAK) { + return; + } + } + } + }, + defer: function defer(fnc) { + setTimeout(fnc, 0); + }, + debounce: function debounce(func, threshold, callImmediately) { + var timeout = void 0; + return function () { + var obj = this; + var args = arguments; + function delayed() { + timeout = null; + if (!callImmediately) func.apply(obj, args); + } + var callNow = callImmediately || !timeout; + clearTimeout(timeout); + timeout = setTimeout(delayed, threshold); + if (callNow) { + func.apply(obj, args); + } + }; + }, + toArray: function toArray(obj) { + if (obj.toArray) return obj.toArray(); + return ARR_SLICE.call(obj); + }, + isUndefined: function isUndefined(obj) { + return obj === undefined; + }, + isNull: function isNull(obj) { + return obj === null; + }, + isNaN: (function (_isNaN) { + function isNaN(_x) { + return _isNaN.apply(this, arguments); + } + isNaN.toString = function () { + return _isNaN.toString(); + }; + return isNaN; + })(function (obj) { + return isNaN(obj); + }), + isArray: + Array.isArray || + function (obj) { + return obj.constructor === Array; + }, + isObject: function isObject(obj) { + return obj === Object(obj); + }, + isNumber: function isNumber(obj) { + return obj === obj + 0; + }, + isString: function isString(obj) { + return obj === obj + ''; + }, + isBoolean: function isBoolean(obj) { + return obj === false || obj === true; + }, + isFunction: function isFunction(obj) { + return obj instanceof Function; + }, + }; + + var INTERPRETATIONS = [ + { + litmus: Common.isString, + conversions: { + THREE_CHAR_HEX: { + read: function read(original) { + var test = original.match(/^#([A-F0-9])([A-F0-9])([A-F0-9])$/i); + if (test === null) { + return false; + } + return { + space: 'HEX', + hex: parseInt( + '0x' + + test[1].toString() + + test[1].toString() + + test[2].toString() + + test[2].toString() + + test[3].toString() + + test[3].toString(), + 0, + ), + }; + }, + write: colorToString, + }, + SIX_CHAR_HEX: { + read: function read(original) { + var test = original.match(/^#([A-F0-9]{6})$/i); + if (test === null) { + return false; + } + return { + space: 'HEX', + hex: parseInt('0x' + test[1].toString(), 0), + }; + }, + write: colorToString, + }, + CSS_RGB: { + read: function read(original) { + var test = original.match(/^rgb\(\s*(.+)\s*,\s*(.+)\s*,\s*(.+)\s*\)/); + if (test === null) { + return false; + } + return { + space: 'RGB', + r: parseFloat(test[1]), + g: parseFloat(test[2]), + b: parseFloat(test[3]), + }; + }, + write: colorToString, + }, + CSS_RGBA: { + read: function read(original) { + var test = original.match(/^rgba\(\s*(.+)\s*,\s*(.+)\s*,\s*(.+)\s*,\s*(.+)\s*\)/); + if (test === null) { + return false; + } + return { + space: 'RGB', + r: parseFloat(test[1]), + g: parseFloat(test[2]), + b: parseFloat(test[3]), + a: parseFloat(test[4]), + }; + }, + write: colorToString, + }, + }, + }, + { + litmus: Common.isNumber, + conversions: { + HEX: { + read: function read(original) { + return { + space: 'HEX', + hex: original, + conversionName: 'HEX', + }; + }, + write: function write(color) { + return color.hex; + }, + }, + }, + }, + { + litmus: Common.isArray, + conversions: { + RGB_ARRAY: { + read: function read(original) { + if (original.length !== 3) { + return false; + } + return { + space: 'RGB', + r: original[0], + g: original[1], + b: original[2], + }; + }, + write: function write(color) { + return [color.r, color.g, color.b]; + }, + }, + RGBA_ARRAY: { + read: function read(original) { + if (original.length !== 4) return false; + return { + space: 'RGB', + r: original[0], + g: original[1], + b: original[2], + a: original[3], + }; + }, + write: function write(color) { + return [color.r, color.g, color.b, color.a]; + }, + }, + }, + }, + { + litmus: Common.isObject, + conversions: { + RGBA_OBJ: { + read: function read(original) { + if ( + Common.isNumber(original.r) && + Common.isNumber(original.g) && + Common.isNumber(original.b) && + Common.isNumber(original.a) + ) { + return { + space: 'RGB', + r: original.r, + g: original.g, + b: original.b, + a: original.a, + }; + } + return false; + }, + write: function write(color) { + return { + r: color.r, + g: color.g, + b: color.b, + a: color.a, + }; + }, + }, + RGB_OBJ: { + read: function read(original) { + if (Common.isNumber(original.r) && Common.isNumber(original.g) && Common.isNumber(original.b)) { + return { + space: 'RGB', + r: original.r, + g: original.g, + b: original.b, + }; + } + return false; + }, + write: function write(color) { + return { + r: color.r, + g: color.g, + b: color.b, + }; + }, + }, + HSVA_OBJ: { + read: function read(original) { + if ( + Common.isNumber(original.h) && + Common.isNumber(original.s) && + Common.isNumber(original.v) && + Common.isNumber(original.a) + ) { + return { + space: 'HSV', + h: original.h, + s: original.s, + v: original.v, + a: original.a, + }; + } + return false; + }, + write: function write(color) { + return { + h: color.h, + s: color.s, + v: color.v, + a: color.a, + }; + }, + }, + HSV_OBJ: { + read: function read(original) { + if (Common.isNumber(original.h) && Common.isNumber(original.s) && Common.isNumber(original.v)) { + return { + space: 'HSV', + h: original.h, + s: original.s, + v: original.v, + }; + } + return false; + }, + write: function write(color) { + return { + h: color.h, + s: color.s, + v: color.v, + }; + }, + }, + }, + }, + ]; + var result = void 0; + var toReturn = void 0; + var interpret = function interpret() { + toReturn = false; + var original = arguments.length > 1 ? Common.toArray(arguments) : arguments[0]; + Common.each(INTERPRETATIONS, function (family) { + if (family.litmus(original)) { + Common.each(family.conversions, function (conversion, conversionName) { + result = conversion.read(original); + if (toReturn === false && result !== false) { + toReturn = result; + result.conversionName = conversionName; + result.conversion = conversion; + return Common.BREAK; + } + }); + return Common.BREAK; + } + }); + return toReturn; + }; -function ___$insertStyle(css) { - if (!css) { - return; - } - if (typeof window === 'undefined') { - return; - } + var tmpComponent = void 0; + var ColorMath = { + hsv_to_rgb: function hsv_to_rgb(h, s, v) { + var hi = Math.floor(h / 60) % 6; + var f = h / 60 - Math.floor(h / 60); + var p = v * (1.0 - s); + var q = v * (1.0 - f * s); + var t = v * (1.0 - (1.0 - f) * s); + var c = [ + [v, t, p], + [q, v, p], + [p, v, t], + [p, q, v], + [t, p, v], + [v, p, q], + ][hi]; + return { + r: c[0] * 255, + g: c[1] * 255, + b: c[2] * 255, + }; + }, + rgb_to_hsv: function rgb_to_hsv(r, g, b) { + var min = Math.min(r, g, b); + var max = Math.max(r, g, b); + var delta = max - min; + var h = void 0; + var s = void 0; + if (max !== 0) { + s = delta / max; + } else { + return { + h: NaN, + s: 0, + v: 0, + }; + } + if (r === max) { + h = (g - b) / delta; + } else if (g === max) { + h = 2 + (b - r) / delta; + } else { + h = 4 + (r - g) / delta; + } + h /= 6; + if (h < 0) { + h += 1; + } + return { + h: h * 360, + s: s, + v: max / 255, + }; + }, + rgb_to_hex: function rgb_to_hex(r, g, b) { + var hex = this.hex_with_component(0, 2, r); + hex = this.hex_with_component(hex, 1, g); + hex = this.hex_with_component(hex, 0, b); + return hex; + }, + component_from_hex: function component_from_hex(hex, componentIndex) { + return (hex >> (componentIndex * 8)) & 0xff; + }, + hex_with_component: function hex_with_component(hex, componentIndex, value) { + return (value << (tmpComponent = componentIndex * 8)) | (hex & ~(0xff << tmpComponent)); + }, + }; - var style = document.createElement('style'); + var _typeof = + typeof Symbol === 'function' && typeof Symbol.iterator === 'symbol' + ? function (obj) { + return typeof obj; + } + : function (obj) { + return obj && typeof Symbol === 'function' && obj.constructor === Symbol && obj !== Symbol.prototype + ? 'symbol' + : typeof obj; + }; + + var classCallCheck = function (instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError('Cannot call a class as a function'); + } + }; - style.setAttribute('type', 'text/css'); - style.innerHTML = css; - document.head.appendChild(style); + var createClass = (function () { + function defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ('value' in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } - return css; -} + return function (Constructor, protoProps, staticProps) { + if (protoProps) defineProperties(Constructor.prototype, protoProps); + if (staticProps) defineProperties(Constructor, staticProps); + return Constructor; + }; + })(); + + var get = function get(object, property, receiver) { + if (object === null) object = Function.prototype; + var desc = Object.getOwnPropertyDescriptor(object, property); + + if (desc === undefined) { + var parent = Object.getPrototypeOf(object); + + if (parent === null) { + return undefined; + } else { + return get(parent, property, receiver); + } + } else if ('value' in desc) { + return desc.value; + } else { + var getter = desc.get; -function colorToString (color, forceCSSHex) { - var colorFormat = color.__state.conversionName.toString(); - var r = Math.round(color.r); - var g = Math.round(color.g); - var b = Math.round(color.b); - var a = color.a; - var h = Math.round(color.h); - var s = color.s.toFixed(1); - var v = color.v.toFixed(1); - if (forceCSSHex || colorFormat === 'THREE_CHAR_HEX' || colorFormat === 'SIX_CHAR_HEX') { - var str = color.hex.toString(16); - while (str.length < 6) { - str = '0' + str; - } - return '#' + str; - } else if (colorFormat === 'CSS_RGB') { - return 'rgb(' + r + ',' + g + ',' + b + ')'; - } else if (colorFormat === 'CSS_RGBA') { - return 'rgba(' + r + ',' + g + ',' + b + ',' + a + ')'; - } else if (colorFormat === 'HEX') { - return '0x' + color.hex.toString(16); - } else if (colorFormat === 'RGB_ARRAY') { - return '[' + r + ',' + g + ',' + b + ']'; - } else if (colorFormat === 'RGBA_ARRAY') { - return '[' + r + ',' + g + ',' + b + ',' + a + ']'; - } else if (colorFormat === 'RGB_OBJ') { - return '{r:' + r + ',g:' + g + ',b:' + b + '}'; - } else if (colorFormat === 'RGBA_OBJ') { - return '{r:' + r + ',g:' + g + ',b:' + b + ',a:' + a + '}'; - } else if (colorFormat === 'HSV_OBJ') { - return '{h:' + h + ',s:' + s + ',v:' + v + '}'; - } else if (colorFormat === 'HSVA_OBJ') { - return '{h:' + h + ',s:' + s + ',v:' + v + ',a:' + a + '}'; - } - return 'unknown format'; -} + if (getter === undefined) { + return undefined; + } -var ARR_EACH = Array.prototype.forEach; -var ARR_SLICE = Array.prototype.slice; -var Common = { - BREAK: {}, - extend: function extend(target) { - this.each(ARR_SLICE.call(arguments, 1), function (obj) { - var keys = this.isObject(obj) ? Object.keys(obj) : []; - keys.forEach(function (key) { - if (!this.isUndefined(obj[key])) { - target[key] = obj[key]; + return getter.call(receiver); } - }.bind(this)); - }, this); - return target; - }, - defaults: function defaults(target) { - this.each(ARR_SLICE.call(arguments, 1), function (obj) { - var keys = this.isObject(obj) ? Object.keys(obj) : []; - keys.forEach(function (key) { - if (this.isUndefined(target[key])) { - target[key] = obj[key]; + }; + + var inherits = function (subClass, superClass) { + if (typeof superClass !== 'function' && superClass !== null) { + throw new TypeError('Super expression must either be null or a function, not ' + typeof superClass); } - }.bind(this)); - }, this); - return target; - }, - compose: function compose() { - var toCall = ARR_SLICE.call(arguments); - return function () { - var args = ARR_SLICE.call(arguments); - for (var i = toCall.length - 1; i >= 0; i--) { - args = [toCall[i].apply(this, args)]; - } - return args[0]; + + subClass.prototype = Object.create(superClass && superClass.prototype, { + constructor: { + value: subClass, + enumerable: false, + writable: true, + configurable: true, + }, + }); + if (superClass) + Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : (subClass.__proto__ = superClass); }; - }, - each: function each(obj, itr, scope) { - if (!obj) { - return; - } - if (ARR_EACH && obj.forEach && obj.forEach === ARR_EACH) { - obj.forEach(itr, scope); - } else if (obj.length === obj.length + 0) { - var key = void 0; - var l = void 0; - for (key = 0, l = obj.length; key < l; key++) { - if (key in obj && itr.call(scope, obj[key], key) === this.BREAK) { - return; + + var possibleConstructorReturn = function (self, call) { + if (!self) { + throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } - } - } else { - for (var _key in obj) { - if (itr.call(scope, obj[_key], _key) === this.BREAK) { - return; + + return call && (typeof call === 'object' || typeof call === 'function') ? call : self; + }; + + var Color = (function () { + function Color() { + classCallCheck(this, Color); + this.__state = interpret.apply(this, arguments); + if (this.__state === false) { + throw new Error('Failed to interpret color arguments'); + } + this.__state.a = this.__state.a || 1; } - } + createClass(Color, [ + { + key: 'toString', + value: function toString() { + return colorToString(this); + }, + }, + { + key: 'toHexString', + value: function toHexString() { + return colorToString(this, true); + }, + }, + { + key: 'toOriginal', + value: function toOriginal() { + return this.__state.conversion.write(this); + }, + }, + ]); + return Color; + })(); + function defineRGBComponent(target, component, componentHexIndex) { + Object.defineProperty(target, component, { + get: function get$$1() { + if (this.__state.space === 'RGB') { + return this.__state[component]; + } + Color.recalculateRGB(this, component, componentHexIndex); + return this.__state[component]; + }, + set: function set$$1(v) { + if (this.__state.space !== 'RGB') { + Color.recalculateRGB(this, component, componentHexIndex); + this.__state.space = 'RGB'; + } + this.__state[component] = v; + }, + }); } - }, - defer: function defer(fnc) { - setTimeout(fnc, 0); - }, - debounce: function debounce(func, threshold, callImmediately) { - var timeout = void 0; - return function () { - var obj = this; - var args = arguments; - function delayed() { - timeout = null; - if (!callImmediately) func.apply(obj, args); - } - var callNow = callImmediately || !timeout; - clearTimeout(timeout); - timeout = setTimeout(delayed, threshold); - if (callNow) { - func.apply(obj, args); - } - }; - }, - toArray: function toArray(obj) { - if (obj.toArray) return obj.toArray(); - return ARR_SLICE.call(obj); - }, - isUndefined: function isUndefined(obj) { - return obj === undefined; - }, - isNull: function isNull(obj) { - return obj === null; - }, - isNaN: function (_isNaN) { - function isNaN(_x) { - return _isNaN.apply(this, arguments); + function defineHSVComponent(target, component) { + Object.defineProperty(target, component, { + get: function get$$1() { + if (this.__state.space === 'HSV') { + return this.__state[component]; + } + Color.recalculateHSV(this); + return this.__state[component]; + }, + set: function set$$1(v) { + if (this.__state.space !== 'HSV') { + Color.recalculateHSV(this); + this.__state.space = 'HSV'; + } + this.__state[component] = v; + }, + }); } - isNaN.toString = function () { - return _isNaN.toString(); + Color.recalculateRGB = function (color, component, componentHexIndex) { + if (color.__state.space === 'HEX') { + color.__state[component] = ColorMath.component_from_hex(color.__state.hex, componentHexIndex); + } else if (color.__state.space === 'HSV') { + Common.extend(color.__state, ColorMath.hsv_to_rgb(color.__state.h, color.__state.s, color.__state.v)); + } else { + throw new Error('Corrupted color state'); + } + }; + Color.recalculateHSV = function (color) { + var result = ColorMath.rgb_to_hsv(color.r, color.g, color.b); + Common.extend(color.__state, { + s: result.s, + v: result.v, + }); + if (!Common.isNaN(result.h)) { + color.__state.h = result.h; + } else if (Common.isUndefined(color.__state.h)) { + color.__state.h = 0; + } }; - return isNaN; - }(function (obj) { - return isNaN(obj); - }), - isArray: Array.isArray || function (obj) { - return obj.constructor === Array; - }, - isObject: function isObject(obj) { - return obj === Object(obj); - }, - isNumber: function isNumber(obj) { - return obj === obj + 0; - }, - isString: function isString(obj) { - return obj === obj + ''; - }, - isBoolean: function isBoolean(obj) { - return obj === false || obj === true; - }, - isFunction: function isFunction(obj) { - return obj instanceof Function; - } -}; + Color.COMPONENTS = ['r', 'g', 'b', 'h', 's', 'v', 'hex', 'a']; + defineRGBComponent(Color.prototype, 'r', 2); + defineRGBComponent(Color.prototype, 'g', 1); + defineRGBComponent(Color.prototype, 'b', 0); + defineHSVComponent(Color.prototype, 'h'); + defineHSVComponent(Color.prototype, 's'); + defineHSVComponent(Color.prototype, 'v'); + Object.defineProperty(Color.prototype, 'a', { + get: function get$$1() { + return this.__state.a; + }, + set: function set$$1(v) { + this.__state.a = v; + }, + }); + Object.defineProperty(Color.prototype, 'hex', { + get: function get$$1() { + if (this.__state.space !== 'HEX') { + this.__state.hex = ColorMath.rgb_to_hex(this.r, this.g, this.b); + this.__state.space = 'HEX'; + } + return this.__state.hex; + }, + set: function set$$1(v) { + this.__state.space = 'HEX'; + this.__state.hex = v; + }, + }); -var INTERPRETATIONS = [ -{ - litmus: Common.isString, - conversions: { - THREE_CHAR_HEX: { - read: function read(original) { - var test = original.match(/^#([A-F0-9])([A-F0-9])([A-F0-9])$/i); - if (test === null) { - return false; + var Controller = (function () { + function Controller(object, property) { + classCallCheck(this, Controller); + this.initialValue = object[property]; + this.domElement = document.createElement('div'); + this.object = object; + this.property = property; + this.__onChange = undefined; + this.__onFinishChange = undefined; } - return { - space: 'HEX', - hex: parseInt('0x' + test[1].toString() + test[1].toString() + test[2].toString() + test[2].toString() + test[3].toString() + test[3].toString(), 0) - }; - }, - write: colorToString - }, - SIX_CHAR_HEX: { - read: function read(original) { - var test = original.match(/^#([A-F0-9]{6})$/i); - if (test === null) { - return false; + createClass(Controller, [ + { + key: 'onChange', + value: function onChange(fnc) { + this.__onChange = fnc; + return this; + }, + }, + { + key: 'onFinishChange', + value: function onFinishChange(fnc) { + this.__onFinishChange = fnc; + return this; + }, + }, + { + key: 'setValue', + value: function setValue(newValue) { + this.object[this.property] = newValue; + if (this.__onChange) { + this.__onChange.call(this, newValue); + } + this.updateDisplay(); + return this; + }, + }, + { + key: 'getValue', + value: function getValue() { + return this.object[this.property]; + }, + }, + { + key: 'updateDisplay', + value: function updateDisplay() { + return this; + }, + }, + { + key: 'isModified', + value: function isModified() { + return this.initialValue !== this.getValue(); + }, + }, + ]); + return Controller; + })(); + + var EVENT_MAP = { + HTMLEvents: ['change'], + MouseEvents: ['click', 'mousemove', 'mousedown', 'mouseup', 'mouseover'], + KeyboardEvents: ['keydown'], + }; + var EVENT_MAP_INV = {}; + Common.each(EVENT_MAP, function (v, k) { + Common.each(v, function (e) { + EVENT_MAP_INV[e] = k; + }); + }); + var CSS_VALUE_PIXELS = /(\d+(\.\d+)?)px/; + function cssValueToPixels(val) { + if (val === '0' || Common.isUndefined(val)) { + return 0; } - return { - space: 'HEX', - hex: parseInt('0x' + test[1].toString(), 0) - }; - }, - write: colorToString - }, - CSS_RGB: { - read: function read(original) { - var test = original.match(/^rgb\(\s*(.+)\s*,\s*(.+)\s*,\s*(.+)\s*\)/); - if (test === null) { - return false; + var match = val.match(CSS_VALUE_PIXELS); + if (!Common.isNull(match)) { + return parseFloat(match[1]); } - return { - space: 'RGB', - r: parseFloat(test[1]), - g: parseFloat(test[2]), - b: parseFloat(test[3]) - }; - }, - write: colorToString - }, - CSS_RGBA: { - read: function read(original) { - var test = original.match(/^rgba\(\s*(.+)\s*,\s*(.+)\s*,\s*(.+)\s*,\s*(.+)\s*\)/); - if (test === null) { - return false; + return 0; + } + var dom = { + makeSelectable: function makeSelectable(elem, selectable) { + if (elem === undefined || elem.style === undefined) return; + elem.onselectstart = selectable + ? function () { + return false; + } + : function () {}; + elem.style.MozUserSelect = selectable ? 'auto' : 'none'; + elem.style.KhtmlUserSelect = selectable ? 'auto' : 'none'; + elem.unselectable = selectable ? 'on' : 'off'; + }, + makeFullscreen: function makeFullscreen(elem, hor, vert) { + var vertical = vert; + var horizontal = hor; + if (Common.isUndefined(horizontal)) { + horizontal = true; + } + if (Common.isUndefined(vertical)) { + vertical = true; + } + elem.style.position = 'absolute'; + if (horizontal) { + elem.style.left = 0; + elem.style.right = 0; + } + if (vertical) { + elem.style.top = 0; + elem.style.bottom = 0; + } + }, + fakeEvent: function fakeEvent(elem, eventType, pars, aux) { + var params = pars || {}; + var className = EVENT_MAP_INV[eventType]; + if (!className) { + throw new Error('Event type ' + eventType + ' not supported.'); + } + var evt = document.createEvent(className); + switch (className) { + case 'MouseEvents': { + var clientX = params.x || params.clientX || 0; + var clientY = params.y || params.clientY || 0; + evt.initMouseEvent( + eventType, + params.bubbles || false, + params.cancelable || true, + window, + params.clickCount || 1, + 0, + 0, + clientX, + clientY, + false, + false, + false, + false, + 0, + null, + ); + break; + } + case 'KeyboardEvents': { + var init = evt.initKeyboardEvent || evt.initKeyEvent; + Common.defaults(params, { + cancelable: true, + ctrlKey: false, + altKey: false, + shiftKey: false, + metaKey: false, + keyCode: undefined, + charCode: undefined, + }); + init( + eventType, + params.bubbles || false, + params.cancelable, + window, + params.ctrlKey, + params.altKey, + params.shiftKey, + params.metaKey, + params.keyCode, + params.charCode, + ); + break; + } + default: { + evt.initEvent(eventType, params.bubbles || false, params.cancelable || true); + break; + } + } + Common.defaults(evt, aux); + elem.dispatchEvent(evt); + }, + bind: function bind(elem, event, func, newBool) { + var bool = newBool || false; + if (elem.addEventListener) { + elem.addEventListener(event, func, bool); + } else if (elem.attachEvent) { + elem.attachEvent('on' + event, func); + } + return dom; + }, + unbind: function unbind(elem, event, func, newBool) { + var bool = newBool || false; + if (elem.removeEventListener) { + elem.removeEventListener(event, func, bool); + } else if (elem.detachEvent) { + elem.detachEvent('on' + event, func); + } + return dom; + }, + addClass: function addClass(elem, className) { + if (elem.className === undefined) { + elem.className = className; + } else if (elem.className !== className) { + var classes = elem.className.split(/ +/); + if (classes.indexOf(className) === -1) { + classes.push(className); + elem.className = classes.join(' ').replace(/^\s+/, '').replace(/\s+$/, ''); + } + } + return dom; + }, + removeClass: function removeClass(elem, className) { + if (className) { + if (elem.className === className) { + elem.removeAttribute('class'); + } else { + var classes = elem.className.split(/ +/); + var index = classes.indexOf(className); + if (index !== -1) { + classes.splice(index, 1); + elem.className = classes.join(' '); + } + } + } else { + elem.className = undefined; + } + return dom; + }, + hasClass: function hasClass(elem, className) { + return new RegExp('(?:^|\\s+)' + className + '(?:\\s+|$)').test(elem.className) || false; + }, + getWidth: function getWidth(elem) { + var style = getComputedStyle(elem); + return ( + cssValueToPixels(style['border-left-width']) + + cssValueToPixels(style['border-right-width']) + + cssValueToPixels(style['padding-left']) + + cssValueToPixels(style['padding-right']) + + cssValueToPixels(style.width) + ); + }, + getHeight: function getHeight(elem) { + var style = getComputedStyle(elem); + return ( + cssValueToPixels(style['border-top-width']) + + cssValueToPixels(style['border-bottom-width']) + + cssValueToPixels(style['padding-top']) + + cssValueToPixels(style['padding-bottom']) + + cssValueToPixels(style.height) + ); + }, + getOffset: function getOffset(el) { + var elem = el; + var offset = { left: 0, top: 0 }; + if (elem.offsetParent) { + do { + offset.left += elem.offsetLeft; + offset.top += elem.offsetTop; + elem = elem.offsetParent; + } while (elem); + } + return offset; + }, + isActive: function isActive(elem) { + return elem === document.activeElement && (elem.type || elem.href); + }, + }; + + var BooleanController = (function (_Controller) { + inherits(BooleanController, _Controller); + function BooleanController(object, property) { + classCallCheck(this, BooleanController); + var _this2 = possibleConstructorReturn( + this, + (BooleanController.__proto__ || Object.getPrototypeOf(BooleanController)).call(this, object, property), + ); + var _this = _this2; + _this2.__prev = _this2.getValue(); + _this2.__checkbox = document.createElement('input'); + _this2.__checkbox.setAttribute('type', 'checkbox'); + function onChange() { + _this.setValue(!_this.__prev); + } + dom.bind(_this2.__checkbox, 'change', onChange, false); + _this2.domElement.appendChild(_this2.__checkbox); + _this2.updateDisplay(); + return _this2; } - return { - space: 'RGB', - r: parseFloat(test[1]), - g: parseFloat(test[2]), - b: parseFloat(test[3]), - a: parseFloat(test[4]) - }; - }, - write: colorToString - } - } -}, -{ - litmus: Common.isNumber, - conversions: { - HEX: { - read: function read(original) { - return { - space: 'HEX', - hex: original, - conversionName: 'HEX' - }; - }, - write: function write(color) { - return color.hex; - } - } - } -}, -{ - litmus: Common.isArray, - conversions: { - RGB_ARRAY: { - read: function read(original) { - if (original.length !== 3) { - return false; + createClass(BooleanController, [ + { + key: 'setValue', + value: function setValue(v) { + var toReturn = get( + BooleanController.prototype.__proto__ || Object.getPrototypeOf(BooleanController.prototype), + 'setValue', + this, + ).call(this, v); + if (this.__onFinishChange) { + this.__onFinishChange.call(this, this.getValue()); + } + this.__prev = this.getValue(); + return toReturn; + }, + }, + { + key: 'updateDisplay', + value: function updateDisplay() { + if (this.getValue() === true) { + this.__checkbox.setAttribute('checked', 'checked'); + this.__checkbox.checked = true; + this.__prev = true; + } else { + this.__checkbox.checked = false; + this.__prev = false; + } + return get( + BooleanController.prototype.__proto__ || Object.getPrototypeOf(BooleanController.prototype), + 'updateDisplay', + this, + ).call(this); + }, + }, + ]); + return BooleanController; + })(Controller); + + var OptionController = (function (_Controller) { + inherits(OptionController, _Controller); + function OptionController(object, property, opts) { + classCallCheck(this, OptionController); + var _this2 = possibleConstructorReturn( + this, + (OptionController.__proto__ || Object.getPrototypeOf(OptionController)).call(this, object, property), + ); + var options = opts; + var _this = _this2; + _this2.__select = document.createElement('select'); + if (Common.isArray(options)) { + var map = {}; + Common.each(options, function (element) { + map[element] = element; + }); + options = map; + } + Common.each(options, function (value, key) { + var opt = document.createElement('option'); + opt.innerHTML = key; + opt.setAttribute('value', value); + _this.__select.appendChild(opt); + }); + _this2.updateDisplay(); + dom.bind(_this2.__select, 'change', function () { + var desiredValue = this.options[this.selectedIndex].value; + _this.setValue(desiredValue); + }); + _this2.domElement.appendChild(_this2.__select); + return _this2; } - return { - space: 'RGB', - r: original[0], - g: original[1], - b: original[2] - }; - }, - write: function write(color) { - return [color.r, color.g, color.b]; - } - }, - RGBA_ARRAY: { - read: function read(original) { - if (original.length !== 4) return false; - return { - space: 'RGB', - r: original[0], - g: original[1], - b: original[2], - a: original[3] - }; - }, - write: function write(color) { - return [color.r, color.g, color.b, color.a]; - } - } - } -}, -{ - litmus: Common.isObject, - conversions: { - RGBA_OBJ: { - read: function read(original) { - if (Common.isNumber(original.r) && Common.isNumber(original.g) && Common.isNumber(original.b) && Common.isNumber(original.a)) { - return { - space: 'RGB', - r: original.r, - g: original.g, - b: original.b, - a: original.a - }; + createClass(OptionController, [ + { + key: 'setValue', + value: function setValue(v) { + var toReturn = get( + OptionController.prototype.__proto__ || Object.getPrototypeOf(OptionController.prototype), + 'setValue', + this, + ).call(this, v); + if (this.__onFinishChange) { + this.__onFinishChange.call(this, this.getValue()); + } + return toReturn; + }, + }, + { + key: 'updateDisplay', + value: function updateDisplay() { + if (dom.isActive(this.__select)) return this; + this.__select.value = this.getValue(); + return get( + OptionController.prototype.__proto__ || Object.getPrototypeOf(OptionController.prototype), + 'updateDisplay', + this, + ).call(this); + }, + }, + ]); + return OptionController; + })(Controller); + + var StringController = (function (_Controller) { + inherits(StringController, _Controller); + function StringController(object, property) { + classCallCheck(this, StringController); + var _this2 = possibleConstructorReturn( + this, + (StringController.__proto__ || Object.getPrototypeOf(StringController)).call(this, object, property), + ); + var _this = _this2; + function onChange() { + _this.setValue(_this.__input.value); + } + function onBlur() { + if (_this.__onFinishChange) { + _this.__onFinishChange.call(_this, _this.getValue()); + } + } + _this2.__input = document.createElement('input'); + _this2.__input.setAttribute('type', 'text'); + dom.bind(_this2.__input, 'keyup', onChange); + dom.bind(_this2.__input, 'change', onChange); + dom.bind(_this2.__input, 'blur', onBlur); + dom.bind(_this2.__input, 'keydown', function (e) { + if (e.keyCode === 13) { + this.blur(); + } + }); + _this2.updateDisplay(); + _this2.domElement.appendChild(_this2.__input); + return _this2; } - return false; - }, - write: function write(color) { - return { - r: color.r, - g: color.g, - b: color.b, - a: color.a - }; - } - }, - RGB_OBJ: { - read: function read(original) { - if (Common.isNumber(original.r) && Common.isNumber(original.g) && Common.isNumber(original.b)) { - return { - space: 'RGB', - r: original.r, - g: original.g, - b: original.b - }; + createClass(StringController, [ + { + key: 'updateDisplay', + value: function updateDisplay() { + if (!dom.isActive(this.__input)) { + this.__input.value = this.getValue(); + } + return get( + StringController.prototype.__proto__ || Object.getPrototypeOf(StringController.prototype), + 'updateDisplay', + this, + ).call(this); + }, + }, + ]); + return StringController; + })(Controller); + + function numDecimals(x) { + var _x = x.toString(); + if (_x.indexOf('.') > -1) { + return _x.length - _x.indexOf('.') - 1; } - return false; - }, - write: function write(color) { - return { - r: color.r, - g: color.g, - b: color.b - }; - } - }, - HSVA_OBJ: { - read: function read(original) { - if (Common.isNumber(original.h) && Common.isNumber(original.s) && Common.isNumber(original.v) && Common.isNumber(original.a)) { - return { - space: 'HSV', - h: original.h, - s: original.s, - v: original.v, - a: original.a - }; + return 0; + } + var NumberController = (function (_Controller) { + inherits(NumberController, _Controller); + function NumberController(object, property, params) { + classCallCheck(this, NumberController); + var _this = possibleConstructorReturn( + this, + (NumberController.__proto__ || Object.getPrototypeOf(NumberController)).call(this, object, property), + ); + var _params = params || {}; + _this.__min = _params.min; + _this.__max = _params.max; + _this.__step = _params.step; + if (Common.isUndefined(_this.__step)) { + if (_this.initialValue === 0) { + _this.__impliedStep = 1; + } else { + _this.__impliedStep = + Math.pow(10, Math.floor(Math.log(Math.abs(_this.initialValue)) / Math.LN10)) / 10; + } + } else { + _this.__impliedStep = _this.__step; + } + _this.__precision = numDecimals(_this.__impliedStep); + return _this; } - return false; - }, - write: function write(color) { - return { - h: color.h, - s: color.s, - v: color.v, - a: color.a - }; - } - }, - HSV_OBJ: { - read: function read(original) { - if (Common.isNumber(original.h) && Common.isNumber(original.s) && Common.isNumber(original.v)) { - return { - space: 'HSV', - h: original.h, - s: original.s, - v: original.v - }; + createClass(NumberController, [ + { + key: 'setValue', + value: function setValue(v) { + var _v = v; + if (this.__min !== undefined && _v < this.__min) { + _v = this.__min; + } else if (this.__max !== undefined && _v > this.__max) { + _v = this.__max; + } + if (this.__step !== undefined && _v % this.__step !== 0) { + _v = Math.round(_v / this.__step) * this.__step; + } + return get( + NumberController.prototype.__proto__ || Object.getPrototypeOf(NumberController.prototype), + 'setValue', + this, + ).call(this, _v); + }, + }, + { + key: 'min', + value: function min(minValue) { + this.__min = minValue; + return this; + }, + }, + { + key: 'max', + value: function max(maxValue) { + this.__max = maxValue; + return this; + }, + }, + { + key: 'step', + value: function step(stepValue) { + this.__step = stepValue; + this.__impliedStep = stepValue; + this.__precision = numDecimals(stepValue); + return this; + }, + }, + ]); + return NumberController; + })(Controller); + + function roundToDecimal(value, decimals) { + var tenTo = Math.pow(10, decimals); + return Math.round(value * tenTo) / tenTo; + } + var NumberControllerBox = (function (_NumberController) { + inherits(NumberControllerBox, _NumberController); + function NumberControllerBox(object, property, params) { + classCallCheck(this, NumberControllerBox); + var _this2 = possibleConstructorReturn( + this, + (NumberControllerBox.__proto__ || Object.getPrototypeOf(NumberControllerBox)).call( + this, + object, + property, + params, + ), + ); + _this2.__truncationSuspended = false; + var _this = _this2; + var prevY = void 0; + function onChange() { + var attempted = parseFloat(_this.__input.value); + if (!Common.isNaN(attempted)) { + _this.setValue(attempted); + } + } + function onFinish() { + if (_this.__onFinishChange) { + _this.__onFinishChange.call(_this, _this.getValue()); + } + } + function onBlur() { + onFinish(); + } + function onMouseDrag(e) { + var diff = prevY - e.clientY; + _this.setValue(_this.getValue() + diff * _this.__impliedStep); + prevY = e.clientY; + } + function onMouseUp() { + dom.unbind(window, 'mousemove', onMouseDrag); + dom.unbind(window, 'mouseup', onMouseUp); + onFinish(); + } + function onMouseDown(e) { + dom.bind(window, 'mousemove', onMouseDrag); + dom.bind(window, 'mouseup', onMouseUp); + prevY = e.clientY; + } + _this2.__input = document.createElement('input'); + _this2.__input.setAttribute('type', 'text'); + dom.bind(_this2.__input, 'change', onChange); + dom.bind(_this2.__input, 'blur', onBlur); + dom.bind(_this2.__input, 'mousedown', onMouseDown); + dom.bind(_this2.__input, 'keydown', function (e) { + if (e.keyCode === 13) { + _this.__truncationSuspended = true; + this.blur(); + _this.__truncationSuspended = false; + onFinish(); + } + }); + _this2.updateDisplay(); + _this2.domElement.appendChild(_this2.__input); + return _this2; } - return false; - }, - write: function write(color) { - return { - h: color.h, - s: color.s, - v: color.v - }; - } - } - } -}]; -var result = void 0; -var toReturn = void 0; -var interpret = function interpret() { - toReturn = false; - var original = arguments.length > 1 ? Common.toArray(arguments) : arguments[0]; - Common.each(INTERPRETATIONS, function (family) { - if (family.litmus(original)) { - Common.each(family.conversions, function (conversion, conversionName) { - result = conversion.read(original); - if (toReturn === false && result !== false) { - toReturn = result; - result.conversionName = conversionName; - result.conversion = conversion; - return Common.BREAK; + createClass(NumberControllerBox, [ + { + key: 'updateDisplay', + value: function updateDisplay() { + this.__input.value = this.__truncationSuspended + ? this.getValue() + : roundToDecimal(this.getValue(), this.__precision); + return get( + NumberControllerBox.prototype.__proto__ || Object.getPrototypeOf(NumberControllerBox.prototype), + 'updateDisplay', + this, + ).call(this); + }, + }, + ]); + return NumberControllerBox; + })(NumberController); + + function map(v, i1, i2, o1, o2) { + return o1 + (o2 - o1) * ((v - i1) / (i2 - i1)); + } + var NumberControllerSlider = (function (_NumberController) { + inherits(NumberControllerSlider, _NumberController); + function NumberControllerSlider(object, property, min, max, step) { + classCallCheck(this, NumberControllerSlider); + var _this2 = possibleConstructorReturn( + this, + (NumberControllerSlider.__proto__ || Object.getPrototypeOf(NumberControllerSlider)).call( + this, + object, + property, + { min: min, max: max, step: step }, + ), + ); + var _this = _this2; + _this2.__background = document.createElement('div'); + _this2.__foreground = document.createElement('div'); + dom.bind(_this2.__background, 'mousedown', onMouseDown); + dom.bind(_this2.__background, 'touchstart', onTouchStart); + dom.addClass(_this2.__background, 'slider'); + dom.addClass(_this2.__foreground, 'slider-fg'); + function onMouseDown(e) { + document.activeElement.blur(); + dom.bind(window, 'mousemove', onMouseDrag); + dom.bind(window, 'mouseup', onMouseUp); + onMouseDrag(e); + } + function onMouseDrag(e) { + e.preventDefault(); + var bgRect = _this.__background.getBoundingClientRect(); + _this.setValue(map(e.clientX, bgRect.left, bgRect.right, _this.__min, _this.__max)); + return false; + } + function onMouseUp() { + dom.unbind(window, 'mousemove', onMouseDrag); + dom.unbind(window, 'mouseup', onMouseUp); + if (_this.__onFinishChange) { + _this.__onFinishChange.call(_this, _this.getValue()); + } + } + function onTouchStart(e) { + if (e.touches.length !== 1) { + return; + } + dom.bind(window, 'touchmove', onTouchMove); + dom.bind(window, 'touchend', onTouchEnd); + onTouchMove(e); + } + function onTouchMove(e) { + var clientX = e.touches[0].clientX; + var bgRect = _this.__background.getBoundingClientRect(); + _this.setValue(map(clientX, bgRect.left, bgRect.right, _this.__min, _this.__max)); + } + function onTouchEnd() { + dom.unbind(window, 'touchmove', onTouchMove); + dom.unbind(window, 'touchend', onTouchEnd); + if (_this.__onFinishChange) { + _this.__onFinishChange.call(_this, _this.getValue()); + } + } + _this2.updateDisplay(); + _this2.__background.appendChild(_this2.__foreground); + _this2.domElement.appendChild(_this2.__background); + return _this2; } - }); - return Common.BREAK; - } - }); - return toReturn; -}; - -var tmpComponent = void 0; -var ColorMath = { - hsv_to_rgb: function hsv_to_rgb(h, s, v) { - var hi = Math.floor(h / 60) % 6; - var f = h / 60 - Math.floor(h / 60); - var p = v * (1.0 - s); - var q = v * (1.0 - f * s); - var t = v * (1.0 - (1.0 - f) * s); - var c = [[v, t, p], [q, v, p], [p, v, t], [p, q, v], [t, p, v], [v, p, q]][hi]; - return { - r: c[0] * 255, - g: c[1] * 255, - b: c[2] * 255 - }; - }, - rgb_to_hsv: function rgb_to_hsv(r, g, b) { - var min = Math.min(r, g, b); - var max = Math.max(r, g, b); - var delta = max - min; - var h = void 0; - var s = void 0; - if (max !== 0) { - s = delta / max; - } else { - return { - h: NaN, - s: 0, - v: 0 - }; - } - if (r === max) { - h = (g - b) / delta; - } else if (g === max) { - h = 2 + (b - r) / delta; - } else { - h = 4 + (r - g) / delta; - } - h /= 6; - if (h < 0) { - h += 1; + createClass(NumberControllerSlider, [ + { + key: 'updateDisplay', + value: function updateDisplay() { + var pct = (this.getValue() - this.__min) / (this.__max - this.__min); + this.__foreground.style.width = pct * 100 + '%'; + return get( + NumberControllerSlider.prototype.__proto__ || + Object.getPrototypeOf(NumberControllerSlider.prototype), + 'updateDisplay', + this, + ).call(this); + }, + }, + ]); + return NumberControllerSlider; + })(NumberController); + + var FunctionController = (function (_Controller) { + inherits(FunctionController, _Controller); + function FunctionController(object, property, text) { + classCallCheck(this, FunctionController); + var _this2 = possibleConstructorReturn( + this, + (FunctionController.__proto__ || Object.getPrototypeOf(FunctionController)).call( + this, + object, + property, + ), + ); + var _this = _this2; + _this2.__button = document.createElement('div'); + _this2.__button.innerHTML = text === undefined ? 'Fire' : text; + dom.bind(_this2.__button, 'click', function (e) { + e.preventDefault(); + _this.fire(); + return false; + }); + dom.addClass(_this2.__button, 'button'); + _this2.domElement.appendChild(_this2.__button); + return _this2; + } + createClass(FunctionController, [ + { + key: 'fire', + value: function fire() { + if (this.__onChange) { + this.__onChange.call(this); + } + this.getValue().call(this.object); + if (this.__onFinishChange) { + this.__onFinishChange.call(this, this.getValue()); + } + }, + }, + ]); + return FunctionController; + })(Controller); + + var ColorController = (function (_Controller) { + inherits(ColorController, _Controller); + function ColorController(object, property) { + classCallCheck(this, ColorController); + var _this2 = possibleConstructorReturn( + this, + (ColorController.__proto__ || Object.getPrototypeOf(ColorController)).call(this, object, property), + ); + _this2.__color = new Color(_this2.getValue()); + _this2.__temp = new Color(0); + var _this = _this2; + _this2.domElement = document.createElement('div'); + dom.makeSelectable(_this2.domElement, false); + _this2.__selector = document.createElement('div'); + _this2.__selector.className = 'selector'; + _this2.__saturation_field = document.createElement('div'); + _this2.__saturation_field.className = 'saturation-field'; + _this2.__field_knob = document.createElement('div'); + _this2.__field_knob.className = 'field-knob'; + _this2.__field_knob_border = '2px solid '; + _this2.__hue_knob = document.createElement('div'); + _this2.__hue_knob.className = 'hue-knob'; + _this2.__hue_field = document.createElement('div'); + _this2.__hue_field.className = 'hue-field'; + _this2.__input = document.createElement('input'); + _this2.__input.type = 'text'; + _this2.__input_textShadow = '0 1px 1px '; + dom.bind(_this2.__input, 'keydown', function (e) { + if (e.keyCode === 13) { + onBlur.call(this); + } + }); + dom.bind(_this2.__input, 'blur', onBlur); + dom.bind(_this2.__selector, 'mousedown', function () { + dom.addClass(this, 'drag').bind(window, 'mouseup', function () { + dom.removeClass(_this.__selector, 'drag'); + }); + }); + dom.bind(_this2.__selector, 'touchstart', function () { + dom.addClass(this, 'drag').bind(window, 'touchend', function () { + dom.removeClass(_this.__selector, 'drag'); + }); + }); + var valueField = document.createElement('div'); + Common.extend(_this2.__selector.style, { + width: '122px', + height: '102px', + padding: '3px', + backgroundColor: '#222', + boxShadow: '0px 1px 3px rgba(0,0,0,0.3)', + }); + Common.extend(_this2.__field_knob.style, { + position: 'absolute', + width: '12px', + height: '12px', + border: _this2.__field_knob_border + (_this2.__color.v < 0.5 ? '#fff' : '#000'), + boxShadow: '0px 1px 3px rgba(0,0,0,0.5)', + borderRadius: '12px', + zIndex: 1, + }); + Common.extend(_this2.__hue_knob.style, { + position: 'absolute', + width: '15px', + height: '2px', + borderRight: '4px solid #fff', + zIndex: 1, + }); + Common.extend(_this2.__saturation_field.style, { + width: '100px', + height: '100px', + border: '1px solid #555', + marginRight: '3px', + display: 'inline-block', + cursor: 'pointer', + }); + Common.extend(valueField.style, { + width: '100%', + height: '100%', + background: 'none', + }); + linearGradient(valueField, 'top', 'rgba(0,0,0,0)', '#000'); + Common.extend(_this2.__hue_field.style, { + width: '15px', + height: '100px', + border: '1px solid #555', + cursor: 'ns-resize', + position: 'absolute', + top: '3px', + right: '3px', + }); + hueGradient(_this2.__hue_field); + Common.extend(_this2.__input.style, { + outline: 'none', + textAlign: 'center', + color: '#fff', + border: 0, + fontWeight: 'bold', + textShadow: _this2.__input_textShadow + 'rgba(0,0,0,0.7)', + }); + dom.bind(_this2.__saturation_field, 'mousedown', fieldDown); + dom.bind(_this2.__saturation_field, 'touchstart', fieldDown); + dom.bind(_this2.__field_knob, 'mousedown', fieldDown); + dom.bind(_this2.__field_knob, 'touchstart', fieldDown); + dom.bind(_this2.__hue_field, 'mousedown', fieldDownH); + dom.bind(_this2.__hue_field, 'touchstart', fieldDownH); + function fieldDown(e) { + setSV(e); + dom.bind(window, 'mousemove', setSV); + dom.bind(window, 'touchmove', setSV); + dom.bind(window, 'mouseup', fieldUpSV); + dom.bind(window, 'touchend', fieldUpSV); + } + function fieldDownH(e) { + setH(e); + dom.bind(window, 'mousemove', setH); + dom.bind(window, 'touchmove', setH); + dom.bind(window, 'mouseup', fieldUpH); + dom.bind(window, 'touchend', fieldUpH); + } + function fieldUpSV() { + dom.unbind(window, 'mousemove', setSV); + dom.unbind(window, 'touchmove', setSV); + dom.unbind(window, 'mouseup', fieldUpSV); + dom.unbind(window, 'touchend', fieldUpSV); + onFinish(); + } + function fieldUpH() { + dom.unbind(window, 'mousemove', setH); + dom.unbind(window, 'touchmove', setH); + dom.unbind(window, 'mouseup', fieldUpH); + dom.unbind(window, 'touchend', fieldUpH); + onFinish(); + } + function onBlur() { + var i = interpret(this.value); + if (i !== false) { + _this.__color.__state = i; + _this.setValue(_this.__color.toOriginal()); + } else { + this.value = _this.__color.toString(); + } + } + function onFinish() { + if (_this.__onFinishChange) { + _this.__onFinishChange.call(_this, _this.__color.toOriginal()); + } + } + _this2.__saturation_field.appendChild(valueField); + _this2.__selector.appendChild(_this2.__field_knob); + _this2.__selector.appendChild(_this2.__saturation_field); + _this2.__selector.appendChild(_this2.__hue_field); + _this2.__hue_field.appendChild(_this2.__hue_knob); + _this2.domElement.appendChild(_this2.__input); + _this2.domElement.appendChild(_this2.__selector); + _this2.updateDisplay(); + function setSV(e) { + if (e.type.indexOf('touch') === -1) { + e.preventDefault(); + } + var fieldRect = _this.__saturation_field.getBoundingClientRect(); + var _ref = (e.touches && e.touches[0]) || e, + clientX = _ref.clientX, + clientY = _ref.clientY; + var s = (clientX - fieldRect.left) / (fieldRect.right - fieldRect.left); + var v = 1 - (clientY - fieldRect.top) / (fieldRect.bottom - fieldRect.top); + if (v > 1) { + v = 1; + } else if (v < 0) { + v = 0; + } + if (s > 1) { + s = 1; + } else if (s < 0) { + s = 0; + } + _this.__color.v = v; + _this.__color.s = s; + _this.setValue(_this.__color.toOriginal()); + return false; + } + function setH(e) { + if (e.type.indexOf('touch') === -1) { + e.preventDefault(); + } + var fieldRect = _this.__hue_field.getBoundingClientRect(); + var _ref2 = (e.touches && e.touches[0]) || e, + clientY = _ref2.clientY; + var h = 1 - (clientY - fieldRect.top) / (fieldRect.bottom - fieldRect.top); + if (h > 1) { + h = 1; + } else if (h < 0) { + h = 0; + } + _this.__color.h = h * 360; + _this.setValue(_this.__color.toOriginal()); + return false; + } + return _this2; + } + createClass(ColorController, [ + { + key: 'updateDisplay', + value: function updateDisplay() { + var i = interpret(this.getValue()); + if (i !== false) { + var mismatch = false; + Common.each( + Color.COMPONENTS, + function (component) { + if ( + !Common.isUndefined(i[component]) && + !Common.isUndefined(this.__color.__state[component]) && + i[component] !== this.__color.__state[component] + ) { + mismatch = true; + return {}; + } + }, + this, + ); + if (mismatch) { + Common.extend(this.__color.__state, i); + } + } + Common.extend(this.__temp.__state, this.__color.__state); + this.__temp.a = 1; + var flip = this.__color.v < 0.5 || this.__color.s > 0.5 ? 255 : 0; + var _flip = 255 - flip; + Common.extend(this.__field_knob.style, { + marginLeft: 100 * this.__color.s - 7 + 'px', + marginTop: 100 * (1 - this.__color.v) - 7 + 'px', + backgroundColor: this.__temp.toHexString(), + border: this.__field_knob_border + 'rgb(' + flip + ',' + flip + ',' + flip + ')', + }); + this.__hue_knob.style.marginTop = (1 - this.__color.h / 360) * 100 + 'px'; + this.__temp.s = 1; + this.__temp.v = 1; + linearGradient(this.__saturation_field, 'left', '#fff', this.__temp.toHexString()); + this.__input.value = this.__color.toString(); + Common.extend(this.__input.style, { + backgroundColor: this.__color.toHexString(), + color: 'rgb(' + flip + ',' + flip + ',' + flip + ')', + textShadow: this.__input_textShadow + 'rgba(' + _flip + ',' + _flip + ',' + _flip + ',.7)', + }); + }, + }, + ]); + return ColorController; + })(Controller); + var vendors = ['-moz-', '-o-', '-webkit-', '-ms-', '']; + function linearGradient(elem, x, a, b) { + elem.style.background = ''; + Common.each(vendors, function (vendor) { + elem.style.cssText += + 'background: ' + vendor + 'linear-gradient(' + x + ', ' + a + ' 0%, ' + b + ' 100%); '; + }); } - return { - h: h * 360, - s: s, - v: max / 255 + function hueGradient(elem) { + elem.style.background = ''; + elem.style.cssText += + 'background: -moz-linear-gradient(top, #ff0000 0%, #ff00ff 17%, #0000ff 34%, #00ffff 50%, #00ff00 67%, #ffff00 84%, #ff0000 100%);'; + elem.style.cssText += + 'background: -webkit-linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; + elem.style.cssText += + 'background: -o-linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; + elem.style.cssText += + 'background: -ms-linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; + elem.style.cssText += + 'background: linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; + } + + var css = { + load: function load(url, indoc) { + var doc = indoc || document; + var link = doc.createElement('link'); + link.type = 'text/css'; + link.rel = 'stylesheet'; + link.href = url; + doc.getElementsByTagName('head')[0].appendChild(link); + }, + inject: function inject(cssContent, indoc) { + var doc = indoc || document; + var injected = document.createElement('style'); + injected.type = 'text/css'; + injected.innerHTML = cssContent; + var head = doc.getElementsByTagName('head')[0]; + try { + head.appendChild(injected); + } catch (e) {} + }, }; - }, - rgb_to_hex: function rgb_to_hex(r, g, b) { - var hex = this.hex_with_component(0, 2, r); - hex = this.hex_with_component(hex, 1, g); - hex = this.hex_with_component(hex, 0, b); - return hex; - }, - component_from_hex: function component_from_hex(hex, componentIndex) { - return hex >> componentIndex * 8 & 0xFF; - }, - hex_with_component: function hex_with_component(hex, componentIndex, value) { - return value << (tmpComponent = componentIndex * 8) | hex & ~(0xFF << tmpComponent); - } -}; - -var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { - return typeof obj; -} : function (obj) { - return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; -}; - - - - - - - - - - - -var classCallCheck = function (instance, Constructor) { - if (!(instance instanceof Constructor)) { - throw new TypeError("Cannot call a class as a function"); - } -}; - -var createClass = function () { - function defineProperties(target, props) { - for (var i = 0; i < props.length; i++) { - var descriptor = props[i]; - descriptor.enumerable = descriptor.enumerable || false; - descriptor.configurable = true; - if ("value" in descriptor) descriptor.writable = true; - Object.defineProperty(target, descriptor.key, descriptor); - } - } - - return function (Constructor, protoProps, staticProps) { - if (protoProps) defineProperties(Constructor.prototype, protoProps); - if (staticProps) defineProperties(Constructor, staticProps); - return Constructor; - }; -}(); - - - - - - - -var get = function get(object, property, receiver) { - if (object === null) object = Function.prototype; - var desc = Object.getOwnPropertyDescriptor(object, property); - - if (desc === undefined) { - var parent = Object.getPrototypeOf(object); - - if (parent === null) { - return undefined; - } else { - return get(parent, property, receiver); - } - } else if ("value" in desc) { - return desc.value; - } else { - var getter = desc.get; - - if (getter === undefined) { - return undefined; - } - - return getter.call(receiver); - } -}; - -var inherits = function (subClass, superClass) { - if (typeof superClass !== "function" && superClass !== null) { - throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); - } - - subClass.prototype = Object.create(superClass && superClass.prototype, { - constructor: { - value: subClass, - enumerable: false, - writable: true, - configurable: true - } - }); - if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; -}; - - + var saveDialogContents = + '
\n\n Here\'s the new load parameter for your GUI\'s constructor:\n\n \n\n
\n\n Automatically save\n values to localStorage on exit.\n\n
The values saved to localStorage will\n override those passed to dat.GUI\'s constructor. This makes it\n easier to work incrementally, but localStorage is fragile,\n and your friends may not see the same values you do.\n\n
\n\n
\n\n
'; - - - - - - - -var possibleConstructorReturn = function (self, call) { - if (!self) { - throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); - } - - return call && (typeof call === "object" || typeof call === "function") ? call : self; -}; - -var Color = function () { - function Color() { - classCallCheck(this, Color); - this.__state = interpret.apply(this, arguments); - if (this.__state === false) { - throw new Error('Failed to interpret color arguments'); - } - this.__state.a = this.__state.a || 1; - } - createClass(Color, [{ - key: 'toString', - value: function toString() { - return colorToString(this); - } - }, { - key: 'toHexString', - value: function toHexString() { - return colorToString(this, true); - } - }, { - key: 'toOriginal', - value: function toOriginal() { - return this.__state.conversion.write(this); - } - }]); - return Color; -}(); -function defineRGBComponent(target, component, componentHexIndex) { - Object.defineProperty(target, component, { - get: function get$$1() { - if (this.__state.space === 'RGB') { - return this.__state[component]; - } - Color.recalculateRGB(this, component, componentHexIndex); - return this.__state[component]; - }, - set: function set$$1(v) { - if (this.__state.space !== 'RGB') { - Color.recalculateRGB(this, component, componentHexIndex); - this.__state.space = 'RGB'; - } - this.__state[component] = v; - } - }); -} -function defineHSVComponent(target, component) { - Object.defineProperty(target, component, { - get: function get$$1() { - if (this.__state.space === 'HSV') { - return this.__state[component]; - } - Color.recalculateHSV(this); - return this.__state[component]; - }, - set: function set$$1(v) { - if (this.__state.space !== 'HSV') { - Color.recalculateHSV(this); - this.__state.space = 'HSV'; - } - this.__state[component] = v; - } - }); -} -Color.recalculateRGB = function (color, component, componentHexIndex) { - if (color.__state.space === 'HEX') { - color.__state[component] = ColorMath.component_from_hex(color.__state.hex, componentHexIndex); - } else if (color.__state.space === 'HSV') { - Common.extend(color.__state, ColorMath.hsv_to_rgb(color.__state.h, color.__state.s, color.__state.v)); - } else { - throw new Error('Corrupted color state'); - } -}; -Color.recalculateHSV = function (color) { - var result = ColorMath.rgb_to_hsv(color.r, color.g, color.b); - Common.extend(color.__state, { - s: result.s, - v: result.v - }); - if (!Common.isNaN(result.h)) { - color.__state.h = result.h; - } else if (Common.isUndefined(color.__state.h)) { - color.__state.h = 0; - } -}; -Color.COMPONENTS = ['r', 'g', 'b', 'h', 's', 'v', 'hex', 'a']; -defineRGBComponent(Color.prototype, 'r', 2); -defineRGBComponent(Color.prototype, 'g', 1); -defineRGBComponent(Color.prototype, 'b', 0); -defineHSVComponent(Color.prototype, 'h'); -defineHSVComponent(Color.prototype, 's'); -defineHSVComponent(Color.prototype, 'v'); -Object.defineProperty(Color.prototype, 'a', { - get: function get$$1() { - return this.__state.a; - }, - set: function set$$1(v) { - this.__state.a = v; - } -}); -Object.defineProperty(Color.prototype, 'hex', { - get: function get$$1() { - if (this.__state.space !== 'HEX') { - this.__state.hex = ColorMath.rgb_to_hex(this.r, this.g, this.b); - this.__state.space = 'HEX'; - } - return this.__state.hex; - }, - set: function set$$1(v) { - this.__state.space = 'HEX'; - this.__state.hex = v; - } -}); - -var Controller = function () { - function Controller(object, property) { - classCallCheck(this, Controller); - this.initialValue = object[property]; - this.domElement = document.createElement('div'); - this.object = object; - this.property = property; - this.__onChange = undefined; - this.__onFinishChange = undefined; - } - createClass(Controller, [{ - key: 'onChange', - value: function onChange(fnc) { - this.__onChange = fnc; - return this; - } - }, { - key: 'onFinishChange', - value: function onFinishChange(fnc) { - this.__onFinishChange = fnc; - return this; - } - }, { - key: 'setValue', - value: function setValue(newValue) { - this.object[this.property] = newValue; - if (this.__onChange) { - this.__onChange.call(this, newValue); - } - this.updateDisplay(); - return this; - } - }, { - key: 'getValue', - value: function getValue() { - return this.object[this.property]; - } - }, { - key: 'updateDisplay', - value: function updateDisplay() { - return this; - } - }, { - key: 'isModified', - value: function isModified() { - return this.initialValue !== this.getValue(); - } - }]); - return Controller; -}(); - -var EVENT_MAP = { - HTMLEvents: ['change'], - MouseEvents: ['click', 'mousemove', 'mousedown', 'mouseup', 'mouseover'], - KeyboardEvents: ['keydown'] -}; -var EVENT_MAP_INV = {}; -Common.each(EVENT_MAP, function (v, k) { - Common.each(v, function (e) { - EVENT_MAP_INV[e] = k; - }); -}); -var CSS_VALUE_PIXELS = /(\d+(\.\d+)?)px/; -function cssValueToPixels(val) { - if (val === '0' || Common.isUndefined(val)) { - return 0; - } - var match = val.match(CSS_VALUE_PIXELS); - if (!Common.isNull(match)) { - return parseFloat(match[1]); - } - return 0; -} -var dom = { - makeSelectable: function makeSelectable(elem, selectable) { - if (elem === undefined || elem.style === undefined) return; - elem.onselectstart = selectable ? function () { - return false; - } : function () {}; - elem.style.MozUserSelect = selectable ? 'auto' : 'none'; - elem.style.KhtmlUserSelect = selectable ? 'auto' : 'none'; - elem.unselectable = selectable ? 'on' : 'off'; - }, - makeFullscreen: function makeFullscreen(elem, hor, vert) { - var vertical = vert; - var horizontal = hor; - if (Common.isUndefined(horizontal)) { - horizontal = true; - } - if (Common.isUndefined(vertical)) { - vertical = true; - } - elem.style.position = 'absolute'; - if (horizontal) { - elem.style.left = 0; - elem.style.right = 0; - } - if (vertical) { - elem.style.top = 0; - elem.style.bottom = 0; - } - }, - fakeEvent: function fakeEvent(elem, eventType, pars, aux) { - var params = pars || {}; - var className = EVENT_MAP_INV[eventType]; - if (!className) { - throw new Error('Event type ' + eventType + ' not supported.'); - } - var evt = document.createEvent(className); - switch (className) { - case 'MouseEvents': - { - var clientX = params.x || params.clientX || 0; - var clientY = params.y || params.clientY || 0; - evt.initMouseEvent(eventType, params.bubbles || false, params.cancelable || true, window, params.clickCount || 1, 0, - 0, - clientX, - clientY, - false, false, false, false, 0, null); - break; + var ControllerFactory = function ControllerFactory(object, property) { + var initialValue = object[property]; + if (Common.isArray(arguments[2]) || Common.isObject(arguments[2])) { + return new OptionController(object, property, arguments[2]); } - case 'KeyboardEvents': - { - var init = evt.initKeyboardEvent || evt.initKeyEvent; - Common.defaults(params, { - cancelable: true, - ctrlKey: false, - altKey: false, - shiftKey: false, - metaKey: false, - keyCode: undefined, - charCode: undefined - }); - init(eventType, params.bubbles || false, params.cancelable, window, params.ctrlKey, params.altKey, params.shiftKey, params.metaKey, params.keyCode, params.charCode); - break; + if (Common.isNumber(initialValue)) { + if (Common.isNumber(arguments[2]) && Common.isNumber(arguments[3])) { + if (Common.isNumber(arguments[4])) { + return new NumberControllerSlider(object, property, arguments[2], arguments[3], arguments[4]); + } + return new NumberControllerSlider(object, property, arguments[2], arguments[3]); + } + if (Common.isNumber(arguments[4])) { + return new NumberControllerBox(object, property, { + min: arguments[2], + max: arguments[3], + step: arguments[4], + }); + } + return new NumberControllerBox(object, property, { min: arguments[2], max: arguments[3] }); } - default: - { - evt.initEvent(eventType, params.bubbles || false, params.cancelable || true); - break; + if (Common.isString(initialValue)) { + return new StringController(object, property); } - } - Common.defaults(evt, aux); - elem.dispatchEvent(evt); - }, - bind: function bind(elem, event, func, newBool) { - var bool = newBool || false; - if (elem.addEventListener) { - elem.addEventListener(event, func, bool); - } else if (elem.attachEvent) { - elem.attachEvent('on' + event, func); - } - return dom; - }, - unbind: function unbind(elem, event, func, newBool) { - var bool = newBool || false; - if (elem.removeEventListener) { - elem.removeEventListener(event, func, bool); - } else if (elem.detachEvent) { - elem.detachEvent('on' + event, func); - } - return dom; - }, - addClass: function addClass(elem, className) { - if (elem.className === undefined) { - elem.className = className; - } else if (elem.className !== className) { - var classes = elem.className.split(/ +/); - if (classes.indexOf(className) === -1) { - classes.push(className); - elem.className = classes.join(' ').replace(/^\s+/, '').replace(/\s+$/, ''); - } - } - return dom; - }, - removeClass: function removeClass(elem, className) { - if (className) { - if (elem.className === className) { - elem.removeAttribute('class'); - } else { - var classes = elem.className.split(/ +/); - var index = classes.indexOf(className); - if (index !== -1) { - classes.splice(index, 1); - elem.className = classes.join(' '); + if (Common.isFunction(initialValue)) { + return new FunctionController(object, property, ''); } - } - } else { - elem.className = undefined; - } - return dom; - }, - hasClass: function hasClass(elem, className) { - return new RegExp('(?:^|\\s+)' + className + '(?:\\s+|$)').test(elem.className) || false; - }, - getWidth: function getWidth(elem) { - var style = getComputedStyle(elem); - return cssValueToPixels(style['border-left-width']) + cssValueToPixels(style['border-right-width']) + cssValueToPixels(style['padding-left']) + cssValueToPixels(style['padding-right']) + cssValueToPixels(style.width); - }, - getHeight: function getHeight(elem) { - var style = getComputedStyle(elem); - return cssValueToPixels(style['border-top-width']) + cssValueToPixels(style['border-bottom-width']) + cssValueToPixels(style['padding-top']) + cssValueToPixels(style['padding-bottom']) + cssValueToPixels(style.height); - }, - getOffset: function getOffset(el) { - var elem = el; - var offset = { left: 0, top: 0 }; - if (elem.offsetParent) { - do { - offset.left += elem.offsetLeft; - offset.top += elem.offsetTop; - elem = elem.offsetParent; - } while (elem); - } - return offset; - }, - isActive: function isActive(elem) { - return elem === document.activeElement && (elem.type || elem.href); - } -}; - -var BooleanController = function (_Controller) { - inherits(BooleanController, _Controller); - function BooleanController(object, property) { - classCallCheck(this, BooleanController); - var _this2 = possibleConstructorReturn(this, (BooleanController.__proto__ || Object.getPrototypeOf(BooleanController)).call(this, object, property)); - var _this = _this2; - _this2.__prev = _this2.getValue(); - _this2.__checkbox = document.createElement('input'); - _this2.__checkbox.setAttribute('type', 'checkbox'); - function onChange() { - _this.setValue(!_this.__prev); - } - dom.bind(_this2.__checkbox, 'change', onChange, false); - _this2.domElement.appendChild(_this2.__checkbox); - _this2.updateDisplay(); - return _this2; - } - createClass(BooleanController, [{ - key: 'setValue', - value: function setValue(v) { - var toReturn = get(BooleanController.prototype.__proto__ || Object.getPrototypeOf(BooleanController.prototype), 'setValue', this).call(this, v); - if (this.__onFinishChange) { - this.__onFinishChange.call(this, this.getValue()); - } - this.__prev = this.getValue(); - return toReturn; - } - }, { - key: 'updateDisplay', - value: function updateDisplay() { - if (this.getValue() === true) { - this.__checkbox.setAttribute('checked', 'checked'); - this.__checkbox.checked = true; - this.__prev = true; - } else { - this.__checkbox.checked = false; - this.__prev = false; - } - return get(BooleanController.prototype.__proto__ || Object.getPrototypeOf(BooleanController.prototype), 'updateDisplay', this).call(this); - } - }]); - return BooleanController; -}(Controller); - -var OptionController = function (_Controller) { - inherits(OptionController, _Controller); - function OptionController(object, property, opts) { - classCallCheck(this, OptionController); - var _this2 = possibleConstructorReturn(this, (OptionController.__proto__ || Object.getPrototypeOf(OptionController)).call(this, object, property)); - var options = opts; - var _this = _this2; - _this2.__select = document.createElement('select'); - if (Common.isArray(options)) { - var map = {}; - Common.each(options, function (element) { - map[element] = element; - }); - options = map; - } - Common.each(options, function (value, key) { - var opt = document.createElement('option'); - opt.innerHTML = key; - opt.setAttribute('value', value); - _this.__select.appendChild(opt); - }); - _this2.updateDisplay(); - dom.bind(_this2.__select, 'change', function () { - var desiredValue = this.options[this.selectedIndex].value; - _this.setValue(desiredValue); - }); - _this2.domElement.appendChild(_this2.__select); - return _this2; - } - createClass(OptionController, [{ - key: 'setValue', - value: function setValue(v) { - var toReturn = get(OptionController.prototype.__proto__ || Object.getPrototypeOf(OptionController.prototype), 'setValue', this).call(this, v); - if (this.__onFinishChange) { - this.__onFinishChange.call(this, this.getValue()); - } - return toReturn; - } - }, { - key: 'updateDisplay', - value: function updateDisplay() { - if (dom.isActive(this.__select)) return this; - this.__select.value = this.getValue(); - return get(OptionController.prototype.__proto__ || Object.getPrototypeOf(OptionController.prototype), 'updateDisplay', this).call(this); - } - }]); - return OptionController; -}(Controller); - -var StringController = function (_Controller) { - inherits(StringController, _Controller); - function StringController(object, property) { - classCallCheck(this, StringController); - var _this2 = possibleConstructorReturn(this, (StringController.__proto__ || Object.getPrototypeOf(StringController)).call(this, object, property)); - var _this = _this2; - function onChange() { - _this.setValue(_this.__input.value); - } - function onBlur() { - if (_this.__onFinishChange) { - _this.__onFinishChange.call(_this, _this.getValue()); - } - } - _this2.__input = document.createElement('input'); - _this2.__input.setAttribute('type', 'text'); - dom.bind(_this2.__input, 'keyup', onChange); - dom.bind(_this2.__input, 'change', onChange); - dom.bind(_this2.__input, 'blur', onBlur); - dom.bind(_this2.__input, 'keydown', function (e) { - if (e.keyCode === 13) { - this.blur(); - } - }); - _this2.updateDisplay(); - _this2.domElement.appendChild(_this2.__input); - return _this2; - } - createClass(StringController, [{ - key: 'updateDisplay', - value: function updateDisplay() { - if (!dom.isActive(this.__input)) { - this.__input.value = this.getValue(); - } - return get(StringController.prototype.__proto__ || Object.getPrototypeOf(StringController.prototype), 'updateDisplay', this).call(this); - } - }]); - return StringController; -}(Controller); - -function numDecimals(x) { - var _x = x.toString(); - if (_x.indexOf('.') > -1) { - return _x.length - _x.indexOf('.') - 1; - } - return 0; -} -var NumberController = function (_Controller) { - inherits(NumberController, _Controller); - function NumberController(object, property, params) { - classCallCheck(this, NumberController); - var _this = possibleConstructorReturn(this, (NumberController.__proto__ || Object.getPrototypeOf(NumberController)).call(this, object, property)); - var _params = params || {}; - _this.__min = _params.min; - _this.__max = _params.max; - _this.__step = _params.step; - if (Common.isUndefined(_this.__step)) { - if (_this.initialValue === 0) { - _this.__impliedStep = 1; - } else { - _this.__impliedStep = Math.pow(10, Math.floor(Math.log(Math.abs(_this.initialValue)) / Math.LN10)) / 10; - } - } else { - _this.__impliedStep = _this.__step; - } - _this.__precision = numDecimals(_this.__impliedStep); - return _this; - } - createClass(NumberController, [{ - key: 'setValue', - value: function setValue(v) { - var _v = v; - if (this.__min !== undefined && _v < this.__min) { - _v = this.__min; - } else if (this.__max !== undefined && _v > this.__max) { - _v = this.__max; - } - if (this.__step !== undefined && _v % this.__step !== 0) { - _v = Math.round(_v / this.__step) * this.__step; - } - return get(NumberController.prototype.__proto__ || Object.getPrototypeOf(NumberController.prototype), 'setValue', this).call(this, _v); - } - }, { - key: 'min', - value: function min(minValue) { - this.__min = minValue; - return this; - } - }, { - key: 'max', - value: function max(maxValue) { - this.__max = maxValue; - return this; - } - }, { - key: 'step', - value: function step(stepValue) { - this.__step = stepValue; - this.__impliedStep = stepValue; - this.__precision = numDecimals(stepValue); - return this; - } - }]); - return NumberController; -}(Controller); - -function roundToDecimal(value, decimals) { - var tenTo = Math.pow(10, decimals); - return Math.round(value * tenTo) / tenTo; -} -var NumberControllerBox = function (_NumberController) { - inherits(NumberControllerBox, _NumberController); - function NumberControllerBox(object, property, params) { - classCallCheck(this, NumberControllerBox); - var _this2 = possibleConstructorReturn(this, (NumberControllerBox.__proto__ || Object.getPrototypeOf(NumberControllerBox)).call(this, object, property, params)); - _this2.__truncationSuspended = false; - var _this = _this2; - var prevY = void 0; - function onChange() { - var attempted = parseFloat(_this.__input.value); - if (!Common.isNaN(attempted)) { - _this.setValue(attempted); - } - } - function onFinish() { - if (_this.__onFinishChange) { - _this.__onFinishChange.call(_this, _this.getValue()); - } - } - function onBlur() { - onFinish(); - } - function onMouseDrag(e) { - var diff = prevY - e.clientY; - _this.setValue(_this.getValue() + diff * _this.__impliedStep); - prevY = e.clientY; - } - function onMouseUp() { - dom.unbind(window, 'mousemove', onMouseDrag); - dom.unbind(window, 'mouseup', onMouseUp); - onFinish(); - } - function onMouseDown(e) { - dom.bind(window, 'mousemove', onMouseDrag); - dom.bind(window, 'mouseup', onMouseUp); - prevY = e.clientY; - } - _this2.__input = document.createElement('input'); - _this2.__input.setAttribute('type', 'text'); - dom.bind(_this2.__input, 'change', onChange); - dom.bind(_this2.__input, 'blur', onBlur); - dom.bind(_this2.__input, 'mousedown', onMouseDown); - dom.bind(_this2.__input, 'keydown', function (e) { - if (e.keyCode === 13) { - _this.__truncationSuspended = true; - this.blur(); - _this.__truncationSuspended = false; - onFinish(); - } - }); - _this2.updateDisplay(); - _this2.domElement.appendChild(_this2.__input); - return _this2; - } - createClass(NumberControllerBox, [{ - key: 'updateDisplay', - value: function updateDisplay() { - this.__input.value = this.__truncationSuspended ? this.getValue() : roundToDecimal(this.getValue(), this.__precision); - return get(NumberControllerBox.prototype.__proto__ || Object.getPrototypeOf(NumberControllerBox.prototype), 'updateDisplay', this).call(this); - } - }]); - return NumberControllerBox; -}(NumberController); - -function map(v, i1, i2, o1, o2) { - return o1 + (o2 - o1) * ((v - i1) / (i2 - i1)); -} -var NumberControllerSlider = function (_NumberController) { - inherits(NumberControllerSlider, _NumberController); - function NumberControllerSlider(object, property, min, max, step) { - classCallCheck(this, NumberControllerSlider); - var _this2 = possibleConstructorReturn(this, (NumberControllerSlider.__proto__ || Object.getPrototypeOf(NumberControllerSlider)).call(this, object, property, { min: min, max: max, step: step })); - var _this = _this2; - _this2.__background = document.createElement('div'); - _this2.__foreground = document.createElement('div'); - dom.bind(_this2.__background, 'mousedown', onMouseDown); - dom.bind(_this2.__background, 'touchstart', onTouchStart); - dom.addClass(_this2.__background, 'slider'); - dom.addClass(_this2.__foreground, 'slider-fg'); - function onMouseDown(e) { - document.activeElement.blur(); - dom.bind(window, 'mousemove', onMouseDrag); - dom.bind(window, 'mouseup', onMouseUp); - onMouseDrag(e); - } - function onMouseDrag(e) { - e.preventDefault(); - var bgRect = _this.__background.getBoundingClientRect(); - _this.setValue(map(e.clientX, bgRect.left, bgRect.right, _this.__min, _this.__max)); - return false; - } - function onMouseUp() { - dom.unbind(window, 'mousemove', onMouseDrag); - dom.unbind(window, 'mouseup', onMouseUp); - if (_this.__onFinishChange) { - _this.__onFinishChange.call(_this, _this.getValue()); - } - } - function onTouchStart(e) { - if (e.touches.length !== 1) { - return; - } - dom.bind(window, 'touchmove', onTouchMove); - dom.bind(window, 'touchend', onTouchEnd); - onTouchMove(e); - } - function onTouchMove(e) { - var clientX = e.touches[0].clientX; - var bgRect = _this.__background.getBoundingClientRect(); - _this.setValue(map(clientX, bgRect.left, bgRect.right, _this.__min, _this.__max)); - } - function onTouchEnd() { - dom.unbind(window, 'touchmove', onTouchMove); - dom.unbind(window, 'touchend', onTouchEnd); - if (_this.__onFinishChange) { - _this.__onFinishChange.call(_this, _this.getValue()); - } - } - _this2.updateDisplay(); - _this2.__background.appendChild(_this2.__foreground); - _this2.domElement.appendChild(_this2.__background); - return _this2; - } - createClass(NumberControllerSlider, [{ - key: 'updateDisplay', - value: function updateDisplay() { - var pct = (this.getValue() - this.__min) / (this.__max - this.__min); - this.__foreground.style.width = pct * 100 + '%'; - return get(NumberControllerSlider.prototype.__proto__ || Object.getPrototypeOf(NumberControllerSlider.prototype), 'updateDisplay', this).call(this); - } - }]); - return NumberControllerSlider; -}(NumberController); - -var FunctionController = function (_Controller) { - inherits(FunctionController, _Controller); - function FunctionController(object, property, text) { - classCallCheck(this, FunctionController); - var _this2 = possibleConstructorReturn(this, (FunctionController.__proto__ || Object.getPrototypeOf(FunctionController)).call(this, object, property)); - var _this = _this2; - _this2.__button = document.createElement('div'); - _this2.__button.innerHTML = text === undefined ? 'Fire' : text; - dom.bind(_this2.__button, 'click', function (e) { - e.preventDefault(); - _this.fire(); - return false; - }); - dom.addClass(_this2.__button, 'button'); - _this2.domElement.appendChild(_this2.__button); - return _this2; - } - createClass(FunctionController, [{ - key: 'fire', - value: function fire() { - if (this.__onChange) { - this.__onChange.call(this); - } - this.getValue().call(this.object); - if (this.__onFinishChange) { - this.__onFinishChange.call(this, this.getValue()); - } - } - }]); - return FunctionController; -}(Controller); - -var ColorController = function (_Controller) { - inherits(ColorController, _Controller); - function ColorController(object, property) { - classCallCheck(this, ColorController); - var _this2 = possibleConstructorReturn(this, (ColorController.__proto__ || Object.getPrototypeOf(ColorController)).call(this, object, property)); - _this2.__color = new Color(_this2.getValue()); - _this2.__temp = new Color(0); - var _this = _this2; - _this2.domElement = document.createElement('div'); - dom.makeSelectable(_this2.domElement, false); - _this2.__selector = document.createElement('div'); - _this2.__selector.className = 'selector'; - _this2.__saturation_field = document.createElement('div'); - _this2.__saturation_field.className = 'saturation-field'; - _this2.__field_knob = document.createElement('div'); - _this2.__field_knob.className = 'field-knob'; - _this2.__field_knob_border = '2px solid '; - _this2.__hue_knob = document.createElement('div'); - _this2.__hue_knob.className = 'hue-knob'; - _this2.__hue_field = document.createElement('div'); - _this2.__hue_field.className = 'hue-field'; - _this2.__input = document.createElement('input'); - _this2.__input.type = 'text'; - _this2.__input_textShadow = '0 1px 1px '; - dom.bind(_this2.__input, 'keydown', function (e) { - if (e.keyCode === 13) { - onBlur.call(this); - } - }); - dom.bind(_this2.__input, 'blur', onBlur); - dom.bind(_this2.__selector, 'mousedown', function () { - dom.addClass(this, 'drag').bind(window, 'mouseup', function () { - dom.removeClass(_this.__selector, 'drag'); - }); - }); - dom.bind(_this2.__selector, 'touchstart', function () { - dom.addClass(this, 'drag').bind(window, 'touchend', function () { - dom.removeClass(_this.__selector, 'drag'); - }); - }); - var valueField = document.createElement('div'); - Common.extend(_this2.__selector.style, { - width: '122px', - height: '102px', - padding: '3px', - backgroundColor: '#222', - boxShadow: '0px 1px 3px rgba(0,0,0,0.3)' - }); - Common.extend(_this2.__field_knob.style, { - position: 'absolute', - width: '12px', - height: '12px', - border: _this2.__field_knob_border + (_this2.__color.v < 0.5 ? '#fff' : '#000'), - boxShadow: '0px 1px 3px rgba(0,0,0,0.5)', - borderRadius: '12px', - zIndex: 1 - }); - Common.extend(_this2.__hue_knob.style, { - position: 'absolute', - width: '15px', - height: '2px', - borderRight: '4px solid #fff', - zIndex: 1 - }); - Common.extend(_this2.__saturation_field.style, { - width: '100px', - height: '100px', - border: '1px solid #555', - marginRight: '3px', - display: 'inline-block', - cursor: 'pointer' - }); - Common.extend(valueField.style, { - width: '100%', - height: '100%', - background: 'none' - }); - linearGradient(valueField, 'top', 'rgba(0,0,0,0)', '#000'); - Common.extend(_this2.__hue_field.style, { - width: '15px', - height: '100px', - border: '1px solid #555', - cursor: 'ns-resize', - position: 'absolute', - top: '3px', - right: '3px' - }); - hueGradient(_this2.__hue_field); - Common.extend(_this2.__input.style, { - outline: 'none', - textAlign: 'center', - color: '#fff', - border: 0, - fontWeight: 'bold', - textShadow: _this2.__input_textShadow + 'rgba(0,0,0,0.7)' - }); - dom.bind(_this2.__saturation_field, 'mousedown', fieldDown); - dom.bind(_this2.__saturation_field, 'touchstart', fieldDown); - dom.bind(_this2.__field_knob, 'mousedown', fieldDown); - dom.bind(_this2.__field_knob, 'touchstart', fieldDown); - dom.bind(_this2.__hue_field, 'mousedown', fieldDownH); - dom.bind(_this2.__hue_field, 'touchstart', fieldDownH); - function fieldDown(e) { - setSV(e); - dom.bind(window, 'mousemove', setSV); - dom.bind(window, 'touchmove', setSV); - dom.bind(window, 'mouseup', fieldUpSV); - dom.bind(window, 'touchend', fieldUpSV); - } - function fieldDownH(e) { - setH(e); - dom.bind(window, 'mousemove', setH); - dom.bind(window, 'touchmove', setH); - dom.bind(window, 'mouseup', fieldUpH); - dom.bind(window, 'touchend', fieldUpH); - } - function fieldUpSV() { - dom.unbind(window, 'mousemove', setSV); - dom.unbind(window, 'touchmove', setSV); - dom.unbind(window, 'mouseup', fieldUpSV); - dom.unbind(window, 'touchend', fieldUpSV); - onFinish(); - } - function fieldUpH() { - dom.unbind(window, 'mousemove', setH); - dom.unbind(window, 'touchmove', setH); - dom.unbind(window, 'mouseup', fieldUpH); - dom.unbind(window, 'touchend', fieldUpH); - onFinish(); - } - function onBlur() { - var i = interpret(this.value); - if (i !== false) { - _this.__color.__state = i; - _this.setValue(_this.__color.toOriginal()); - } else { - this.value = _this.__color.toString(); - } - } - function onFinish() { - if (_this.__onFinishChange) { - _this.__onFinishChange.call(_this, _this.__color.toOriginal()); - } - } - _this2.__saturation_field.appendChild(valueField); - _this2.__selector.appendChild(_this2.__field_knob); - _this2.__selector.appendChild(_this2.__saturation_field); - _this2.__selector.appendChild(_this2.__hue_field); - _this2.__hue_field.appendChild(_this2.__hue_knob); - _this2.domElement.appendChild(_this2.__input); - _this2.domElement.appendChild(_this2.__selector); - _this2.updateDisplay(); - function setSV(e) { - if (e.type.indexOf('touch') === -1) { - e.preventDefault(); - } - var fieldRect = _this.__saturation_field.getBoundingClientRect(); - var _ref = e.touches && e.touches[0] || e, - clientX = _ref.clientX, - clientY = _ref.clientY; - var s = (clientX - fieldRect.left) / (fieldRect.right - fieldRect.left); - var v = 1 - (clientY - fieldRect.top) / (fieldRect.bottom - fieldRect.top); - if (v > 1) { - v = 1; - } else if (v < 0) { - v = 0; - } - if (s > 1) { - s = 1; - } else if (s < 0) { - s = 0; - } - _this.__color.v = v; - _this.__color.s = s; - _this.setValue(_this.__color.toOriginal()); - return false; - } - function setH(e) { - if (e.type.indexOf('touch') === -1) { - e.preventDefault(); - } - var fieldRect = _this.__hue_field.getBoundingClientRect(); - var _ref2 = e.touches && e.touches[0] || e, - clientY = _ref2.clientY; - var h = 1 - (clientY - fieldRect.top) / (fieldRect.bottom - fieldRect.top); - if (h > 1) { - h = 1; - } else if (h < 0) { - h = 0; - } - _this.__color.h = h * 360; - _this.setValue(_this.__color.toOriginal()); - return false; - } - return _this2; - } - createClass(ColorController, [{ - key: 'updateDisplay', - value: function updateDisplay() { - var i = interpret(this.getValue()); - if (i !== false) { - var mismatch = false; - Common.each(Color.COMPONENTS, function (component) { - if (!Common.isUndefined(i[component]) && !Common.isUndefined(this.__color.__state[component]) && i[component] !== this.__color.__state[component]) { - mismatch = true; - return {}; - } - }, this); - if (mismatch) { - Common.extend(this.__color.__state, i); + if (Common.isBoolean(initialValue)) { + return new BooleanController(object, property); } - } - Common.extend(this.__temp.__state, this.__color.__state); - this.__temp.a = 1; - var flip = this.__color.v < 0.5 || this.__color.s > 0.5 ? 255 : 0; - var _flip = 255 - flip; - Common.extend(this.__field_knob.style, { - marginLeft: 100 * this.__color.s - 7 + 'px', - marginTop: 100 * (1 - this.__color.v) - 7 + 'px', - backgroundColor: this.__temp.toHexString(), - border: this.__field_knob_border + 'rgb(' + flip + ',' + flip + ',' + flip + ')' - }); - this.__hue_knob.style.marginTop = (1 - this.__color.h / 360) * 100 + 'px'; - this.__temp.s = 1; - this.__temp.v = 1; - linearGradient(this.__saturation_field, 'left', '#fff', this.__temp.toHexString()); - this.__input.value = this.__color.toString(); - Common.extend(this.__input.style, { - backgroundColor: this.__color.toHexString(), - color: 'rgb(' + flip + ',' + flip + ',' + flip + ')', - textShadow: this.__input_textShadow + 'rgba(' + _flip + ',' + _flip + ',' + _flip + ',.7)' - }); - } - }]); - return ColorController; -}(Controller); -var vendors = ['-moz-', '-o-', '-webkit-', '-ms-', '']; -function linearGradient(elem, x, a, b) { - elem.style.background = ''; - Common.each(vendors, function (vendor) { - elem.style.cssText += 'background: ' + vendor + 'linear-gradient(' + x + ', ' + a + ' 0%, ' + b + ' 100%); '; - }); -} -function hueGradient(elem) { - elem.style.background = ''; - elem.style.cssText += 'background: -moz-linear-gradient(top, #ff0000 0%, #ff00ff 17%, #0000ff 34%, #00ffff 50%, #00ff00 67%, #ffff00 84%, #ff0000 100%);'; - elem.style.cssText += 'background: -webkit-linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; - elem.style.cssText += 'background: -o-linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; - elem.style.cssText += 'background: -ms-linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; - elem.style.cssText += 'background: linear-gradient(top, #ff0000 0%,#ff00ff 17%,#0000ff 34%,#00ffff 50%,#00ff00 67%,#ffff00 84%,#ff0000 100%);'; -} - -var css = { - load: function load(url, indoc) { - var doc = indoc || document; - var link = doc.createElement('link'); - link.type = 'text/css'; - link.rel = 'stylesheet'; - link.href = url; - doc.getElementsByTagName('head')[0].appendChild(link); - }, - inject: function inject(cssContent, indoc) { - var doc = indoc || document; - var injected = document.createElement('style'); - injected.type = 'text/css'; - injected.innerHTML = cssContent; - var head = doc.getElementsByTagName('head')[0]; - try { - head.appendChild(injected); - } catch (e) { - } - } -}; - -var saveDialogContents = "
\n\n Here's the new load parameter for your GUI's constructor:\n\n \n\n
\n\n Automatically save\n values to localStorage on exit.\n\n
The values saved to localStorage will\n override those passed to dat.GUI's constructor. This makes it\n easier to work incrementally, but localStorage is fragile,\n and your friends may not see the same values you do.\n\n
\n\n
\n\n
"; - -var ControllerFactory = function ControllerFactory(object, property) { - var initialValue = object[property]; - if (Common.isArray(arguments[2]) || Common.isObject(arguments[2])) { - return new OptionController(object, property, arguments[2]); - } - if (Common.isNumber(initialValue)) { - if (Common.isNumber(arguments[2]) && Common.isNumber(arguments[3])) { - if (Common.isNumber(arguments[4])) { - return new NumberControllerSlider(object, property, arguments[2], arguments[3], arguments[4]); - } - return new NumberControllerSlider(object, property, arguments[2], arguments[3]); - } - if (Common.isNumber(arguments[4])) { - return new NumberControllerBox(object, property, { min: arguments[2], max: arguments[3], step: arguments[4] }); - } - return new NumberControllerBox(object, property, { min: arguments[2], max: arguments[3] }); - } - if (Common.isString(initialValue)) { - return new StringController(object, property); - } - if (Common.isFunction(initialValue)) { - return new FunctionController(object, property, ''); - } - if (Common.isBoolean(initialValue)) { - return new BooleanController(object, property); - } - return null; -}; - -function requestAnimationFrame(callback) { - setTimeout(callback, 1000 / 60); -} -var requestAnimationFrame$1 = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.oRequestAnimationFrame || window.msRequestAnimationFrame || requestAnimationFrame; - -var CenteredDiv = function () { - function CenteredDiv() { - classCallCheck(this, CenteredDiv); - this.backgroundElement = document.createElement('div'); - Common.extend(this.backgroundElement.style, { - backgroundColor: 'rgba(0,0,0,0.8)', - top: 0, - left: 0, - display: 'none', - zIndex: '1000', - opacity: 0, - WebkitTransition: 'opacity 0.2s linear', - transition: 'opacity 0.2s linear' - }); - dom.makeFullscreen(this.backgroundElement); - this.backgroundElement.style.position = 'fixed'; - this.domElement = document.createElement('div'); - Common.extend(this.domElement.style, { - position: 'fixed', - display: 'none', - zIndex: '1001', - opacity: 0, - WebkitTransition: '-webkit-transform 0.2s ease-out, opacity 0.2s linear', - transition: 'transform 0.2s ease-out, opacity 0.2s linear' - }); - document.body.appendChild(this.backgroundElement); - document.body.appendChild(this.domElement); - var _this = this; - dom.bind(this.backgroundElement, 'click', function () { - _this.hide(); - }); - } - createClass(CenteredDiv, [{ - key: 'show', - value: function show() { - var _this = this; - this.backgroundElement.style.display = 'block'; - this.domElement.style.display = 'block'; - this.domElement.style.opacity = 0; - this.domElement.style.webkitTransform = 'scale(1.1)'; - this.layout(); - Common.defer(function () { - _this.backgroundElement.style.opacity = 1; - _this.domElement.style.opacity = 1; - _this.domElement.style.webkitTransform = 'scale(1)'; - }); - } - }, { - key: 'hide', - value: function hide() { - var _this = this; - var hide = function hide() { - _this.domElement.style.display = 'none'; - _this.backgroundElement.style.display = 'none'; - dom.unbind(_this.domElement, 'webkitTransitionEnd', hide); - dom.unbind(_this.domElement, 'transitionend', hide); - dom.unbind(_this.domElement, 'oTransitionEnd', hide); - }; - dom.bind(this.domElement, 'webkitTransitionEnd', hide); - dom.bind(this.domElement, 'transitionend', hide); - dom.bind(this.domElement, 'oTransitionEnd', hide); - this.backgroundElement.style.opacity = 0; - this.domElement.style.opacity = 0; - this.domElement.style.webkitTransform = 'scale(1.1)'; - } - }, { - key: 'layout', - value: function layout() { - this.domElement.style.left = window.innerWidth / 2 - dom.getWidth(this.domElement) / 2 + 'px'; - this.domElement.style.top = window.innerHeight / 2 - dom.getHeight(this.domElement) / 2 + 'px'; - } - }]); - return CenteredDiv; -}(); - -var styleSheet = ___$insertStyle(".dg ul{list-style:none;margin:0;padding:0;width:100%;clear:both}.dg.ac{position:fixed;top:0;left:0;right:0;height:0;z-index:0}.dg:not(.ac) .main{overflow:hidden}.dg.main{-webkit-transition:opacity .1s linear;-o-transition:opacity .1s linear;-moz-transition:opacity .1s linear;transition:opacity .1s linear}.dg.main.taller-than-window{overflow-y:auto}.dg.main.taller-than-window .close-button{opacity:1;margin-top:-1px;border-top:1px solid #2c2c2c}.dg.main ul.closed .close-button{opacity:1 !important}.dg.main:hover .close-button,.dg.main .close-button.drag{opacity:1}.dg.main .close-button{-webkit-transition:opacity .1s linear;-o-transition:opacity .1s linear;-moz-transition:opacity .1s linear;transition:opacity .1s linear;border:0;line-height:19px;height:20px;cursor:pointer;text-align:center;background-color:#000}.dg.main .close-button.close-top{position:relative}.dg.main .close-button.close-bottom{position:absolute}.dg.main .close-button:hover{background-color:#111}.dg.a{float:right;margin-right:15px;overflow-y:visible}.dg.a.has-save>ul.close-top{margin-top:0}.dg.a.has-save>ul.close-bottom{margin-top:27px}.dg.a.has-save>ul.closed{margin-top:0}.dg.a .save-row{top:0;z-index:1002}.dg.a .save-row.close-top{position:relative}.dg.a .save-row.close-bottom{position:fixed}.dg li{-webkit-transition:height .1s ease-out;-o-transition:height .1s ease-out;-moz-transition:height .1s ease-out;transition:height .1s ease-out;-webkit-transition:overflow .1s linear;-o-transition:overflow .1s linear;-moz-transition:overflow .1s linear;transition:overflow .1s linear}.dg li:not(.folder){cursor:auto;height:27px;line-height:27px;padding:0 4px 0 5px}.dg li.folder{padding:0;border-left:4px solid rgba(0,0,0,0)}.dg li.title{cursor:pointer;margin-left:-4px}.dg .closed li:not(.title),.dg .closed ul li,.dg .closed ul li>*{height:0;overflow:hidden;border:0}.dg .cr{clear:both;padding-left:3px;height:27px;overflow:hidden}.dg .property-name{cursor:default;float:left;clear:left;width:40%;overflow:hidden;text-overflow:ellipsis}.dg .c{float:left;width:60%;position:relative}.dg .c input[type=text]{border:0;margin-top:4px;padding:3px;width:100%;float:right}.dg .has-slider input[type=text]{width:30%;margin-left:0}.dg .slider{float:left;width:66%;margin-left:-5px;margin-right:0;height:19px;margin-top:4px}.dg .slider-fg{height:100%}.dg .c input[type=checkbox]{margin-top:7px}.dg .c select{margin-top:5px}.dg .cr.function,.dg .cr.function .property-name,.dg .cr.function *,.dg .cr.boolean,.dg .cr.boolean *{cursor:pointer}.dg .cr.color{overflow:visible}.dg .selector{display:none;position:absolute;margin-left:-9px;margin-top:23px;z-index:10}.dg .c:hover .selector,.dg .selector.drag{display:block}.dg li.save-row{padding:0}.dg li.save-row .button{display:inline-block;padding:0px 6px}.dg.dialogue{background-color:#222;width:460px;padding:15px;font-size:13px;line-height:15px}#dg-new-constructor{padding:10px;color:#222;font-family:Monaco, monospace;font-size:10px;border:0;resize:none;box-shadow:inset 1px 1px 1px #888;word-wrap:break-word;margin:12px 0;display:block;width:440px;overflow-y:scroll;height:100px;position:relative}#dg-local-explain{display:none;font-size:11px;line-height:17px;border-radius:3px;background-color:#333;padding:8px;margin-top:10px}#dg-local-explain code{font-size:10px}#dat-gui-save-locally{display:none}.dg{color:#eee;font:11px 'Lucida Grande', sans-serif;text-shadow:0 -1px 0 #111}.dg.main::-webkit-scrollbar{width:5px;background:#1a1a1a}.dg.main::-webkit-scrollbar-corner{height:0;display:none}.dg.main::-webkit-scrollbar-thumb{border-radius:5px;background:#676767}.dg li:not(.folder){background:#1a1a1a;border-bottom:1px solid #2c2c2c}.dg li.save-row{line-height:25px;background:#dad5cb;border:0}.dg li.save-row select{margin-left:5px;width:108px}.dg li.save-row .button{margin-left:5px;margin-top:1px;border-radius:2px;font-size:9px;line-height:7px;padding:4px 4px 5px 4px;background:#c5bdad;color:#fff;text-shadow:0 1px 0 #b0a58f;box-shadow:0 -1px 0 #b0a58f;cursor:pointer}.dg li.save-row .button.gears{background:#c5bdad url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAsAAAANCAYAAAB/9ZQ7AAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAQJJREFUeNpiYKAU/P//PwGIC/ApCABiBSAW+I8AClAcgKxQ4T9hoMAEUrxx2QSGN6+egDX+/vWT4e7N82AMYoPAx/evwWoYoSYbACX2s7KxCxzcsezDh3evFoDEBYTEEqycggWAzA9AuUSQQgeYPa9fPv6/YWm/Acx5IPb7ty/fw+QZblw67vDs8R0YHyQhgObx+yAJkBqmG5dPPDh1aPOGR/eugW0G4vlIoTIfyFcA+QekhhHJhPdQxbiAIguMBTQZrPD7108M6roWYDFQiIAAv6Aow/1bFwXgis+f2LUAynwoIaNcz8XNx3Dl7MEJUDGQpx9gtQ8YCueB+D26OECAAQDadt7e46D42QAAAABJRU5ErkJggg==) 2px 1px no-repeat;height:7px;width:8px}.dg li.save-row .button:hover{background-color:#bab19e;box-shadow:0 -1px 0 #b0a58f}.dg li.folder{border-bottom:0}.dg li.title{padding-left:16px;background:#000 url(data:image/gif;base64,R0lGODlhBQAFAJEAAP////Pz8////////yH5BAEAAAIALAAAAAAFAAUAAAIIlI+hKgFxoCgAOw==) 6px 10px no-repeat;cursor:pointer;border-bottom:1px solid rgba(255,255,255,0.2)}.dg .closed li.title{background-image:url(data:image/gif;base64,R0lGODlhBQAFAJEAAP////Pz8////////yH5BAEAAAIALAAAAAAFAAUAAAIIlGIWqMCbWAEAOw==)}.dg .cr.boolean{border-left:3px solid #806787}.dg .cr.color{border-left:3px solid}.dg .cr.function{border-left:3px solid #e61d5f}.dg .cr.number{border-left:3px solid #2FA1D6}.dg .cr.number input[type=text]{color:#2FA1D6}.dg .cr.string{border-left:3px solid #1ed36f}.dg .cr.string input[type=text]{color:#1ed36f}.dg .cr.function:hover,.dg .cr.boolean:hover{background:#111}.dg .c input[type=text]{background:#303030;outline:none}.dg .c input[type=text]:hover{background:#3c3c3c}.dg .c input[type=text]:focus{background:#494949;color:#fff}.dg .c .slider{background:#303030;cursor:ew-resize}.dg .c .slider-fg{background:#2FA1D6;max-width:100%}.dg .c .slider:hover{background:#3c3c3c}.dg .c .slider:hover .slider-fg{background:#44abda}\n"); + return null; + }; -css.inject(styleSheet); -var CSS_NAMESPACE = 'dg'; -var HIDE_KEY_CODE = 72; -var CLOSE_BUTTON_HEIGHT = 20; -var DEFAULT_DEFAULT_PRESET_NAME = 'Default'; -var SUPPORTS_LOCAL_STORAGE = function () { - try { - return !!window.localStorage; - } catch (e) { - return false; - } -}(); -var SAVE_DIALOGUE = void 0; -var autoPlaceVirgin = true; -var autoPlaceContainer = void 0; -var hide = false; -var hideableGuis = []; -var GUI = function GUI(pars) { - var _this = this; - var params = pars || {}; - this.domElement = document.createElement('div'); - this.__ul = document.createElement('ul'); - this.domElement.appendChild(this.__ul); - dom.addClass(this.domElement, CSS_NAMESPACE); - this.__folders = {}; - this.__controllers = []; - this.__rememberedObjects = []; - this.__rememberedObjectIndecesToControllers = []; - this.__listening = []; - params = Common.defaults(params, { - closeOnTop: false, - autoPlace: true, - width: GUI.DEFAULT_WIDTH - }); - params = Common.defaults(params, { - resizable: params.autoPlace, - hideable: params.autoPlace - }); - if (!Common.isUndefined(params.load)) { - if (params.preset) { - params.load.preset = params.preset; - } - } else { - params.load = { preset: DEFAULT_DEFAULT_PRESET_NAME }; - } - if (Common.isUndefined(params.parent) && params.hideable) { - hideableGuis.push(this); - } - params.resizable = Common.isUndefined(params.parent) && params.resizable; - if (params.autoPlace && Common.isUndefined(params.scrollable)) { - params.scrollable = true; - } - var useLocalStorage = SUPPORTS_LOCAL_STORAGE && localStorage.getItem(getLocalStorageHash(this, 'isLocal')) === 'true'; - var saveToLocalStorage = void 0; - var titleRow = void 0; - Object.defineProperties(this, - { - parent: { - get: function get$$1() { - return params.parent; - } - }, - scrollable: { - get: function get$$1() { - return params.scrollable; - } - }, - autoPlace: { - get: function get$$1() { - return params.autoPlace; - } - }, - closeOnTop: { - get: function get$$1() { - return params.closeOnTop; - } - }, - preset: { - get: function get$$1() { - if (_this.parent) { - return _this.getRoot().preset; + function requestAnimationFrame(callback) { + setTimeout(callback, 1000 / 60); + } + var requestAnimationFrame$1 = + window.requestAnimationFrame || + window.webkitRequestAnimationFrame || + window.mozRequestAnimationFrame || + window.oRequestAnimationFrame || + window.msRequestAnimationFrame || + requestAnimationFrame; + + var CenteredDiv = (function () { + function CenteredDiv() { + classCallCheck(this, CenteredDiv); + this.backgroundElement = document.createElement('div'); + Common.extend(this.backgroundElement.style, { + backgroundColor: 'rgba(0,0,0,0.8)', + top: 0, + left: 0, + display: 'none', + zIndex: '1000', + opacity: 0, + WebkitTransition: 'opacity 0.2s linear', + transition: 'opacity 0.2s linear', + }); + dom.makeFullscreen(this.backgroundElement); + this.backgroundElement.style.position = 'fixed'; + this.domElement = document.createElement('div'); + Common.extend(this.domElement.style, { + position: 'fixed', + display: 'none', + zIndex: '1001', + opacity: 0, + WebkitTransition: '-webkit-transform 0.2s ease-out, opacity 0.2s linear', + transition: 'transform 0.2s ease-out, opacity 0.2s linear', + }); + document.body.appendChild(this.backgroundElement); + document.body.appendChild(this.domElement); + var _this = this; + dom.bind(this.backgroundElement, 'click', function () { + _this.hide(); + }); } - return params.load.preset; - }, - set: function set$$1(v) { - if (_this.parent) { - _this.getRoot().preset = v; + createClass(CenteredDiv, [ + { + key: 'show', + value: function show() { + var _this = this; + this.backgroundElement.style.display = 'block'; + this.domElement.style.display = 'block'; + this.domElement.style.opacity = 0; + this.domElement.style.webkitTransform = 'scale(1.1)'; + this.layout(); + Common.defer(function () { + _this.backgroundElement.style.opacity = 1; + _this.domElement.style.opacity = 1; + _this.domElement.style.webkitTransform = 'scale(1)'; + }); + }, + }, + { + key: 'hide', + value: function hide() { + var _this = this; + var hide = function hide() { + _this.domElement.style.display = 'none'; + _this.backgroundElement.style.display = 'none'; + dom.unbind(_this.domElement, 'webkitTransitionEnd', hide); + dom.unbind(_this.domElement, 'transitionend', hide); + dom.unbind(_this.domElement, 'oTransitionEnd', hide); + }; + dom.bind(this.domElement, 'webkitTransitionEnd', hide); + dom.bind(this.domElement, 'transitionend', hide); + dom.bind(this.domElement, 'oTransitionEnd', hide); + this.backgroundElement.style.opacity = 0; + this.domElement.style.opacity = 0; + this.domElement.style.webkitTransform = 'scale(1.1)'; + }, + }, + { + key: 'layout', + value: function layout() { + this.domElement.style.left = window.innerWidth / 2 - dom.getWidth(this.domElement) / 2 + 'px'; + this.domElement.style.top = window.innerHeight / 2 - dom.getHeight(this.domElement) / 2 + 'px'; + }, + }, + ]); + return CenteredDiv; + })(); + + var styleSheet = ___$insertStyle( + ".dg ul{list-style:none;margin:0;padding:0;width:100%;clear:both}.dg.ac{position:fixed;top:0;left:0;right:0;height:0;z-index:0}.dg:not(.ac) .main{overflow:hidden}.dg.main{-webkit-transition:opacity .1s linear;-o-transition:opacity .1s linear;-moz-transition:opacity .1s linear;transition:opacity .1s linear}.dg.main.taller-than-window{overflow-y:auto}.dg.main.taller-than-window .close-button{opacity:1;margin-top:-1px;border-top:1px solid #2c2c2c}.dg.main ul.closed .close-button{opacity:1 !important}.dg.main:hover .close-button,.dg.main .close-button.drag{opacity:1}.dg.main .close-button{-webkit-transition:opacity .1s linear;-o-transition:opacity .1s linear;-moz-transition:opacity .1s linear;transition:opacity .1s linear;border:0;line-height:19px;height:20px;cursor:pointer;text-align:center;background-color:#000}.dg.main .close-button.close-top{position:relative}.dg.main .close-button.close-bottom{position:absolute}.dg.main .close-button:hover{background-color:#111}.dg.a{float:right;margin-right:15px;overflow-y:visible}.dg.a.has-save>ul.close-top{margin-top:0}.dg.a.has-save>ul.close-bottom{margin-top:27px}.dg.a.has-save>ul.closed{margin-top:0}.dg.a .save-row{top:0;z-index:1002}.dg.a .save-row.close-top{position:relative}.dg.a .save-row.close-bottom{position:fixed}.dg li{-webkit-transition:height .1s ease-out;-o-transition:height .1s ease-out;-moz-transition:height .1s ease-out;transition:height .1s ease-out;-webkit-transition:overflow .1s linear;-o-transition:overflow .1s linear;-moz-transition:overflow .1s linear;transition:overflow .1s linear}.dg li:not(.folder){cursor:auto;height:27px;line-height:27px;padding:0 4px 0 5px}.dg li.folder{padding:0;border-left:4px solid rgba(0,0,0,0)}.dg li.title{cursor:pointer;margin-left:-4px}.dg .closed li:not(.title),.dg .closed ul li,.dg .closed ul li>*{height:0;overflow:hidden;border:0}.dg .cr{clear:both;padding-left:3px;height:27px;overflow:hidden}.dg .property-name{cursor:default;float:left;clear:left;width:40%;overflow:hidden;text-overflow:ellipsis}.dg .c{float:left;width:60%;position:relative}.dg .c input[type=text]{border:0;margin-top:4px;padding:3px;width:100%;float:right}.dg .has-slider input[type=text]{width:30%;margin-left:0}.dg .slider{float:left;width:66%;margin-left:-5px;margin-right:0;height:19px;margin-top:4px}.dg .slider-fg{height:100%}.dg .c input[type=checkbox]{margin-top:7px}.dg .c select{margin-top:5px}.dg .cr.function,.dg .cr.function .property-name,.dg .cr.function *,.dg .cr.boolean,.dg .cr.boolean *{cursor:pointer}.dg .cr.color{overflow:visible}.dg .selector{display:none;position:absolute;margin-left:-9px;margin-top:23px;z-index:10}.dg .c:hover .selector,.dg .selector.drag{display:block}.dg li.save-row{padding:0}.dg li.save-row .button{display:inline-block;padding:0px 6px}.dg.dialogue{background-color:#222;width:460px;padding:15px;font-size:13px;line-height:15px}#dg-new-constructor{padding:10px;color:#222;font-family:Monaco, monospace;font-size:10px;border:0;resize:none;box-shadow:inset 1px 1px 1px #888;word-wrap:break-word;margin:12px 0;display:block;width:440px;overflow-y:scroll;height:100px;position:relative}#dg-local-explain{display:none;font-size:11px;line-height:17px;border-radius:3px;background-color:#333;padding:8px;margin-top:10px}#dg-local-explain code{font-size:10px}#dat-gui-save-locally{display:none}.dg{color:#eee;font:11px 'Lucida Grande', sans-serif;text-shadow:0 -1px 0 #111}.dg.main::-webkit-scrollbar{width:5px;background:#1a1a1a}.dg.main::-webkit-scrollbar-corner{height:0;display:none}.dg.main::-webkit-scrollbar-thumb{border-radius:5px;background:#676767}.dg li:not(.folder){background:#1a1a1a;border-bottom:1px solid #2c2c2c}.dg li.save-row{line-height:25px;background:#dad5cb;border:0}.dg li.save-row select{margin-left:5px;width:108px}.dg li.save-row .button{margin-left:5px;margin-top:1px;border-radius:2px;font-size:9px;line-height:7px;padding:4px 4px 5px 4px;background:#c5bdad;color:#fff;text-shadow:0 1px 0 #b0a58f;box-shadow:0 -1px 0 #b0a58f;cursor:pointer}.dg li.save-row .button.gears{background:#c5bdad url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAsAAAANCAYAAAB/9ZQ7AAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAQJJREFUeNpiYKAU/P//PwGIC/ApCABiBSAW+I8AClAcgKxQ4T9hoMAEUrxx2QSGN6+egDX+/vWT4e7N82AMYoPAx/evwWoYoSYbACX2s7KxCxzcsezDh3evFoDEBYTEEqycggWAzA9AuUSQQgeYPa9fPv6/YWm/Acx5IPb7ty/fw+QZblw67vDs8R0YHyQhgObx+yAJkBqmG5dPPDh1aPOGR/eugW0G4vlIoTIfyFcA+QekhhHJhPdQxbiAIguMBTQZrPD7108M6roWYDFQiIAAv6Aow/1bFwXgis+f2LUAynwoIaNcz8XNx3Dl7MEJUDGQpx9gtQ8YCueB+D26OECAAQDadt7e46D42QAAAABJRU5ErkJggg==) 2px 1px no-repeat;height:7px;width:8px}.dg li.save-row .button:hover{background-color:#bab19e;box-shadow:0 -1px 0 #b0a58f}.dg li.folder{border-bottom:0}.dg li.title{padding-left:16px;background:#000 url(data:image/gif;base64,R0lGODlhBQAFAJEAAP////Pz8////////yH5BAEAAAIALAAAAAAFAAUAAAIIlI+hKgFxoCgAOw==) 6px 10px no-repeat;cursor:pointer;border-bottom:1px solid rgba(255,255,255,0.2)}.dg .closed li.title{background-image:url(data:image/gif;base64,R0lGODlhBQAFAJEAAP////Pz8////////yH5BAEAAAIALAAAAAAFAAUAAAIIlGIWqMCbWAEAOw==)}.dg .cr.boolean{border-left:3px solid #806787}.dg .cr.color{border-left:3px solid}.dg .cr.function{border-left:3px solid #e61d5f}.dg .cr.number{border-left:3px solid #2FA1D6}.dg .cr.number input[type=text]{color:#2FA1D6}.dg .cr.string{border-left:3px solid #1ed36f}.dg .cr.string input[type=text]{color:#1ed36f}.dg .cr.function:hover,.dg .cr.boolean:hover{background:#111}.dg .c input[type=text]{background:#303030;outline:none}.dg .c input[type=text]:hover{background:#3c3c3c}.dg .c input[type=text]:focus{background:#494949;color:#fff}.dg .c .slider{background:#303030;cursor:ew-resize}.dg .c .slider-fg{background:#2FA1D6;max-width:100%}.dg .c .slider:hover{background:#3c3c3c}.dg .c .slider:hover .slider-fg{background:#44abda}\n", + ); + + css.inject(styleSheet); + var CSS_NAMESPACE = 'dg'; + var HIDE_KEY_CODE = 72; + var CLOSE_BUTTON_HEIGHT = 20; + var DEFAULT_DEFAULT_PRESET_NAME = 'Default'; + var SUPPORTS_LOCAL_STORAGE = (function () { + try { + return !!window.localStorage; + } catch (e) { + return false; + } + })(); + var SAVE_DIALOGUE = void 0; + var autoPlaceVirgin = true; + var autoPlaceContainer = void 0; + var hide = false; + var hideableGuis = []; + var GUI = function GUI(pars) { + var _this = this; + var params = pars || {}; + this.domElement = document.createElement('div'); + this.__ul = document.createElement('ul'); + this.domElement.appendChild(this.__ul); + dom.addClass(this.domElement, CSS_NAMESPACE); + this.__folders = {}; + this.__controllers = []; + this.__rememberedObjects = []; + this.__rememberedObjectIndecesToControllers = []; + this.__listening = []; + params = Common.defaults(params, { + closeOnTop: false, + autoPlace: true, + width: GUI.DEFAULT_WIDTH, + }); + params = Common.defaults(params, { + resizable: params.autoPlace, + hideable: params.autoPlace, + }); + if (!Common.isUndefined(params.load)) { + if (params.preset) { + params.load.preset = params.preset; + } } else { - params.load.preset = v; + params.load = { preset: DEFAULT_DEFAULT_PRESET_NAME }; } - setPresetSelectIndex(this); - _this.revert(); - } - }, - width: { - get: function get$$1() { - return params.width; - }, - set: function set$$1(v) { - params.width = v; - setWidth(_this, v); - } - }, - name: { - get: function get$$1() { - return params.name; - }, - set: function set$$1(v) { - params.name = v; - if (titleRow) { - titleRow.innerHTML = params.name; + if (Common.isUndefined(params.parent) && params.hideable) { + hideableGuis.push(this); } - } - }, - closed: { - get: function get$$1() { - return params.closed; - }, - set: function set$$1(v) { - params.closed = v; - if (params.closed) { - dom.addClass(_this.__ul, GUI.CLASS_CLOSED); + params.resizable = Common.isUndefined(params.parent) && params.resizable; + if (params.autoPlace && Common.isUndefined(params.scrollable)) { + params.scrollable = true; + } + var useLocalStorage = + SUPPORTS_LOCAL_STORAGE && localStorage.getItem(getLocalStorageHash(this, 'isLocal')) === 'true'; + var saveToLocalStorage = void 0; + var titleRow = void 0; + Object.defineProperties(this, { + parent: { + get: function get$$1() { + return params.parent; + }, + }, + scrollable: { + get: function get$$1() { + return params.scrollable; + }, + }, + autoPlace: { + get: function get$$1() { + return params.autoPlace; + }, + }, + closeOnTop: { + get: function get$$1() { + return params.closeOnTop; + }, + }, + preset: { + get: function get$$1() { + if (_this.parent) { + return _this.getRoot().preset; + } + return params.load.preset; + }, + set: function set$$1(v) { + if (_this.parent) { + _this.getRoot().preset = v; + } else { + params.load.preset = v; + } + setPresetSelectIndex(this); + _this.revert(); + }, + }, + width: { + get: function get$$1() { + return params.width; + }, + set: function set$$1(v) { + params.width = v; + setWidth(_this, v); + }, + }, + name: { + get: function get$$1() { + return params.name; + }, + set: function set$$1(v) { + params.name = v; + if (titleRow) { + titleRow.innerHTML = params.name; + } + }, + }, + closed: { + get: function get$$1() { + return params.closed; + }, + set: function set$$1(v) { + params.closed = v; + if (params.closed) { + dom.addClass(_this.__ul, GUI.CLASS_CLOSED); + } else { + dom.removeClass(_this.__ul, GUI.CLASS_CLOSED); + } + this.onResize(); + if (_this.__closeButton) { + _this.__closeButton.innerHTML = v ? GUI.TEXT_OPEN : GUI.TEXT_CLOSED; + } + }, + }, + load: { + get: function get$$1() { + return params.load; + }, + }, + useLocalStorage: { + get: function get$$1() { + return useLocalStorage; + }, + set: function set$$1(bool) { + if (SUPPORTS_LOCAL_STORAGE) { + useLocalStorage = bool; + if (bool) { + dom.bind(window, 'unload', saveToLocalStorage); + } else { + dom.unbind(window, 'unload', saveToLocalStorage); + } + localStorage.setItem(getLocalStorageHash(_this, 'isLocal'), bool); + } + }, + }, + }); + if (Common.isUndefined(params.parent)) { + this.closed = params.closed || false; + dom.addClass(this.domElement, GUI.CLASS_MAIN); + dom.makeSelectable(this.domElement, false); + if (SUPPORTS_LOCAL_STORAGE) { + if (useLocalStorage) { + _this.useLocalStorage = true; + var savedGui = localStorage.getItem(getLocalStorageHash(this, 'gui')); + if (savedGui) { + params.load = JSON.parse(savedGui); + } + } + } + this.__closeButton = document.createElement('div'); + this.__closeButton.innerHTML = GUI.TEXT_CLOSED; + dom.addClass(this.__closeButton, GUI.CLASS_CLOSE_BUTTON); + if (params.closeOnTop) { + dom.addClass(this.__closeButton, GUI.CLASS_CLOSE_TOP); + this.domElement.insertBefore(this.__closeButton, this.domElement.childNodes[0]); + } else { + dom.addClass(this.__closeButton, GUI.CLASS_CLOSE_BOTTOM); + this.domElement.appendChild(this.__closeButton); + } + dom.bind(this.__closeButton, 'click', function () { + _this.closed = !_this.closed; + }); } else { - dom.removeClass(_this.__ul, GUI.CLASS_CLOSED); + if (params.closed === undefined) { + params.closed = true; + } + var titleRowName = document.createTextNode(params.name); + dom.addClass(titleRowName, 'controller-name'); + titleRow = addRow(_this, titleRowName); + var onClickTitle = function onClickTitle(e) { + e.preventDefault(); + _this.closed = !_this.closed; + return false; + }; + dom.addClass(this.__ul, GUI.CLASS_CLOSED); + dom.addClass(titleRow, 'title'); + dom.bind(titleRow, 'click', onClickTitle); + if (!params.closed) { + this.closed = false; + } } + if (params.autoPlace) { + if (Common.isUndefined(params.parent)) { + if (autoPlaceVirgin) { + autoPlaceContainer = document.createElement('div'); + dom.addClass(autoPlaceContainer, CSS_NAMESPACE); + dom.addClass(autoPlaceContainer, GUI.CLASS_AUTO_PLACE_CONTAINER); + document.body.appendChild(autoPlaceContainer); + autoPlaceVirgin = false; + } + autoPlaceContainer.appendChild(this.domElement); + dom.addClass(this.domElement, GUI.CLASS_AUTO_PLACE); + } + if (!this.parent) { + setWidth(_this, params.width); + } + } + this.__resizeHandler = function () { + _this.onResizeDebounced(); + }; + dom.bind(window, 'resize', this.__resizeHandler); + dom.bind(this.__ul, 'webkitTransitionEnd', this.__resizeHandler); + dom.bind(this.__ul, 'transitionend', this.__resizeHandler); + dom.bind(this.__ul, 'oTransitionEnd', this.__resizeHandler); this.onResize(); - if (_this.__closeButton) { - _this.__closeButton.innerHTML = v ? GUI.TEXT_OPEN : GUI.TEXT_CLOSED; + if (params.resizable) { + addResizeHandle(this); } - } - }, - load: { - get: function get$$1() { - return params.load; - } - }, - useLocalStorage: { - get: function get$$1() { - return useLocalStorage; - }, - set: function set$$1(bool) { - if (SUPPORTS_LOCAL_STORAGE) { - useLocalStorage = bool; - if (bool) { - dom.bind(window, 'unload', saveToLocalStorage); - } else { - dom.unbind(window, 'unload', saveToLocalStorage); - } - localStorage.setItem(getLocalStorageHash(_this, 'isLocal'), bool); + saveToLocalStorage = function saveToLocalStorage() { + if (SUPPORTS_LOCAL_STORAGE && localStorage.getItem(getLocalStorageHash(_this, 'isLocal')) === 'true') { + localStorage.setItem(getLocalStorageHash(_this, 'gui'), JSON.stringify(_this.getSaveObject())); + } + }; + this.saveToLocalStorageIfPossible = saveToLocalStorage; + function resetWidth() { + var root = _this.getRoot(); + root.width += 1; + Common.defer(function () { + root.width -= 1; + }); } - } - } - }); - if (Common.isUndefined(params.parent)) { - this.closed = params.closed || false; - dom.addClass(this.domElement, GUI.CLASS_MAIN); - dom.makeSelectable(this.domElement, false); - if (SUPPORTS_LOCAL_STORAGE) { - if (useLocalStorage) { - _this.useLocalStorage = true; - var savedGui = localStorage.getItem(getLocalStorageHash(this, 'gui')); - if (savedGui) { - params.load = JSON.parse(savedGui); + if (!params.parent) { + resetWidth(); } - } - } - this.__closeButton = document.createElement('div'); - this.__closeButton.innerHTML = GUI.TEXT_CLOSED; - dom.addClass(this.__closeButton, GUI.CLASS_CLOSE_BUTTON); - if (params.closeOnTop) { - dom.addClass(this.__closeButton, GUI.CLASS_CLOSE_TOP); - this.domElement.insertBefore(this.__closeButton, this.domElement.childNodes[0]); - } else { - dom.addClass(this.__closeButton, GUI.CLASS_CLOSE_BOTTOM); - this.domElement.appendChild(this.__closeButton); - } - dom.bind(this.__closeButton, 'click', function () { - _this.closed = !_this.closed; - }); - } else { - if (params.closed === undefined) { - params.closed = true; - } - var titleRowName = document.createTextNode(params.name); - dom.addClass(titleRowName, 'controller-name'); - titleRow = addRow(_this, titleRowName); - var onClickTitle = function onClickTitle(e) { - e.preventDefault(); - _this.closed = !_this.closed; - return false; }; - dom.addClass(this.__ul, GUI.CLASS_CLOSED); - dom.addClass(titleRow, 'title'); - dom.bind(titleRow, 'click', onClickTitle); - if (!params.closed) { - this.closed = false; - } - } - if (params.autoPlace) { - if (Common.isUndefined(params.parent)) { - if (autoPlaceVirgin) { - autoPlaceContainer = document.createElement('div'); - dom.addClass(autoPlaceContainer, CSS_NAMESPACE); - dom.addClass(autoPlaceContainer, GUI.CLASS_AUTO_PLACE_CONTAINER); - document.body.appendChild(autoPlaceContainer); - autoPlaceVirgin = false; - } - autoPlaceContainer.appendChild(this.domElement); - dom.addClass(this.domElement, GUI.CLASS_AUTO_PLACE); - } - if (!this.parent) { - setWidth(_this, params.width); - } - } - this.__resizeHandler = function () { - _this.onResizeDebounced(); - }; - dom.bind(window, 'resize', this.__resizeHandler); - dom.bind(this.__ul, 'webkitTransitionEnd', this.__resizeHandler); - dom.bind(this.__ul, 'transitionend', this.__resizeHandler); - dom.bind(this.__ul, 'oTransitionEnd', this.__resizeHandler); - this.onResize(); - if (params.resizable) { - addResizeHandle(this); - } - saveToLocalStorage = function saveToLocalStorage() { - if (SUPPORTS_LOCAL_STORAGE && localStorage.getItem(getLocalStorageHash(_this, 'isLocal')) === 'true') { - localStorage.setItem(getLocalStorageHash(_this, 'gui'), JSON.stringify(_this.getSaveObject())); - } - }; - this.saveToLocalStorageIfPossible = saveToLocalStorage; - function resetWidth() { - var root = _this.getRoot(); - root.width += 1; - Common.defer(function () { - root.width -= 1; - }); - } - if (!params.parent) { - resetWidth(); - } -}; -GUI.toggleHide = function () { - hide = !hide; - Common.each(hideableGuis, function (gui) { - gui.domElement.style.display = hide ? 'none' : ''; - }); -}; -GUI.CLASS_AUTO_PLACE = 'a'; -GUI.CLASS_AUTO_PLACE_CONTAINER = 'ac'; -GUI.CLASS_MAIN = 'main'; -GUI.CLASS_CONTROLLER_ROW = 'cr'; -GUI.CLASS_TOO_TALL = 'taller-than-window'; -GUI.CLASS_CLOSED = 'closed'; -GUI.CLASS_CLOSE_BUTTON = 'close-button'; -GUI.CLASS_CLOSE_TOP = 'close-top'; -GUI.CLASS_CLOSE_BOTTOM = 'close-bottom'; -GUI.CLASS_DRAG = 'drag'; -GUI.DEFAULT_WIDTH = 245; -GUI.TEXT_CLOSED = 'Close Controls'; -GUI.TEXT_OPEN = 'Open Controls'; -GUI._keydownHandler = function (e) { - if (document.activeElement.type !== 'text' && (e.which === HIDE_KEY_CODE || e.keyCode === HIDE_KEY_CODE)) { - GUI.toggleHide(); - } -}; -dom.bind(window, 'keydown', GUI._keydownHandler, false); -Common.extend(GUI.prototype, -{ - add: function add(object, property) { - return _add(this, object, property, { - factoryArgs: Array.prototype.slice.call(arguments, 2) - }); - }, - addColor: function addColor(object, property) { - return _add(this, object, property, { - color: true - }); - }, - remove: function remove(controller) { - this.__ul.removeChild(controller.__li); - this.__controllers.splice(this.__controllers.indexOf(controller), 1); - var _this = this; - Common.defer(function () { - _this.onResize(); - }); - }, - destroy: function destroy() { - if (this.parent) { - throw new Error('Only the root GUI should be removed with .destroy(). ' + 'For subfolders, use gui.removeFolder(folder) instead.'); - } - if (this.autoPlace) { - autoPlaceContainer.removeChild(this.domElement); - } - var _this = this; - Common.each(this.__folders, function (subfolder) { - _this.removeFolder(subfolder); - }); - dom.unbind(window, 'keydown', GUI._keydownHandler, false); - removeListeners(this); - }, - addFolder: function addFolder(name) { - if (this.__folders[name] !== undefined) { - throw new Error('You already have a folder in this GUI by the' + ' name "' + name + '"'); - } - var newGuiParams = { name: name, parent: this }; - newGuiParams.autoPlace = this.autoPlace; - if (this.load && - this.load.folders && - this.load.folders[name]) { - newGuiParams.closed = this.load.folders[name].closed; - newGuiParams.load = this.load.folders[name]; - } - var gui = new GUI(newGuiParams); - this.__folders[name] = gui; - var li = addRow(this, gui.domElement); - dom.addClass(li, 'folder'); - return gui; - }, - removeFolder: function removeFolder(folder) { - this.__ul.removeChild(folder.domElement.parentElement); - delete this.__folders[folder.name]; - if (this.load && - this.load.folders && - this.load.folders[folder.name]) { - delete this.load.folders[folder.name]; - } - removeListeners(folder); - var _this = this; - Common.each(folder.__folders, function (subfolder) { - folder.removeFolder(subfolder); - }); - Common.defer(function () { - _this.onResize(); - }); - }, - open: function open() { - this.closed = false; - }, - close: function close() { - this.closed = true; - }, - hide: function hide() { - this.domElement.style.display = 'none'; - }, - show: function show() { - this.domElement.style.display = ''; - }, - onResize: function onResize() { - var root = this.getRoot(); - if (root.scrollable) { - var top = dom.getOffset(root.__ul).top; - var h = 0; - Common.each(root.__ul.childNodes, function (node) { - if (!(root.autoPlace && node === root.__save_row)) { - h += dom.getHeight(node); + GUI.toggleHide = function () { + hide = !hide; + Common.each(hideableGuis, function (gui) { + gui.domElement.style.display = hide ? 'none' : ''; + }); + }; + GUI.CLASS_AUTO_PLACE = 'a'; + GUI.CLASS_AUTO_PLACE_CONTAINER = 'ac'; + GUI.CLASS_MAIN = 'main'; + GUI.CLASS_CONTROLLER_ROW = 'cr'; + GUI.CLASS_TOO_TALL = 'taller-than-window'; + GUI.CLASS_CLOSED = 'closed'; + GUI.CLASS_CLOSE_BUTTON = 'close-button'; + GUI.CLASS_CLOSE_TOP = 'close-top'; + GUI.CLASS_CLOSE_BOTTOM = 'close-bottom'; + GUI.CLASS_DRAG = 'drag'; + GUI.DEFAULT_WIDTH = 245; + GUI.TEXT_CLOSED = 'Close Controls'; + GUI.TEXT_OPEN = 'Open Controls'; + GUI._keydownHandler = function (e) { + if (document.activeElement.type !== 'text' && (e.which === HIDE_KEY_CODE || e.keyCode === HIDE_KEY_CODE)) { + GUI.toggleHide(); } - }); - if (window.innerHeight - top - CLOSE_BUTTON_HEIGHT < h) { - dom.addClass(root.domElement, GUI.CLASS_TOO_TALL); - root.__ul.style.height = window.innerHeight - top - CLOSE_BUTTON_HEIGHT + 'px'; - } else { - dom.removeClass(root.domElement, GUI.CLASS_TOO_TALL); - root.__ul.style.height = 'auto'; - } - } - if (root.__resize_handle) { - Common.defer(function () { - root.__resize_handle.style.height = root.__ul.offsetHeight + 'px'; - }); - } - if (root.__closeButton) { - root.__closeButton.style.width = root.width + 'px'; - } - }, - onResizeDebounced: Common.debounce(function () { - this.onResize(); - }, 50), - remember: function remember() { - if (Common.isUndefined(SAVE_DIALOGUE)) { - SAVE_DIALOGUE = new CenteredDiv(); - SAVE_DIALOGUE.domElement.innerHTML = saveDialogContents; - } - if (this.parent) { - throw new Error('You can only call remember on a top level GUI.'); - } - var _this = this; - Common.each(Array.prototype.slice.call(arguments), function (object) { - if (_this.__rememberedObjects.length === 0) { - addSaveMenu(_this); - } - if (_this.__rememberedObjects.indexOf(object) === -1) { - _this.__rememberedObjects.push(object); - } + }; + dom.bind(window, 'keydown', GUI._keydownHandler, false); + Common.extend(GUI.prototype, { + add: function add(object, property) { + return _add(this, object, property, { + factoryArgs: Array.prototype.slice.call(arguments, 2), + }); + }, + addColor: function addColor(object, property) { + return _add(this, object, property, { + color: true, + }); + }, + remove: function remove(controller) { + this.__ul.removeChild(controller.__li); + this.__controllers.splice(this.__controllers.indexOf(controller), 1); + var _this = this; + Common.defer(function () { + _this.onResize(); + }); + }, + destroy: function destroy() { + if (this.parent) { + throw new Error( + 'Only the root GUI should be removed with .destroy(). ' + + 'For subfolders, use gui.removeFolder(folder) instead.', + ); + } + if (this.autoPlace) { + autoPlaceContainer.removeChild(this.domElement); + } + var _this = this; + Common.each(this.__folders, function (subfolder) { + _this.removeFolder(subfolder); + }); + dom.unbind(window, 'keydown', GUI._keydownHandler, false); + removeListeners(this); + }, + addFolder: function addFolder(name) { + if (this.__folders[name] !== undefined) { + throw new Error('You already have a folder in this GUI by the' + ' name "' + name + '"'); + } + var newGuiParams = { name: name, parent: this }; + newGuiParams.autoPlace = this.autoPlace; + if (this.load && this.load.folders && this.load.folders[name]) { + newGuiParams.closed = this.load.folders[name].closed; + newGuiParams.load = this.load.folders[name]; + } + var gui = new GUI(newGuiParams); + this.__folders[name] = gui; + var li = addRow(this, gui.domElement); + dom.addClass(li, 'folder'); + return gui; + }, + removeFolder: function removeFolder(folder) { + this.__ul.removeChild(folder.domElement.parentElement); + delete this.__folders[folder.name]; + if (this.load && this.load.folders && this.load.folders[folder.name]) { + delete this.load.folders[folder.name]; + } + removeListeners(folder); + var _this = this; + Common.each(folder.__folders, function (subfolder) { + folder.removeFolder(subfolder); + }); + Common.defer(function () { + _this.onResize(); + }); + }, + open: function open() { + this.closed = false; + }, + close: function close() { + this.closed = true; + }, + hide: function hide() { + this.domElement.style.display = 'none'; + }, + show: function show() { + this.domElement.style.display = ''; + }, + onResize: function onResize() { + var root = this.getRoot(); + if (root.scrollable) { + var top = dom.getOffset(root.__ul).top; + var h = 0; + Common.each(root.__ul.childNodes, function (node) { + if (!(root.autoPlace && node === root.__save_row)) { + h += dom.getHeight(node); + } + }); + if (window.innerHeight - top - CLOSE_BUTTON_HEIGHT < h) { + dom.addClass(root.domElement, GUI.CLASS_TOO_TALL); + root.__ul.style.height = window.innerHeight - top - CLOSE_BUTTON_HEIGHT + 'px'; + } else { + dom.removeClass(root.domElement, GUI.CLASS_TOO_TALL); + root.__ul.style.height = 'auto'; + } + } + if (root.__resize_handle) { + Common.defer(function () { + root.__resize_handle.style.height = root.__ul.offsetHeight + 'px'; + }); + } + if (root.__closeButton) { + root.__closeButton.style.width = root.width + 'px'; + } + }, + onResizeDebounced: Common.debounce(function () { + this.onResize(); + }, 50), + remember: function remember() { + if (Common.isUndefined(SAVE_DIALOGUE)) { + SAVE_DIALOGUE = new CenteredDiv(); + SAVE_DIALOGUE.domElement.innerHTML = saveDialogContents; + } + if (this.parent) { + throw new Error('You can only call remember on a top level GUI.'); + } + var _this = this; + Common.each(Array.prototype.slice.call(arguments), function (object) { + if (_this.__rememberedObjects.length === 0) { + addSaveMenu(_this); + } + if (_this.__rememberedObjects.indexOf(object) === -1) { + _this.__rememberedObjects.push(object); + } + }); + if (this.autoPlace) { + setWidth(this, this.width); + } + }, + getRoot: function getRoot() { + var gui = this; + while (gui.parent) { + gui = gui.parent; + } + return gui; + }, + getSaveObject: function getSaveObject() { + var toReturn = this.load; + toReturn.closed = this.closed; + if (this.__rememberedObjects.length > 0) { + toReturn.preset = this.preset; + if (!toReturn.remembered) { + toReturn.remembered = {}; + } + toReturn.remembered[this.preset] = getCurrentPreset(this); + } + toReturn.folders = {}; + Common.each(this.__folders, function (element, key) { + toReturn.folders[key] = element.getSaveObject(); + }); + return toReturn; + }, + save: function save() { + if (!this.load.remembered) { + this.load.remembered = {}; + } + this.load.remembered[this.preset] = getCurrentPreset(this); + markPresetModified(this, false); + this.saveToLocalStorageIfPossible(); + }, + saveAs: function saveAs(presetName) { + if (!this.load.remembered) { + this.load.remembered = {}; + this.load.remembered[DEFAULT_DEFAULT_PRESET_NAME] = getCurrentPreset(this, true); + } + this.load.remembered[presetName] = getCurrentPreset(this); + this.preset = presetName; + addPresetOption(this, presetName, true); + this.saveToLocalStorageIfPossible(); + }, + revert: function revert(gui) { + Common.each( + this.__controllers, + function (controller) { + if (!this.getRoot().load.remembered) { + controller.setValue(controller.initialValue); + } else { + recallSavedValue(gui || this.getRoot(), controller); + } + if (controller.__onFinishChange) { + controller.__onFinishChange.call(controller, controller.getValue()); + } + }, + this, + ); + Common.each(this.__folders, function (folder) { + folder.revert(folder); + }); + if (!gui) { + markPresetModified(this.getRoot(), false); + } + }, + listen: function listen(controller) { + var init = this.__listening.length === 0; + this.__listening.push(controller); + if (init) { + updateDisplays(this.__listening); + } + }, + updateDisplay: function updateDisplay() { + Common.each(this.__controllers, function (controller) { + controller.updateDisplay(); + }); + Common.each(this.__folders, function (folder) { + folder.updateDisplay(); + }); + }, }); - if (this.autoPlace) { - setWidth(this, this.width); - } - }, - getRoot: function getRoot() { - var gui = this; - while (gui.parent) { - gui = gui.parent; - } - return gui; - }, - getSaveObject: function getSaveObject() { - var toReturn = this.load; - toReturn.closed = this.closed; - if (this.__rememberedObjects.length > 0) { - toReturn.preset = this.preset; - if (!toReturn.remembered) { - toReturn.remembered = {}; - } - toReturn.remembered[this.preset] = getCurrentPreset(this); + function addRow(gui, newDom, liBefore) { + var li = document.createElement('li'); + if (newDom) { + li.appendChild(newDom); + } + if (liBefore) { + gui.__ul.insertBefore(li, liBefore); + } else { + gui.__ul.appendChild(li); + } + gui.onResize(); + return li; } - toReturn.folders = {}; - Common.each(this.__folders, function (element, key) { - toReturn.folders[key] = element.getSaveObject(); - }); - return toReturn; - }, - save: function save() { - if (!this.load.remembered) { - this.load.remembered = {}; + function removeListeners(gui) { + dom.unbind(window, 'resize', gui.__resizeHandler); + if (gui.saveToLocalStorageIfPossible) { + dom.unbind(window, 'unload', gui.saveToLocalStorageIfPossible); + } } - this.load.remembered[this.preset] = getCurrentPreset(this); - markPresetModified(this, false); - this.saveToLocalStorageIfPossible(); - }, - saveAs: function saveAs(presetName) { - if (!this.load.remembered) { - this.load.remembered = {}; - this.load.remembered[DEFAULT_DEFAULT_PRESET_NAME] = getCurrentPreset(this, true); + function markPresetModified(gui, modified) { + var opt = gui.__preset_select[gui.__preset_select.selectedIndex]; + if (modified) { + opt.innerHTML = opt.value + '*'; + } else { + opt.innerHTML = opt.value; + } } - this.load.remembered[presetName] = getCurrentPreset(this); - this.preset = presetName; - addPresetOption(this, presetName, true); - this.saveToLocalStorageIfPossible(); - }, - revert: function revert(gui) { - Common.each(this.__controllers, function (controller) { - if (!this.getRoot().load.remembered) { - controller.setValue(controller.initialValue); - } else { - recallSavedValue(gui || this.getRoot(), controller); - } - if (controller.__onFinishChange) { - controller.__onFinishChange.call(controller, controller.getValue()); - } - }, this); - Common.each(this.__folders, function (folder) { - folder.revert(folder); - }); - if (!gui) { - markPresetModified(this.getRoot(), false); + function augmentController(gui, li, controller) { + controller.__li = li; + controller.__gui = gui; + Common.extend(controller, { + options: function options(_options) { + if (arguments.length > 1) { + var nextSibling = controller.__li.nextElementSibling; + controller.remove(); + return _add(gui, controller.object, controller.property, { + before: nextSibling, + factoryArgs: [Common.toArray(arguments)], + }); + } + if (Common.isArray(_options) || Common.isObject(_options)) { + var _nextSibling = controller.__li.nextElementSibling; + controller.remove(); + return _add(gui, controller.object, controller.property, { + before: _nextSibling, + factoryArgs: [_options], + }); + } + }, + name: function name(_name) { + controller.__li.firstElementChild.firstElementChild.innerHTML = _name; + return controller; + }, + listen: function listen() { + controller.__gui.listen(controller); + return controller; + }, + remove: function remove() { + controller.__gui.remove(controller); + return controller; + }, + }); + if (controller instanceof NumberControllerSlider) { + var box = new NumberControllerBox(controller.object, controller.property, { + min: controller.__min, + max: controller.__max, + step: controller.__step, + }); + Common.each(['updateDisplay', 'onChange', 'onFinishChange', 'step', 'min', 'max'], function (method) { + var pc = controller[method]; + var pb = box[method]; + controller[method] = box[method] = function () { + var args = Array.prototype.slice.call(arguments); + pb.apply(box, args); + return pc.apply(controller, args); + }; + }); + dom.addClass(li, 'has-slider'); + controller.domElement.insertBefore(box.domElement, controller.domElement.firstElementChild); + } else if (controller instanceof NumberControllerBox) { + var r = function r(returned) { + if (Common.isNumber(controller.__min) && Common.isNumber(controller.__max)) { + var oldName = controller.__li.firstElementChild.firstElementChild.innerHTML; + var wasListening = controller.__gui.__listening.indexOf(controller) > -1; + controller.remove(); + var newController = _add(gui, controller.object, controller.property, { + before: controller.__li.nextElementSibling, + factoryArgs: [controller.__min, controller.__max, controller.__step], + }); + newController.name(oldName); + if (wasListening) newController.listen(); + return newController; + } + return returned; + }; + controller.min = Common.compose(r, controller.min); + controller.max = Common.compose(r, controller.max); + } else if (controller instanceof BooleanController) { + dom.bind(li, 'click', function () { + dom.fakeEvent(controller.__checkbox, 'click'); + }); + dom.bind(controller.__checkbox, 'click', function (e) { + e.stopPropagation(); + }); + } else if (controller instanceof FunctionController) { + dom.bind(li, 'click', function () { + dom.fakeEvent(controller.__button, 'click'); + }); + dom.bind(li, 'mouseover', function () { + dom.addClass(controller.__button, 'hover'); + }); + dom.bind(li, 'mouseout', function () { + dom.removeClass(controller.__button, 'hover'); + }); + } else if (controller instanceof ColorController) { + dom.addClass(li, 'color'); + controller.updateDisplay = Common.compose(function (val) { + li.style.borderLeftColor = controller.__color.toString(); + return val; + }, controller.updateDisplay); + controller.updateDisplay(); + } + controller.setValue = Common.compose(function (val) { + if (gui.getRoot().__preset_select && controller.isModified()) { + markPresetModified(gui.getRoot(), true); + } + return val; + }, controller.setValue); + } + function recallSavedValue(gui, controller) { + var root = gui.getRoot(); + var matchedIndex = root.__rememberedObjects.indexOf(controller.object); + if (matchedIndex !== -1) { + var controllerMap = root.__rememberedObjectIndecesToControllers[matchedIndex]; + if (controllerMap === undefined) { + controllerMap = {}; + root.__rememberedObjectIndecesToControllers[matchedIndex] = controllerMap; + } + controllerMap[controller.property] = controller; + if (root.load && root.load.remembered) { + var presetMap = root.load.remembered; + var preset = void 0; + if (presetMap[gui.preset]) { + preset = presetMap[gui.preset]; + } else if (presetMap[DEFAULT_DEFAULT_PRESET_NAME]) { + preset = presetMap[DEFAULT_DEFAULT_PRESET_NAME]; + } else { + return; + } + if (preset[matchedIndex] && preset[matchedIndex][controller.property] !== undefined) { + var value = preset[matchedIndex][controller.property]; + controller.initialValue = value; + controller.setValue(value); + } + } + } } - }, - listen: function listen(controller) { - var init = this.__listening.length === 0; - this.__listening.push(controller); - if (init) { - updateDisplays(this.__listening); + function _add(gui, object, property, params) { + if (object[property] === undefined) { + throw new Error('Object "' + object + '" has no property "' + property + '"'); + } + var controller = void 0; + if (params.color) { + controller = new ColorController(object, property); + } else { + var factoryArgs = [object, property].concat(params.factoryArgs); + controller = ControllerFactory.apply(gui, factoryArgs); + } + if (params.before instanceof Controller) { + params.before = params.before.__li; + } + recallSavedValue(gui, controller); + dom.addClass(controller.domElement, 'c'); + var name = document.createElement('span'); + dom.addClass(name, 'property-name'); + name.innerHTML = controller.property; + var container = document.createElement('div'); + container.appendChild(name); + container.appendChild(controller.domElement); + var li = addRow(gui, container, params.before); + dom.addClass(li, GUI.CLASS_CONTROLLER_ROW); + if (controller instanceof ColorController) { + dom.addClass(li, 'color'); + } else { + dom.addClass(li, _typeof(controller.getValue())); + } + augmentController(gui, li, controller); + gui.__controllers.push(controller); + return controller; + } + function getLocalStorageHash(gui, key) { + return document.location.href + '.' + key; + } + function addPresetOption(gui, name, setSelected) { + var opt = document.createElement('option'); + opt.innerHTML = name; + opt.value = name; + gui.__preset_select.appendChild(opt); + if (setSelected) { + gui.__preset_select.selectedIndex = gui.__preset_select.length - 1; + } } - }, - updateDisplay: function updateDisplay() { - Common.each(this.__controllers, function (controller) { - controller.updateDisplay(); - }); - Common.each(this.__folders, function (folder) { - folder.updateDisplay(); - }); - } -}); -function addRow(gui, newDom, liBefore) { - var li = document.createElement('li'); - if (newDom) { - li.appendChild(newDom); - } - if (liBefore) { - gui.__ul.insertBefore(li, liBefore); - } else { - gui.__ul.appendChild(li); - } - gui.onResize(); - return li; -} -function removeListeners(gui) { - dom.unbind(window, 'resize', gui.__resizeHandler); - if (gui.saveToLocalStorageIfPossible) { - dom.unbind(window, 'unload', gui.saveToLocalStorageIfPossible); - } -} -function markPresetModified(gui, modified) { - var opt = gui.__preset_select[gui.__preset_select.selectedIndex]; - if (modified) { - opt.innerHTML = opt.value + '*'; - } else { - opt.innerHTML = opt.value; - } -} -function augmentController(gui, li, controller) { - controller.__li = li; - controller.__gui = gui; - Common.extend(controller, { - options: function options(_options) { - if (arguments.length > 1) { - var nextSibling = controller.__li.nextElementSibling; - controller.remove(); - return _add(gui, controller.object, controller.property, { - before: nextSibling, - factoryArgs: [Common.toArray(arguments)] + function showHideExplain(gui, explain) { + explain.style.display = gui.useLocalStorage ? 'block' : 'none'; + } + function addSaveMenu(gui) { + var div = (gui.__save_row = document.createElement('li')); + dom.addClass(gui.domElement, 'has-save'); + gui.__ul.insertBefore(div, gui.__ul.firstChild); + dom.addClass(div, 'save-row'); + var gears = document.createElement('span'); + gears.innerHTML = ' '; + dom.addClass(gears, 'button gears'); + var button = document.createElement('span'); + button.innerHTML = 'Save'; + dom.addClass(button, 'button'); + dom.addClass(button, 'save'); + var button2 = document.createElement('span'); + button2.innerHTML = 'New'; + dom.addClass(button2, 'button'); + dom.addClass(button2, 'save-as'); + var button3 = document.createElement('span'); + button3.innerHTML = 'Revert'; + dom.addClass(button3, 'button'); + dom.addClass(button3, 'revert'); + var select = (gui.__preset_select = document.createElement('select')); + if (gui.load && gui.load.remembered) { + Common.each(gui.load.remembered, function (value, key) { + addPresetOption(gui, key, key === gui.preset); + }); + } else { + addPresetOption(gui, DEFAULT_DEFAULT_PRESET_NAME, false); + } + dom.bind(select, 'change', function () { + for (var index = 0; index < gui.__preset_select.length; index++) { + gui.__preset_select[index].innerHTML = gui.__preset_select[index].value; + } + gui.preset = this.value; }); - } - if (Common.isArray(_options) || Common.isObject(_options)) { - var _nextSibling = controller.__li.nextElementSibling; - controller.remove(); - return _add(gui, controller.object, controller.property, { - before: _nextSibling, - factoryArgs: [_options] + div.appendChild(select); + div.appendChild(gears); + div.appendChild(button); + div.appendChild(button2); + div.appendChild(button3); + if (SUPPORTS_LOCAL_STORAGE) { + var explain = document.getElementById('dg-local-explain'); + var localStorageCheckBox = document.getElementById('dg-local-storage'); + var saveLocally = document.getElementById('dg-save-locally'); + saveLocally.style.display = 'block'; + if (localStorage.getItem(getLocalStorageHash(gui, 'isLocal')) === 'true') { + localStorageCheckBox.setAttribute('checked', 'checked'); + } + showHideExplain(gui, explain); + dom.bind(localStorageCheckBox, 'change', function () { + gui.useLocalStorage = !gui.useLocalStorage; + showHideExplain(gui, explain); + }); + } + var newConstructorTextArea = document.getElementById('dg-new-constructor'); + dom.bind(newConstructorTextArea, 'keydown', function (e) { + if (e.metaKey && (e.which === 67 || e.keyCode === 67)) { + SAVE_DIALOGUE.hide(); + } }); - } - }, - name: function name(_name) { - controller.__li.firstElementChild.firstElementChild.innerHTML = _name; - return controller; - }, - listen: function listen() { - controller.__gui.listen(controller); - return controller; - }, - remove: function remove() { - controller.__gui.remove(controller); - return controller; - } - }); - if (controller instanceof NumberControllerSlider) { - var box = new NumberControllerBox(controller.object, controller.property, { min: controller.__min, max: controller.__max, step: controller.__step }); - Common.each(['updateDisplay', 'onChange', 'onFinishChange', 'step', 'min', 'max'], function (method) { - var pc = controller[method]; - var pb = box[method]; - controller[method] = box[method] = function () { - var args = Array.prototype.slice.call(arguments); - pb.apply(box, args); - return pc.apply(controller, args); - }; - }); - dom.addClass(li, 'has-slider'); - controller.domElement.insertBefore(box.domElement, controller.domElement.firstElementChild); - } else if (controller instanceof NumberControllerBox) { - var r = function r(returned) { - if (Common.isNumber(controller.__min) && Common.isNumber(controller.__max)) { - var oldName = controller.__li.firstElementChild.firstElementChild.innerHTML; - var wasListening = controller.__gui.__listening.indexOf(controller) > -1; - controller.remove(); - var newController = _add(gui, controller.object, controller.property, { - before: controller.__li.nextElementSibling, - factoryArgs: [controller.__min, controller.__max, controller.__step] + dom.bind(gears, 'click', function () { + newConstructorTextArea.innerHTML = JSON.stringify(gui.getSaveObject(), undefined, 2); + SAVE_DIALOGUE.show(); + newConstructorTextArea.focus(); + newConstructorTextArea.select(); + }); + dom.bind(button, 'click', function () { + gui.save(); + }); + dom.bind(button2, 'click', function () { + var presetName = prompt('Enter a new preset name.'); + if (presetName) { + gui.saveAs(presetName); + } + }); + dom.bind(button3, 'click', function () { + gui.revert(); }); - newController.name(oldName); - if (wasListening) newController.listen(); - return newController; - } - return returned; - }; - controller.min = Common.compose(r, controller.min); - controller.max = Common.compose(r, controller.max); - } else if (controller instanceof BooleanController) { - dom.bind(li, 'click', function () { - dom.fakeEvent(controller.__checkbox, 'click'); - }); - dom.bind(controller.__checkbox, 'click', function (e) { - e.stopPropagation(); - }); - } else if (controller instanceof FunctionController) { - dom.bind(li, 'click', function () { - dom.fakeEvent(controller.__button, 'click'); - }); - dom.bind(li, 'mouseover', function () { - dom.addClass(controller.__button, 'hover'); - }); - dom.bind(li, 'mouseout', function () { - dom.removeClass(controller.__button, 'hover'); - }); - } else if (controller instanceof ColorController) { - dom.addClass(li, 'color'); - controller.updateDisplay = Common.compose(function (val) { - li.style.borderLeftColor = controller.__color.toString(); - return val; - }, controller.updateDisplay); - controller.updateDisplay(); - } - controller.setValue = Common.compose(function (val) { - if (gui.getRoot().__preset_select && controller.isModified()) { - markPresetModified(gui.getRoot(), true); - } - return val; - }, controller.setValue); -} -function recallSavedValue(gui, controller) { - var root = gui.getRoot(); - var matchedIndex = root.__rememberedObjects.indexOf(controller.object); - if (matchedIndex !== -1) { - var controllerMap = root.__rememberedObjectIndecesToControllers[matchedIndex]; - if (controllerMap === undefined) { - controllerMap = {}; - root.__rememberedObjectIndecesToControllers[matchedIndex] = controllerMap; - } - controllerMap[controller.property] = controller; - if (root.load && root.load.remembered) { - var presetMap = root.load.remembered; - var preset = void 0; - if (presetMap[gui.preset]) { - preset = presetMap[gui.preset]; - } else if (presetMap[DEFAULT_DEFAULT_PRESET_NAME]) { - preset = presetMap[DEFAULT_DEFAULT_PRESET_NAME]; - } else { - return; - } - if (preset[matchedIndex] && preset[matchedIndex][controller.property] !== undefined) { - var value = preset[matchedIndex][controller.property]; - controller.initialValue = value; - controller.setValue(value); - } - } - } -} -function _add(gui, object, property, params) { - if (object[property] === undefined) { - throw new Error('Object "' + object + '" has no property "' + property + '"'); - } - var controller = void 0; - if (params.color) { - controller = new ColorController(object, property); - } else { - var factoryArgs = [object, property].concat(params.factoryArgs); - controller = ControllerFactory.apply(gui, factoryArgs); - } - if (params.before instanceof Controller) { - params.before = params.before.__li; - } - recallSavedValue(gui, controller); - dom.addClass(controller.domElement, 'c'); - var name = document.createElement('span'); - dom.addClass(name, 'property-name'); - name.innerHTML = controller.property; - var container = document.createElement('div'); - container.appendChild(name); - container.appendChild(controller.domElement); - var li = addRow(gui, container, params.before); - dom.addClass(li, GUI.CLASS_CONTROLLER_ROW); - if (controller instanceof ColorController) { - dom.addClass(li, 'color'); - } else { - dom.addClass(li, _typeof(controller.getValue())); - } - augmentController(gui, li, controller); - gui.__controllers.push(controller); - return controller; -} -function getLocalStorageHash(gui, key) { - return document.location.href + '.' + key; -} -function addPresetOption(gui, name, setSelected) { - var opt = document.createElement('option'); - opt.innerHTML = name; - opt.value = name; - gui.__preset_select.appendChild(opt); - if (setSelected) { - gui.__preset_select.selectedIndex = gui.__preset_select.length - 1; - } -} -function showHideExplain(gui, explain) { - explain.style.display = gui.useLocalStorage ? 'block' : 'none'; -} -function addSaveMenu(gui) { - var div = gui.__save_row = document.createElement('li'); - dom.addClass(gui.domElement, 'has-save'); - gui.__ul.insertBefore(div, gui.__ul.firstChild); - dom.addClass(div, 'save-row'); - var gears = document.createElement('span'); - gears.innerHTML = ' '; - dom.addClass(gears, 'button gears'); - var button = document.createElement('span'); - button.innerHTML = 'Save'; - dom.addClass(button, 'button'); - dom.addClass(button, 'save'); - var button2 = document.createElement('span'); - button2.innerHTML = 'New'; - dom.addClass(button2, 'button'); - dom.addClass(button2, 'save-as'); - var button3 = document.createElement('span'); - button3.innerHTML = 'Revert'; - dom.addClass(button3, 'button'); - dom.addClass(button3, 'revert'); - var select = gui.__preset_select = document.createElement('select'); - if (gui.load && gui.load.remembered) { - Common.each(gui.load.remembered, function (value, key) { - addPresetOption(gui, key, key === gui.preset); - }); - } else { - addPresetOption(gui, DEFAULT_DEFAULT_PRESET_NAME, false); - } - dom.bind(select, 'change', function () { - for (var index = 0; index < gui.__preset_select.length; index++) { - gui.__preset_select[index].innerHTML = gui.__preset_select[index].value; } - gui.preset = this.value; - }); - div.appendChild(select); - div.appendChild(gears); - div.appendChild(button); - div.appendChild(button2); - div.appendChild(button3); - if (SUPPORTS_LOCAL_STORAGE) { - var explain = document.getElementById('dg-local-explain'); - var localStorageCheckBox = document.getElementById('dg-local-storage'); - var saveLocally = document.getElementById('dg-save-locally'); - saveLocally.style.display = 'block'; - if (localStorage.getItem(getLocalStorageHash(gui, 'isLocal')) === 'true') { - localStorageCheckBox.setAttribute('checked', 'checked'); + function addResizeHandle(gui) { + var pmouseX = void 0; + gui.__resize_handle = document.createElement('div'); + Common.extend(gui.__resize_handle.style, { + width: '6px', + marginLeft: '-3px', + height: '200px', + cursor: 'ew-resize', + position: 'absolute', + }); + function drag(e) { + e.preventDefault(); + gui.width += pmouseX - e.clientX; + gui.onResize(); + pmouseX = e.clientX; + return false; + } + function dragStop() { + dom.removeClass(gui.__closeButton, GUI.CLASS_DRAG); + dom.unbind(window, 'mousemove', drag); + dom.unbind(window, 'mouseup', dragStop); + } + function dragStart(e) { + e.preventDefault(); + pmouseX = e.clientX; + dom.addClass(gui.__closeButton, GUI.CLASS_DRAG); + dom.bind(window, 'mousemove', drag); + dom.bind(window, 'mouseup', dragStop); + return false; + } + dom.bind(gui.__resize_handle, 'mousedown', dragStart); + dom.bind(gui.__closeButton, 'mousedown', dragStart); + gui.domElement.insertBefore(gui.__resize_handle, gui.domElement.firstElementChild); + } + function setWidth(gui, w) { + gui.domElement.style.width = w + 'px'; + if (gui.__save_row && gui.autoPlace) { + gui.__save_row.style.width = w + 'px'; + } + if (gui.__closeButton) { + gui.__closeButton.style.width = w + 'px'; + } } - showHideExplain(gui, explain); - dom.bind(localStorageCheckBox, 'change', function () { - gui.useLocalStorage = !gui.useLocalStorage; - showHideExplain(gui, explain); - }); - } - var newConstructorTextArea = document.getElementById('dg-new-constructor'); - dom.bind(newConstructorTextArea, 'keydown', function (e) { - if (e.metaKey && (e.which === 67 || e.keyCode === 67)) { - SAVE_DIALOGUE.hide(); + function getCurrentPreset(gui, useInitialValues) { + var toReturn = {}; + Common.each(gui.__rememberedObjects, function (val, index) { + var savedValues = {}; + var controllerMap = gui.__rememberedObjectIndecesToControllers[index]; + Common.each(controllerMap, function (controller, property) { + savedValues[property] = useInitialValues ? controller.initialValue : controller.getValue(); + }); + toReturn[index] = savedValues; + }); + return toReturn; } - }); - dom.bind(gears, 'click', function () { - newConstructorTextArea.innerHTML = JSON.stringify(gui.getSaveObject(), undefined, 2); - SAVE_DIALOGUE.show(); - newConstructorTextArea.focus(); - newConstructorTextArea.select(); - }); - dom.bind(button, 'click', function () { - gui.save(); - }); - dom.bind(button2, 'click', function () { - var presetName = prompt('Enter a new preset name.'); - if (presetName) { - gui.saveAs(presetName); + function setPresetSelectIndex(gui) { + for (var index = 0; index < gui.__preset_select.length; index++) { + if (gui.__preset_select[index].value === gui.preset) { + gui.__preset_select.selectedIndex = index; + } + } } - }); - dom.bind(button3, 'click', function () { - gui.revert(); - }); -} -function addResizeHandle(gui) { - var pmouseX = void 0; - gui.__resize_handle = document.createElement('div'); - Common.extend(gui.__resize_handle.style, { - width: '6px', - marginLeft: '-3px', - height: '200px', - cursor: 'ew-resize', - position: 'absolute' - }); - function drag(e) { - e.preventDefault(); - gui.width += pmouseX - e.clientX; - gui.onResize(); - pmouseX = e.clientX; - return false; - } - function dragStop() { - dom.removeClass(gui.__closeButton, GUI.CLASS_DRAG); - dom.unbind(window, 'mousemove', drag); - dom.unbind(window, 'mouseup', dragStop); - } - function dragStart(e) { - e.preventDefault(); - pmouseX = e.clientX; - dom.addClass(gui.__closeButton, GUI.CLASS_DRAG); - dom.bind(window, 'mousemove', drag); - dom.bind(window, 'mouseup', dragStop); - return false; - } - dom.bind(gui.__resize_handle, 'mousedown', dragStart); - dom.bind(gui.__closeButton, 'mousedown', dragStart); - gui.domElement.insertBefore(gui.__resize_handle, gui.domElement.firstElementChild); -} -function setWidth(gui, w) { - gui.domElement.style.width = w + 'px'; - if (gui.__save_row && gui.autoPlace) { - gui.__save_row.style.width = w + 'px'; - } - if (gui.__closeButton) { - gui.__closeButton.style.width = w + 'px'; - } -} -function getCurrentPreset(gui, useInitialValues) { - var toReturn = {}; - Common.each(gui.__rememberedObjects, function (val, index) { - var savedValues = {}; - var controllerMap = gui.__rememberedObjectIndecesToControllers[index]; - Common.each(controllerMap, function (controller, property) { - savedValues[property] = useInitialValues ? controller.initialValue : controller.getValue(); - }); - toReturn[index] = savedValues; - }); - return toReturn; -} -function setPresetSelectIndex(gui) { - for (var index = 0; index < gui.__preset_select.length; index++) { - if (gui.__preset_select[index].value === gui.preset) { - gui.__preset_select.selectedIndex = index; + function updateDisplays(controllerArray) { + if (controllerArray.length !== 0) { + requestAnimationFrame$1.call(window, function () { + updateDisplays(controllerArray); + }); + } + Common.each(controllerArray, function (c) { + c.updateDisplay(); + }); } - } -} -function updateDisplays(controllerArray) { - if (controllerArray.length !== 0) { - requestAnimationFrame$1.call(window, function () { - updateDisplays(controllerArray); - }); - } - Common.each(controllerArray, function (c) { - c.updateDisplay(); - }); -} - -var color = { - Color: Color, - math: ColorMath, - interpret: interpret -}; -var controllers = { - Controller: Controller, - BooleanController: BooleanController, - OptionController: OptionController, - StringController: StringController, - NumberController: NumberController, - NumberControllerBox: NumberControllerBox, - NumberControllerSlider: NumberControllerSlider, - FunctionController: FunctionController, - ColorController: ColorController -}; -var dom$1 = { dom: dom }; -var gui = { GUI: GUI }; -var GUI$1 = GUI; -var index = { - color: color, - controllers: controllers, - dom: dom$1, - gui: gui, - GUI: GUI$1 -}; -exports.color = color; -exports.controllers = controllers; -exports.dom = dom$1; -exports.gui = gui; -exports.GUI = GUI$1; -exports['default'] = index; + var color = { + Color: Color, + math: ColorMath, + interpret: interpret, + }; + var controllers = { + Controller: Controller, + BooleanController: BooleanController, + OptionController: OptionController, + StringController: StringController, + NumberController: NumberController, + NumberControllerBox: NumberControllerBox, + NumberControllerSlider: NumberControllerSlider, + FunctionController: FunctionController, + ColorController: ColorController, + }; + var dom$1 = { dom: dom }; + var gui = { GUI: GUI }; + var GUI$1 = GUI; + var index = { + color: color, + controllers: controllers, + dom: dom$1, + gui: gui, + GUI: GUI$1, + }; -Object.defineProperty(exports, '__esModule', { value: true }); + exports.color = color; + exports.controllers = controllers; + exports.dom = dom$1; + exports.gui = gui; + exports.GUI = GUI$1; + exports['default'] = index; -}))); + Object.defineProperty(exports, '__esModule', { value: true }); +}); //# sourceMappingURL=dat.gui.js.map diff --git a/gradients/index.html b/gradients/index.html index 948d0e0..9909286 100644 --- a/gradients/index.html +++ b/gradients/index.html @@ -1,73 +1,74 @@ - + - - - - - - Gradients Playground - - - -
-
- - - + .circle[data-hover='true'], + [data-show-circles='last'] .circle[data-hover='true'] { + border: 2px dotted black; + } + + + +
+ + + diff --git a/gradients/index.js b/gradients/index.js index 324b742..655d177 100644 --- a/gradients/index.js +++ b/gradients/index.js @@ -21,7 +21,7 @@ const GENERAL_FIELDS = { ADD_LINEAR: 'Add linear gradient', ADD_CONIC: 'Add conic gradient', ADD_CONIC_SPOT: 'Add conic spot gradient', - EASING_POINTS: 'Easing points' + EASING_POINTS: 'Easing points', }; const BLEND_MODES = [ 'normal', @@ -39,16 +39,9 @@ const BLEND_MODES = [ 'hue', 'saturation', 'color', - 'luminosity' -]; -const DEFAULT_LINEAR_COLORS = [ - '#f53d3d', - '#3d3df5', - '#3df53d', - '#3df5f5', - '#f53df5', - '#f5f53d' + 'luminosity', ]; +const DEFAULT_LINEAR_COLORS = ['#f53d3d', '#3d3df5', '#3df53d', '#3df5f5', '#f53df5', '#f5f53d']; const config = { [GENERAL_FIELDS.CANVAS_SIZE]: 100, @@ -61,43 +54,36 @@ const config = { [GENERAL_FIELDS.ADD_LINEAR]: addLinearGradient, [GENERAL_FIELDS.ADD_CONIC]: addConicGradient, [GENERAL_FIELDS.ADD_CONIC_SPOT]: addConicSpotGradient, - [GENERAL_FIELDS.EASING_POINTS]: 6 + [GENERAL_FIELDS.EASING_POINTS]: 6, }; gui.remember(config); gui.add(config, GENERAL_FIELDS.CANVAS_SIZE, 5, 100, 1) - .onChange(value => { + .onChange((value) => { mainEl.style.setProperty('--canvas-width', `${value}%`); mainEl.style.setProperty('--canvas-height', `${value}%`); setCanvasSize(); }) .onFinishChange(updateCirclePositions); -gui.add(config, GENERAL_FIELDS.SHAPE, ['circle', 'ellipse']) - .onChange(generateGradients); -gui.add(config, GENERAL_FIELDS.ACTION, ['add', 'move']) - .onChange(value => { - mainEl.dataset.action = value; - setAction(value); - }) -gui.addColor(config, GENERAL_FIELDS.BG_COLOR) - .onChange(value => { - mainEl.style.backgroundColor = `${value}${percentToHex(config[GENERAL_FIELDS.BG_OPACITY])}`; - }) -gui.add(config, GENERAL_FIELDS.BG_OPACITY, 0, 100, 1) - .onChange(value => { - mainEl.style.backgroundColor = `${config[GENERAL_FIELDS.BG_COLOR]}${percentToHex(value)}`; - }) -gui.add(config, GENERAL_FIELDS.BLEND_MODE, BLEND_MODES) - .onChange(value => { - mainEl.style.setProperty('--blendMode', value); - }) -gui.add(config, GENERAL_FIELDS.SHOW_CIRCLES, ['last', 'all', 'none']) - .onChange(value => { - mainEl.dataset.showCircles = value.toLowerCase(); - }); -gui.add(config, GENERAL_FIELDS.EASING_POINTS, 1, 12, 1) - .onChange(generateGradients); +gui.add(config, GENERAL_FIELDS.SHAPE, ['circle', 'ellipse']).onChange(generateGradients); +gui.add(config, GENERAL_FIELDS.ACTION, ['add', 'move']).onChange((value) => { + mainEl.dataset.action = value; + setAction(value); +}); +gui.addColor(config, GENERAL_FIELDS.BG_COLOR).onChange((value) => { + mainEl.style.backgroundColor = `${value}${percentToHex(config[GENERAL_FIELDS.BG_OPACITY])}`; +}); +gui.add(config, GENERAL_FIELDS.BG_OPACITY, 0, 100, 1).onChange((value) => { + mainEl.style.backgroundColor = `${config[GENERAL_FIELDS.BG_COLOR]}${percentToHex(value)}`; +}); +gui.add(config, GENERAL_FIELDS.BLEND_MODE, BLEND_MODES).onChange((value) => { + mainEl.style.setProperty('--blendMode', value); +}); +gui.add(config, GENERAL_FIELDS.SHOW_CIRCLES, ['last', 'all', 'none']).onChange((value) => { + mainEl.dataset.showCircles = value.toLowerCase(); +}); +gui.add(config, GENERAL_FIELDS.EASING_POINTS, 1, 12, 1).onChange(generateGradients); gui.add(config, GENERAL_FIELDS.ADD_LINEAR); gui.add(config, GENERAL_FIELDS.ADD_CONIC); @@ -117,43 +103,39 @@ let linearsIndex = 0; let conicsIndex = 0; let conicSpotsIndex = 0; -function addCircleFolder ({onColor, onSize, onRemove, onMiddle/*, onBlend*/}) { +function addCircleFolder({ onColor, onSize, onRemove, onMiddle /*, onBlend*/ }) { const folderConfig = { color: DEFAULT_COLOR, size: DEFAULT_RADIUS, middle: 50, // 'blend mode': 'normal', - remove: onRemove + remove: onRemove, }; const folder = gui.addFolder(`Circle ${++circlesIndex}`); folder.open(); - folder.addColor(folderConfig, 'color') - .onChange(onColor); - folder.add(folderConfig, 'size', MIN_RADIUS, MAX_RADIUS, RADIUS_STEP) - .onChange(onSize); - folder.add(folderConfig, 'middle', 0, 100, 1) - .onChange(onMiddle); + folder.addColor(folderConfig, 'color').onChange(onColor); + folder.add(folderConfig, 'size', MIN_RADIUS, MAX_RADIUS, RADIUS_STEP).onChange(onSize); + folder.add(folderConfig, 'middle', 0, 100, 1).onChange(onMiddle); // folder.add(folderConfig, 'blend mode', BLEND_MODES) // .onChange(onBlend) folder.add(folderConfig, 'remove'); return { folder, - config: folderConfig + config: folderConfig, }; } -function addLinearFolder ({onStopAdd, onFrom, onRemove/*, onBlend*/}) { +function addLinearFolder({ onStopAdd, onFrom, onRemove /*, onBlend*/ }) { const folderConfig = { from: DEFAULT_LINEAR_ANGLE, // 'blend mode': 'normal', 'add stop': onStopAdd, - remove: onRemove + remove: onRemove, }; const folder = linearFolder.addFolder(`Linear ${++linearsIndex}`); folder.open(); - folder.add(folderConfig, 'from', 0, 360, 1) - .onChange(onFrom); + folder.add(folderConfig, 'from', 0, 360, 1).onChange(onFrom); // folder.add(folderConfig, 'blend mode', BLEND_MODES) // .onChange(onBlend); folder.add(folderConfig, 'add stop'); @@ -165,20 +147,19 @@ function addLinearFolder ({onStopAdd, onFrom, onRemove/*, onBlend*/}) { return { folder, config: folderConfig, - stopsFolder + stopsFolder, }; } -function addConicFolder ({onStopAdd, onPosition, onRemove}) { +function addConicFolder({ onStopAdd, onPosition, onRemove }) { const folderConfig = { position: DEFAULT_CONIC_POSITION, 'add stop': onStopAdd, - remove: onRemove + remove: onRemove, }; const folder = conicFolder.addFolder(`Conic ${++conicsIndex}`); folder.open(); - folder.add(folderConfig, 'position', 0, 360, 1) - .onChange(onPosition); + folder.add(folderConfig, 'position', 0, 360, 1).onChange(onPosition); folder.add(folderConfig, 'add stop'); folder.add(folderConfig, 'remove'); @@ -188,26 +169,23 @@ function addConicFolder ({onStopAdd, onPosition, onRemove}) { return { folder, config: folderConfig, - stopsFolder + stopsFolder, }; } -function addConicSpotFolder ({onStopAdd, onChangeX, onChangeY, onAngle, onRemove}) { +function addConicSpotFolder({ onStopAdd, onChangeX, onChangeY, onAngle, onRemove }) { const folderConfig = { angle: DEFAULT_CONIC_ANGLE, x: DEFAULT_CONICSPOT_X, y: DEFAULT_CONICSPOT_Y, 'add stop': onStopAdd, - remove: onRemove + remove: onRemove, }; const folder = conicSpotFolder.addFolder(`Conic ${++conicSpotsIndex}`); folder.open(); - folder.add(folderConfig, 'angle', 0, 360, 1) - .onChange(onAngle); - folder.add(folderConfig, 'x', 0, 100, 1) - .onChange(onChangeX); - folder.add(folderConfig, 'y', 0, 100, 1) - .onChange(onChangeY); + folder.add(folderConfig, 'angle', 0, 360, 1).onChange(onAngle); + folder.add(folderConfig, 'x', 0, 100, 1).onChange(onChangeX); + folder.add(folderConfig, 'y', 0, 100, 1).onChange(onChangeY); folder.add(folderConfig, 'add stop'); folder.add(folderConfig, 'remove'); @@ -217,30 +195,27 @@ function addConicSpotFolder ({onStopAdd, onChangeX, onChangeY, onAngle, onRemove return { folder, config: folderConfig, - stopsFolder + stopsFolder, }; } -function addColorStopFolder ({parentFolder, index, color, stop, onColor, onOpacity, onStop, onRemove}) { +function addColorStopFolder({ parentFolder, index, color, stop, onColor, onOpacity, onStop, onRemove }) { const folderConfig = { color, opacity: 100, stop, - remove: onRemove + remove: onRemove, }; const folder = parentFolder.addFolder(`Stop ${index}`); folder.open(); - folder.addColor(folderConfig, 'color') - .onChange(onColor); - folder.add(folderConfig, 'opacity', 0, 100, 1) - .onChange(onOpacity); - folder.add(folderConfig, 'stop', 0, 100, 1) - .onChange(onStop); + folder.addColor(folderConfig, 'color').onChange(onColor); + folder.add(folderConfig, 'opacity', 0, 100, 1).onChange(onOpacity); + folder.add(folderConfig, 'stop', 0, 100, 1).onChange(onStop); folder.add(folderConfig, 'remove'); return { folder, - config: folderConfig + config: folderConfig, }; } @@ -253,7 +228,7 @@ const linears = []; const conics = []; const conicSpots = []; -function setAction (type) { +function setAction(type) { if (type === 'add') { cancelCheckCircleToMove(); if (hoveredCircle) { @@ -263,8 +238,7 @@ function setAction (type) { mainEl.removeEventListener('pointerdown', moveStart); mainEl.removeEventListener('pointerup', moveEnd); mainEl.addEventListener('click', addCircle); - } - else if (type === 'move') { + } else if (type === 'move') { mainEl.dataset.showCircles = 'none'; mainEl.removeEventListener('click', addCircle); mainEl.addEventListener('pointerdown', moveStart); @@ -273,31 +247,31 @@ function setAction (type) { } } -function addLinearGradient () { +function addLinearGradient() { const linear = new Linear(); linears.push(linear); generateGradients(); } -function addConicGradient () { +function addConicGradient() { const conic = new Conic(); conics.push(conic); generateGradients(); } -function addConicSpotGradient () { +function addConicSpotGradient() { const conicSpot = new ConicSpot(); conicSpots.push(conicSpot); generateGradients(); } -function addCircle (e) { +function addCircle(e) { const circle = new Circle({ x: e.offsetX, - y: e.offsetY + y: e.offsetY, }); circles.push(circle); mainEl.appendChild(circle.el); @@ -306,7 +280,7 @@ function addCircle (e) { } let hoveredCircle = null; -let current = {x: 0, y: 0}; +let current = { x: 0, y: 0 }; let shouldCheckCircleToMove = true; let canvasWidth; @@ -320,25 +294,25 @@ function setCanvasSize() { setCanvasSize(); function updateCirclePositions(value) { - circles.forEach(circle => { + circles.forEach((circle) => { circle.setPosition({ - offsetX: circle.px / 100 * canvasWidth, - offsetY: circle.py / 100 * canvasHeight + offsetX: (circle.px / 100) * canvasWidth, + offsetY: (circle.py / 100) * canvasHeight, }); }); } -function checkCirclesDist () { +function checkCirclesDist() { shouldCheckCircleToMove = true; - const closest = circles.map( - circle => ({ + const closest = circles + .map((circle) => ({ dist: Math.hypot(current.x - circle.x, current.y - circle.y), - circle - }) - ).sort((a, b) => { - return a.dist > b.dist ? 1 : -1; - })[0]; + circle, + })) + .sort((a, b) => { + return a.dist > b.dist ? 1 : -1; + })[0]; if (hoveredCircle !== closest.circle) { if (hoveredCircle) { @@ -349,7 +323,7 @@ function checkCirclesDist () { } } -function checkCircleToMove (e) { +function checkCircleToMove(e) { current.x = e.offsetX; current.y = e.offsetY; if (shouldCheckCircleToMove) { @@ -358,23 +332,23 @@ function checkCircleToMove (e) { } } -function cancelCheckCircleToMove () { +function cancelCheckCircleToMove() { mainEl.removeEventListener('pointermove', checkCircleToMove); cancelAnimationFrame(checkCirclesDist); shouldCheckCircleToMove = true; } -function moveStart (e) { +function moveStart(e) { cancelCheckCircleToMove(); mainEl.addEventListener('pointermove', moveMove); } -function moveMove (e) { +function moveMove(e) { hoveredCircle.setPosition(e); hoveredCircle.updateGradient(); } -function moveEnd (e) { +function moveEnd(e) { mainEl.removeEventListener('pointermove', moveMove); mainEl.addEventListener('pointermove', checkCircleToMove); } @@ -382,12 +356,12 @@ function moveEnd (e) { setAction(config[GENERAL_FIELDS.ACTION]); class Circle { - constructor ({x, y}) { - const {config, folder} = addCircleFolder({ + constructor({ x, y }) { + const { config, folder } = addCircleFolder({ onColor: () => this.onColor(), onSize: () => this.onSize(), onRemove: () => this.onRemove(), - onMiddle: () => this.onMiddle() + onMiddle: () => this.onMiddle(), // onBlend: value => this.onBlend(value) }); this.x = x; @@ -402,7 +376,7 @@ class Circle { this.createGradient(); } - createElement () { + createElement() { const el = document.createElement('div'); this.el = el; el.classList.add('circle'); @@ -410,33 +384,33 @@ class Circle { this.setPosition(); } - setSize () { + setSize() { this.el.style.setProperty('--radius', `${this.config.size}%`); } - setPosition (position) { + setPosition(position) { if (position) { this.x = position.offsetX; this.y = position.offsetY; } - const size = this.config.size / 100 * canvasWidth; - this.el.style.setProperty('--x', `${(this.x - size / 2) / canvasWidth * 100}%`); - this.el.style.setProperty('--y', `${(this.y - size / 2) / canvasHeight * 100}%`); + const size = (this.config.size / 100) * canvasWidth; + this.el.style.setProperty('--x', `${((this.x - size / 2) / canvasWidth) * 100}%`); + this.el.style.setProperty('--y', `${((this.y - size / 2) / canvasHeight) * 100}%`); } - createGradient () { - this.px = this.x / canvasWidth * 100; - this.py = this.y / canvasHeight * 100; + createGradient() { + this.px = (this.x / canvasWidth) * 100; + this.py = (this.y / canvasHeight) * 100; this.setSize(); this.gradient.fixed = [`${this.px}% ${this.py}%`, `${this.config.color}`, this.config.middle, this.config.size]; } - generate () { + generate() { const numOfLerpPoints = config[GENERAL_FIELDS.EASING_POINTS]; const [position, color, middle, size] = this.gradient.fixed; - const middleHint = middle / 100 * size; + const middleHint = (middle / 100) * size; if (numOfLerpPoints > 1) { // east in from color (start) to middle (x * x * x) @@ -444,37 +418,43 @@ class Circle { .fill(1) .map((_, i, a) => { const p = i / (a.length - 1); - return `${color}${Math.round(lerp(1, 0.5, easeIn(p)) * 255).toString(16).padStart(2, '0')} ${p * middleHint}%`; - }).join(', '); + return `${color}${Math.round(lerp(1, 0.5, easeIn(p)) * 255) + .toString(16) + .padStart(2, '0')} ${p * middleHint}%`; + }) + .join(', '); // ease out from middle to size (end) (1 - Math.pow(1 - x, 3)) const easeOutPoints = Array(numOfLerpPoints) .fill(1) .map((_, i, a) => { const p = i / (a.length - 1); - return `${color}${Math.round(lerp(0.5, 0, easeOut(p)) * 255).toString(16).padStart(2, '0')} ${lerp(middleHint, size, p)}%`; - }).join(', '); + return `${color}${Math.round(lerp(0.5, 0, easeOut(p)) * 255) + .toString(16) + .padStart(2, '0')} ${lerp(middleHint, size, p)}%`; + }) + .join(', '); return `radial-gradient(${config[GENERAL_FIELDS.SHAPE]} at ${position}, ${easeInPoints}, ${easeOutPoints})`; } - return `radial-gradient(${config[GENERAL_FIELDS.SHAPE]} at ${position}, ${color}, ${middle / 100 * size}%, transparent ${size}%)`; + return `radial-gradient(${config[GENERAL_FIELDS.SHAPE]} at ${position}, ${color}, ${(middle / 100) * size}%, transparent ${size}%)`; } - updateGradient () { + updateGradient() { this.createGradient(); generateGradients(); } - onColor () { + onColor() { this.updateGradient(); } - onSize () { + onSize() { this.setSize(); this.setPosition(); this.updateGradient(); } - onMiddle () { + onMiddle() { this.updateGradient(); } @@ -483,7 +463,7 @@ class Circle { // updateBlendModes(); // } - onRemove () { + onRemove() { gui.removeFolder(this.folder); this.el.remove(); circles.splice(circles.indexOf(this), 1); @@ -491,22 +471,21 @@ class Circle { } } -function easeIn (t) { +function easeIn(t) { return t * t * t; } -function easeOut (t) { +function easeOut(t) { return 1 - Math.pow(1 - t, 3); } -function lerp (a, b, t) { +function lerp(a, b, t) { return a * (1 - t) + b * t; } - class Conic { - constructor () { - const {config, folder, stopsFolder} = addConicFolder({ + constructor() { + const { config, folder, stopsFolder } = addConicFolder({ onStopAdd: () => this.addColorStop(), onPosition: () => this.onPosition(), // onAngle: () => this.onAngle(), @@ -520,23 +499,23 @@ class Conic { // this.blendMode = 'normal'; this.stopsFolder = stopsFolder; - this.addColorStop({stop: 50}); + this.addColorStop({ stop: 50 }); this.addColorStop(); this.createGradient(); } - createGradient () { + createGradient() { this.gradient = [`from ${this.config.position}deg at ${this._getPosition()}`, this.createStops().join(', ')]; } - updateGradient () { + updateGradient() { this.createGradient(); generateGradients(); } - createStops () { - function mapStop (value) { + createStops() { + function mapStop(value) { return map(parseInt(value), 0, 100, 25, 75); } @@ -553,9 +532,15 @@ class Conic { }); } - addColorStop ({stop = 100} = {}) { + addColorStop({ stop = 100 } = {}) { const color = DEFAULT_LINEAR_COLORS[this.index % DEFAULT_LINEAR_COLORS.length]; - const colorStop = new ColorStop({parentFolder: this.stopsFolder, index: ++this.index, color, stop, parent: this}); + const colorStop = new ColorStop({ + parentFolder: this.stopsFolder, + index: ++this.index, + color, + stop, + parent: this, + }); this.stops.push(colorStop); this.updateGradient(); @@ -565,20 +550,20 @@ class Conic { // this.updateGradient(); // } - onPosition () { + onPosition() { this.updateGradient(); } - _getPosition () { + _getPosition() { const r = Math.hypot(WINDOW_WIDTH / 2, WINDOW_HEIGHT / 2) * 1.05; // enlarge radius by 5% to push the cone's tip off screen - const angle = Math.PI * this.config.position / 180; - const x = (WINDOW_WIDTH / 2 + r * Math.sin(angle)) / WINDOW_WIDTH * 100; - const y = (WINDOW_HEIGHT / 2 - r * Math.cos(angle)) / WINDOW_HEIGHT * 100; + const angle = (Math.PI * this.config.position) / 180; + const x = ((WINDOW_WIDTH / 2 + r * Math.sin(angle)) / WINDOW_WIDTH) * 100; + const y = ((WINDOW_HEIGHT / 2 - r * Math.cos(angle)) / WINDOW_HEIGHT) * 100; return `${clamp(-5, 105, x)}% ${clamp(-5, 105, y)}%`; } - onRemove () { + onRemove() { conicFolder.removeFolder(this.folder); conics.splice(conics.indexOf(this), 1); generateGradients(); @@ -586,8 +571,8 @@ class Conic { } class ConicSpot { - constructor () { - const {config, folder, stopsFolder} = addConicSpotFolder({ + constructor() { + const { config, folder, stopsFolder } = addConicSpotFolder({ onStopAdd: () => this.addColorStop(), onChangeX: () => this.onChangeX(), onChangeY: () => this.onChangeY(), @@ -600,46 +585,55 @@ class ConicSpot { this.folder = folder; this.stopsFolder = stopsFolder; - this.addColorStop({stop: 50}); + this.addColorStop({ stop: 50 }); this.addColorStop(); this.createGradient(); } - createGradient () { - this.gradient = [`from ${this.config.angle}deg at ${this.config.x}% ${this.config.y}%`, this.createStops().join(', ')]; + createGradient() { + this.gradient = [ + `from ${this.config.angle}deg at ${this.config.x}% ${this.config.y}%`, + this.createStops().join(', '), + ]; } - updateGradient () { + updateGradient() { this.createGradient(); generateGradients(); } - createStops () { - return this.stops.map((stop, i) => i + 1 < this.stops.length ? stop.stop.join(', ') : stop.stop[0]); + createStops() { + return this.stops.map((stop, i) => (i + 1 < this.stops.length ? stop.stop.join(', ') : stop.stop[0])); } - addColorStop ({stop = 100} = {}) { + addColorStop({ stop = 100 } = {}) { const color = DEFAULT_LINEAR_COLORS[this.index % DEFAULT_LINEAR_COLORS.length]; - const colorStop = new ColorStop({parentFolder: this.stopsFolder, index: ++this.index, color, stop, parent: this}); + const colorStop = new ColorStop({ + parentFolder: this.stopsFolder, + index: ++this.index, + color, + stop, + parent: this, + }); this.stops.push(colorStop); this.updateGradient(); } - onAngle () { + onAngle() { this.updateGradient(); } - onChangeX () { + onChangeX() { this.updateGradient(); } - onChangeY () { + onChangeY() { this.updateGradient(); } - onRemove () { + onRemove() { conicSpotFolder.removeFolder(this.folder); conicSpots.splice(conicSpots.indexOf(this), 1); generateGradients(); @@ -647,8 +641,8 @@ class ConicSpot { } class Linear { - constructor () { - const {config, folder, stopsFolder} = addLinearFolder({ + constructor() { + const { config, folder, stopsFolder } = addLinearFolder({ onStopAdd: () => this.addColorStop(), onFrom: () => this.onFrom(), onRemove: () => this.onRemove(), @@ -661,34 +655,40 @@ class Linear { // this.blendMode = 'normal'; this.stopsFolder = stopsFolder; - this.addColorStop({stop: 50}); + this.addColorStop({ stop: 50 }); this.addColorStop(); this.createGradient(); } - createGradient () { + createGradient() { this.gradient = [`${this.config.from}deg`, this.createStops().join(', ')]; } - updateGradient () { + updateGradient() { this.createGradient(); generateGradients(); } - createStops () { - return this.stops.map((stop, i) => i + 1 < this.stops.length ? stop.stop.join(', ') : stop.stop[0]); + createStops() { + return this.stops.map((stop, i) => (i + 1 < this.stops.length ? stop.stop.join(', ') : stop.stop[0])); } - addColorStop ({stop = 100} = {}) { + addColorStop({ stop = 100 } = {}) { const color = DEFAULT_LINEAR_COLORS[this.index % DEFAULT_LINEAR_COLORS.length]; - const colorStop = new ColorStop({parentFolder: this.stopsFolder, index: ++this.index, color, stop, parent: this}); + const colorStop = new ColorStop({ + parentFolder: this.stopsFolder, + index: ++this.index, + color, + stop, + parent: this, + }); this.stops.push(colorStop); this.updateGradient(); } - onFrom () { + onFrom() { this.updateGradient(); } @@ -697,7 +697,7 @@ class Linear { // updateBlendModes(); // } - onRemove () { + onRemove() { linearFolder.removeFolder(this.folder); linears.splice(linears.indexOf(this), 1); generateGradients(); @@ -705,10 +705,10 @@ class Linear { } class ColorStop { - constructor ({parentFolder, color, stop, index, parent}) { + constructor({ parentFolder, color, stop, index, parent }) { this.parentFolder = parentFolder; - const {config, folder} = addColorStopFolder({ + const { config, folder } = addColorStopFolder({ parentFolder, index, color, @@ -716,7 +716,7 @@ class ColorStop { onColor: () => this.onColor(), onOpacity: () => this.onOpacity(), onStop: () => this.onStop(), - onRemove: () => this.onRemove() + onRemove: () => this.onRemove(), }); this.config = config; this.folder = folder; @@ -725,19 +725,16 @@ class ColorStop { this.updateStop(); } - updateStop () { - this.stop = [ - `${this.config.color}${percentToHex(this.config.opacity)}`, - `${this.config.stop}%` - ]; + updateStop() { + this.stop = [`${this.config.color}${percentToHex(this.config.opacity)}`, `${this.config.stop}%`]; } - onColor () { + onColor() { this.updateStop(); this.parent.updateGradient(); } - onOpacity () { + onOpacity() { this.updateStop(); this.parent.updateGradient(); } @@ -747,42 +744,54 @@ class ColorStop { this.parent.updateGradient(); } - onRemove () { + onRemove() { this.parentFolder.removeFolder(this.folder); this.parent.stops.splice(this.parent.stops.indexOf(this), 1); this.parent.updateGradient(); } } -function generateGradients () { - const gradients = circles.map(circle => circle.generate()).reverse() - gradients.push(...conicSpots.map(conicSpot => { - const [start, stops] = conicSpot.gradient; - return `conic-gradient(${start}, ${stops})` - }).reverse()); - gradients.push(...conics.map(conic => { - const [start, stops] = conic.gradient; - return `conic-gradient(${start}, ${stops})` - }).reverse()); - gradients.push(...linears.map(linear => { - const [start, stops] = linear.gradient; - return `linear-gradient(${start}, ${stops})` - }).reverse()); +function generateGradients() { + const gradients = circles.map((circle) => circle.generate()).reverse(); + gradients.push( + ...conicSpots + .map((conicSpot) => { + const [start, stops] = conicSpot.gradient; + return `conic-gradient(${start}, ${stops})`; + }) + .reverse(), + ); + gradients.push( + ...conics + .map((conic) => { + const [start, stops] = conic.gradient; + return `conic-gradient(${start}, ${stops})`; + }) + .reverse(), + ); + gradients.push( + ...linears + .map((linear) => { + const [start, stops] = linear.gradient; + return `linear-gradient(${start}, ${stops})`; + }) + .reverse(), + ); mainEl.style.setProperty('--gradient', gradients.join(', ')); // updateBlendModes(); } -function clamp (min, max, val) { +function clamp(min, max, val) { return Math.max(min, Math.min(max, val)); } -function map (x, a, b, c, d) { - return (x - a) * (d - c) / (b - a) + c; +function map(x, a, b, c, d) { + return ((x - a) * (d - c)) / (b - a) + c; } -function percentToHex (value) { - const alpha = (value / 100 * 255).toString(16).split('.')[0]; +function percentToHex(value) { + const alpha = ((value / 100) * 255).toString(16).split('.')[0]; return alpha.length === 1 ? `0${alpha}` : alpha; } diff --git a/gradients/package.json b/gradients/package.json index 4c5cebd..b8c89de 100644 --- a/gradients/package.json +++ b/gradients/package.json @@ -1,25 +1,25 @@ { - "name": "wow-gradient-playground", - "version": "0.0.1", - "description": "wow!Team playground for gradients", - "main": "index.js", - "scripts": { - "test": "echo \"no test specified\"", - "build": "echo \"no build specified\"" - }, - "repository": { - "type": "git", - "url": "git+https://github.com/wix-playground/wow-demos.git" - }, - "keywords": [ - "CSS", - "SVG", - "gradients", - "blend-mode" - ], - "author": "wow!Team", - "license": "WTFPL", - "dependencies": { - "dat.gui": "^0.7.7" - } + "name": "wow-gradient-playground", + "version": "0.0.1", + "description": "wow!Team playground for gradients", + "main": "index.js", + "scripts": { + "test": "echo \"no test specified\"", + "build": "echo \"no build specified\"" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/wix-playground/wow-demos.git" + }, + "keywords": [ + "CSS", + "SVG", + "gradients", + "blend-mode" + ], + "author": "wow!Team", + "license": "WTFPL", + "dependencies": { + "dat.gui": "^0.7.7" + } } diff --git a/index.html b/index.html index 3253a25..7b70ecd 100644 --- a/index.html +++ b/index.html @@ -1,53 +1,53 @@ - + - - - wow!Team Demos - - - -
-

Wow!Team Demos

-
- - + + + wow!Team Demos + + + +
+

Wow!Team Demos

+
+ + diff --git a/kampos/global.d.ts b/kampos/global.d.ts index fe4dfb0..ec51dac 100644 --- a/kampos/global.d.ts +++ b/kampos/global.d.ts @@ -1,79 +1,77 @@ -import { Pane } from "tweakpane"; +import { Pane } from 'tweakpane'; export {}; - declare global { - -type State = { - video: string; - video2: string; - effects: { - duotone: { - active: boolean; - dark: string; - light: string; - }; - brightnessContrast: { - active: boolean; - brightness: number; - contrast: number; - }; - hueSaturation: { - active: boolean; - hue: number; - saturation: number; - }; - blend: { - active: boolean; - mode: string; - color: string; - image: string; - }; - alphaMask: { - active: boolean; - isLuminance: boolean; - mask: string; - }; - displacement: { - active: boolean; - wrap: string; - scaleX: number; - scaleY: number; - map: string; - }; - turbulence: { - active: boolean; - noise: string; - output: string; - frequencyX: number; - frequencyY: number; - octaves: number; - isFractal: boolean; - time: number; - }; - kaleidoscope: { - active: boolean; - segments: number; - offset: number; - }; - fadeTransition: { - active: boolean; - progress: number; - }; - displacementTransition: { - active: boolean; - progress: number; - }; - dissolveTransition: { - active: boolean; - progress: number; + type State = { + video: string; + video2: string; + effects: { + duotone: { + active: boolean; + dark: string; + light: string; + }; + brightnessContrast: { + active: boolean; + brightness: number; + contrast: number; + }; + hueSaturation: { + active: boolean; + hue: number; + saturation: number; + }; + blend: { + active: boolean; + mode: string; + color: string; + image: string; + }; + alphaMask: { + active: boolean; + isLuminance: boolean; + mask: string; + }; + displacement: { + active: boolean; + wrap: string; + scaleX: number; + scaleY: number; + map: string; + }; + turbulence: { + active: boolean; + noise: string; + output: string; + frequencyX: number; + frequencyY: number; + octaves: number; + isFractal: boolean; + time: number; + }; + kaleidoscope: { + active: boolean; + segments: number; + offset: number; + }; + fadeTransition: { + active: boolean; + progress: number; + }; + displacementTransition: { + active: boolean; + progress: number; + }; + dissolveTransition: { + active: boolean; + progress: number; + }; }; + }; + interface Window { + state: State; + pane: Pane; + kamposCanvas: any; // TODO kamposInstance } -} - interface Window { - state: State; - pane: Pane; - kamposCanvas: any;// TODO kamposInstance - } } diff --git a/kampos/index.html b/kampos/index.html index 9964138..568304f 100644 --- a/kampos/index.html +++ b/kampos/index.html @@ -1,15 +1,15 @@ - + - - - - - Wow!Team Demo of kampos - - - -
+ + + + + Wow!Team Demo of kampos + + + +
- - + + diff --git a/kampos/package-lock.json b/kampos/package-lock.json index 3afad6f..a00f3da 100644 --- a/kampos/package-lock.json +++ b/kampos/package-lock.json @@ -1,3206 +1,3206 @@ { - "name": "vite-template-solid", - "version": "0.0.0", - "lockfileVersion": 3, - "requires": true, - "packages": { - "": { - "name": "vite-template-solid", - "version": "0.0.0", - "license": "MIT", - "dependencies": { - "@tweakpane/plugin-camerakit": "^0.3.0", - "debounce": "^2.1.0", - "deep-object-diff": "^1.1.9", - "kampos": "^0.9.1", - "lz-string": "^1.5.0", - "solid-js": "^1.8.11", - "stats.js": "^0.17.0", - "tailwindcss-spring": "^1.0.1", - "tweakpane": "^4.0.4" - }, - "devDependencies": { - "@tweakpane/core": "^2.0.4", - "@types/stats.js": "^0.17.3", - "autoprefixer": "^10.4.17", - "postcss": "^8.4.33", - "solid-devtools": "^0.29.2", - "tailwindcss": "^3.4.1", - "typescript": "^5.3.3", - "vite": "^5.0.11", - "vite-plugin-solid": "^2.8.2" - } - }, - "node_modules/@alloc/quick-lru": { - "version": "5.2.0", - "resolved": "https://registry.npmjs.org/@alloc/quick-lru/-/quick-lru-5.2.0.tgz", - "integrity": "sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==", - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/@ampproject/remapping": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/@ampproject/remapping/-/remapping-2.3.0.tgz", - "integrity": "sha512-30iZtAPgz+LTIYoeivqYo853f02jBYSd5uGnGpkFV0M3xOt9aN73erkgYAmZU43x4VfqcnLxW9Kpg3R5LC4YYw==", - "dev": true, - "dependencies": { - "@jridgewell/gen-mapping": "^0.3.5", - "@jridgewell/trace-mapping": "^0.3.24" - }, - "engines": { - "node": ">=6.0.0" - } - }, - "node_modules/@babel/code-frame": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.24.7.tgz", - "integrity": "sha512-BcYH1CVJBO9tvyIZ2jVeXgSIMvGZ2FDRvDdOIVQyuklNKSsx+eppDEBq/g47Ayw+RqNFE+URvOShmf+f/qwAlA==", - "dev": true, - "dependencies": { - "@babel/highlight": "^7.24.7", - "picocolors": "^1.0.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/compat-data": { - "version": "7.25.2", - "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.25.2.tgz", - "integrity": "sha512-bYcppcpKBvX4znYaPEeFau03bp89ShqNMLs+rmdptMw+heSZh9+z84d2YG+K7cYLbWwzdjtDoW/uqZmPjulClQ==", - "dev": true, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/core": { - "version": "7.25.2", - "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.25.2.tgz", - "integrity": "sha512-BBt3opiCOxUr9euZ5/ro/Xv8/V7yJ5bjYMqG/C1YAo8MIKAnumZalCN+msbci3Pigy4lIQfPUpfMM27HMGaYEA==", - "dev": true, - "dependencies": { - "@ampproject/remapping": "^2.2.0", - "@babel/code-frame": "^7.24.7", - "@babel/generator": "^7.25.0", - "@babel/helper-compilation-targets": "^7.25.2", - "@babel/helper-module-transforms": "^7.25.2", - "@babel/helpers": "^7.25.0", - "@babel/parser": "^7.25.0", - "@babel/template": "^7.25.0", - "@babel/traverse": "^7.25.2", - "@babel/types": "^7.25.2", - "convert-source-map": "^2.0.0", - "debug": "^4.1.0", - "gensync": "^1.0.0-beta.2", - "json5": "^2.2.3", - "semver": "^6.3.1" - }, - "engines": { - "node": ">=6.9.0" - }, - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/babel" - } - }, - "node_modules/@babel/generator": { - "version": "7.25.0", - "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.25.0.tgz", - "integrity": "sha512-3LEEcj3PVW8pW2R1SR1M89g/qrYk/m/mB/tLqn7dn4sbBUQyTqnlod+II2U4dqiGtUmkcnAmkMDralTFZttRiw==", - "dev": true, - "dependencies": { - "@babel/types": "^7.25.0", - "@jridgewell/gen-mapping": "^0.3.5", - "@jridgewell/trace-mapping": "^0.3.25", - "jsesc": "^2.5.1" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-compilation-targets": { - "version": "7.25.2", - "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.25.2.tgz", - "integrity": "sha512-U2U5LsSaZ7TAt3cfaymQ8WHh0pxvdHoEk6HVpaexxixjyEquMh0L0YNJNM6CTGKMXV1iksi0iZkGw4AcFkPaaw==", - "dev": true, - "dependencies": { - "@babel/compat-data": "^7.25.2", - "@babel/helper-validator-option": "^7.24.8", - "browserslist": "^4.23.1", - "lru-cache": "^5.1.1", - "semver": "^6.3.1" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-module-imports": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.24.7.tgz", - "integrity": "sha512-8AyH3C+74cgCVVXow/myrynrAGv+nTVg5vKu2nZph9x7RcRwzmh0VFallJuFTZ9mx6u4eSdXZfcOzSqTUm0HCA==", - "dev": true, - "dependencies": { - "@babel/traverse": "^7.24.7", - "@babel/types": "^7.24.7" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-module-transforms": { - "version": "7.25.2", - "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.25.2.tgz", - "integrity": "sha512-BjyRAbix6j/wv83ftcVJmBt72QtHI56C7JXZoG2xATiLpmoC7dpd8WnkikExHDVPpi/3qCmO6WY1EaXOluiecQ==", - "dev": true, - "dependencies": { - "@babel/helper-module-imports": "^7.24.7", - "@babel/helper-simple-access": "^7.24.7", - "@babel/helper-validator-identifier": "^7.24.7", - "@babel/traverse": "^7.25.2" - }, - "engines": { - "node": ">=6.9.0" - }, - "peerDependencies": { - "@babel/core": "^7.0.0" - } - }, - "node_modules/@babel/helper-plugin-utils": { - "version": "7.24.8", - "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.24.8.tgz", - "integrity": "sha512-FFWx5142D8h2Mgr/iPVGH5G7w6jDn4jUSpZTyDnQO0Yn7Ks2Kuz6Pci8H6MPCoUJegd/UZQ3tAvfLCxQSnWWwg==", - "dev": true, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-simple-access": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.24.7.tgz", - "integrity": "sha512-zBAIvbCMh5Ts+b86r/CjU+4XGYIs+R1j951gxI3KmmxBMhCg4oQMsv6ZXQ64XOm/cvzfU1FmoCyt6+owc5QMYg==", - "dev": true, - "dependencies": { - "@babel/traverse": "^7.24.7", - "@babel/types": "^7.24.7" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-string-parser": { - "version": "7.24.8", - "resolved": "https://registry.npmjs.org/@babel/helper-string-parser/-/helper-string-parser-7.24.8.tgz", - "integrity": "sha512-pO9KhhRcuUyGnJWwyEgnRJTSIZHiT+vMD0kPeD+so0l7mxkMT19g3pjY9GTnHySck/hDzq+dtW/4VgnMkippsQ==", - "dev": true, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-validator-identifier": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.24.7.tgz", - "integrity": "sha512-rR+PBcQ1SMQDDyF6X0wxtG8QyLCgUB0eRAGguqRLfkCA87l7yAP7ehq8SNj96OOGTO8OBV70KhuFYcIkHXOg0w==", - "dev": true, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helper-validator-option": { - "version": "7.24.8", - "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.24.8.tgz", - "integrity": "sha512-xb8t9tD1MHLungh/AIoWYN+gVHaB9kwlu8gffXGSt3FFEIT7RjS+xWbc2vUD1UTZdIpKj/ab3rdqJ7ufngyi2Q==", - "dev": true, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/helpers": { - "version": "7.25.0", - "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.25.0.tgz", - "integrity": "sha512-MjgLZ42aCm0oGjJj8CtSM3DB8NOOf8h2l7DCTePJs29u+v7yO/RBX9nShlKMgFnRks/Q4tBAe7Hxnov9VkGwLw==", - "dev": true, - "dependencies": { - "@babel/template": "^7.25.0", - "@babel/types": "^7.25.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/highlight": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.24.7.tgz", - "integrity": "sha512-EStJpq4OuY8xYfhGVXngigBJRWxftKX9ksiGDnmlY3o7B/V7KIAc9X4oiK87uPJSc/vs5L869bem5fhZa8caZw==", - "dev": true, - "dependencies": { - "@babel/helper-validator-identifier": "^7.24.7", - "chalk": "^2.4.2", - "js-tokens": "^4.0.0", - "picocolors": "^1.0.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/parser": { - "version": "7.25.3", - "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.25.3.tgz", - "integrity": "sha512-iLTJKDbJ4hMvFPgQwwsVoxtHyWpKKPBrxkANrSYewDPaPpT5py5yeVkgPIJ7XYXhndxJpaA3PyALSXQ7u8e/Dw==", - "dev": true, - "dependencies": { - "@babel/types": "^7.25.2" - }, - "bin": { - "parser": "bin/babel-parser.js" - }, - "engines": { - "node": ">=6.0.0" - } - }, - "node_modules/@babel/plugin-syntax-jsx": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.24.7.tgz", - "integrity": "sha512-6ddciUPe/mpMnOKv/U+RSd2vvVy+Yw/JfBB0ZHYjEZt9NLHmCUylNYlsbqCCS1Bffjlb0fCwC9Vqz+sBz6PsiQ==", - "dev": true, - "dependencies": { - "@babel/helper-plugin-utils": "^7.24.7" - }, - "engines": { - "node": ">=6.9.0" - }, - "peerDependencies": { - "@babel/core": "^7.0.0-0" - } - }, - "node_modules/@babel/plugin-syntax-typescript": { - "version": "7.24.7", - "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.24.7.tgz", - "integrity": "sha512-c/+fVeJBB0FeKsFvwytYiUD+LBvhHjGSI0g446PRGdSVGZLRNArBUno2PETbAly3tpiNAQR5XaZ+JslxkotsbA==", - "dev": true, - "dependencies": { - "@babel/helper-plugin-utils": "^7.24.7" - }, - "engines": { - "node": ">=6.9.0" - }, - "peerDependencies": { - "@babel/core": "^7.0.0-0" - } - }, - "node_modules/@babel/template": { - "version": "7.25.0", - "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.25.0.tgz", - "integrity": "sha512-aOOgh1/5XzKvg1jvVz7AVrx2piJ2XBi227DHmbY6y+bM9H2FlN+IfecYu4Xl0cNiiVejlsCri89LUsbj8vJD9Q==", - "dev": true, - "dependencies": { - "@babel/code-frame": "^7.24.7", - "@babel/parser": "^7.25.0", - "@babel/types": "^7.25.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/traverse": { - "version": "7.25.3", - "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.25.3.tgz", - "integrity": "sha512-HefgyP1x754oGCsKmV5reSmtV7IXj/kpaE1XYY+D9G5PvKKoFfSbiS4M77MdjuwlZKDIKFCffq9rPU+H/s3ZdQ==", - "dev": true, - "dependencies": { - "@babel/code-frame": "^7.24.7", - "@babel/generator": "^7.25.0", - "@babel/parser": "^7.25.3", - "@babel/template": "^7.25.0", - "@babel/types": "^7.25.2", - "debug": "^4.3.1", - "globals": "^11.1.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@babel/types": { - "version": "7.25.2", - "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.25.2.tgz", - "integrity": "sha512-YTnYtra7W9e6/oAZEHj0bJehPRUlLH9/fbpT5LfB0NhQXyALCRkRs3zH9v07IYhkgpqX6Z78FnuccZr/l4Fs4Q==", - "dev": true, - "dependencies": { - "@babel/helper-string-parser": "^7.24.8", - "@babel/helper-validator-identifier": "^7.24.7", - "to-fast-properties": "^2.0.0" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/@esbuild/aix-ppc64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.21.5.tgz", - "integrity": "sha512-1SDgH6ZSPTlggy1yI6+Dbkiz8xzpHJEVAlF/AM1tHPLsf5STom9rwtjE4hKAF20FfXXNTFqEYXyJNWh1GiZedQ==", - "cpu": [ - "ppc64" - ], - "dev": true, - "optional": true, - "os": [ - "aix" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/android-arm": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.21.5.tgz", - "integrity": "sha512-vCPvzSjpPHEi1siZdlvAlsPxXl7WbOVUBBAowWug4rJHb68Ox8KualB+1ocNvT5fjv6wpkX6o/iEpbDrf68zcg==", - "cpu": [ - "arm" - ], - "dev": true, - "optional": true, - "os": [ - "android" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/android-arm64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.21.5.tgz", - "integrity": "sha512-c0uX9VAUBQ7dTDCjq+wdyGLowMdtR/GoC2U5IYk/7D1H1JYC0qseD7+11iMP2mRLN9RcCMRcjC4YMclCzGwS/A==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "android" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/android-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.21.5.tgz", - "integrity": "sha512-D7aPRUUNHRBwHxzxRvp856rjUHRFW1SdQATKXH2hqA0kAZb1hKmi02OpYRacl0TxIGz/ZmXWlbZgjwWYaCakTA==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "android" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/darwin-arm64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.21.5.tgz", - "integrity": "sha512-DwqXqZyuk5AiWWf3UfLiRDJ5EDd49zg6O9wclZ7kUMv2WRFr4HKjXp/5t8JZ11QbQfUS6/cRCKGwYhtNAY88kQ==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "darwin" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/darwin-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.21.5.tgz", - "integrity": "sha512-se/JjF8NlmKVG4kNIuyWMV/22ZaerB+qaSi5MdrXtd6R08kvs2qCN4C09miupktDitvh8jRFflwGFBQcxZRjbw==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "darwin" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/freebsd-arm64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.21.5.tgz", - "integrity": "sha512-5JcRxxRDUJLX8JXp/wcBCy3pENnCgBR9bN6JsY4OmhfUtIHe3ZW0mawA7+RDAcMLrMIZaf03NlQiX9DGyB8h4g==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "freebsd" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/freebsd-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.21.5.tgz", - "integrity": "sha512-J95kNBj1zkbMXtHVH29bBriQygMXqoVQOQYA+ISs0/2l3T9/kj42ow2mpqerRBxDJnmkUDCaQT/dfNXWX/ZZCQ==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "freebsd" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-arm": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.21.5.tgz", - "integrity": "sha512-bPb5AHZtbeNGjCKVZ9UGqGwo8EUu4cLq68E95A53KlxAPRmUyYv2D6F0uUI65XisGOL1hBP5mTronbgo+0bFcA==", - "cpu": [ - "arm" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-arm64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.21.5.tgz", - "integrity": "sha512-ibKvmyYzKsBeX8d8I7MH/TMfWDXBF3db4qM6sy+7re0YXya+K1cem3on9XgdT2EQGMu4hQyZhan7TeQ8XkGp4Q==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-ia32": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.21.5.tgz", - "integrity": "sha512-YvjXDqLRqPDl2dvRODYmmhz4rPeVKYvppfGYKSNGdyZkA01046pLWyRKKI3ax8fbJoK5QbxblURkwK/MWY18Tg==", - "cpu": [ - "ia32" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-loong64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.21.5.tgz", - "integrity": "sha512-uHf1BmMG8qEvzdrzAqg2SIG/02+4/DHB6a9Kbya0XDvwDEKCoC8ZRWI5JJvNdUjtciBGFQ5PuBlpEOXQj+JQSg==", - "cpu": [ - "loong64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-mips64el": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.21.5.tgz", - "integrity": "sha512-IajOmO+KJK23bj52dFSNCMsz1QP1DqM6cwLUv3W1QwyxkyIWecfafnI555fvSGqEKwjMXVLokcV5ygHW5b3Jbg==", - "cpu": [ - "mips64el" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-ppc64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.21.5.tgz", - "integrity": "sha512-1hHV/Z4OEfMwpLO8rp7CvlhBDnjsC3CttJXIhBi+5Aj5r+MBvy4egg7wCbe//hSsT+RvDAG7s81tAvpL2XAE4w==", - "cpu": [ - "ppc64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-riscv64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.21.5.tgz", - "integrity": "sha512-2HdXDMd9GMgTGrPWnJzP2ALSokE/0O5HhTUvWIbD3YdjME8JwvSCnNGBnTThKGEB91OZhzrJ4qIIxk/SBmyDDA==", - "cpu": [ - "riscv64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-s390x": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.21.5.tgz", - "integrity": "sha512-zus5sxzqBJD3eXxwvjN1yQkRepANgxE9lgOW2qLnmr8ikMTphkjgXu1HR01K4FJg8h1kEEDAqDcZQtbrRnB41A==", - "cpu": [ - "s390x" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/linux-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.21.5.tgz", - "integrity": "sha512-1rYdTpyv03iycF1+BhzrzQJCdOuAOtaqHTWJZCWvijKD2N5Xu0TtVC8/+1faWqcP9iBCWOmjmhoH94dH82BxPQ==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/netbsd-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.21.5.tgz", - "integrity": "sha512-Woi2MXzXjMULccIwMnLciyZH4nCIMpWQAs049KEeMvOcNADVxo0UBIQPfSmxB3CWKedngg7sWZdLvLczpe0tLg==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "netbsd" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/openbsd-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.21.5.tgz", - "integrity": "sha512-HLNNw99xsvx12lFBUwoT8EVCsSvRNDVxNpjZ7bPn947b8gJPzeHWyNVhFsaerc0n3TsbOINvRP2byTZ5LKezow==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "openbsd" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/sunos-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.21.5.tgz", - "integrity": "sha512-6+gjmFpfy0BHU5Tpptkuh8+uw3mnrvgs+dSPQXQOv3ekbordwnzTVEb4qnIvQcYXq6gzkyTnoZ9dZG+D4garKg==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "sunos" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/win32-arm64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.21.5.tgz", - "integrity": "sha512-Z0gOTd75VvXqyq7nsl93zwahcTROgqvuAcYDUr+vOv8uHhNSKROyU961kgtCD1e95IqPKSQKH7tBTslnS3tA8A==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "win32" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/win32-ia32": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.21.5.tgz", - "integrity": "sha512-SWXFF1CL2RVNMaVs+BBClwtfZSvDgtL//G/smwAc5oVK/UPu2Gu9tIaRgFmYFFKrmg3SyAjSrElf0TiJ1v8fYA==", - "cpu": [ - "ia32" - ], - "dev": true, - "optional": true, - "os": [ - "win32" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@esbuild/win32-x64": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.21.5.tgz", - "integrity": "sha512-tQd/1efJuzPC6rCFwEvLtci/xNFcTZknmXs98FYDfGE4wP9ClFV98nyKrzJKVPMhdDnjzLhdUyMX4PsQAPjwIw==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "win32" - ], - "engines": { - "node": ">=12" - } - }, - "node_modules/@isaacs/cliui": { - "version": "8.0.2", - "resolved": "https://registry.npmjs.org/@isaacs/cliui/-/cliui-8.0.2.tgz", - "integrity": "sha512-O8jcjabXaleOG9DQ0+ARXWZBTfnP4WNAqzuiJK7ll44AmxGKv/J2M4TPjxjY3znBCfvBXFzucm1twdyFybFqEA==", - "dependencies": { - "string-width": "^5.1.2", - "string-width-cjs": "npm:string-width@^4.2.0", - "strip-ansi": "^7.0.1", - "strip-ansi-cjs": "npm:strip-ansi@^6.0.1", - "wrap-ansi": "^8.1.0", - "wrap-ansi-cjs": "npm:wrap-ansi@^7.0.0" - }, - "engines": { - "node": ">=12" - } - }, - "node_modules/@jridgewell/gen-mapping": { - "version": "0.3.5", - "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz", - "integrity": "sha512-IzL8ZoEDIBRWEzlCcRhOaCupYyN5gdIK+Q6fbFdPDg6HqX6jpkItn7DFIpW9LQzXG6Df9sA7+OKnq0qlz/GaQg==", - "dependencies": { - "@jridgewell/set-array": "^1.2.1", - "@jridgewell/sourcemap-codec": "^1.4.10", - "@jridgewell/trace-mapping": "^0.3.24" - }, - "engines": { - "node": ">=6.0.0" - } - }, - "node_modules/@jridgewell/resolve-uri": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz", - "integrity": "sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==", - "engines": { - "node": ">=6.0.0" - } - }, - "node_modules/@jridgewell/set-array": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.2.1.tgz", - "integrity": "sha512-R8gLRTZeyp03ymzP/6Lil/28tGeGEzhx1q2k703KGWRAI1VdvPIXdG70VJc2pAMw3NA6JKL5hhFu1sJX0Mnn/A==", - "engines": { - "node": ">=6.0.0" - } - }, - "node_modules/@jridgewell/sourcemap-codec": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.0.tgz", - "integrity": "sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==" - }, - "node_modules/@jridgewell/trace-mapping": { - "version": "0.3.25", - "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz", - "integrity": "sha512-vNk6aEwybGtawWmy/PzwnGDOjCkLWSD2wqvjGGAgOAwCGWySYXfYoxt00IJkTF+8Lb57DwOb3Aa0o9CApepiYQ==", - "dependencies": { - "@jridgewell/resolve-uri": "^3.1.0", - "@jridgewell/sourcemap-codec": "^1.4.14" - } - }, - "node_modules/@nodelib/fs.scandir": { - "version": "2.1.5", - "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", - "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", - "dependencies": { - "@nodelib/fs.stat": "2.0.5", - "run-parallel": "^1.1.9" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/@nodelib/fs.stat": { - "version": "2.0.5", - "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", - "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", - "engines": { - "node": ">= 8" - } - }, - "node_modules/@nodelib/fs.walk": { - "version": "1.2.8", - "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", - "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", - "dependencies": { - "@nodelib/fs.scandir": "2.1.5", - "fastq": "^1.6.0" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/@nothing-but/utils": { - "version": "0.12.1", - "resolved": "https://registry.npmjs.org/@nothing-but/utils/-/utils-0.12.1.tgz", - "integrity": "sha512-1qZU1Q5El0IjE7JT/ucvJNzdr2hL3W8Rm27xNf1p6gb3Nw8pGnZmxp6/GEW9h+I1k1cICxXNq25hBwknTQ7yhg==", - "dev": true - }, - "node_modules/@pkgjs/parseargs": { - "version": "0.11.0", - "resolved": "https://registry.npmjs.org/@pkgjs/parseargs/-/parseargs-0.11.0.tgz", - "integrity": "sha512-+1VkjdD0QBLPodGrJUeqarH8VAIvQODIbwh9XpP5Syisf7YoQgsJKPNFoqqLQlu+VQ/tVSshMR6loPMn8U+dPg==", - "optional": true, - "engines": { - "node": ">=14" - } - }, - "node_modules/@rollup/rollup-android-arm-eabi": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.20.0.tgz", - "integrity": "sha512-TSpWzflCc4VGAUJZlPpgAJE1+V60MePDQnBd7PPkpuEmOy8i87aL6tinFGKBFKuEDikYpig72QzdT3QPYIi+oA==", - "cpu": [ - "arm" - ], - "dev": true, - "optional": true, - "os": [ - "android" - ] - }, - "node_modules/@rollup/rollup-android-arm64": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.20.0.tgz", - "integrity": "sha512-u00Ro/nok7oGzVuh/FMYfNoGqxU5CPWz1mxV85S2w9LxHR8OoMQBuSk+3BKVIDYgkpeOET5yXkx90OYFc+ytpQ==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "android" - ] - }, - "node_modules/@rollup/rollup-darwin-arm64": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.20.0.tgz", - "integrity": "sha512-uFVfvzvsdGtlSLuL0ZlvPJvl6ZmrH4CBwLGEFPe7hUmf7htGAN+aXo43R/V6LATyxlKVC/m6UsLb7jbG+LG39Q==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "darwin" - ] - }, - "node_modules/@rollup/rollup-darwin-x64": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.20.0.tgz", - "integrity": "sha512-xbrMDdlev53vNXexEa6l0LffojxhqDTBeL+VUxuuIXys4x6xyvbKq5XqTXBCEUA8ty8iEJblHvFaWRJTk/icAQ==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "darwin" - ] - }, - "node_modules/@rollup/rollup-linux-arm-gnueabihf": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.20.0.tgz", - "integrity": "sha512-jMYvxZwGmoHFBTbr12Xc6wOdc2xA5tF5F2q6t7Rcfab68TT0n+r7dgawD4qhPEvasDsVpQi+MgDzj2faOLsZjA==", - "cpu": [ - "arm" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-arm-musleabihf": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.20.0.tgz", - "integrity": "sha512-1asSTl4HKuIHIB1GcdFHNNZhxAYEdqML/MW4QmPS4G0ivbEcBr1JKlFLKsIRqjSwOBkdItn3/ZDlyvZ/N6KPlw==", - "cpu": [ - "arm" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-arm64-gnu": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.20.0.tgz", - "integrity": "sha512-COBb8Bkx56KldOYJfMf6wKeYJrtJ9vEgBRAOkfw6Ens0tnmzPqvlpjZiLgkhg6cA3DGzCmLmmd319pmHvKWWlQ==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-arm64-musl": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.20.0.tgz", - "integrity": "sha512-+it+mBSyMslVQa8wSPvBx53fYuZK/oLTu5RJoXogjk6x7Q7sz1GNRsXWjn6SwyJm8E/oMjNVwPhmNdIjwP135Q==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-powerpc64le-gnu": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.20.0.tgz", - "integrity": "sha512-yAMvqhPfGKsAxHN8I4+jE0CpLWD8cv4z7CK7BMmhjDuz606Q2tFKkWRY8bHR9JQXYcoLfopo5TTqzxgPUjUMfw==", - "cpu": [ - "ppc64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-riscv64-gnu": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.20.0.tgz", - "integrity": "sha512-qmuxFpfmi/2SUkAw95TtNq/w/I7Gpjurx609OOOV7U4vhvUhBcftcmXwl3rqAek+ADBwSjIC4IVNLiszoj3dPA==", - "cpu": [ - "riscv64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-s390x-gnu": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.20.0.tgz", - "integrity": "sha512-I0BtGXddHSHjV1mqTNkgUZLnS3WtsqebAXv11D5BZE/gfw5KoyXSAXVqyJximQXNvNzUo4GKlCK/dIwXlz+jlg==", - "cpu": [ - "s390x" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-x64-gnu": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.20.0.tgz", - "integrity": "sha512-y+eoL2I3iphUg9tN9GB6ku1FA8kOfmF4oUEWhztDJ4KXJy1agk/9+pejOuZkNFhRwHAOxMsBPLbXPd6mJiCwew==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-linux-x64-musl": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.20.0.tgz", - "integrity": "sha512-hM3nhW40kBNYUkZb/r9k2FKK+/MnKglX7UYd4ZUy5DJs8/sMsIbqWK2piZtVGE3kcXVNj3B2IrUYROJMMCikNg==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "linux" - ] - }, - "node_modules/@rollup/rollup-win32-arm64-msvc": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.20.0.tgz", - "integrity": "sha512-psegMvP+Ik/Bg7QRJbv8w8PAytPA7Uo8fpFjXyCRHWm6Nt42L+JtoqH8eDQ5hRP7/XW2UiIriy1Z46jf0Oa1kA==", - "cpu": [ - "arm64" - ], - "dev": true, - "optional": true, - "os": [ - "win32" - ] - }, - "node_modules/@rollup/rollup-win32-ia32-msvc": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.20.0.tgz", - "integrity": "sha512-GabekH3w4lgAJpVxkk7hUzUf2hICSQO0a/BLFA11/RMxQT92MabKAqyubzDZmMOC/hcJNlc+rrypzNzYl4Dx7A==", - "cpu": [ - "ia32" - ], - "dev": true, - "optional": true, - "os": [ - "win32" - ] - }, - "node_modules/@rollup/rollup-win32-x64-msvc": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.20.0.tgz", - "integrity": "sha512-aJ1EJSuTdGnM6qbVC4B5DSmozPTqIag9fSzXRNNo+humQLG89XpPgdt16Ia56ORD7s+H8Pmyx44uczDQ0yDzpg==", - "cpu": [ - "x64" - ], - "dev": true, - "optional": true, - "os": [ - "win32" - ] - }, - "node_modules/@solid-devtools/debugger": { - "version": "0.23.4", - "resolved": "https://registry.npmjs.org/@solid-devtools/debugger/-/debugger-0.23.4.tgz", - "integrity": "sha512-EfTB1Eo313wztQYGJ4Ec/wE70Ay2d603VCXfT3RlyqO5QfLrQGRHX5NXC07hJpQTJJJ3tbNgzO7+ZKo76MM5uA==", - "dev": true, - "dependencies": { - "@nothing-but/utils": "~0.12.0", - "@solid-devtools/shared": "^0.13.2", - "@solid-primitives/bounds": "^0.0.118", - "@solid-primitives/cursor": "^0.0.112", - "@solid-primitives/event-bus": "^1.0.8", - "@solid-primitives/event-listener": "^2.3.0", - "@solid-primitives/keyboard": "^1.2.5", - "@solid-primitives/platform": "^0.1.0", - "@solid-primitives/rootless": "^1.4.2", - "@solid-primitives/scheduled": "^1.4.1", - "@solid-primitives/static-store": "^0.0.5", - "@solid-primitives/utils": "^6.2.1" - }, - "peerDependencies": { - "solid-js": "^1.8.0" - } - }, - "node_modules/@solid-devtools/shared": { - "version": "0.13.2", - "resolved": "https://registry.npmjs.org/@solid-devtools/shared/-/shared-0.13.2.tgz", - "integrity": "sha512-Y4uaC4EfTVwBR537MZwfaY/eiWAh+hW4mbtnwNuUw/LFmitHSkQhNQTUlLQv/S0chtwrYWQBxvXos1dC7e8R9g==", - "dev": true, - "dependencies": { - "@solid-primitives/event-bus": "^1.0.8", - "@solid-primitives/event-listener": "^2.3.0", - "@solid-primitives/media": "^2.2.5", - "@solid-primitives/refs": "^1.0.5", - "@solid-primitives/rootless": "^1.4.2", - "@solid-primitives/scheduled": "^1.4.1", - "@solid-primitives/static-store": "^0.0.5", - "@solid-primitives/styles": "^0.0.111", - "@solid-primitives/utils": "^6.2.1" - }, - "peerDependencies": { - "solid-js": "^1.8.0" - } - }, - "node_modules/@solid-primitives/bounds": { - "version": "0.0.118", - "resolved": "https://registry.npmjs.org/@solid-primitives/bounds/-/bounds-0.0.118.tgz", - "integrity": "sha512-Qj42w8LlnhJ3r/t+t0c0vrdwIvvQMPgjEFGmLiwREaA85ojLbgL9lSBq2tKvljeLCvRVkgj10KEUf+vc99VCIg==", - "dev": true, - "dependencies": { - "@solid-primitives/event-listener": "^2.3.0", - "@solid-primitives/resize-observer": "^2.0.22", - "@solid-primitives/static-store": "^0.0.5", - "@solid-primitives/utils": "^6.2.1" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/cursor": { - "version": "0.0.112", - "resolved": "https://registry.npmjs.org/@solid-primitives/cursor/-/cursor-0.0.112.tgz", - "integrity": "sha512-TAtU7qD7ipSLSXHnq8FhhosAPVX+dnOCb/ITcGcLlj8e/C9YKcxDhgBHJ3R/d1xDRb5/vO/szJtEz6fnQD311Q==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.1" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/event-bus": { - "version": "1.0.11", - "resolved": "https://registry.npmjs.org/@solid-primitives/event-bus/-/event-bus-1.0.11.tgz", - "integrity": "sha512-bSwVA4aI2aNHomSbEroUnisMSyDDXJbrw4U8kFEvrcYdlLrJX5i6QeCFx+vj/zdQQw62KAllrEIyWP8KMpPVnQ==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/event-listener": { - "version": "2.3.3", - "resolved": "https://registry.npmjs.org/@solid-primitives/event-listener/-/event-listener-2.3.3.tgz", - "integrity": "sha512-DAJbl+F0wrFW2xmcV8dKMBhk9QLVLuBSW+TR4JmIfTaObxd13PuL7nqaXnaYKDWOYa6otB00qcCUIGbuIhSUgQ==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/keyboard": { - "version": "1.2.8", - "resolved": "https://registry.npmjs.org/@solid-primitives/keyboard/-/keyboard-1.2.8.tgz", - "integrity": "sha512-pJtcbkjozS6L1xvTht9rPpyPpX55nAkfBzbFWdf3y0Suwh6qClTibvvObzKOf7uzQ+8aZRDH4LsoGmbTKXtJjQ==", - "dev": true, - "dependencies": { - "@solid-primitives/event-listener": "^2.3.3", - "@solid-primitives/rootless": "^1.4.5", - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/media": { - "version": "2.2.9", - "resolved": "https://registry.npmjs.org/@solid-primitives/media/-/media-2.2.9.tgz", - "integrity": "sha512-QUmU62D4/d9YWx/4Dvr/UZasIkIpqNXz7wosA5GLmesRW9XlPa3G5M6uOmTw73SByHNTCw0D6x8bSdtvvLgzvQ==", - "dev": true, - "dependencies": { - "@solid-primitives/event-listener": "^2.3.3", - "@solid-primitives/rootless": "^1.4.5", - "@solid-primitives/static-store": "^0.0.8", - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/media/node_modules/@solid-primitives/static-store": { - "version": "0.0.8", - "resolved": "https://registry.npmjs.org/@solid-primitives/static-store/-/static-store-0.0.8.tgz", - "integrity": "sha512-ZecE4BqY0oBk0YG00nzaAWO5Mjcny8Fc06CdbXadH9T9lzq/9GefqcSe/5AtdXqjvY/DtJ5C6CkcjPZO0o/eqg==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/platform": { - "version": "0.1.2", - "resolved": "https://registry.npmjs.org/@solid-primitives/platform/-/platform-0.1.2.tgz", - "integrity": "sha512-sSxcZfuUrtxcwV0vdjmGnZQcflACzMfLriVeIIWXKp8hzaS3Or3tO6EFQkTd3L8T5dTq+kTtLvPscXIpL0Wzdg==", - "dev": true, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/refs": { - "version": "1.0.8", - "resolved": "https://registry.npmjs.org/@solid-primitives/refs/-/refs-1.0.8.tgz", - "integrity": "sha512-+jIsWG8/nYvhaCoG2Vg6CJOLgTmPKFbaCrNQKWfChalgUf9WrVxWw0CdJb3yX15n5lUcQ0jBo6qYtuVVmBLpBw==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/resize-observer": { - "version": "2.0.26", - "resolved": "https://registry.npmjs.org/@solid-primitives/resize-observer/-/resize-observer-2.0.26.tgz", - "integrity": "sha512-KbPhwal6ML9OHeUTZszBbt6PYSMj89d4wVCLxlvDYL4U0+p+xlCEaqz6v9dkCwm/0Lb+Wed7W5T1dQZCP3JUUw==", - "dev": true, - "dependencies": { - "@solid-primitives/event-listener": "^2.3.3", - "@solid-primitives/rootless": "^1.4.5", - "@solid-primitives/static-store": "^0.0.8", - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/resize-observer/node_modules/@solid-primitives/static-store": { - "version": "0.0.8", - "resolved": "https://registry.npmjs.org/@solid-primitives/static-store/-/static-store-0.0.8.tgz", - "integrity": "sha512-ZecE4BqY0oBk0YG00nzaAWO5Mjcny8Fc06CdbXadH9T9lzq/9GefqcSe/5AtdXqjvY/DtJ5C6CkcjPZO0o/eqg==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/rootless": { - "version": "1.4.5", - "resolved": "https://registry.npmjs.org/@solid-primitives/rootless/-/rootless-1.4.5.tgz", - "integrity": "sha512-GFJE9GC3ojx0aUKqAUZmQPyU8fOVMtnVNrkdk2yS4kd17WqVSpXpoTmo9CnOwA+PG7FTzdIkogvfLQSLs4lrww==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.3" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/scheduled": { - "version": "1.4.3", - "resolved": "https://registry.npmjs.org/@solid-primitives/scheduled/-/scheduled-1.4.3.tgz", - "integrity": "sha512-HfWN5w7b7FEc6VPLBKnnE302h90jsLMuR28Fcf7neRGGf8jBj6wm6/UFQ00VlKexHFMR6KQ2u4VBh5a1ZcqM8g==", - "dev": true, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/static-store": { - "version": "0.0.5", - "resolved": "https://registry.npmjs.org/@solid-primitives/static-store/-/static-store-0.0.5.tgz", - "integrity": "sha512-ssQ+s/wrlFAEE4Zw8GV499yBfvWx7SMm+ZVc11wvao4T5xg9VfXCL9Oa+x4h+vPMvSV/Knv5LrsLiUa+wlJUXQ==", - "dev": true, - "dependencies": { - "@solid-primitives/utils": "^6.2.1" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/styles": { - "version": "0.0.111", - "resolved": "https://registry.npmjs.org/@solid-primitives/styles/-/styles-0.0.111.tgz", - "integrity": "sha512-1mBxOGAPXmfD5oYCvqjKBDN7SuNjz2qz7RdH7KtsuNLQh6lpuSKadtHnLvru0Y8Vz1InqTJisBIy/6P5kyDmPw==", - "dev": true, - "dependencies": { - "@solid-primitives/rootless": "^1.4.2", - "@solid-primitives/utils": "^6.2.1" - }, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@solid-primitives/utils": { - "version": "6.2.3", - "resolved": "https://registry.npmjs.org/@solid-primitives/utils/-/utils-6.2.3.tgz", - "integrity": "sha512-CqAwKb2T5Vi72+rhebSsqNZ9o67buYRdEJrIFzRXz3U59QqezuuxPsyzTSVCacwS5Pf109VRsgCJQoxKRoECZQ==", - "dev": true, - "peerDependencies": { - "solid-js": "^1.6.12" - } - }, - "node_modules/@tweakpane/core": { - "version": "2.0.4", - "resolved": "https://registry.npmjs.org/@tweakpane/core/-/core-2.0.4.tgz", - "integrity": "sha512-0P3xcmvjBr8AmqMOEDNYIbkiaPwvQPkj8VeJX+8ZYkpRgWWbNp1HLbld0MDI0WJHdom89osH3MmCDLnWEXKI2w==", - "dev": true - }, - "node_modules/@tweakpane/plugin-camerakit": { - "version": "0.3.0", - "resolved": "https://registry.npmjs.org/@tweakpane/plugin-camerakit/-/plugin-camerakit-0.3.0.tgz", - "integrity": "sha512-6UwgwDKU+oaAgXJ2D/pOoIpEAZts0RyeLmVzBJGs+VVNqSfkiHzL0i5XD+XnmSL2PaLXBne0dlz0bYOrjmeELw==", - "peerDependencies": { - "tweakpane": "^4.0.0-beta.2" - } - }, - "node_modules/@types/babel__core": { - "version": "7.20.5", - "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.20.5.tgz", - "integrity": "sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA==", - "dev": true, - "dependencies": { - "@babel/parser": "^7.20.7", - "@babel/types": "^7.20.7", - "@types/babel__generator": "*", - "@types/babel__template": "*", - "@types/babel__traverse": "*" - } - }, - "node_modules/@types/babel__generator": { - "version": "7.6.8", - "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.8.tgz", - "integrity": "sha512-ASsj+tpEDsEiFr1arWrlN6V3mdfjRMZt6LtK/Vp/kreFLnr5QH5+DhvD5nINYZXzwJvXeGq+05iUXcAzVrqWtw==", - "dev": true, - "dependencies": { - "@babel/types": "^7.0.0" - } - }, - "node_modules/@types/babel__template": { - "version": "7.4.4", - "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.4.4.tgz", - "integrity": "sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==", - "dev": true, - "dependencies": { - "@babel/parser": "^7.1.0", - "@babel/types": "^7.0.0" - } - }, - "node_modules/@types/babel__traverse": { - "version": "7.20.6", - "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.20.6.tgz", - "integrity": "sha512-r1bzfrm0tomOI8g1SzvCaQHo6Lcv6zu0EA+W2kHrt8dyrHQxGzBBL4kdkzIS+jBMV+EYcMAEAqXqYaLJq5rOZg==", - "dev": true, - "dependencies": { - "@babel/types": "^7.20.7" - } - }, - "node_modules/@types/estree": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.5.tgz", - "integrity": "sha512-/kYRxGDLWzHOB7q+wtSUQlFrtcdUccpfy+X+9iMBpHK8QLLhx2wIPYuS5DYtR9Wa/YlZAbIovy7qVdB1Aq6Lyw==", - "dev": true - }, - "node_modules/@types/stats.js": { - "version": "0.17.3", - "resolved": "https://registry.npmjs.org/@types/stats.js/-/stats.js-0.17.3.tgz", - "integrity": "sha512-pXNfAD3KHOdif9EQXZ9deK82HVNaXP5ZIF5RP2QG6OQFNTaY2YIetfrE9t528vEreGQvEPRDDc8muaoYeK0SxQ==", - "dev": true - }, - "node_modules/ansi-regex": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", - "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/ansi-regex?sponsor=1" - } - }, - "node_modules/ansi-styles": { - "version": "3.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", - "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", - "dev": true, - "dependencies": { - "color-convert": "^1.9.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/any-promise": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", - "integrity": "sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==" - }, - "node_modules/anymatch": { - "version": "3.1.3", - "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", - "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", - "dependencies": { - "normalize-path": "^3.0.0", - "picomatch": "^2.0.4" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/arg": { - "version": "5.0.2", - "resolved": "https://registry.npmjs.org/arg/-/arg-5.0.2.tgz", - "integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==" - }, - "node_modules/autoprefixer": { - "version": "10.4.20", - "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.20.tgz", - "integrity": "sha512-XY25y5xSv/wEoqzDyXXME4AFfkZI0P23z6Fs3YgymDnKJkCGOnkL0iTxCa85UTqaSgfcqyf3UA6+c7wUvx/16g==", - "dev": true, - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/postcss/" - }, - { - "type": "tidelift", - "url": "https://tidelift.com/funding/github/npm/autoprefixer" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "dependencies": { - "browserslist": "^4.23.3", - "caniuse-lite": "^1.0.30001646", - "fraction.js": "^4.3.7", - "normalize-range": "^0.1.2", - "picocolors": "^1.0.1", - "postcss-value-parser": "^4.2.0" - }, - "bin": { - "autoprefixer": "bin/autoprefixer" - }, - "engines": { - "node": "^10 || ^12 || >=14" - }, - "peerDependencies": { - "postcss": "^8.1.0" - } - }, - "node_modules/babel-plugin-jsx-dom-expressions": { - "version": "0.38.1", - "resolved": "https://registry.npmjs.org/babel-plugin-jsx-dom-expressions/-/babel-plugin-jsx-dom-expressions-0.38.1.tgz", - "integrity": "sha512-4FD4H69Cu4jHx2uLDEvx4YC5T/fC/Dmaafhsm8hXm7SjHYzjr09gBVyHdoFza+91f/g9e6tIzjbLCMkOXwmlew==", - "dev": true, - "dependencies": { - "@babel/helper-module-imports": "7.18.6", - "@babel/plugin-syntax-jsx": "^7.18.6", - "@babel/types": "^7.20.7", - "html-entities": "2.3.3", - "validate-html-nesting": "^1.2.1" - }, - "peerDependencies": { - "@babel/core": "^7.20.12" - } - }, - "node_modules/babel-plugin-jsx-dom-expressions/node_modules/@babel/helper-module-imports": { - "version": "7.18.6", - "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.18.6.tgz", - "integrity": "sha512-0NFvs3VkuSYbFi1x2Vd6tKrywq+z/cLeYC/RJNFrIX/30Bf5aiGYbtvGXolEktzJH8o5E5KJ3tT+nkxuuZFVlA==", - "dev": true, - "dependencies": { - "@babel/types": "^7.18.6" - }, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/babel-preset-solid": { - "version": "1.8.19", - "resolved": "https://registry.npmjs.org/babel-preset-solid/-/babel-preset-solid-1.8.19.tgz", - "integrity": "sha512-F3MoUdx3i4znhStnXUBno+5kGSbvhpbGrPgqfRPrS8W7foVJUOSd1/F9QDyd9dgClHfr+J7V14931eu1PEDDMQ==", - "dev": true, - "dependencies": { - "babel-plugin-jsx-dom-expressions": "^0.38.1" - }, - "peerDependencies": { - "@babel/core": "^7.0.0" - } - }, - "node_modules/balanced-match": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", - "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==" - }, - "node_modules/binary-extensions": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", - "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==", - "engines": { - "node": ">=8" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/brace-expansion": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz", - "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==", - "dependencies": { - "balanced-match": "^1.0.0" - } - }, - "node_modules/braces": { - "version": "3.0.3", - "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz", - "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==", - "dependencies": { - "fill-range": "^7.1.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/browserslist": { - "version": "4.23.3", - "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.23.3.tgz", - "integrity": "sha512-btwCFJVjI4YWDNfau8RhZ+B1Q/VLoUITrm3RlP6y1tYGWIOa+InuYiRGXUBXo8nA1qKmHMyLB/iVQg5TT4eFoA==", - "dev": true, - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/browserslist" - }, - { - "type": "tidelift", - "url": "https://tidelift.com/funding/github/npm/browserslist" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "dependencies": { - "caniuse-lite": "^1.0.30001646", - "electron-to-chromium": "^1.5.4", - "node-releases": "^2.0.18", - "update-browserslist-db": "^1.1.0" - }, - "bin": { - "browserslist": "cli.js" - }, - "engines": { - "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" - } - }, - "node_modules/camelcase-css": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz", - "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==", - "engines": { - "node": ">= 6" - } - }, - "node_modules/caniuse-lite": { - "version": "1.0.30001651", - "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001651.tgz", - "integrity": "sha512-9Cf+Xv1jJNe1xPZLGuUXLNkE1BoDkqRqYyFJ9TDYSqhduqA4hu4oR9HluGoWYQC/aj8WHjsGVV+bwkh0+tegRg==", - "dev": true, - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/browserslist" - }, - { - "type": "tidelift", - "url": "https://tidelift.com/funding/github/npm/caniuse-lite" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ] - }, - "node_modules/chalk": { - "version": "2.4.2", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", - "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", - "dev": true, - "dependencies": { - "ansi-styles": "^3.2.1", - "escape-string-regexp": "^1.0.5", - "supports-color": "^5.3.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/chokidar": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz", - "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==", - "dependencies": { - "anymatch": "~3.1.2", - "braces": "~3.0.2", - "glob-parent": "~5.1.2", - "is-binary-path": "~2.1.0", - "is-glob": "~4.0.1", - "normalize-path": "~3.0.0", - "readdirp": "~3.6.0" - }, - "engines": { - "node": ">= 8.10.0" - }, - "funding": { - "url": "https://paulmillr.com/funding/" - }, - "optionalDependencies": { - "fsevents": "~2.3.2" - } - }, - "node_modules/chokidar/node_modules/glob-parent": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", - "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", - "dependencies": { - "is-glob": "^4.0.1" - }, - "engines": { - "node": ">= 6" - } - }, - "node_modules/color-convert": { - "version": "1.9.3", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", - "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", - "dev": true, - "dependencies": { - "color-name": "1.1.3" - } - }, - "node_modules/color-name": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", - "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==", - "dev": true - }, - "node_modules/commander": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/commander/-/commander-4.1.1.tgz", - "integrity": "sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==", - "engines": { - "node": ">= 6" - } - }, - "node_modules/convert-source-map": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-2.0.0.tgz", - "integrity": "sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==", - "dev": true - }, - "node_modules/cross-spawn": { - "version": "7.0.3", - "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz", - "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==", - "dependencies": { - "path-key": "^3.1.0", - "shebang-command": "^2.0.0", - "which": "^2.0.1" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/cssesc": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", - "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", - "bin": { - "cssesc": "bin/cssesc" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/csstype": { - "version": "3.1.3", - "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz", - "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw==" - }, - "node_modules/debounce": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/debounce/-/debounce-2.1.0.tgz", - "integrity": "sha512-OkL3+0pPWCqoBc/nhO9u6TIQNTK44fnBnzuVtJAbp13Naxw9R6u21x+8tVTka87AhDZ3htqZ2pSSsZl9fqL2Wg==", - "engines": { - "node": ">=18" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/debug": { - "version": "4.3.6", - "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.6.tgz", - "integrity": "sha512-O/09Bd4Z1fBrU4VzkhFqVgpPzaGbw6Sm9FEkBT1A/YBXQFGuuSxa1dN2nxgxS34JmKXqYx8CZAwEVoJFImUXIg==", - "dev": true, - "dependencies": { - "ms": "2.1.2" - }, - "engines": { - "node": ">=6.0" - }, - "peerDependenciesMeta": { - "supports-color": { - "optional": true - } - } - }, - "node_modules/deep-object-diff": { - "version": "1.1.9", - "resolved": "https://registry.npmjs.org/deep-object-diff/-/deep-object-diff-1.1.9.tgz", - "integrity": "sha512-Rn+RuwkmkDwCi2/oXOFS9Gsr5lJZu/yTGpK7wAaAIE75CC+LCGEZHpY6VQJa/RoJcrmaA/docWJZvYohlNkWPA==" - }, - "node_modules/didyoumean": { - "version": "1.2.2", - "resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz", - "integrity": "sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw==" - }, - "node_modules/dlv": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/dlv/-/dlv-1.1.3.tgz", - "integrity": "sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==" - }, - "node_modules/eastasianwidth": { - "version": "0.2.0", - "resolved": "https://registry.npmjs.org/eastasianwidth/-/eastasianwidth-0.2.0.tgz", - "integrity": "sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==" - }, - "node_modules/electron-to-chromium": { - "version": "1.5.9", - "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.5.9.tgz", - "integrity": "sha512-HfkT8ndXR0SEkU8gBQQM3rz035bpE/hxkZ1YIt4KJPEFES68HfIU6LzKukH0H794Lm83WJtkSAMfEToxCs15VA==", - "dev": true - }, - "node_modules/emoji-regex": { - "version": "9.2.2", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz", - "integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==" - }, - "node_modules/esbuild": { - "version": "0.21.5", - "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.21.5.tgz", - "integrity": "sha512-mg3OPMV4hXywwpoDxu3Qda5xCKQi+vCTZq8S9J/EpkhB2HzKXq4SNFZE3+NK93JYxc8VMSep+lOUSC/RVKaBqw==", - "dev": true, - "hasInstallScript": true, - "bin": { - "esbuild": "bin/esbuild" - }, - "engines": { - "node": ">=12" - }, - "optionalDependencies": { - "@esbuild/aix-ppc64": "0.21.5", - "@esbuild/android-arm": "0.21.5", - "@esbuild/android-arm64": "0.21.5", - "@esbuild/android-x64": "0.21.5", - "@esbuild/darwin-arm64": "0.21.5", - "@esbuild/darwin-x64": "0.21.5", - "@esbuild/freebsd-arm64": "0.21.5", - "@esbuild/freebsd-x64": "0.21.5", - "@esbuild/linux-arm": "0.21.5", - "@esbuild/linux-arm64": "0.21.5", - "@esbuild/linux-ia32": "0.21.5", - "@esbuild/linux-loong64": "0.21.5", - "@esbuild/linux-mips64el": "0.21.5", - "@esbuild/linux-ppc64": "0.21.5", - "@esbuild/linux-riscv64": "0.21.5", - "@esbuild/linux-s390x": "0.21.5", - "@esbuild/linux-x64": "0.21.5", - "@esbuild/netbsd-x64": "0.21.5", - "@esbuild/openbsd-x64": "0.21.5", - "@esbuild/sunos-x64": "0.21.5", - "@esbuild/win32-arm64": "0.21.5", - "@esbuild/win32-ia32": "0.21.5", - "@esbuild/win32-x64": "0.21.5" - } - }, - "node_modules/escalade": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.2.tgz", - "integrity": "sha512-ErCHMCae19vR8vQGe50xIsVomy19rg6gFu3+r3jkEO46suLMWBksvVyoGgQV+jOfl84ZSOSlmv6Gxa89PmTGmA==", - "dev": true, - "engines": { - "node": ">=6" - } - }, - "node_modules/escape-string-regexp": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", - "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==", - "dev": true, - "engines": { - "node": ">=0.8.0" - } - }, - "node_modules/fast-glob": { - "version": "3.3.2", - "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz", - "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==", - "dependencies": { - "@nodelib/fs.stat": "^2.0.2", - "@nodelib/fs.walk": "^1.2.3", - "glob-parent": "^5.1.2", - "merge2": "^1.3.0", - "micromatch": "^4.0.4" - }, - "engines": { - "node": ">=8.6.0" - } - }, - "node_modules/fast-glob/node_modules/glob-parent": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", - "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", - "dependencies": { - "is-glob": "^4.0.1" - }, - "engines": { - "node": ">= 6" - } - }, - "node_modules/fastq": { - "version": "1.17.1", - "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.17.1.tgz", - "integrity": "sha512-sRVD3lWVIXWg6By68ZN7vho9a1pQcN/WBFaAAsDDFzlJjvoGx0P8z7V1t72grFJfJhu3YPZBuu25f7Kaw2jN1w==", - "dependencies": { - "reusify": "^1.0.4" - } - }, - "node_modules/fill-range": { - "version": "7.1.1", - "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz", - "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==", - "dependencies": { - "to-regex-range": "^5.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/foreground-child": { - "version": "3.3.0", - "resolved": "https://registry.npmjs.org/foreground-child/-/foreground-child-3.3.0.tgz", - "integrity": "sha512-Ld2g8rrAyMYFXBhEqMz8ZAHBi4J4uS1i/CxGMDnjyFWddMXLVcDp051DZfu+t7+ab7Wv6SMqpWmyFIj5UbfFvg==", - "dependencies": { - "cross-spawn": "^7.0.0", - "signal-exit": "^4.0.1" - }, - "engines": { - "node": ">=14" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/fraction.js": { - "version": "4.3.7", - "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-4.3.7.tgz", - "integrity": "sha512-ZsDfxO51wGAXREY55a7la9LScWpwv9RxIrYABrlvOFBlH/ShPnrtsXeuUIfXKKOVicNxQ+o8JTbJvjS4M89yew==", - "dev": true, - "engines": { - "node": "*" - }, - "funding": { - "type": "patreon", - "url": "https://github.com/sponsors/rawify" - } - }, - "node_modules/fsevents": { - "version": "2.3.3", - "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", - "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", - "hasInstallScript": true, - "optional": true, - "os": [ - "darwin" - ], - "engines": { - "node": "^8.16.0 || ^10.6.0 || >=11.0.0" - } - }, - "node_modules/function-bind": { - "version": "1.1.2", - "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", - "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/gensync": { - "version": "1.0.0-beta.2", - "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", - "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", - "dev": true, - "engines": { - "node": ">=6.9.0" - } - }, - "node_modules/glob": { - "version": "10.4.5", - "resolved": "https://registry.npmjs.org/glob/-/glob-10.4.5.tgz", - "integrity": "sha512-7Bv8RF0k6xjo7d4A/PxYLbUCfb6c+Vpd2/mB2yRDlew7Jb5hEXiCD9ibfO7wpk8i4sevK6DFny9h7EYbM3/sHg==", - "dependencies": { - "foreground-child": "^3.1.0", - "jackspeak": "^3.1.2", - "minimatch": "^9.0.4", - "minipass": "^7.1.2", - "package-json-from-dist": "^1.0.0", - "path-scurry": "^1.11.1" - }, - "bin": { - "glob": "dist/esm/bin.mjs" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/glob-parent": { - "version": "6.0.2", - "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", - "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", - "dependencies": { - "is-glob": "^4.0.3" - }, - "engines": { - "node": ">=10.13.0" - } - }, - "node_modules/globals": { - "version": "11.12.0", - "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", - "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", - "dev": true, - "engines": { - "node": ">=4" - } - }, - "node_modules/has-flag": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", - "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", - "dev": true, - "engines": { - "node": ">=4" - } - }, - "node_modules/hasown": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", - "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", - "dependencies": { - "function-bind": "^1.1.2" - }, - "engines": { - "node": ">= 0.4" - } - }, - "node_modules/html-entities": { - "version": "2.3.3", - "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-2.3.3.tgz", - "integrity": "sha512-DV5Ln36z34NNTDgnz0EWGBLZENelNAtkiFA4kyNOG2tDI6Mz1uSWiq1wAKdyjnJwyDiDO7Fa2SO1CTxPXL8VxA==", - "dev": true - }, - "node_modules/is-binary-path": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", - "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", - "dependencies": { - "binary-extensions": "^2.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/is-core-module": { - "version": "2.15.0", - "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.15.0.tgz", - "integrity": "sha512-Dd+Lb2/zvk9SKy1TGCt1wFJFo/MWBPMX5x7KcvLajWTGuomczdQX61PvY5yK6SVACwpoexWo81IfFyoKY2QnTA==", - "dependencies": { - "hasown": "^2.0.2" - }, - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/is-extglob": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", - "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/is-fullwidth-code-point": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", - "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", - "engines": { - "node": ">=8" - } - }, - "node_modules/is-glob": { - "version": "4.0.3", - "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", - "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", - "dependencies": { - "is-extglob": "^2.1.1" - }, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/is-number": { - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", - "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", - "engines": { - "node": ">=0.12.0" - } - }, - "node_modules/is-what": { - "version": "4.1.16", - "resolved": "https://registry.npmjs.org/is-what/-/is-what-4.1.16.tgz", - "integrity": "sha512-ZhMwEosbFJkA0YhFnNDgTM4ZxDRsS6HqTo7qsZM08fehyRYIYa0yHu5R6mgo1n/8MgaPBXiPimPD77baVFYg+A==", - "dev": true, - "engines": { - "node": ">=12.13" - }, - "funding": { - "url": "https://github.com/sponsors/mesqueeb" - } - }, - "node_modules/isexe": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", - "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==" - }, - "node_modules/jackspeak": { - "version": "3.4.3", - "resolved": "https://registry.npmjs.org/jackspeak/-/jackspeak-3.4.3.tgz", - "integrity": "sha512-OGlZQpz2yfahA/Rd1Y8Cd9SIEsqvXkLVoSw/cgwhnhFMDbsQFeZYoJJ7bIZBS9BcamUW96asq/npPWugM+RQBw==", - "dependencies": { - "@isaacs/cliui": "^8.0.2" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - }, - "optionalDependencies": { - "@pkgjs/parseargs": "^0.11.0" - } - }, - "node_modules/jiti": { - "version": "1.21.6", - "resolved": "https://registry.npmjs.org/jiti/-/jiti-1.21.6.tgz", - "integrity": "sha512-2yTgeWTWzMWkHu6Jp9NKgePDaYHbntiwvYuuJLbbN9vl7DC9DvXKOB2BC3ZZ92D3cvV/aflH0osDfwpHepQ53w==", - "bin": { - "jiti": "bin/jiti.js" - } - }, - "node_modules/js-tokens": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", - "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", - "dev": true - }, - "node_modules/jsesc": { - "version": "2.5.2", - "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", - "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", - "dev": true, - "bin": { - "jsesc": "bin/jsesc" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/json5": { - "version": "2.2.3", - "resolved": "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz", - "integrity": "sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==", - "dev": true, - "bin": { - "json5": "lib/cli.js" - }, - "engines": { - "node": ">=6" - } - }, - "node_modules/kampos": { - "version": "0.9.1", - "resolved": "https://registry.npmjs.org/kampos/-/kampos-0.9.1.tgz", - "integrity": "sha512-BsGWzhcmCwzTXkKETtmyrwFgOKJcYc3EPLgfBFlw/JBqLrqr+coRdqXQHlvW3T3y6EeDS0BlRd/buuoV1gLKbg==" - }, - "node_modules/lilconfig": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-2.1.0.tgz", - "integrity": "sha512-utWOt/GHzuUxnLKxB6dk81RoOeoNeHgbrXiuGk4yyF5qlRz+iIVWu56E2fqGHFrXz0QNUhLB/8nKqvRH66JKGQ==", - "engines": { - "node": ">=10" - } - }, - "node_modules/lines-and-columns": { - "version": "1.2.4", - "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz", - "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==" - }, - "node_modules/lru-cache": { - "version": "5.1.1", - "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", - "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", - "dev": true, - "dependencies": { - "yallist": "^3.0.2" - } - }, - "node_modules/lz-string": { - "version": "1.5.0", - "resolved": "https://registry.npmjs.org/lz-string/-/lz-string-1.5.0.tgz", - "integrity": "sha512-h5bgJWpxJNswbU7qCrV0tIKQCaS3blPDrqKWx+QxzuzL1zGUzij9XCWLrSLsJPu5t+eWA/ycetzYAO5IOMcWAQ==", - "bin": { - "lz-string": "bin/bin.js" - } - }, - "node_modules/merge-anything": { - "version": "5.1.7", - "resolved": "https://registry.npmjs.org/merge-anything/-/merge-anything-5.1.7.tgz", - "integrity": "sha512-eRtbOb1N5iyH0tkQDAoQ4Ipsp/5qSR79Dzrz8hEPxRX10RWWR/iQXdoKmBSRCThY1Fh5EhISDtpSc93fpxUniQ==", - "dev": true, - "dependencies": { - "is-what": "^4.1.8" - }, - "engines": { - "node": ">=12.13" - }, - "funding": { - "url": "https://github.com/sponsors/mesqueeb" - } - }, - "node_modules/merge2": { - "version": "1.4.1", - "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz", - "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==", - "engines": { - "node": ">= 8" - } - }, - "node_modules/micromatch": { - "version": "4.0.7", - "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.7.tgz", - "integrity": "sha512-LPP/3KorzCwBxfeUuZmaR6bG2kdeHSbe0P2tY3FLRU4vYrjYz5hI4QZwV0njUx3jeuKe67YukQ1LSPZBKDqO/Q==", - "dependencies": { - "braces": "^3.0.3", - "picomatch": "^2.3.1" - }, - "engines": { - "node": ">=8.6" - } - }, - "node_modules/minimatch": { - "version": "9.0.5", - "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.5.tgz", - "integrity": "sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==", - "dependencies": { - "brace-expansion": "^2.0.1" - }, - "engines": { - "node": ">=16 || 14 >=14.17" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/minipass": { - "version": "7.1.2", - "resolved": "https://registry.npmjs.org/minipass/-/minipass-7.1.2.tgz", - "integrity": "sha512-qOOzS1cBTWYF4BH8fVePDBOO9iptMnGUEZwNc/cMWnTV2nVLZ7VoNWEPHkYczZA0pdoA7dl6e7FL659nX9S2aw==", - "engines": { - "node": ">=16 || 14 >=14.17" - } - }, - "node_modules/ms": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", - "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", - "dev": true - }, - "node_modules/mz": { - "version": "2.7.0", - "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz", - "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==", - "dependencies": { - "any-promise": "^1.0.0", - "object-assign": "^4.0.1", - "thenify-all": "^1.0.0" - } - }, - "node_modules/nanoid": { - "version": "3.3.7", - "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz", - "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==", - "funding": [ - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "bin": { - "nanoid": "bin/nanoid.cjs" - }, - "engines": { - "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" - } - }, - "node_modules/node-releases": { - "version": "2.0.18", - "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.18.tgz", - "integrity": "sha512-d9VeXT4SJ7ZeOqGX6R5EM022wpL+eWPooLI+5UpWn2jCT1aosUQEhQP214x33Wkwx3JQMvIm+tIoVOdodFS40g==", - "dev": true - }, - "node_modules/normalize-path": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", - "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/normalize-range": { - "version": "0.1.2", - "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz", - "integrity": "sha512-bdok/XvKII3nUpklnV6P2hxtMNrCboOjAcyBuQnWEhO665FwrSNRxU+AqpsyvO6LgGYPspN+lu5CLtw4jPRKNA==", - "dev": true, - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/object-assign": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", - "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/object-hash": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/object-hash/-/object-hash-3.0.0.tgz", - "integrity": "sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw==", - "engines": { - "node": ">= 6" - } - }, - "node_modules/package-json-from-dist": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/package-json-from-dist/-/package-json-from-dist-1.0.0.tgz", - "integrity": "sha512-dATvCeZN/8wQsGywez1mzHtTlP22H8OEfPrVMLNr4/eGa+ijtLn/6M5f0dY8UKNrC2O9UCU6SSoG3qRKnt7STw==" - }, - "node_modules/path-key": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz", - "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", - "engines": { - "node": ">=8" - } - }, - "node_modules/path-parse": { - "version": "1.0.7", - "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz", - "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==" - }, - "node_modules/path-scurry": { - "version": "1.11.1", - "resolved": "https://registry.npmjs.org/path-scurry/-/path-scurry-1.11.1.tgz", - "integrity": "sha512-Xa4Nw17FS9ApQFJ9umLiJS4orGjm7ZzwUrwamcGQuHSzDyth9boKDaycYdDcZDuqYATXw4HFXgaqWTctW/v1HA==", - "dependencies": { - "lru-cache": "^10.2.0", - "minipass": "^5.0.0 || ^6.0.2 || ^7.0.0" - }, - "engines": { - "node": ">=16 || 14 >=14.18" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/path-scurry/node_modules/lru-cache": { - "version": "10.4.3", - "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-10.4.3.tgz", - "integrity": "sha512-JNAzZcXrCt42VGLuYz0zfAzDfAvJWW6AfYlDBQyDV5DClI2m5sAmK+OIO7s59XfsRsWHp02jAJrRadPRGTt6SQ==" - }, - "node_modules/picocolors": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.1.tgz", - "integrity": "sha512-anP1Z8qwhkbmu7MFP5iTt+wQKXgwzf7zTyGlcdzabySa9vd0Xt392U0rVmz9poOaBj0uHJKyyo9/upk0HrEQew==" - }, - "node_modules/picomatch": { - "version": "2.3.1", - "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", - "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", - "engines": { - "node": ">=8.6" - }, - "funding": { - "url": "https://github.com/sponsors/jonschlinkert" - } - }, - "node_modules/pify": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", - "integrity": "sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/pirates": { - "version": "4.0.6", - "resolved": "https://registry.npmjs.org/pirates/-/pirates-4.0.6.tgz", - "integrity": "sha512-saLsH7WeYYPiD25LDuLRRY/i+6HaPYr6G1OUlN39otzkSTxKnubR9RTxS3/Kk50s1g2JTgFwWQDQyplC5/SHZg==", - "engines": { - "node": ">= 6" - } - }, - "node_modules/postcss": { - "version": "8.4.41", - "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.41.tgz", - "integrity": "sha512-TesUflQ0WKZqAvg52PWL6kHgLKP6xB6heTOdoYM0Wt2UHyxNa4K25EZZMgKns3BH1RLVbZCREPpLY0rhnNoHVQ==", - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/postcss/" - }, - { - "type": "tidelift", - "url": "https://tidelift.com/funding/github/npm/postcss" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "dependencies": { - "nanoid": "^3.3.7", - "picocolors": "^1.0.1", - "source-map-js": "^1.2.0" - }, - "engines": { - "node": "^10 || ^12 || >=14" - } - }, - "node_modules/postcss-import": { - "version": "15.1.0", - "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-15.1.0.tgz", - "integrity": "sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew==", - "dependencies": { - "postcss-value-parser": "^4.0.0", - "read-cache": "^1.0.0", - "resolve": "^1.1.7" - }, - "engines": { - "node": ">=14.0.0" - }, - "peerDependencies": { - "postcss": "^8.0.0" - } - }, - "node_modules/postcss-js": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.0.1.tgz", - "integrity": "sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw==", - "dependencies": { - "camelcase-css": "^2.0.1" - }, - "engines": { - "node": "^12 || ^14 || >= 16" - }, - "funding": { - "type": "opencollective", - "url": "https://opencollective.com/postcss/" - }, - "peerDependencies": { - "postcss": "^8.4.21" - } - }, - "node_modules/postcss-load-config": { - "version": "4.0.2", - "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-4.0.2.tgz", - "integrity": "sha512-bSVhyJGL00wMVoPUzAVAnbEoWyqRxkjv64tUl427SKnPrENtq6hJwUojroMz2VB+Q1edmi4IfrAPpami5VVgMQ==", - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/postcss/" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "dependencies": { - "lilconfig": "^3.0.0", - "yaml": "^2.3.4" - }, - "engines": { - "node": ">= 14" - }, - "peerDependencies": { - "postcss": ">=8.0.9", - "ts-node": ">=9.0.0" - }, - "peerDependenciesMeta": { - "postcss": { - "optional": true - }, - "ts-node": { - "optional": true - } - } - }, - "node_modules/postcss-load-config/node_modules/lilconfig": { - "version": "3.1.2", - "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-3.1.2.tgz", - "integrity": "sha512-eop+wDAvpItUys0FWkHIKeC9ybYrTGbU41U5K7+bttZZeohvnY7M9dZ5kB21GNWiFT2q1OoPTvncPCgSOVO5ow==", - "engines": { - "node": ">=14" - }, - "funding": { - "url": "https://github.com/sponsors/antonk52" - } - }, - "node_modules/postcss-nested": { - "version": "6.2.0", - "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.2.0.tgz", - "integrity": "sha512-HQbt28KulC5AJzG+cZtj9kvKB93CFCdLvog1WFLf1D+xmMvPGlBstkpTEZfK5+AN9hfJocyBFCNiqyS48bpgzQ==", - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/postcss/" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "dependencies": { - "postcss-selector-parser": "^6.1.1" - }, - "engines": { - "node": ">=12.0" - }, - "peerDependencies": { - "postcss": "^8.2.14" - } - }, - "node_modules/postcss-selector-parser": { - "version": "6.1.2", - "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.1.2.tgz", - "integrity": "sha512-Q8qQfPiZ+THO/3ZrOrO0cJJKfpYCagtMUkXbnEfmgUjwXg6z/WBeOyS9APBBPCTSiDV+s4SwQGu8yFsiMRIudg==", - "dependencies": { - "cssesc": "^3.0.0", - "util-deprecate": "^1.0.2" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/postcss-value-parser": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", - "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==" - }, - "node_modules/queue-microtask": { - "version": "1.2.3", - "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz", - "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==", - "funding": [ - { - "type": "github", - "url": "https://github.com/sponsors/feross" - }, - { - "type": "patreon", - "url": "https://www.patreon.com/feross" - }, - { - "type": "consulting", - "url": "https://feross.org/support" - } - ] - }, - "node_modules/read-cache": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz", - "integrity": "sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA==", - "dependencies": { - "pify": "^2.3.0" - } - }, - "node_modules/readdirp": { - "version": "3.6.0", - "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", - "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", - "dependencies": { - "picomatch": "^2.2.1" - }, - "engines": { - "node": ">=8.10.0" - } - }, - "node_modules/resolve": { - "version": "1.22.8", - "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.8.tgz", - "integrity": "sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw==", - "dependencies": { - "is-core-module": "^2.13.0", - "path-parse": "^1.0.7", - "supports-preserve-symlinks-flag": "^1.0.0" - }, - "bin": { - "resolve": "bin/resolve" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/reusify": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", - "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", - "engines": { - "iojs": ">=1.0.0", - "node": ">=0.10.0" - } - }, - "node_modules/rollup": { - "version": "4.20.0", - "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.20.0.tgz", - "integrity": "sha512-6rbWBChcnSGzIlXeIdNIZTopKYad8ZG8ajhl78lGRLsI2rX8IkaotQhVas2Ma+GPxJav19wrSzvRvuiv0YKzWw==", - "dev": true, - "dependencies": { - "@types/estree": "1.0.5" - }, - "bin": { - "rollup": "dist/bin/rollup" - }, - "engines": { - "node": ">=18.0.0", - "npm": ">=8.0.0" - }, - "optionalDependencies": { - "@rollup/rollup-android-arm-eabi": "4.20.0", - "@rollup/rollup-android-arm64": "4.20.0", - "@rollup/rollup-darwin-arm64": "4.20.0", - "@rollup/rollup-darwin-x64": "4.20.0", - "@rollup/rollup-linux-arm-gnueabihf": "4.20.0", - "@rollup/rollup-linux-arm-musleabihf": "4.20.0", - "@rollup/rollup-linux-arm64-gnu": "4.20.0", - "@rollup/rollup-linux-arm64-musl": "4.20.0", - "@rollup/rollup-linux-powerpc64le-gnu": "4.20.0", - "@rollup/rollup-linux-riscv64-gnu": "4.20.0", - "@rollup/rollup-linux-s390x-gnu": "4.20.0", - "@rollup/rollup-linux-x64-gnu": "4.20.0", - "@rollup/rollup-linux-x64-musl": "4.20.0", - "@rollup/rollup-win32-arm64-msvc": "4.20.0", - "@rollup/rollup-win32-ia32-msvc": "4.20.0", - "@rollup/rollup-win32-x64-msvc": "4.20.0", - "fsevents": "~2.3.2" - } - }, - "node_modules/run-parallel": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", - "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==", - "funding": [ - { - "type": "github", - "url": "https://github.com/sponsors/feross" - }, - { - "type": "patreon", - "url": "https://www.patreon.com/feross" - }, - { - "type": "consulting", - "url": "https://feross.org/support" - } - ], - "dependencies": { - "queue-microtask": "^1.2.2" - } - }, - "node_modules/semver": { - "version": "6.3.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", - "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", - "dev": true, - "bin": { - "semver": "bin/semver.js" - } - }, - "node_modules/seroval": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/seroval/-/seroval-1.1.1.tgz", - "integrity": "sha512-rqEO6FZk8mv7Hyv4UCj3FD3b6Waqft605TLfsCe/BiaylRpyyMC0b+uA5TJKawX3KzMrdi3wsLbCaLplrQmBvQ==", - "engines": { - "node": ">=10" - } - }, - "node_modules/seroval-plugins": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/seroval-plugins/-/seroval-plugins-1.1.1.tgz", - "integrity": "sha512-qNSy1+nUj7hsCOon7AO4wdAIo9P0jrzAMp18XhiOzA6/uO5TKtP7ScozVJ8T293oRIvi5wyCHSM4TrJo/c/GJA==", - "engines": { - "node": ">=10" - }, - "peerDependencies": { - "seroval": "^1.0" - } - }, - "node_modules/shebang-command": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", - "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==", - "dependencies": { - "shebang-regex": "^3.0.0" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/shebang-regex": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz", - "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==", - "engines": { - "node": ">=8" - } - }, - "node_modules/signal-exit": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-4.1.0.tgz", - "integrity": "sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==", - "engines": { - "node": ">=14" - }, - "funding": { - "url": "https://github.com/sponsors/isaacs" - } - }, - "node_modules/solid-devtools": { - "version": "0.29.3", - "resolved": "https://registry.npmjs.org/solid-devtools/-/solid-devtools-0.29.3.tgz", - "integrity": "sha512-9j3VxVbEoC54ML22gAMytR8ZS1nk9xKatsWziKSkI4c/Bcyh4sxQBGESHuXSLs9xaxpyGVTmFl3hknoxEpKzlA==", - "dev": true, - "dependencies": { - "@babel/core": "^7.23.3", - "@babel/plugin-syntax-typescript": "^7.23.3", - "@babel/types": "^7.23.3", - "@solid-devtools/debugger": "^0.23.3", - "@solid-devtools/shared": "^0.13.1" - }, - "peerDependencies": { - "solid-js": "^1.8.0", - "solid-start": "^0.3.0", - "vite": "^2.2.3 || ^3.0.0 || ^4.0.0 || ^5.0.0" - }, - "peerDependenciesMeta": { - "solid-start": { - "optional": true - }, - "vite": { - "optional": true - } - } - }, - "node_modules/solid-js": { - "version": "1.8.21", - "resolved": "https://registry.npmjs.org/solid-js/-/solid-js-1.8.21.tgz", - "integrity": "sha512-FHUGdoo7GVa1BTpGh/4UtwIISde0vSXoqNB6KFpHiTgkIY959tmCJ7NYQAWDfScBfnpoMGZR8lFz0DiwW/gFlw==", - "dependencies": { - "csstype": "^3.1.0", - "seroval": "^1.1.0", - "seroval-plugins": "^1.1.0" - } - }, - "node_modules/solid-refresh": { - "version": "0.6.3", - "resolved": "https://registry.npmjs.org/solid-refresh/-/solid-refresh-0.6.3.tgz", - "integrity": "sha512-F3aPsX6hVw9ttm5LYlth8Q15x6MlI/J3Dn+o3EQyRTtTxidepSTwAYdozt01/YA+7ObcciagGEyXIopGZzQtbA==", - "dev": true, - "dependencies": { - "@babel/generator": "^7.23.6", - "@babel/helper-module-imports": "^7.22.15", - "@babel/types": "^7.23.6" - }, - "peerDependencies": { - "solid-js": "^1.3" - } - }, - "node_modules/source-map-js": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.0.tgz", - "integrity": "sha512-itJW8lvSA0TXEphiRoawsCksnlf8SyvmFzIhltqAHluXd88pkCd+cXJVHTDwdCr0IzwptSm035IHQktUu1QUMg==", - "engines": { - "node": ">=0.10.0" - } - }, - "node_modules/stats.js": { - "version": "0.17.0", - "resolved": "https://registry.npmjs.org/stats.js/-/stats.js-0.17.0.tgz", - "integrity": "sha512-hNKz8phvYLPEcRkeG1rsGmV5ChMjKDAWU7/OJJdDErPBNChQXxCo3WZurGpnWc6gZhAzEPFad1aVgyOANH1sMw==" - }, - "node_modules/string-width": { - "version": "5.1.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-5.1.2.tgz", - "integrity": "sha512-HnLOCR3vjcY8beoNLtcjZ5/nxn2afmME6lhrDrebokqMap+XbeW8n9TXpPDOqdGK5qcI3oT0GKTW6wC7EMiVqA==", - "dependencies": { - "eastasianwidth": "^0.2.0", - "emoji-regex": "^9.2.2", - "strip-ansi": "^7.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/sponsors/sindresorhus" - } - }, - "node_modules/string-width-cjs": { - "name": "string-width", - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", - "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", - "dependencies": { - "emoji-regex": "^8.0.0", - "is-fullwidth-code-point": "^3.0.0", - "strip-ansi": "^6.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/string-width-cjs/node_modules/ansi-regex": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", - "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", - "engines": { - "node": ">=8" - } - }, - "node_modules/string-width-cjs/node_modules/emoji-regex": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", - "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" - }, - "node_modules/string-width-cjs/node_modules/strip-ansi": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", - "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", - "dependencies": { - "ansi-regex": "^5.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/strip-ansi": { - "version": "7.1.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", - "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", - "dependencies": { - "ansi-regex": "^6.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/strip-ansi?sponsor=1" - } - }, - "node_modules/strip-ansi-cjs": { - "name": "strip-ansi", - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", - "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", - "dependencies": { - "ansi-regex": "^5.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/strip-ansi-cjs/node_modules/ansi-regex": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", - "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", - "engines": { - "node": ">=8" - } - }, - "node_modules/sucrase": { - "version": "3.35.0", - "resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.35.0.tgz", - "integrity": "sha512-8EbVDiu9iN/nESwxeSxDKe0dunta1GOlHufmSSXxMD2z2/tMZpDMpvXQGsc+ajGo8y2uYUmixaSRUc/QPoQ0GA==", - "dependencies": { - "@jridgewell/gen-mapping": "^0.3.2", - "commander": "^4.0.0", - "glob": "^10.3.10", - "lines-and-columns": "^1.1.6", - "mz": "^2.7.0", - "pirates": "^4.0.1", - "ts-interface-checker": "^0.1.9" - }, - "bin": { - "sucrase": "bin/sucrase", - "sucrase-node": "bin/sucrase-node" - }, - "engines": { - "node": ">=16 || 14 >=14.17" - } - }, - "node_modules/supports-color": { - "version": "5.5.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", - "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", - "dev": true, - "dependencies": { - "has-flag": "^3.0.0" - }, - "engines": { - "node": ">=4" - } - }, - "node_modules/supports-preserve-symlinks-flag": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz", - "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==", - "engines": { - "node": ">= 0.4" - }, - "funding": { - "url": "https://github.com/sponsors/ljharb" - } - }, - "node_modules/tailwindcss": { - "version": "3.4.10", - "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-3.4.10.tgz", - "integrity": "sha512-KWZkVPm7yJRhdu4SRSl9d4AK2wM3a50UsvgHZO7xY77NQr2V+fIrEuoDGQcbvswWvFGbS2f6e+jC/6WJm1Dl0w==", - "dependencies": { - "@alloc/quick-lru": "^5.2.0", - "arg": "^5.0.2", - "chokidar": "^3.5.3", - "didyoumean": "^1.2.2", - "dlv": "^1.1.3", - "fast-glob": "^3.3.0", - "glob-parent": "^6.0.2", - "is-glob": "^4.0.3", - "jiti": "^1.21.0", - "lilconfig": "^2.1.0", - "micromatch": "^4.0.5", - "normalize-path": "^3.0.0", - "object-hash": "^3.0.0", - "picocolors": "^1.0.0", - "postcss": "^8.4.23", - "postcss-import": "^15.1.0", - "postcss-js": "^4.0.1", - "postcss-load-config": "^4.0.1", - "postcss-nested": "^6.0.1", - "postcss-selector-parser": "^6.0.11", - "resolve": "^1.22.2", - "sucrase": "^3.32.0" - }, - "bin": { - "tailwind": "lib/cli.js", - "tailwindcss": "lib/cli.js" - }, - "engines": { - "node": ">=14.0.0" - } - }, - "node_modules/tailwindcss-spring": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/tailwindcss-spring/-/tailwindcss-spring-1.0.1.tgz", - "integrity": "sha512-v8ibKyVCgbFcHzP9EFSbsvR0vH7Vk2Skl9JnJ9HUrnA16NhjvI4SlV9Y4SkinL+4bNrm1XpftZwX1DAD1mNZFA==", - "peerDependencies": { - "tailwindcss": ">=3.0.0 || insiders" - } - }, - "node_modules/thenify": { - "version": "3.3.1", - "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz", - "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==", - "dependencies": { - "any-promise": "^1.0.0" - } - }, - "node_modules/thenify-all": { - "version": "1.6.0", - "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz", - "integrity": "sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==", - "dependencies": { - "thenify": ">= 3.1.0 < 4" - }, - "engines": { - "node": ">=0.8" - } - }, - "node_modules/to-fast-properties": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", - "integrity": "sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog==", - "dev": true, - "engines": { - "node": ">=4" - } - }, - "node_modules/to-regex-range": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", - "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", - "dependencies": { - "is-number": "^7.0.0" - }, - "engines": { - "node": ">=8.0" - } - }, - "node_modules/ts-interface-checker": { - "version": "0.1.13", - "resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz", - "integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==" - }, - "node_modules/tweakpane": { - "version": "4.0.4", - "resolved": "https://registry.npmjs.org/tweakpane/-/tweakpane-4.0.4.tgz", - "integrity": "sha512-RkWD54zDlEbnN01wQPk0ANHGbdCvlJx/E8A1QxhTfCbX+ROWos1Ws2MnhOm39aUGMOh+36TjUwpDmLfmwTr1Fg==", - "funding": { - "url": "https://github.com/sponsors/cocopon" - } - }, - "node_modules/typescript": { - "version": "5.5.4", - "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.5.4.tgz", - "integrity": "sha512-Mtq29sKDAEYP7aljRgtPOpTvOfbwRWlS6dPRzwjdE+C0R4brX/GUyhHSecbHMFLNBLcJIPt9nl9yG5TZ1weH+Q==", - "dev": true, - "bin": { - "tsc": "bin/tsc", - "tsserver": "bin/tsserver" - }, - "engines": { - "node": ">=14.17" - } - }, - "node_modules/update-browserslist-db": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.1.0.tgz", - "integrity": "sha512-EdRAaAyk2cUE1wOf2DkEhzxqOQvFOoRJFNS6NeyJ01Gp2beMRpBAINjM2iDXE3KCuKhwnvHIQCJm6ThL2Z+HzQ==", - "dev": true, - "funding": [ - { - "type": "opencollective", - "url": "https://opencollective.com/browserslist" - }, - { - "type": "tidelift", - "url": "https://tidelift.com/funding/github/npm/browserslist" - }, - { - "type": "github", - "url": "https://github.com/sponsors/ai" - } - ], - "dependencies": { - "escalade": "^3.1.2", - "picocolors": "^1.0.1" - }, - "bin": { - "update-browserslist-db": "cli.js" - }, - "peerDependencies": { - "browserslist": ">= 4.21.0" - } - }, - "node_modules/util-deprecate": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", - "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==" - }, - "node_modules/validate-html-nesting": { - "version": "1.2.2", - "resolved": "https://registry.npmjs.org/validate-html-nesting/-/validate-html-nesting-1.2.2.tgz", - "integrity": "sha512-hGdgQozCsQJMyfK5urgFcWEqsSSrK63Awe0t/IMR0bZ0QMtnuaiHzThW81guu3qx9abLi99NEuiaN6P9gVYsNg==", - "dev": true - }, - "node_modules/vite": { - "version": "5.4.1", - "resolved": "https://registry.npmjs.org/vite/-/vite-5.4.1.tgz", - "integrity": "sha512-1oE6yuNXssjrZdblI9AfBbHCC41nnyoVoEZxQnID6yvQZAFBzxxkqoFLtHUMkYunL8hwOLEjgTuxpkRxvba3kA==", - "dev": true, - "dependencies": { - "esbuild": "^0.21.3", - "postcss": "^8.4.41", - "rollup": "^4.13.0" - }, - "bin": { - "vite": "bin/vite.js" - }, - "engines": { - "node": "^18.0.0 || >=20.0.0" - }, - "funding": { - "url": "https://github.com/vitejs/vite?sponsor=1" - }, - "optionalDependencies": { - "fsevents": "~2.3.3" - }, - "peerDependencies": { - "@types/node": "^18.0.0 || >=20.0.0", - "less": "*", - "lightningcss": "^1.21.0", - "sass": "*", - "sass-embedded": "*", - "stylus": "*", - "sugarss": "*", - "terser": "^5.4.0" - }, - "peerDependenciesMeta": { - "@types/node": { - "optional": true - }, - "less": { - "optional": true - }, - "lightningcss": { - "optional": true - }, - "sass": { - "optional": true - }, - "sass-embedded": { - "optional": true - }, - "stylus": { - "optional": true - }, - "sugarss": { - "optional": true - }, - "terser": { - "optional": true - } - } - }, - "node_modules/vite-plugin-solid": { - "version": "2.10.2", - "resolved": "https://registry.npmjs.org/vite-plugin-solid/-/vite-plugin-solid-2.10.2.tgz", - "integrity": "sha512-AOEtwMe2baBSXMXdo+BUwECC8IFHcKS6WQV/1NEd+Q7vHPap5fmIhLcAzr+DUJ04/KHx/1UBU0l1/GWP+rMAPQ==", - "dev": true, - "dependencies": { - "@babel/core": "^7.23.3", - "@types/babel__core": "^7.20.4", - "babel-preset-solid": "^1.8.4", - "merge-anything": "^5.1.7", - "solid-refresh": "^0.6.3", - "vitefu": "^0.2.5" - }, - "peerDependencies": { - "@testing-library/jest-dom": "^5.16.6 || ^5.17.0 || ^6.*", - "solid-js": "^1.7.2", - "vite": "^3.0.0 || ^4.0.0 || ^5.0.0" - }, - "peerDependenciesMeta": { - "@testing-library/jest-dom": { - "optional": true - } - } - }, - "node_modules/vitefu": { - "version": "0.2.5", - "resolved": "https://registry.npmjs.org/vitefu/-/vitefu-0.2.5.tgz", - "integrity": "sha512-SgHtMLoqaeeGnd2evZ849ZbACbnwQCIwRH57t18FxcXoZop0uQu0uzlIhJBlF/eWVzuce0sHeqPcDo+evVcg8Q==", - "dev": true, - "peerDependencies": { - "vite": "^3.0.0 || ^4.0.0 || ^5.0.0" - }, - "peerDependenciesMeta": { - "vite": { - "optional": true + "name": "vite-template-solid", + "version": "0.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "vite-template-solid", + "version": "0.0.0", + "license": "MIT", + "dependencies": { + "@tweakpane/plugin-camerakit": "^0.3.0", + "debounce": "^2.1.0", + "deep-object-diff": "^1.1.9", + "kampos": "^0.9.1", + "lz-string": "^1.5.0", + "solid-js": "^1.8.11", + "stats.js": "^0.17.0", + "tailwindcss-spring": "^1.0.1", + "tweakpane": "^4.0.4" + }, + "devDependencies": { + "@tweakpane/core": "^2.0.4", + "@types/stats.js": "^0.17.3", + "autoprefixer": "^10.4.17", + "postcss": "^8.4.33", + "solid-devtools": "^0.29.2", + "tailwindcss": "^3.4.1", + "typescript": "^5.3.3", + "vite": "^5.0.11", + "vite-plugin-solid": "^2.8.2" + } + }, + "node_modules/@alloc/quick-lru": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@alloc/quick-lru/-/quick-lru-5.2.0.tgz", + "integrity": "sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==", + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@ampproject/remapping": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/@ampproject/remapping/-/remapping-2.3.0.tgz", + "integrity": "sha512-30iZtAPgz+LTIYoeivqYo853f02jBYSd5uGnGpkFV0M3xOt9aN73erkgYAmZU43x4VfqcnLxW9Kpg3R5LC4YYw==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.24" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/code-frame": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.24.7.tgz", + "integrity": "sha512-BcYH1CVJBO9tvyIZ2jVeXgSIMvGZ2FDRvDdOIVQyuklNKSsx+eppDEBq/g47Ayw+RqNFE+URvOShmf+f/qwAlA==", + "dev": true, + "dependencies": { + "@babel/highlight": "^7.24.7", + "picocolors": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/compat-data": { + "version": "7.25.2", + "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.25.2.tgz", + "integrity": "sha512-bYcppcpKBvX4znYaPEeFau03bp89ShqNMLs+rmdptMw+heSZh9+z84d2YG+K7cYLbWwzdjtDoW/uqZmPjulClQ==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/core": { + "version": "7.25.2", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.25.2.tgz", + "integrity": "sha512-BBt3opiCOxUr9euZ5/ro/Xv8/V7yJ5bjYMqG/C1YAo8MIKAnumZalCN+msbci3Pigy4lIQfPUpfMM27HMGaYEA==", + "dev": true, + "dependencies": { + "@ampproject/remapping": "^2.2.0", + "@babel/code-frame": "^7.24.7", + "@babel/generator": "^7.25.0", + "@babel/helper-compilation-targets": "^7.25.2", + "@babel/helper-module-transforms": "^7.25.2", + "@babel/helpers": "^7.25.0", + "@babel/parser": "^7.25.0", + "@babel/template": "^7.25.0", + "@babel/traverse": "^7.25.2", + "@babel/types": "^7.25.2", + "convert-source-map": "^2.0.0", + "debug": "^4.1.0", + "gensync": "^1.0.0-beta.2", + "json5": "^2.2.3", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/babel" + } + }, + "node_modules/@babel/generator": { + "version": "7.25.0", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.25.0.tgz", + "integrity": "sha512-3LEEcj3PVW8pW2R1SR1M89g/qrYk/m/mB/tLqn7dn4sbBUQyTqnlod+II2U4dqiGtUmkcnAmkMDralTFZttRiw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.25.0", + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.25", + "jsesc": "^2.5.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-compilation-targets": { + "version": "7.25.2", + "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.25.2.tgz", + "integrity": "sha512-U2U5LsSaZ7TAt3cfaymQ8WHh0pxvdHoEk6HVpaexxixjyEquMh0L0YNJNM6CTGKMXV1iksi0iZkGw4AcFkPaaw==", + "dev": true, + "dependencies": { + "@babel/compat-data": "^7.25.2", + "@babel/helper-validator-option": "^7.24.8", + "browserslist": "^4.23.1", + "lru-cache": "^5.1.1", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-imports": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.24.7.tgz", + "integrity": "sha512-8AyH3C+74cgCVVXow/myrynrAGv+nTVg5vKu2nZph9x7RcRwzmh0VFallJuFTZ9mx6u4eSdXZfcOzSqTUm0HCA==", + "dev": true, + "dependencies": { + "@babel/traverse": "^7.24.7", + "@babel/types": "^7.24.7" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-transforms": { + "version": "7.25.2", + "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.25.2.tgz", + "integrity": "sha512-BjyRAbix6j/wv83ftcVJmBt72QtHI56C7JXZoG2xATiLpmoC7dpd8WnkikExHDVPpi/3qCmO6WY1EaXOluiecQ==", + "dev": true, + "dependencies": { + "@babel/helper-module-imports": "^7.24.7", + "@babel/helper-simple-access": "^7.24.7", + "@babel/helper-validator-identifier": "^7.24.7", + "@babel/traverse": "^7.25.2" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/@babel/helper-plugin-utils": { + "version": "7.24.8", + "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.24.8.tgz", + "integrity": "sha512-FFWx5142D8h2Mgr/iPVGH5G7w6jDn4jUSpZTyDnQO0Yn7Ks2Kuz6Pci8H6MPCoUJegd/UZQ3tAvfLCxQSnWWwg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-simple-access": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.24.7.tgz", + "integrity": "sha512-zBAIvbCMh5Ts+b86r/CjU+4XGYIs+R1j951gxI3KmmxBMhCg4oQMsv6ZXQ64XOm/cvzfU1FmoCyt6+owc5QMYg==", + "dev": true, + "dependencies": { + "@babel/traverse": "^7.24.7", + "@babel/types": "^7.24.7" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-string-parser": { + "version": "7.24.8", + "resolved": "https://registry.npmjs.org/@babel/helper-string-parser/-/helper-string-parser-7.24.8.tgz", + "integrity": "sha512-pO9KhhRcuUyGnJWwyEgnRJTSIZHiT+vMD0kPeD+so0l7mxkMT19g3pjY9GTnHySck/hDzq+dtW/4VgnMkippsQ==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-identifier": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.24.7.tgz", + "integrity": "sha512-rR+PBcQ1SMQDDyF6X0wxtG8QyLCgUB0eRAGguqRLfkCA87l7yAP7ehq8SNj96OOGTO8OBV70KhuFYcIkHXOg0w==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-option": { + "version": "7.24.8", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.24.8.tgz", + "integrity": "sha512-xb8t9tD1MHLungh/AIoWYN+gVHaB9kwlu8gffXGSt3FFEIT7RjS+xWbc2vUD1UTZdIpKj/ab3rdqJ7ufngyi2Q==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helpers": { + "version": "7.25.0", + "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.25.0.tgz", + "integrity": "sha512-MjgLZ42aCm0oGjJj8CtSM3DB8NOOf8h2l7DCTePJs29u+v7yO/RBX9nShlKMgFnRks/Q4tBAe7Hxnov9VkGwLw==", + "dev": true, + "dependencies": { + "@babel/template": "^7.25.0", + "@babel/types": "^7.25.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/highlight": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.24.7.tgz", + "integrity": "sha512-EStJpq4OuY8xYfhGVXngigBJRWxftKX9ksiGDnmlY3o7B/V7KIAc9X4oiK87uPJSc/vs5L869bem5fhZa8caZw==", + "dev": true, + "dependencies": { + "@babel/helper-validator-identifier": "^7.24.7", + "chalk": "^2.4.2", + "js-tokens": "^4.0.0", + "picocolors": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/parser": { + "version": "7.25.3", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.25.3.tgz", + "integrity": "sha512-iLTJKDbJ4hMvFPgQwwsVoxtHyWpKKPBrxkANrSYewDPaPpT5py5yeVkgPIJ7XYXhndxJpaA3PyALSXQ7u8e/Dw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.25.2" + }, + "bin": { + "parser": "bin/babel-parser.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/plugin-syntax-jsx": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.24.7.tgz", + "integrity": "sha512-6ddciUPe/mpMnOKv/U+RSd2vvVy+Yw/JfBB0ZHYjEZt9NLHmCUylNYlsbqCCS1Bffjlb0fCwC9Vqz+sBz6PsiQ==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.24.7" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-syntax-typescript": { + "version": "7.24.7", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.24.7.tgz", + "integrity": "sha512-c/+fVeJBB0FeKsFvwytYiUD+LBvhHjGSI0g446PRGdSVGZLRNArBUno2PETbAly3tpiNAQR5XaZ+JslxkotsbA==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.24.7" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/template": { + "version": "7.25.0", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.25.0.tgz", + "integrity": "sha512-aOOgh1/5XzKvg1jvVz7AVrx2piJ2XBi227DHmbY6y+bM9H2FlN+IfecYu4Xl0cNiiVejlsCri89LUsbj8vJD9Q==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.24.7", + "@babel/parser": "^7.25.0", + "@babel/types": "^7.25.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/traverse": { + "version": "7.25.3", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.25.3.tgz", + "integrity": "sha512-HefgyP1x754oGCsKmV5reSmtV7IXj/kpaE1XYY+D9G5PvKKoFfSbiS4M77MdjuwlZKDIKFCffq9rPU+H/s3ZdQ==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.24.7", + "@babel/generator": "^7.25.0", + "@babel/parser": "^7.25.3", + "@babel/template": "^7.25.0", + "@babel/types": "^7.25.2", + "debug": "^4.3.1", + "globals": "^11.1.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/types": { + "version": "7.25.2", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.25.2.tgz", + "integrity": "sha512-YTnYtra7W9e6/oAZEHj0bJehPRUlLH9/fbpT5LfB0NhQXyALCRkRs3zH9v07IYhkgpqX6Z78FnuccZr/l4Fs4Q==", + "dev": true, + "dependencies": { + "@babel/helper-string-parser": "^7.24.8", + "@babel/helper-validator-identifier": "^7.24.7", + "to-fast-properties": "^2.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@esbuild/aix-ppc64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.21.5.tgz", + "integrity": "sha512-1SDgH6ZSPTlggy1yI6+Dbkiz8xzpHJEVAlF/AM1tHPLsf5STom9rwtjE4hKAF20FfXXNTFqEYXyJNWh1GiZedQ==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "aix" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.21.5.tgz", + "integrity": "sha512-vCPvzSjpPHEi1siZdlvAlsPxXl7WbOVUBBAowWug4rJHb68Ox8KualB+1ocNvT5fjv6wpkX6o/iEpbDrf68zcg==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.21.5.tgz", + "integrity": "sha512-c0uX9VAUBQ7dTDCjq+wdyGLowMdtR/GoC2U5IYk/7D1H1JYC0qseD7+11iMP2mRLN9RcCMRcjC4YMclCzGwS/A==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.21.5.tgz", + "integrity": "sha512-D7aPRUUNHRBwHxzxRvp856rjUHRFW1SdQATKXH2hqA0kAZb1hKmi02OpYRacl0TxIGz/ZmXWlbZgjwWYaCakTA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.21.5.tgz", + "integrity": "sha512-DwqXqZyuk5AiWWf3UfLiRDJ5EDd49zg6O9wclZ7kUMv2WRFr4HKjXp/5t8JZ11QbQfUS6/cRCKGwYhtNAY88kQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.21.5.tgz", + "integrity": "sha512-se/JjF8NlmKVG4kNIuyWMV/22ZaerB+qaSi5MdrXtd6R08kvs2qCN4C09miupktDitvh8jRFflwGFBQcxZRjbw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.21.5.tgz", + "integrity": "sha512-5JcRxxRDUJLX8JXp/wcBCy3pENnCgBR9bN6JsY4OmhfUtIHe3ZW0mawA7+RDAcMLrMIZaf03NlQiX9DGyB8h4g==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.21.5.tgz", + "integrity": "sha512-J95kNBj1zkbMXtHVH29bBriQygMXqoVQOQYA+ISs0/2l3T9/kj42ow2mpqerRBxDJnmkUDCaQT/dfNXWX/ZZCQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.21.5.tgz", + "integrity": "sha512-bPb5AHZtbeNGjCKVZ9UGqGwo8EUu4cLq68E95A53KlxAPRmUyYv2D6F0uUI65XisGOL1hBP5mTronbgo+0bFcA==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.21.5.tgz", + "integrity": "sha512-ibKvmyYzKsBeX8d8I7MH/TMfWDXBF3db4qM6sy+7re0YXya+K1cem3on9XgdT2EQGMu4hQyZhan7TeQ8XkGp4Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.21.5.tgz", + "integrity": "sha512-YvjXDqLRqPDl2dvRODYmmhz4rPeVKYvppfGYKSNGdyZkA01046pLWyRKKI3ax8fbJoK5QbxblURkwK/MWY18Tg==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.21.5.tgz", + "integrity": "sha512-uHf1BmMG8qEvzdrzAqg2SIG/02+4/DHB6a9Kbya0XDvwDEKCoC8ZRWI5JJvNdUjtciBGFQ5PuBlpEOXQj+JQSg==", + "cpu": [ + "loong64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.21.5.tgz", + "integrity": "sha512-IajOmO+KJK23bj52dFSNCMsz1QP1DqM6cwLUv3W1QwyxkyIWecfafnI555fvSGqEKwjMXVLokcV5ygHW5b3Jbg==", + "cpu": [ + "mips64el" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.21.5.tgz", + "integrity": "sha512-1hHV/Z4OEfMwpLO8rp7CvlhBDnjsC3CttJXIhBi+5Aj5r+MBvy4egg7wCbe//hSsT+RvDAG7s81tAvpL2XAE4w==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.21.5.tgz", + "integrity": "sha512-2HdXDMd9GMgTGrPWnJzP2ALSokE/0O5HhTUvWIbD3YdjME8JwvSCnNGBnTThKGEB91OZhzrJ4qIIxk/SBmyDDA==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.21.5.tgz", + "integrity": "sha512-zus5sxzqBJD3eXxwvjN1yQkRepANgxE9lgOW2qLnmr8ikMTphkjgXu1HR01K4FJg8h1kEEDAqDcZQtbrRnB41A==", + "cpu": [ + "s390x" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.21.5.tgz", + "integrity": "sha512-1rYdTpyv03iycF1+BhzrzQJCdOuAOtaqHTWJZCWvijKD2N5Xu0TtVC8/+1faWqcP9iBCWOmjmhoH94dH82BxPQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.21.5.tgz", + "integrity": "sha512-Woi2MXzXjMULccIwMnLciyZH4nCIMpWQAs049KEeMvOcNADVxo0UBIQPfSmxB3CWKedngg7sWZdLvLczpe0tLg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.21.5.tgz", + "integrity": "sha512-HLNNw99xsvx12lFBUwoT8EVCsSvRNDVxNpjZ7bPn947b8gJPzeHWyNVhFsaerc0n3TsbOINvRP2byTZ5LKezow==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.21.5.tgz", + "integrity": "sha512-6+gjmFpfy0BHU5Tpptkuh8+uw3mnrvgs+dSPQXQOv3ekbordwnzTVEb4qnIvQcYXq6gzkyTnoZ9dZG+D4garKg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.21.5.tgz", + "integrity": "sha512-Z0gOTd75VvXqyq7nsl93zwahcTROgqvuAcYDUr+vOv8uHhNSKROyU961kgtCD1e95IqPKSQKH7tBTslnS3tA8A==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.21.5.tgz", + "integrity": "sha512-SWXFF1CL2RVNMaVs+BBClwtfZSvDgtL//G/smwAc5oVK/UPu2Gu9tIaRgFmYFFKrmg3SyAjSrElf0TiJ1v8fYA==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.21.5.tgz", + "integrity": "sha512-tQd/1efJuzPC6rCFwEvLtci/xNFcTZknmXs98FYDfGE4wP9ClFV98nyKrzJKVPMhdDnjzLhdUyMX4PsQAPjwIw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@isaacs/cliui": { + "version": "8.0.2", + "resolved": "https://registry.npmjs.org/@isaacs/cliui/-/cliui-8.0.2.tgz", + "integrity": "sha512-O8jcjabXaleOG9DQ0+ARXWZBTfnP4WNAqzuiJK7ll44AmxGKv/J2M4TPjxjY3znBCfvBXFzucm1twdyFybFqEA==", + "dependencies": { + "string-width": "^5.1.2", + "string-width-cjs": "npm:string-width@^4.2.0", + "strip-ansi": "^7.0.1", + "strip-ansi-cjs": "npm:strip-ansi@^6.0.1", + "wrap-ansi": "^8.1.0", + "wrap-ansi-cjs": "npm:wrap-ansi@^7.0.0" + }, + "engines": { + "node": ">=12" + } + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.5", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz", + "integrity": "sha512-IzL8ZoEDIBRWEzlCcRhOaCupYyN5gdIK+Q6fbFdPDg6HqX6jpkItn7DFIpW9LQzXG6Df9sA7+OKnq0qlz/GaQg==", + "dependencies": { + "@jridgewell/set-array": "^1.2.1", + "@jridgewell/sourcemap-codec": "^1.4.10", + "@jridgewell/trace-mapping": "^0.3.24" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz", + "integrity": "sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/set-array": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.2.1.tgz", + "integrity": "sha512-R8gLRTZeyp03ymzP/6Lil/28tGeGEzhx1q2k703KGWRAI1VdvPIXdG70VJc2pAMw3NA6JKL5hhFu1sJX0Mnn/A==", + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.0.tgz", + "integrity": "sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==" + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.25", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz", + "integrity": "sha512-vNk6aEwybGtawWmy/PzwnGDOjCkLWSD2wqvjGGAgOAwCGWySYXfYoxt00IJkTF+8Lb57DwOb3Aa0o9CApepiYQ==", + "dependencies": { + "@jridgewell/resolve-uri": "^3.1.0", + "@jridgewell/sourcemap-codec": "^1.4.14" + } + }, + "node_modules/@nodelib/fs.scandir": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", + "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", + "dependencies": { + "@nodelib/fs.stat": "2.0.5", + "run-parallel": "^1.1.9" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.stat": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", + "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.walk": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", + "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", + "dependencies": { + "@nodelib/fs.scandir": "2.1.5", + "fastq": "^1.6.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nothing-but/utils": { + "version": "0.12.1", + "resolved": "https://registry.npmjs.org/@nothing-but/utils/-/utils-0.12.1.tgz", + "integrity": "sha512-1qZU1Q5El0IjE7JT/ucvJNzdr2hL3W8Rm27xNf1p6gb3Nw8pGnZmxp6/GEW9h+I1k1cICxXNq25hBwknTQ7yhg==", + "dev": true + }, + "node_modules/@pkgjs/parseargs": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/@pkgjs/parseargs/-/parseargs-0.11.0.tgz", + "integrity": "sha512-+1VkjdD0QBLPodGrJUeqarH8VAIvQODIbwh9XpP5Syisf7YoQgsJKPNFoqqLQlu+VQ/tVSshMR6loPMn8U+dPg==", + "optional": true, + "engines": { + "node": ">=14" + } + }, + "node_modules/@rollup/rollup-android-arm-eabi": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.20.0.tgz", + "integrity": "sha512-TSpWzflCc4VGAUJZlPpgAJE1+V60MePDQnBd7PPkpuEmOy8i87aL6tinFGKBFKuEDikYpig72QzdT3QPYIi+oA==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-android-arm64": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.20.0.tgz", + "integrity": "sha512-u00Ro/nok7oGzVuh/FMYfNoGqxU5CPWz1mxV85S2w9LxHR8OoMQBuSk+3BKVIDYgkpeOET5yXkx90OYFc+ytpQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-darwin-arm64": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.20.0.tgz", + "integrity": "sha512-uFVfvzvsdGtlSLuL0ZlvPJvl6ZmrH4CBwLGEFPe7hUmf7htGAN+aXo43R/V6LATyxlKVC/m6UsLb7jbG+LG39Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-darwin-x64": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.20.0.tgz", + "integrity": "sha512-xbrMDdlev53vNXexEa6l0LffojxhqDTBeL+VUxuuIXys4x6xyvbKq5XqTXBCEUA8ty8iEJblHvFaWRJTk/icAQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-linux-arm-gnueabihf": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.20.0.tgz", + "integrity": "sha512-jMYvxZwGmoHFBTbr12Xc6wOdc2xA5tF5F2q6t7Rcfab68TT0n+r7dgawD4qhPEvasDsVpQi+MgDzj2faOLsZjA==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm-musleabihf": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.20.0.tgz", + "integrity": "sha512-1asSTl4HKuIHIB1GcdFHNNZhxAYEdqML/MW4QmPS4G0ivbEcBr1JKlFLKsIRqjSwOBkdItn3/ZDlyvZ/N6KPlw==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-gnu": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.20.0.tgz", + "integrity": "sha512-COBb8Bkx56KldOYJfMf6wKeYJrtJ9vEgBRAOkfw6Ens0tnmzPqvlpjZiLgkhg6cA3DGzCmLmmd319pmHvKWWlQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-musl": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.20.0.tgz", + "integrity": "sha512-+it+mBSyMslVQa8wSPvBx53fYuZK/oLTu5RJoXogjk6x7Q7sz1GNRsXWjn6SwyJm8E/oMjNVwPhmNdIjwP135Q==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-powerpc64le-gnu": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.20.0.tgz", + "integrity": "sha512-yAMvqhPfGKsAxHN8I4+jE0CpLWD8cv4z7CK7BMmhjDuz606Q2tFKkWRY8bHR9JQXYcoLfopo5TTqzxgPUjUMfw==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-gnu": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.20.0.tgz", + "integrity": "sha512-qmuxFpfmi/2SUkAw95TtNq/w/I7Gpjurx609OOOV7U4vhvUhBcftcmXwl3rqAek+ADBwSjIC4IVNLiszoj3dPA==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-s390x-gnu": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.20.0.tgz", + "integrity": "sha512-I0BtGXddHSHjV1mqTNkgUZLnS3WtsqebAXv11D5BZE/gfw5KoyXSAXVqyJximQXNvNzUo4GKlCK/dIwXlz+jlg==", + "cpu": [ + "s390x" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-gnu": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.20.0.tgz", + "integrity": "sha512-y+eoL2I3iphUg9tN9GB6ku1FA8kOfmF4oUEWhztDJ4KXJy1agk/9+pejOuZkNFhRwHAOxMsBPLbXPd6mJiCwew==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-musl": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.20.0.tgz", + "integrity": "sha512-hM3nhW40kBNYUkZb/r9k2FKK+/MnKglX7UYd4ZUy5DJs8/sMsIbqWK2piZtVGE3kcXVNj3B2IrUYROJMMCikNg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-win32-arm64-msvc": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.20.0.tgz", + "integrity": "sha512-psegMvP+Ik/Bg7QRJbv8w8PAytPA7Uo8fpFjXyCRHWm6Nt42L+JtoqH8eDQ5hRP7/XW2UiIriy1Z46jf0Oa1kA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-ia32-msvc": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.20.0.tgz", + "integrity": "sha512-GabekH3w4lgAJpVxkk7hUzUf2hICSQO0a/BLFA11/RMxQT92MabKAqyubzDZmMOC/hcJNlc+rrypzNzYl4Dx7A==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-x64-msvc": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.20.0.tgz", + "integrity": "sha512-aJ1EJSuTdGnM6qbVC4B5DSmozPTqIag9fSzXRNNo+humQLG89XpPgdt16Ia56ORD7s+H8Pmyx44uczDQ0yDzpg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@solid-devtools/debugger": { + "version": "0.23.4", + "resolved": "https://registry.npmjs.org/@solid-devtools/debugger/-/debugger-0.23.4.tgz", + "integrity": "sha512-EfTB1Eo313wztQYGJ4Ec/wE70Ay2d603VCXfT3RlyqO5QfLrQGRHX5NXC07hJpQTJJJ3tbNgzO7+ZKo76MM5uA==", + "dev": true, + "dependencies": { + "@nothing-but/utils": "~0.12.0", + "@solid-devtools/shared": "^0.13.2", + "@solid-primitives/bounds": "^0.0.118", + "@solid-primitives/cursor": "^0.0.112", + "@solid-primitives/event-bus": "^1.0.8", + "@solid-primitives/event-listener": "^2.3.0", + "@solid-primitives/keyboard": "^1.2.5", + "@solid-primitives/platform": "^0.1.0", + "@solid-primitives/rootless": "^1.4.2", + "@solid-primitives/scheduled": "^1.4.1", + "@solid-primitives/static-store": "^0.0.5", + "@solid-primitives/utils": "^6.2.1" + }, + "peerDependencies": { + "solid-js": "^1.8.0" + } + }, + "node_modules/@solid-devtools/shared": { + "version": "0.13.2", + "resolved": "https://registry.npmjs.org/@solid-devtools/shared/-/shared-0.13.2.tgz", + "integrity": "sha512-Y4uaC4EfTVwBR537MZwfaY/eiWAh+hW4mbtnwNuUw/LFmitHSkQhNQTUlLQv/S0chtwrYWQBxvXos1dC7e8R9g==", + "dev": true, + "dependencies": { + "@solid-primitives/event-bus": "^1.0.8", + "@solid-primitives/event-listener": "^2.3.0", + "@solid-primitives/media": "^2.2.5", + "@solid-primitives/refs": "^1.0.5", + "@solid-primitives/rootless": "^1.4.2", + "@solid-primitives/scheduled": "^1.4.1", + "@solid-primitives/static-store": "^0.0.5", + "@solid-primitives/styles": "^0.0.111", + "@solid-primitives/utils": "^6.2.1" + }, + "peerDependencies": { + "solid-js": "^1.8.0" + } + }, + "node_modules/@solid-primitives/bounds": { + "version": "0.0.118", + "resolved": "https://registry.npmjs.org/@solid-primitives/bounds/-/bounds-0.0.118.tgz", + "integrity": "sha512-Qj42w8LlnhJ3r/t+t0c0vrdwIvvQMPgjEFGmLiwREaA85ojLbgL9lSBq2tKvljeLCvRVkgj10KEUf+vc99VCIg==", + "dev": true, + "dependencies": { + "@solid-primitives/event-listener": "^2.3.0", + "@solid-primitives/resize-observer": "^2.0.22", + "@solid-primitives/static-store": "^0.0.5", + "@solid-primitives/utils": "^6.2.1" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/cursor": { + "version": "0.0.112", + "resolved": "https://registry.npmjs.org/@solid-primitives/cursor/-/cursor-0.0.112.tgz", + "integrity": "sha512-TAtU7qD7ipSLSXHnq8FhhosAPVX+dnOCb/ITcGcLlj8e/C9YKcxDhgBHJ3R/d1xDRb5/vO/szJtEz6fnQD311Q==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.1" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/event-bus": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/@solid-primitives/event-bus/-/event-bus-1.0.11.tgz", + "integrity": "sha512-bSwVA4aI2aNHomSbEroUnisMSyDDXJbrw4U8kFEvrcYdlLrJX5i6QeCFx+vj/zdQQw62KAllrEIyWP8KMpPVnQ==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/event-listener": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/@solid-primitives/event-listener/-/event-listener-2.3.3.tgz", + "integrity": "sha512-DAJbl+F0wrFW2xmcV8dKMBhk9QLVLuBSW+TR4JmIfTaObxd13PuL7nqaXnaYKDWOYa6otB00qcCUIGbuIhSUgQ==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/keyboard": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/@solid-primitives/keyboard/-/keyboard-1.2.8.tgz", + "integrity": "sha512-pJtcbkjozS6L1xvTht9rPpyPpX55nAkfBzbFWdf3y0Suwh6qClTibvvObzKOf7uzQ+8aZRDH4LsoGmbTKXtJjQ==", + "dev": true, + "dependencies": { + "@solid-primitives/event-listener": "^2.3.3", + "@solid-primitives/rootless": "^1.4.5", + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/media": { + "version": "2.2.9", + "resolved": "https://registry.npmjs.org/@solid-primitives/media/-/media-2.2.9.tgz", + "integrity": "sha512-QUmU62D4/d9YWx/4Dvr/UZasIkIpqNXz7wosA5GLmesRW9XlPa3G5M6uOmTw73SByHNTCw0D6x8bSdtvvLgzvQ==", + "dev": true, + "dependencies": { + "@solid-primitives/event-listener": "^2.3.3", + "@solid-primitives/rootless": "^1.4.5", + "@solid-primitives/static-store": "^0.0.8", + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/media/node_modules/@solid-primitives/static-store": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/@solid-primitives/static-store/-/static-store-0.0.8.tgz", + "integrity": "sha512-ZecE4BqY0oBk0YG00nzaAWO5Mjcny8Fc06CdbXadH9T9lzq/9GefqcSe/5AtdXqjvY/DtJ5C6CkcjPZO0o/eqg==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/platform": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/@solid-primitives/platform/-/platform-0.1.2.tgz", + "integrity": "sha512-sSxcZfuUrtxcwV0vdjmGnZQcflACzMfLriVeIIWXKp8hzaS3Or3tO6EFQkTd3L8T5dTq+kTtLvPscXIpL0Wzdg==", + "dev": true, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/refs": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/@solid-primitives/refs/-/refs-1.0.8.tgz", + "integrity": "sha512-+jIsWG8/nYvhaCoG2Vg6CJOLgTmPKFbaCrNQKWfChalgUf9WrVxWw0CdJb3yX15n5lUcQ0jBo6qYtuVVmBLpBw==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/resize-observer": { + "version": "2.0.26", + "resolved": "https://registry.npmjs.org/@solid-primitives/resize-observer/-/resize-observer-2.0.26.tgz", + "integrity": "sha512-KbPhwal6ML9OHeUTZszBbt6PYSMj89d4wVCLxlvDYL4U0+p+xlCEaqz6v9dkCwm/0Lb+Wed7W5T1dQZCP3JUUw==", + "dev": true, + "dependencies": { + "@solid-primitives/event-listener": "^2.3.3", + "@solid-primitives/rootless": "^1.4.5", + "@solid-primitives/static-store": "^0.0.8", + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/resize-observer/node_modules/@solid-primitives/static-store": { + "version": "0.0.8", + "resolved": "https://registry.npmjs.org/@solid-primitives/static-store/-/static-store-0.0.8.tgz", + "integrity": "sha512-ZecE4BqY0oBk0YG00nzaAWO5Mjcny8Fc06CdbXadH9T9lzq/9GefqcSe/5AtdXqjvY/DtJ5C6CkcjPZO0o/eqg==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/rootless": { + "version": "1.4.5", + "resolved": "https://registry.npmjs.org/@solid-primitives/rootless/-/rootless-1.4.5.tgz", + "integrity": "sha512-GFJE9GC3ojx0aUKqAUZmQPyU8fOVMtnVNrkdk2yS4kd17WqVSpXpoTmo9CnOwA+PG7FTzdIkogvfLQSLs4lrww==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.3" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/scheduled": { + "version": "1.4.3", + "resolved": "https://registry.npmjs.org/@solid-primitives/scheduled/-/scheduled-1.4.3.tgz", + "integrity": "sha512-HfWN5w7b7FEc6VPLBKnnE302h90jsLMuR28Fcf7neRGGf8jBj6wm6/UFQ00VlKexHFMR6KQ2u4VBh5a1ZcqM8g==", + "dev": true, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/static-store": { + "version": "0.0.5", + "resolved": "https://registry.npmjs.org/@solid-primitives/static-store/-/static-store-0.0.5.tgz", + "integrity": "sha512-ssQ+s/wrlFAEE4Zw8GV499yBfvWx7SMm+ZVc11wvao4T5xg9VfXCL9Oa+x4h+vPMvSV/Knv5LrsLiUa+wlJUXQ==", + "dev": true, + "dependencies": { + "@solid-primitives/utils": "^6.2.1" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/styles": { + "version": "0.0.111", + "resolved": "https://registry.npmjs.org/@solid-primitives/styles/-/styles-0.0.111.tgz", + "integrity": "sha512-1mBxOGAPXmfD5oYCvqjKBDN7SuNjz2qz7RdH7KtsuNLQh6lpuSKadtHnLvru0Y8Vz1InqTJisBIy/6P5kyDmPw==", + "dev": true, + "dependencies": { + "@solid-primitives/rootless": "^1.4.2", + "@solid-primitives/utils": "^6.2.1" + }, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@solid-primitives/utils": { + "version": "6.2.3", + "resolved": "https://registry.npmjs.org/@solid-primitives/utils/-/utils-6.2.3.tgz", + "integrity": "sha512-CqAwKb2T5Vi72+rhebSsqNZ9o67buYRdEJrIFzRXz3U59QqezuuxPsyzTSVCacwS5Pf109VRsgCJQoxKRoECZQ==", + "dev": true, + "peerDependencies": { + "solid-js": "^1.6.12" + } + }, + "node_modules/@tweakpane/core": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/@tweakpane/core/-/core-2.0.4.tgz", + "integrity": "sha512-0P3xcmvjBr8AmqMOEDNYIbkiaPwvQPkj8VeJX+8ZYkpRgWWbNp1HLbld0MDI0WJHdom89osH3MmCDLnWEXKI2w==", + "dev": true + }, + "node_modules/@tweakpane/plugin-camerakit": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/@tweakpane/plugin-camerakit/-/plugin-camerakit-0.3.0.tgz", + "integrity": "sha512-6UwgwDKU+oaAgXJ2D/pOoIpEAZts0RyeLmVzBJGs+VVNqSfkiHzL0i5XD+XnmSL2PaLXBne0dlz0bYOrjmeELw==", + "peerDependencies": { + "tweakpane": "^4.0.0-beta.2" + } + }, + "node_modules/@types/babel__core": { + "version": "7.20.5", + "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.20.5.tgz", + "integrity": "sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.20.7", + "@babel/types": "^7.20.7", + "@types/babel__generator": "*", + "@types/babel__template": "*", + "@types/babel__traverse": "*" + } + }, + "node_modules/@types/babel__generator": { + "version": "7.6.8", + "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.8.tgz", + "integrity": "sha512-ASsj+tpEDsEiFr1arWrlN6V3mdfjRMZt6LtK/Vp/kreFLnr5QH5+DhvD5nINYZXzwJvXeGq+05iUXcAzVrqWtw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.0.0" + } + }, + "node_modules/@types/babel__template": { + "version": "7.4.4", + "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.4.4.tgz", + "integrity": "sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.1.0", + "@babel/types": "^7.0.0" + } + }, + "node_modules/@types/babel__traverse": { + "version": "7.20.6", + "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.20.6.tgz", + "integrity": "sha512-r1bzfrm0tomOI8g1SzvCaQHo6Lcv6zu0EA+W2kHrt8dyrHQxGzBBL4kdkzIS+jBMV+EYcMAEAqXqYaLJq5rOZg==", + "dev": true, + "dependencies": { + "@babel/types": "^7.20.7" + } + }, + "node_modules/@types/estree": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.5.tgz", + "integrity": "sha512-/kYRxGDLWzHOB7q+wtSUQlFrtcdUccpfy+X+9iMBpHK8QLLhx2wIPYuS5DYtR9Wa/YlZAbIovy7qVdB1Aq6Lyw==", + "dev": true + }, + "node_modules/@types/stats.js": { + "version": "0.17.3", + "resolved": "https://registry.npmjs.org/@types/stats.js/-/stats.js-0.17.3.tgz", + "integrity": "sha512-pXNfAD3KHOdif9EQXZ9deK82HVNaXP5ZIF5RP2QG6OQFNTaY2YIetfrE9t528vEreGQvEPRDDc8muaoYeK0SxQ==", + "dev": true + }, + "node_modules/ansi-regex": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", + "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/ansi-regex?sponsor=1" + } + }, + "node_modules/ansi-styles": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "dev": true, + "dependencies": { + "color-convert": "^1.9.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/any-promise": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", + "integrity": "sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==" + }, + "node_modules/anymatch": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", + "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/arg": { + "version": "5.0.2", + "resolved": "https://registry.npmjs.org/arg/-/arg-5.0.2.tgz", + "integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==" + }, + "node_modules/autoprefixer": { + "version": "10.4.20", + "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.20.tgz", + "integrity": "sha512-XY25y5xSv/wEoqzDyXXME4AFfkZI0P23z6Fs3YgymDnKJkCGOnkL0iTxCa85UTqaSgfcqyf3UA6+c7wUvx/16g==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/autoprefixer" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "browserslist": "^4.23.3", + "caniuse-lite": "^1.0.30001646", + "fraction.js": "^4.3.7", + "normalize-range": "^0.1.2", + "picocolors": "^1.0.1", + "postcss-value-parser": "^4.2.0" + }, + "bin": { + "autoprefixer": "bin/autoprefixer" + }, + "engines": { + "node": "^10 || ^12 || >=14" + }, + "peerDependencies": { + "postcss": "^8.1.0" + } + }, + "node_modules/babel-plugin-jsx-dom-expressions": { + "version": "0.38.1", + "resolved": "https://registry.npmjs.org/babel-plugin-jsx-dom-expressions/-/babel-plugin-jsx-dom-expressions-0.38.1.tgz", + "integrity": "sha512-4FD4H69Cu4jHx2uLDEvx4YC5T/fC/Dmaafhsm8hXm7SjHYzjr09gBVyHdoFza+91f/g9e6tIzjbLCMkOXwmlew==", + "dev": true, + "dependencies": { + "@babel/helper-module-imports": "7.18.6", + "@babel/plugin-syntax-jsx": "^7.18.6", + "@babel/types": "^7.20.7", + "html-entities": "2.3.3", + "validate-html-nesting": "^1.2.1" + }, + "peerDependencies": { + "@babel/core": "^7.20.12" + } + }, + "node_modules/babel-plugin-jsx-dom-expressions/node_modules/@babel/helper-module-imports": { + "version": "7.18.6", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.18.6.tgz", + "integrity": "sha512-0NFvs3VkuSYbFi1x2Vd6tKrywq+z/cLeYC/RJNFrIX/30Bf5aiGYbtvGXolEktzJH8o5E5KJ3tT+nkxuuZFVlA==", + "dev": true, + "dependencies": { + "@babel/types": "^7.18.6" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/babel-preset-solid": { + "version": "1.8.19", + "resolved": "https://registry.npmjs.org/babel-preset-solid/-/babel-preset-solid-1.8.19.tgz", + "integrity": "sha512-F3MoUdx3i4znhStnXUBno+5kGSbvhpbGrPgqfRPrS8W7foVJUOSd1/F9QDyd9dgClHfr+J7V14931eu1PEDDMQ==", + "dev": true, + "dependencies": { + "babel-plugin-jsx-dom-expressions": "^0.38.1" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==" + }, + "node_modules/binary-extensions": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", + "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==", + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/brace-expansion": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz", + "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==", + "dependencies": { + "balanced-match": "^1.0.0" + } + }, + "node_modules/braces": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz", + "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==", + "dependencies": { + "fill-range": "^7.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/browserslist": { + "version": "4.23.3", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.23.3.tgz", + "integrity": "sha512-btwCFJVjI4YWDNfau8RhZ+B1Q/VLoUITrm3RlP6y1tYGWIOa+InuYiRGXUBXo8nA1qKmHMyLB/iVQg5TT4eFoA==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "caniuse-lite": "^1.0.30001646", + "electron-to-chromium": "^1.5.4", + "node-releases": "^2.0.18", + "update-browserslist-db": "^1.1.0" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/camelcase-css": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz", + "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001651", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001651.tgz", + "integrity": "sha512-9Cf+Xv1jJNe1xPZLGuUXLNkE1BoDkqRqYyFJ9TDYSqhduqA4hu4oR9HluGoWYQC/aj8WHjsGVV+bwkh0+tegRg==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ] + }, + "node_modules/chalk": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", + "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", + "dev": true, + "dependencies": { + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/chokidar": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz", + "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==", + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "funding": { + "url": "https://paulmillr.com/funding/" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/chokidar/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/color-convert": { + "version": "1.9.3", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "dev": true, + "dependencies": { + "color-name": "1.1.3" + } + }, + "node_modules/color-name": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==", + "dev": true + }, + "node_modules/commander": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/commander/-/commander-4.1.1.tgz", + "integrity": "sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/convert-source-map": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-2.0.0.tgz", + "integrity": "sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==", + "dev": true + }, + "node_modules/cross-spawn": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz", + "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==", + "dependencies": { + "path-key": "^3.1.0", + "shebang-command": "^2.0.0", + "which": "^2.0.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/csstype": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz", + "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw==" + }, + "node_modules/debounce": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/debounce/-/debounce-2.1.0.tgz", + "integrity": "sha512-OkL3+0pPWCqoBc/nhO9u6TIQNTK44fnBnzuVtJAbp13Naxw9R6u21x+8tVTka87AhDZ3htqZ2pSSsZl9fqL2Wg==", + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/debug": { + "version": "4.3.6", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.6.tgz", + "integrity": "sha512-O/09Bd4Z1fBrU4VzkhFqVgpPzaGbw6Sm9FEkBT1A/YBXQFGuuSxa1dN2nxgxS34JmKXqYx8CZAwEVoJFImUXIg==", + "dev": true, + "dependencies": { + "ms": "2.1.2" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/deep-object-diff": { + "version": "1.1.9", + "resolved": "https://registry.npmjs.org/deep-object-diff/-/deep-object-diff-1.1.9.tgz", + "integrity": "sha512-Rn+RuwkmkDwCi2/oXOFS9Gsr5lJZu/yTGpK7wAaAIE75CC+LCGEZHpY6VQJa/RoJcrmaA/docWJZvYohlNkWPA==" + }, + "node_modules/didyoumean": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz", + "integrity": "sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw==" + }, + "node_modules/dlv": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/dlv/-/dlv-1.1.3.tgz", + "integrity": "sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==" + }, + "node_modules/eastasianwidth": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/eastasianwidth/-/eastasianwidth-0.2.0.tgz", + "integrity": "sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==" + }, + "node_modules/electron-to-chromium": { + "version": "1.5.9", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.5.9.tgz", + "integrity": "sha512-HfkT8ndXR0SEkU8gBQQM3rz035bpE/hxkZ1YIt4KJPEFES68HfIU6LzKukH0H794Lm83WJtkSAMfEToxCs15VA==", + "dev": true + }, + "node_modules/emoji-regex": { + "version": "9.2.2", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz", + "integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==" + }, + "node_modules/esbuild": { + "version": "0.21.5", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.21.5.tgz", + "integrity": "sha512-mg3OPMV4hXywwpoDxu3Qda5xCKQi+vCTZq8S9J/EpkhB2HzKXq4SNFZE3+NK93JYxc8VMSep+lOUSC/RVKaBqw==", + "dev": true, + "hasInstallScript": true, + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=12" + }, + "optionalDependencies": { + "@esbuild/aix-ppc64": "0.21.5", + "@esbuild/android-arm": "0.21.5", + "@esbuild/android-arm64": "0.21.5", + "@esbuild/android-x64": "0.21.5", + "@esbuild/darwin-arm64": "0.21.5", + "@esbuild/darwin-x64": "0.21.5", + "@esbuild/freebsd-arm64": "0.21.5", + "@esbuild/freebsd-x64": "0.21.5", + "@esbuild/linux-arm": "0.21.5", + "@esbuild/linux-arm64": "0.21.5", + "@esbuild/linux-ia32": "0.21.5", + "@esbuild/linux-loong64": "0.21.5", + "@esbuild/linux-mips64el": "0.21.5", + "@esbuild/linux-ppc64": "0.21.5", + "@esbuild/linux-riscv64": "0.21.5", + "@esbuild/linux-s390x": "0.21.5", + "@esbuild/linux-x64": "0.21.5", + "@esbuild/netbsd-x64": "0.21.5", + "@esbuild/openbsd-x64": "0.21.5", + "@esbuild/sunos-x64": "0.21.5", + "@esbuild/win32-arm64": "0.21.5", + "@esbuild/win32-ia32": "0.21.5", + "@esbuild/win32-x64": "0.21.5" + } + }, + "node_modules/escalade": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.2.tgz", + "integrity": "sha512-ErCHMCae19vR8vQGe50xIsVomy19rg6gFu3+r3jkEO46suLMWBksvVyoGgQV+jOfl84ZSOSlmv6Gxa89PmTGmA==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/escape-string-regexp": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", + "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==", + "dev": true, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/fast-glob": { + "version": "3.3.2", + "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz", + "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==", + "dependencies": { + "@nodelib/fs.stat": "^2.0.2", + "@nodelib/fs.walk": "^1.2.3", + "glob-parent": "^5.1.2", + "merge2": "^1.3.0", + "micromatch": "^4.0.4" + }, + "engines": { + "node": ">=8.6.0" + } + }, + "node_modules/fast-glob/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/fastq": { + "version": "1.17.1", + "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.17.1.tgz", + "integrity": "sha512-sRVD3lWVIXWg6By68ZN7vho9a1pQcN/WBFaAAsDDFzlJjvoGx0P8z7V1t72grFJfJhu3YPZBuu25f7Kaw2jN1w==", + "dependencies": { + "reusify": "^1.0.4" + } + }, + "node_modules/fill-range": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz", + "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==", + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/foreground-child": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/foreground-child/-/foreground-child-3.3.0.tgz", + "integrity": "sha512-Ld2g8rrAyMYFXBhEqMz8ZAHBi4J4uS1i/CxGMDnjyFWddMXLVcDp051DZfu+t7+ab7Wv6SMqpWmyFIj5UbfFvg==", + "dependencies": { + "cross-spawn": "^7.0.0", + "signal-exit": "^4.0.1" + }, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/fraction.js": { + "version": "4.3.7", + "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-4.3.7.tgz", + "integrity": "sha512-ZsDfxO51wGAXREY55a7la9LScWpwv9RxIrYABrlvOFBlH/ShPnrtsXeuUIfXKKOVicNxQ+o8JTbJvjS4M89yew==", + "dev": true, + "engines": { + "node": "*" + }, + "funding": { + "type": "patreon", + "url": "https://github.com/sponsors/rawify" + } + }, + "node_modules/fsevents": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", + "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gensync": { + "version": "1.0.0-beta.2", + "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", + "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/glob": { + "version": "10.4.5", + "resolved": "https://registry.npmjs.org/glob/-/glob-10.4.5.tgz", + "integrity": "sha512-7Bv8RF0k6xjo7d4A/PxYLbUCfb6c+Vpd2/mB2yRDlew7Jb5hEXiCD9ibfO7wpk8i4sevK6DFny9h7EYbM3/sHg==", + "dependencies": { + "foreground-child": "^3.1.0", + "jackspeak": "^3.1.2", + "minimatch": "^9.0.4", + "minipass": "^7.1.2", + "package-json-from-dist": "^1.0.0", + "path-scurry": "^1.11.1" + }, + "bin": { + "glob": "dist/esm/bin.mjs" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/glob-parent": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", + "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", + "dependencies": { + "is-glob": "^4.0.3" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/html-entities": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-2.3.3.tgz", + "integrity": "sha512-DV5Ln36z34NNTDgnz0EWGBLZENelNAtkiFA4kyNOG2tDI6Mz1uSWiq1wAKdyjnJwyDiDO7Fa2SO1CTxPXL8VxA==", + "dev": true + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-core-module": { + "version": "2.15.0", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.15.0.tgz", + "integrity": "sha512-Dd+Lb2/zvk9SKy1TGCt1wFJFo/MWBPMX5x7KcvLajWTGuomczdQX61PvY5yK6SVACwpoexWo81IfFyoKY2QnTA==", + "dependencies": { + "hasown": "^2.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "engines": { + "node": ">=8" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/is-what": { + "version": "4.1.16", + "resolved": "https://registry.npmjs.org/is-what/-/is-what-4.1.16.tgz", + "integrity": "sha512-ZhMwEosbFJkA0YhFnNDgTM4ZxDRsS6HqTo7qsZM08fehyRYIYa0yHu5R6mgo1n/8MgaPBXiPimPD77baVFYg+A==", + "dev": true, + "engines": { + "node": ">=12.13" + }, + "funding": { + "url": "https://github.com/sponsors/mesqueeb" + } + }, + "node_modules/isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==" + }, + "node_modules/jackspeak": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/jackspeak/-/jackspeak-3.4.3.tgz", + "integrity": "sha512-OGlZQpz2yfahA/Rd1Y8Cd9SIEsqvXkLVoSw/cgwhnhFMDbsQFeZYoJJ7bIZBS9BcamUW96asq/npPWugM+RQBw==", + "dependencies": { + "@isaacs/cliui": "^8.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + }, + "optionalDependencies": { + "@pkgjs/parseargs": "^0.11.0" + } + }, + "node_modules/jiti": { + "version": "1.21.6", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-1.21.6.tgz", + "integrity": "sha512-2yTgeWTWzMWkHu6Jp9NKgePDaYHbntiwvYuuJLbbN9vl7DC9DvXKOB2BC3ZZ92D3cvV/aflH0osDfwpHepQ53w==", + "bin": { + "jiti": "bin/jiti.js" + } + }, + "node_modules/js-tokens": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", + "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", + "dev": true + }, + "node_modules/jsesc": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", + "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", + "dev": true, + "bin": { + "jsesc": "bin/jsesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/json5": { + "version": "2.2.3", + "resolved": "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz", + "integrity": "sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==", + "dev": true, + "bin": { + "json5": "lib/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/kampos": { + "version": "0.9.1", + "resolved": "https://registry.npmjs.org/kampos/-/kampos-0.9.1.tgz", + "integrity": "sha512-BsGWzhcmCwzTXkKETtmyrwFgOKJcYc3EPLgfBFlw/JBqLrqr+coRdqXQHlvW3T3y6EeDS0BlRd/buuoV1gLKbg==" + }, + "node_modules/lilconfig": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-2.1.0.tgz", + "integrity": "sha512-utWOt/GHzuUxnLKxB6dk81RoOeoNeHgbrXiuGk4yyF5qlRz+iIVWu56E2fqGHFrXz0QNUhLB/8nKqvRH66JKGQ==", + "engines": { + "node": ">=10" + } + }, + "node_modules/lines-and-columns": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz", + "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==" + }, + "node_modules/lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dev": true, + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/lz-string": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/lz-string/-/lz-string-1.5.0.tgz", + "integrity": "sha512-h5bgJWpxJNswbU7qCrV0tIKQCaS3blPDrqKWx+QxzuzL1zGUzij9XCWLrSLsJPu5t+eWA/ycetzYAO5IOMcWAQ==", + "bin": { + "lz-string": "bin/bin.js" + } + }, + "node_modules/merge-anything": { + "version": "5.1.7", + "resolved": "https://registry.npmjs.org/merge-anything/-/merge-anything-5.1.7.tgz", + "integrity": "sha512-eRtbOb1N5iyH0tkQDAoQ4Ipsp/5qSR79Dzrz8hEPxRX10RWWR/iQXdoKmBSRCThY1Fh5EhISDtpSc93fpxUniQ==", + "dev": true, + "dependencies": { + "is-what": "^4.1.8" + }, + "engines": { + "node": ">=12.13" + }, + "funding": { + "url": "https://github.com/sponsors/mesqueeb" + } + }, + "node_modules/merge2": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz", + "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==", + "engines": { + "node": ">= 8" + } + }, + "node_modules/micromatch": { + "version": "4.0.7", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.7.tgz", + "integrity": "sha512-LPP/3KorzCwBxfeUuZmaR6bG2kdeHSbe0P2tY3FLRU4vYrjYz5hI4QZwV0njUx3jeuKe67YukQ1LSPZBKDqO/Q==", + "dependencies": { + "braces": "^3.0.3", + "picomatch": "^2.3.1" + }, + "engines": { + "node": ">=8.6" + } + }, + "node_modules/minimatch": { + "version": "9.0.5", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.5.tgz", + "integrity": "sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==", + "dependencies": { + "brace-expansion": "^2.0.1" + }, + "engines": { + "node": ">=16 || 14 >=14.17" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/minipass": { + "version": "7.1.2", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-7.1.2.tgz", + "integrity": "sha512-qOOzS1cBTWYF4BH8fVePDBOO9iptMnGUEZwNc/cMWnTV2nVLZ7VoNWEPHkYczZA0pdoA7dl6e7FL659nX9S2aw==", + "engines": { + "node": ">=16 || 14 >=14.17" + } + }, + "node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "dev": true + }, + "node_modules/mz": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz", + "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==", + "dependencies": { + "any-promise": "^1.0.0", + "object-assign": "^4.0.1", + "thenify-all": "^1.0.0" + } + }, + "node_modules/nanoid": { + "version": "3.3.7", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz", + "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/node-releases": { + "version": "2.0.18", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.18.tgz", + "integrity": "sha512-d9VeXT4SJ7ZeOqGX6R5EM022wpL+eWPooLI+5UpWn2jCT1aosUQEhQP214x33Wkwx3JQMvIm+tIoVOdodFS40g==", + "dev": true + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize-range": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz", + "integrity": "sha512-bdok/XvKII3nUpklnV6P2hxtMNrCboOjAcyBuQnWEhO665FwrSNRxU+AqpsyvO6LgGYPspN+lu5CLtw4jPRKNA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-hash": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/object-hash/-/object-hash-3.0.0.tgz", + "integrity": "sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/package-json-from-dist": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/package-json-from-dist/-/package-json-from-dist-1.0.0.tgz", + "integrity": "sha512-dATvCeZN/8wQsGywez1mzHtTlP22H8OEfPrVMLNr4/eGa+ijtLn/6M5f0dY8UKNrC2O9UCU6SSoG3qRKnt7STw==" + }, + "node_modules/path-key": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz", + "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", + "engines": { + "node": ">=8" + } + }, + "node_modules/path-parse": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz", + "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==" + }, + "node_modules/path-scurry": { + "version": "1.11.1", + "resolved": "https://registry.npmjs.org/path-scurry/-/path-scurry-1.11.1.tgz", + "integrity": "sha512-Xa4Nw17FS9ApQFJ9umLiJS4orGjm7ZzwUrwamcGQuHSzDyth9boKDaycYdDcZDuqYATXw4HFXgaqWTctW/v1HA==", + "dependencies": { + "lru-cache": "^10.2.0", + "minipass": "^5.0.0 || ^6.0.2 || ^7.0.0" + }, + "engines": { + "node": ">=16 || 14 >=14.18" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/path-scurry/node_modules/lru-cache": { + "version": "10.4.3", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-10.4.3.tgz", + "integrity": "sha512-JNAzZcXrCt42VGLuYz0zfAzDfAvJWW6AfYlDBQyDV5DClI2m5sAmK+OIO7s59XfsRsWHp02jAJrRadPRGTt6SQ==" + }, + "node_modules/picocolors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.1.tgz", + "integrity": "sha512-anP1Z8qwhkbmu7MFP5iTt+wQKXgwzf7zTyGlcdzabySa9vd0Xt392U0rVmz9poOaBj0uHJKyyo9/upk0HrEQew==" + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pirates": { + "version": "4.0.6", + "resolved": "https://registry.npmjs.org/pirates/-/pirates-4.0.6.tgz", + "integrity": "sha512-saLsH7WeYYPiD25LDuLRRY/i+6HaPYr6G1OUlN39otzkSTxKnubR9RTxS3/Kk50s1g2JTgFwWQDQyplC5/SHZg==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss": { + "version": "8.4.41", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.41.tgz", + "integrity": "sha512-TesUflQ0WKZqAvg52PWL6kHgLKP6xB6heTOdoYM0Wt2UHyxNa4K25EZZMgKns3BH1RLVbZCREPpLY0rhnNoHVQ==", + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "nanoid": "^3.3.7", + "picocolors": "^1.0.1", + "source-map-js": "^1.2.0" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/postcss-import": { + "version": "15.1.0", + "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-15.1.0.tgz", + "integrity": "sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew==", + "dependencies": { + "postcss-value-parser": "^4.0.0", + "read-cache": "^1.0.0", + "resolve": "^1.1.7" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "postcss": "^8.0.0" + } + }, + "node_modules/postcss-js": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.0.1.tgz", + "integrity": "sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw==", + "dependencies": { + "camelcase-css": "^2.0.1" + }, + "engines": { + "node": "^12 || ^14 || >= 16" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.4.21" + } + }, + "node_modules/postcss-load-config": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-4.0.2.tgz", + "integrity": "sha512-bSVhyJGL00wMVoPUzAVAnbEoWyqRxkjv64tUl427SKnPrENtq6hJwUojroMz2VB+Q1edmi4IfrAPpami5VVgMQ==", + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "lilconfig": "^3.0.0", + "yaml": "^2.3.4" + }, + "engines": { + "node": ">= 14" + }, + "peerDependencies": { + "postcss": ">=8.0.9", + "ts-node": ">=9.0.0" + }, + "peerDependenciesMeta": { + "postcss": { + "optional": true + }, + "ts-node": { + "optional": true + } + } + }, + "node_modules/postcss-load-config/node_modules/lilconfig": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-3.1.2.tgz", + "integrity": "sha512-eop+wDAvpItUys0FWkHIKeC9ybYrTGbU41U5K7+bttZZeohvnY7M9dZ5kB21GNWiFT2q1OoPTvncPCgSOVO5ow==", + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/antonk52" + } + }, + "node_modules/postcss-nested": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.2.0.tgz", + "integrity": "sha512-HQbt28KulC5AJzG+cZtj9kvKB93CFCdLvog1WFLf1D+xmMvPGlBstkpTEZfK5+AN9hfJocyBFCNiqyS48bpgzQ==", + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "postcss-selector-parser": "^6.1.1" + }, + "engines": { + "node": ">=12.0" + }, + "peerDependencies": { + "postcss": "^8.2.14" + } + }, + "node_modules/postcss-selector-parser": { + "version": "6.1.2", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.1.2.tgz", + "integrity": "sha512-Q8qQfPiZ+THO/3ZrOrO0cJJKfpYCagtMUkXbnEfmgUjwXg6z/WBeOyS9APBBPCTSiDV+s4SwQGu8yFsiMRIudg==", + "dependencies": { + "cssesc": "^3.0.0", + "util-deprecate": "^1.0.2" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/postcss-value-parser": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", + "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==" + }, + "node_modules/queue-microtask": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz", + "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/read-cache": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz", + "integrity": "sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA==", + "dependencies": { + "pify": "^2.3.0" + } + }, + "node_modules/readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/resolve": { + "version": "1.22.8", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.8.tgz", + "integrity": "sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw==", + "dependencies": { + "is-core-module": "^2.13.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/reusify": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", + "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", + "engines": { + "iojs": ">=1.0.0", + "node": ">=0.10.0" + } + }, + "node_modules/rollup": { + "version": "4.20.0", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.20.0.tgz", + "integrity": "sha512-6rbWBChcnSGzIlXeIdNIZTopKYad8ZG8ajhl78lGRLsI2rX8IkaotQhVas2Ma+GPxJav19wrSzvRvuiv0YKzWw==", + "dev": true, + "dependencies": { + "@types/estree": "1.0.5" + }, + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=18.0.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "@rollup/rollup-android-arm-eabi": "4.20.0", + "@rollup/rollup-android-arm64": "4.20.0", + "@rollup/rollup-darwin-arm64": "4.20.0", + "@rollup/rollup-darwin-x64": "4.20.0", + "@rollup/rollup-linux-arm-gnueabihf": "4.20.0", + "@rollup/rollup-linux-arm-musleabihf": "4.20.0", + "@rollup/rollup-linux-arm64-gnu": "4.20.0", + "@rollup/rollup-linux-arm64-musl": "4.20.0", + "@rollup/rollup-linux-powerpc64le-gnu": "4.20.0", + "@rollup/rollup-linux-riscv64-gnu": "4.20.0", + "@rollup/rollup-linux-s390x-gnu": "4.20.0", + "@rollup/rollup-linux-x64-gnu": "4.20.0", + "@rollup/rollup-linux-x64-musl": "4.20.0", + "@rollup/rollup-win32-arm64-msvc": "4.20.0", + "@rollup/rollup-win32-ia32-msvc": "4.20.0", + "@rollup/rollup-win32-x64-msvc": "4.20.0", + "fsevents": "~2.3.2" + } + }, + "node_modules/run-parallel": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", + "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "dependencies": { + "queue-microtask": "^1.2.2" + } + }, + "node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/seroval": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/seroval/-/seroval-1.1.1.tgz", + "integrity": "sha512-rqEO6FZk8mv7Hyv4UCj3FD3b6Waqft605TLfsCe/BiaylRpyyMC0b+uA5TJKawX3KzMrdi3wsLbCaLplrQmBvQ==", + "engines": { + "node": ">=10" + } + }, + "node_modules/seroval-plugins": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/seroval-plugins/-/seroval-plugins-1.1.1.tgz", + "integrity": "sha512-qNSy1+nUj7hsCOon7AO4wdAIo9P0jrzAMp18XhiOzA6/uO5TKtP7ScozVJ8T293oRIvi5wyCHSM4TrJo/c/GJA==", + "engines": { + "node": ">=10" + }, + "peerDependencies": { + "seroval": "^1.0" + } + }, + "node_modules/shebang-command": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", + "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==", + "dependencies": { + "shebang-regex": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/shebang-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz", + "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==", + "engines": { + "node": ">=8" + } + }, + "node_modules/signal-exit": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-4.1.0.tgz", + "integrity": "sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==", + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/solid-devtools": { + "version": "0.29.3", + "resolved": "https://registry.npmjs.org/solid-devtools/-/solid-devtools-0.29.3.tgz", + "integrity": "sha512-9j3VxVbEoC54ML22gAMytR8ZS1nk9xKatsWziKSkI4c/Bcyh4sxQBGESHuXSLs9xaxpyGVTmFl3hknoxEpKzlA==", + "dev": true, + "dependencies": { + "@babel/core": "^7.23.3", + "@babel/plugin-syntax-typescript": "^7.23.3", + "@babel/types": "^7.23.3", + "@solid-devtools/debugger": "^0.23.3", + "@solid-devtools/shared": "^0.13.1" + }, + "peerDependencies": { + "solid-js": "^1.8.0", + "solid-start": "^0.3.0", + "vite": "^2.2.3 || ^3.0.0 || ^4.0.0 || ^5.0.0" + }, + "peerDependenciesMeta": { + "solid-start": { + "optional": true + }, + "vite": { + "optional": true + } + } + }, + "node_modules/solid-js": { + "version": "1.8.21", + "resolved": "https://registry.npmjs.org/solid-js/-/solid-js-1.8.21.tgz", + "integrity": "sha512-FHUGdoo7GVa1BTpGh/4UtwIISde0vSXoqNB6KFpHiTgkIY959tmCJ7NYQAWDfScBfnpoMGZR8lFz0DiwW/gFlw==", + "dependencies": { + "csstype": "^3.1.0", + "seroval": "^1.1.0", + "seroval-plugins": "^1.1.0" + } + }, + "node_modules/solid-refresh": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/solid-refresh/-/solid-refresh-0.6.3.tgz", + "integrity": "sha512-F3aPsX6hVw9ttm5LYlth8Q15x6MlI/J3Dn+o3EQyRTtTxidepSTwAYdozt01/YA+7ObcciagGEyXIopGZzQtbA==", + "dev": true, + "dependencies": { + "@babel/generator": "^7.23.6", + "@babel/helper-module-imports": "^7.22.15", + "@babel/types": "^7.23.6" + }, + "peerDependencies": { + "solid-js": "^1.3" + } + }, + "node_modules/source-map-js": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.0.tgz", + "integrity": "sha512-itJW8lvSA0TXEphiRoawsCksnlf8SyvmFzIhltqAHluXd88pkCd+cXJVHTDwdCr0IzwptSm035IHQktUu1QUMg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/stats.js": { + "version": "0.17.0", + "resolved": "https://registry.npmjs.org/stats.js/-/stats.js-0.17.0.tgz", + "integrity": "sha512-hNKz8phvYLPEcRkeG1rsGmV5ChMjKDAWU7/OJJdDErPBNChQXxCo3WZurGpnWc6gZhAzEPFad1aVgyOANH1sMw==" + }, + "node_modules/string-width": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-5.1.2.tgz", + "integrity": "sha512-HnLOCR3vjcY8beoNLtcjZ5/nxn2afmME6lhrDrebokqMap+XbeW8n9TXpPDOqdGK5qcI3oT0GKTW6wC7EMiVqA==", + "dependencies": { + "eastasianwidth": "^0.2.0", + "emoji-regex": "^9.2.2", + "strip-ansi": "^7.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/string-width-cjs": { + "name": "string-width", + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/string-width-cjs/node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/string-width-cjs/node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" + }, + "node_modules/string-width-cjs/node_modules/strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-ansi": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", + "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", + "dependencies": { + "ansi-regex": "^6.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/strip-ansi?sponsor=1" + } + }, + "node_modules/strip-ansi-cjs": { + "name": "strip-ansi", + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-ansi-cjs/node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/sucrase": { + "version": "3.35.0", + "resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.35.0.tgz", + "integrity": "sha512-8EbVDiu9iN/nESwxeSxDKe0dunta1GOlHufmSSXxMD2z2/tMZpDMpvXQGsc+ajGo8y2uYUmixaSRUc/QPoQ0GA==", + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.2", + "commander": "^4.0.0", + "glob": "^10.3.10", + "lines-and-columns": "^1.1.6", + "mz": "^2.7.0", + "pirates": "^4.0.1", + "ts-interface-checker": "^0.1.9" + }, + "bin": { + "sucrase": "bin/sucrase", + "sucrase-node": "bin/sucrase-node" + }, + "engines": { + "node": ">=16 || 14 >=14.17" + } + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/supports-preserve-symlinks-flag": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz", + "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==", + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/tailwindcss": { + "version": "3.4.10", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-3.4.10.tgz", + "integrity": "sha512-KWZkVPm7yJRhdu4SRSl9d4AK2wM3a50UsvgHZO7xY77NQr2V+fIrEuoDGQcbvswWvFGbS2f6e+jC/6WJm1Dl0w==", + "dependencies": { + "@alloc/quick-lru": "^5.2.0", + "arg": "^5.0.2", + "chokidar": "^3.5.3", + "didyoumean": "^1.2.2", + "dlv": "^1.1.3", + "fast-glob": "^3.3.0", + "glob-parent": "^6.0.2", + "is-glob": "^4.0.3", + "jiti": "^1.21.0", + "lilconfig": "^2.1.0", + "micromatch": "^4.0.5", + "normalize-path": "^3.0.0", + "object-hash": "^3.0.0", + "picocolors": "^1.0.0", + "postcss": "^8.4.23", + "postcss-import": "^15.1.0", + "postcss-js": "^4.0.1", + "postcss-load-config": "^4.0.1", + "postcss-nested": "^6.0.1", + "postcss-selector-parser": "^6.0.11", + "resolve": "^1.22.2", + "sucrase": "^3.32.0" + }, + "bin": { + "tailwind": "lib/cli.js", + "tailwindcss": "lib/cli.js" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/tailwindcss-spring": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/tailwindcss-spring/-/tailwindcss-spring-1.0.1.tgz", + "integrity": "sha512-v8ibKyVCgbFcHzP9EFSbsvR0vH7Vk2Skl9JnJ9HUrnA16NhjvI4SlV9Y4SkinL+4bNrm1XpftZwX1DAD1mNZFA==", + "peerDependencies": { + "tailwindcss": ">=3.0.0 || insiders" + } + }, + "node_modules/thenify": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz", + "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==", + "dependencies": { + "any-promise": "^1.0.0" + } + }, + "node_modules/thenify-all": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz", + "integrity": "sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==", + "dependencies": { + "thenify": ">= 3.1.0 < 4" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/to-fast-properties": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", + "integrity": "sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/ts-interface-checker": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz", + "integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==" + }, + "node_modules/tweakpane": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/tweakpane/-/tweakpane-4.0.4.tgz", + "integrity": "sha512-RkWD54zDlEbnN01wQPk0ANHGbdCvlJx/E8A1QxhTfCbX+ROWos1Ws2MnhOm39aUGMOh+36TjUwpDmLfmwTr1Fg==", + "funding": { + "url": "https://github.com/sponsors/cocopon" + } + }, + "node_modules/typescript": { + "version": "5.5.4", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.5.4.tgz", + "integrity": "sha512-Mtq29sKDAEYP7aljRgtPOpTvOfbwRWlS6dPRzwjdE+C0R4brX/GUyhHSecbHMFLNBLcJIPt9nl9yG5TZ1weH+Q==", + "dev": true, + "bin": { + "tsc": "bin/tsc", + "tsserver": "bin/tsserver" + }, + "engines": { + "node": ">=14.17" + } + }, + "node_modules/update-browserslist-db": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.1.0.tgz", + "integrity": "sha512-EdRAaAyk2cUE1wOf2DkEhzxqOQvFOoRJFNS6NeyJ01Gp2beMRpBAINjM2iDXE3KCuKhwnvHIQCJm6ThL2Z+HzQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "escalade": "^3.1.2", + "picocolors": "^1.0.1" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==" + }, + "node_modules/validate-html-nesting": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/validate-html-nesting/-/validate-html-nesting-1.2.2.tgz", + "integrity": "sha512-hGdgQozCsQJMyfK5urgFcWEqsSSrK63Awe0t/IMR0bZ0QMtnuaiHzThW81guu3qx9abLi99NEuiaN6P9gVYsNg==", + "dev": true + }, + "node_modules/vite": { + "version": "5.4.1", + "resolved": "https://registry.npmjs.org/vite/-/vite-5.4.1.tgz", + "integrity": "sha512-1oE6yuNXssjrZdblI9AfBbHCC41nnyoVoEZxQnID6yvQZAFBzxxkqoFLtHUMkYunL8hwOLEjgTuxpkRxvba3kA==", + "dev": true, + "dependencies": { + "esbuild": "^0.21.3", + "postcss": "^8.4.41", + "rollup": "^4.13.0" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^18.0.0 || >=20.0.0" + }, + "funding": { + "url": "https://github.com/vitejs/vite?sponsor=1" + }, + "optionalDependencies": { + "fsevents": "~2.3.3" + }, + "peerDependencies": { + "@types/node": "^18.0.0 || >=20.0.0", + "less": "*", + "lightningcss": "^1.21.0", + "sass": "*", + "sass-embedded": "*", + "stylus": "*", + "sugarss": "*", + "terser": "^5.4.0" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "less": { + "optional": true + }, + "lightningcss": { + "optional": true + }, + "sass": { + "optional": true + }, + "sass-embedded": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + } + } + }, + "node_modules/vite-plugin-solid": { + "version": "2.10.2", + "resolved": "https://registry.npmjs.org/vite-plugin-solid/-/vite-plugin-solid-2.10.2.tgz", + "integrity": "sha512-AOEtwMe2baBSXMXdo+BUwECC8IFHcKS6WQV/1NEd+Q7vHPap5fmIhLcAzr+DUJ04/KHx/1UBU0l1/GWP+rMAPQ==", + "dev": true, + "dependencies": { + "@babel/core": "^7.23.3", + "@types/babel__core": "^7.20.4", + "babel-preset-solid": "^1.8.4", + "merge-anything": "^5.1.7", + "solid-refresh": "^0.6.3", + "vitefu": "^0.2.5" + }, + "peerDependencies": { + "@testing-library/jest-dom": "^5.16.6 || ^5.17.0 || ^6.*", + "solid-js": "^1.7.2", + "vite": "^3.0.0 || ^4.0.0 || ^5.0.0" + }, + "peerDependenciesMeta": { + "@testing-library/jest-dom": { + "optional": true + } + } + }, + "node_modules/vitefu": { + "version": "0.2.5", + "resolved": "https://registry.npmjs.org/vitefu/-/vitefu-0.2.5.tgz", + "integrity": "sha512-SgHtMLoqaeeGnd2evZ849ZbACbnwQCIwRH57t18FxcXoZop0uQu0uzlIhJBlF/eWVzuce0sHeqPcDo+evVcg8Q==", + "dev": true, + "peerDependencies": { + "vite": "^3.0.0 || ^4.0.0 || ^5.0.0" + }, + "peerDependenciesMeta": { + "vite": { + "optional": true + } + } + }, + "node_modules/which": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "node-which": "bin/node-which" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/wrap-ansi": { + "version": "8.1.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-8.1.0.tgz", + "integrity": "sha512-si7QWI6zUMq56bESFvagtmzMdGOtoxfR+Sez11Mobfc7tm+VkUckk9bW2UeffTGVUbOksxmSw0AA2gs8g71NCQ==", + "dependencies": { + "ansi-styles": "^6.1.0", + "string-width": "^5.0.1", + "strip-ansi": "^7.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/wrap-ansi?sponsor=1" + } + }, + "node_modules/wrap-ansi-cjs": { + "name": "wrap-ansi", + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz", + "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==", + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/chalk/wrap-ansi?sponsor=1" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "engines": { + "node": ">=8" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" + }, + "node_modules/wrap-ansi-cjs/node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" + }, + "node_modules/wrap-ansi-cjs/node_modules/string-width": { + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/wrap-ansi/node_modules/ansi-styles": { + "version": "6.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-6.2.1.tgz", + "integrity": "sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug==", + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", + "dev": true + }, + "node_modules/yaml": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/yaml/-/yaml-2.5.0.tgz", + "integrity": "sha512-2wWLbGbYDiSqqIKoPjar3MPgB94ErzCtrNE1FdqGuaO0pi2JGjmE8aW8TDZwzU7vuxcGRdL/4gPQwQ7hD5AMSw==", + "bin": { + "yaml": "bin.mjs" + }, + "engines": { + "node": ">= 14" + } } - } - }, - "node_modules/which": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", - "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", - "dependencies": { - "isexe": "^2.0.0" - }, - "bin": { - "node-which": "bin/node-which" - }, - "engines": { - "node": ">= 8" - } - }, - "node_modules/wrap-ansi": { - "version": "8.1.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-8.1.0.tgz", - "integrity": "sha512-si7QWI6zUMq56bESFvagtmzMdGOtoxfR+Sez11Mobfc7tm+VkUckk9bW2UeffTGVUbOksxmSw0AA2gs8g71NCQ==", - "dependencies": { - "ansi-styles": "^6.1.0", - "string-width": "^5.0.1", - "strip-ansi": "^7.0.1" - }, - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/wrap-ansi?sponsor=1" - } - }, - "node_modules/wrap-ansi-cjs": { - "name": "wrap-ansi", - "version": "7.0.0", - "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz", - "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==", - "dependencies": { - "ansi-styles": "^4.0.0", - "string-width": "^4.1.0", - "strip-ansi": "^6.0.0" - }, - "engines": { - "node": ">=10" - }, - "funding": { - "url": "https://github.com/chalk/wrap-ansi?sponsor=1" - } - }, - "node_modules/wrap-ansi-cjs/node_modules/ansi-regex": { - "version": "5.0.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", - "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", - "engines": { - "node": ">=8" - } - }, - "node_modules/wrap-ansi-cjs/node_modules/ansi-styles": { - "version": "4.3.0", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", - "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", - "dependencies": { - "color-convert": "^2.0.1" - }, - "engines": { - "node": ">=8" - }, - "funding": { - "url": "https://github.com/chalk/ansi-styles?sponsor=1" - } - }, - "node_modules/wrap-ansi-cjs/node_modules/color-convert": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", - "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", - "dependencies": { - "color-name": "~1.1.4" - }, - "engines": { - "node": ">=7.0.0" - } - }, - "node_modules/wrap-ansi-cjs/node_modules/color-name": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", - "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==" - }, - "node_modules/wrap-ansi-cjs/node_modules/emoji-regex": { - "version": "8.0.0", - "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", - "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" - }, - "node_modules/wrap-ansi-cjs/node_modules/string-width": { - "version": "4.2.3", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", - "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", - "dependencies": { - "emoji-regex": "^8.0.0", - "is-fullwidth-code-point": "^3.0.0", - "strip-ansi": "^6.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/wrap-ansi-cjs/node_modules/strip-ansi": { - "version": "6.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", - "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", - "dependencies": { - "ansi-regex": "^5.0.1" - }, - "engines": { - "node": ">=8" - } - }, - "node_modules/wrap-ansi/node_modules/ansi-styles": { - "version": "6.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-6.2.1.tgz", - "integrity": "sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug==", - "engines": { - "node": ">=12" - }, - "funding": { - "url": "https://github.com/chalk/ansi-styles?sponsor=1" - } - }, - "node_modules/yallist": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", - "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", - "dev": true - }, - "node_modules/yaml": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/yaml/-/yaml-2.5.0.tgz", - "integrity": "sha512-2wWLbGbYDiSqqIKoPjar3MPgB94ErzCtrNE1FdqGuaO0pi2JGjmE8aW8TDZwzU7vuxcGRdL/4gPQwQ7hD5AMSw==", - "bin": { - "yaml": "bin.mjs" - }, - "engines": { - "node": ">= 14" - } } - } } diff --git a/kampos/package.json b/kampos/package.json index 8bb26c8..5661172 100644 --- a/kampos/package.json +++ b/kampos/package.json @@ -1,33 +1,33 @@ { - "name": "vite-template-solid", - "version": "0.0.0", - "description": "", - "scripts": { - "start": "vite", - "dev": "vite", - "build": "vite build", - "serve": "vite preview", - "test": "vitest" - }, - "license": "MIT", - "devDependencies": { - "@tweakpane/core": "^2.0.4", - "@types/stats.js": "^0.17.3", - "autoprefixer": "^10.4.17", - "postcss": "^8.4.33", - "solid-devtools": "^0.29.2", - "tailwindcss": "^3.4.1", - "typescript": "^5.3.3", - "vite": "^5.0.11", - "vite-plugin-solid": "^2.8.2" - }, - "dependencies": { - "@tweakpane/plugin-camerakit": "^0.3.0", - "debounce": "^2.1.0", - "kampos": "^0.10.0", - "solid-js": "^1.8.11", - "stats.js": "^0.17.0", - "tailwindcss-spring": "^1.0.1", - "tweakpane": "^4.0.4" - } + "name": "vite-template-solid", + "version": "0.0.0", + "description": "", + "scripts": { + "start": "vite", + "dev": "vite", + "build": "vite build", + "serve": "vite preview", + "test": "vitest" + }, + "license": "MIT", + "devDependencies": { + "@tweakpane/core": "^2.0.4", + "@types/stats.js": "^0.17.3", + "autoprefixer": "^10.4.17", + "postcss": "^8.4.33", + "solid-devtools": "^0.29.2", + "tailwindcss": "^3.4.1", + "typescript": "^5.3.3", + "vite": "^5.0.11", + "vite-plugin-solid": "^2.8.2" + }, + "dependencies": { + "@tweakpane/plugin-camerakit": "^0.3.0", + "debounce": "^2.1.0", + "kampos": "^0.10.0", + "solid-js": "^1.8.11", + "stats.js": "^0.17.0", + "tailwindcss-spring": "^1.0.1", + "tweakpane": "^4.0.4" + } } diff --git a/kampos/postcss.config.js b/kampos/postcss.config.js index 4be1640..7904127 100644 --- a/kampos/postcss.config.js +++ b/kampos/postcss.config.js @@ -1,7 +1,7 @@ module.exports = { - purge: ['./index.html', './src/**/*.{vue,js,ts,jsx,tsx}'], - plugins: { - tailwindcss: {}, - autoprefixer: {}, - }, + purge: ['./index.html', './src/**/*.{vue,js,ts,jsx,tsx}'], + plugins: { + tailwindcss: {}, + autoprefixer: {}, + }, }; diff --git a/kampos/src/App.tsx b/kampos/src/App.tsx index 22fc2de..7fdc83a 100644 --- a/kampos/src/App.tsx +++ b/kampos/src/App.tsx @@ -2,33 +2,27 @@ import type { Component } from 'solid-js'; import { VideoSelector } from './components/video-selector'; const App: Component = () => { - return ( - <> -
- -
-